[maven-release-plugin] prepare release github-api-1.127

Fix JaCoCo execution when we have additional Surefire options

.gitattributes

@@ -0,0 +1 @@
+*.java text eol=lf

.github/PULL_REQUEST_TEMPLATE.md

@@ -7,8 +7,7 @@ We love getting PRs, but we hate asking people for the same basic changes every
 - [ ] Push your changes to a branch other than `master`. Create your PR from that branch.    
 - [ ] Add JavaDocs and other comments
 - [ ] Write tests that run and pass in CI. See [CONTRIBUTING.md](CONTRIBUTING.md) for details on how to capture snapshot data.
-- [ ] Run `mvn clean compile` locally. This may reformat your code, commit those changes.
-- [ ] Run `mvn -D enable-ci clean install site` locally. If this command doesn't succeed, your change will not pass CI.
+- [ ] Run `mvn -D enable-ci clean install site` locally. If this command doesn't succeed, your change will not pass CI. 
 
 # When creating a PR: 
 

.github/workflows/maven-build.yml

@@ -2,14 +2,18 @@ name: CI
 
 on: [push, pull_request]
 
+# this is required by spotless for JDK 16+
+env:
+  JAVA_11_PLUS_MAVEN_OPTS: "--add-opens jdk.compiler/com.sun.tools.javac.util=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.file=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.parser=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.tree=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.api=ALL-UNNAMED"
 
 jobs:
   build:
     name: build-only (Java ${{ matrix.java }})
     runs-on: ubuntu-latest
     strategy:
+      fail-fast: false
       matrix:
-        java: [ 13 ]
+        java: [ 16 ]
     steps:
       - uses: actions/checkout@v2
       - name: Set up JDK
@@ -17,18 +21,21 @@ jobs:
         with:
           java-version: ${{ matrix.java }}
       - name: Cached .m2
-        uses: actions/cache@v2
+        uses: actions/cache@v2.1.4
         with:
           path: ~/.m2/repository
           key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
           restore-keys: |
             ${{ runner.os }}-maven-
       - name: Maven Install (skipTests)
-        run: mvn -B install -DskipTests -D enable-ci --file pom.xml
+        env:
+          MAVEN_OPTS: ${{ env.JAVA_11_PLUS_MAVEN_OPTS }}
+        run: mvn -B install -DskipTests --file pom.xml
   site:
     name: site (Java ${{ matrix.java }})
     runs-on: ubuntu-latest
     strategy:
+      fail-fast: false
       matrix:
         java: [ 8, 11 ]
     steps:
@@ -37,7 +44,7 @@ jobs:
         uses: actions/setup-java@v1
         with:
           java-version: ${{ matrix.java }}
-      - uses: actions/cache@v2
+      - uses: actions/cache@v2.1.4
         with:
           path: ~/.m2/repository
           key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
@@ -49,24 +56,37 @@ jobs:
     name: test (${{ matrix.os }}, Java ${{ matrix.java }})
     runs-on: ${{ matrix.os }}-latest
     strategy:
+      fail-fast: false
       matrix:
         os: [ ubuntu, windows ]
-        java: [ 8, 11, 13, 15-ea ]
+        java: [ 8, 11, 16 ]
     steps:
     - uses: actions/checkout@v2
     - name: Set up JDK
       uses: actions/setup-java@v1
       with:
         java-version: ${{ matrix.java }}
-    - uses: actions/cache@v2
+    - uses: actions/cache@v2.1.4
       with:
         path: ~/.m2/repository
         key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
         restore-keys: |
           ${{ runner.os }}-maven-
+    # JDK 8
     - name: Maven Install without Code Coverage
-      if: matrix.os == 'windows'
+      if: matrix.os == 'windows' && matrix.java == '8'
       run: mvn -B install --file pom.xml
     - name: Maven Install with Code Coverage
-      if: matrix.os != 'windows'
+      if: matrix.os != 'windows' && matrix.java == '8'
+      run: mvn -B install -D enable-ci --file pom.xml
+    # JDK 11+
+    - name: Maven Install without Code Coverage
+      if: matrix.os == 'windows' && matrix.java != '8'
+      env:
+        MAVEN_OPTS: ${{ env.JAVA_11_PLUS_MAVEN_OPTS }}
+      run: mvn -B install --file pom.xml
+    - name: Maven Install with Code Coverage
+      if: matrix.os != 'windows' && matrix.java != '8'
+      env:
+        MAVEN_OPTS: ${{ env.JAVA_11_PLUS_MAVEN_OPTS }}
       run: mvn -B install -D enable-ci --file pom.xml

CONTRIBUTING.md

@@ -21,7 +21,7 @@ Example for a single test case:
 
 ### Setting up credential
 
-1. Create an OAuth token on github.com
+1. Create a "Personal access token" on https://github.com/ (`Settings` > `Developer settings` > `Personal access tokens`)
 2. Set the GITHUB_OAUTH environment variable to the value of that token
 3. Set the system property `test.github.useProxy` (usually like "-Dtest.github.useProxy" as a Java VM option)
 

pom.xml

@@ -2,7 +2,7 @@
   <modelVersion>4.0.0</modelVersion>
   <groupId>org.kohsuke</groupId>
   <artifactId>github-api</artifactId>
-  <version>1.121</version>
+  <version>1.127</version>
   <name>GitHub API for Java</name>
   <url>https://github-api.kohsuke.org/</url>
   <description>GitHub API for Java</description>
@@ -11,7 +11,7 @@
     <connection>scm:git:git@github.com/hub4j/${project.artifactId}.git</connection>
     <developerConnection>scm:git:ssh://git@github.com/hub4j/${project.artifactId}.git</developerConnection>
     <url>https://github.com/hub4j/github-api/</url>
-    <tag>github-api-1.121</tag>
+    <tag>github-api-1.127</tag>
   </scm>
 
   <distributionManagement>
@@ -33,19 +33,21 @@
 
   <properties>
     <project.build.sourceEncoding>UTF-8</project.build.sourceEncoding>
-    <spotbugs-maven-plugin.version>4.1.4</spotbugs-maven-plugin.version>
-    <spotbugs.version>4.1.3</spotbugs.version>
+    <spotbugs-maven-plugin.version>4.2.0</spotbugs-maven-plugin.version>
+    <spotbugs.version>4.2.2</spotbugs.version>
     <spotbugs-maven-plugin.failOnError>true</spotbugs-maven-plugin.failOnError>
     <hamcrest.version>2.2</hamcrest.version>
     <okhttp3.version>4.4.1</okhttp3.version>
     <okio.version>2.5.0</okio.version>
-    <spotless-maven-plugin.goal>apply</spotless-maven-plugin.goal>
     <!-- Using this as the minimum bar for code coverage.  Adding methods without covering them will fail this. -->
-    <jacoco.coverage.target.bundle.method>0.60</jacoco.coverage.target.bundle.method>
-    <jacoco.coverage.target.class.method>0.25</jacoco.coverage.target.class.method>
+    <jacoco.coverage.target.bundle.method>0.70</jacoco.coverage.target.bundle.method>
+    <jacoco.coverage.target.class.method>0.50</jacoco.coverage.target.class.method>
     <!-- For non-ci builds we'd like the build to still complete if jacoco metrics aren't met. -->
     <jacoco.haltOnFailure>false</jacoco.haltOnFailure>
     <jjwt.suite.version>0.11.2</jjwt.suite.version>
+
+    <jacoco.surefire.argLine />
+    <surefire.argLine />
   </properties>
 
   <build>
@@ -106,6 +108,9 @@
               <goals>
                 <goal>prepare-agent</goal>
               </goals>
+              <configuration>
+                <propertyName>jacoco.surefire.argLine</propertyName>
+              </configuration>
             </execution>
             <!-- attached to Maven test phase -->
             <execution>
@@ -153,59 +158,39 @@
                       <!-- Sample only -->
                       <exclude>org.kohsuke.github.example.*</exclude>
 
-                      <!-- No methods -->
-                      <exclude>org.kohsuke.github.internal.Previews</exclude>
 
                       <!-- Deprecated -->
                       <exclude>org.kohsuke.github.extras.OkHttp3Connector</exclude>
                       <exclude>org.kohsuke.github.EnforcementLevel</exclude>
                       <exclude>org.kohsuke.github.GHPerson.1</exclude>
-
-                      <!-- These fail coverage on windows because tests are disabled -->
-                      <exclude>org.kohsuke.github.GHAsset</exclude>
-                      <exclude>org.kohsuke.github.GHReleaseBuilder</exclude>
-                      <exclude>org.kohsuke.github.GHRelease</exclude>
+                      <!-- TODO: Some coverage, but more needed -->
+                      <exclude>org.kohsuke.github.GHPullRequestReviewBuilder.DraftReviewComment</exclude>
+                      <exclude>org.kohsuke.github.GHIssue.PullRequest</exclude>
+                      <exclude>org.kohsuke.github.GHCommitSearchBuilder</exclude>
+                      <exclude>org.kohsuke.github.GHRepositorySearchBuilder</exclude>
+                      <exclude>org.kohsuke.github.GHUserSearchBuilder</exclude>
 
                       <!-- TODO: These still need test coverage -->
                       <exclude>org.kohsuke.github.GHBranchProtection.RequiredSignatures</exclude>
                       <exclude>org.kohsuke.github.GHBranchProtectionBuilder.Restrictions</exclude>
                       <exclude>org.kohsuke.github.GHBranchProtection.Restrictions</exclude>
                       <exclude>org.kohsuke.github.GHCommentAuthorAssociation</exclude>
-                      <exclude>org.kohsuke.github.GHCommitBuilder.UserInfo</exclude>
-                      <exclude>org.kohsuke.github.GHCommitState</exclude>
                       <exclude>org.kohsuke.github.GHCompare.Commit</exclude>
                       <exclude>org.kohsuke.github.GHCompare.InnerCommit</exclude>
-                      <exclude>org.kohsuke.github.GHCompare.Status</exclude>
                       <exclude>org.kohsuke.github.GHCompare.Tree</exclude>
                       <exclude>org.kohsuke.github.GHCompare.User</exclude>
                       <exclude>org.kohsuke.github.GHCompare</exclude>
                       <exclude>org.kohsuke.github.GHDeployKey</exclude>
-                      <exclude>org.kohsuke.github.GHDeploymentStatusBuilder</exclude>
-                      <exclude>org.kohsuke.github.GHDirection</exclude>
                       <exclude>org.kohsuke.github.GHEmail</exclude>
-                      <exclude>org.kohsuke.github.GHEventPayload.Ping</exclude>
-                      <exclude>org.kohsuke.github.GHEventPayload.Release</exclude>
-                      <exclude>org.kohsuke.github.GHException</exclude>
-                      <exclude>org.kohsuke.github.GHHook</exclude>
-                      <exclude>org.kohsuke.github.GHHooks.OrgContext</exclude>
                       <exclude>org.kohsuke.github.GHInvitation</exclude>
-                      <exclude>org.kohsuke.github.GHMilestoneState</exclude>
-                      <exclude>org.kohsuke.github.GHOrgHook</exclude>
-                      <exclude>org.kohsuke.github.GHProject.ProjectStateFilter</exclude>
                       <exclude>org.kohsuke.github.GHPullRequestCommitDetail.Authorship</exclude>
                       <exclude>org.kohsuke.github.GHPullRequestCommitDetail.Commit</exclude>
                       <exclude>org.kohsuke.github.GHPullRequestCommitDetail.CommitPointer</exclude>
                       <exclude>org.kohsuke.github.GHPullRequestCommitDetail.Tree</exclude>
                       <exclude>org.kohsuke.github.GHPullRequestCommitDetail</exclude>
                       <exclude>org.kohsuke.github.GHPullRequestFileDetail</exclude>
-                      <exclude>org.kohsuke.github.GHPullRequestQueryBuilder.Sort</exclude>
                       <exclude>org.kohsuke.github.GHReleaseUpdater</exclude>
-                      <exclude>org.kohsuke.github.GHRepository.ForkSort</exclude>
                       <exclude>org.kohsuke.github.GHRequestedAction</exclude>
-                      <exclude>org.kohsuke.github.GHStargazer</exclude>
-                      <exclude>org.kohsuke.github.GHTagObject</exclude>
-                      <exclude>org.kohsuke.github.GHTeam.Role</exclude>
-                      <exclude>org.kohsuke.github.GHUserSearchBuilder.Sort</exclude>
                       <exclude>org.kohsuke.github.GHVerifiedKey</exclude>
                     </excludes>
                   </rule>
@@ -293,18 +278,7 @@
             <id>default-test</id>
             <configuration>
               <excludesFile>src/test/resources/slow-or-flaky-tests.txt</excludesFile>
-            </configuration>
-          </execution>
-          <execution>
-            <id>slow-or-flaky-test</id>
-            <phase>test</phase>
-            <goals>
-              <goal>test</goal>
-            </goals>
-            <configuration>
-              <rerunFailingTestsCount>2</rerunFailingTestsCount>
-              <!-- There are some tests that take longer or are a little flaky.  Run them here. -->
-              <includesFile>src/test/resources/slow-or-flaky-tests.txt</includesFile>
+              <argLine>@{jacoco.surefire.argLine} ${surefire.argLine}</argLine>
             </configuration>
           </execution>
         </executions>
@@ -312,7 +286,7 @@
       <plugin>
         <groupId>org.codehaus.mojo</groupId>
         <artifactId>animal-sniffer-maven-plugin</artifactId>
-        <version>1.19</version>
+        <version>1.20</version>
         <configuration>
           <signature>
             <groupId>org.codehaus.mojo.signature</groupId>
@@ -345,13 +319,14 @@
       <plugin>
         <groupId>com.diffplug.spotless</groupId>
         <artifactId>spotless-maven-plugin</artifactId>
-        <version>2.6.1</version>
+        <version>2.9.0</version>
         <executions>
           <execution>
             <id>spotless-check</id>
-            <phase>process-sources</phase>
+            <!-- runs in verify phase by default -->
             <goals>
-              <goal>${spotless-maven-plugin.goal}</goal>
+              <!-- can be disabled using -Dspotless.check.skip=true -->
+              <goal>check</goal>
             </goals>
           </execution>
         </executions>
@@ -410,7 +385,7 @@
     <dependency>
       <groupId>com.tngtech.archunit</groupId>
       <artifactId>archunit</artifactId>
-      <version>0.15.0</version>
+      <version>0.17.0</version>
       <scope>test</scope>
     </dependency>
     <dependency>
@@ -435,13 +410,19 @@
     <dependency>
       <groupId>junit</groupId>
       <artifactId>junit</artifactId>
-      <version>4.13.1</version>
+      <version>4.13.2</version>
+      <scope>test</scope>
+    </dependency>
+    <dependency>
+      <groupId>org.awaitility</groupId>
+      <artifactId>awaitility</artifactId>
+      <version>4.0.3</version>
       <scope>test</scope>
     </dependency>
     <dependency>
       <groupId>com.fasterxml.jackson.core</groupId>
       <artifactId>jackson-databind</artifactId>
-      <version>2.10.2</version>
+      <version>2.12.1</version>
     </dependency>
     <dependency>
       <groupId>commons-io</groupId>
@@ -484,7 +465,7 @@
     <dependency>
       <groupId>org.eclipse.jgit</groupId>
       <artifactId>org.eclipse.jgit</artifactId>
-      <version>5.10.0.202012080955-r</version>
+      <version>5.11.0.202103091610-r</version>
       <scope>test</scope>
     </dependency>
     <dependency>
@@ -540,7 +521,7 @@
     <dependency>
       <groupId>org.mockito</groupId>
       <artifactId>mockito-core</artifactId>
-      <version>3.6.28</version>
+      <version>3.8.0</version>
       <scope>test</scope>
     </dependency>
     <dependency>
@@ -581,6 +562,48 @@
     </pluginRepository>
   </pluginRepositories>
   <profiles>
+    <!-- only enable slow-or-flaky-test if -Dtest= is not present -->
+    <profile>
+      <id>slow-or-flaky-test</id>
+      <activation>
+        <property>
+          <name>!test</name>
+        </property>
+      </activation>
+      <build>
+        <plugins>
+          <plugin>
+            <artifactId>maven-surefire-plugin</artifactId>
+            <executions>
+              <execution>
+                <id>slow-or-flaky-test</id>
+                <phase>test</phase>
+                <goals>
+                  <goal>test</goal>
+                </goals>
+                <configuration>
+                  <rerunFailingTestsCount>2</rerunFailingTestsCount>
+                  <!-- There are some tests that take longer or are a little
+                    flaky. Run them here. -->
+                  <includesFile>src/test/resources/slow-or-flaky-tests.txt</includesFile>
+                  <argLine>@{jacoco.surefire.argLine} ${surefire.argLine}</argLine>
+                </configuration>
+              </execution>
+            </executions>
+          </plugin>
+        </plugins>
+      </build>
+    </profile>
+    <profile>
+      <id>jdk11+</id>
+      <activation>
+        <jdk>[11,)</jdk>
+      </activation>
+      <properties>
+        <!-- this is required for GithubHttpUrlConnectionClient#setRequestMethod() to work with JDK 16+ -->
+        <surefire.argLine>--add-opens java.base/java.net=ALL-UNNAMED</surefire.argLine>
+      </properties>
+    </profile>
     <profile>
       <id>ci-non-windows</id>
       <activation>
@@ -592,7 +615,8 @@
         </os>
       </activation>
       <properties>
-        <spotless-maven-plugin.goal>check</spotless-maven-plugin.goal>
+        <!-- Only fail code coverage on non-windows machines -->
+        <jacoco.haltOnFailure>true</jacoco.haltOnFailure>
       </properties>
     </profile>
     <profile>
@@ -602,23 +626,55 @@
           <name>enable-ci</name>
         </property>
       </activation>
-      <properties>
-        <jacoco.haltOnFailure>true</jacoco.haltOnFailure>
-      </properties>
       <build>
         <plugins>
           <plugin>
             <groupId>org.jacoco</groupId>
             <artifactId>jacoco-maven-plugin</artifactId>
           </plugin>
+          <plugin>
+            <groupId>com.diffplug.spotless</groupId>
+            <artifactId>spotless-maven-plugin</artifactId>
+            <executions>
+              <execution>
+                <id>spotless-check</id>
+                <!-- In CI, run check early in the build -->
+                <phase>process-sources</phase>
+                <goals>
+                  <goal>check</goal>
+                </goals>
+              </execution>
+            </executions>
+          </plugin>
+          <plugin>
+            <groupId>org.apache.maven.plugins</groupId>
+            <artifactId>maven-enforcer-plugin</artifactId>
+            <version>3.0.0-M3</version>
+            <executions>
+              <execution>
+                <id>enforce-jacoco-exist</id>
+                <phase>verify</phase>
+                <goals>
+                  <goal>enforce</goal>
+                </goals>
+                <configuration>
+                  <rules>
+                    <requireFilesExist>
+                      <files>
+                        <file>${project.build.directory}/jacoco.exec</file>
+                      </files>
+                    </requireFilesExist>
+                  </rules>
+                  <fail>true</fail>
+                </configuration>
+              </execution>
+            </executions>
+          </plugin>
         </plugins>
       </build>
     </profile>
     <profile>
       <id>release</id>
-      <properties>
-        <spotless-maven-plugin.goal>check</spotless-maven-plugin.goal>
-      </properties>
       <build>
         <plugins>
           <plugin>

src/main/java/org/kohsuke/github/GHArtifact.java

@@ -0,0 +1,140 @@
+package org.kohsuke.github;
+
+import com.fasterxml.jackson.annotation.JsonIgnore;
+import org.apache.commons.lang3.StringUtils;
+import org.kohsuke.github.function.InputStreamFunction;
+
+import java.io.IOException;
+import java.net.URL;
+import java.util.Date;
+import java.util.Objects;
+
+import static java.util.Objects.requireNonNull;
+
+/**
+ * An artifact from a workflow run.
+ *
+ * @author Guillaume Smet
+ */
+public class GHArtifact extends GHObject {
+
+    // Not provided by the API.
+    @JsonIgnore
+    private GHRepository owner;
+
+    private String name;
+    private long sizeInBytes;
+    private String archiveDownloadUrl;
+    private boolean expired;
+    private String expiresAt;
+
+    /**
+     * Gets the name.
+     *
+     * @return the name
+     */
+    public String getName() {
+        return name;
+    }
+
+    /**
+     * Gets the size of the artifact in bytes.
+     *
+     * @return the size
+     */
+    public long getSizeInBytes() {
+        return sizeInBytes;
+    }
+
+    /**
+     * Gets the archive download URL.
+     *
+     * @return the archive download URL
+     */
+    public URL getArchiveDownloadUrl() {
+        return GitHubClient.parseURL(archiveDownloadUrl);
+    }
+
+    /**
+     * If this artifact has expired.
+     *
+     * @return if the artifact has expired
+     */
+    public boolean isExpired() {
+        return expired;
+    }
+
+    /**
+     * Gets the date at which this artifact will expire.
+     *
+     * @return the date of expiration
+     */
+    public Date getExpiresAt() {
+        return GitHubClient.parseDate(expiresAt);
+    }
+
+    /**
+     * Repository to which the artifact belongs.
+     *
+     * @return the repository
+     */
+    public GHRepository getRepository() {
+        return owner;
+    }
+
+    /**
+     * @deprecated This object has no HTML URL.
+     */
+    @Override
+    public URL getHtmlUrl() throws IOException {
+        return null;
+    }
+
+    /**
+     * Deletes the artifact.
+     *
+     * @throws IOException
+     *             the io exception
+     */
+    public void delete() throws IOException {
+        root.createRequest().method("DELETE").withUrlPath(getApiRoute()).fetchHttpStatusCode();
+    }
+
+    /**
+     * Downloads the artifact.
+     *
+     * @param <T>
+     *            the type of result
+     * @param streamFunction
+     *            The {@link InputStreamFunction} that will process the stream
+     * @throws IOException
+     *             The IO exception.
+     * @return the result of reading the stream.
+     */
+    public <T> T download(InputStreamFunction<T> streamFunction) throws IOException {
+        requireNonNull(streamFunction, "Stream function must not be null");
+
+        return root.createRequest().method("GET").withUrlPath(getApiRoute(), "zip").fetchStream(streamFunction);
+    }
+
+    private String getApiRoute() {
+        if (owner == null) {
+            // Workflow runs returned from search to do not have an owner. Attempt to use url.
+            final URL url = Objects.requireNonNull(getUrl(), "Missing instance URL!");
+            return StringUtils.prependIfMissing(url.toString().replace(root.getApiUrl(), ""), "/");
+        }
+        return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/actions/artifacts/" + getId();
+    }
+
+    GHArtifact wrapUp(GHRepository owner) {
+        this.owner = owner;
+        return wrapUp(owner.root);
+    }
+
+    GHArtifact wrapUp(GitHub root) {
+        this.root = root;
+        if (owner != null)
+            owner.wrap(root);
+        return this;
+    }
+}

src/main/java/org/kohsuke/github/GHArtifactsIterable.java

@@ -0,0 +1,49 @@
+package org.kohsuke.github;
+
+import java.net.MalformedURLException;
+import java.util.Iterator;
+
+import javax.annotation.Nonnull;
+
+/**
+ * Iterable for artifacts listing.
+ */
+class GHArtifactsIterable extends PagedIterable<GHArtifact> {
+    private final transient GHRepository owner;
+    private final GitHubRequest request;
+
+    private GHArtifactsPage result;
+
+    public GHArtifactsIterable(GHRepository owner, GitHubRequest.Builder<?> requestBuilder) {
+        this.owner = owner;
+        try {
+            this.request = requestBuilder.build();
+        } catch (MalformedURLException e) {
+            throw new GHException("Malformed URL", e);
+        }
+    }
+
+    @Nonnull
+    @Override
+    public PagedIterator<GHArtifact> _iterator(int pageSize) {
+        return new PagedIterator<>(
+                adapt(GitHubPageIterator.create(owner.getRoot().getClient(), GHArtifactsPage.class, request, pageSize)),
+                null);
+    }
+
+    protected Iterator<GHArtifact[]> adapt(final Iterator<GHArtifactsPage> base) {
+        return new Iterator<GHArtifact[]>() {
+            public boolean hasNext() {
+                return base.hasNext();
+            }
+
+            public GHArtifact[] next() {
+                GHArtifactsPage v = base.next();
+                if (result == null) {
+                    result = v;
+                }
+                return v.getArtifacts(owner);
+            }
+        };
+    }
+}

src/main/java/org/kohsuke/github/GHArtifactsPage.java

@@ -0,0 +1,20 @@
+package org.kohsuke.github;
+
+/**
+ * Represents the one page of artifacts result when listing artifacts.
+ */
+class GHArtifactsPage {
+    private int total_count;
+    private GHArtifact[] artifacts;
+
+    public int getTotalCount() {
+        return total_count;
+    }
+
+    GHArtifact[] getArtifacts(GHRepository owner) {
+        for (GHArtifact artifact : artifacts) {
+            artifact.wrapUp(owner);
+        }
+        return artifacts;
+    }
+}

src/main/java/org/kohsuke/github/GHCheckRun.java

@@ -1,8 +1,12 @@
 package org.kohsuke.github;
 
 import com.fasterxml.jackson.annotation.JsonProperty;
+import com.infradna.tool.bridge_method_injector.WithBridgeMethods;
 import edu.umd.cs.findbugs.annotations.NonNull;
 import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
+import org.kohsuke.github.GHWorkflowRun.Conclusion;
+import org.kohsuke.github.GHWorkflowRun.Status;
+import org.kohsuke.github.internal.EnumUtils;
 import org.kohsuke.github.internal.Previews;
 
 import java.io.IOException;
@@ -11,6 +15,7 @@ import java.util.Arrays;
 import java.util.Collections;
 import java.util.Date;
 import java.util.List;
+import java.util.Locale;
 
 /**
  * Represents a check run.
@@ -80,12 +85,27 @@ public class GHCheckRun extends GHObject {
      * @return Status of the check run
      * @see Status
      */
-    public String getStatus() {
+    @WithBridgeMethods(value = String.class, adapterMethod = "statusAsStr")
+    public Status getStatus() {
+        return Status.from(status);
+    }
+
+    @SuppressFBWarnings(value = "UPM_UNCALLED_PRIVATE_METHOD", justification = "Bridge method of getStatus")
+    private Object statusAsStr(Status status, Class type) {
         return status;
     }
 
     public static enum Status {
-        QUEUED, IN_PROGRESS, COMPLETED
+        QUEUED, IN_PROGRESS, COMPLETED, UNKNOWN;
+
+        public static Status from(String value) {
+            return EnumUtils.getNullableEnumOrDefault(Status.class, value, Status.UNKNOWN);
+        }
+
+        @Override
+        public String toString() {
+            return name().toLowerCase(Locale.ROOT);
+        }
     }
 
     /**
@@ -94,7 +114,13 @@ public class GHCheckRun extends GHObject {
      * @return Status of the check run
      * @see Conclusion
      */
-    public String getConclusion() {
+    @WithBridgeMethods(value = String.class, adapterMethod = "conclusionAsStr")
+    public Conclusion getConclusion() {
+        return Conclusion.from(conclusion);
+    }
+
+    @SuppressFBWarnings(value = "UPM_UNCALLED_PRIVATE_METHOD", justification = "Bridge method of getConclusion")
+    private Object conclusionAsStr(Conclusion conclusion, Class type) {
         return conclusion;
     }
 
@@ -105,7 +131,16 @@ public class GHCheckRun extends GHObject {
      * Parameters - <code>conclusion</code></a>.
      */
     public static enum Conclusion {
-        SUCCESS, FAILURE, NEUTRAL, CANCELLED, TIMED_OUT, ACTION_REQUIRED, SKIPPED
+        ACTION_REQUIRED, CANCELLED, FAILURE, NEUTRAL, SUCCESS, SKIPPED, STALE, TIMED_OUT, UNKNOWN;
+
+        public static Conclusion from(String value) {
+            return EnumUtils.getNullableEnumOrDefault(Conclusion.class, value, Conclusion.UNKNOWN);
+        }
+
+        @Override
+        public String toString() {
+            return name().toLowerCase(Locale.ROOT);
+        }
     }
 
     /**

src/main/java/org/kohsuke/github/GHCheckRunBuilder.java

@@ -152,7 +152,7 @@ public final class GHCheckRunBuilder {
         }
         GHCheckRun run = requester.with("output", output).with("actions", actions).fetch(GHCheckRun.class).wrap(repo);
         while (!extraAnnotations.isEmpty()) {
-            Output output2 = new Output(output.title, output.summary);
+            Output output2 = new Output(output.title, output.summary).withText(output.text);
             int i = Math.min(extraAnnotations.size(), MAX_ANNOTATIONS);
             output2.annotations = extraAnnotations.subList(0, i);
             extraAnnotations = extraAnnotations.subList(i, extraAnnotations.size());

src/main/java/org/kohsuke/github/GHEventPayload.java

@@ -5,7 +5,9 @@ import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
 
 import java.io.IOException;
 import java.io.Reader;
+import java.util.Date;
 import java.util.List;
+import java.util.Map;
 
 /**
  * Base type for types used in databinding of the event payload.
@@ -380,9 +382,9 @@ public class GHEventPayload extends GitHubInteractiveObject {
         }
 
         /**
-         * Gets label.
+         * Gets the added or removed label for labeled/unlabeled events.
          *
-         * @return the label
+         * @return label the added or removed label
          */
         public GHLabel getLabel() {
             return label;
@@ -519,6 +521,10 @@ public class GHEventPayload extends GitHubInteractiveObject {
     public static class Issue extends GHEventPayload {
         private GHIssue issue;
 
+        private GHLabel label;
+
+        private GHIssueChanges changes;
+
         /**
          * Gets issue.
          *
@@ -538,6 +544,24 @@ public class GHEventPayload extends GitHubInteractiveObject {
             this.issue = issue;
         }
 
+        /**
+         * Gets the added or removed label for labeled/unlabeled events.
+         *
+         * @return label the added or removed label
+         */
+        public GHLabel getLabel() {
+            return label;
+        }
+
+        /**
+         * Get changes (for action="edited")
+         *
+         * @return changes
+         */
+        public GHIssueChanges getChanges() {
+            return changes;
+        }
+
         @Override
         void wrapUp(GitHub root) {
             super.wrapUp(root);
@@ -1067,7 +1091,7 @@ public class GHEventPayload extends GitHubInteractiveObject {
         public static class PushCommit {
             private GitUser author;
             private GitUser committer;
-            private String url, sha, message;
+            private String url, sha, message, timestamp;
             private boolean distinct;
             private List<String> added, removed, modified;
 
@@ -1156,6 +1180,15 @@ public class GHEventPayload extends GitHubInteractiveObject {
             public List<String> getModified() {
                 return modified;
             }
+
+            /**
+             * Obtains the timestamp of the commit
+             *
+             * @return the timestamp
+             */
+            public Date getTimestamp() {
+                return GitHubClient.parseDate(timestamp);
+            }
         }
     }
 
@@ -1294,4 +1327,84 @@ public class GHEventPayload extends GitHubInteractiveObject {
             }
         }
     }
+
+    /**
+     * Occurs when someone triggered a workflow run or sends a POST request to the "Create a workflow dispatch event"
+     * endpoint.
+     *
+     * @see <a href=
+     *      "https://docs.github.com/en/developers/webhooks-and-events/webhook-events-and-payloads#workflow_dispatch">
+     *      workflow dispatch event</a>
+     * @see <a href=
+     *      "https://docs.github.com/en/actions/reference/events-that-trigger-workflows#workflow_dispatch">Events that
+     *      trigger workflows</a>
+     */
+    public static class WorkflowDispatch extends GHEventPayload {
+        private Map<String, Object> inputs;
+        private String ref;
+        private String workflow;
+
+        /**
+         * Gets the map of input parameters passed to the workflow.
+         *
+         * @return the map of input parameters
+         */
+        public Map<String, Object> getInputs() {
+            return inputs;
+        }
+
+        /**
+         * Gets the ref of the branch (e.g. refs/heads/main)
+         *
+         * @return the ref of the branch
+         */
+        public String getRef() {
+            return ref;
+        }
+
+        /**
+         * Gets the path of the workflow file (e.g. .github/workflows/hello-world-workflow.yml).
+         *
+         * @return the path of the workflow file
+         */
+        public String getWorkflow() {
+            return workflow;
+        }
+    }
+
+    /**
+     * A workflow run was requested or completed.
+     *
+     * @see <a href=
+     *      "https://docs.github.com/en/developers/webhooks-and-events/webhook-events-and-payloads#workflow_run">
+     *      workflow run event</a>
+     * @see <a href="https://docs.github.com/en/rest/reference/actions#workflow-runs">Actions Workflow Runs</a>
+     */
+    public static class WorkflowRun extends GHEventPayload {
+        private GHWorkflowRun workflowRun;
+        private GHWorkflow workflow;
+
+        public GHWorkflowRun getWorkflowRun() {
+            return workflowRun;
+        }
+
+        public GHWorkflow getWorkflow() {
+            return workflow;
+        }
+
+        @Override
+        void wrapUp(GitHub root) {
+            super.wrapUp(root);
+            if (workflowRun == null || workflow == null) {
+                throw new IllegalStateException(
+                        "Expected workflow and workflow_run payload, but got something else. Maybe we've got another type of event?");
+            }
+            GHRepository repository = getRepository();
+            if (repository == null) {
+                throw new IllegalStateException("Repository must not be null");
+            }
+            workflowRun.wrapUp(repository);
+            workflow.wrapUp(repository);
+        }
+    }
 }

src/main/java/org/kohsuke/github/GHIssue.java

@@ -312,7 +312,7 @@ public class GHIssue extends GHObject implements Reactable {
     }
 
     /**
-     * Sets labels.
+     * Sets labels on the target to a specific list.
      *
      * @param labels
      *            the labels
@@ -326,6 +326,8 @@ public class GHIssue extends GHObject implements Reactable {
     /**
      * Adds labels to the issue.
      *
+     * Labels that are already present on the target are ignored.
+     *
      * @param names
      *            Names of the label
      * @throws IOException
@@ -338,6 +340,8 @@ public class GHIssue extends GHObject implements Reactable {
     /**
      * Add labels.
      *
+     * Labels that are already present on the target are ignored.
+     *
      * @param labels
      *            the labels
      * @throws IOException
@@ -350,6 +354,8 @@ public class GHIssue extends GHObject implements Reactable {
     /**
      * Add labels.
      *
+     * Labels that are already present on the target are ignored.
+     *
      * @param labels
      *            the labels
      * @throws IOException
@@ -360,21 +366,27 @@ public class GHIssue extends GHObject implements Reactable {
     }
 
     private void _addLabels(Collection<String> names) throws IOException {
-        List<String> newLabels = new ArrayList<String>();
-
-        for (GHLabel label : getLabels()) {
-            newLabels.add(label.getName());
-        }
-        for (String name : names) {
-            if (!newLabels.contains(name)) {
-                newLabels.add(name);
-            }
-        }
-        setLabels(newLabels.toArray(new String[0]));
+        root.createRequest().with("labels", names).method("POST").withUrlPath(getIssuesApiRoute() + "/labels").send();
     }
 
     /**
-     * Remove a given label by name from this issue.
+     * Remove a single label.
+     *
+     * Attempting to remove a label that is not present throws {@link GHFileNotFoundException}.
+     *
+     * @param name
+     *            the name
+     * @throws IOException
+     *             the io exception, throws {@link GHFileNotFoundException} if label was not present.
+     */
+    public void removeLabel(String name) throws IOException {
+        root.createRequest().method("DELETE").withUrlPath(getIssuesApiRoute() + "/labels", name).send();
+    }
+
+    /**
+     * Remove a collection of labels.
+     *
+     * Attempting to remove labels that are not present on the target are ignored.
      *
      * @param names
      *            the names
@@ -386,7 +398,9 @@ public class GHIssue extends GHObject implements Reactable {
     }
 
     /**
-     * Remove labels.
+     * Remove a collection of labels.
+     *
+     * Attempting to remove labels that are not present on the target are ignored.
      *
      * @param labels
      *            the labels
@@ -399,7 +413,9 @@ public class GHIssue extends GHObject implements Reactable {
     }
 
     /**
-     * Remove labels.
+     * Remove a collection of labels.
+     *
+     * Attempting to remove labels that are not present on the target are ignored.
      *
      * @param labels
      *            the labels
@@ -411,15 +427,13 @@ public class GHIssue extends GHObject implements Reactable {
     }
 
     private void _removeLabels(Collection<String> names) throws IOException {
-        List<String> newLabels = new ArrayList<String>();
-
-        for (GHLabel l : getLabels()) {
-            if (!names.contains(l.getName())) {
-                newLabels.add(l.getName());
+        for (String name : names) {
+            try {
+                removeLabel(name);
+            } catch (GHFileNotFoundException e) {
+                // when trying to remove multiple labels, we ignore already removed
             }
         }
-
-        setLabels(newLabels.toArray(new String[0]));
     }
 
     /**

src/main/java/org/kohsuke/github/GHIssueChanges.java

@@ -0,0 +1,49 @@
+package org.kohsuke.github;
+
+import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
+
+/**
+ * Wrapper to define changed fields on issues action="edited"
+ *
+ * @see GHEventPayload.Issue
+ */
+@SuppressFBWarnings("UWF_UNWRITTEN_FIELD")
+public class GHIssueChanges {
+
+    private GHFrom title;
+    private GHFrom body;
+
+    /**
+     * Old issue title.
+     *
+     * @return old issue title (or null if not changed)
+     */
+    public GHFrom getTitle() {
+        return title;
+    }
+
+    /**
+     * Old issue body.
+     *
+     * @return old issue body (or null if not changed)
+     */
+    public GHFrom getBody() {
+        return body;
+    }
+
+    /**
+     * Wrapper for changed values.
+     */
+    public static class GHFrom {
+        private String from;
+
+        /**
+         * Previous value that was changed.
+         *
+         * @return previous value
+         */
+        public String getFrom() {
+            return from;
+        }
+    }
+}

src/main/java/org/kohsuke/github/GHLabel.java

@@ -2,6 +2,7 @@ package org.kohsuke.github;
 
 import com.fasterxml.jackson.annotation.JacksonInject;
 import com.fasterxml.jackson.annotation.JsonCreator;
+import com.fasterxml.jackson.annotation.JsonProperty;
 
 import java.io.IOException;
 import java.util.ArrayList;
@@ -22,6 +23,11 @@ import javax.annotation.Nonnull;
  */
 public class GHLabel extends GitHubInteractiveObject {
 
+    private long id;
+    private String nodeId;
+    @JsonProperty("default")
+    private boolean default_;
+
     @Nonnull
     private String url, name, color;
 
@@ -42,6 +48,24 @@ public class GHLabel extends GitHubInteractiveObject {
         return Objects.requireNonNull(root);
     }
 
+    /**
+     * Gets id.
+     *
+     * @return the id
+     */
+    public long getId() {
+        return id;
+    }
+
+    /**
+     * Gets node id.
+     *
+     * @return the node id.
+     */
+    public String getNodeId() {
+        return nodeId;
+    }
+
     /**
      * Gets url.
      *
@@ -82,6 +106,15 @@ public class GHLabel extends GitHubInteractiveObject {
         return description;
     }
 
+    /**
+     * If the label is one of the default labels created by GitHub automatically.
+     *
+     * @return true if the label is a default one
+     */
+    public boolean isDefault() {
+        return default_;
+    }
+
     /**
      * Sets color.
      *

src/main/java/org/kohsuke/github/GHPullRequestReviewComment.java

@@ -153,7 +153,20 @@ public class GHPullRequestReviewComment extends GHObject implements Reactable {
      * @return the api route
      */
     protected String getApiRoute() {
-        return "/repos/" + owner.getRepository().getFullName() + "/pulls/comments/" + getId();
+        return getApiRoute(false);
+    }
+
+    /**
+     * Gets api route.
+     *
+     * @param includePullNumber
+     *            if true, includes the owning pull request's number in the route.
+     *
+     * @return the api route
+     */
+    protected String getApiRoute(boolean includePullNumber) {
+        return "/repos/" + owner.getRepository().getFullName() + "/pulls"
+                + (includePullNumber ? "/" + owner.getNumber() : "") + "/comments/" + getId();
     }
 
     /**
@@ -192,8 +205,7 @@ public class GHPullRequestReviewComment extends GHObject implements Reactable {
         return owner.root.createRequest()
                 .method("POST")
                 .with("body", body)
-                .with("in_reply_to", getId())
-                .withUrlPath(getApiRoute() + "/comments")
+                .withUrlPath(getApiRoute(true) + "/replies")
                 .fetch(GHPullRequestReviewComment.class)
                 .wrapUp(owner);
     }

src/main/java/org/kohsuke/github/GHRepository.java

@@ -30,6 +30,8 @@ import edu.umd.cs.findbugs.annotations.CheckForNull;
 import edu.umd.cs.findbugs.annotations.NonNull;
 import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
 import org.apache.commons.lang3.StringUtils;
+import org.kohsuke.github.function.InputStreamFunction;
+import org.kohsuke.github.internal.EnumUtils;
 
 import java.io.FileNotFoundException;
 import java.io.IOException;
@@ -48,21 +50,23 @@ import java.util.HashSet;
 import java.util.Iterator;
 import java.util.LinkedHashSet;
 import java.util.List;
+import java.util.Locale;
 import java.util.Map;
-import java.util.Objects;
 import java.util.Set;
 import java.util.TreeMap;
 import java.util.WeakHashMap;
 
 import javax.annotation.Nonnull;
 
-import static java.util.Arrays.*;
+import static java.util.Arrays.asList;
+import static java.util.Objects.requireNonNull;
 import static org.kohsuke.github.internal.Previews.ANTIOPE;
 import static org.kohsuke.github.internal.Previews.ANT_MAN;
 import static org.kohsuke.github.internal.Previews.BAPTISTE;
 import static org.kohsuke.github.internal.Previews.FLASH;
 import static org.kohsuke.github.internal.Previews.INERTIA;
 import static org.kohsuke.github.internal.Previews.MERCY;
+import static org.kohsuke.github.internal.Previews.NEBULA;
 import static org.kohsuke.github.internal.Previews.SHADOW_CAT;
 
 /**
@@ -103,6 +107,8 @@ public class GHRepository extends GHObject {
     @JsonProperty("private")
     private boolean _private;
 
+    private String visibility;
+
     private int forks_count, stargazers_count, watchers_count, size, open_issues_count, subscribers_count;
 
     private String pushed_at;
@@ -709,6 +715,41 @@ public class GHRepository extends GHObject {
         return _private;
     }
 
+    /**
+     * Visibility of a repository.
+     */
+    public enum Visibility {
+        PUBLIC, INTERNAL, PRIVATE, UNKNOWN;
+
+        public static Visibility from(String value) {
+            return EnumUtils.getNullableEnumOrDefault(Visibility.class, value, Visibility.UNKNOWN);
+        }
+
+        @Override
+        public String toString() {
+            return name().toLowerCase(Locale.ROOT);
+        }
+    }
+
+    /**
+     * Gets the visibility of the repository.
+     *
+     * @return the visibility
+     */
+    @Deprecated
+    @Preview(NEBULA)
+    public Visibility getVisibility() {
+        if (visibility == null) {
+            try {
+                populate();
+            } catch (final IOException e) {
+                // Convert this to a runtime exception to avoid messy method signature
+                throw new GHException("Could not populate the visibility of the repository", e);
+            }
+        }
+        return Visibility.from(visibility);
+    }
+
     /**
      * Is template boolean.
      *
@@ -1201,6 +1242,26 @@ public class GHRepository extends GHObject {
         set().private_(value);
     }
 
+    /**
+     * Sets visibility.
+     *
+     * @param value
+     *            the value
+     * @throws IOException
+     *             the io exception
+     */
+    @Deprecated
+    @Preview(NEBULA)
+    public void setVisibility(final Visibility value) throws IOException {
+        root.createRequest()
+                .method("PATCH")
+                .withPreview(NEBULA)
+                .with("name", name)
+                .with("visibility", value)
+                .withUrlPath(getApiTailUrl(""))
+                .send();
+    }
+
     /**
      * Allow squash merge.
      *
@@ -1788,7 +1849,7 @@ public class GHRepository extends GHObject {
         return root.createRequest()
                 .withHeader("Accept", "application/vnd.github.v3.raw")
                 .withUrlPath(target)
-                .fetchStream();
+                .fetchStream(Requester::copyInputStream);
     }
 
     /**
@@ -2815,7 +2876,7 @@ public class GHRepository extends GHObject {
                         .with("mode", mode == null ? null : mode.toString())
                         .with("context", getFullName())
                         .withUrlPath("/markdown")
-                        .fetchStream(),
+                        .fetchStream(Requester::copyInputStream),
                 "UTF-8");
     }
 
@@ -2903,6 +2964,110 @@ public class GHRepository extends GHObject {
                 .wrapUp(root);
     }
 
+    /**
+     * Lists all the workflows of this repository.
+     *
+     * @return the paged iterable
+     */
+    public PagedIterable<GHWorkflow> listWorkflows() {
+        return new GHWorkflowsIterable(this);
+    }
+
+    /**
+     * Gets a workflow by id.
+     *
+     * @param id
+     *            the id of the workflow run
+     * @return the workflow run
+     * @throws IOException
+     *             the io exception
+     */
+    public GHWorkflow getWorkflow(long id) throws IOException {
+        return getWorkflow(String.valueOf(id));
+    }
+
+    /**
+     * Gets a workflow by name of the file.
+     *
+     * @param nameOrId
+     *            either the name of the file (e.g. my-workflow.yml) or the id as a string
+     * @return the workflow run
+     * @throws IOException
+     *             the io exception
+     */
+    public GHWorkflow getWorkflow(String nameOrId) throws IOException {
+        return root.createRequest()
+                .withUrlPath(getApiTailUrl("actions/workflows"), nameOrId)
+                .fetch(GHWorkflow.class)
+                .wrapUp(this);
+    }
+
+    /**
+     * Retrieves workflow runs.
+     *
+     * @return the workflow run query builder
+     */
+    public GHWorkflowRunQueryBuilder queryWorkflowRuns() {
+        return new GHWorkflowRunQueryBuilder(this);
+    }
+
+    /**
+     * Gets a workflow run.
+     *
+     * @param id
+     *            the id of the workflow run
+     * @return the workflow run
+     * @throws IOException
+     *             the io exception
+     */
+    public GHWorkflowRun getWorkflowRun(long id) throws IOException {
+        return root.createRequest()
+                .withUrlPath(getApiTailUrl("actions/runs"), String.valueOf(id))
+                .fetch(GHWorkflowRun.class)
+                .wrapUp(this);
+    }
+
+    /**
+     * Lists all the artifacts of this repository.
+     *
+     * @return the paged iterable
+     */
+    public PagedIterable<GHArtifact> listArtifacts() {
+        return new GHArtifactsIterable(this, root.createRequest().withUrlPath(getApiTailUrl("actions/artifacts")));
+    }
+
+    /**
+     * Gets an artifact by id.
+     *
+     * @param id
+     *            the id of the artifact
+     * @return the artifact
+     * @throws IOException
+     *             the io exception
+     */
+    public GHArtifact getArtifact(long id) throws IOException {
+        return root.createRequest()
+                .withUrlPath(getApiTailUrl("actions/artifacts"), String.valueOf(id))
+                .fetch(GHArtifact.class)
+                .wrapUp(this);
+    }
+
+    /**
+     * Gets a job from a workflow run by id.
+     *
+     * @param id
+     *            the id of the job
+     * @return the job
+     * @throws IOException
+     *             the io exception
+     */
+    public GHWorkflowJob getWorkflowJob(long id) throws IOException {
+        return root.createRequest()
+                .withUrlPath(getApiTailUrl("/actions/jobs/"), String.valueOf(id))
+                .fetch(GHWorkflowJob.class)
+                .wrapUp(this);
+    }
+
     // Only used within listTopics().
     private static class Topics {
         public List<String> names;
@@ -2969,6 +3134,52 @@ public class GHRepository extends GHObject {
                 .wrap(this);
     }
 
+    /**
+     * Streams a zip archive of the repository, optionally at a given <code>ref</code>.
+     *
+     * @param <T>
+     *            the type of result
+     * @param streamFunction
+     *            The {@link InputStreamFunction} that will process the stream
+     * @param ref
+     *            if <code>null</code> the repository's default branch, usually <code>master</code>,
+     * @throws IOException
+     *             The IO exception.
+     * @return the result of reading the stream.
+     */
+    public <T> T readZip(InputStreamFunction<T> streamFunction, String ref) throws IOException {
+        return downloadArchive("zip", ref, streamFunction);
+    }
+
+    /**
+     * Streams a tar archive of the repository, optionally at a given <code>ref</code>.
+     *
+     * @param <T>
+     *            the type of result
+     * @param streamFunction
+     *            The {@link InputStreamFunction} that will process the stream
+     * @param ref
+     *            if <code>null</code> the repository's default branch, usually <code>master</code>,
+     * @throws IOException
+     *             The IO exception.
+     * @return the result of reading the stream.
+     */
+    public <T> T readTar(InputStreamFunction<T> streamFunction, String ref) throws IOException {
+        return downloadArchive("tar", ref, streamFunction);
+    }
+
+    private <T> T downloadArchive(@Nonnull String type,
+            @CheckForNull String ref,
+            @Nonnull InputStreamFunction<T> streamFunction) throws IOException {
+        requireNonNull(streamFunction, "Sink must not be null");
+        String tailUrl = getApiTailUrl(type + "ball");
+        if (ref != null) {
+            tailUrl += "/" + ref;
+        }
+        final Requester builder = root.createRequest().method("GET").withUrlPath(tailUrl);
+        return builder.fetchStream(streamFunction);
+    }
+
     /**
      * Populate this object.
      *
@@ -2980,18 +3191,24 @@ public class GHRepository extends GHObject {
             return; // can't populate if the root is offline
         }
 
-        final URL url = Objects.requireNonNull(getUrl(), "Missing instance URL!");
+        final URL url = requireNonNull(getUrl(), "Missing instance URL!");
 
         try {
             // IMPORTANT: the url for repository records does not reliably point to the API url.
             // There is bug in Push event payloads that returns the wrong url.
             // All other occurrences of "url" take the form "https://api.github.com/...".
             // For Push event repository records, they take the form "https://github.com/{fullName}".
-            root.createRequest().withPreview(BAPTISTE).setRawUrlPath(url.toString()).fetchInto(this).wrap(root);
+            root.createRequest()
+                    .withPreview(BAPTISTE)
+                    .withPreview(NEBULA)
+                    .setRawUrlPath(url.toString())
+                    .fetchInto(this)
+                    .wrap(root);
         } catch (HttpException e) {
             if (e.getCause() instanceof JsonParseException) {
                 root.createRequest()
                         .withPreview(BAPTISTE)
+                        .withPreview(NEBULA)
                         .withUrlPath("/repos/" + full_name)
                         .fetchInto(this)
                         .wrap(root);

src/main/java/org/kohsuke/github/GHRepositoryBuilder.java

@@ -1,9 +1,12 @@
 package org.kohsuke.github;
 
+import org.kohsuke.github.GHRepository.Visibility;
+
 import java.io.IOException;
 import java.net.URL;
 
 import static org.kohsuke.github.internal.Previews.BAPTISTE;
+import static org.kohsuke.github.internal.Previews.NEBULA;
 
 abstract class GHRepositoryBuilder<S> extends AbstractBuilder<GHRepository, S> {
 
@@ -146,6 +149,20 @@ abstract class GHRepositoryBuilder<S> extends AbstractBuilder<GHRepository, S> {
         return with("private", enabled);
     }
 
+    /**
+     * Sets the repository visibility
+     *
+     * @param visibility
+     *            visibility of repository
+     * @return a builder to continue with building
+     * @throws IOException
+     *             In case of any networking error or error from the server.
+     */
+    public S visibility(final Visibility visibility) throws IOException {
+        requester.withPreview(NEBULA);
+        return with("visibility", visibility);
+    }
+
     /**
      * Enables issue tracker
      *

src/main/java/org/kohsuke/github/GHWorkflow.java

@@ -0,0 +1,158 @@
+package org.kohsuke.github;
+
+import com.fasterxml.jackson.annotation.JsonIgnore;
+import org.apache.commons.lang3.StringUtils;
+
+import java.io.IOException;
+import java.net.URL;
+import java.util.Collections;
+import java.util.Map;
+import java.util.Objects;
+
+/**
+ * A workflow.
+ *
+ * @author Guillaume Smet
+ * @see GHRepository#getWorkflow(long)
+ */
+public class GHWorkflow extends GHObject {
+
+    // Not provided by the API.
+    @JsonIgnore
+    private GHRepository owner;
+
+    private String name;
+    private String path;
+    private String state;
+
+    private String htmlUrl;
+    private String badgeUrl;
+
+    /**
+     * The name of the workflow.
+     *
+     * @return the name
+     */
+    public String getName() {
+        return name;
+    }
+
+    /**
+     * The path of the workflow e.g. .github/workflows/blank.yaml
+     *
+     * @return the path
+     */
+    public String getPath() {
+        return path;
+    }
+
+    /**
+     * The state of the workflow.
+     *
+     * @return the state
+     */
+    public String getState() {
+        return state;
+    }
+
+    @Override
+    public URL getHtmlUrl() throws IOException {
+        return GitHubClient.parseURL(htmlUrl);
+    }
+
+    /**
+     * Repository to which the workflow belongs.
+     *
+     * @return the repository
+     */
+    public GHRepository getRepository() {
+        return owner;
+    }
+
+    /**
+     * The badge URL, like https://github.com/octo-org/octo-repo/workflows/CI/badge.svg
+     *
+     * @return the badge url
+     */
+    public URL getBadgeUrl() {
+        return GitHubClient.parseURL(badgeUrl);
+    }
+
+    /**
+     * Disable the workflow.
+     *
+     * @throws IOException
+     *             the io exception
+     */
+    public void disable() throws IOException {
+        root.createRequest().method("PUT").withUrlPath(getApiRoute(), "disable").fetchHttpStatusCode();
+    }
+
+    /**
+     * Enable the workflow.
+     *
+     * @throws IOException
+     *             the io exception
+     */
+    public void enable() throws IOException {
+        root.createRequest().method("PUT").withUrlPath(getApiRoute(), "enable").fetchHttpStatusCode();
+    }
+
+    /**
+     * Create a workflow dispatch event which triggers a manual workflow run.
+     *
+     * @param ref
+     *            the git reference for the workflow. The reference can be a branch or tag name.
+     * @throws IOException
+     *             the io exception
+     */
+    public void dispatch(String ref) throws IOException {
+        dispatch(ref, Collections.emptyMap());
+    }
+
+    /**
+     * Create a workflow dispatch event which triggers a manual workflow run.
+     *
+     * @param ref
+     *            the git reference for the workflow. The reference can be a branch or tag name.
+     * @param inputs
+     *            input keys and values configured in the workflow file. The maximum number of properties is 10. Any
+     *            default properties configured in the workflow file will be used when inputs are omitted.
+     * @throws IOException
+     *             the io exception
+     */
+    public void dispatch(String ref, Map<String, Object> inputs) throws IOException {
+        Requester requester = root.createRequest()
+                .method("POST")
+                .withUrlPath(getApiRoute(), "dispatches")
+                .with("ref", ref);
+
+        if (!inputs.isEmpty()) {
+            requester.with("inputs", inputs);
+        }
+
+        requester.fetchHttpStatusCode();
+    }
+
+    private String getApiRoute() {
+        if (owner == null) {
+            // Workflow runs returned from search to do not have an owner. Attempt to use url.
+            final URL url = Objects.requireNonNull(getUrl(), "Missing instance URL!");
+            return StringUtils.prependIfMissing(url.toString().replace(root.getApiUrl(), ""), "/");
+
+        }
+        return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/actions/workflows/" + getId();
+    }
+
+    GHWorkflow wrapUp(GHRepository owner) {
+        this.owner = owner;
+        return wrapUp(owner.root);
+    }
+
+    GHWorkflow wrapUp(GitHub root) {
+        this.root = root;
+        if (owner != null)
+            owner.wrap(root);
+        return this;
+    }
+}

src/main/java/org/kohsuke/github/GHWorkflowJob.java

@@ -0,0 +1,256 @@
+package org.kohsuke.github;
+
+import com.fasterxml.jackson.annotation.JsonIgnore;
+import org.apache.commons.lang3.StringUtils;
+import org.kohsuke.github.GHWorkflowRun.Conclusion;
+import org.kohsuke.github.GHWorkflowRun.Status;
+import org.kohsuke.github.function.InputStreamFunction;
+
+import java.io.IOException;
+import java.net.URL;
+import java.util.ArrayList;
+import java.util.Date;
+import java.util.List;
+import java.util.Objects;
+
+import static java.util.Objects.requireNonNull;
+
+/**
+ * A workflow run job.
+ *
+ * @author Guillaume Smet
+ */
+public class GHWorkflowJob extends GHObject {
+
+    // Not provided by the API.
+    @JsonIgnore
+    private GHRepository owner;
+
+    private String name;
+
+    private String headSha;
+
+    private String startedAt;
+    private String completedAt;
+
+    private String status;
+    private String conclusion;
+
+    private long runId;
+
+    private String htmlUrl;
+    private String checkRunUrl;
+
+    private List<Step> steps = new ArrayList<>();
+
+    /**
+     * The name of the job.
+     *
+     * @return the name
+     */
+    public String getName() {
+        return name;
+    }
+
+    /**
+     * Gets the HEAD SHA.
+     *
+     * @return sha for the HEAD commit
+     */
+    public String getHeadSha() {
+        return headSha;
+    }
+
+    /**
+     * When was this job started?
+     *
+     * @return start date
+     */
+    public Date getStartedAt() {
+        return GitHubClient.parseDate(startedAt);
+    }
+
+    /**
+     * When was this job completed?
+     *
+     * @return completion date
+     */
+    public Date getCompletedAt() {
+        return GitHubClient.parseDate(completedAt);
+    }
+
+    /**
+     * Gets status of the job.
+     * <p>
+     * Can be {@code UNKNOWN} if the value returned by GitHub is unknown from the API.
+     *
+     * @return status of the job
+     */
+    public Status getStatus() {
+        return Status.from(status);
+    }
+
+    /**
+     * Gets the conclusion of the job.
+     * <p>
+     * Can be {@code UNKNOWN} if the value returned by GitHub is unknown from the API.
+     *
+     * @return conclusion of the job
+     */
+    public Conclusion getConclusion() {
+        return Conclusion.from(conclusion);
+    }
+
+    /**
+     * The run id.
+     *
+     * @return the run id
+     */
+    public long getRunId() {
+        return runId;
+    }
+
+    @Override
+    public URL getHtmlUrl() {
+        return GitHubClient.parseURL(htmlUrl);
+    }
+
+    /**
+     * The check run URL.
+     *
+     * @return the check run url
+     */
+    public URL getCheckRunUrl() {
+        return GitHubClient.parseURL(checkRunUrl);
+    }
+
+    /**
+     * Gets the execution steps of this job.
+     *
+     * @return the execution steps
+     */
+    public List<Step> getSteps() {
+        return steps;
+    }
+
+    /**
+     * Repository to which the job belongs.
+     *
+     * @return the repository
+     */
+    public GHRepository getRepository() {
+        return owner;
+    }
+
+    /**
+     * Downloads the logs.
+     * <p>
+     * The logs are returned as a text file.
+     *
+     * @param <T>
+     *            the type of result
+     * @param streamFunction
+     *            The {@link InputStreamFunction} that will process the stream
+     * @throws IOException
+     *             The IO exception.
+     * @return the result of reading the stream.
+     */
+    public <T> T downloadLogs(InputStreamFunction<T> streamFunction) throws IOException {
+        requireNonNull(streamFunction, "Stream function must not be null");
+
+        return root.createRequest().method("GET").withUrlPath(getApiRoute(), "logs").fetchStream(streamFunction);
+    }
+
+    private String getApiRoute() {
+        if (owner == null) {
+            // Workflow runs returned from search to do not have an owner. Attempt to use url.
+            final URL url = Objects.requireNonNull(getUrl(), "Missing instance URL!");
+            return StringUtils.prependIfMissing(url.toString().replace(root.getApiUrl(), ""), "/");
+
+        }
+        return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/actions/jobs/" + getId();
+    }
+
+    GHWorkflowJob wrapUp(GHRepository owner) {
+        this.owner = owner;
+        return wrapUp(owner.root);
+    }
+
+    GHWorkflowJob wrapUp(GitHub root) {
+        this.root = root;
+        if (owner != null) {
+            owner.wrap(root);
+        }
+        return this;
+    }
+
+    public static class Step {
+
+        private String name;
+        private int number;
+
+        private String startedAt;
+        private String completedAt;
+
+        private String status;
+        private String conclusion;
+
+        /**
+         * Gets the name of the step.
+         *
+         * @return name
+         */
+        public String getName() {
+            return name;
+        }
+
+        /**
+         * Gets the sequential number of the step.
+         *
+         * @return number
+         */
+        public int getNumber() {
+            return number;
+        }
+
+        /**
+         * When was this step started?
+         *
+         * @return start date
+         */
+        public Date getStartedAt() {
+            return GitHubClient.parseDate(startedAt);
+        }
+
+        /**
+         * When was this step completed?
+         *
+         * @return completion date
+         */
+        public Date getCompletedAt() {
+            return GitHubClient.parseDate(completedAt);
+        }
+
+        /**
+         * Gets status of the step.
+         * <p>
+         * Can be {@code UNKNOWN} if the value returned by GitHub is unknown from the API.
+         *
+         * @return status of the step
+         */
+        public Status getStatus() {
+            return Status.from(status);
+        }
+
+        /**
+         * Gets the conclusion of the step.
+         * <p>
+         * Can be {@code UNKNOWN} if the value returned by GitHub is unknown from the API.
+         *
+         * @return conclusion of the step
+         */
+        public Conclusion getConclusion() {
+            return Conclusion.from(conclusion);
+        }
+    }
+}

src/main/java/org/kohsuke/github/GHWorkflowJobQueryBuilder.java

@@ -0,0 +1,47 @@
+package org.kohsuke.github;
+
+import java.net.MalformedURLException;
+
+/**
+ * Lists up jobs of a workflow run with some filtering.
+ *
+ * @author Guillaume Smet
+ */
+public class GHWorkflowJobQueryBuilder extends GHQueryBuilder<GHWorkflowJob> {
+    private final GHRepository repo;
+
+    GHWorkflowJobQueryBuilder(GHWorkflowRun workflowRun) {
+        super(workflowRun.getRepository().root);
+        this.repo = workflowRun.getRepository();
+        req.withUrlPath(repo.getApiTailUrl("actions/runs"), String.valueOf(workflowRun.getId()), "jobs");
+    }
+
+    /**
+     * Apply a filter to only return the jobs of the most recent execution of the workflow run.
+     *
+     * @return the workflow run job query builder
+     */
+    public GHWorkflowJobQueryBuilder latest() {
+        req.with("filter", "latest");
+        return this;
+    }
+
+    /**
+     * Apply a filter to return jobs from all executions of this workflow run.
+     *
+     * @return the workflow run job run query builder
+     */
+    public GHWorkflowJobQueryBuilder all() {
+        req.with("filter", "all");
+        return this;
+    }
+
+    @Override
+    public PagedIterable<GHWorkflowJob> list() {
+        try {
+            return new GHWorkflowJobsIterable(repo, req.build());
+        } catch (MalformedURLException e) {
+            throw new GHException(e.getMessage(), e);
+        }
+    }
+}

src/main/java/org/kohsuke/github/GHWorkflowJobsIterable.java

@@ -0,0 +1,44 @@
+package org.kohsuke.github;
+
+import java.util.Iterator;
+
+import javax.annotation.Nonnull;
+
+/**
+ * Iterable for workflow run jobs listing.
+ */
+class GHWorkflowJobsIterable extends PagedIterable<GHWorkflowJob> {
+    private final GHRepository repo;
+    private final GitHubRequest request;
+
+    private GHWorkflowJobsPage result;
+
+    public GHWorkflowJobsIterable(GHRepository repo, GitHubRequest request) {
+        this.repo = repo;
+        this.request = request;
+    }
+
+    @Nonnull
+    @Override
+    public PagedIterator<GHWorkflowJob> _iterator(int pageSize) {
+        return new PagedIterator<>(
+                adapt(GitHubPageIterator.create(repo.root.getClient(), GHWorkflowJobsPage.class, request, pageSize)),
+                null);
+    }
+
+    protected Iterator<GHWorkflowJob[]> adapt(final Iterator<GHWorkflowJobsPage> base) {
+        return new Iterator<GHWorkflowJob[]>() {
+            public boolean hasNext() {
+                return base.hasNext();
+            }
+
+            public GHWorkflowJob[] next() {
+                GHWorkflowJobsPage v = base.next();
+                if (result == null) {
+                    result = v;
+                }
+                return v.getWorkflowJobs(repo);
+            }
+        };
+    }
+}

src/main/java/org/kohsuke/github/GHWorkflowJobsPage.java

@@ -0,0 +1,20 @@
+package org.kohsuke.github;
+
+/**
+ * Represents the one page of jobs result when listing jobs from a workflow run.
+ */
+class GHWorkflowJobsPage {
+    private int total_count;
+    private GHWorkflowJob[] jobs;
+
+    public int getTotalCount() {
+        return total_count;
+    }
+
+    GHWorkflowJob[] getWorkflowJobs(GHRepository repo) {
+        for (GHWorkflowJob job : jobs) {
+            job.wrapUp(repo);
+        }
+        return jobs;
+    }
+}

src/main/java/org/kohsuke/github/GHWorkflowRun.java

@@ -0,0 +1,457 @@
+package org.kohsuke.github;
+
+import com.fasterxml.jackson.annotation.JsonProperty;
+import org.apache.commons.lang3.StringUtils;
+import org.kohsuke.github.function.InputStreamFunction;
+import org.kohsuke.github.internal.EnumUtils;
+
+import java.io.IOException;
+import java.net.URL;
+import java.util.Arrays;
+import java.util.Collections;
+import java.util.Date;
+import java.util.List;
+import java.util.Locale;
+import java.util.Objects;
+
+import static java.util.Objects.requireNonNull;
+
+/**
+ * A workflow run.
+ *
+ * @author Guillaume Smet
+ * @see GHRepository#getWorkflowRun(long)
+ */
+public class GHWorkflowRun extends GHObject {
+
+    @JsonProperty("repository")
+    private GHRepository owner;
+
+    private String name;
+    private long runNumber;
+    private long workflowId;
+
+    private String htmlUrl;
+    private String jobsUrl;
+    private String logsUrl;
+    private String checkSuiteUrl;
+    private String artifactsUrl;
+    private String cancelUrl;
+    private String rerunUrl;
+    private String workflowUrl;
+
+    private String headBranch;
+    private String headSha;
+    private GHRepository headRepository;
+    private HeadCommit headCommit;
+
+    private String event;
+    private String status;
+    private String conclusion;
+
+    private GHPullRequest[] pullRequests;
+
+    /**
+     * The name of the workflow run.
+     *
+     * @return the name
+     */
+    public String getName() {
+        return name;
+    }
+
+    /**
+     * The run number.
+     *
+     * @return the run number
+     */
+    public long getRunNumber() {
+        return runNumber;
+    }
+
+    /**
+     * The workflow id.
+     *
+     * @return the workflow id
+     */
+    public long getWorkflowId() {
+        return workflowId;
+    }
+
+    @Override
+    public URL getHtmlUrl() throws IOException {
+        return GitHubClient.parseURL(htmlUrl);
+    }
+
+    /**
+     * The jobs URL, like https://api.github.com/repos/octo-org/octo-repo/actions/runs/30433642/jobs
+     *
+     * @return the jobs url
+     */
+    public URL getJobsUrl() {
+        return GitHubClient.parseURL(jobsUrl);
+    }
+
+    /**
+     * The logs URL, like https://api.github.com/repos/octo-org/octo-repo/actions/runs/30433642/logs
+     *
+     * @return the logs url
+     */
+    public URL getLogsUrl() {
+        return GitHubClient.parseURL(logsUrl);
+    }
+
+    /**
+     * The check suite URL, like https://api.github.com/repos/octo-org/octo-repo/check-suites/414944374
+     *
+     * @return the check suite url
+     */
+    public URL getCheckSuiteUrl() {
+        return GitHubClient.parseURL(checkSuiteUrl);
+    }
+
+    /**
+     * The artifacts URL, like https://api.github.com/repos/octo-org/octo-repo/actions/runs/30433642/artifacts
+     *
+     * @return the artifacts url
+     */
+    public URL getArtifactsUrl() {
+        return GitHubClient.parseURL(artifactsUrl);
+    }
+
+    /**
+     * The cancel URL, like https://api.github.com/repos/octo-org/octo-repo/actions/runs/30433642/cancel
+     *
+     * @return the cancel url
+     */
+    public URL getCancelUrl() {
+        return GitHubClient.parseURL(cancelUrl);
+    }
+
+    /**
+     * The rerun URL, like https://api.github.com/repos/octo-org/octo-repo/actions/runs/30433642/rerun
+     *
+     * @return the rerun url
+     */
+    public URL getRerunUrl() {
+        return GitHubClient.parseURL(rerunUrl);
+    }
+
+    /**
+     * The workflow URL, like https://api.github.com/repos/octo-org/octo-repo/actions/workflows/159038
+     *
+     * @return the workflow url
+     */
+    public URL getWorkflowUrl() {
+        return GitHubClient.parseURL(workflowUrl);
+    }
+
+    /**
+     * The head branch name the changes are on.
+     *
+     * @return head branch name
+     */
+    public String getHeadBranch() {
+        return headBranch;
+    }
+
+    /**
+     * Gets the HEAD SHA.
+     *
+     * @return sha for the HEAD commit
+     */
+    public String getHeadSha() {
+        return headSha;
+    }
+
+    /**
+     * The commit of current head.
+     *
+     * @return head commit
+     */
+    public HeadCommit getHeadCommit() {
+        return headCommit;
+    }
+
+    /**
+     * The repository of current head.
+     *
+     * @return head repository
+     */
+    public GHRepository getHeadRepository() {
+        return headRepository;
+    }
+
+    /**
+     * The type of event that triggered the build.
+     *
+     * @return type of event
+     */
+    public GHEvent getEvent() {
+        return Enum.valueOf(GHEvent.class, event.toUpperCase(Locale.ROOT));
+    }
+
+    /**
+     * Gets status of the workflow run.
+     * <p>
+     * Can be {@code UNKNOWN} if the value returned by GitHub is unknown from the API.
+     *
+     * @return status of the workflow run
+     */
+    public Status getStatus() {
+        return Status.from(status);
+    }
+
+    /**
+     * Gets the conclusion of the workflow run.
+     * <p>
+     * Can be {@code UNKNOWN} if the value returned by GitHub is unknown from the API.
+     *
+     * @return conclusion of the workflow run
+     */
+    public Conclusion getConclusion() {
+        return Conclusion.from(conclusion);
+    }
+
+    /**
+     * Repository to which the workflow run belongs.
+     *
+     * @return the repository
+     */
+    public GHRepository getRepository() {
+        return owner;
+    }
+
+    /**
+     * Gets the pull requests participated in this workflow run.
+     *
+     * Note this field is only populated for events. When getting a {@link GHWorkflowRun} outside of an event, this is
+     * always empty.
+     *
+     * @return the list of {@link GHPullRequest}s for this workflow run. Only populated for events.
+     * @throws IOException
+     *             the io exception
+     */
+    public List<GHPullRequest> getPullRequests() throws IOException {
+        if (pullRequests != null && pullRequests.length != 0) {
+            for (GHPullRequest pullRequest : pullRequests) {
+                // Only refresh if we haven't do so before
+                pullRequest.refresh(pullRequest.getTitle());
+            }
+            return Collections.unmodifiableList(Arrays.asList(pullRequests));
+        }
+        return Collections.emptyList();
+    }
+
+    /**
+     * Cancel the workflow run.
+     *
+     * @throws IOException
+     *             the io exception
+     */
+    public void cancel() throws IOException {
+        root.createRequest().method("POST").withUrlPath(getApiRoute(), "cancel").fetchHttpStatusCode();
+    }
+
+    /**
+     * Delete the workflow run.
+     *
+     * @throws IOException
+     *             the io exception
+     */
+    public void delete() throws IOException {
+        root.createRequest().method("DELETE").withUrlPath(getApiRoute()).fetchHttpStatusCode();
+    }
+
+    /**
+     * Rerun the workflow run.
+     *
+     * @throws IOException
+     *             the io exception
+     */
+    public void rerun() throws IOException {
+        root.createRequest().method("POST").withUrlPath(getApiRoute(), "rerun").fetchHttpStatusCode();
+    }
+
+    /**
+     * Lists the artifacts attached to this workflow run.
+     *
+     * @return the paged iterable
+     */
+    public PagedIterable<GHArtifact> listArtifacts() {
+        return new GHArtifactsIterable(owner, root.createRequest().withUrlPath(getApiRoute(), "artifacts"));
+    }
+
+    /**
+     * Downloads the logs.
+     * <p>
+     * The logs are in the form of a zip archive.
+     * <p>
+     * Note that the archive is the same as the one downloaded from a workflow run so it contains the logs for all jobs.
+     *
+     * @param <T>
+     *            the type of result
+     * @param streamFunction
+     *            The {@link InputStreamFunction} that will process the stream
+     * @throws IOException
+     *             The IO exception.
+     * @return the result of reading the stream.
+     */
+    public <T> T downloadLogs(InputStreamFunction<T> streamFunction) throws IOException {
+        requireNonNull(streamFunction, "Stream function must not be null");
+
+        return root.createRequest().method("GET").withUrlPath(getApiRoute(), "logs").fetchStream(streamFunction);
+    }
+
+    /**
+     * Delete the logs.
+     *
+     * @throws IOException
+     *             the io exception
+     */
+    public void deleteLogs() throws IOException {
+        root.createRequest().method("DELETE").withUrlPath(getApiRoute(), "logs").fetchHttpStatusCode();
+    }
+
+    /**
+     * Returns the list of jobs of this workflow run for the last execution.
+     *
+     * @return list of jobs from the last execution
+     */
+    public PagedIterable<GHWorkflowJob> listJobs() {
+        return new GHWorkflowJobQueryBuilder(this).latest().list();
+    }
+
+    /**
+     * Returns the list of jobs from all the executions of this workflow run.
+     *
+     * @return list of jobs from all the executions
+     */
+    public PagedIterable<GHWorkflowJob> listAllJobs() {
+        return new GHWorkflowJobQueryBuilder(this).all().list();
+    }
+
+    private String getApiRoute() {
+        if (owner == null) {
+            // Workflow runs returned from search to do not have an owner. Attempt to use url.
+            final URL url = Objects.requireNonNull(getUrl(), "Missing instance URL!");
+            return StringUtils.prependIfMissing(url.toString().replace(root.getApiUrl(), ""), "/");
+
+        }
+        return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/actions/runs/" + getId();
+    }
+
+    GHWorkflowRun wrapUp(GHRepository owner) {
+        this.owner = owner;
+        return wrapUp(owner.root);
+    }
+
+    GHWorkflowRun wrapUp(GitHub root) {
+        this.root = root;
+        if (owner != null) {
+            owner.wrap(root);
+            if (pullRequests != null) {
+                for (GHPullRequest singlePull : pullRequests) {
+                    singlePull.wrap(owner);
+                }
+            }
+        } else if (pullRequests != null) {
+            for (GHPullRequest singlePull : pullRequests) {
+                singlePull.wrap(root);
+            }
+        }
+        if (headRepository != null) {
+            headRepository.wrap(root);
+        }
+        return this;
+    }
+
+    public static class HeadCommit {
+        private String id;
+        private String treeId;
+        private String message;
+        private String timestamp;
+        private GitUser author;
+        private GitUser committer;
+
+        /**
+         * Gets id of the commit
+         *
+         * @return id of the commit
+         */
+        public String getId() {
+            return id;
+        }
+
+        /**
+         * Gets id of the tree.
+         *
+         * @return id of the tree
+         */
+        public String getTreeId() {
+            return treeId;
+        }
+
+        /**
+         * Gets message.
+         *
+         * @return commit message.
+         */
+        public String getMessage() {
+            return message;
+        }
+
+        /**
+         * Gets timestamp of the commit.
+         *
+         * @return timestamp of the commit
+         */
+        public Date getTimestamp() {
+            return GitHubClient.parseDate(timestamp);
+        }
+
+        /**
+         * Gets author.
+         *
+         * @return the author
+         */
+        public GitUser getAuthor() {
+            return author;
+        }
+
+        /**
+         * Gets committer.
+         *
+         * @return the committer
+         */
+        public GitUser getCommitter() {
+            return committer;
+        }
+    }
+
+    public static enum Status {
+        QUEUED, IN_PROGRESS, COMPLETED, UNKNOWN;
+
+        public static Status from(String value) {
+            return EnumUtils.getNullableEnumOrDefault(Status.class, value, Status.UNKNOWN);
+        }
+
+        @Override
+        public String toString() {
+            return name().toLowerCase(Locale.ROOT);
+        }
+    }
+
+    public static enum Conclusion {
+        ACTION_REQUIRED, CANCELLED, FAILURE, NEUTRAL, SUCCESS, SKIPPED, STALE, TIMED_OUT, UNKNOWN;
+
+        public static Conclusion from(String value) {
+            return EnumUtils.getNullableEnumOrDefault(Conclusion.class, value, Conclusion.UNKNOWN);
+        }
+
+        @Override
+        public String toString() {
+            return name().toLowerCase(Locale.ROOT);
+        }
+    }
+}

src/main/java/org/kohsuke/github/GHWorkflowRunQueryBuilder.java

@@ -0,0 +1,101 @@
+package org.kohsuke.github;
+
+import org.kohsuke.github.GHWorkflowRun.Status;
+
+import java.net.MalformedURLException;
+
+/**
+ * Lists up workflow runs with some filtering and sorting.
+ *
+ * @author Guillaume Smet
+ * @see GHRepository#queryWorkflowRuns()
+ */
+public class GHWorkflowRunQueryBuilder extends GHQueryBuilder<GHWorkflowRun> {
+    private final GHRepository repo;
+
+    GHWorkflowRunQueryBuilder(GHRepository repo) {
+        super(repo.root);
+        this.repo = repo;
+    }
+
+    /**
+     * Actor workflow run query builder.
+     *
+     * @param actor
+     *            the actor
+     * @return the gh workflow run query builder
+     */
+    public GHWorkflowRunQueryBuilder actor(String actor) {
+        req.with("actor", actor);
+        return this;
+    }
+
+    /**
+     * Actor workflow run query builder.
+     *
+     * @param actor
+     *            the actor
+     * @return the gh workflow run query builder
+     */
+    public GHWorkflowRunQueryBuilder actor(GHUser actor) {
+        req.with("actor", actor.getLogin());
+        return this;
+    }
+
+    /**
+     * Branch workflow run query builder.
+     *
+     * @param branch
+     *            the branch
+     * @return the gh workflow run query builder
+     */
+    public GHWorkflowRunQueryBuilder branch(String branch) {
+        req.with("branch", branch);
+        return this;
+    }
+
+    /**
+     * Event workflow run query builder.
+     *
+     * @param event
+     *            the event
+     * @return the gh workflow run query builder
+     */
+    public GHWorkflowRunQueryBuilder event(GHEvent event) {
+        req.with("event", event.symbol());
+        return this;
+    }
+
+    /**
+     * Event workflow run query builder.
+     *
+     * @param event
+     *            the event
+     * @return the gh workflow run query builder
+     */
+    public GHWorkflowRunQueryBuilder event(String event) {
+        req.with("event", event);
+        return this;
+    }
+
+    /**
+     * Status workflow run query builder.
+     *
+     * @param status
+     *            the status
+     * @return the gh workflow run query builder
+     */
+    public GHWorkflowRunQueryBuilder status(Status status) {
+        req.with("status", status.toString());
+        return this;
+    }
+
+    @Override
+    public PagedIterable<GHWorkflowRun> list() {
+        try {
+            return new GHWorkflowRunsIterable(repo, req.withUrlPath(repo.getApiTailUrl("actions/runs")).build());
+        } catch (MalformedURLException e) {
+            throw new GHException(e.getMessage(), e);
+        }
+    }
+}

src/main/java/org/kohsuke/github/GHWorkflowRunsIterable.java

@@ -0,0 +1,45 @@
+package org.kohsuke.github;
+
+import java.util.Iterator;
+
+import javax.annotation.Nonnull;
+
+/**
+ * Iterable for workflow runs listing.
+ */
+class GHWorkflowRunsIterable extends PagedIterable<GHWorkflowRun> {
+    private final GHRepository owner;
+    private final GitHubRequest request;
+
+    private GHWorkflowRunsPage result;
+
+    public GHWorkflowRunsIterable(GHRepository owner, GitHubRequest request) {
+        this.owner = owner;
+        this.request = request;
+    }
+
+    @Nonnull
+    @Override
+    public PagedIterator<GHWorkflowRun> _iterator(int pageSize) {
+        return new PagedIterator<>(
+                adapt(GitHubPageIterator
+                        .create(owner.getRoot().getClient(), GHWorkflowRunsPage.class, request, pageSize)),
+                null);
+    }
+
+    protected Iterator<GHWorkflowRun[]> adapt(final Iterator<GHWorkflowRunsPage> base) {
+        return new Iterator<GHWorkflowRun[]>() {
+            public boolean hasNext() {
+                return base.hasNext();
+            }
+
+            public GHWorkflowRun[] next() {
+                GHWorkflowRunsPage v = base.next();
+                if (result == null) {
+                    result = v;
+                }
+                return v.getWorkflowRuns(owner);
+            }
+        };
+    }
+}

src/main/java/org/kohsuke/github/GHWorkflowRunsPage.java

@@ -0,0 +1,20 @@
+package org.kohsuke.github;
+
+/**
+ * Represents the one page of workflow runs result when listing workflow runs.
+ */
+class GHWorkflowRunsPage {
+    private int totalCount;
+    private GHWorkflowRun[] workflowRuns;
+
+    public int getTotalCount() {
+        return totalCount;
+    }
+
+    GHWorkflowRun[] getWorkflowRuns(GHRepository owner) {
+        for (GHWorkflowRun workflowRun : workflowRuns) {
+            workflowRun.wrapUp(owner);
+        }
+        return workflowRuns;
+    }
+}

src/main/java/org/kohsuke/github/GHWorkflowsIterable.java

@@ -0,0 +1,53 @@
+package org.kohsuke.github;
+
+import java.net.MalformedURLException;
+import java.util.Iterator;
+
+import javax.annotation.Nonnull;
+
+/**
+ * Iterable for workflows listing.
+ */
+class GHWorkflowsIterable extends PagedIterable<GHWorkflow> {
+    private final transient GHRepository owner;
+
+    private GHWorkflowsPage result;
+
+    public GHWorkflowsIterable(GHRepository owner) {
+        this.owner = owner;
+    }
+
+    @Nonnull
+    @Override
+    public PagedIterator<GHWorkflow> _iterator(int pageSize) {
+        try {
+            GitHubRequest request = owner.getRoot()
+                    .createRequest()
+                    .withUrlPath(owner.getApiTailUrl("actions/workflows"))
+                    .build();
+
+            return new PagedIterator<>(
+                    adapt(GitHubPageIterator
+                            .create(owner.getRoot().getClient(), GHWorkflowsPage.class, request, pageSize)),
+                    null);
+        } catch (MalformedURLException e) {
+            throw new GHException("Malformed URL", e);
+        }
+    }
+
+    protected Iterator<GHWorkflow[]> adapt(final Iterator<GHWorkflowsPage> base) {
+        return new Iterator<GHWorkflow[]>() {
+            public boolean hasNext() {
+                return base.hasNext();
+            }
+
+            public GHWorkflow[] next() {
+                GHWorkflowsPage v = base.next();
+                if (result == null) {
+                    result = v;
+                }
+                return v.getWorkflows(owner);
+            }
+        };
+    }
+}

src/main/java/org/kohsuke/github/GHWorkflowsPage.java

@@ -0,0 +1,20 @@
+package org.kohsuke.github;
+
+/**
+ * Represents the one page of workflow result when listing workflows.
+ */
+class GHWorkflowsPage {
+    private int total_count;
+    private GHWorkflow[] workflows;
+
+    public int getTotalCount() {
+        return total_count;
+    }
+
+    GHWorkflow[] getWorkflows(GHRepository owner) {
+        for (GHWorkflow workflow : workflows) {
+            workflow.wrapUp(owner);
+        }
+        return workflows;
+    }
+}

src/main/java/org/kohsuke/github/GitHub.java

@@ -632,11 +632,28 @@ public class GitHub {
      * @return the repository by id
      * @throws IOException
      *             the io exception
+     *
+     * @deprecated Do not use this method. It was added due to misunderstanding of the type of parameter. Use
+     *             {@link #getRepositoryById(long)} instead
      */
+    @Deprecated
     public GHRepository getRepositoryById(String id) throws IOException {
         return createRequest().withUrlPath("/repositories/" + id).fetch(GHRepository.class).wrap(this);
     }
 
+    /**
+     * Gets the repository object from its ID
+     *
+     * @param id
+     *            the id
+     * @return the repository by id
+     * @throws IOException
+     *             the io exception
+     */
+    public GHRepository getRepositoryById(long id) throws IOException {
+        return createRequest().withUrlPath("/repositories/" + id).fetch(GHRepository.class).wrap(this);
+    }
+
     /**
      * Returns a list of popular open source licenses
      *
@@ -1278,7 +1295,7 @@ public class GitHub {
                         .with(new ByteArrayInputStream(text.getBytes("UTF-8")))
                         .contentType("text/plain;charset=UTF-8")
                         .withUrlPath("/markdown/raw")
-                        .fetchStream(),
+                        .fetchStream(Requester::copyInputStream),
                 "UTF-8");
     }
 

src/main/java/org/kohsuke/github/GitHubInteractiveObject.java

@@ -20,4 +20,8 @@ abstract class GitHubInteractiveObject {
     GitHubInteractiveObject(GitHub root) {
         this.root = root;
     }
+
+    GitHub getRoot() {
+        return root;
+    }
 }

src/main/java/org/kohsuke/github/GitHubResponse.java

@@ -4,6 +4,7 @@ import com.fasterxml.jackson.core.JsonParseException;
 import com.fasterxml.jackson.databind.InjectableValues;
 import com.fasterxml.jackson.databind.JsonMappingException;
 import org.apache.commons.io.IOUtils;
+import org.kohsuke.github.function.FunctionThrows;
 
 import java.io.Closeable;
 import java.io.IOException;
@@ -194,24 +195,11 @@ class GitHubResponse<T> {
     /**
      * Represents a supplier of results that can throw.
      *
-     * <p>
-     * This is a <a href="package-summary.html">functional interface</a> whose functional method is
-     * {@link #apply(ResponseInfo)}.
-     *
      * @param <T>
      *            the type of results supplied by this supplier
      */
     @FunctionalInterface
-    interface BodyHandler<T> {
-
-        /**
-         * Gets a result.
-         *
-         * @return a result
-         * @throws IOException
-         *             if an I/O Exception occurs.
-         */
-        T apply(ResponseInfo input) throws IOException;
+    interface BodyHandler<T> extends FunctionThrows<ResponseInfo, T, IOException> {
     }
 
     /**

src/main/java/org/kohsuke/github/Requester.java

@@ -23,7 +23,9 @@
  */
 package org.kohsuke.github;
 
+import edu.umd.cs.findbugs.annotations.NonNull;
 import org.apache.commons.io.IOUtils;
+import org.kohsuke.github.function.InputStreamFunction;
 
 import java.io.ByteArrayInputStream;
 import java.io.IOException;
@@ -106,15 +108,31 @@ class Requester extends GitHubRequest.Builder<Requester> {
      * Response input stream. There are scenarios where direct stream reading is needed, however it is better to use
      * {@link #fetch(Class)} where possible.
      *
-     * @return the input stream
      * @throws IOException
      *             the io exception
      */
-    public InputStream fetchStream() throws IOException {
-        return client
-                .sendRequest(this,
-                        (responseInfo) -> new ByteArrayInputStream(IOUtils.toByteArray(responseInfo.bodyStream())))
-                .body();
+    public <T> T fetchStream(@Nonnull InputStreamFunction<T> handler) throws IOException {
+        return client.sendRequest(this, (responseInfo) -> handler.apply(responseInfo.bodyStream())).body();
+    }
+
+    /**
+     * Helper function to make it easy to pull streams.
+     *
+     * Copies an input stream to an in-memory input stream. The performance on this is not great but
+     * {@link GitHubResponse.ResponseInfo#bodyStream()} is closed at the end of every call to
+     * {@link GitHubClient#sendRequest(GitHubRequest, GitHubResponse.BodyHandler)}, so any reads to the original input
+     * stream must be completed before then. There are a number of deprecated methods that return {@link InputStream}.
+     * This method keeps all of them using the same code path.
+     *
+     * @param inputStream
+     *            the input stream to be copied
+     * @return an in-memory copy of the passed input stream
+     * @throws IOException
+     *             if an error occurs while copying the stream
+     */
+    @NonNull
+    public static InputStream copyInputStream(InputStream inputStream) throws IOException {
+        return new ByteArrayInputStream(IOUtils.toByteArray(inputStream));
     }
 
     /**

src/main/java/org/kohsuke/github/extras/authorization/JWTTokenProvider.java

@@ -42,11 +42,15 @@ public class JWTTokenProvider implements AuthorizationProvider {
     private final String applicationId;
 
     public JWTTokenProvider(String applicationId, File keyFile) throws GeneralSecurityException, IOException {
-        this(applicationId, loadPrivateKey(keyFile.toPath()));
+        this(applicationId, keyFile.toPath());
     }
 
     public JWTTokenProvider(String applicationId, Path keyPath) throws GeneralSecurityException, IOException {
-        this(applicationId, loadPrivateKey(keyPath));
+        this(applicationId, new String(Files.readAllBytes(keyPath), StandardCharsets.UTF_8));
+    }
+
+    public JWTTokenProvider(String applicationId, String keyString) throws GeneralSecurityException {
+        this(applicationId, getPrivateKeyFromString(keyString));
     }
 
     public JWTTokenProvider(String applicationId, PrivateKey privateKey) {
@@ -64,18 +68,6 @@ public class JWTTokenProvider implements AuthorizationProvider {
         }
     }
 
-    /**
-     * add dependencies for a jwt suite You can generate a key to load in this method with:
-     *
-     * <pre>
-     * openssl pkcs8 -topk8 -inform PEM -outform DER -in ~/github-api-app.private-key.pem -out ~/github-api-app.private-key.der -nocrypt
-     * </pre>
-     */
-    private static PrivateKey loadPrivateKey(Path keyPath) throws GeneralSecurityException, IOException {
-        String keyString = new String(Files.readAllBytes(keyPath), StandardCharsets.UTF_8);
-        return getPrivateKeyFromString(keyString);
-    }
-
     /**
      * Convert a PKCS#8 formatted private key in string format into a java PrivateKey
      *
@@ -111,20 +103,28 @@ public class JWTTokenProvider implements AuthorizationProvider {
     private String refreshJWT() {
         Instant now = Instant.now();
 
-        // Token expires in 10 minutes
-        Instant expiration = Instant.now().plus(Duration.ofMinutes(10));
+        // Max token expiration is 10 minutes for GitHub
+        // We use a smaller window since we likely will not need more than a few seconds
+        Instant expiration = now.plus(Duration.ofMinutes(8));
+
+        // Setting the issued at to a time in the past to allow for clock skew
+        Instant issuedAt = getIssuedAt(now);
 
         // Let's set the JWT Claims
         JwtBuilder builder = Jwts.builder()
-                .setIssuedAt(Date.from(now))
+                .setIssuedAt(Date.from(issuedAt))
                 .setExpiration(Date.from(expiration))
                 .setIssuer(this.applicationId)
                 .signWith(privateKey, SignatureAlgorithm.RS256);
 
-        // Token will refresh after 8 minutes
+        // Token will refresh 2 minutes before it expires
         validUntil = expiration.minus(Duration.ofMinutes(2));
 
         // Builds the JWT and serializes it to a compact, URL-safe string
         return builder.compact();
     }
+
+    Instant getIssuedAt(Instant now) {
+        return now.minus(Duration.ofMinutes(2));
+    }
 }

src/main/java/org/kohsuke/github/function/FunctionThrows.java

@@ -0,0 +1,25 @@
+package org.kohsuke.github.function;
+
+/**
+ * A functional interface, equivalent to {@link java.util.function.Function} but that allows throwing {@link Throwable}
+ *
+ * @param <T>
+ *            the type of input
+ * @param <R>
+ *            the type of output
+ * @param <E>
+ *            the type of error
+ */
+@FunctionalInterface
+public interface FunctionThrows<T, R, E extends Throwable> {
+    /**
+     * Apply r.
+     *
+     * @param input
+     *            the input
+     * @return the r
+     * @throws E
+     *             the e
+     */
+    R apply(T input) throws E;
+}

src/main/java/org/kohsuke/github/function/InputStreamFunction.java

@@ -0,0 +1,14 @@
+package org.kohsuke.github.function;
+
+import java.io.IOException;
+import java.io.InputStream;
+
+/**
+ * A functional interface, equivalent to {@link java.util.function.Function} but that allows throwing {@link Throwable}
+ *
+ * @param <R>
+ *            the type to of object to be returned
+ */
+@FunctionalInterface
+public interface InputStreamFunction<R> extends FunctionThrows<InputStream, R, IOException> {
+}

src/main/java/org/kohsuke/github/internal/EnumUtils.java

@@ -0,0 +1,39 @@
+package org.kohsuke.github.internal;
+
+import java.util.Locale;
+
+/**
+ * Utils for Enums.
+ */
+public final class EnumUtils {
+
+    /**
+     * Returns an enum value matching the value if found, null if the value is null and {@code defaultEnum} if the value
+     * cannot be matched to a value of the enum.
+     * <p>
+     * The value is converted to uppercase before being matched to the enum values.
+     *
+     * @param <E>
+     *            the type of the enum
+     * @param enumClass
+     *            the type of the enum
+     * @param value
+     *            the value to interpret
+     * @param defaultEnum
+     *            the default enum value if the value doesn't match one of the enum value
+     * @return an enum value or null
+     */
+    public static <E extends Enum<E>> E getNullableEnumOrDefault(Class<E> enumClass, String value, E defaultEnum) {
+        if (value == null) {
+            return null;
+        }
+        try {
+            return Enum.valueOf(enumClass, value.toUpperCase(Locale.ROOT));
+        } catch (IllegalArgumentException e) {
+            return defaultEnum;
+        }
+    }
+
+    private EnumUtils() {
+    }
+}

src/test/java/org/kohsuke/github/AbstractGHAppInstallationTest.java

@@ -7,6 +7,8 @@ import org.kohsuke.github.extras.authorization.JWTTokenProvider;
 
 import java.io.File;
 import java.io.IOException;
+import java.nio.charset.StandardCharsets;
+import java.nio.file.Files;
 import java.security.GeneralSecurityException;
 import java.security.KeyFactory;
 import java.security.PrivateKey;
@@ -34,9 +36,12 @@ public class AbstractGHAppInstallationTest extends AbstractGitHubWireMockTest {
             JWT_PROVIDER_1 = new JWTTokenProvider(TEST_APP_ID_1,
                     new File(this.getClass().getResource(PRIVATE_KEY_FILE_APP_1).getFile()));
             JWT_PROVIDER_2 = new JWTTokenProvider(TEST_APP_ID_2,
-                    new File(this.getClass().getResource(PRIVATE_KEY_FILE_APP_2).getFile()));
+                    new File(this.getClass().getResource(PRIVATE_KEY_FILE_APP_2).getFile()).toPath());
             JWT_PROVIDER_3 = new JWTTokenProvider(TEST_APP_ID_3,
-                    new File(this.getClass().getResource(PRIVATE_KEY_FILE_APP_3).getFile()));
+                    new String(
+                            Files.readAllBytes(
+                                    new File(this.getClass().getResource(PRIVATE_KEY_FILE_APP_3).getFile()).toPath()),
+                            StandardCharsets.UTF_8));
         } catch (GeneralSecurityException | IOException e) {
             throw new RuntimeException("These should never fail", e);
         }
@@ -75,10 +80,11 @@ public class AbstractGHAppInstallationTest extends AbstractGitHubWireMockTest {
                 .findFirst()
                 .get();
 
-        appInstallation
-                .setRoot(getGitHubBuilder().withAppInstallationToken(appInstallation.createToken().create().getToken())
-                        .withEndpoint(mockGitHub.apiServer().baseUrl())
-                        .build());
+        // TODO: this is odd
+        // appInstallation
+        // .setRoot(getGitHubBuilder().withAppInstallationToken(appInstallation.createToken().create().getToken())
+        // .withEndpoint(mockGitHub.apiServer().baseUrl())
+        // .build());
 
         return appInstallation;
     }

src/test/java/org/kohsuke/github/AppTest.java

@@ -19,10 +19,7 @@ import java.util.*;
 import java.util.Map.Entry;
 import java.util.regex.Pattern;
 
-import static org.hamcrest.CoreMatchers.*;
-import static org.hamcrest.CoreMatchers.sameInstance;
-import static org.hamcrest.Matchers.hasProperty;
-import static org.hamcrest.Matchers.oneOf;
+import static org.hamcrest.Matchers.*;
 
 /**
  * Unit test for simple App.
@@ -37,10 +34,11 @@ public class AppTest extends AbstractGitHubWireMockTest {
         cleanupUserRepository("github-api-test-rename");
         cleanupUserRepository(targetName);
 
-        GHRepository r = gitHub.createRepository("github-api-test-rename",
-                "a test repository",
-                "http://github-api.kohsuke.org/",
-                true);
+        GHRepository r = gitHub.createRepository("github-api-test-rename")
+                .description("a test repository")
+                .homepage("http://github-api.kohsuke.org/")
+                .private_(false)
+                .create();
 
         assertThat(r.hasIssues(), is(true));
         assertThat(r.hasWiki(), is(true));
@@ -137,13 +135,36 @@ public class AppTest extends AbstractGitHubWireMockTest {
     @Test
     public void testIssueWithNoComment() throws IOException {
         GHRepository repository = gitHub.getRepository("kohsuke/test");
-        List<GHIssueComment> v = repository.getIssue(4).getComments();
+        GHIssue i = repository.getIssue(4);
+        List<GHIssueComment> v = i.getComments();
         // System.out.println(v);
         assertTrue(v.isEmpty());
 
-        v = repository.getIssue(3).getComments();
+        i = repository.getIssue(3);
+        v = i.getComments();
         // System.out.println(v);
-        assertTrue(v.size() == 3);
+        assertThat(v.size(), equalTo(3));
+        assertThat(v.get(0).getHtmlUrl().toString(),
+                equalTo("https://github.com/kohsuke/test/issues/3#issuecomment-8547249"));
+        assertThat(v.get(0).getUrl().toString(), endsWith("/repos/kohsuke/test/issues/comments/8547249"));
+        assertThat(v.get(0).getNodeId(), equalTo("MDEyOklzc3VlQ29tbWVudDg1NDcyNDk="));
+        assertThat(v.get(0).getParent().getNumber(), equalTo(3));
+        assertThat(v.get(0).getParent().getId(), equalTo(6863845L));
+        assertThat(v.get(0).getUser().getLogin(), equalTo("kohsuke"));
+        assertThat(v.get(0).listReactions().toList().size(), equalTo(0));
+
+        assertThat(v.get(1).getHtmlUrl().toString(),
+                equalTo("https://github.com/kohsuke/test/issues/3#issuecomment-8547251"));
+        assertThat(v.get(1).getUrl().toString(), endsWith("/repos/kohsuke/test/issues/comments/8547251"));
+        assertThat(v.get(1).getNodeId(), equalTo("MDEyOklzc3VlQ29tbWVudDg1NDcyNTE="));
+        assertThat(v.get(1).getParent().getNumber(), equalTo(3));
+        assertThat(v.get(1).getUser().getLogin(), equalTo("kohsuke"));
+        List<GHReaction> reactions = v.get(1).listReactions().toList();
+        assertThat(reactions.size(), equalTo(3));
+
+        // TODO: Add comment CRUD test
+        // TODO: Add reactions CRUD test
+
     }
 
     @Test
@@ -165,49 +186,60 @@ public class AppTest extends AbstractGitHubWireMockTest {
     @Test
     public void testCreateAndListDeployments() throws IOException {
         GHRepository repository = getTestRepository();
-        GHDeployment deployment = repository.createDeployment("master")
+        GHDeployment deployment = repository.createDeployment("main")
                 .payload("{\"user\":\"atmos\",\"room_id\":123456}")
                 .description("question")
                 .environment("unittest")
                 .create();
-        assertNotNull(deployment.getCreator());
-        assertNotNull(deployment.getId());
-        List<GHDeployment> deployments = repository.listDeployments(null, "master", null, "unittest").toList();
-        assertNotNull(deployments);
-        assertFalse(Iterables.isEmpty(deployments));
-        GHDeployment unitTestDeployment = deployments.get(0);
-        assertEquals("unittest", unitTestDeployment.getEnvironment());
-        assertEquals("unittest", unitTestDeployment.getOriginalEnvironment());
-        assertEquals(false, unitTestDeployment.isProductionEnvironment());
-        assertEquals(true, unitTestDeployment.isTransientEnvironment());
-        assertEquals("master", unitTestDeployment.getRef());
+        try {
+            assertNotNull(deployment.getCreator());
+            assertNotNull(deployment.getId());
+            List<GHDeployment> deployments = repository.listDeployments(null, "main", null, "unittest").toList();
+            assertNotNull(deployments);
+            assertFalse(Iterables.isEmpty(deployments));
+            GHDeployment unitTestDeployment = deployments.get(0);
+            assertEquals("unittest", unitTestDeployment.getEnvironment());
+            assertEquals("unittest", unitTestDeployment.getOriginalEnvironment());
+            assertEquals(false, unitTestDeployment.isProductionEnvironment());
+            assertEquals(false, unitTestDeployment.isTransientEnvironment());
+            assertEquals("main", unitTestDeployment.getRef());
+        } finally {
+            // deployment.delete();
+            assert true;
+        }
     }
 
-    @Ignore("Needs mocking check")
     @Test
     public void testGetDeploymentStatuses() throws IOException {
         GHRepository repository = getTestRepository();
-        GHDeployment deployment = repository.createDeployment("master")
+        GHDeployment deployment = repository.createDeployment("main")
                 .description("question")
                 .payload("{\"user\":\"atmos\",\"room_id\":123456}")
                 .create();
-        GHDeploymentStatus ghDeploymentStatus = deployment.createStatus(GHDeploymentState.QUEUED)
-                .description("success")
-                .targetUrl("http://www.github.com")
-                .logUrl("http://www.github.com/logurl")
-                .environmentUrl("http://www.github.com/envurl")
-                .environment("new-ci-env")
-                .create();
-        Iterable<GHDeploymentStatus> deploymentStatuses = deployment.listStatuses();
-        assertNotNull(deploymentStatuses);
-        assertEquals(1, Iterables.size(deploymentStatuses));
-        GHDeploymentStatus actualStatus = Iterables.get(deploymentStatuses, 0);
-        assertEquals(ghDeploymentStatus.getId(), actualStatus.getId());
-        assertEquals(ghDeploymentStatus.getState(), actualStatus.getState());
-        assertEquals(ghDeploymentStatus.getLogUrl(), actualStatus.getLogUrl());
-        // Target url was deprecated and replaced with log url. The gh api will
-        // prefer the log url value and return it in place of target url.
-        assertEquals(ghDeploymentStatus.getTargetUrl(), actualStatus.getLogUrl());
+        try {
+            GHDeploymentStatus ghDeploymentStatus = deployment.createStatus(GHDeploymentState.QUEUED)
+                    .description("success")
+                    .targetUrl("http://www.github.com")
+                    .logUrl("http://www.github.com/logurl")
+                    .environmentUrl("http://www.github.com/envurl")
+                    .environment("new-ci-env")
+                    .create();
+            Iterable<GHDeploymentStatus> deploymentStatuses = deployment.listStatuses();
+            assertNotNull(deploymentStatuses);
+            assertEquals(1, Iterables.size(deploymentStatuses));
+            GHDeploymentStatus actualStatus = Iterables.get(deploymentStatuses, 0);
+            assertEquals(ghDeploymentStatus.getId(), actualStatus.getId());
+            assertEquals(ghDeploymentStatus.getState(), actualStatus.getState());
+            assertEquals(ghDeploymentStatus.getLogUrl(), actualStatus.getLogUrl());
+            // Target url was deprecated and replaced with log url. The gh api will
+            // prefer the log url value and return it in place of target url.
+            assertEquals(ghDeploymentStatus.getTargetUrl(), actualStatus.getLogUrl());
+            assertThat(ghDeploymentStatus.getDeploymentUrl(), equalTo(deployment.getUrl()));
+            assertThat(ghDeploymentStatus.getRepositoryUrl(), equalTo(repository.getUrl()));
+        } finally {
+            // deployment.delete();
+            assert true;
+        }
     }
 
     @Test
@@ -324,7 +356,7 @@ public class AppTest extends AbstractGitHubWireMockTest {
         assertEquals(teamByName.getId(), teamById.getId());
         assertEquals(teamByName.getDescription(), teamById.getDescription());
 
-        GHTeam teamById2 = organization.getTeam((int) teamByName.getId());
+        GHTeam teamById2 = organization.getTeam(teamByName.getId());
         assertNotNull(teamById2);
 
         assertEquals(teamByName.getId(), teamById2.getId());
@@ -445,6 +477,16 @@ public class AppTest extends AbstractGitHubWireMockTest {
 
         File f = commit.getFiles().get(0);
         assertEquals(48, f.getLinesChanged());
+        assertThat(f.getLinesAdded(), equalTo(40));
+        assertThat(f.getLinesDeleted(), equalTo(8));
+        assertThat(f.getPreviousFilename(), nullValue());
+        assertThat(f.getPatch(), startsWith("@@ -54,6 +54,14 @@\n"));
+        assertThat(f.getSha(), equalTo("04d3e54017542ad0ff46355eababacd4850ccba5"));
+        assertThat(f.getBlobUrl().toString(),
+                equalTo("https://github.com/jenkinsci/jenkins/blob/08c1c9970af4d609ae754fbe803e06186e3206f7/changelog.html"));
+        assertThat(f.getRawUrl().toString(),
+                equalTo("https://github.com/jenkinsci/jenkins/raw/08c1c9970af4d609ae754fbe803e06186e3206f7/changelog.html"));
+
         assertEquals("modified", f.getStatus());
         assertEquals("changelog.html", f.getFileName());
 
@@ -464,22 +506,6 @@ public class AppTest extends AbstractGitHubWireMockTest {
         assertEquals(1, sha1.size());
     }
 
-    public void testQueryCommits() throws Exception {
-        List<String> sha1 = new ArrayList<String>();
-        for (GHCommit c : gitHub.getUser("jenkinsci")
-                .getRepository("jenkins")
-                .queryCommits()
-                .since(new Date(1199174400000L))
-                .until(1201852800000L)
-                .path("pom.xml")
-                .list()) {
-            // System.out.println(c.getSHA1());
-            sha1.add(c.getSHA1());
-        }
-        assertEquals("1cccddb22e305397151b2b7b87b4b47d74ca337b", sha1.get(0));
-        assertEquals(29, sha1.size());
-    }
-
     @Ignore("Needs mocking check")
     @Test
     public void testBranches() throws Exception {
@@ -504,23 +530,65 @@ public class AppTest extends AbstractGitHubWireMockTest {
                 .getRepository("sandbox-ant")
                 .getCommit("8ae38db0ea5837313ab5f39d43a6f73de3bd9000");
         GHCommitComment c = commit.createComment("[testing](http://kohsuse.org/)");
-        // System.out.println(c);
-        c.update("updated text");
-        // System.out.println(c);
-        c.delete();
+        try {
+            assertThat(c.getPath(), nullValue());
+            assertThat(c.getLine(), equalTo(-1));
+            assertThat(c.getHtmlUrl().toString(),
+                    containsString(
+                            "kohsuke/sandbox-ant/commit/8ae38db0ea5837313ab5f39d43a6f73de3bd9000#commitcomment-"));
+            assertThat(c.listReactions().toList(), is(empty()));
+
+            c.update("updated text");
+            assertThat(c.getBody(), equalTo("updated text"));
+        } finally {
+            c.delete();
+        }
     }
 
     @Test
     public void tryHook() throws Exception {
-        kohsuke();
-        GHRepository r = gitHub.getOrganization(GITHUB_API_TEST_ORG).getRepository("github-api");
-        GHHook hook = r.createWebHook(new URL("http://www.google.com/"));
-        // System.out.println(hook);
+        GHOrganization o = gitHub.getOrganization(GITHUB_API_TEST_ORG);
+        GHRepository r = o.getRepository("github-api");
+        try {
+            GHHook hook = r.createWebHook(new URL("http://www.google.com/"));
+            assertThat(hook.getName(), equalTo("web"));
+            assertThat(hook.getEvents().size(), equalTo(1));
+            assertThat(hook.getEvents(), contains(GHEvent.PUSH));
+            assertThat(hook.getConfig().size(), equalTo(3));
+            assertThat(hook.isActive(), equalTo(true));
 
-        if (mockGitHub.isUseProxy()) {
-            r = getGitHubBeforeAfter().getOrganization(GITHUB_API_TEST_ORG).getRepository("github-api");
-            for (GHHook h : r.getHooks()) {
-                h.delete();
+            GHHook hook2 = r.getHook((int) hook.getId());
+            assertThat(hook2.getName(), equalTo("web"));
+            assertThat(hook2.getEvents().size(), equalTo(1));
+            assertThat(hook2.getEvents(), contains(GHEvent.PUSH));
+            assertThat(hook2.getConfig().size(), equalTo(3));
+            assertThat(hook2.isActive(), equalTo(true));
+            hook2.ping();
+            hook2.delete();
+
+            hook = o.createWebHook(new URL("http://www.google.com/"));
+            assertThat(hook.getName(), equalTo("web"));
+            assertThat(hook.getEvents().size(), equalTo(1));
+            assertThat(hook.getEvents(), contains(GHEvent.PUSH));
+            assertThat(hook.getConfig().size(), equalTo(3));
+            assertThat(hook.isActive(), equalTo(true));
+
+            hook2 = o.getHook((int) hook.getId());
+            assertThat(hook2.getName(), equalTo("web"));
+            assertThat(hook2.getEvents().size(), equalTo(1));
+            assertThat(hook2.getEvents(), contains(GHEvent.PUSH));
+            assertThat(hook2.getConfig().size(), equalTo(3));
+            assertThat(hook2.isActive(), equalTo(true));
+            hook2.ping();
+            hook2.delete();
+
+            // System.out.println(hook);
+        } finally {
+            if (mockGitHub.isUseProxy()) {
+                r = getGitHubBeforeAfter().getOrganization(GITHUB_API_TEST_ORG).getRepository("github-api");
+                for (GHHook h : r.getHooks()) {
+                    h.delete();
+                }
             }
         }
     }
@@ -529,6 +597,14 @@ public class AppTest extends AbstractGitHubWireMockTest {
     public void testEventApi() throws Exception {
         for (GHEventInfo ev : gitHub.getEvents()) {
             if (ev.getType() == GHEvent.PULL_REQUEST) {
+                if (ev.getId() == 10680625394L) {
+                    assertThat(ev.getActorLogin(), equalTo("pull[bot]"));
+                    assertThat(ev.getOrganization(), nullValue());
+                    assertThat(ev.getRepository().getFullName(), equalTo("daddyfatstacksBIG/lerna"));
+                    assertThat(ev.getCreatedAt(), equalTo(GitHubClient.parseDate("2019-10-21T21:54:52Z")));
+                    assertThat(ev.getType(), equalTo(GHEvent.PULL_REQUEST));
+                }
+
                 GHEventPayload.PullRequest pr = ev.getPayload(GHEventPayload.PullRequest.class);
                 assertThat(pr.getNumber(), is(pr.getPullRequest().getNumber()));
             }
@@ -859,8 +935,18 @@ public class AppTest extends AbstractGitHubWireMockTest {
         for (GHTreeEntry e : masterTree.getTree()) {
             if (e.getPath().endsWith(AppTest.class.getSimpleName() + ".java")) {
                 foundThisFile = true;
+                assertThat(e.getPath(), equalTo("src/test/java/org/kohsuke/github/AppTest.java"));
+                assertThat(e.getSha(), equalTo("baad7a7c4cf409f610a0e8c7eba17664eb655c44"));
+                assertThat(e.getMode(), equalTo("100755"));
+                assertThat(e.getSize(), greaterThan(30000L));
+                assertThat(e.getUrl().toString(),
+                        containsString("/repos/hub4j/github-api/git/blobs/baad7a7c4cf409f610a0e8c7eba17664eb655c44"));
+                GHBlob blob = e.asBlob();
+                assertThat(e.asBlob().getUrl().toString(),
+                        containsString("/repos/hub4j/github-api/git/blobs/baad7a7c4cf409f610a0e8c7eba17664eb655c44"));
                 break;
             }
+
         }
         assertTrue(foundThisFile);
     }
@@ -879,6 +965,9 @@ public class AppTest extends AbstractGitHubWireMockTest {
         GHLabel e = r.getLabel("enhancement");
         assertEquals("enhancement", e.getName());
         assertNotNull(e.getUrl());
+        assertEquals(177339106, e.getId());
+        assertEquals("MDU6TGFiZWwxNzczMzkxMDY=", e.getNodeId());
+        assertTrue(e.isDefault());
         assertTrue(Pattern.matches("[0-9a-fA-F]{6}", e.getColor()));
 
         GHLabel t = null;
@@ -890,12 +979,17 @@ public class AppTest extends AbstractGitHubWireMockTest {
             assertThat(t, not(sameInstance(t2)));
             assertThat(t, equalTo(t2));
 
+            assertFalse(t2.isDefault());
+
+            assertEquals(t.getId(), t2.getId());
+            assertEquals(t.getNodeId(), t2.getNodeId());
             assertEquals(t.getName(), t2.getName());
             assertEquals(t.getColor(), "123456");
             assertEquals(t.getColor(), t2.getColor());
             assertEquals(t.getDescription(), "");
             assertEquals(t.getDescription(), t2.getDescription());
             assertEquals(t.getUrl(), t2.getUrl());
+            assertEquals(t.isDefault(), t2.isDefault());
 
             // update works on multiple changes in one call
             t3 = t.update().color("000000").description("It is dark!").done();

src/test/java/org/kohsuke/github/BridgeMethodTest.java

@@ -33,6 +33,7 @@ public class BridgeMethodTest extends Assert {
         verifyBridgeMethods(GHIssue.class, "getCreatedAt", Date.class, String.class);
         verifyBridgeMethods(GHIssue.class, "getId", int.class, long.class, String.class);
         verifyBridgeMethods(GHIssue.class, "getUrl", String.class, URL.class);
+        verifyBridgeMethods(GHIssue.class, "comment", 1, void.class, GHIssueComment.class);
 
         verifyBridgeMethods(GHOrganization.class, "getHtmlUrl", String.class, URL.class);
         verifyBridgeMethods(GHOrganization.class, "getId", int.class, long.class, String.class);
@@ -55,12 +56,17 @@ public class BridgeMethodTest extends Assert {
     }
 
     void verifyBridgeMethods(@Nonnull Class<?> targetClass, @Nonnull String methodName, Class<?>... returnTypes) {
+        verifyBridgeMethods(targetClass, methodName, 0, returnTypes);
+    }
+
+    void verifyBridgeMethods(@Nonnull Class<?> targetClass,
+            @Nonnull String methodName,
+            int parameterCount,
+            Class<?>... returnTypes) {
         List<Class<?>> foundMethods = new ArrayList<>();
         Method[] methods = targetClass.getMethods();
         for (Method method : methods) {
-            if (method.getName().equalsIgnoreCase(methodName)) {
-                // Bridge methods are only
-                assertThat(method.getParameterCount(), equalTo(0));
+            if (method.getName().equalsIgnoreCase(methodName) && method.getParameterCount() == parameterCount) {
                 foundMethods.add(method.getReturnType());
             }
         }

src/test/java/org/kohsuke/github/CommitTest.java

@@ -4,7 +4,9 @@ import com.google.common.collect.Iterables;
 import org.junit.Test;
 
 import java.io.IOException;
+import java.util.ArrayList;
 import java.util.Arrays;
+import java.util.Date;
 import java.util.List;
 
 import static org.hamcrest.Matchers.equalTo;
@@ -29,6 +31,85 @@ public class CommitTest extends AbstractGitHubWireMockTest {
         }
     }
 
+    @Test
+    public void testQueryCommits() throws Exception {
+        List<String> sha1 = new ArrayList<String>();
+        List<GHCommit> commits = gitHub.getUser("jenkinsci")
+                .getRepository("jenkins")
+                .queryCommits()
+                .since(1199174400000L)
+                .until(1201852800000L)
+                .path("pom.xml")
+                .pageSize(100)
+                .list()
+                .toList();
+
+        assertThat(commits.get(0).getSHA1(), equalTo("1cccddb22e305397151b2b7b87b4b47d74ca337b"));
+        assertThat(commits.size(), equalTo(29));
+
+        commits = gitHub.getUser("jenkinsci")
+                .getRepository("jenkins")
+                .queryCommits()
+                .since(new Date(1199174400000L))
+                .until(new Date(1201852800000L))
+                .path("pom.xml")
+                .pageSize(100)
+                .list()
+                .toList();
+
+        assertThat(commits.get(0).getSHA1(), equalTo("1cccddb22e305397151b2b7b87b4b47d74ca337b"));
+        assertThat(commits.get(15).getSHA1(), equalTo("a5259970acaec9813e2a12a91f37dfc7871a5ef5"));
+        assertThat(commits.size(), equalTo(29));
+
+        commits = gitHub.getUser("jenkinsci")
+                .getRepository("jenkins")
+                .queryCommits()
+                .since(new Date(1199174400000L))
+                .until(new Date(1201852800000L))
+                .path("pom.xml")
+                .from("a5259970acaec9813e2a12a91f37dfc7871a5ef5")
+                .list()
+                .toList();
+
+        assertThat(commits.get(0).getSHA1(), equalTo("a5259970acaec9813e2a12a91f37dfc7871a5ef5"));
+        assertThat(commits.size(), equalTo(14));
+
+        commits = gitHub.getUser("jenkinsci")
+                .getRepository("jenkins")
+                .queryCommits()
+                .until(new Date(1201852800000L))
+                .path("pom.xml")
+                .author("kohsuke")
+                .list()
+                .toList();
+
+        assertThat(commits.size(), equalTo(0));
+
+        commits = gitHub.getUser("jenkinsci")
+                .getRepository("jenkins")
+                .queryCommits()
+                .until(new Date(1201852800000L))
+                .path("pom.xml")
+                .pageSize(100)
+                .author("kohsuke@71c3de6d-444a-0410-be80-ed276b4c234a")
+                .list()
+                .toList();
+
+        assertThat(commits.size(), equalTo(266));
+
+        commits = gitHub.getUser("jenkinsci")
+                .getRepository("jenkins")
+                .queryCommits()
+                .path("pom.xml")
+                .pageSize(100)
+                .author("kohsuke@71c3de6d-444a-0410-be80-ed276b4c234a")
+                .list()
+                .toList();
+
+        assertThat(commits.size(), equalTo(648));
+
+    }
+
     @Test
     public void listPullRequestsOfNotIncludedCommit() throws Exception {
         GHRepository repo = gitHub.getOrganization("hub4j-test-org").getRepository("listPrsListHeads");

src/test/java/org/kohsuke/github/EnumTest.java

@@ -0,0 +1,85 @@
+package org.kohsuke.github;
+
+import org.junit.Test;
+
+import static org.hamcrest.CoreMatchers.*;
+
+/**
+ * Unit test for {@link GitHub} static helpers.
+ *
+ * @author Liam Newman
+ */
+public class EnumTest extends AbstractGitHubWireMockTest {
+
+    @Test
+    public void touchEnums() {
+        assertThat(GHCheckRun.AnnotationLevel.values().length, equalTo(3));
+        assertThat(GHCheckRun.Conclusion.values().length, equalTo(9));
+        assertThat(GHCheckRun.Status.values().length, equalTo(4));
+
+        assertThat(GHCommentAuthorAssociation.values().length, equalTo(7));
+
+        assertThat(GHCommitState.values().length, equalTo(4));
+
+        assertThat(GHCompare.Status.values().length, equalTo(4));
+
+        assertThat(GHDeploymentState.values().length, equalTo(7));
+
+        assertThat(GHDirection.values().length, equalTo(2));
+
+        assertThat(GHEvent.values().length, equalTo(56));
+        assertThat(GHEvent.ALL.symbol(), equalTo("*"));
+        assertThat(GHEvent.PULL_REQUEST.symbol(), equalTo(GHEvent.PULL_REQUEST.toString().toLowerCase()));
+
+        assertThat(GHIssueSearchBuilder.Sort.values().length, equalTo(3));
+
+        assertThat(GHIssueState.values().length, equalTo(3));
+
+        assertThat(GHMarketplaceAccountType.values().length, equalTo(2));
+
+        assertThat(GHMarketplaceListAccountBuilder.Sort.values().length, equalTo(2));
+
+        assertThat(GHMarketplacePriceModel.values().length, equalTo(3));
+
+        assertThat(GHMembership.Role.values().length, equalTo(2));
+
+        assertThat(GHMilestoneState.values().length, equalTo(2));
+
+        assertThat(GHMyself.RepositoryListFilter.values().length, equalTo(5));
+
+        assertThat(GHOrganization.Role.values().length, equalTo(2));
+        assertThat(GHOrganization.Permission.values().length, equalTo(5));
+
+        assertThat(GHPermissionType.values().length, equalTo(4));
+
+        assertThat(GHProject.ProjectState.values().length, equalTo(2));
+        assertThat(GHProject.ProjectStateFilter.values().length, equalTo(3));
+
+        assertThat(GHPullRequest.MergeMethod.values().length, equalTo(3));
+
+        assertThat(GHPullRequestQueryBuilder.Sort.values().length, equalTo(4));
+
+        assertThat(GHPullRequestReviewEvent.values().length, equalTo(4));
+        assertThat(GHPullRequestReviewEvent.PENDING.toState(), equalTo(GHPullRequestReviewState.PENDING));
+        assertThat(GHPullRequestReviewEvent.PENDING.action(), nullValue());
+
+        assertThat(GHPullRequestReviewState.values().length, equalTo(6));
+        assertThat(GHPullRequestReviewState.PENDING.toEvent(), equalTo(GHPullRequestReviewEvent.PENDING));
+        assertThat(GHPullRequestReviewState.APPROVED.action(), equalTo(GHPullRequestReviewEvent.APPROVE.action()));
+        assertThat(GHPullRequestReviewState.DISMISSED.toEvent(), nullValue());
+
+        assertThat(GHRepository.CollaboratorAffiliation.values().length, equalTo(3));
+        assertThat(GHRepository.ForkSort.values().length, equalTo(3));
+        assertThat(GHRepository.Visibility.values().length, equalTo(4));
+
+        assertThat(GHRepositorySearchBuilder.Sort.values().length, equalTo(3));
+
+        assertThat(GHRepositorySelection.values().length, equalTo(2));
+
+        assertThat(GHTeam.Role.values().length, equalTo(2));
+        assertThat(GHTeam.Privacy.values().length, equalTo(2));
+
+        assertThat(GHUserSearchBuilder.Sort.values().length, equalTo(3));
+    }
+
+}

src/test/java/org/kohsuke/github/GHAppTest.java

@@ -103,7 +103,8 @@ public class GHAppTest extends AbstractGitHubWireMockTest {
         permissions.put("metadata", GHPermissionType.READ);
 
         // Create token specifying both permissions and repository ids
-        GHAppInstallationToken installationToken = installation.createToken(permissions)
+        GHAppInstallationToken installationToken = installation.createToken()
+                .permissions(permissions)
                 .repositoryIds(Collections.singletonList((long) 111111111))
                 .create();
 

src/test/java/org/kohsuke/github/GHCheckRunBuilderTest.java

@@ -25,11 +25,13 @@
 package org.kohsuke.github;
 
 import org.junit.Test;
+import org.kohsuke.github.GHCheckRun.Status;
 
 import java.io.IOException;
 import java.util.Date;
 
 import static org.hamcrest.Matchers.containsString;
+import static org.hamcrest.Matchers.equalTo;
 
 @SuppressWarnings("deprecation") // preview
 public class GHCheckRunBuilderTest extends AbstractGHAppInstallationTest {
@@ -48,7 +50,7 @@ public class GHCheckRunBuilderTest extends AbstractGHAppInstallationTest {
                 .withExternalID("whatever")
                 .withStartedAt(new Date(999_999_000))
                 .withCompletedAt(new Date(999_999_999))
-                .add(new GHCheckRunBuilder.Output("Some Title", "what happened…")
+                .add(new GHCheckRunBuilder.Output("Some Title", "what happened…").withText("Hello Text!")
                         .add(new GHCheckRunBuilder.Annotation("stuff.txt",
                                 1,
                                 GHCheckRun.AnnotationLevel.NOTICE,
@@ -58,14 +60,17 @@ public class GHCheckRunBuilderTest extends AbstractGHAppInstallationTest {
                                         .withCaption("Princess Unikitty")))
                 .add(new GHCheckRunBuilder.Action("Help", "what I need help with", "doit"))
                 .create();
-        assertEquals("completed", checkRun.getStatus());
+        assertEquals(Status.COMPLETED, checkRun.getStatus());
         assertEquals(1, checkRun.getOutput().getAnnotationsCount());
         assertEquals(1424883286, checkRun.getId());
+        assertEquals("Hello Text!", checkRun.getOutput().getText());
     }
 
     @Test
     public void createCheckRunManyAnnotations() throws Exception {
-        GHCheckRunBuilder.Output output = new GHCheckRunBuilder.Output("Big Run", "Lots of stuff here »");
+        GHCheckRunBuilder.Output output = new GHCheckRunBuilder.Output("Big Run", "Lots of stuff here »")
+                .withText("Hello Text!");
+
         for (int i = 0; i < 101; i++) {
             output.add(
                     new GHCheckRunBuilder.Annotation("stuff.txt", 1, GHCheckRun.AnnotationLevel.NOTICE, "hello #" + i));
@@ -75,10 +80,11 @@ public class GHCheckRunBuilderTest extends AbstractGHAppInstallationTest {
                 .withConclusion(GHCheckRun.Conclusion.SUCCESS)
                 .add(output)
                 .create();
-        assertEquals("completed", checkRun.getStatus());
+        assertEquals(Status.COMPLETED, checkRun.getStatus());
         assertEquals("Big Run", checkRun.getOutput().getTitle());
         assertEquals("Lots of stuff here »", checkRun.getOutput().getSummary());
         assertEquals(101, checkRun.getOutput().getAnnotationsCount());
+        assertEquals("Hello Text!", checkRun.getOutput().getText());
         assertEquals(1424883599, checkRun.getId());
     }
 
@@ -89,7 +95,7 @@ public class GHCheckRunBuilderTest extends AbstractGHAppInstallationTest {
                 .withConclusion(GHCheckRun.Conclusion.NEUTRAL)
                 .add(new GHCheckRunBuilder.Output("Quick note", "nothing more to see here"))
                 .create();
-        assertEquals("completed", checkRun.getStatus());
+        assertEquals(Status.COMPLETED, checkRun.getStatus());
         assertEquals(0, checkRun.getOutput().getAnnotationsCount());
         assertEquals(1424883957, checkRun.getId());
     }
@@ -100,7 +106,7 @@ public class GHCheckRunBuilderTest extends AbstractGHAppInstallationTest {
                 .createCheckRun("outstanding", "89a9ae301e35e667756034fdc933b1fc94f63fc1")
                 .withStatus(GHCheckRun.Status.IN_PROGRESS)
                 .create();
-        assertEquals("in_progress", checkRun.getStatus());
+        assertEquals(Status.IN_PROGRESS, checkRun.getStatus());
         assertNull(checkRun.getConclusion());
         assertEquals(1424883451, checkRun.getId());
     }
@@ -116,6 +122,8 @@ public class GHCheckRunBuilderTest extends AbstractGHAppInstallationTest {
         } catch (HttpException x) {
             assertEquals(422, x.getResponseCode());
             assertThat(x.getMessage(), containsString("\\\"conclusion\\\" wasn't supplied"));
+            assertThat(x.getUrl(), containsString("/repos/hub4j-test-org/test-checks/check-runs"));
+            assertThat(x.getResponseMessage(), equalTo("422 Unprocessable Entity"));
         }
     }
 

src/test/java/org/kohsuke/github/GHContentIntegrationTest.java

@@ -45,6 +45,14 @@ public class GHContentIntegrationTest extends AbstractGitHubWireMockTest {
         repo = gitHub.getRepository("hub4j-test-org/GHContentIntegrationTest");
     }
 
+    @Test
+    public void testGetRepository() throws Exception {
+        GHRepository testRepo = gitHub.getRepositoryById(repo.getId());
+        assertThat(testRepo.getName(), equalTo(repo.getName()));
+        testRepo = gitHub.getRepositoryById(Long.toString(repo.getId()));
+        assertThat(testRepo.getName(), equalTo(repo.getName()));
+    }
+
     @Test
     public void testGetFileContent() throws Exception {
         repo = gitHub.getRepository("hub4j-test-org/GHContentIntegrationTest");

src/test/java/org/kohsuke/github/GHEventPayloadTest.java

@@ -2,14 +2,26 @@ package org.kohsuke.github;
 
 import org.junit.Rule;
 import org.junit.Test;
+import org.kohsuke.github.GHCheckRun.Conclusion;
+import org.kohsuke.github.GHCheckRun.Status;
 
 import java.io.IOException;
 import java.text.SimpleDateFormat;
 import java.util.Collections;
+import java.util.List;
 import java.util.TimeZone;
 
 import static java.lang.Boolean.TRUE;
-import static org.hamcrest.Matchers.*;
+import static org.hamcrest.Matchers.aMapWithSize;
+import static org.hamcrest.Matchers.contains;
+import static org.hamcrest.Matchers.endsWith;
+import static org.hamcrest.Matchers.equalTo;
+import static org.hamcrest.Matchers.hasToString;
+import static org.hamcrest.Matchers.is;
+import static org.hamcrest.Matchers.lessThanOrEqualTo;
+import static org.hamcrest.Matchers.notNullValue;
+import static org.hamcrest.Matchers.nullValue;
+import static org.hamcrest.Matchers.startsWith;
 
 public class GHEventPayloadTest extends AbstractGitHubWireMockTest {
 
@@ -141,6 +153,45 @@ public class GHEventPayloadTest extends AbstractGitHubWireMockTest {
         assertThat(event.getSender().getLogin(), is("baxterthehacker"));
     }
 
+    @Test
+    public void issue_labeled() throws Exception {
+        GHEventPayload.Issue event = GitHub.offline().parseEventPayload(payload.asReader(), GHEventPayload.Issue.class);
+        assertThat(event.getAction(), is("labeled"));
+        assertThat(event.getIssue().getNumber(), is(42));
+        assertThat(event.getIssue().getTitle(), is("Test GHEventPayload.Issue label/unlabel"));
+        assertThat(event.getIssue().getLabels().size(), is(1));
+        assertThat(event.getIssue().getLabels().iterator().next().getName(), is("enhancement"));
+        assertThat(event.getLabel().getName(), is("enhancement"));
+    }
+
+    @Test
+    public void issue_unlabeled() throws Exception {
+        GHEventPayload.Issue event = GitHub.offline().parseEventPayload(payload.asReader(), GHEventPayload.Issue.class);
+        assertThat(event.getAction(), is("unlabeled"));
+        assertThat(event.getIssue().getNumber(), is(42));
+        assertThat(event.getIssue().getTitle(), is("Test GHEventPayload.Issue label/unlabel"));
+        assertThat(event.getIssue().getLabels().size(), is(0));
+        assertThat(event.getLabel().getName(), is("enhancement"));
+    }
+
+    @Test
+    public void issue_title_edited() throws Exception {
+        GHEventPayload.Issue event = GitHub.offline().parseEventPayload(payload.asReader(), GHEventPayload.Issue.class);
+        assertThat(event.getAction(), is("edited"));
+        assertThat(event.getIssue().getNumber(), is(43));
+        assertThat(event.getIssue().getTitle(), is("Test GHEventPayload.Issue changes [updated]"));
+        assertThat(event.getChanges().getTitle().getFrom(), is("Test GHEventPayload.Issue changes"));
+    }
+
+    @Test
+    public void issue_body_edited() throws Exception {
+        GHEventPayload.Issue event = GitHub.offline().parseEventPayload(payload.asReader(), GHEventPayload.Issue.class);
+        assertThat(event.getAction(), is("edited"));
+        assertThat(event.getIssue().getNumber(), is(43));
+        assertThat(event.getIssue().getBody(), is("Description [updated]."));
+        assertThat(event.getChanges().getBody().getFrom(), is("Description."));
+    }
+
     // TODO implement support classes and write test
     // @Test
     // public void label() throws Exception {}
@@ -361,6 +412,9 @@ public class GHEventPayloadTest extends AbstractGitHubWireMockTest {
         assertThat(event.getCommits().get(0).getRemoved().size(), is(0));
         assertThat(event.getCommits().get(0).getModified().size(), is(1));
         assertThat(event.getCommits().get(0).getModified().get(0), is("README.md"));
+        SimpleDateFormat formatter = new SimpleDateFormat("yyyy-MM-dd'T'HH:mm:ss'Z'");
+        formatter.setTimeZone(TimeZone.getTimeZone("UTC"));
+        assertThat(formatter.format(event.getCommits().get(0).getTimestamp()), is("2015-05-05T23:40:15Z"));
         assertThat(event.getRepository().getName(), is("public-repo"));
         assertThat(event.getRepository().getOwnerName(), is("baxterthehacker"));
         assertThat(event.getRepository().getUrl().toExternalForm(),
@@ -515,12 +569,13 @@ public class GHEventPayloadTest extends AbstractGitHubWireMockTest {
         assertThat(event.getRepository().getName(), is("Hello-World"));
         assertThat(event.getRepository().getOwner().getLogin(), is("Codertocat"));
         assertThat(event.getAction(), is("created"));
+        assertThat(event.getRequestedAction(), nullValue());
 
         // Checks the deserialization of check_run
         GHCheckRun checkRun = event.getCheckRun();
         assertThat(checkRun.getName(), is("Octocoders-linter"));
         assertThat(checkRun.getHeadSha(), is("ec26c3e57ca3a959ca5aad62de7213c562f8c821"));
-        assertThat(checkRun.getStatus(), is("completed"));
+        assertThat(checkRun.getStatus(), is(Status.COMPLETED));
         assertThat(checkRun.getNodeId(), is("MDg6Q2hlY2tSdW4xMjg2MjAyMjg="));
         assertThat(checkRun.getExternalId(), is(""));
 
@@ -529,7 +584,7 @@ public class GHEventPayloadTest extends AbstractGitHubWireMockTest {
         assertThat(formatter.format(checkRun.getStartedAt()), is("2019-05-15T15:21:12Z"));
         assertThat(formatter.format(checkRun.getCompletedAt()), is("2019-05-15T20:22:22Z"));
 
-        assertThat(checkRun.getConclusion(), is("success"));
+        assertThat(checkRun.getConclusion(), is(Conclusion.SUCCESS));
         assertThat(checkRun.getUrl().toString(), endsWith("/repos/Codertocat/Hello-World/check-runs/128620228"));
         assertThat(checkRun.getHtmlUrl().toString(),
                 endsWith("https://github.com/Codertocat/Hello-World/runs/128620228"));
@@ -650,4 +705,104 @@ public class GHEventPayloadTest extends AbstractGitHubWireMockTest {
 
         assertThat(event.getSender().getLogin(), is("octocat"));
     }
+
+    @Test
+    public void workflow_dispatch() throws Exception {
+        GHEventPayload.WorkflowDispatch workflowDispatchPayload = GitHub.offline()
+                .parseEventPayload(payload.asReader(), GHEventPayload.WorkflowDispatch.class);
+
+        assertThat(workflowDispatchPayload.getRef(), is("refs/heads/main"));
+        assertThat(workflowDispatchPayload.getAction(), is(nullValue()));
+        assertThat(workflowDispatchPayload.getWorkflow(), is(".github/workflows/main.yml"));
+        assertThat(workflowDispatchPayload.getInputs(), aMapWithSize(1));
+        assertThat(workflowDispatchPayload.getInputs().keySet(), contains("logLevel"));
+        assertThat(workflowDispatchPayload.getInputs().values(), contains("warning"));
+        assertThat(workflowDispatchPayload.getRepository().getName(), is("quarkus-bot-java-playground"));
+        assertThat(workflowDispatchPayload.getSender().getLogin(), is("gsmet"));
+    }
+
+    @Test
+    public void workflow_run() throws Exception {
+        GHEventPayload.WorkflowRun workflowRunPayload = GitHub.offline()
+                .parseEventPayload(payload.asReader(), GHEventPayload.WorkflowRun.class);
+
+        assertThat(workflowRunPayload.getAction(), is("completed"));
+        assertThat(workflowRunPayload.getRepository().getFullName(), is("gsmet/quarkus-bot-java-playground"));
+        assertThat(workflowRunPayload.getSender().getLogin(), is("gsmet"));
+
+        GHWorkflow workflow = workflowRunPayload.getWorkflow();
+        assertThat(workflow.getId(), is(7087581L));
+        assertThat(workflow.getName(), is("CI"));
+        assertThat(workflow.getPath(), is(".github/workflows/main.yml"));
+        assertThat(workflow.getState(), is("active"));
+        assertThat(workflow.getUrl().toString(),
+                is("https://api.github.com/repos/gsmet/quarkus-bot-java-playground/actions/workflows/7087581"));
+        assertThat(workflow.getHtmlUrl().toString(),
+                is("https://github.com/gsmet/quarkus-bot-java-playground/blob/main/.github/workflows/main.yml"));
+        assertThat(workflow.getBadgeUrl().toString(),
+                is("https://github.com/gsmet/quarkus-bot-java-playground/workflows/CI/badge.svg"));
+
+        GHWorkflowRun workflowRun = workflowRunPayload.getWorkflowRun();
+        assertThat(workflowRun.getId(), is(680604745L));
+        assertThat(workflowRun.getName(), is("CI"));
+        assertThat(workflowRun.getHeadBranch(), is("main"));
+        assertThat(workflowRun.getHeadSha(), is("dbea8d8b6ed2cf764dfd84a215f3f9040b3d4423"));
+        assertThat(workflowRun.getRunNumber(), is(6L));
+        assertThat(workflowRun.getEvent(), is(GHEvent.WORKFLOW_DISPATCH));
+        assertThat(workflowRun.getStatus(), is(GHWorkflowRun.Status.COMPLETED));
+        assertThat(workflowRun.getConclusion(), is(GHWorkflowRun.Conclusion.SUCCESS));
+        assertThat(workflowRun.getWorkflowId(), is(7087581L));
+        assertThat(workflowRun.getUrl().toString(),
+                is("https://api.github.com/repos/gsmet/quarkus-bot-java-playground/actions/runs/680604745"));
+        assertThat(workflowRun.getHtmlUrl().toString(),
+                is("https://github.com/gsmet/quarkus-bot-java-playground/actions/runs/680604745"));
+        assertThat(workflowRun.getJobsUrl().toString(),
+                is("https://api.github.com/repos/gsmet/quarkus-bot-java-playground/actions/runs/680604745/jobs"));
+        assertThat(workflowRun.getLogsUrl().toString(),
+                is("https://api.github.com/repos/gsmet/quarkus-bot-java-playground/actions/runs/680604745/logs"));
+        assertThat(workflowRun.getCheckSuiteUrl().toString(),
+                is("https://api.github.com/repos/gsmet/quarkus-bot-java-playground/check-suites/2327154397"));
+        assertThat(workflowRun.getArtifactsUrl().toString(),
+                is("https://api.github.com/repos/gsmet/quarkus-bot-java-playground/actions/runs/680604745/artifacts"));
+        assertThat(workflowRun.getCancelUrl().toString(),
+                is("https://api.github.com/repos/gsmet/quarkus-bot-java-playground/actions/runs/680604745/cancel"));
+        assertThat(workflowRun.getRerunUrl().toString(),
+                is("https://api.github.com/repos/gsmet/quarkus-bot-java-playground/actions/runs/680604745/rerun"));
+        assertThat(workflowRun.getWorkflowUrl().toString(),
+                is("https://api.github.com/repos/gsmet/quarkus-bot-java-playground/actions/workflows/7087581"));
+        assertThat(workflowRun.getCreatedAt().getTime(), is(1616524526000L));
+        assertThat(workflowRun.getUpdatedAt().getTime(), is(1616524543000L));
+        assertThat(workflowRun.getHeadCommit().getId(), is("dbea8d8b6ed2cf764dfd84a215f3f9040b3d4423"));
+        assertThat(workflowRun.getHeadCommit().getTreeId(), is("b17089e6a2574ec1002566fe980923e62dce3026"));
+        assertThat(workflowRun.getHeadCommit().getMessage(), is("Update main.yml"));
+        assertThat(workflowRun.getHeadCommit().getTimestamp().getTime(), is(1616523390000L));
+        assertThat(workflowRun.getHeadCommit().getAuthor().getName(), is("Guillaume Smet"));
+        assertThat(workflowRun.getHeadCommit().getAuthor().getEmail(), is("guillaume.smet@gmail.com"));
+        assertThat(workflowRun.getHeadCommit().getCommitter().getName(), is("GitHub"));
+        assertThat(workflowRun.getHeadCommit().getCommitter().getEmail(), is("noreply@github.com"));
+        assertThat(workflowRun.getHeadRepository().getFullName(), is("gsmet/quarkus-bot-java-playground"));
+    }
+
+    @Test
+    public void workflow_run_pull_request() throws Exception {
+        GHEventPayload.WorkflowRun workflowRunPayload = GitHub.offline()
+                .parseEventPayload(payload.asReader(), GHEventPayload.WorkflowRun.class);
+
+        List<GHPullRequest> pullRequests = workflowRunPayload.getWorkflowRun().getPullRequests();
+        assertThat(pullRequests.size(), is(1));
+
+        GHPullRequest pullRequest = pullRequests.get(0);
+        assertThat(pullRequest.getId(), is(599098265L));
+    }
+
+    @Test
+    public void workflow_run_other_repository() throws Exception {
+        GHEventPayload.WorkflowRun workflowRunPayload = GitHub.offline()
+                .parseEventPayload(payload.asReader(), GHEventPayload.WorkflowRun.class);
+        GHWorkflowRun workflowRun = workflowRunPayload.getWorkflowRun();
+
+        assertThat(workflowRunPayload.getRepository().getFullName(), is("gsmet/quarkus-bot-java-playground"));
+        assertThat(workflowRun.getHeadRepository().getFullName(),
+                is("gsmet-bot-playground/quarkus-bot-java-playground"));
+    }
 }

src/test/java/org/kohsuke/github/GHIssueEventTest.java

@@ -18,7 +18,7 @@ public class GHIssueEventTest extends AbstractGitHubWireMockTest {
         GHIssue issue = builder.create();
 
         // Generate some events.
-        issue.addLabels("test-label");
+        issue.setLabels("test-label");
 
         // Test that the events are present.
         List<GHIssueEvent> list = issue.listEvents().toList();

src/test/java/org/kohsuke/github/GHLicenseTest.java

@@ -79,9 +79,19 @@ public class GHLicenseTest extends AbstractGitHubWireMockTest {
         String key = "mit";
         GHLicense license = gitHub.getLicense(key);
         assertNotNull(license);
-        assertTrue("The name is correct", license.getName().equals("MIT License"));
-        assertTrue("The HTML URL is correct",
-                license.getHtmlUrl().equals(new URL("http://choosealicense.com/licenses/mit/")));
+        assertThat("The name is correct", license.getName(), equalTo("MIT License"));
+        assertThat("The HTML URL is correct",
+                license.getHtmlUrl(),
+                equalTo(new URL("http://choosealicense.com/licenses/mit/")));
+        assertThat(license.getBody(), startsWith("MIT License\n" + "\n" + "Copyright (c) [year] [fullname]\n\n"));
+        assertThat(license.getForbidden().size(), equalTo(0));
+        assertThat(license.getPermitted().size(), equalTo(0));
+        assertThat(license.getImplementation(),
+                equalTo("Create a text file (typically named LICENSE or LICENSE.txt) in the root of your source code and copy the text of the license into the file. Replace [year] with the current year and [fullname] with the name (or names) of the copyright holders."));
+        assertThat(license.getCategory(), nullValue());
+        assertThat(license.isFeatured(), equalTo(true));
+        assertThat(license.equals(null), equalTo(false));
+        assertThat(license.equals(gitHub.getLicense(key)), equalTo(true));
     }
 
     /**

src/test/java/org/kohsuke/github/GHOrganizationTest.java

@@ -36,11 +36,12 @@ public class GHOrganizationTest extends AbstractGitHubWireMockTest {
         cleanupRepository(GITHUB_API_TEST_ORG + '/' + GITHUB_API_TEST);
 
         GHOrganization org = gitHub.getOrganization(GITHUB_API_TEST_ORG);
-        GHRepository repository = org.createRepository(GITHUB_API_TEST,
-                "a test repository used to test kohsuke's github-api",
-                "http://github-api.kohsuke.org/",
-                "Core Developers",
-                true);
+        GHRepository repository = org.createRepository(GITHUB_API_TEST)
+                .description("a test repository used to test kohsuke's github-api")
+                .homepage("http://github-api.kohsuke.org/")
+                .team(org.getTeamByName("Core Developers"))
+                .private_(false)
+                .create();
         Assert.assertNotNull(repository);
     }
 
@@ -72,7 +73,7 @@ public class GHOrganizationTest extends AbstractGitHubWireMockTest {
                 .homepage("http://github-api.kohsuke.org/")
                 .team(team)
                 .autoInit(true)
-                .templateRepository(true)
+                .isTemplate(true)
                 .create();
         Assert.assertNotNull(repository);
         assertThat(mockGitHub.getRequestCount(), equalTo(requestCount + 1));
@@ -136,7 +137,7 @@ public class GHOrganizationTest extends AbstractGitHubWireMockTest {
     public void testListMembersWithFilter() throws IOException {
         GHOrganization org = gitHub.getOrganization(GITHUB_API_TEST_ORG);
 
-        List<GHUser> admins = org.listMembersWithFilter("all").asList();
+        List<GHUser> admins = org.listMembersWithFilter("all").toList();
 
         assertNotNull(admins);
         assertTrue(admins.size() >= 12); // In case more are added in the future
@@ -158,7 +159,7 @@ public class GHOrganizationTest extends AbstractGitHubWireMockTest {
     public void testListMembersWithRole() throws IOException {
         GHOrganization org = gitHub.getOrganization(GITHUB_API_TEST_ORG);
 
-        List<GHUser> admins = org.listMembersWithRole("admin").asList();
+        List<GHUser> admins = org.listMembersWithRole("admin").toList();
 
         assertNotNull(admins);
         assertTrue(admins.size() >= 12); // In case more are added in the future

src/test/java/org/kohsuke/github/GHPullRequestTest.java

@@ -5,12 +5,18 @@ import org.junit.Before;
 import org.junit.Test;
 
 import java.io.IOException;
-import java.net.URL;
 import java.util.Collection;
 import java.util.Collections;
 import java.util.List;
 
-import static org.hamcrest.CoreMatchers.*;
+import static org.hamcrest.Matchers.containsInAnyOrder;
+import static org.hamcrest.Matchers.containsString;
+import static org.hamcrest.Matchers.equalTo;
+import static org.hamcrest.Matchers.hasProperty;
+import static org.hamcrest.Matchers.instanceOf;
+import static org.hamcrest.Matchers.is;
+import static org.hamcrest.Matchers.notNullValue;
+import static org.hamcrest.Matchers.nullValue;
 
 /**
  * @author Kohsuke Kawaguchi
@@ -112,28 +118,52 @@ public class GHPullRequestTest extends AbstractGitHubWireMockTest {
     public void pullRequestReviewComments() throws Exception {
         String name = "pullRequestReviewComments";
         GHPullRequest p = getRepository().createPullRequest(name, "test/stable", "master", "## test");
-        // System.out.println(p.getUrl());
-        assertTrue(p.listReviewComments().toList().isEmpty());
-        p.createReviewComment("Sample review comment", p.getHead().getSha(), "README.md", 1);
-        List<GHPullRequestReviewComment> comments = p.listReviewComments().toList();
-        assertEquals(1, comments.size());
-        GHPullRequestReviewComment comment = comments.get(0);
-        assertEquals("Sample review comment", comment.getBody());
+        try {
+            // System.out.println(p.getUrl());
+            assertTrue(p.listReviewComments().toList().isEmpty());
+            p.createReviewComment("Sample review comment", p.getHead().getSha(), "README.md", 1);
+            List<GHPullRequestReviewComment> comments = p.listReviewComments().toList();
+            assertEquals(1, comments.size());
+            GHPullRequestReviewComment comment = comments.get(0);
+            assertEquals("Sample review comment", comment.getBody());
+            assertThat(comment.getInReplyToId(), equalTo(-1L));
+            assertThat(comment.getPath(), equalTo("README.md"));
+            assertThat(comment.getPosition(), equalTo(1));
+            assertThat(comment.getUser(), notNullValue());
+            // Assert htmlUrl is not null
+            assertThat(comment.getHtmlUrl(), notNullValue());
+            assertThat(comment.getHtmlUrl().toString(),
+                    containsString("hub4j-test-org/github-api/pull/" + p.getNumber()));
 
-        // Assert htmlUrl is not null
-        assertNotNull(comment.getHtmlUrl());
-        assertEquals(new URL("https://github.com/hub4j-test-org/github-api/pull/266#discussion_r321995146"),
-                comment.getHtmlUrl());
+            List<GHReaction> reactions = comment.listReactions().toList();
+            assertThat(reactions.size(), equalTo(0));
 
-        comment.update("Updated review comment");
-        comments = p.listReviewComments().toList();
-        assertEquals(1, comments.size());
-        comment = comments.get(0);
-        assertEquals("Updated review comment", comment.getBody());
+            GHReaction reaction = comment.createReaction(ReactionContent.CONFUSED);
+            assertThat(reaction.getContent(), equalTo(ReactionContent.CONFUSED));
 
-        comment.delete();
-        comments = p.listReviewComments().toList();
-        assertTrue(comments.isEmpty());
+            reactions = comment.listReactions().toList();
+            assertThat(reactions.size(), equalTo(1));
+
+            GHPullRequestReviewComment reply = comment.reply("This is a reply.");
+            assertThat(reply.getInReplyToId(), equalTo(comment.getId()));
+            comments = p.listReviewComments().toList();
+
+            assertEquals(2, comments.size());
+
+            comment.update("Updated review comment");
+            comments = p.listReviewComments().toList();
+            comment = comments.get(0);
+            assertEquals("Updated review comment", comment.getBody());
+
+            comment.delete();
+            comments = p.listReviewComments().toList();
+            // Reply is still present after delete of original comment, but no longer has replyToId
+            assertThat(comments.size(), equalTo(1));
+            assertThat(comments.get(0).getId(), equalTo(reply.getId()));
+            assertThat(comments.get(0).getInReplyToId(), equalTo(-1L));
+        } finally {
+            p.close();
+        }
     }
 
     @Test
@@ -395,7 +425,93 @@ public class GHPullRequestTest extends AbstractGitHubWireMockTest {
 
         Collection<GHLabel> labels = getRepository().getPullRequest(p.getNumber()).getLabels();
         assertEquals(1, labels.size());
-        assertEquals(label, labels.iterator().next().getName());
+        GHLabel savedLabel = labels.iterator().next();
+        assertEquals(label, savedLabel.getName());
+        assertNotNull(savedLabel.getId());
+        assertNotNull(savedLabel.getNodeId());
+        assertFalse(savedLabel.isDefault());
+    }
+
+    @Test
+    // Requires push access to the test repo to pass
+    public void addLabels() throws Exception {
+        GHPullRequest p = getRepository().createPullRequest("addLabels", "test/stable", "master", "## test");
+        String addedLabel1 = "addLabels_label_name_1";
+        String addedLabel2 = "addLabels_label_name_2";
+        String addedLabel3 = "addLabels_label_name_3";
+
+        p.addLabels(addedLabel1);
+
+        int requestCount = mockGitHub.getRequestCount();
+        p.addLabels(addedLabel2, addedLabel3);
+        // multiple labels can be added with one api call
+        assertThat(mockGitHub.getRequestCount(), equalTo(requestCount + 1));
+
+        Collection<GHLabel> labels = getRepository().getPullRequest(p.getNumber()).getLabels();
+        assertEquals(3, labels.size());
+        assertThat(labels,
+                containsInAnyOrder(hasProperty("name", equalTo(addedLabel1)),
+                        hasProperty("name", equalTo(addedLabel2)),
+                        hasProperty("name", equalTo(addedLabel3))));
+
+        // Adding a label which is already present does not throw an error
+        p.addLabels(addedLabel1);
+    }
+
+    @Test
+    // Requires push access to the test repo to pass
+    public void addLabelsConcurrencyIssue() throws Exception {
+        String addedLabel1 = "addLabelsConcurrencyIssue_label_name_1";
+        String addedLabel2 = "addLabelsConcurrencyIssue_label_name_2";
+
+        GHPullRequest p1 = getRepository()
+                .createPullRequest("addLabelsConcurrencyIssue", "test/stable", "master", "## test");
+        p1.getLabels();
+
+        GHPullRequest p2 = getRepository().getPullRequest(p1.getNumber());
+        p2.addLabels(addedLabel2);
+
+        p1.addLabels(addedLabel1);
+
+        Collection<GHLabel> labels = getRepository().getPullRequest(p1.getNumber()).getLabels();
+        assertEquals(2, labels.size());
+        assertThat(labels,
+                containsInAnyOrder(hasProperty("name", equalTo(addedLabel1)),
+                        hasProperty("name", equalTo(addedLabel2))));
+    }
+
+    @Test
+    // Requires push access to the test repo to pass
+    public void removeLabels() throws Exception {
+        GHPullRequest p = getRepository().createPullRequest("removeLabels", "test/stable", "master", "## test");
+        String label1 = "removeLabels_label_name_1";
+        String label2 = "removeLabels_label_name_2";
+        String label3 = "removeLabels_label_name_3";
+        p.setLabels(label1, label2, label3);
+
+        Collection<GHLabel> labels = getRepository().getPullRequest(p.getNumber()).getLabels();
+        assertEquals(3, labels.size());
+
+        int requestCount = mockGitHub.getRequestCount();
+        p.removeLabels(label2, label3);
+        // each label deleted is a separate api call
+        assertThat(mockGitHub.getRequestCount(), equalTo(requestCount + 2));
+
+        labels = getRepository().getPullRequest(p.getNumber()).getLabels();
+        assertEquals(1, labels.size());
+        assertEquals(label1, labels.iterator().next().getName());
+
+        // Removing some labels that are not present does not throw
+        // This is consistent with earlier behavior and with addLabels()
+        p.removeLabels(label3);
+
+        // Calling removeLabel() on label that is not present will throw
+        try {
+            p.removeLabel(label3);
+            fail("Expected GHFileNotFoundException");
+        } catch (GHFileNotFoundException e) {
+            assertThat(e.getMessage(), containsString("Label does not exist"));
+        }
     }
 
     @Test
@@ -412,15 +528,15 @@ public class GHPullRequestTest extends AbstractGitHubWireMockTest {
     public void getUserTest() throws IOException {
         GHPullRequest p = getRepository().createPullRequest("getUserTest", "test/stable", "master", "## test");
         GHPullRequest prSingle = getRepository().getPullRequest(p.getNumber());
-        assertNotNull(prSingle.getUser().root);
+        assertNotNull(prSingle.getUser().getRoot());
         prSingle.getMergeable();
-        assertNotNull(prSingle.getUser().root);
+        assertNotNull(prSingle.getUser().getRoot());
 
         PagedIterable<GHPullRequest> ghPullRequests = getRepository().listPullRequests(GHIssueState.OPEN);
         for (GHPullRequest pr : ghPullRequests) {
-            assertNotNull(pr.getUser().root);
+            assertNotNull(pr.getUser().getRoot());
             pr.getMergeable();
-            assertNotNull(pr.getUser().root);
+            assertNotNull(pr.getUser().getRoot());
         }
     }
 

src/test/java/org/kohsuke/github/GHRateLimitTest.java

@@ -312,9 +312,6 @@ public class GHRateLimitTest extends AbstractGitHubWireMockTest {
         // Give this a moment
         Thread.sleep(1500);
 
-        // lastRateLimit the same as rateLimit
-        assertThat(gitHub.lastRateLimit(), sameInstance(rateLimit));
-
         // ratelimit() tries not to make additional requests, uses queried rate limit since header not available
         Thread.sleep(1500);
         assertThat(gitHub.rateLimit(), sameInstance(rateLimit));
@@ -490,9 +487,6 @@ public class GHRateLimitTest extends AbstractGitHubWireMockTest {
         assertThat("rateLimit() selects header instance when not expired, does not ask server",
                 gitHub.rateLimit(),
                 sameInstance(headerRateLimit));
-        assertThat("lastRateLimit() always selects header instance, does not ask server",
-                gitHub.lastRateLimit(),
-                sameInstance(headerRateLimit));
 
         assertThat(mockGitHub.getRequestCount(), equalTo(1));
 

src/test/java/org/kohsuke/github/GHRepositoryStatisticsTest.java

@@ -34,6 +34,7 @@ public class GHRepositoryStatisticsTest extends AbstractGitHubWireMockTest {
         for (GHRepositoryStatistics.ContributorStats statsForAuthor : list) {
             if (authorLogin.equals(statsForAuthor.getAuthor().getLogin())) {
                 assertEquals(715, statsForAuthor.getTotal());
+                assertEquals("kohsuke made 715 contributions over 494 weeks", statsForAuthor.toString());
 
                 List<GHRepositoryStatistics.ContributorStats.Week> weeks = statsForAuthor.getWeeks();
                 assertEquals(494, weeks.size());
@@ -46,6 +47,8 @@ public class GHRepositoryStatisticsTest extends AbstractGitHubWireMockTest {
                     assertEquals(63, week.getNumberOfAdditions());
                     assertEquals(56, week.getNumberOfDeletions());
                     assertEquals(5, week.getNumberOfCommits());
+                    assertEquals("Week starting 1541289600 - Additions: 63, Deletions: 56, Commits: 5",
+                            week.toString());
                 } catch (NoSuchElementException e) {
                     fail("Did not find week 1546128000");
                 }
@@ -131,6 +134,7 @@ public class GHRepositoryStatisticsTest extends AbstractGitHubWireMockTest {
             if (item.getWeekTimestamp() == 1535241600) {
                 assertEquals(185, item.getAdditions());
                 assertEquals(-243, item.getDeletions());
+                assertEquals("Week starting 1535241600 has 185 additions and 243 deletions", item.toString());
                 foundWeek = true;
                 break;
             }
@@ -196,6 +200,7 @@ public class GHRepositoryStatisticsTest extends AbstractGitHubWireMockTest {
                 // TODO: Make an easier access method. Perhaps wrap in an
                 // object and have a method such as GetCommits(1, 16).
                 assertEquals(16, item.getNumberOfCommits());
+                assertEquals("Day 2 Hour 10: 16 commits", item.toString());
                 hourFound = true;
                 break;
             }

src/test/java/org/kohsuke/github/GHRepositoryTest.java

@@ -3,11 +3,16 @@ package org.kohsuke.github;
 import com.fasterxml.jackson.databind.JsonMappingException;
 import org.apache.commons.io.IOUtils;
 import org.junit.Test;
+import org.kohsuke.github.GHCheckRun.Conclusion;
+import org.kohsuke.github.GHRepository.Visibility;
 
+import java.io.ByteArrayInputStream;
 import java.io.FileNotFoundException;
 import java.io.IOException;
+import java.io.InputStream;
 import java.net.URL;
 import java.util.ArrayList;
+import java.util.Date;
 import java.util.List;
 import java.util.Set;
 
@@ -28,6 +33,20 @@ public class GHRepositoryTest extends AbstractGitHubWireMockTest {
         return gitHub.getOrganization("hub4j-test-org").getRepository("github-api");
     }
 
+    @Test
+    public void testZipball() throws IOException {
+        getTempRepository().readZip((InputStream inputstream) -> {
+            return new ByteArrayInputStream(IOUtils.toByteArray(inputstream));
+        }, null);
+    }
+
+    @Test
+    public void testTarball() throws IOException {
+        getTempRepository().readTar((InputStream inputstream) -> {
+            return new ByteArrayInputStream(IOUtils.toByteArray(inputstream));
+        }, null);
+    }
+
     @Test
     public void testGetters() throws IOException {
         GHRepository r = getTempRepository();
@@ -110,6 +129,19 @@ public class GHRepositoryTest extends AbstractGitHubWireMockTest {
         assertEquals(UNKNOWN_SIGNATURE_TYPE, verification.getReason());
     }
 
+    @Test
+    public void listStargazers() throws IOException {
+        GHRepository repository = getRepository();
+        assertThat(repository.listStargazers2().toList(), empty());
+
+        repository = gitHub.getOrganization("hub4j").getRepository("github-api");
+        Iterable<GHStargazer> stargazers = repository.listStargazers2();
+        GHStargazer stargazer = stargazers.iterator().next();
+        assertThat(stargazer.getStarredAt(), equalTo(new Date(1271650383000L)));
+        assertThat(stargazer.getUser().getLogin(), equalTo("nielswind"));
+        assertThat(stargazer.getRepository(), sameInstance(repository));
+    }
+
     // Issue #607
     @Test
     public void getBranchNonExistentBut200Status() throws Exception {
@@ -135,11 +167,20 @@ public class GHRepositoryTest extends AbstractGitHubWireMockTest {
     public void subscription() throws Exception {
         GHRepository r = getRepository();
         assertNull(r.getSubscription());
-
         GHSubscription s = r.subscribe(true, false);
-        assertEquals(s.getRepository(), r);
+        try {
 
-        s.delete();
+            assertEquals(s.getRepository(), r);
+            assertThat(s.isIgnored(), equalTo(false));
+            assertThat(s.isSubscribed(), equalTo(true));
+            assertThat(s.getRepositoryUrl().toString(), containsString("/repos/hub4j-test-org/github-api"));
+            assertThat(s.getUrl().toString(), containsString("/repos/hub4j-test-org/github-api/subscription"));
+
+            assertThat(s.getReason(), nullValue());
+            assertThat(s.getCreatedAt(), equalTo(new Date(1611377286000L)));
+        } finally {
+            s.delete();
+        }
 
         assertNull(r.getSubscription());
     }
@@ -209,6 +250,30 @@ public class GHRepositoryTest extends AbstractGitHubWireMockTest {
         assertThat(redux.getDescription(), equalTo(updatedDescription));
     }
 
+    @Test
+    public void testGetRepositoryWithVisibility() throws IOException {
+        snapshotNotAllowed();
+        final String repoName = "test-repo-visibility";
+        final GHRepository repo = getTempRepository(repoName);
+        assertEquals(Visibility.PUBLIC, repo.getVisibility());
+
+        repo.setVisibility(Visibility.INTERNAL);
+        assertEquals(Visibility.INTERNAL,
+                gitHub.getRepository(repo.getOwnerName() + "/" + repo.getName()).getVisibility());
+
+        repo.setVisibility(Visibility.PRIVATE);
+        assertEquals(Visibility.PRIVATE,
+                gitHub.getRepository(repo.getOwnerName() + "/" + repo.getName()).getVisibility());
+
+        repo.setVisibility(Visibility.PUBLIC);
+        assertEquals(Visibility.PUBLIC,
+                gitHub.getRepository(repo.getOwnerName() + "/" + repo.getName()).getVisibility());
+
+        // deliberately bogus response in snapshot
+        assertEquals(Visibility.UNKNOWN,
+                gitHub.getRepository(repo.getOwnerName() + "/" + repo.getName()).getVisibility());
+    }
+
     @Test
     public void listContributors() throws IOException {
         GHRepository r = gitHub.getOrganization("hub4j").getRepository("github-api");
@@ -641,17 +706,6 @@ public class GHRepositoryTest extends AbstractGitHubWireMockTest {
             assertThat(e, instanceOf(GHFileNotFoundException.class));
             assertThat(e.getMessage(), containsString("/repos/hub4j-test-org/temp-listRefsEmptyTags/git/refs/tags"));
         }
-
-        try {
-            GHRepository repo = getTempRepository();
-            repo.listRefs("tags").asList();
-            fail();
-        } catch (Exception e) {
-            assertThat(e, instanceOf(GHException.class));
-            assertThat(e.getMessage(), containsString("Failed to retrieve "));
-            assertThat(e.getMessage(), containsString("/repos/hub4j-test-org/temp-listRefsEmptyTags/git/refs/tags"));
-            assertThat(e.getCause(), instanceOf(GHFileNotFoundException.class));
-        }
     }
 
     @Test
@@ -715,7 +769,7 @@ public class GHRepositoryTest extends AbstractGitHubWireMockTest {
         // Check if the checkruns are all succeeded and if we got all of them
         int checkRunsCount = 0;
         for (GHCheckRun checkRun : checkRuns) {
-            assertThat(checkRun.getConclusion(), equalTo("success"));
+            assertThat(checkRun.getConclusion(), equalTo(Conclusion.SUCCESS));
             checkRunsCount++;
         }
         assertThat(checkRunsCount, equalTo(expectedCount));

src/test/java/org/kohsuke/github/GHTagTest.java

@@ -6,6 +6,7 @@ import org.junit.Test;
 
 import java.io.IOException;
 
+import static org.hamcrest.Matchers.*;
 import static org.junit.Assert.assertEquals;
 import static org.junit.Assert.assertNotNull;
 
@@ -49,6 +50,10 @@ public class GHTagTest extends AbstractGitHubWireMockTest {
         assertEquals(commitSha, tag.getObject().getSha());
         assertFalse(tag.getVerification().isVerified());
         assertEquals(tag.getVerification().getReason(), GHVerification.Reason.UNSIGNED);
+        assertThat(tag.getUrl(),
+                containsString("/repos/hub4j-test-org/github-api/git/tags/e7aa6d4afbaa48669f0bbe11ca3c4d787b2b153c"));
+        assertThat(tag.getOwner().getId(), equalTo(repo.getId()));
+        assertThat(tag.getTagger().getEmail(), equalTo("martin.vanzijl@gmail.com"));
 
         // Make a reference to the newly created tag.
         GHRef ref = repo.createRef("refs/tags/" + tagName, tag.getSha());

src/test/java/org/kohsuke/github/GHTeamTest.java

@@ -41,7 +41,7 @@ public class GHTeamTest extends AbstractGitHubWireMockTest {
 
         GHTeam team = gitHub.getOrganization(GITHUB_API_TEST_ORG).getTeamBySlug(teamSlug);
 
-        List<GHUser> admins = team.listMembers("admin").asList();
+        List<GHUser> admins = team.listMembers("admin").toList();
 
         assertNotNull(admins);
         assertThat("One admin in dummy team", admins.size() == 1);
@@ -55,7 +55,7 @@ public class GHTeamTest extends AbstractGitHubWireMockTest {
 
         GHTeam team = gitHub.getOrganization(GITHUB_API_TEST_ORG).getTeamBySlug(teamSlug);
 
-        List<GHUser> justMembers = team.listMembers("member").asList();
+        List<GHUser> justMembers = team.listMembers("member").toList();
 
         assertThat("No regular members in team", justMembers.isEmpty());
     }

src/test/java/org/kohsuke/github/GHTreeBuilderTest.java

@@ -7,7 +7,9 @@ import org.junit.Test;
 
 import java.io.IOException;
 import java.util.Arrays;
+import java.util.Date;
 
+import static org.hamcrest.Matchers.*;
 import static org.junit.Assert.assertEquals;
 
 public class GHTreeBuilderTest extends AbstractGitHubWireMockTest {
@@ -87,22 +89,30 @@ public class GHTreeBuilderTest extends AbstractGitHubWireMockTest {
         treeBuilder.add(PATH_DATA1, CONTENT_DATA1, false);
         treeBuilder.add(PATH_DATA2, CONTENT_DATA2, false);
 
-        updateTree();
+        GHCommit commit = updateTree();
 
         assertEquals(CONTENT_SCRIPT.length(), getFileSize(PATH_SCRIPT));
         assertEquals(CONTENT_README.length(), getFileSize(PATH_README));
         assertEquals(CONTENT_DATA1.length, getFileSize(PATH_DATA1));
         assertEquals(CONTENT_DATA2.length, getFileSize(PATH_DATA2));
+
+        assertThat(commit.getCommitShortInfo().getAuthor().getEmail(), equalTo("author@author.com"));
+        assertThat(commit.getCommitShortInfo().getCommitter().getEmail(), equalTo("committer@committer.com"));
+
     }
 
-    private void updateTree() throws IOException {
+    private GHCommit updateTree() throws IOException {
         String treeSha = treeBuilder.create().getSha();
-        String commitSha = new GHCommitBuilder(repo).message("Add files")
+        GHCommit commit = new GHCommitBuilder(repo).message("Add files")
                 .tree(treeSha)
+                .author("author", "author@author.com", new Date(1611433225969L))
+                .committer("committer", "committer@committer.com", new Date(1611433225968L))
                 .parent(masterRef.getObject().getSha())
-                .create()
-                .getSHA1();
+                .create();
+
+        String commitSha = commit.getSHA1();
         masterRef.updateTo(commitSha);
+        return commit;
     }
 
     private long getFileSize(String path) throws IOException {

src/test/java/org/kohsuke/github/GHUserTest.java

@@ -39,14 +39,27 @@ public class GHUserTest extends AbstractGitHubWireMockTest {
             }
         });
         assertEquals(1066173, ghKeys.get(0).getId());
+        assertThat(ghKeys.get(0).getTitle(), nullValue());
+        assertThat(ghKeys.get(0).getUrl(), nullValue());
+        assertThat(ghKeys.get(0).isVerified(), equalTo(false));
+        assertThat(ghKeys.get(0).toString(),
+                containsString(
+                        "title=<null>,id=1066173,key=ssh-rsa AAAAB3NzaC1yc2EAAAABIwAAAQEAueiy12T5bvFhsc9YjfLc3aVIxgySd3gDxQWy/bletIoZL8omKmzocBYJ7F58U1asoyfWsy2ToTOY8jJp1eToXmbD6L5+xvHba0A7djYh9aQRrFam7doKQ0zp0ZSUF6+R1v0OM4nnWqK4n2ECIYd+Bdzrp+xA5+XlW3ZSNzlnW2BeWznzmgRMcp6wI+zQ9GMHWviR1cxpml5Z6wrxTZ0aX91btvnNPqoOGva976B6e6403FOEkkIFTk6CC1TFKwc/VjbqxYBg4kU0JhiTP+iEZibcQrYjWdYUgAotYbFVe5/DneHMLNsMPdeihba4PUwt62rXyNegenuCRmCntLcaFQ=="));
+
         assertEquals(
                 "ssh-rsa AAAAB3NzaC1yc2EAAAABIwAAAQEAueiy12T5bvFhsc9YjfLc3aVIxgySd3gDxQWy/bletIoZL8omKmzocBYJ7F58U1asoyfWsy2ToTOY8jJp1eToXmbD6L5+xvHba0A7djYh9aQRrFam7doKQ0zp0ZSUF6+R1v0OM4nnWqK4n2ECIYd+Bdzrp+xA5+XlW3ZSNzlnW2BeWznzmgRMcp6wI+zQ9GMHWviR1cxpml5Z6wrxTZ0aX91btvnNPqoOGva976B6e6403FOEkkIFTk6CC1TFKwc/VjbqxYBg4kU0JhiTP+iEZibcQrYjWdYUgAotYbFVe5/DneHMLNsMPdeihba4PUwt62rXyNegenuCRmCntLcaFQ==",
                 ghKeys.get(0).getKey());
         assertEquals(28136459, ghKeys.get(1).getId());
+        assertThat(ghKeys.get(1).getTitle(), nullValue());
+        assertThat(ghKeys.get(1).getUrl(), nullValue());
+        assertThat(ghKeys.get(1).isVerified(), equalTo(false));
         assertEquals(
                 "ssh-rsa AAAAB3NzaC1yc2EAAAADAQABAAABAQDTU0s5OKCC6VpKZGL9NJD4mNLY0AtujkVB1JkkuQ4OkMi2YGUHJtGhTbTwEVhNxpm0x2dM5KSzse6MLDYuGBW0qkE/VVuD9+9I73hbq461KqP0+WlupNh+Qc86kbiLBDv64+vWc+50mp1dbINpoM5xvaPYxgjnemydPv7vu5bhCHBugW7aN8VcLgfFgcp8vZCEanMtd3hIRjRU8v8Skk233ZGu1bXkG8iIOBQPabvEtZ0VDMg9pT3Q1R6lnnKqfCwHXd6zP6uAtejFSxvKRGKpu3OLGQMHwk7NlImVuhkVdaEFBq7pQtpOaGuP2eLKcN1wy5jsTYE+ZB6pvHCi2ecb",
                 ghKeys.get(1).getKey());
         assertEquals(31452581, ghKeys.get(2).getId());
+        assertThat(ghKeys.get(2).getTitle(), nullValue());
+        assertThat(ghKeys.get(2).getUrl(), nullValue());
+        assertThat(ghKeys.get(2).isVerified(), equalTo(false));
         assertEquals(
                 "ssh-rsa AAAAB3NzaC1yc2EAAAADAQABAAACAQC3JhH2FZBDmHLjXTcBoV6tdcYKmsQ7sgu8k1RsUhwxGsXm65+Cuas6GcMVoA1DncKfJGQkulHDFiTxIROIBmedh9/otHWBlZ4HqYZ4MQ1A8W5quULkXwX/kF+UdRBUxFvjigibEbuHB+LARVxRRzFlPnTSE9rAfAv8OOEsb3lNUGT/IGhN8w1vwe8GclB90tgqN1RBDgrVqwLFwn5AfrW9kUIa2f2oT4RjYu1OrhKhVIIzfHADo85aD+s8wEhqwI96BCJG3qTWrypoHwBUoj1O6Ak5CGc1iKz9o8XyTMjudRt2ddCjfOtxsuwSlTbVtQXJGIpgKviX1sgh4pPvGh7BVAFP+mdAK4F+mEugDnuj47GO/K5KGGDRCL56kh9+h28l4q/+fZvp7DhtmSN2EzrVAdQFskF8yY/6Xit/aAvjeKm03DcjbylSXbG26EJefaLHlwYFq2mUFRMak25wuuCZS71GF3RC3Sl/bMoxBKRYkyfYtGafeaYTFNGn8Dbd+hfVUCz31ebI8cvmlQR5b5AbCre3T7HTVgw8FKbAxWRf1Fio56PnqHsj+sT1KVj255Zo1F8iD9GrgERSVAlkh5bY/CKszQ8ZSd01c9Qp2a47/gR7XAAbxhzGHP+cSOlrqDlJ24fbPtcpVsM0llqKUcxpmoOBFNboRmE1QqnSmAf9ww==",
                 ghKeys.get(2).getKey());
@@ -109,5 +122,11 @@ public class GHUserTest extends AbstractGitHubWireMockTest {
         assertThat(u.getBio(), equalTo("I like to program things and I hope to program something cool one day :D"));
         assertTrue(u.isHireable());
         assertNotNull(u.getTwitterUsername());
+        assertThat(u.getBlog(), equalTo("https://chew.pw"));
+        assertThat(u.getCompany(), equalTo("@Memerator"));
+        assertThat(u.getFollowersCount(), equalTo(29));
+        assertThat(u.getFollowingCount(), equalTo(3));
+        assertThat(u.getPublicGistCount(), equalTo(4));
+        assertThat(u.getPublicRepoCount(), equalTo(96));
     }
 }

src/test/java/org/kohsuke/github/GHWorkflowRunTest.java

@@ -0,0 +1,506 @@
+package org.kohsuke.github;
+
+import org.awaitility.Awaitility;
+import org.junit.Assert;
+import org.junit.Before;
+import org.junit.Test;
+import org.kohsuke.github.GHWorkflowJob.Step;
+import org.kohsuke.github.GHWorkflowRun.Conclusion;
+import org.kohsuke.github.GHWorkflowRun.Status;
+import org.kohsuke.github.function.InputStreamFunction;
+
+import java.io.IOException;
+import java.time.Duration;
+import java.util.ArrayList;
+import java.util.List;
+import java.util.Optional;
+import java.util.Scanner;
+import java.util.function.Function;
+import java.util.stream.Collectors;
+import java.util.zip.ZipEntry;
+import java.util.zip.ZipInputStream;
+
+import static org.hamcrest.Matchers.containsString;
+import static org.hamcrest.Matchers.greaterThan;
+import static org.hamcrest.Matchers.greaterThanOrEqualTo;
+import static org.hamcrest.Matchers.hasItems;
+import static org.hamcrest.Matchers.is;
+
+public class GHWorkflowRunTest extends AbstractGitHubWireMockTest {
+
+    private static final String REPO_NAME = "hub4j-test-org/GHWorkflowRunTest";
+    private static final String MAIN_BRANCH = "main";
+    private static final String SECOND_BRANCH = "second-branch";
+
+    private static final String FAST_WORKFLOW_PATH = "fast-workflow.yml";
+    private static final String FAST_WORKFLOW_NAME = "Fast workflow";
+
+    private static final String SLOW_WORKFLOW_PATH = "slow-workflow.yml";
+    private static final String SLOW_WORKFLOW_NAME = "Slow workflow";
+
+    private static final String ARTIFACTS_WORKFLOW_PATH = "artifacts-workflow.yml";
+    private static final String ARTIFACTS_WORKFLOW_NAME = "Artifacts workflow";
+
+    private static final String MULTI_JOBS_WORKFLOW_PATH = "multi-jobs-workflow.yml";
+    private static final String MULTI_JOBS_WORKFLOW_NAME = "Multi jobs workflow";
+    private static final String RUN_A_ONE_LINE_SCRIPT_STEP_NAME = "Run a one-line script";
+
+    private GHRepository repo;
+
+    @Before
+    public void setUp() throws Exception {
+        repo = gitHub.getRepository(REPO_NAME);
+    }
+
+    @Test
+    public void testManualRunAndBasicInformation() throws IOException {
+        GHWorkflow workflow = repo.getWorkflow(FAST_WORKFLOW_PATH);
+
+        long latestPreexistingWorkflowRunId = getLatestPreexistingWorkflowRunId();
+
+        workflow.dispatch(MAIN_BRANCH);
+
+        await((nonRecordingRepo) -> getWorkflowRun(nonRecordingRepo,
+                FAST_WORKFLOW_NAME,
+                MAIN_BRANCH,
+                Status.COMPLETED,
+                latestPreexistingWorkflowRunId).isPresent());
+
+        GHWorkflowRun workflowRun = getWorkflowRun(FAST_WORKFLOW_NAME,
+                MAIN_BRANCH,
+                Status.COMPLETED,
+                latestPreexistingWorkflowRunId).orElseThrow(
+                        () -> new IllegalStateException("We must have a valid workflow run starting from here"));
+
+        assertEquals(workflow.getId(), workflowRun.getWorkflowId());
+        assertNotNull(workflowRun.getId());
+        assertNotNull(workflowRun.getNodeId());
+        assertEquals(REPO_NAME, workflowRun.getRepository().getFullName());
+        assertTrue(workflowRun.getUrl().getPath().contains("/actions/runs/"));
+        assertTrue(workflowRun.getHtmlUrl().getPath().contains("/actions/runs/"));
+        assertTrue(workflowRun.getJobsUrl().getPath().endsWith("/jobs"));
+        assertTrue(workflowRun.getLogsUrl().getPath().endsWith("/logs"));
+        assertTrue(workflowRun.getCheckSuiteUrl().getPath().contains("/check-suites/"));
+        assertTrue(workflowRun.getArtifactsUrl().getPath().endsWith("/artifacts"));
+        assertTrue(workflowRun.getCancelUrl().getPath().endsWith("/cancel"));
+        assertTrue(workflowRun.getRerunUrl().getPath().endsWith("/rerun"));
+        assertTrue(workflowRun.getWorkflowUrl().getPath().contains("/actions/workflows/"));
+        assertEquals(MAIN_BRANCH, workflowRun.getHeadBranch());
+        assertNotNull(workflowRun.getHeadCommit().getId());
+        assertNotNull(workflowRun.getHeadCommit().getTreeId());
+        assertNotNull(workflowRun.getHeadCommit().getMessage());
+        assertNotNull(workflowRun.getHeadCommit().getTimestamp());
+        assertNotNull(workflowRun.getHeadCommit().getAuthor().getEmail());
+        assertNotNull(workflowRun.getHeadCommit().getCommitter().getEmail());
+        assertEquals(GHEvent.WORKFLOW_DISPATCH, workflowRun.getEvent());
+        assertEquals(Status.COMPLETED, workflowRun.getStatus());
+        assertEquals(Conclusion.SUCCESS, workflowRun.getConclusion());
+        assertNotNull(workflowRun.getHeadSha());
+    }
+
+    @Test
+    public void testCancelAndRerun() throws IOException {
+        GHWorkflow workflow = repo.getWorkflow(SLOW_WORKFLOW_PATH);
+
+        long latestPreexistingWorkflowRunId = getLatestPreexistingWorkflowRunId();
+
+        workflow.dispatch(MAIN_BRANCH);
+
+        // now that we have triggered the workflow run, we will wait until it's in progress and then cancel it
+        await((nonRecordingRepo) -> getWorkflowRun(nonRecordingRepo,
+                SLOW_WORKFLOW_NAME,
+                MAIN_BRANCH,
+                Status.IN_PROGRESS,
+                latestPreexistingWorkflowRunId).isPresent());
+
+        GHWorkflowRun workflowRun = getWorkflowRun(SLOW_WORKFLOW_NAME,
+                MAIN_BRANCH,
+                Status.IN_PROGRESS,
+                latestPreexistingWorkflowRunId).orElseThrow(
+                        () -> new IllegalStateException("We must have a valid workflow run starting from here"));
+
+        assertNotNull(workflowRun.getId());
+
+        workflowRun.cancel();
+        long cancelledWorkflowRunId = workflowRun.getId();
+
+        // let's wait until it's completed
+        await((nonRecordingRepo) -> getWorkflowRunStatus(nonRecordingRepo, cancelledWorkflowRunId) == Status.COMPLETED);
+
+        // let's check that it has been properly cancelled
+        workflowRun = repo.getWorkflowRun(cancelledWorkflowRunId);
+        assertEquals(Conclusion.CANCELLED, workflowRun.getConclusion());
+
+        // now let's rerun it
+        workflowRun.rerun();
+
+        // let's check that it has been rerun
+        await((nonRecordingRepo) -> getWorkflowRunStatus(nonRecordingRepo,
+                cancelledWorkflowRunId) == Status.IN_PROGRESS);
+
+        // cancel it again
+        workflowRun.cancel();
+    }
+
+    @Test
+    public void testDelete() throws IOException {
+        GHWorkflow workflow = repo.getWorkflow(FAST_WORKFLOW_PATH);
+
+        long latestPreexistingWorkflowRunId = getLatestPreexistingWorkflowRunId();
+
+        workflow.dispatch(MAIN_BRANCH);
+
+        await((nonRecordingRepo) -> getWorkflowRun(nonRecordingRepo,
+                FAST_WORKFLOW_NAME,
+                MAIN_BRANCH,
+                Status.COMPLETED,
+                latestPreexistingWorkflowRunId).isPresent());
+
+        GHWorkflowRun workflowRunToDelete = getWorkflowRun(FAST_WORKFLOW_NAME,
+                MAIN_BRANCH,
+                Status.COMPLETED,
+                latestPreexistingWorkflowRunId).orElseThrow(
+                        () -> new IllegalStateException("We must have a valid workflow run starting from here"));
+
+        assertNotNull(workflowRunToDelete.getId());
+
+        workflowRunToDelete.delete();
+
+        try {
+            repo.getWorkflowRun(workflowRunToDelete.getId());
+            Assert.fail("The workflow " + workflowRunToDelete.getId() + " should have been deleted.");
+        } catch (GHFileNotFoundException e) {
+            // success
+        }
+    }
+
+    @Test
+    public void testSearchOnBranch() throws IOException {
+        GHWorkflow workflow = repo.getWorkflow(FAST_WORKFLOW_PATH);
+
+        long latestPreexistingWorkflowRunId = getLatestPreexistingWorkflowRunId();
+
+        workflow.dispatch(SECOND_BRANCH);
+
+        await((nonRecordingRepo) -> getWorkflowRun(nonRecordingRepo,
+                FAST_WORKFLOW_NAME,
+                SECOND_BRANCH,
+                Status.COMPLETED,
+                latestPreexistingWorkflowRunId).isPresent());
+
+        GHWorkflowRun workflowRun = getWorkflowRun(FAST_WORKFLOW_NAME,
+                SECOND_BRANCH,
+                Status.COMPLETED,
+                latestPreexistingWorkflowRunId).orElseThrow(
+                        () -> new IllegalStateException("We must have a valid workflow run starting from here"));
+
+        assertEquals(workflow.getId(), workflowRun.getWorkflowId());
+        assertEquals(SECOND_BRANCH, workflowRun.getHeadBranch());
+        assertEquals(GHEvent.WORKFLOW_DISPATCH, workflowRun.getEvent());
+        assertEquals(Status.COMPLETED, workflowRun.getStatus());
+        assertEquals(Conclusion.SUCCESS, workflowRun.getConclusion());
+    }
+
+    @Test
+    public void testLogs() throws IOException {
+        GHWorkflow workflow = repo.getWorkflow(FAST_WORKFLOW_PATH);
+
+        long latestPreexistingWorkflowRunId = getLatestPreexistingWorkflowRunId();
+
+        workflow.dispatch(MAIN_BRANCH);
+
+        await((nonRecordingRepo) -> getWorkflowRun(nonRecordingRepo,
+                FAST_WORKFLOW_NAME,
+                MAIN_BRANCH,
+                Status.COMPLETED,
+                latestPreexistingWorkflowRunId).isPresent());
+
+        GHWorkflowRun workflowRun = getWorkflowRun(FAST_WORKFLOW_NAME,
+                MAIN_BRANCH,
+                Status.COMPLETED,
+                latestPreexistingWorkflowRunId).orElseThrow(
+                        () -> new IllegalStateException("We must have a valid workflow run starting from here"));
+
+        List<String> logsArchiveEntries = new ArrayList<>();
+        String fullLogContent = workflowRun
+                .downloadLogs(getLogArchiveInputStreamFunction("1_build.txt", logsArchiveEntries));
+
+        assertThat(logsArchiveEntries, hasItems("1_build.txt", "build/9_Complete job.txt"));
+        assertThat(fullLogContent, containsString("Hello, world!"));
+
+        workflowRun.deleteLogs();
+
+        try {
+            workflowRun.downloadLogs((is) -> "");
+            Assert.fail("Downloading logs should not be possible as they were deleted");
+        } catch (GHFileNotFoundException e) {
+            assertThat(e.getMessage(), containsString("Not Found"));
+        }
+    }
+
+    @SuppressWarnings("resource")
+    @Test
+    public void testArtifacts() throws IOException {
+        GHWorkflow workflow = repo.getWorkflow(ARTIFACTS_WORKFLOW_PATH);
+
+        long latestPreexistingWorkflowRunId = getLatestPreexistingWorkflowRunId();
+
+        workflow.dispatch(MAIN_BRANCH);
+
+        await((nonRecordingRepo) -> getWorkflowRun(nonRecordingRepo,
+                ARTIFACTS_WORKFLOW_NAME,
+                MAIN_BRANCH,
+                Status.COMPLETED,
+                latestPreexistingWorkflowRunId).isPresent());
+
+        GHWorkflowRun workflowRun = getWorkflowRun(ARTIFACTS_WORKFLOW_NAME,
+                MAIN_BRANCH,
+                Status.COMPLETED,
+                latestPreexistingWorkflowRunId).orElseThrow(
+                        () -> new IllegalStateException("We must have a valid workflow run starting from here"));
+
+        List<GHArtifact> artifacts = new ArrayList<>(workflowRun.listArtifacts().toList());
+        artifacts.sort((a1, a2) -> a1.getName().compareTo(a2.getName()));
+
+        assertThat(artifacts.size(), is(2));
+
+        // Test properties
+        checkArtifactProperties(artifacts.get(0), "artifact1");
+        checkArtifactProperties(artifacts.get(1), "artifact2");
+
+        // Test download
+        String artifactContent = artifacts.get(0).download((is) -> {
+            try (ZipInputStream zis = new ZipInputStream(is)) {
+                StringBuilder sb = new StringBuilder();
+
+                ZipEntry ze = zis.getNextEntry();
+                assertThat(ze.getName(), is("artifact1.txt"));
+
+                // the scanner has to be kept open to avoid closing zis
+                Scanner scanner = new Scanner(zis);
+                while (scanner.hasNextLine()) {
+                    sb.append(scanner.nextLine());
+                }
+
+                return sb.toString();
+            }
+        });
+
+        assertThat(artifactContent, is("artifact1"));
+
+        // Test GHRepository#getArtifact(long) as we are sure we have artifacts around
+        GHArtifact artifactById = repo.getArtifact(artifacts.get(0).getId());
+        checkArtifactProperties(artifactById, "artifact1");
+
+        artifactById = repo.getArtifact(artifacts.get(1).getId());
+        checkArtifactProperties(artifactById, "artifact2");
+
+        // Test GHRepository#listArtifacts() as we are sure we have artifacts around
+        List<GHArtifact> artifactsFromRepo = new ArrayList<>(
+                repo.listArtifacts().withPageSize(2).iterator().nextPage());
+        artifactsFromRepo.sort((a1, a2) -> a1.getName().compareTo(a2.getName()));
+
+        // We have at least the two artifacts we just added
+        assertThat(artifactsFromRepo.size(), is(2));
+
+        // Test properties
+        checkArtifactProperties(artifactsFromRepo.get(0), "artifact1");
+        checkArtifactProperties(artifactsFromRepo.get(1), "artifact2");
+
+        // Now let's test the delete() method
+        GHArtifact artifact1 = artifacts.get(0);
+        artifact1.delete();
+
+        try {
+            repo.getArtifact(artifact1.getId());
+            Assert.fail("Getting the artifact should fail as it was deleted");
+        } catch (GHFileNotFoundException e) {
+            assertThat(e.getMessage(), containsString("Not Found"));
+        }
+    }
+
+    @Test
+    public void testJobs() throws IOException {
+        GHWorkflow workflow = repo.getWorkflow(MULTI_JOBS_WORKFLOW_PATH);
+
+        long latestPreexistingWorkflowRunId = getLatestPreexistingWorkflowRunId();
+
+        workflow.dispatch(MAIN_BRANCH);
+
+        await((nonRecordingRepo) -> getWorkflowRun(nonRecordingRepo,
+                MULTI_JOBS_WORKFLOW_NAME,
+                MAIN_BRANCH,
+                Status.COMPLETED,
+                latestPreexistingWorkflowRunId).isPresent());
+
+        GHWorkflowRun workflowRun = getWorkflowRun(MULTI_JOBS_WORKFLOW_NAME,
+                MAIN_BRANCH,
+                Status.COMPLETED,
+                latestPreexistingWorkflowRunId).orElseThrow(
+                        () -> new IllegalStateException("We must have a valid workflow run starting from here"));
+
+        List<GHWorkflowJob> jobs = workflowRun.listJobs()
+                .toList()
+                .stream()
+                .sorted((j1, j2) -> j1.getName().compareTo(j2.getName()))
+                .collect(Collectors.toList());
+
+        assertThat(jobs.size(), is(2));
+
+        GHWorkflowJob job1 = jobs.get(0);
+        checkJobProperties(workflowRun.getId(), job1, "job1");
+        String fullLogContent = job1.downloadLogs(getLogTextInputStreamFunction());
+        assertThat(fullLogContent, containsString("Hello from job1!"));
+
+        GHWorkflowJob job2 = jobs.get(1);
+        checkJobProperties(workflowRun.getId(), job2, "job2");
+        fullLogContent = job2.downloadLogs(getLogTextInputStreamFunction());
+        assertThat(fullLogContent, containsString("Hello from job2!"));
+
+        // while we have a job around, test GHRepository#getWorkflowJob(id)
+        GHWorkflowJob job1ById = repo.getWorkflowJob(job1.getId());
+        checkJobProperties(workflowRun.getId(), job1ById, "job1");
+
+        // Also test listAllJobs() works correctly
+        List<GHWorkflowJob> allJobs = workflowRun.listAllJobs().withPageSize(10).iterator().nextPage();
+        assertThat(allJobs.size(), greaterThanOrEqualTo(2));
+    }
+
+    private void await(Function<GHRepository, Boolean> condition) throws IOException {
+        if (!mockGitHub.isUseProxy()) {
+            return;
+        }
+
+        GHRepository nonRecordingRepo = getGitHubBeforeAfter().getRepository(REPO_NAME);
+
+        Awaitility.await().pollInterval(Duration.ofSeconds(5)).atMost(Duration.ofSeconds(60)).until(() -> {
+            return condition.apply(nonRecordingRepo);
+        });
+    }
+
+    private long getLatestPreexistingWorkflowRunId() {
+        return repo.queryWorkflowRuns().list().withPageSize(1).iterator().next().getId();
+    }
+
+    private static Optional<GHWorkflowRun> getWorkflowRun(GHRepository repository,
+            String workflowName,
+            String branch,
+            Status status,
+            long latestPreexistingWorkflowRunId) {
+        List<GHWorkflowRun> workflowRuns = repository.queryWorkflowRuns()
+                .branch(branch)
+                .status(status)
+                .event(GHEvent.WORKFLOW_DISPATCH)
+                .list()
+                .withPageSize(20)
+                .iterator()
+                .nextPage();
+
+        for (GHWorkflowRun workflowRun : workflowRuns) {
+            if (workflowRun.getName().equals(workflowName) && workflowRun.getId() > latestPreexistingWorkflowRunId) {
+                return Optional.of(workflowRun);
+            }
+        }
+        return Optional.empty();
+    }
+
+    private Optional<GHWorkflowRun> getWorkflowRun(String workflowName,
+            String branch,
+            Status status,
+            long latestPreexistingWorkflowRunId) {
+        return getWorkflowRun(this.repo, workflowName, branch, status, latestPreexistingWorkflowRunId);
+    }
+
+    private static Status getWorkflowRunStatus(GHRepository repository, long workflowRunId) {
+        try {
+            return repository.getWorkflowRun(workflowRunId).getStatus();
+        } catch (IOException e) {
+            throw new IllegalStateException("Unable to get workflow run status", e);
+        }
+    }
+
+    @SuppressWarnings("resource")
+    private static InputStreamFunction<String> getLogArchiveInputStreamFunction(String mainLogFileName,
+            List<String> logsArchiveEntries) {
+        return (is) -> {
+            try (ZipInputStream zis = new ZipInputStream(is)) {
+                StringBuilder sb = new StringBuilder();
+
+                ZipEntry ze;
+                while ((ze = zis.getNextEntry()) != null) {
+                    logsArchiveEntries.add(ze.getName());
+                    if (mainLogFileName.equals(ze.getName())) {
+                        // the scanner has to be kept open to avoid closing zis
+                        Scanner scanner = new Scanner(zis);
+                        while (scanner.hasNextLine()) {
+                            sb.append(scanner.nextLine()).append("\n");
+                        }
+                    }
+                }
+
+                return sb.toString();
+            }
+        };
+    }
+
+    @SuppressWarnings("resource")
+    private static InputStreamFunction<String> getLogTextInputStreamFunction() {
+        return (is) -> {
+            StringBuilder sb = new StringBuilder();
+            Scanner scanner = new Scanner(is);
+            while (scanner.hasNextLine()) {
+                sb.append(scanner.nextLine()).append("\n");
+            }
+            return sb.toString();
+        };
+    }
+
+    private static void checkArtifactProperties(GHArtifact artifact, String artifactName) throws IOException {
+        assertNotNull(artifact.getId());
+        assertNotNull(artifact.getNodeId());
+        assertEquals(REPO_NAME, artifact.getRepository().getFullName());
+        assertThat(artifact.getName(), is(artifactName));
+        assertThat(artifact.getArchiveDownloadUrl().getPath(), containsString("actions/artifacts"));
+        assertNotNull(artifact.getCreatedAt());
+        assertNotNull(artifact.getUpdatedAt());
+        assertNotNull(artifact.getExpiresAt());
+        assertThat(artifact.getSizeInBytes(), greaterThan(0L));
+        assertFalse(artifact.isExpired());
+    }
+
+    private static void checkJobProperties(long workflowRunId, GHWorkflowJob job, String jobName) throws IOException {
+        assertNotNull(job.getId());
+        assertNotNull(job.getNodeId());
+        assertEquals(REPO_NAME, job.getRepository().getFullName());
+        assertThat(job.getName(), is(jobName));
+        assertNotNull(job.getStartedAt());
+        assertNotNull(job.getCompletedAt());
+        assertNotNull(job.getHeadSha());
+        assertThat(job.getStatus(), is(Status.COMPLETED));
+        assertThat(job.getConclusion(), is(Conclusion.SUCCESS));
+        assertThat(job.getRunId(), is(workflowRunId));
+        assertThat(job.getUrl().getPath(), containsString("/actions/jobs/"));
+        assertThat(job.getHtmlUrl().getPath(), containsString("/runs/" + job.getId()));
+        assertThat(job.getCheckRunUrl().getPath(), containsString("/check-runs/"));
+
+        // we only test the step we have control over, the others are added by GitHub
+        Optional<Step> step = job.getSteps()
+                .stream()
+                .filter(s -> RUN_A_ONE_LINE_SCRIPT_STEP_NAME.equals(s.getName()))
+                .findFirst();
+        if (!step.isPresent()) {
+            fail("Unable to find " + RUN_A_ONE_LINE_SCRIPT_STEP_NAME + " step");
+        }
+
+        checkStepProperties(step.get(), RUN_A_ONE_LINE_SCRIPT_STEP_NAME, 2);
+    }
+
+    private static void checkStepProperties(Step step, String name, int number) {
+        assertThat(step.getName(), is(name));
+        assertThat(step.getNumber(), is(number));
+        assertThat(step.getStatus(), is(Status.COMPLETED));
+        assertThat(step.getConclusion(), is(Conclusion.SUCCESS));
+        assertNotNull(step.getStartedAt());
+        assertNotNull(step.getCompletedAt());
+    }
+}

src/test/java/org/kohsuke/github/GHWorkflowTest.java

@@ -0,0 +1,108 @@
+package org.kohsuke.github;
+
+import org.junit.After;
+import org.junit.Before;
+import org.junit.Test;
+
+import java.io.IOException;
+import java.util.Collections;
+import java.util.List;
+
+import static com.github.tomakehurst.wiremock.client.WireMock.containing;
+import static com.github.tomakehurst.wiremock.client.WireMock.postRequestedFor;
+import static com.github.tomakehurst.wiremock.client.WireMock.urlPathEqualTo;
+import static com.github.tomakehurst.wiremock.client.WireMock.verify;
+
+public class GHWorkflowTest extends AbstractGitHubWireMockTest {
+
+    private static String REPO_NAME = "hub4j-test-org/GHWorkflowTest";
+
+    private GHRepository repo;
+
+    @Before
+    @After
+    public void cleanup() throws Exception {
+        if (mockGitHub.isUseProxy()) {
+            repo = getGitHubBeforeAfter().getRepository(REPO_NAME);
+
+            // we need to make sure the workflow is enabled before the tests
+            GHWorkflow workflow = repo.getWorkflow("test-workflow.yml");
+            if (!workflow.getState().equals("active")) {
+                workflow.enable();
+            }
+        }
+    }
+
+    @Before
+    public void setUp() throws Exception {
+        repo = gitHub.getRepository(REPO_NAME);
+    }
+
+    @Test
+    public void testBasicInformation() throws IOException {
+        GHWorkflow workflow = repo.getWorkflow("test-workflow.yml");
+
+        assertEquals("test-workflow", workflow.getName());
+        assertEquals(REPO_NAME, workflow.getRepository().getFullName());
+        assertEquals(".github/workflows/test-workflow.yml", workflow.getPath());
+        assertEquals("active", workflow.getState());
+        assertEquals("/repos/hub4j-test-org/GHWorkflowTest/actions/workflows/6817859", workflow.getUrl().getPath());
+        assertEquals("/hub4j-test-org/GHWorkflowTest/blob/main/.github/workflows/test-workflow.yml",
+                workflow.getHtmlUrl().getPath());
+        assertEquals("/hub4j-test-org/GHWorkflowTest/workflows/test-workflow/badge.svg",
+                workflow.getBadgeUrl().getPath());
+
+        GHWorkflow workflowById = repo.getWorkflow(workflow.getId());
+        assertEquals(workflow.getNodeId(), workflowById.getNodeId());
+    }
+
+    @Test
+    public void testDisableEnable() throws IOException {
+        GHWorkflow workflow = repo.getWorkflow("test-workflow.yml");
+
+        assertEquals("active", workflow.getState());
+
+        workflow.disable();
+
+        workflow = repo.getWorkflow("test-workflow.yml");
+        assertEquals("disabled_manually", workflow.getState());
+
+        workflow.enable();
+
+        workflow = repo.getWorkflow("test-workflow.yml");
+        assertEquals("active", workflow.getState());
+    }
+
+    @Test
+    public void testDispatch() throws IOException {
+        GHWorkflow workflow = repo.getWorkflow("test-workflow.yml");
+
+        workflow.dispatch("main");
+        verify(postRequestedFor(
+                urlPathEqualTo("/repos/hub4j-test-org/GHWorkflowTest/actions/workflows/6817859/dispatches")));
+
+        workflow.dispatch("main", Collections.singletonMap("parameter", "value"));
+        verify(postRequestedFor(
+                urlPathEqualTo("/repos/hub4j-test-org/GHWorkflowTest/actions/workflows/6817859/dispatches"))
+                        .withRequestBody(containing("inputs"))
+                        .withRequestBody(containing("parameter"))
+                        .withRequestBody(containing("value")));
+    }
+
+    @Test
+    public void testListWorkflows() throws IOException {
+        List<GHWorkflow> workflows = repo.listWorkflows().toList();
+
+        GHWorkflow workflow = workflows.get(0);
+        assertEquals(6817859L, workflow.getId());
+        assertEquals("MDg6V29ya2Zsb3c2ODE3ODU5", workflow.getNodeId());
+        assertEquals("test-workflow", workflow.getName());
+        assertEquals(".github/workflows/test-workflow.yml", workflow.getPath());
+        assertEquals("active", workflow.getState());
+        assertEquals("/repos/hub4j-test-org/GHWorkflowTest/actions/workflows/6817859", workflow.getUrl().getPath());
+        assertEquals("/hub4j-test-org/GHWorkflowTest/blob/main/.github/workflows/test-workflow.yml",
+                workflow.getHtmlUrl().getPath());
+        assertEquals("/hub4j-test-org/GHWorkflowTest/workflows/test-workflow/badge.svg",
+                workflow.getBadgeUrl().getPath());
+    }
+}

src/test/java/org/kohsuke/github/GitHubConnectionTest.java

@@ -1,13 +1,20 @@
 package org.kohsuke.github;
 
+import org.junit.Assume;
 import org.junit.Test;
 import org.kohsuke.github.authorization.UserAuthorizationProvider;
 
 import java.io.IOException;
 import java.lang.reflect.Field;
-import java.util.*;
+import java.util.Collections;
+import java.util.HashMap;
+import java.util.Map;
 
-import static org.hamcrest.CoreMatchers.*;
+import static org.hamcrest.Matchers.equalTo;
+import static org.hamcrest.Matchers.instanceOf;
+import static org.hamcrest.Matchers.lessThan;
+import static org.hamcrest.Matchers.not;
+import static org.hamcrest.Matchers.nullValue;
 
 /**
  * Unit test for {@link GitHub}.
@@ -56,6 +63,8 @@ public class GitHubConnectionTest extends AbstractGitHubWireMockTest {
 
     @Test
     public void testGitHubBuilderFromEnvironment() throws IOException {
+        // we disable this test for JDK 16+ as the current hacks in setupEnvironment() don't work with JDK 16+
+        Assume.assumeThat(Double.valueOf(System.getProperty("java.specification.version")), lessThan(16.0));
 
         Map<String, String> props = new HashMap<String, String>();
 
@@ -98,6 +107,9 @@ public class GitHubConnectionTest extends AbstractGitHubWireMockTest {
 
     @Test
     public void testGitHubBuilderFromCustomEnvironment() throws IOException {
+        // we disable this test for JDK 16+ as the current hacks in setupEnvironment() don't work with JDK 16+
+        Assume.assumeThat(Double.valueOf(System.getProperty("java.specification.version")), lessThan(16.0));
+
         Map<String, String> props = new HashMap<String, String>();
 
         props.put("customEndpoint", "bogus endpoint url");

src/test/java/org/kohsuke/github/GitHubStaticTest.java

@@ -2,7 +2,9 @@ package org.kohsuke.github;
 
 import org.junit.Test;
 
+import java.net.URL;
 import java.text.SimpleDateFormat;
+import java.time.Duration;
 import java.time.Instant;
 import java.time.format.DateTimeParseException;
 import java.time.temporal.ChronoUnit;
@@ -10,6 +12,9 @@ import java.util.Date;
 import java.util.TimeZone;
 
 import static org.hamcrest.CoreMatchers.*;
+import static org.hamcrest.Matchers.containsString;
+import static org.hamcrest.Matchers.not;
+import static org.hamcrest.core.IsInstanceOf.instanceOf;
 import static org.junit.Assert.fail;
 
 /**
@@ -19,6 +24,34 @@ import static org.junit.Assert.fail;
  */
 public class GitHubStaticTest extends AbstractGitHubWireMockTest {
 
+    @Test
+    public void testParseURL() throws Exception {
+        assertThat(GitHubClient.parseURL("https://api.github.com"), equalTo(new URL("https://api.github.com")));
+        assertThat(GitHubClient.parseURL(null), nullValue());
+
+        try {
+            GitHubClient.parseURL("bogus");
+            fail();
+        } catch (IllegalStateException e) {
+            assertThat(e.getMessage(), equalTo("Invalid URL: bogus"));
+        }
+    }
+
+    @Test
+    public void testParseInstant() throws Exception {
+        assertThat(GitHubClient.parseInstant(null), nullValue());
+    }
+
+    @Test
+    public void testRawUrlPathInvalid() throws Exception {
+        try {
+            gitHub.createRequest().setRawUrlPath("invalid.path.com");
+            fail();
+        } catch (GHException e) {
+            assertThat(e.getMessage(), equalTo("Raw URL must start with 'http'"));
+        }
+    }
+
     @Test
     public void timeRoundTrip() throws Exception {
         final long stableInstantEpochMilli = 1533721222255L;
@@ -78,6 +111,62 @@ public class GitHubStaticTest extends AbstractGitHubWireMockTest {
         }
     }
 
+    @Test
+    public void testFromRecord() throws Exception {
+        final long stableInstantEpochSeconds = 11610674762L;
+
+        GHRateLimit rateLimit_none = GHRateLimit.fromRecord(new GHRateLimit.Record(9876,
+                5432,
+                (stableInstantEpochSeconds + Duration.ofMinutes(30).toMillis()) / 1000L), RateLimitTarget.NONE);
+
+        GHRateLimit rateLimit_core = GHRateLimit.fromRecord(new GHRateLimit.Record(9876,
+                5432,
+                (stableInstantEpochSeconds + Duration.ofMinutes(30).toMillis()) / 1000L), RateLimitTarget.CORE);
+
+        GHRateLimit rateLimit_search = GHRateLimit.fromRecord(new GHRateLimit.Record(19876,
+                15432,
+                (stableInstantEpochSeconds + Duration.ofHours(1).toMillis()) / 1000L), RateLimitTarget.SEARCH);
+
+        GHRateLimit rateLimit_graphql = GHRateLimit.fromRecord(new GHRateLimit.Record(29876,
+                25432,
+                (stableInstantEpochSeconds + Duration.ofHours(2).toMillis()) / 1000L), RateLimitTarget.GRAPHQL);
+
+        GHRateLimit rateLimit_integration = GHRateLimit.fromRecord(
+                new GHRateLimit.Record(39876,
+                        35432,
+                        (stableInstantEpochSeconds + Duration.ofHours(3).toMillis()) / 1000L),
+                RateLimitTarget.INTEGRATION_MANIFEST);
+
+        assertThat(rateLimit_none, equalTo(rateLimit_core));
+        assertThat(rateLimit_none, not(sameInstance(rateLimit_core)));
+        assertTrue(rateLimit_none.hashCode() == rateLimit_core.hashCode());
+        assertTrue(rateLimit_none.equals(rateLimit_core));
+
+        assertThat(rateLimit_none, not(equalTo(rateLimit_search)));
+
+        assertThat(rateLimit_none.getCore(), not(sameInstance(rateLimit_core.getCore())));
+
+        assertThat(rateLimit_core.getRecord(RateLimitTarget.NONE), instanceOf(GHRateLimit.UnknownLimitRecord.class));
+        assertThat(rateLimit_core.getRecord(RateLimitTarget.NONE),
+                sameInstance(rateLimit_none.getRecord(RateLimitTarget.NONE)));
+
+        assertThat(rateLimit_core.getRecord(RateLimitTarget.SEARCH), sameInstance(rateLimit_search.getGraphQL()));
+        assertThat(rateLimit_search.getRecord(RateLimitTarget.GRAPHQL),
+                sameInstance(rateLimit_graphql.getIntegrationManifest()));
+        assertThat(rateLimit_graphql.getRecord(RateLimitTarget.INTEGRATION_MANIFEST),
+                sameInstance(rateLimit_integration.getCore()));
+        assertThat(rateLimit_integration.getRecord(RateLimitTarget.CORE), sameInstance(rateLimit_core.getSearch()));
+
+        assertThat(rateLimit_none.getRecord(RateLimitTarget.CORE).getLimit(), equalTo(9876));
+        assertThat(rateLimit_core.getRecord(RateLimitTarget.CORE).getLimit(), equalTo(9876));
+        assertThat(rateLimit_search.getRecord(RateLimitTarget.SEARCH).getLimit(), equalTo(19876));
+        assertThat(rateLimit_graphql.getRecord(RateLimitTarget.GRAPHQL).getLimit(), equalTo(29876));
+        assertThat(rateLimit_integration.getRecord(RateLimitTarget.INTEGRATION_MANIFEST).getLimit(), equalTo(39876));
+
+        assertThat(rateLimit_core.toString(), containsString("GHRateLimit {core {remaining=5432, limit=9876"));
+        assertThat(rateLimit_core.toString(), containsString("search {remaining=999999, limit=1000000"));
+    }
+
     @Test
     public void testGitHubRateLimitShouldReplaceRateLimit() throws Exception {
 
@@ -225,7 +314,7 @@ public class GitHubStaticTest extends AbstractGitHubWireMockTest {
         // this makes sure they don't break.
 
         GHRepository repo = getTempRepository();
-        assertThat(repo.root, not(nullValue()));
+        assertThat(repo.getRoot(), not(nullValue()));
         assertThat(repo.getResponseHeaderFields(), not(nullValue()));
 
         String repoString = GitHub.getMappingObjectWriter().writeValueAsString(repo);
@@ -237,13 +326,13 @@ public class GitHubStaticTest extends AbstractGitHubWireMockTest {
                 .readValue(repoString);
 
         // This should never happen if the internal method isn't used
-        assertThat(readRepo.root, nullValue());
+        assertThat(readRepo.getRoot(), nullValue());
         assertThat(readRepo.getResponseHeaderFields(), nullValue());
 
         readRepo = GitHub.getMappingObjectReader().forType(GHRepository.class).readValue(repoString);
 
         // This should never happen if the internal method isn't used
-        assertThat(readRepo.root.getConnector(), equalTo(HttpConnector.OFFLINE));
+        assertThat(readRepo.getRoot().getConnector(), equalTo(HttpConnector.OFFLINE));
         assertThat(readRepo.getResponseHeaderFields(), nullValue());
 
         String readRepoString = GitHub.getMappingObjectWriter().writeValueAsString(readRepo);

src/test/java/org/kohsuke/github/GitHubTest.java

@@ -25,6 +25,22 @@ public class GitHubTest extends AbstractGitHubWireMockTest {
         }
     }
 
+    @Test
+    public void getRepository() throws IOException {
+        GHRepository repo = gitHub.getRepository("hub4j/github-api");
+
+        assertThat(repo.getFullName(), equalTo("hub4j/github-api"));
+
+        GHRepository repo2 = gitHub.getRepositoryById(Long.toString(repo.getId()));
+        assertThat(repo2.getFullName(), equalTo("hub4j/github-api"));
+
+        try {
+            gitHub.getRepository("hub4j_github-api");
+        } catch (IllegalArgumentException e) {
+            assertThat(e.getMessage(), equalTo("Repository name must be in format owner/repo"));
+        }
+    }
+
     @Test
     public void getOrgs() throws IOException {
         int iterations = 10;
@@ -34,6 +50,18 @@ public class GitHubTest extends AbstractGitHubWireMockTest {
             // System.out.println(org.getName());
         }
         assertThat(orgIds.size(), equalTo(iterations));
+
+        GHOrganization org = gitHub.getOrganization("hub4j");
+        GHOrganization org2 = gitHub.getOrganization("hub4j");
+        assertThat(org.getLogin(), equalTo("hub4j"));
+        // caching
+        assertThat(org, sameInstance(org2));
+
+        gitHub.refreshCache();
+        org2 = gitHub.getOrganization("hub4j");
+        assertThat(org2.getLogin(), equalTo("hub4j"));
+        // cache cleared
+        assertThat(org, not(sameInstance(org2)));
     }
 
     @Test

src/test/java/org/kohsuke/github/Github2faTest.java

@@ -6,6 +6,7 @@ import java.io.IOException;
 import java.util.Arrays;
 import java.util.List;
 
+import static org.hamcrest.Matchers.*;
 import static org.junit.Assert.assertFalse;
 import static org.junit.Assert.assertTrue;
 
@@ -24,19 +25,27 @@ public class Github2faTest extends AbstractGitHubWireMockTest {
                                                   // collide with older tokens
 
         GHAuthorization token = gitHub
-                .createToken(asList, nameOfToken, "this is a test token created by a unit test", () -> {
+                .createToken(asList, nameOfToken, "https://localhost/this/is/a/test/token", () -> {
                     String data = "111878";
                     // TO UPDATE run this in debugger mode, put a breakpoint here, and enter the OTP you get into the
                     // value of Data
                     return data;
                 });
-        assert token != null;
+
+        assertThat(token, notNullValue());
+
         for (int i = 0; i < asList.size(); i++) {
             assertTrue(token.getScopes().get(i).contentEquals(asList.get(i)));
         }
 
-        String p = token.getToken();
+        assertThat(token.getToken(), equalTo("63042a99d88bf138e6d6cf5788e0dc4e7a5d7309"));
+        assertThat(token.getTokenLastEight(), equalTo("7a5d7309"));
+        assertThat(token.getHashedToken(), equalTo("12b727a23cad7c5a5caabb806d88e722794dede98464aed7f77cbc00dbf031a2"));
+        assertThat(token.getNote(), equalTo("Test2faTokenCreate"));
+        assertThat(token.getNoteUrl().toString(), equalTo("https://localhost/this/is/a/test/token"));
+        assertThat(token.getAppUrl().toString(), equalTo("https://localhost/this/is/a/test/app/token"));
+        assertThat(token.getFingerprint(), nullValue());
+        assertThat(token.getHtmlUrl(), nullValue());
 
-        assert p != null;
     }
 }

src/test/java/org/kohsuke/github/LifecycleTest.java

@@ -10,7 +10,7 @@ import java.io.IOException;
 import java.io.PrintWriter;
 import java.util.List;
 
-import static org.hamcrest.CoreMatchers.notNullValue;
+import static org.hamcrest.CoreMatchers.*;
 import static org.hamcrest.core.Is.is;
 
 public class LifecycleTest extends AbstractGitHubWireMockTest {
@@ -61,6 +61,13 @@ public class LifecycleTest extends AbstractGitHubWireMockTest {
         List<GHAsset> assets = release.getAssets();
         assertEquals(1, assets.size());
         assertEquals("LICENSE.txt", assets.get(0).getName());
+        assertThat(assets.get(0).getSize(), equalTo(1104L));
+        assertThat(assets.get(0).getContentType(), equalTo("application/text"));
+        assertThat(assets.get(0).getState(), equalTo("uploaded"));
+        assertThat(assets.get(0).getDownloadCount(), equalTo(0L));
+        assertThat(assets.get(0).getOwner(), sameInstance(release.getOwner()));
+        assertThat(assets.get(0).getBrowserDownloadUrl(),
+                containsString("/temp-testCreateRepository/releases/download/release_tag/LICENSE.txt"));
 
         return asset;
     }
@@ -74,6 +81,16 @@ public class LifecycleTest extends AbstractGitHubWireMockTest {
         assertEquals(1, releases.size());
         GHRelease release = releases.get(0);
         assertEquals("Test Release", release.getName());
+        assertThat(release.getBody(), startsWith("How exciting!"));
+        assertThat(release.getOwner(), sameInstance(repository));
+        assertThat(release.getZipballUrl(),
+                endsWith("/repos/hub4j-test-org/temp-testCreateRepository/zipball/release_tag"));
+        assertThat(release.getTarballUrl(),
+                endsWith("/repos/hub4j-test-org/temp-testCreateRepository/tarball/release_tag"));
+        assertThat(release.getTargetCommitish(), equalTo("master"));
+        assertThat(release.getHtmlUrl().toString(),
+                endsWith("/hub4j-test-org/temp-testCreateRepository/releases/tag/release_tag"));
+
         return release;
     }
 

src/test/java/org/kohsuke/github/extras/authorization/JWTTokenProviderTest.java

@@ -3,10 +3,16 @@ package org.kohsuke.github.extras.authorization;
 import org.junit.Test;
 import org.kohsuke.github.AbstractGitHubWireMockTest;
 import org.kohsuke.github.GitHub;
+import org.kohsuke.github.HttpException;
 
 import java.io.File;
 import java.io.IOException;
 import java.security.GeneralSecurityException;
+import java.time.Duration;
+import java.time.Instant;
+
+import static org.hamcrest.Matchers.*;
+
 /*
  * This test will request an application ensuring that the header for the "Authorization" matches a valid JWT token.
  * A JWT token in the Authorization header will always start with "ey" which is always the start of the base64
@@ -33,6 +39,9 @@ public class JWTTokenProviderTest extends AbstractGitHubWireMockTest {
 
     @Test
     public void testAuthorizationHeaderPattern() throws GeneralSecurityException, IOException {
+        // authorization header check is custom
+        snapshotNotAllowed();
+
         JWTTokenProvider jwtTokenProvider = new JWTTokenProvider(TEST_APP_ID_2,
                 new File(this.getClass().getResource(PRIVATE_KEY_FILE_APP_2).getFile()));
         GitHub gh = getGitHubBuilder().withEndpoint(mockGitHub.apiServer().baseUrl())
@@ -44,4 +53,35 @@ public class JWTTokenProviderTest extends AbstractGitHubWireMockTest {
         gh.getApp();
     }
 
+    @Test
+    public void testIssuedAtSkew() throws GeneralSecurityException, IOException {
+        // TODO: This isn't a great test as it doesn't really check anything in CI
+        // This test was accurate when recorded but it doesn't verify that the jwt token is different
+        // or accurate in anyway.
+
+        JWTTokenProvider jwtTokenProvider = new JWTTokenProvider(TEST_APP_ID_2,
+                new File(this.getClass().getResource(PRIVATE_KEY_FILE_APP_2).getFile())) {
+
+            @Override
+            Instant getIssuedAt(Instant now) {
+                return now.plus(Duration.ofMinutes(2));
+            }
+        };
+        GitHub gh = getGitHubBuilder().withEndpoint(mockGitHub.apiServer().baseUrl())
+                .withAuthorizationProvider(jwtTokenProvider)
+                .build();
+
+        try {
+            // Request the application, the wiremock matcher will ensure that the header
+            // for the authorization is present and has a the format of a valid JWT token
+            gh.getApp();
+            fail();
+        } catch (HttpException e) {
+            assertThat(e.getResponseCode(), equalTo(401));
+            assertThat(e.getMessage(),
+                    containsString(
+                            "'Issued at' claim ('iat') must be an Integer representing the time that the assertion was issued"));
+        }
+    }
+
 }

src/test/java/org/kohsuke/github/internal/EnumUtilsTest.java

@@ -0,0 +1,23 @@
+package org.kohsuke.github.internal;
+
+import org.junit.Test;
+
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.assertNull;
+
+public class EnumUtilsTest {
+
+    @Test
+    public void testGetEnum() {
+        assertNull(EnumUtils.getNullableEnumOrDefault(TestEnum.class, null, TestEnum.UNKNOWN));
+        assertEquals(TestEnum.UNKNOWN, EnumUtils.getNullableEnumOrDefault(TestEnum.class, "foobar", TestEnum.UNKNOWN));
+        assertEquals(TestEnum.VALUE_1, EnumUtils.getNullableEnumOrDefault(TestEnum.class, "VALUE_1", TestEnum.UNKNOWN));
+        assertEquals(TestEnum.VALUE_1, EnumUtils.getNullableEnumOrDefault(TestEnum.class, "value_1", TestEnum.UNKNOWN));
+        assertEquals(TestEnum.VALUE_2, EnumUtils.getNullableEnumOrDefault(TestEnum.class, "VALUE_2", TestEnum.UNKNOWN));
+        assertEquals(TestEnum.VALUE_2, EnumUtils.getNullableEnumOrDefault(TestEnum.class, "value_2", TestEnum.UNKNOWN));
+    }
+
+    private enum TestEnum {
+        VALUE_1, VALUE_2, UNKNOWN;
+    }
+}

src/test/java/org/kohsuke/github/junit/GitHubWireMockRule.java

@@ -8,6 +8,7 @@ import com.github.tomakehurst.wiremock.extension.ResponseTransformer;
 import com.github.tomakehurst.wiremock.http.*;
 import com.github.tomakehurst.wiremock.matching.RequestPatternBuilder;
 import com.google.gson.*;
+import edu.umd.cs.findbugs.annotations.NonNull;
 
 import java.io.File;
 import java.io.IOException;
@@ -64,6 +65,14 @@ public class GitHubWireMockRule extends WireMockMultiServerRule {
         return servers.get("uploads");
     }
 
+    public WireMockServer codeloadServer() {
+        return servers.get("codeload");
+    }
+
+    public WireMockServer actionsUserContentServer() {
+        return servers.get("actions-user-content");
+    }
+
     public boolean isUseProxy() {
         return GitHubWireMockRule.useProxy;
     }
@@ -88,6 +97,15 @@ public class GitHubWireMockRule extends WireMockMultiServerRule {
         if (new File(apiServer().getOptions().filesRoot().getPath() + "_uploads").exists() || isUseProxy()) {
             initializeServer("uploads");
         }
+
+        if (new File(apiServer().getOptions().filesRoot().getPath() + "_codeload").exists() || isUseProxy()) {
+            initializeServer("codeload");
+        }
+
+        if (new File(apiServer().getOptions().filesRoot().getPath() + "_actions-user-content").exists()
+                || isUseProxy()) {
+            initializeServer("actions-user-content");
+        }
     }
 
     @Override
@@ -106,6 +124,16 @@ public class GitHubWireMockRule extends WireMockMultiServerRule {
         if (this.uploadsServer() != null) {
             this.uploadsServer().stubFor(proxyAllTo("https://uploads.github.com").atPriority(100));
         }
+
+        if (this.codeloadServer() != null) {
+            this.codeloadServer().stubFor(proxyAllTo("https://codeload.github.com").atPriority(100));
+        }
+
+        if (this.actionsUserContentServer() != null) {
+            this.actionsUserContentServer()
+                    .stubFor(proxyAllTo("https://pipelines.actions.githubusercontent.com").atPriority(100));
+        }
+
     }
 
     @Override
@@ -121,6 +149,10 @@ public class GitHubWireMockRule extends WireMockMultiServerRule {
         recordSnapshot(this.rawServer(), "https://raw.githubusercontent.com", true);
 
         recordSnapshot(this.uploadsServer(), "https://uploads.github.com", false);
+
+        recordSnapshot(this.codeloadServer(), "https://codeload.github.com", true);
+
+        recordSnapshot(this.actionsUserContentServer(), "https://pipelines.actions.githubusercontent.com", true);
     }
 
     private void recordSnapshot(WireMockServer server, String target, boolean isRawServer) {
@@ -141,7 +173,7 @@ public class GitHubWireMockRule extends WireMockMultiServerRule {
                     .extractTextBodiesOver(255));
 
             // After taking the snapshot, format the output
-            formatTestResources(new File(this.apiServer().getOptions().filesRoot().getPath()).toPath(), false);
+            formatTestResources(new File(server.getOptions().filesRoot().getPath()).toPath(), isRawServer);
         }
     }
 
@@ -213,6 +245,15 @@ public class GitHubWireMockRule extends WireMockMultiServerRule {
                             fileText = fileText.replace(this.uploadsServer().baseUrl(), "https://uploads.github.com");
                         }
 
+                        if (this.codeloadServer() != null) {
+                            fileText = fileText.replace(this.codeloadServer().baseUrl(), "https://codeload.github.com");
+                        }
+
+                        if (this.actionsUserContentServer() != null) {
+                            fileText = fileText.replace(this.actionsUserContentServer().baseUrl(),
+                                    "https://pipelines.actions.githubusercontent.com");
+                        }
+
                         // point bodyFile in the mapping to the renamed body file
                         if (entry != null && filePath.toString().contains("mappings")) {
                             fileText = fileText.replace("-" + entry.getKey(), "-" + entry.getValue());
@@ -263,16 +304,28 @@ public class GitHubWireMockRule extends WireMockMultiServerRule {
     public String mapToMockGitHub(String body) {
         body = body.replace("https://api.github.com", this.apiServer().baseUrl());
 
-        if (this.rawServer() != null) {
-            body = body.replace("https://raw.githubusercontent.com", this.rawServer().baseUrl());
-        } else {
-            body = body.replace("https://raw.githubusercontent.com", this.apiServer().baseUrl() + "/raw");
-        }
+        body = replaceTargetServerUrl(body, this.rawServer(), "https://raw.githubusercontent.com", "/raw");
 
-        if (this.uploadsServer() != null) {
-            body = body.replace("https://uploads.github.com", this.uploadsServer().baseUrl());
+        body = replaceTargetServerUrl(body, this.uploadsServer(), "https://uploads.github.com", "/uploads");
+
+        body = replaceTargetServerUrl(body, this.codeloadServer(), "https://codeload.github.com", "/codeload");
+
+        body = replaceTargetServerUrl(body,
+                this.actionsUserContentServer(),
+                "https://pipelines.actions.githubusercontent.com",
+                "/actions-user-content");
+        return body;
+    }
+
+    @NonNull
+    private String replaceTargetServerUrl(String body,
+            WireMockServer wireMockServer,
+            String rawTarget,
+            String inactiveTarget) {
+        if (wireMockServer != null) {
+            body = body.replace(rawTarget, wireMockServer.baseUrl());
         } else {
-            body = body.replace("https://uploads.github.com", this.apiServer().baseUrl() + "/uploads");
+            body = body.replace(rawTarget, this.apiServer().baseUrl() + inactiveTarget);
         }
         return body;
     }
@@ -294,6 +347,7 @@ public class GitHubWireMockRule extends WireMockMultiServerRule {
             Collection<HttpHeader> headers = response.getHeaders().all();
 
             fixListTraversalHeader(response, headers);
+            fixLocationHeader(response, headers);
 
             if ("application/json".equals(response.getHeaders().getContentTypeHeader().mimeTypePart())) {
 
@@ -321,11 +375,20 @@ public class GitHubWireMockRule extends WireMockMultiServerRule {
         }
 
         private void fixListTraversalHeader(Response response, Collection<HttpHeader> headers) {
+            // Lists are broken up into pages. The Link header contains urls for previous and next pages.
             HttpHeader linkHeader = response.getHeaders().getHeader("Link");
             if (linkHeader.isPresent()) {
                 headers.removeIf(item -> item.keyEquals("Link"));
-                headers.add(HttpHeader.httpHeader("Link",
-                        linkHeader.firstValue().replace("https://api.github.com", rule.apiServer().baseUrl())));
+                headers.add(HttpHeader.httpHeader("Link", rule.mapToMockGitHub(linkHeader.firstValue())));
+            }
+        }
+
+        private void fixLocationHeader(Response response, Collection<HttpHeader> headers) {
+            // For redirects, the Location header points to the new target.
+            HttpHeader linkHeader = response.getHeaders().getHeader("Location");
+            if (linkHeader.isPresent()) {
+                headers.removeIf(item -> item.keyEquals("Location"));
+                headers.add(HttpHeader.httpHeader("Location", rule.mapToMockGitHub(linkHeader.firstValue())));
             }
         }
 

src/test/resources/org/kohsuke/github/AppTest/wiremock/testCreateAndListDeployments/__files/repos_hub4j-test-org_github-api-test-2.json

@@ -1,6 +1,6 @@
 {
-  "id": 212656166,
-  "node_id": "MDEwOlJlcG9zaXRvcnkyMTI2NTYxNjY=",
+  "id": 332135400,
+  "node_id": "MDEwOlJlcG9zaXRvcnkzMzIxMzU0MDA=",
   "name": "github-api-test",
   "full_name": "hub4j-test-org/github-api-test",
   "private": false,
@@ -8,7 +8,7 @@
     "login": "hub4j-test-org",
     "id": 7544739,
     "node_id": "MDEyOk9yZ2FuaXphdGlvbjc1NDQ3Mzk=",
-    "avatar_url": "https://avatars3.githubusercontent.com/u/7544739?v=4",
+    "avatar_url": "https://avatars.githubusercontent.com/u/7544739?v=4",
     "gravatar_id": "",
     "url": "https://api.github.com/users/hub4j-test-org",
     "html_url": "https://github.com/hub4j-test-org",
@@ -25,7 +25,7 @@
     "site_admin": false
   },
   "html_url": "https://github.com/hub4j-test-org/github-api-test",
-  "description": "A test repository for testing the github-api project",
+  "description": "A test repository for testing the github-api project: github-api-test",
   "fork": false,
   "url": "https://api.github.com/repos/hub4j-test-org/github-api-test",
   "forks_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/forks",
@@ -64,9 +64,9 @@
   "labels_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/labels{/name}",
   "releases_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/releases{/id}",
   "deployments_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/deployments",
-  "created_at": "2019-10-03T18:57:53Z",
-  "updated_at": "2019-10-03T18:57:57Z",
-  "pushed_at": "2019-10-03T18:57:54Z",
+  "created_at": "2021-01-23T05:30:23Z",
+  "updated_at": "2021-01-23T05:30:27Z",
+  "pushed_at": "2021-01-23T05:30:25Z",
   "git_url": "git://github.com/hub4j-test-org/github-api-test.git",
   "ssh_url": "git@github.com:hub4j-test-org/github-api-test.git",
   "clone_url": "https://github.com/hub4j-test-org/github-api-test.git",
@@ -90,20 +90,22 @@
   "forks": 0,
   "open_issues": 0,
   "watchers": 0,
-  "default_branch": "master",
+  "default_branch": "main",
   "permissions": {
     "admin": true,
     "push": true,
     "pull": true
   },
+  "temp_clone_token": "",
   "allow_squash_merge": true,
   "allow_merge_commit": true,
   "allow_rebase_merge": true,
+  "delete_branch_on_merge": false,
   "organization": {
     "login": "hub4j-test-org",
     "id": 7544739,
     "node_id": "MDEyOk9yZ2FuaXphdGlvbjc1NDQ3Mzk=",
-    "avatar_url": "https://avatars3.githubusercontent.com/u/7544739?v=4",
+    "avatar_url": "https://avatars.githubusercontent.com/u/7544739?v=4",
     "gravatar_id": "",
     "url": "https://api.github.com/users/hub4j-test-org",
     "html_url": "https://github.com/hub4j-test-org",
@@ -120,5 +122,5 @@
     "site_admin": false
   },
   "network_count": 0,
-  "subscribers_count": 2
+  "subscribers_count": 9
 }

src/test/resources/org/kohsuke/github/AppTest/wiremock/testCreateAndListDeployments/__files/repos_hub4j-test-org_github-api-test_deployments-3.json

@@ -1,38 +1,39 @@
 {
-  "url": "http://localhost:62379/repos/hub4j-test-org/github-api-test/deployments/173089055",
-  "id": 173089055,
-  "node_id": "MDEwOkRlcGxveW1lbnQxNzMwODkwNTU=",
-  "sha": "a446d9fa5c6f43d5f9333b625606909cd4635071",
-  "ref": "master",
+  "url": "https://api.github.com/repos/hub4j-test-org/github-api-test/deployments/315601563",
+  "id": 315601563,
+  "node_id": "MDEwOkRlcGxveW1lbnQzMTU2MDE1NjM=",
   "task": "deploy",
-  "payload": "{\"user\":\"atmos\",\"room_id\":123456}",
   "original_environment": "unittest",
   "environment": "unittest",
   "description": "question",
+  "created_at": "2021-01-23T05:30:28Z",
+  "updated_at": "2021-01-23T05:30:28Z",
+  "statuses_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/deployments/315601563/statuses",
+  "repository_url": "https://api.github.com/repos/hub4j-test-org/github-api-test",
   "creator": {
     "login": "bitwiseman",
     "id": 1958953,
     "node_id": "MDQ6VXNlcjE5NTg5NTM=",
-    "avatar_url": "https://avatars3.githubusercontent.com/u/1958953?v=4",
+    "avatar_url": "https://avatars.githubusercontent.com/u/1958953?v=4",
     "gravatar_id": "",
-    "url": "http://localhost:62379/users/bitwiseman",
+    "url": "https://api.github.com/users/bitwiseman",
     "html_url": "https://github.com/bitwiseman",
-    "followers_url": "http://localhost:62379/users/bitwiseman/followers",
-    "following_url": "http://localhost:62379/users/bitwiseman/following{/other_user}",
-    "gists_url": "http://localhost:62379/users/bitwiseman/gists{/gist_id}",
-    "starred_url": "http://localhost:62379/users/bitwiseman/starred{/owner}{/repo}",
-    "subscriptions_url": "http://localhost:62379/users/bitwiseman/subscriptions",
-    "organizations_url": "http://localhost:62379/users/bitwiseman/orgs",
-    "repos_url": "http://localhost:62379/users/bitwiseman/repos",
-    "events_url": "http://localhost:62379/users/bitwiseman/events{/privacy}",
-    "received_events_url": "http://localhost:62379/users/bitwiseman/received_events",
+    "followers_url": "https://api.github.com/users/bitwiseman/followers",
+    "following_url": "https://api.github.com/users/bitwiseman/following{/other_user}",
+    "gists_url": "https://api.github.com/users/bitwiseman/gists{/gist_id}",
+    "starred_url": "https://api.github.com/users/bitwiseman/starred{/owner}{/repo}",
+    "subscriptions_url": "https://api.github.com/users/bitwiseman/subscriptions",
+    "organizations_url": "https://api.github.com/users/bitwiseman/orgs",
+    "repos_url": "https://api.github.com/users/bitwiseman/repos",
+    "events_url": "https://api.github.com/users/bitwiseman/events{/privacy}",
+    "received_events_url": "https://api.github.com/users/bitwiseman/received_events",
     "type": "User",
     "site_admin": false
   },
-  "created_at": "2019-10-03T18:57:57Z",
-  "updated_at": "2019-10-03T18:57:57Z",
-  "statuses_url": "http://localhost:62379/repos/hub4j-test-org/github-api-test/deployments/173089055/statuses",
-  "repository_url": "http://localhost:62379/repos/hub4j-test-org/github-api-test",
-  "transient_environment": true,
-  "production_environment": false
+  "sha": "e53a04ca0ba2fbe6ea3fd590e8ea1391ac61630f",
+  "ref": "main",
+  "payload": "{\"user\":\"atmos\",\"room_id\":123456}",
+  "transient_environment": false,
+  "production_environment": false,
+  "performed_via_github_app": null
 }

src/test/resources/org/kohsuke/github/AppTest/wiremock/testCreateAndListDeployments/__files/repos_hub4j-test-org_github-api-test_deployments-4.json

@@ -1,20 +1,21 @@
 [
   {
-    "url": "https://api.github.com/repos/hub4j-test-org/github-api-test/deployments/173089055",
-    "id": 173089055,
-    "node_id": "MDEwOkRlcGxveW1lbnQxNzMwODkwNTU=",
-    "sha": "a446d9fa5c6f43d5f9333b625606909cd4635071",
-    "ref": "master",
+    "url": "https://api.github.com/repos/hub4j-test-org/github-api-test/deployments/315601563",
+    "id": 315601563,
+    "node_id": "MDEwOkRlcGxveW1lbnQzMTU2MDE1NjM=",
     "task": "deploy",
-    "payload": "{\"user\":\"atmos\",\"room_id\":123456}",
     "original_environment": "unittest",
     "environment": "unittest",
     "description": "question",
+    "created_at": "2021-01-23T05:30:28Z",
+    "updated_at": "2021-01-23T05:30:28Z",
+    "statuses_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/deployments/315601563/statuses",
+    "repository_url": "https://api.github.com/repos/hub4j-test-org/github-api-test",
     "creator": {
       "login": "bitwiseman",
       "id": 1958953,
       "node_id": "MDQ6VXNlcjE5NTg5NTM=",
-      "avatar_url": "https://avatars3.githubusercontent.com/u/1958953?v=4",
+      "avatar_url": "https://avatars.githubusercontent.com/u/1958953?v=4",
       "gravatar_id": "",
       "url": "https://api.github.com/users/bitwiseman",
       "html_url": "https://github.com/bitwiseman",
@@ -30,11 +31,11 @@
       "type": "User",
       "site_admin": false
     },
-    "created_at": "2019-10-03T18:57:57Z",
-    "updated_at": "2019-10-03T18:57:57Z",
-    "statuses_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/deployments/173089055/statuses",
-    "repository_url": "https://api.github.com/repos/hub4j-test-org/github-api-test",
-    "transient_environment": true,
-    "production_environment": false
+    "sha": "e53a04ca0ba2fbe6ea3fd590e8ea1391ac61630f",
+    "ref": "main",
+    "payload": "{\"user\":\"atmos\",\"room_id\":123456}",
+    "transient_environment": false,
+    "production_environment": false,
+    "performed_via_github_app": null
   }
 ]

src/test/resources/org/kohsuke/github/AppTest/wiremock/testCreateAndListDeployments/__files/user-1.json

@@ -2,7 +2,7 @@
   "login": "bitwiseman",
   "id": 1958953,
   "node_id": "MDQ6VXNlcjE5NTg5NTM=",
-  "avatar_url": "https://avatars3.githubusercontent.com/u/1958953?v=4",
+  "avatar_url": "https://avatars.githubusercontent.com/u/1958953?v=4",
   "gravatar_id": "",
   "url": "https://api.github.com/users/bitwiseman",
   "html_url": "https://github.com/bitwiseman",
@@ -23,17 +23,18 @@
   "location": "Seattle, WA, USA",
   "email": "bitwiseman@gmail.com",
   "hireable": null,
-  "bio": "https://twitter.com/bitwiseman",
-  "public_repos": 167,
-  "public_gists": 4,
-  "followers": 136,
-  "following": 9,
+  "bio": null,
+  "twitter_username": "bitwiseman",
+  "public_repos": 201,
+  "public_gists": 7,
+  "followers": 176,
+  "following": 11,
   "created_at": "2012-07-11T20:38:33Z",
-  "updated_at": "2019-09-24T19:32:29Z",
-  "private_gists": 7,
-  "total_private_repos": 9,
+  "updated_at": "2021-01-22T16:38:42Z",
+  "private_gists": 19,
+  "total_private_repos": 17,
   "owned_private_repos": 0,
-  "disk_usage": 33697,
+  "disk_usage": 33700,
   "collaborators": 0,
   "two_factor_authentication": true,
   "plan": {

src/test/resources/org/kohsuke/github/AppTest/wiremock/testCreateAndListDeployments/mappings/repos_hub4j-test-org_github-api-test-2.json

@@ -1,5 +1,5 @@
 {
-  "id": "31a86a0d-5120-47b8-a9bc-ec4b34a08080",
+  "id": "b0faf3a5-5d1d-4f5f-bcc0-32f5c182f4c4",
   "name": "repos_hub4j-test-org_github-api-test",
   "request": {
     "url": "/repos/hub4j-test-org/github-api-test",
@@ -14,35 +14,35 @@
     "status": 200,
     "bodyFileName": "repos_hub4j-test-org_github-api-test-2.json",
     "headers": {
-      "Date": "Thu, 03 Oct 2019 18:57:57 GMT",
+      "Date": "Sat, 23 Jan 2021 05:30:28 GMT",
       "Content-Type": "application/json; charset=utf-8",
       "Server": "GitHub.com",
       "Status": "200 OK",
-      "X-RateLimit-Limit": "5000",
-      "X-RateLimit-Remaining": "4750",
-      "X-RateLimit-Reset": "1570132527",
       "Cache-Control": "private, max-age=60, s-maxage=60",
       "Vary": [
         "Accept, Authorization, Cookie, X-GitHub-OTP",
+        "Accept-Encoding, Accept, X-Requested-With",
         "Accept-Encoding"
       ],
-      "ETag": "W/\"65ee4cf55cf4d084267c80a5d39244c6\"",
-      "Last-Modified": "Thu, 03 Oct 2019 18:57:57 GMT",
-      "X-OAuth-Scopes": "admin:org, admin:org_hook, admin:public_key, admin:repo_hook, delete_repo, gist, notifications, repo, user, write:discussion",
+      "ETag": "W/\"10026c1f1a22ffaba0888b2d3e2501ab45ade2789609aa725a767f8593b8f060\"",
+      "last-modified": "Sat, 23 Jan 2021 05:30:27 GMT",
+      "X-OAuth-Scopes": "admin:org, admin:org_hook, admin:public_key, admin:repo_hook, delete_repo, gist, notifications, repo, user, workflow, write:discussion",
       "X-Accepted-OAuth-Scopes": "repo",
       "X-GitHub-Media-Type": "unknown, github.v3",
-      "Access-Control-Expose-Headers": "ETag, Link, Location, Retry-After, X-GitHub-OTP, X-RateLimit-Limit, X-RateLimit-Remaining, X-RateLimit-Reset, X-OAuth-Scopes, X-Accepted-OAuth-Scopes, X-Poll-Interval, X-GitHub-Media-Type",
-      "Access-Control-Allow-Origin": "*",
+      "X-RateLimit-Limit": "5000",
+      "X-RateLimit-Remaining": "4904",
+      "X-RateLimit-Reset": "1611382753",
+      "x-ratelimit-used": "96",
       "Strict-Transport-Security": "max-age=31536000; includeSubdomains; preload",
       "X-Frame-Options": "deny",
       "X-Content-Type-Options": "nosniff",
       "X-XSS-Protection": "1; mode=block",
       "Referrer-Policy": "origin-when-cross-origin, strict-origin-when-cross-origin",
       "Content-Security-Policy": "default-src 'none'",
-      "X-GitHub-Request-Id": "F3AD:3618:10E8DB:149FB6:5D9644B0"
+      "X-GitHub-Request-Id": "D9F6:8870:9D4A2:B9689:600BB46D"
     }
   },
-  "uuid": "31a86a0d-5120-47b8-a9bc-ec4b34a08080",
+  "uuid": "b0faf3a5-5d1d-4f5f-bcc0-32f5c182f4c4",
   "persistent": true,
   "insertionIndex": 2
 }

src/test/resources/org/kohsuke/github/AppTest/wiremock/testCreateAndListDeployments/mappings/repos_hub4j-test-org_github-api-test_deployments-3.json

@@ -1,56 +1,56 @@
 {
-  "id": "702b7123-86c1-41e0-bee7-f3cb89a3236d",
+  "id": "794202d0-93a7-4526-b91b-00059c377ee0",
   "name": "repos_hub4j-test-org_github-api-test_deployments",
   "request": {
     "url": "/repos/hub4j-test-org/github-api-test/deployments",
     "method": "POST",
-    "bodyPatterns": [
-      {
-        "equalToJson": "{\"ref\":\"master\",\"environment\":\"unittest\",\"payload\":\"{\\\"user\\\":\\\"atmos\\\",\\\"room_id\\\":123456}\",\"description\":\"question\"}",
-        "ignoreArrayOrder": true,
-        "ignoreExtraElements": true
-      }
-    ],
     "headers": {
       "Accept": {
         "equalTo": "application/vnd.github.ant-man-preview+json, application/vnd.github.flash-preview+json"
       }
-    }
+    },
+    "bodyPatterns": [
+      {
+        "equalToJson": "{\"ref\":\"main\",\"environment\":\"unittest\",\"payload\":\"{\\\"user\\\":\\\"atmos\\\",\\\"room_id\\\":123456}\",\"description\":\"question\"}",
+        "ignoreArrayOrder": true,
+        "ignoreExtraElements": false
+      }
+    ]
   },
   "response": {
     "status": 201,
     "bodyFileName": "repos_hub4j-test-org_github-api-test_deployments-3.json",
     "headers": {
-      "Date": "Thu, 03 Oct 2019 18:57:57 GMT",
+      "Date": "Sat, 23 Jan 2021 05:30:28 GMT",
       "Content-Type": "application/json; charset=utf-8",
       "Server": "GitHub.com",
       "Status": "201 Created",
-      "X-RateLimit-Limit": "5000",
-      "X-RateLimit-Remaining": "4749",
-      "X-RateLimit-Reset": "1570132527",
       "Cache-Control": "private, max-age=60, s-maxage=60",
       "Vary": [
         "Accept, Authorization, Cookie, X-GitHub-OTP",
+        "Accept-Encoding, Accept, X-Requested-With",
         "Accept-Encoding"
       ],
-      "ETag": "\"c76b22eae3a1d091db2c789a39fecda9\"",
-      "Last-Modified": "Thu, 03 Oct 2019 18:57:57 GMT",
-      "X-OAuth-Scopes": "admin:org, admin:org_hook, admin:public_key, admin:repo_hook, delete_repo, gist, notifications, repo, user, write:discussion",
+      "ETag": "\"d256e649a7f1dfa04498ff9107cd30d1f42dcf80793952739c20e04436165cf3\"",
+      "last-modified": "Sat, 23 Jan 2021 05:30:28 GMT",
+      "X-OAuth-Scopes": "admin:org, admin:org_hook, admin:public_key, admin:repo_hook, delete_repo, gist, notifications, repo, user, workflow, write:discussion",
       "X-Accepted-OAuth-Scopes": "",
-      "Location": "https://api.github.com/repos/hub4j-test-org/github-api-test/deployments/173089055",
-      "X-GitHub-Media-Type": "unknown, github.v3",
-      "Access-Control-Expose-Headers": "ETag, Link, Location, Retry-After, X-GitHub-OTP, X-RateLimit-Limit, X-RateLimit-Remaining, X-RateLimit-Reset, X-OAuth-Scopes, X-Accepted-OAuth-Scopes, X-Poll-Interval, X-GitHub-Media-Type",
-      "Access-Control-Allow-Origin": "*",
+      "Location": "https://api.github.com/repos/hub4j-test-org/github-api-test/deployments/315601563",
+      "X-GitHub-Media-Type": "github.ant-man-preview; format=json, github.flash-preview; format=json",
+      "X-RateLimit-Limit": "5000",
+      "X-RateLimit-Remaining": "4903",
+      "X-RateLimit-Reset": "1611382753",
+      "x-ratelimit-used": "97",
       "Strict-Transport-Security": "max-age=31536000; includeSubdomains; preload",
       "X-Frame-Options": "deny",
       "X-Content-Type-Options": "nosniff",
       "X-XSS-Protection": "1; mode=block",
       "Referrer-Policy": "origin-when-cross-origin, strict-origin-when-cross-origin",
       "Content-Security-Policy": "default-src 'none'",
-      "X-GitHub-Request-Id": "F3AD:3618:10E8DF:149FEF:5D9644B5"
+      "X-GitHub-Request-Id": "D9F6:8870:9D4A9:B9794:600BB474"
     }
   },
-  "uuid": "702b7123-86c1-41e0-bee7-f3cb89a3236d",
+  "uuid": "794202d0-93a7-4526-b91b-00059c377ee0",
   "persistent": true,
   "insertionIndex": 3
 }

src/test/resources/org/kohsuke/github/AppTest/wiremock/testCreateAndListDeployments/mappings/repos_hub4j-test-org_github-api-test_deployments-4.json

@@ -1,8 +1,8 @@
 {
-  "id": "b4bcdadb-a708-4509-9382-479f300eb172",
+  "id": "ad687411-71ba-4851-91b0-2ace8f6111a2",
   "name": "repos_hub4j-test-org_github-api-test_deployments",
   "request": {
-    "url": "/repos/hub4j-test-org/github-api-test/deployments?ref=master&environment=unittest",
+    "url": "/repos/hub4j-test-org/github-api-test/deployments?ref=main&environment=unittest",
     "method": "GET",
     "headers": {
       "Accept": {
@@ -14,34 +14,34 @@
     "status": 200,
     "bodyFileName": "repos_hub4j-test-org_github-api-test_deployments-4.json",
     "headers": {
-      "Date": "Thu, 03 Oct 2019 18:57:58 GMT",
+      "Date": "Sat, 23 Jan 2021 05:30:29 GMT",
       "Content-Type": "application/json; charset=utf-8",
       "Server": "GitHub.com",
       "Status": "200 OK",
-      "X-RateLimit-Limit": "5000",
-      "X-RateLimit-Remaining": "4748",
-      "X-RateLimit-Reset": "1570132527",
       "Cache-Control": "private, max-age=60, s-maxage=60",
       "Vary": [
         "Accept, Authorization, Cookie, X-GitHub-OTP",
+        "Accept-Encoding, Accept, X-Requested-With",
         "Accept-Encoding"
       ],
-      "ETag": "W/\"b47f03577f96c1081341944009009f7f\"",
-      "X-OAuth-Scopes": "admin:org, admin:org_hook, admin:public_key, admin:repo_hook, delete_repo, gist, notifications, repo, user, write:discussion",
+      "ETag": "W/\"37d9142674c76d3eb0593d8a62756ab18011fd64315c81dbfa2c7f7dd7596dd7\"",
+      "X-OAuth-Scopes": "admin:org, admin:org_hook, admin:public_key, admin:repo_hook, delete_repo, gist, notifications, repo, user, workflow, write:discussion",
       "X-Accepted-OAuth-Scopes": "repo, repo_deployment",
-      "X-GitHub-Media-Type": "unknown, github.v3",
-      "Access-Control-Expose-Headers": "ETag, Link, Location, Retry-After, X-GitHub-OTP, X-RateLimit-Limit, X-RateLimit-Remaining, X-RateLimit-Reset, X-OAuth-Scopes, X-Accepted-OAuth-Scopes, X-Poll-Interval, X-GitHub-Media-Type",
-      "Access-Control-Allow-Origin": "*",
+      "X-GitHub-Media-Type": "github.ant-man-preview; format=json, github.flash-preview; format=json",
+      "X-RateLimit-Limit": "5000",
+      "X-RateLimit-Remaining": "4902",
+      "X-RateLimit-Reset": "1611382753",
+      "x-ratelimit-used": "98",
       "Strict-Transport-Security": "max-age=31536000; includeSubdomains; preload",
       "X-Frame-Options": "deny",
       "X-Content-Type-Options": "nosniff",
       "X-XSS-Protection": "1; mode=block",
       "Referrer-Policy": "origin-when-cross-origin, strict-origin-when-cross-origin",
       "Content-Security-Policy": "default-src 'none'",
-      "X-GitHub-Request-Id": "F3AD:3618:10E8E2:149FF2:5D9644B5"
+      "X-GitHub-Request-Id": "D9F6:8870:9D4AF:B979B:600BB474"
     }
   },
-  "uuid": "b4bcdadb-a708-4509-9382-479f300eb172",
+  "uuid": "ad687411-71ba-4851-91b0-2ace8f6111a2",
   "persistent": true,
   "insertionIndex": 4
 }

src/test/resources/org/kohsuke/github/AppTest/wiremock/testCreateAndListDeployments/mappings/repos_hub4j-test-org_github-api-test_deployments_315601563-5.json

@@ -0,0 +1,42 @@
+{
+  "id": "3360bee1-e184-49de-8434-9fabafc6e075",
+  "name": "repos_hub4j-test-org_github-api-test_deployments_315601563",
+  "request": {
+    "url": "/repos/hub4j-test-org/github-api-test/deployments/315601563",
+    "method": "DELETE",
+    "headers": {
+      "Accept": {
+        "equalTo": "text/html, image/gif, image/jpeg, *; q=.2, */*; q=.2"
+      }
+    }
+  },
+  "response": {
+    "status": 204,
+    "headers": {
+      "Date": "Sat, 23 Jan 2021 05:30:29 GMT",
+      "Server": "GitHub.com",
+      "Status": "204 No Content",
+      "X-OAuth-Scopes": "admin:org, admin:org_hook, admin:public_key, admin:repo_hook, delete_repo, gist, notifications, repo, user, workflow, write:discussion",
+      "X-Accepted-OAuth-Scopes": "",
+      "X-GitHub-Media-Type": "unknown, github.v3",
+      "X-RateLimit-Limit": "5000",
+      "X-RateLimit-Remaining": "4901",
+      "X-RateLimit-Reset": "1611382753",
+      "x-ratelimit-used": "99",
+      "Strict-Transport-Security": "max-age=31536000; includeSubdomains; preload",
+      "X-Frame-Options": "deny",
+      "X-Content-Type-Options": "nosniff",
+      "X-XSS-Protection": "1; mode=block",
+      "Referrer-Policy": "origin-when-cross-origin, strict-origin-when-cross-origin",
+      "Content-Security-Policy": "default-src 'none'",
+      "Vary": [
+        "Accept-Encoding, Accept, X-Requested-With",
+        "Accept-Encoding"
+      ],
+      "X-GitHub-Request-Id": "D9F6:8870:9D4B5:B97A0:600BB475"
+    }
+  },
+  "uuid": "3360bee1-e184-49de-8434-9fabafc6e075",
+  "persistent": true,
+  "insertionIndex": 5
+}

src/test/resources/org/kohsuke/github/AppTest/wiremock/testCreateAndListDeployments/mappings/user-1.json

@@ -1,5 +1,5 @@
 {
-  "id": "6d2dcbf4-4abf-4180-9b55-ca2931ca31c5",
+  "id": "9e2336dc-4e61-49ef-a171-2d408b3bf5ac",
   "name": "user",
   "request": {
     "url": "/user",
@@ -14,35 +14,35 @@
     "status": 200,
     "bodyFileName": "user-1.json",
     "headers": {
-      "Date": "Thu, 03 Oct 2019 18:57:52 GMT",
+      "Date": "Sat, 23 Jan 2021 05:30:21 GMT",
       "Content-Type": "application/json; charset=utf-8",
       "Server": "GitHub.com",
       "Status": "200 OK",
-      "X-RateLimit-Limit": "5000",
-      "X-RateLimit-Remaining": "4759",
-      "X-RateLimit-Reset": "1570132527",
       "Cache-Control": "private, max-age=60, s-maxage=60",
       "Vary": [
         "Accept, Authorization, Cookie, X-GitHub-OTP",
+        "Accept-Encoding, Accept, X-Requested-With",
         "Accept-Encoding"
       ],
-      "ETag": "W/\"cf6199fecf47b59c42190e1e11147ee2\"",
-      "Last-Modified": "Tue, 24 Sep 2019 19:32:29 GMT",
-      "X-OAuth-Scopes": "admin:org, admin:org_hook, admin:public_key, admin:repo_hook, delete_repo, gist, notifications, repo, user, write:discussion",
+      "ETag": "W/\"c8b61de8f7b00ef1a040d10e88b51dd065defb82f7d94a95a97b3dbab636edbe\"",
+      "last-modified": "Fri, 22 Jan 2021 16:38:42 GMT",
+      "X-OAuth-Scopes": "admin:org, admin:org_hook, admin:public_key, admin:repo_hook, delete_repo, gist, notifications, repo, user, workflow, write:discussion",
       "X-Accepted-OAuth-Scopes": "",
       "X-GitHub-Media-Type": "unknown, github.v3",
-      "Access-Control-Expose-Headers": "ETag, Link, Location, Retry-After, X-GitHub-OTP, X-RateLimit-Limit, X-RateLimit-Remaining, X-RateLimit-Reset, X-OAuth-Scopes, X-Accepted-OAuth-Scopes, X-Poll-Interval, X-GitHub-Media-Type",
-      "Access-Control-Allow-Origin": "*",
+      "X-RateLimit-Limit": "5000",
+      "X-RateLimit-Remaining": "4909",
+      "X-RateLimit-Reset": "1611382753",
+      "x-ratelimit-used": "91",
       "Strict-Transport-Security": "max-age=31536000; includeSubdomains; preload",
       "X-Frame-Options": "deny",
       "X-Content-Type-Options": "nosniff",
       "X-XSS-Protection": "1; mode=block",
       "Referrer-Policy": "origin-when-cross-origin, strict-origin-when-cross-origin",
       "Content-Security-Policy": "default-src 'none'",
-      "X-GitHub-Request-Id": "F3AD:3618:10E8AA:149FB4:5D9644B0"
+      "X-GitHub-Request-Id": "D9F6:8870:9D3CD:B9683:600BB46D"
     }
   },
-  "uuid": "6d2dcbf4-4abf-4180-9b55-ca2931ca31c5",
+  "uuid": "9e2336dc-4e61-49ef-a171-2d408b3bf5ac",
   "persistent": true,
   "insertionIndex": 1
 }

src/test/resources/org/kohsuke/github/AppTest/wiremock/testCreateCommitComment/__files/repos_kohsuke_sandbox-ant-3.json

@@ -8,7 +8,7 @@
     "login": "kohsuke",
     "id": 50003,
     "node_id": "MDQ6VXNlcjUwMDAz",
-    "avatar_url": "https://avatars1.githubusercontent.com/u/50003?v=4",
+    "avatar_url": "https://avatars.githubusercontent.com/u/50003?v=4",
     "gravatar_id": "",
     "url": "https://api.github.com/users/kohsuke",
     "html_url": "https://github.com/kohsuke",
@@ -96,6 +96,7 @@
     "push": false,
     "pull": true
   },
+  "temp_clone_token": "",
   "parent": {
     "id": 3231216,
     "node_id": "MDEwOlJlcG9zaXRvcnkzMjMxMjE2",
@@ -106,7 +107,7 @@
       "login": "kohsuke2",
       "id": 1329242,
       "node_id": "MDQ6VXNlcjEzMjkyNDI=",
-      "avatar_url": "https://avatars2.githubusercontent.com/u/1329242?v=4",
+      "avatar_url": "https://avatars.githubusercontent.com/u/1329242?v=4",
       "gravatar_id": "",
       "url": "https://api.github.com/users/kohsuke2",
       "html_url": "https://github.com/kohsuke2",
@@ -200,7 +201,7 @@
       "login": "kohsuke2",
       "id": 1329242,
       "node_id": "MDQ6VXNlcjEzMjkyNDI=",
-      "avatar_url": "https://avatars2.githubusercontent.com/u/1329242?v=4",
+      "avatar_url": "https://avatars.githubusercontent.com/u/1329242?v=4",
       "gravatar_id": "",
       "url": "https://api.github.com/users/kohsuke2",
       "html_url": "https://github.com/kohsuke2",

src/test/resources/org/kohsuke/github/AppTest/wiremock/testCreateCommitComment/__files/repos_kohsuke_sandbox-ant_comments_46267761-7.json

@@ -1,13 +1,13 @@
 {
-  "url": "https://api.github.com/repos/kohsuke/sandbox-ant/comments/35673784",
-  "html_url": "https://github.com/kohsuke/sandbox-ant/commit/8ae38db0ea5837313ab5f39d43a6f73de3bd9000#commitcomment-35673784",
-  "id": 35673784,
-  "node_id": "MDEzOkNvbW1pdENvbW1lbnQzNTY3Mzc4NA==",
+  "url": "https://api.github.com/repos/kohsuke/sandbox-ant/comments/46267761",
+  "html_url": "https://github.com/kohsuke/sandbox-ant/commit/8ae38db0ea5837313ab5f39d43a6f73de3bd9000#commitcomment-46267761",
+  "id": 46267761,
+  "node_id": "MDEzOkNvbW1pdENvbW1lbnQ0NjI2Nzc2MQ==",
   "user": {
     "login": "bitwiseman",
     "id": 1958953,
     "node_id": "MDQ6VXNlcjE5NTg5NTM=",
-    "avatar_url": "https://avatars3.githubusercontent.com/u/1958953?v=4",
+    "avatar_url": "https://avatars.githubusercontent.com/u/1958953?v=4",
     "gravatar_id": "",
     "url": "https://api.github.com/users/bitwiseman",
     "html_url": "https://github.com/bitwiseman",
@@ -27,8 +27,8 @@
   "line": null,
   "path": null,
   "commit_id": "8ae38db0ea5837313ab5f39d43a6f73de3bd9000",
-  "created_at": "2019-10-26T01:28:59Z",
-  "updated_at": "2019-10-26T01:28:59Z",
+  "created_at": "2021-01-23T06:39:40Z",
+  "updated_at": "2021-01-23T06:39:40Z",
   "author_association": "NONE",
   "body": "updated text"
 }

src/test/resources/org/kohsuke/github/AppTest/wiremock/testCreateCommitComment/__files/repos_kohsuke_sandbox-ant_commits_8ae38db0ea5837313ab5f39d43a6f73de3bd9000-4.json

@@ -33,7 +33,7 @@
     "login": "kohsuke",
     "id": 50003,
     "node_id": "MDQ6VXNlcjUwMDAz",
-    "avatar_url": "https://avatars1.githubusercontent.com/u/50003?v=4",
+    "avatar_url": "https://avatars.githubusercontent.com/u/50003?v=4",
     "gravatar_id": "",
     "url": "https://api.github.com/users/kohsuke",
     "html_url": "https://github.com/kohsuke",
@@ -53,7 +53,7 @@
     "login": "kohsuke",
     "id": 50003,
     "node_id": "MDQ6VXNlcjUwMDAz",
-    "avatar_url": "https://avatars1.githubusercontent.com/u/50003?v=4",
+    "avatar_url": "https://avatars.githubusercontent.com/u/50003?v=4",
     "gravatar_id": "",
     "url": "https://api.github.com/users/kohsuke",
     "html_url": "https://github.com/kohsuke",

src/test/resources/org/kohsuke/github/AppTest/wiremock/testCreateCommitComment/__files/repos_kohsuke_sandbox-ant_commits_8ae38db0ea5837313ab5f39d43a6f73de3bd9000_comments-5.json

@@ -1,13 +1,13 @@
 {
-  "url": "https://api.github.com/repos/kohsuke/sandbox-ant/comments/35673784",
-  "html_url": "https://github.com/kohsuke/sandbox-ant/commit/8ae38db0ea5837313ab5f39d43a6f73de3bd9000#commitcomment-35673784",
-  "id": 35673784,
-  "node_id": "MDEzOkNvbW1pdENvbW1lbnQzNTY3Mzc4NA==",
+  "url": "https://api.github.com/repos/kohsuke/sandbox-ant/comments/46267761",
+  "html_url": "https://github.com/kohsuke/sandbox-ant/commit/8ae38db0ea5837313ab5f39d43a6f73de3bd9000#commitcomment-46267761",
+  "id": 46267761,
+  "node_id": "MDEzOkNvbW1pdENvbW1lbnQ0NjI2Nzc2MQ==",
   "user": {
     "login": "bitwiseman",
     "id": 1958953,
     "node_id": "MDQ6VXNlcjE5NTg5NTM=",
-    "avatar_url": "https://avatars3.githubusercontent.com/u/1958953?v=4",
+    "avatar_url": "https://avatars.githubusercontent.com/u/1958953?v=4",
     "gravatar_id": "",
     "url": "https://api.github.com/users/bitwiseman",
     "html_url": "https://github.com/bitwiseman",
@@ -27,8 +27,8 @@
   "line": null,
   "path": null,
   "commit_id": "8ae38db0ea5837313ab5f39d43a6f73de3bd9000",
-  "created_at": "2019-10-26T01:28:59Z",
-  "updated_at": "2019-10-26T01:28:59Z",
+  "created_at": "2021-01-23T06:39:40Z",
+  "updated_at": "2021-01-23T06:39:40Z",
   "author_association": "NONE",
   "body": "[testing](http://kohsuse.org/)"
 }

src/test/resources/org/kohsuke/github/AppTest/wiremock/testCreateCommitComment/__files/user-1.json

@@ -2,7 +2,7 @@
   "login": "bitwiseman",
   "id": 1958953,
   "node_id": "MDQ6VXNlcjE5NTg5NTM=",
-  "avatar_url": "https://avatars3.githubusercontent.com/u/1958953?v=4",
+  "avatar_url": "https://avatars.githubusercontent.com/u/1958953?v=4",
   "gravatar_id": "",
   "url": "https://api.github.com/users/bitwiseman",
   "html_url": "https://github.com/bitwiseman",
@@ -23,17 +23,18 @@
   "location": "Seattle, WA, USA",
   "email": "bitwiseman@gmail.com",
   "hireable": null,
-  "bio": "https://twitter.com/bitwiseman",
-  "public_repos": 169,
+  "bio": null,
+  "twitter_username": "bitwiseman",
+  "public_repos": 201,
   "public_gists": 7,
-  "followers": 139,
-  "following": 9,
+  "followers": 176,
+  "following": 11,
   "created_at": "2012-07-11T20:38:33Z",
-  "updated_at": "2019-09-24T19:32:29Z",
-  "private_gists": 7,
-  "total_private_repos": 9,
+  "updated_at": "2021-01-22T16:38:42Z",
+  "private_gists": 19,
+  "total_private_repos": 17,
   "owned_private_repos": 0,
-  "disk_usage": 33697,
+  "disk_usage": 33700,
   "collaborators": 0,
   "two_factor_authentication": true,
   "plan": {

src/test/resources/org/kohsuke/github/AppTest/wiremock/testCreateCommitComment/__files/users_kohsuke-2.json

@@ -2,7 +2,7 @@
   "login": "kohsuke",
   "id": 50003,
   "node_id": "MDQ6VXNlcjUwMDAz",
-  "avatar_url": "https://avatars1.githubusercontent.com/u/50003?v=4",
+  "avatar_url": "https://avatars.githubusercontent.com/u/50003?v=4",
   "gravatar_id": "",
   "url": "https://api.github.com/users/kohsuke",
   "html_url": "https://github.com/kohsuke",
@@ -18,16 +18,17 @@
   "type": "User",
   "site_admin": false,
   "name": "Kohsuke Kawaguchi",
-  "company": "CloudBees, Inc.",
-  "blog": "http://www.kohsuke.org/",
+  "company": "@launchableinc ",
+  "blog": "https://www.kohsuke.org/",
   "location": "San Jose, California",
   "email": "kk@kohsuke.org",
   "hireable": null,
   "bio": null,
-  "public_repos": 257,
-  "public_gists": 109,
-  "followers": 1692,
+  "twitter_username": null,
+  "public_repos": 262,
+  "public_gists": 113,
+  "followers": 1886,
   "following": 3,
   "created_at": "2009-01-28T18:53:21Z",
-  "updated_at": "2019-10-25T16:53:26Z"
+  "updated_at": "2021-01-22T19:41:07Z"
 }

src/test/resources/org/kohsuke/github/AppTest/wiremock/testCreateCommitComment/mappings/repos_kohsuke_sandbox-ant-3.json

@@ -1,5 +1,5 @@
 {
-  "id": "3fd5d206-9d71-4f2a-bc95-605c06b6f793",
+  "id": "525a2ad5-8560-42d6-b12d-25fa6d7c2806",
   "name": "repos_kohsuke_sandbox-ant",
   "request": {
     "url": "/repos/kohsuke/sandbox-ant",
@@ -14,35 +14,35 @@
     "status": 200,
     "bodyFileName": "repos_kohsuke_sandbox-ant-3.json",
     "headers": {
-      "Date": "Sat, 26 Oct 2019 01:28:58 GMT",
+      "Date": "Sat, 23 Jan 2021 06:39:39 GMT",
       "Content-Type": "application/json; charset=utf-8",
       "Server": "GitHub.com",
       "Status": "200 OK",
-      "X-RateLimit-Limit": "5000",
-      "X-RateLimit-Remaining": "4242",
-      "X-RateLimit-Reset": "1572055286",
       "Cache-Control": "private, max-age=60, s-maxage=60",
       "Vary": [
         "Accept, Authorization, Cookie, X-GitHub-OTP",
+        "Accept-Encoding, Accept, X-Requested-With",
         "Accept-Encoding"
       ],
-      "ETag": "W/\"6d4495f0d482e4612ed1964d37884bce\"",
-      "Last-Modified": "Tue, 13 Aug 2019 14:56:58 GMT",
-      "X-OAuth-Scopes": "admin:org, admin:org_hook, admin:public_key, admin:repo_hook, delete_repo, gist, notifications, repo, user, write:discussion",
+      "ETag": "W/\"7ad6797858a55e4d4576e2481c25ba68b88b778461b12575e2c2702cce47585f\"",
+      "last-modified": "Tue, 13 Aug 2019 14:56:58 GMT",
+      "X-OAuth-Scopes": "admin:org, admin:org_hook, admin:public_key, admin:repo_hook, delete_repo, gist, notifications, repo, user, workflow, write:discussion",
       "X-Accepted-OAuth-Scopes": "repo",
       "X-GitHub-Media-Type": "unknown, github.v3",
-      "Access-Control-Expose-Headers": "ETag, Link, Location, Retry-After, X-GitHub-OTP, X-RateLimit-Limit, X-RateLimit-Remaining, X-RateLimit-Reset, X-OAuth-Scopes, X-Accepted-OAuth-Scopes, X-Poll-Interval, X-GitHub-Media-Type",
-      "Access-Control-Allow-Origin": "*",
+      "X-RateLimit-Limit": "5000",
+      "X-RateLimit-Remaining": "4945",
+      "X-RateLimit-Reset": "1611386378",
+      "x-ratelimit-used": "55",
       "Strict-Transport-Security": "max-age=31536000; includeSubdomains; preload",
       "X-Frame-Options": "deny",
       "X-Content-Type-Options": "nosniff",
       "X-XSS-Protection": "1; mode=block",
       "Referrer-Policy": "origin-when-cross-origin, strict-origin-when-cross-origin",
       "Content-Security-Policy": "default-src 'none'",
-      "X-GitHub-Request-Id": "CB24:8340:ED2364:116FE52:5DB3A15A"
+      "X-GitHub-Request-Id": "E9F0:5E21:C00DF:DCE23:600BC4AB"
     }
   },
-  "uuid": "3fd5d206-9d71-4f2a-bc95-605c06b6f793",
+  "uuid": "525a2ad5-8560-42d6-b12d-25fa6d7c2806",
   "persistent": true,
   "insertionIndex": 3
 }

src/test/resources/org/kohsuke/github/AppTest/wiremock/testCreateCommitComment/mappings/repos_kohsuke_sandbox-ant_comments_46267761-7.json

@@ -1,54 +1,54 @@
 {
-  "id": "70a63f41-02d3-404e-af0b-8e1c3cd00494",
-  "name": "repos_kohsuke_sandbox-ant_comments_35673784",
+  "id": "4eccc8fc-0026-4272-93b8-76a31a95eeb5",
+  "name": "repos_kohsuke_sandbox-ant_comments_46267761",
   "request": {
-    "url": "/repos/kohsuke/sandbox-ant/comments/35673784",
+    "url": "/repos/kohsuke/sandbox-ant/comments/46267761",
     "method": "PATCH",
-    "bodyPatterns": [
-      {
-        "equalToJson": "{\"body\":\"updated text\"}",
-        "ignoreArrayOrder": true,
-        "ignoreExtraElements": true
-      }
-    ],
     "headers": {
       "Accept": {
         "equalTo": "text/html, image/gif, image/jpeg, *; q=.2, */*; q=.2"
       }
-    }
+    },
+    "bodyPatterns": [
+      {
+        "equalToJson": "{\"body\":\"updated text\"}",
+        "ignoreArrayOrder": true,
+        "ignoreExtraElements": false
+      }
+    ]
   },
   "response": {
     "status": 200,
-    "bodyFileName": "repos_kohsuke_sandbox-ant_comments_35673784-6.json",
+    "bodyFileName": "repos_kohsuke_sandbox-ant_comments_46267761-7.json",
     "headers": {
-      "Date": "Sat, 26 Oct 2019 01:28:59 GMT",
+      "Date": "Sat, 23 Jan 2021 06:39:41 GMT",
       "Content-Type": "application/json; charset=utf-8",
       "Server": "GitHub.com",
       "Status": "200 OK",
-      "X-RateLimit-Limit": "5000",
-      "X-RateLimit-Remaining": "4239",
-      "X-RateLimit-Reset": "1572055286",
       "Cache-Control": "private, max-age=60, s-maxage=60",
       "Vary": [
         "Accept, Authorization, Cookie, X-GitHub-OTP",
+        "Accept-Encoding, Accept, X-Requested-With",
         "Accept-Encoding"
       ],
-      "ETag": "W/\"e22c642208efa831e007ec061a30aae3\"",
-      "X-OAuth-Scopes": "admin:org, admin:org_hook, admin:public_key, admin:repo_hook, delete_repo, gist, notifications, repo, user, write:discussion",
+      "ETag": "W/\"9e8eb640e5722329d90564fe83bd1f435fc96bb91d69f800343394957c050e78\"",
+      "X-OAuth-Scopes": "admin:org, admin:org_hook, admin:public_key, admin:repo_hook, delete_repo, gist, notifications, repo, user, workflow, write:discussion",
       "X-Accepted-OAuth-Scopes": "",
       "X-GitHub-Media-Type": "unknown, github.v3",
-      "Access-Control-Expose-Headers": "ETag, Link, Location, Retry-After, X-GitHub-OTP, X-RateLimit-Limit, X-RateLimit-Remaining, X-RateLimit-Reset, X-OAuth-Scopes, X-Accepted-OAuth-Scopes, X-Poll-Interval, X-GitHub-Media-Type",
-      "Access-Control-Allow-Origin": "*",
+      "X-RateLimit-Limit": "5000",
+      "X-RateLimit-Remaining": "4941",
+      "X-RateLimit-Reset": "1611386378",
+      "x-ratelimit-used": "59",
       "Strict-Transport-Security": "max-age=31536000; includeSubdomains; preload",
       "X-Frame-Options": "deny",
       "X-Content-Type-Options": "nosniff",
       "X-XSS-Protection": "1; mode=block",
       "Referrer-Policy": "origin-when-cross-origin, strict-origin-when-cross-origin",
       "Content-Security-Policy": "default-src 'none'",
-      "X-GitHub-Request-Id": "CB24:8340:ED23BA:116FEBA:5DB3A15B"
+      "X-GitHub-Request-Id": "E9F0:5E21:C00FF:DCE46:600BC4AC"
     }
   },
-  "uuid": "70a63f41-02d3-404e-af0b-8e1c3cd00494",
+  "uuid": "4eccc8fc-0026-4272-93b8-76a31a95eeb5",
   "persistent": true,
-  "insertionIndex": 6
+  "insertionIndex": 7
 }

src/test/resources/org/kohsuke/github/AppTest/wiremock/testCreateCommitComment/mappings/repos_kohsuke_sandbox-ant_comments_46267761-8.json

@@ -0,0 +1,42 @@
+{
+  "id": "88c294c8-e966-4052-a675-7bb9038191e0",
+  "name": "repos_kohsuke_sandbox-ant_comments_46267761",
+  "request": {
+    "url": "/repos/kohsuke/sandbox-ant/comments/46267761",
+    "method": "DELETE",
+    "headers": {
+      "Accept": {
+        "equalTo": "text/html, image/gif, image/jpeg, *; q=.2, */*; q=.2"
+      }
+    }
+  },
+  "response": {
+    "status": 204,
+    "headers": {
+      "Date": "Sat, 23 Jan 2021 06:39:41 GMT",
+      "Server": "GitHub.com",
+      "Status": "204 No Content",
+      "X-OAuth-Scopes": "admin:org, admin:org_hook, admin:public_key, admin:repo_hook, delete_repo, gist, notifications, repo, user, workflow, write:discussion",
+      "X-Accepted-OAuth-Scopes": "",
+      "X-GitHub-Media-Type": "unknown, github.v3",
+      "X-RateLimit-Limit": "5000",
+      "X-RateLimit-Remaining": "4940",
+      "X-RateLimit-Reset": "1611386378",
+      "x-ratelimit-used": "60",
+      "Strict-Transport-Security": "max-age=31536000; includeSubdomains; preload",
+      "X-Frame-Options": "deny",
+      "X-Content-Type-Options": "nosniff",
+      "X-XSS-Protection": "1; mode=block",
+      "Referrer-Policy": "origin-when-cross-origin, strict-origin-when-cross-origin",
+      "Content-Security-Policy": "default-src 'none'",
+      "Vary": [
+        "Accept-Encoding, Accept, X-Requested-With",
+        "Accept-Encoding"
+      ],
+      "X-GitHub-Request-Id": "E9F0:5E21:C010A:DCE4F:600BC4AD"
+    }
+  },
+  "uuid": "88c294c8-e966-4052-a675-7bb9038191e0",
+  "persistent": true,
+  "insertionIndex": 8
+}

src/test/resources/org/kohsuke/github/AppTest/wiremock/testCreateCommitComment/mappings/repos_kohsuke_sandbox-ant_comments_46267761_reactions-6.json

@@ -0,0 +1,47 @@
+{
+  "id": "caa495ce-fc95-43ae-aa52-4b392bbc8beb",
+  "name": "repos_kohsuke_sandbox-ant_comments_46267761_reactions",
+  "request": {
+    "url": "/repos/kohsuke/sandbox-ant/comments/46267761/reactions",
+    "method": "GET",
+    "headers": {
+      "Accept": {
+        "equalTo": "application/vnd.github.squirrel-girl-preview+json"
+      }
+    }
+  },
+  "response": {
+    "status": 200,
+    "body": "[]",
+    "headers": {
+      "Date": "Sat, 23 Jan 2021 06:39:40 GMT",
+      "Content-Type": "application/json; charset=utf-8",
+      "Server": "GitHub.com",
+      "Status": "200 OK",
+      "Cache-Control": "private, max-age=60, s-maxage=60",
+      "Vary": [
+        "Accept, Authorization, Cookie, X-GitHub-OTP",
+        "Accept-Encoding, Accept, X-Requested-With",
+        "Accept-Encoding"
+      ],
+      "ETag": "\"7d0253ca51c378ca4fa4839bfd5bb1ac338f28e5ac8f6810cbdc8553513d942f\"",
+      "X-OAuth-Scopes": "admin:org, admin:org_hook, admin:public_key, admin:repo_hook, delete_repo, gist, notifications, repo, user, workflow, write:discussion",
+      "X-Accepted-OAuth-Scopes": "",
+      "X-GitHub-Media-Type": "github.squirrel-girl-preview; format=json",
+      "X-RateLimit-Limit": "5000",
+      "X-RateLimit-Remaining": "4942",
+      "X-RateLimit-Reset": "1611386378",
+      "x-ratelimit-used": "58",
+      "Strict-Transport-Security": "max-age=31536000; includeSubdomains; preload",
+      "X-Frame-Options": "deny",
+      "X-Content-Type-Options": "nosniff",
+      "X-XSS-Protection": "1; mode=block",
+      "Referrer-Policy": "origin-when-cross-origin, strict-origin-when-cross-origin",
+      "Content-Security-Policy": "default-src 'none'",
+      "X-GitHub-Request-Id": "E9F0:5E21:C00FA:DCE40:600BC4AC"
+    }
+  },
+  "uuid": "caa495ce-fc95-43ae-aa52-4b392bbc8beb",
+  "persistent": true,
+  "insertionIndex": 6
+}

src/test/resources/org/kohsuke/github/AppTest/wiremock/testCreateCommitComment/mappings/repos_kohsuke_sandbox-ant_commits_8ae38db0ea5837313ab5f39d43a6f73de3bd9000-4.json

@@ -1,5 +1,5 @@
 {
-  "id": "d1822d1b-5505-42ae-ba1d-ae0496d76c19",
+  "id": "7e297839-c637-4c01-a773-27c649765e10",
   "name": "repos_kohsuke_sandbox-ant_commits_8ae38db0ea5837313ab5f39d43a6f73de3bd9000",
   "request": {
     "url": "/repos/kohsuke/sandbox-ant/commits/8ae38db0ea5837313ab5f39d43a6f73de3bd9000",
@@ -14,35 +14,35 @@
     "status": 200,
     "bodyFileName": "repos_kohsuke_sandbox-ant_commits_8ae38db0ea5837313ab5f39d43a6f73de3bd9000-4.json",
     "headers": {
-      "Date": "Sat, 26 Oct 2019 01:28:58 GMT",
+      "Date": "Sat, 23 Jan 2021 06:39:40 GMT",
       "Content-Type": "application/json; charset=utf-8",
       "Server": "GitHub.com",
       "Status": "200 OK",
-      "X-RateLimit-Limit": "5000",
-      "X-RateLimit-Remaining": "4241",
-      "X-RateLimit-Reset": "1572055286",
       "Cache-Control": "private, max-age=60, s-maxage=60",
       "Vary": [
         "Accept, Authorization, Cookie, X-GitHub-OTP",
+        "Accept-Encoding, Accept, X-Requested-With",
         "Accept-Encoding"
       ],
-      "ETag": "W/\"f7ff477379d3449f082c148579824d0f\"",
-      "Last-Modified": "Tue, 24 Apr 2012 22:54:20 GMT",
-      "X-OAuth-Scopes": "admin:org, admin:org_hook, admin:public_key, admin:repo_hook, delete_repo, gist, notifications, repo, user, write:discussion",
+      "ETag": "W/\"139c7c0d228567659135acca1ec295558864e921bd0f87cebb65f72058545d99\"",
+      "last-modified": "Tue, 24 Apr 2012 22:54:20 GMT",
+      "X-OAuth-Scopes": "admin:org, admin:org_hook, admin:public_key, admin:repo_hook, delete_repo, gist, notifications, repo, user, workflow, write:discussion",
       "X-Accepted-OAuth-Scopes": "",
       "X-GitHub-Media-Type": "unknown, github.v3",
-      "Access-Control-Expose-Headers": "ETag, Link, Location, Retry-After, X-GitHub-OTP, X-RateLimit-Limit, X-RateLimit-Remaining, X-RateLimit-Reset, X-OAuth-Scopes, X-Accepted-OAuth-Scopes, X-Poll-Interval, X-GitHub-Media-Type",
-      "Access-Control-Allow-Origin": "*",
+      "X-RateLimit-Limit": "5000",
+      "X-RateLimit-Remaining": "4944",
+      "X-RateLimit-Reset": "1611386378",
+      "x-ratelimit-used": "56",
       "Strict-Transport-Security": "max-age=31536000; includeSubdomains; preload",
       "X-Frame-Options": "deny",
       "X-Content-Type-Options": "nosniff",
       "X-XSS-Protection": "1; mode=block",
       "Referrer-Policy": "origin-when-cross-origin, strict-origin-when-cross-origin",
       "Content-Security-Policy": "default-src 'none'",
-      "X-GitHub-Request-Id": "CB24:8340:ED2375:116FE66:5DB3A15A"
+      "X-GitHub-Request-Id": "E9F0:5E21:C00E8:DCE27:600BC4AB"
     }
   },
-  "uuid": "d1822d1b-5505-42ae-ba1d-ae0496d76c19",
+  "uuid": "7e297839-c637-4c01-a773-27c649765e10",
   "persistent": true,
   "insertionIndex": 4
 }

src/test/resources/org/kohsuke/github/AppTest/wiremock/testCreateCommitComment/mappings/repos_kohsuke_sandbox-ant_commits_8ae38db0ea5837313ab5f39d43a6f73de3bd9000_comments-5.json

@@ -1,55 +1,55 @@
 {
-  "id": "62d11eb1-6045-42a7-988a-aae9d9f3800b",
+  "id": "c0911355-a85d-40b9-b291-e0c098407d2e",
   "name": "repos_kohsuke_sandbox-ant_commits_8ae38db0ea5837313ab5f39d43a6f73de3bd9000_comments",
   "request": {
     "url": "/repos/kohsuke/sandbox-ant/commits/8ae38db0ea5837313ab5f39d43a6f73de3bd9000/comments",
     "method": "POST",
-    "bodyPatterns": [
-      {
-        "equalToJson": "{\"body\":\"[testing](http://kohsuse.org/)\"}",
-        "ignoreArrayOrder": true,
-        "ignoreExtraElements": true
-      }
-    ],
     "headers": {
       "Accept": {
         "equalTo": "text/html, image/gif, image/jpeg, *; q=.2, */*; q=.2"
       }
-    }
+    },
+    "bodyPatterns": [
+      {
+        "equalToJson": "{\"body\":\"[testing](http://kohsuse.org/)\"}",
+        "ignoreArrayOrder": true,
+        "ignoreExtraElements": false
+      }
+    ]
   },
   "response": {
     "status": 201,
     "bodyFileName": "repos_kohsuke_sandbox-ant_commits_8ae38db0ea5837313ab5f39d43a6f73de3bd9000_comments-5.json",
     "headers": {
-      "Date": "Sat, 26 Oct 2019 01:28:59 GMT",
+      "Date": "Sat, 23 Jan 2021 06:39:40 GMT",
       "Content-Type": "application/json; charset=utf-8",
       "Server": "GitHub.com",
       "Status": "201 Created",
-      "X-RateLimit-Limit": "5000",
-      "X-RateLimit-Remaining": "4240",
-      "X-RateLimit-Reset": "1572055286",
       "Cache-Control": "private, max-age=60, s-maxage=60",
       "Vary": [
         "Accept, Authorization, Cookie, X-GitHub-OTP",
+        "Accept-Encoding, Accept, X-Requested-With",
         "Accept-Encoding"
       ],
-      "ETag": "\"1ebfc3d7a9cbe1bfbab78c1636ef102a\"",
-      "X-OAuth-Scopes": "admin:org, admin:org_hook, admin:public_key, admin:repo_hook, delete_repo, gist, notifications, repo, user, write:discussion",
+      "ETag": "\"de435e64b07783ba615db4fd69d86e8c13c4fe1281f1265937cf7b887dad2579\"",
+      "X-OAuth-Scopes": "admin:org, admin:org_hook, admin:public_key, admin:repo_hook, delete_repo, gist, notifications, repo, user, workflow, write:discussion",
       "X-Accepted-OAuth-Scopes": "",
-      "Location": "https://api.github.com/repos/kohsuke/sandbox-ant/comments/35673784",
+      "Location": "https://api.github.com/repos/kohsuke/sandbox-ant/comments/46267761",
       "X-GitHub-Media-Type": "unknown, github.v3",
-      "Access-Control-Expose-Headers": "ETag, Link, Location, Retry-After, X-GitHub-OTP, X-RateLimit-Limit, X-RateLimit-Remaining, X-RateLimit-Reset, X-OAuth-Scopes, X-Accepted-OAuth-Scopes, X-Poll-Interval, X-GitHub-Media-Type",
-      "Access-Control-Allow-Origin": "*",
+      "X-RateLimit-Limit": "5000",
+      "X-RateLimit-Remaining": "4943",
+      "X-RateLimit-Reset": "1611386378",
+      "x-ratelimit-used": "57",
       "Strict-Transport-Security": "max-age=31536000; includeSubdomains; preload",
       "X-Frame-Options": "deny",
       "X-Content-Type-Options": "nosniff",
       "X-XSS-Protection": "1; mode=block",
       "Referrer-Policy": "origin-when-cross-origin, strict-origin-when-cross-origin",
       "Content-Security-Policy": "default-src 'none'",
-      "X-GitHub-Request-Id": "CB24:8340:ED2399:116FE83:5DB3A15A"
+      "X-GitHub-Request-Id": "E9F0:5E21:C00ED:DCE30:600BC4AC"
     }
   },
-  "uuid": "62d11eb1-6045-42a7-988a-aae9d9f3800b",
+  "uuid": "c0911355-a85d-40b9-b291-e0c098407d2e",
   "persistent": true,
   "insertionIndex": 5
 }

src/test/resources/org/kohsuke/github/AppTest/wiremock/testCreateCommitComment/mappings/user-1.json

@@ -1,5 +1,5 @@
 {
-  "id": "a9b48b44-c9ff-4434-9f98-64195b0c46ce",
+  "id": "4b33e8fd-7ae4-4141-8bfc-96d62e8361dc",
   "name": "user",
   "request": {
     "url": "/user",
@@ -14,35 +14,35 @@
     "status": 200,
     "bodyFileName": "user-1.json",
     "headers": {
-      "Date": "Sat, 26 Oct 2019 01:28:58 GMT",
+      "Date": "Sat, 23 Jan 2021 06:39:39 GMT",
       "Content-Type": "application/json; charset=utf-8",
       "Server": "GitHub.com",
       "Status": "200 OK",
-      "X-RateLimit-Limit": "5000",
-      "X-RateLimit-Remaining": "4245",
-      "X-RateLimit-Reset": "1572055286",
       "Cache-Control": "private, max-age=60, s-maxage=60",
       "Vary": [
         "Accept, Authorization, Cookie, X-GitHub-OTP",
+        "Accept-Encoding, Accept, X-Requested-With",
         "Accept-Encoding"
       ],
-      "ETag": "W/\"8c3d3dcf6fc5f9edaf26c902295396e5\"",
-      "Last-Modified": "Tue, 24 Sep 2019 19:32:29 GMT",
-      "X-OAuth-Scopes": "admin:org, admin:org_hook, admin:public_key, admin:repo_hook, delete_repo, gist, notifications, repo, user, write:discussion",
+      "ETag": "W/\"c8b61de8f7b00ef1a040d10e88b51dd065defb82f7d94a95a97b3dbab636edbe\"",
+      "last-modified": "Fri, 22 Jan 2021 16:38:42 GMT",
+      "X-OAuth-Scopes": "admin:org, admin:org_hook, admin:public_key, admin:repo_hook, delete_repo, gist, notifications, repo, user, workflow, write:discussion",
       "X-Accepted-OAuth-Scopes": "",
       "X-GitHub-Media-Type": "unknown, github.v3",
-      "Access-Control-Expose-Headers": "ETag, Link, Location, Retry-After, X-GitHub-OTP, X-RateLimit-Limit, X-RateLimit-Remaining, X-RateLimit-Reset, X-OAuth-Scopes, X-Accepted-OAuth-Scopes, X-Poll-Interval, X-GitHub-Media-Type",
-      "Access-Control-Allow-Origin": "*",
+      "X-RateLimit-Limit": "5000",
+      "X-RateLimit-Remaining": "4948",
+      "X-RateLimit-Reset": "1611386378",
+      "x-ratelimit-used": "52",
       "Strict-Transport-Security": "max-age=31536000; includeSubdomains; preload",
       "X-Frame-Options": "deny",
       "X-Content-Type-Options": "nosniff",
       "X-XSS-Protection": "1; mode=block",
       "Referrer-Policy": "origin-when-cross-origin, strict-origin-when-cross-origin",
       "Content-Security-Policy": "default-src 'none'",
-      "X-GitHub-Request-Id": "CB24:8340:ED234A:116FE30:5DB3A15A"
+      "X-GitHub-Request-Id": "E9F0:5E21:C00C9:DCE0A:600BC4AA"
     }
   },
-  "uuid": "a9b48b44-c9ff-4434-9f98-64195b0c46ce",
+  "uuid": "4b33e8fd-7ae4-4141-8bfc-96d62e8361dc",
   "persistent": true,
   "insertionIndex": 1
 }

src/test/resources/org/kohsuke/github/AppTest/wiremock/testCreateCommitComment/mappings/users_kohsuke-2.json

@@ -1,5 +1,5 @@
 {
-  "id": "a4924f94-0b1c-4cb0-bf1f-595ccb78aa41",
+  "id": "bdde4d6a-6b43-4ee2-8e93-4c4ec59bccf4",
   "name": "users_kohsuke",
   "request": {
     "url": "/users/kohsuke",
@@ -14,35 +14,35 @@
     "status": 200,
     "bodyFileName": "users_kohsuke-2.json",
     "headers": {
-      "Date": "Sat, 26 Oct 2019 01:28:58 GMT",
+      "Date": "Sat, 23 Jan 2021 06:39:39 GMT",
       "Content-Type": "application/json; charset=utf-8",
       "Server": "GitHub.com",
       "Status": "200 OK",
-      "X-RateLimit-Limit": "5000",
-      "X-RateLimit-Remaining": "4243",
-      "X-RateLimit-Reset": "1572055286",
       "Cache-Control": "private, max-age=60, s-maxage=60",
       "Vary": [
         "Accept, Authorization, Cookie, X-GitHub-OTP",
+        "Accept-Encoding, Accept, X-Requested-With",
         "Accept-Encoding"
       ],
-      "ETag": "W/\"99c27226f3b6139ef2af80ccbcd5d252\"",
-      "Last-Modified": "Fri, 25 Oct 2019 16:53:26 GMT",
-      "X-OAuth-Scopes": "admin:org, admin:org_hook, admin:public_key, admin:repo_hook, delete_repo, gist, notifications, repo, user, write:discussion",
+      "ETag": "W/\"e41eed9772453b3fbbdb7bba892d24e645750ddd73b3a74c68106566916b3312\"",
+      "last-modified": "Fri, 22 Jan 2021 19:41:07 GMT",
+      "X-OAuth-Scopes": "admin:org, admin:org_hook, admin:public_key, admin:repo_hook, delete_repo, gist, notifications, repo, user, workflow, write:discussion",
       "X-Accepted-OAuth-Scopes": "",
       "X-GitHub-Media-Type": "unknown, github.v3",
-      "Access-Control-Expose-Headers": "ETag, Link, Location, Retry-After, X-GitHub-OTP, X-RateLimit-Limit, X-RateLimit-Remaining, X-RateLimit-Reset, X-OAuth-Scopes, X-Accepted-OAuth-Scopes, X-Poll-Interval, X-GitHub-Media-Type",
-      "Access-Control-Allow-Origin": "*",
+      "X-RateLimit-Limit": "5000",
+      "X-RateLimit-Remaining": "4946",
+      "X-RateLimit-Reset": "1611386378",
+      "x-ratelimit-used": "54",
       "Strict-Transport-Security": "max-age=31536000; includeSubdomains; preload",
       "X-Frame-Options": "deny",
       "X-Content-Type-Options": "nosniff",
       "X-XSS-Protection": "1; mode=block",
       "Referrer-Policy": "origin-when-cross-origin, strict-origin-when-cross-origin",
       "Content-Security-Policy": "default-src 'none'",
-      "X-GitHub-Request-Id": "CB24:8340:ED235B:116FE3C:5DB3A15A"
+      "X-GitHub-Request-Id": "E9F0:5E21:C00DB:DCE0C:600BC4AB"
     }
   },
-  "uuid": "a4924f94-0b1c-4cb0-bf1f-595ccb78aa41",
+  "uuid": "bdde4d6a-6b43-4ee2-8e93-4c4ec59bccf4",
   "persistent": true,
   "insertionIndex": 2
 }

src/test/resources/org/kohsuke/github/AppTest/wiremock/testEventApi/__files/repos_daddyfatstacksbig_lerna-12.json

@@ -0,0 +1,308 @@
+{
+  "id": 197345677,
+  "node_id": "MDEwOlJlcG9zaXRvcnkxOTczNDU2Nzc=",
+  "name": "lerna",
+  "full_name": "daddyfatstacksBIG/lerna",
+  "private": false,
+  "owner": {
+    "login": "daddyfatstacksBIG",
+    "id": 50436469,
+    "node_id": "MDQ6VXNlcjUwNDM2NDY5",
+    "avatar_url": "https://avatars3.githubusercontent.com/u/50436469?v=4",
+    "gravatar_id": "",
+    "url": "https://api.github.com/users/daddyfatstacksBIG",
+    "html_url": "https://github.com/daddyfatstacksBIG",
+    "followers_url": "https://api.github.com/users/daddyfatstacksBIG/followers",
+    "following_url": "https://api.github.com/users/daddyfatstacksBIG/following{/other_user}",
+    "gists_url": "https://api.github.com/users/daddyfatstacksBIG/gists{/gist_id}",
+    "starred_url": "https://api.github.com/users/daddyfatstacksBIG/starred{/owner}{/repo}",
+    "subscriptions_url": "https://api.github.com/users/daddyfatstacksBIG/subscriptions",
+    "organizations_url": "https://api.github.com/users/daddyfatstacksBIG/orgs",
+    "repos_url": "https://api.github.com/users/daddyfatstacksBIG/repos",
+    "events_url": "https://api.github.com/users/daddyfatstacksBIG/events{/privacy}",
+    "received_events_url": "https://api.github.com/users/daddyfatstacksBIG/received_events",
+    "type": "User",
+    "site_admin": false
+  },
+  "html_url": "https://github.com/daddyfatstacksBIG/lerna",
+  "description": ":dragon: A tool for managing JavaScript projects with multiple packages.",
+  "fork": true,
+  "url": "https://api.github.com/repos/daddyfatstacksBIG/lerna",
+  "forks_url": "https://api.github.com/repos/daddyfatstacksBIG/lerna/forks",
+  "keys_url": "https://api.github.com/repos/daddyfatstacksBIG/lerna/keys{/key_id}",
+  "collaborators_url": "https://api.github.com/repos/daddyfatstacksBIG/lerna/collaborators{/collaborator}",
+  "teams_url": "https://api.github.com/repos/daddyfatstacksBIG/lerna/teams",
+  "hooks_url": "https://api.github.com/repos/daddyfatstacksBIG/lerna/hooks",
+  "issue_events_url": "https://api.github.com/repos/daddyfatstacksBIG/lerna/issues/events{/number}",
+  "events_url": "https://api.github.com/repos/daddyfatstacksBIG/lerna/events",
+  "assignees_url": "https://api.github.com/repos/daddyfatstacksBIG/lerna/assignees{/user}",
+  "branches_url": "https://api.github.com/repos/daddyfatstacksBIG/lerna/branches{/branch}",
+  "tags_url": "https://api.github.com/repos/daddyfatstacksBIG/lerna/tags",
+  "blobs_url": "https://api.github.com/repos/daddyfatstacksBIG/lerna/git/blobs{/sha}",
+  "git_tags_url": "https://api.github.com/repos/daddyfatstacksBIG/lerna/git/tags{/sha}",
+  "git_refs_url": "https://api.github.com/repos/daddyfatstacksBIG/lerna/git/refs{/sha}",
+  "trees_url": "https://api.github.com/repos/daddyfatstacksBIG/lerna/git/trees{/sha}",
+  "statuses_url": "https://api.github.com/repos/daddyfatstacksBIG/lerna/statuses/{sha}",
+  "languages_url": "https://api.github.com/repos/daddyfatstacksBIG/lerna/languages",
+  "stargazers_url": "https://api.github.com/repos/daddyfatstacksBIG/lerna/stargazers",
+  "contributors_url": "https://api.github.com/repos/daddyfatstacksBIG/lerna/contributors",
+  "subscribers_url": "https://api.github.com/repos/daddyfatstacksBIG/lerna/subscribers",
+  "subscription_url": "https://api.github.com/repos/daddyfatstacksBIG/lerna/subscription",
+  "commits_url": "https://api.github.com/repos/daddyfatstacksBIG/lerna/commits{/sha}",
+  "git_commits_url": "https://api.github.com/repos/daddyfatstacksBIG/lerna/git/commits{/sha}",
+  "comments_url": "https://api.github.com/repos/daddyfatstacksBIG/lerna/comments{/number}",
+  "issue_comment_url": "https://api.github.com/repos/daddyfatstacksBIG/lerna/issues/comments{/number}",
+  "contents_url": "https://api.github.com/repos/daddyfatstacksBIG/lerna/contents/{+path}",
+  "compare_url": "https://api.github.com/repos/daddyfatstacksBIG/lerna/compare/{base}...{head}",
+  "merges_url": "https://api.github.com/repos/daddyfatstacksBIG/lerna/merges",
+  "archive_url": "https://api.github.com/repos/daddyfatstacksBIG/lerna/{archive_format}{/ref}",
+  "downloads_url": "https://api.github.com/repos/daddyfatstacksBIG/lerna/downloads",
+  "issues_url": "https://api.github.com/repos/daddyfatstacksBIG/lerna/issues{/number}",
+  "pulls_url": "https://api.github.com/repos/daddyfatstacksBIG/lerna/pulls{/number}",
+  "milestones_url": "https://api.github.com/repos/daddyfatstacksBIG/lerna/milestones{/number}",
+  "notifications_url": "https://api.github.com/repos/daddyfatstacksBIG/lerna/notifications{?since,all,participating}",
+  "labels_url": "https://api.github.com/repos/daddyfatstacksBIG/lerna/labels{/name}",
+  "releases_url": "https://api.github.com/repos/daddyfatstacksBIG/lerna/releases{/id}",
+  "deployments_url": "https://api.github.com/repos/daddyfatstacksBIG/lerna/deployments",
+  "created_at": "2019-07-17T08:14:07Z",
+  "updated_at": "2020-06-09T04:42:07Z",
+  "pushed_at": "2020-06-09T04:42:04Z",
+  "git_url": "git://github.com/daddyfatstacksBIG/lerna.git",
+  "ssh_url": "git@github.com:daddyfatstacksBIG/lerna.git",
+  "clone_url": "https://github.com/daddyfatstacksBIG/lerna.git",
+  "svn_url": "https://github.com/daddyfatstacksBIG/lerna",
+  "homepage": "https://lerna.js.org",
+  "size": 8388,
+  "stargazers_count": 0,
+  "watchers_count": 0,
+  "language": "JavaScript",
+  "has_issues": false,
+  "has_projects": true,
+  "has_downloads": true,
+  "has_wiki": false,
+  "has_pages": false,
+  "forks_count": 0,
+  "mirror_url": null,
+  "archived": false,
+  "disabled": false,
+  "open_issues_count": 1,
+  "license": {
+    "key": "mit",
+    "name": "MIT License",
+    "spdx_id": "MIT",
+    "url": "https://api.github.com/licenses/mit",
+    "node_id": "MDc6TGljZW5zZTEz"
+  },
+  "forks": 0,
+  "open_issues": 1,
+  "watchers": 0,
+  "default_branch": "master",
+  "permissions": {
+    "admin": false,
+    "push": false,
+    "pull": true
+  },
+  "temp_clone_token": "",
+  "parent": {
+    "id": 47394776,
+    "node_id": "MDEwOlJlcG9zaXRvcnk0NzM5NDc3Ng==",
+    "name": "lerna",
+    "full_name": "lerna/lerna",
+    "private": false,
+    "owner": {
+      "login": "lerna",
+      "id": 19333396,
+      "node_id": "MDEyOk9yZ2FuaXphdGlvbjE5MzMzMzk2",
+      "avatar_url": "https://avatars2.githubusercontent.com/u/19333396?v=4",
+      "gravatar_id": "",
+      "url": "https://api.github.com/users/lerna",
+      "html_url": "https://github.com/lerna",
+      "followers_url": "https://api.github.com/users/lerna/followers",
+      "following_url": "https://api.github.com/users/lerna/following{/other_user}",
+      "gists_url": "https://api.github.com/users/lerna/gists{/gist_id}",
+      "starred_url": "https://api.github.com/users/lerna/starred{/owner}{/repo}",
+      "subscriptions_url": "https://api.github.com/users/lerna/subscriptions",
+      "organizations_url": "https://api.github.com/users/lerna/orgs",
+      "repos_url": "https://api.github.com/users/lerna/repos",
+      "events_url": "https://api.github.com/users/lerna/events{/privacy}",
+      "received_events_url": "https://api.github.com/users/lerna/received_events",
+      "type": "Organization",
+      "site_admin": false
+    },
+    "html_url": "https://github.com/lerna/lerna",
+    "description": ":dragon: A tool for managing JavaScript projects with multiple packages.",
+    "fork": false,
+    "url": "https://api.github.com/repos/lerna/lerna",
+    "forks_url": "https://api.github.com/repos/lerna/lerna/forks",
+    "keys_url": "https://api.github.com/repos/lerna/lerna/keys{/key_id}",
+    "collaborators_url": "https://api.github.com/repos/lerna/lerna/collaborators{/collaborator}",
+    "teams_url": "https://api.github.com/repos/lerna/lerna/teams",
+    "hooks_url": "https://api.github.com/repos/lerna/lerna/hooks",
+    "issue_events_url": "https://api.github.com/repos/lerna/lerna/issues/events{/number}",
+    "events_url": "https://api.github.com/repos/lerna/lerna/events",
+    "assignees_url": "https://api.github.com/repos/lerna/lerna/assignees{/user}",
+    "branches_url": "https://api.github.com/repos/lerna/lerna/branches{/branch}",
+    "tags_url": "https://api.github.com/repos/lerna/lerna/tags",
+    "blobs_url": "https://api.github.com/repos/lerna/lerna/git/blobs{/sha}",
+    "git_tags_url": "https://api.github.com/repos/lerna/lerna/git/tags{/sha}",
+    "git_refs_url": "https://api.github.com/repos/lerna/lerna/git/refs{/sha}",
+    "trees_url": "https://api.github.com/repos/lerna/lerna/git/trees{/sha}",
+    "statuses_url": "https://api.github.com/repos/lerna/lerna/statuses/{sha}",
+    "languages_url": "https://api.github.com/repos/lerna/lerna/languages",
+    "stargazers_url": "https://api.github.com/repos/lerna/lerna/stargazers",
+    "contributors_url": "https://api.github.com/repos/lerna/lerna/contributors",
+    "subscribers_url": "https://api.github.com/repos/lerna/lerna/subscribers",
+    "subscription_url": "https://api.github.com/repos/lerna/lerna/subscription",
+    "commits_url": "https://api.github.com/repos/lerna/lerna/commits{/sha}",
+    "git_commits_url": "https://api.github.com/repos/lerna/lerna/git/commits{/sha}",
+    "comments_url": "https://api.github.com/repos/lerna/lerna/comments{/number}",
+    "issue_comment_url": "https://api.github.com/repos/lerna/lerna/issues/comments{/number}",
+    "contents_url": "https://api.github.com/repos/lerna/lerna/contents/{+path}",
+    "compare_url": "https://api.github.com/repos/lerna/lerna/compare/{base}...{head}",
+    "merges_url": "https://api.github.com/repos/lerna/lerna/merges",
+    "archive_url": "https://api.github.com/repos/lerna/lerna/{archive_format}{/ref}",
+    "downloads_url": "https://api.github.com/repos/lerna/lerna/downloads",
+    "issues_url": "https://api.github.com/repos/lerna/lerna/issues{/number}",
+    "pulls_url": "https://api.github.com/repos/lerna/lerna/pulls{/number}",
+    "milestones_url": "https://api.github.com/repos/lerna/lerna/milestones{/number}",
+    "notifications_url": "https://api.github.com/repos/lerna/lerna/notifications{?since,all,participating}",
+    "labels_url": "https://api.github.com/repos/lerna/lerna/labels{/name}",
+    "releases_url": "https://api.github.com/repos/lerna/lerna/releases{/id}",
+    "deployments_url": "https://api.github.com/repos/lerna/lerna/deployments",
+    "created_at": "2015-12-04T09:36:55Z",
+    "updated_at": "2021-01-14T22:58:27Z",
+    "pushed_at": "2021-01-09T20:24:41Z",
+    "git_url": "git://github.com/lerna/lerna.git",
+    "ssh_url": "git@github.com:lerna/lerna.git",
+    "clone_url": "https://github.com/lerna/lerna.git",
+    "svn_url": "https://github.com/lerna/lerna",
+    "homepage": "https://lerna.js.org",
+    "size": 10634,
+    "stargazers_count": 26245,
+    "watchers_count": 26245,
+    "language": "JavaScript",
+    "has_issues": true,
+    "has_projects": true,
+    "has_downloads": true,
+    "has_wiki": false,
+    "has_pages": false,
+    "forks_count": 1674,
+    "mirror_url": null,
+    "archived": false,
+    "disabled": false,
+    "open_issues_count": 564,
+    "license": {
+      "key": "mit",
+      "name": "MIT License",
+      "spdx_id": "MIT",
+      "url": "https://api.github.com/licenses/mit",
+      "node_id": "MDc6TGljZW5zZTEz"
+    },
+    "forks": 1674,
+    "open_issues": 564,
+    "watchers": 26245,
+    "default_branch": "main"
+  },
+  "source": {
+    "id": 47394776,
+    "node_id": "MDEwOlJlcG9zaXRvcnk0NzM5NDc3Ng==",
+    "name": "lerna",
+    "full_name": "lerna/lerna",
+    "private": false,
+    "owner": {
+      "login": "lerna",
+      "id": 19333396,
+      "node_id": "MDEyOk9yZ2FuaXphdGlvbjE5MzMzMzk2",
+      "avatar_url": "https://avatars2.githubusercontent.com/u/19333396?v=4",
+      "gravatar_id": "",
+      "url": "https://api.github.com/users/lerna",
+      "html_url": "https://github.com/lerna",
+      "followers_url": "https://api.github.com/users/lerna/followers",
+      "following_url": "https://api.github.com/users/lerna/following{/other_user}",
+      "gists_url": "https://api.github.com/users/lerna/gists{/gist_id}",
+      "starred_url": "https://api.github.com/users/lerna/starred{/owner}{/repo}",
+      "subscriptions_url": "https://api.github.com/users/lerna/subscriptions",
+      "organizations_url": "https://api.github.com/users/lerna/orgs",
+      "repos_url": "https://api.github.com/users/lerna/repos",
+      "events_url": "https://api.github.com/users/lerna/events{/privacy}",
+      "received_events_url": "https://api.github.com/users/lerna/received_events",
+      "type": "Organization",
+      "site_admin": false
+    },
+    "html_url": "https://github.com/lerna/lerna",
+    "description": ":dragon: A tool for managing JavaScript projects with multiple packages.",
+    "fork": false,
+    "url": "https://api.github.com/repos/lerna/lerna",
+    "forks_url": "https://api.github.com/repos/lerna/lerna/forks",
+    "keys_url": "https://api.github.com/repos/lerna/lerna/keys{/key_id}",
+    "collaborators_url": "https://api.github.com/repos/lerna/lerna/collaborators{/collaborator}",
+    "teams_url": "https://api.github.com/repos/lerna/lerna/teams",
+    "hooks_url": "https://api.github.com/repos/lerna/lerna/hooks",
+    "issue_events_url": "https://api.github.com/repos/lerna/lerna/issues/events{/number}",
+    "events_url": "https://api.github.com/repos/lerna/lerna/events",
+    "assignees_url": "https://api.github.com/repos/lerna/lerna/assignees{/user}",
+    "branches_url": "https://api.github.com/repos/lerna/lerna/branches{/branch}",
+    "tags_url": "https://api.github.com/repos/lerna/lerna/tags",
+    "blobs_url": "https://api.github.com/repos/lerna/lerna/git/blobs{/sha}",
+    "git_tags_url": "https://api.github.com/repos/lerna/lerna/git/tags{/sha}",
+    "git_refs_url": "https://api.github.com/repos/lerna/lerna/git/refs{/sha}",
+    "trees_url": "https://api.github.com/repos/lerna/lerna/git/trees{/sha}",
+    "statuses_url": "https://api.github.com/repos/lerna/lerna/statuses/{sha}",
+    "languages_url": "https://api.github.com/repos/lerna/lerna/languages",
+    "stargazers_url": "https://api.github.com/repos/lerna/lerna/stargazers",
+    "contributors_url": "https://api.github.com/repos/lerna/lerna/contributors",
+    "subscribers_url": "https://api.github.com/repos/lerna/lerna/subscribers",
+    "subscription_url": "https://api.github.com/repos/lerna/lerna/subscription",
+    "commits_url": "https://api.github.com/repos/lerna/lerna/commits{/sha}",
+    "git_commits_url": "https://api.github.com/repos/lerna/lerna/git/commits{/sha}",
+    "comments_url": "https://api.github.com/repos/lerna/lerna/comments{/number}",
+    "issue_comment_url": "https://api.github.com/repos/lerna/lerna/issues/comments{/number}",
+    "contents_url": "https://api.github.com/repos/lerna/lerna/contents/{+path}",
+    "compare_url": "https://api.github.com/repos/lerna/lerna/compare/{base}...{head}",
+    "merges_url": "https://api.github.com/repos/lerna/lerna/merges",
+    "archive_url": "https://api.github.com/repos/lerna/lerna/{archive_format}{/ref}",
+    "downloads_url": "https://api.github.com/repos/lerna/lerna/downloads",
+    "issues_url": "https://api.github.com/repos/lerna/lerna/issues{/number}",
+    "pulls_url": "https://api.github.com/repos/lerna/lerna/pulls{/number}",
+    "milestones_url": "https://api.github.com/repos/lerna/lerna/milestones{/number}",
+    "notifications_url": "https://api.github.com/repos/lerna/lerna/notifications{?since,all,participating}",
+    "labels_url": "https://api.github.com/repos/lerna/lerna/labels{/name}",
+    "releases_url": "https://api.github.com/repos/lerna/lerna/releases{/id}",
+    "deployments_url": "https://api.github.com/repos/lerna/lerna/deployments",
+    "created_at": "2015-12-04T09:36:55Z",
+    "updated_at": "2021-01-14T22:58:27Z",
+    "pushed_at": "2021-01-09T20:24:41Z",
+    "git_url": "git://github.com/lerna/lerna.git",
+    "ssh_url": "git@github.com:lerna/lerna.git",
+    "clone_url": "https://github.com/lerna/lerna.git",
+    "svn_url": "https://github.com/lerna/lerna",
+    "homepage": "https://lerna.js.org",
+    "size": 10634,
+    "stargazers_count": 26245,
+    "watchers_count": 26245,
+    "language": "JavaScript",
+    "has_issues": true,
+    "has_projects": true,
+    "has_downloads": true,
+    "has_wiki": false,
+    "has_pages": false,
+    "forks_count": 1674,
+    "mirror_url": null,
+    "archived": false,
+    "disabled": false,
+    "open_issues_count": 564,
+    "license": {
+      "key": "mit",
+      "name": "MIT License",
+      "spdx_id": "MIT",
+      "url": "https://api.github.com/licenses/mit",
+      "node_id": "MDc6TGljZW5zZTEz"
+    },
+    "forks": 1674,
+    "open_issues": 564,
+    "watchers": 26245,
+    "default_branch": "main"
+  },
+  "network_count": 1674,
+  "subscribers_count": 0
+}

src/test/resources/org/kohsuke/github/AppTest/wiremock/testEventApi/mappings/repos_daddyfatstacksbig_lerna-12.json

@@ -0,0 +1,48 @@
+{
+  "id": "c536ef14-9fde-4a95-ae89-43f6753e4f2a",
+  "name": "repos_daddyfatstacksbig_lerna",
+  "request": {
+    "url": "/repos/daddyfatstacksBIG/lerna",
+    "method": "GET",
+    "headers": {
+      "Accept": {
+        "equalTo": "text/html, image/gif, image/jpeg, *; q=.2, */*; q=.2"
+      }
+    }
+  },
+  "response": {
+    "status": 200,
+    "bodyFileName": "repos_daddyfatstacksbig_lerna-12.json",
+    "headers": {
+      "Date": "Fri, 15 Jan 2021 02:18:27 GMT",
+      "Content-Type": "application/json; charset=utf-8",
+      "Server": "GitHub.com",
+      "Status": "200 OK",
+      "Cache-Control": "private, max-age=60, s-maxage=60",
+      "Vary": [
+        "Accept, Authorization, Cookie, X-GitHub-OTP",
+        "Accept-Encoding, Accept, X-Requested-With",
+        "Accept-Encoding"
+      ],
+      "ETag": "W/\"a9b6035f2bfdf3830acbea545b9a837965158f59ac8cf616563e29681b0f0098\"",
+      "last-modified": "Tue, 09 Jun 2020 04:42:07 GMT",
+      "X-OAuth-Scopes": "admin:org, admin:org_hook, admin:public_key, admin:repo_hook, delete_repo, gist, notifications, repo, user, workflow, write:discussion",
+      "X-Accepted-OAuth-Scopes": "repo",
+      "X-GitHub-Media-Type": "unknown, github.v3",
+      "X-RateLimit-Limit": "5000",
+      "X-RateLimit-Remaining": "4777",
+      "X-RateLimit-Reset": "1610678593",
+      "x-ratelimit-used": "223",
+      "Strict-Transport-Security": "max-age=31536000; includeSubdomains; preload",
+      "X-Frame-Options": "deny",
+      "X-Content-Type-Options": "nosniff",
+      "X-XSS-Protection": "1; mode=block",
+      "Referrer-Policy": "origin-when-cross-origin, strict-origin-when-cross-origin",
+      "Content-Security-Policy": "default-src 'none'",
+      "X-GitHub-Request-Id": "D91F:62A3:2C8A07:3712B1:6000FB73"
+    }
+  },
+  "uuid": "c536ef14-9fde-4a95-ae89-43f6753e4f2a",
+  "persistent": true,
+  "insertionIndex": 12
+}

src/test/resources/org/kohsuke/github/AppTest/wiremock/testGetDeploymentStatuses/__files/repos_hub4j-test-org_github-api-test-2.json

@@ -0,0 +1,126 @@
+{
+  "id": 332135466,
+  "node_id": "MDEwOlJlcG9zaXRvcnkzMzIxMzU0NjY=",
+  "name": "github-api-test",
+  "full_name": "hub4j-test-org/github-api-test",
+  "private": false,
+  "owner": {
+    "login": "hub4j-test-org",
+    "id": 7544739,
+    "node_id": "MDEyOk9yZ2FuaXphdGlvbjc1NDQ3Mzk=",
+    "avatar_url": "https://avatars.githubusercontent.com/u/7544739?v=4",
+    "gravatar_id": "",
+    "url": "https://api.github.com/users/hub4j-test-org",
+    "html_url": "https://github.com/hub4j-test-org",
+    "followers_url": "https://api.github.com/users/hub4j-test-org/followers",
+    "following_url": "https://api.github.com/users/hub4j-test-org/following{/other_user}",
+    "gists_url": "https://api.github.com/users/hub4j-test-org/gists{/gist_id}",
+    "starred_url": "https://api.github.com/users/hub4j-test-org/starred{/owner}{/repo}",
+    "subscriptions_url": "https://api.github.com/users/hub4j-test-org/subscriptions",
+    "organizations_url": "https://api.github.com/users/hub4j-test-org/orgs",
+    "repos_url": "https://api.github.com/users/hub4j-test-org/repos",
+    "events_url": "https://api.github.com/users/hub4j-test-org/events{/privacy}",
+    "received_events_url": "https://api.github.com/users/hub4j-test-org/received_events",
+    "type": "Organization",
+    "site_admin": false
+  },
+  "html_url": "https://github.com/hub4j-test-org/github-api-test",
+  "description": "A test repository for testing the github-api project: github-api-test",
+  "fork": false,
+  "url": "https://api.github.com/repos/hub4j-test-org/github-api-test",
+  "forks_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/forks",
+  "keys_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/keys{/key_id}",
+  "collaborators_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/collaborators{/collaborator}",
+  "teams_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/teams",
+  "hooks_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/hooks",
+  "issue_events_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/issues/events{/number}",
+  "events_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/events",
+  "assignees_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/assignees{/user}",
+  "branches_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/branches{/branch}",
+  "tags_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/tags",
+  "blobs_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/git/blobs{/sha}",
+  "git_tags_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/git/tags{/sha}",
+  "git_refs_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/git/refs{/sha}",
+  "trees_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/git/trees{/sha}",
+  "statuses_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/statuses/{sha}",
+  "languages_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/languages",
+  "stargazers_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/stargazers",
+  "contributors_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/contributors",
+  "subscribers_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/subscribers",
+  "subscription_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/subscription",
+  "commits_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/commits{/sha}",
+  "git_commits_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/git/commits{/sha}",
+  "comments_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/comments{/number}",
+  "issue_comment_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/issues/comments{/number}",
+  "contents_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/contents/{+path}",
+  "compare_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/compare/{base}...{head}",
+  "merges_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/merges",
+  "archive_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/{archive_format}{/ref}",
+  "downloads_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/downloads",
+  "issues_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/issues{/number}",
+  "pulls_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/pulls{/number}",
+  "milestones_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/milestones{/number}",
+  "notifications_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/notifications{?since,all,participating}",
+  "labels_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/labels{/name}",
+  "releases_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/releases{/id}",
+  "deployments_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/deployments",
+  "created_at": "2021-01-23T05:30:48Z",
+  "updated_at": "2021-01-23T05:30:52Z",
+  "pushed_at": "2021-01-23T05:30:50Z",
+  "git_url": "git://github.com/hub4j-test-org/github-api-test.git",
+  "ssh_url": "git@github.com:hub4j-test-org/github-api-test.git",
+  "clone_url": "https://github.com/hub4j-test-org/github-api-test.git",
+  "svn_url": "https://github.com/hub4j-test-org/github-api-test",
+  "homepage": "http://github-api.kohsuke.org/",
+  "size": 0,
+  "stargazers_count": 0,
+  "watchers_count": 0,
+  "language": null,
+  "has_issues": true,
+  "has_projects": true,
+  "has_downloads": true,
+  "has_wiki": true,
+  "has_pages": false,
+  "forks_count": 0,
+  "mirror_url": null,
+  "archived": false,
+  "disabled": false,
+  "open_issues_count": 0,
+  "license": null,
+  "forks": 0,
+  "open_issues": 0,
+  "watchers": 0,
+  "default_branch": "main",
+  "permissions": {
+    "admin": true,
+    "push": true,
+    "pull": true
+  },
+  "temp_clone_token": "",
+  "allow_squash_merge": true,
+  "allow_merge_commit": true,
+  "allow_rebase_merge": true,
+  "delete_branch_on_merge": false,
+  "organization": {
+    "login": "hub4j-test-org",
+    "id": 7544739,
+    "node_id": "MDEyOk9yZ2FuaXphdGlvbjc1NDQ3Mzk=",
+    "avatar_url": "https://avatars.githubusercontent.com/u/7544739?v=4",
+    "gravatar_id": "",
+    "url": "https://api.github.com/users/hub4j-test-org",
+    "html_url": "https://github.com/hub4j-test-org",
+    "followers_url": "https://api.github.com/users/hub4j-test-org/followers",
+    "following_url": "https://api.github.com/users/hub4j-test-org/following{/other_user}",
+    "gists_url": "https://api.github.com/users/hub4j-test-org/gists{/gist_id}",
+    "starred_url": "https://api.github.com/users/hub4j-test-org/starred{/owner}{/repo}",
+    "subscriptions_url": "https://api.github.com/users/hub4j-test-org/subscriptions",
+    "organizations_url": "https://api.github.com/users/hub4j-test-org/orgs",
+    "repos_url": "https://api.github.com/users/hub4j-test-org/repos",
+    "events_url": "https://api.github.com/users/hub4j-test-org/events{/privacy}",
+    "received_events_url": "https://api.github.com/users/hub4j-test-org/received_events",
+    "type": "Organization",
+    "site_admin": false
+  },
+  "network_count": 0,
+  "subscribers_count": 9
+}

src/test/resources/org/kohsuke/github/AppTest/wiremock/testGetDeploymentStatuses/__files/repos_hub4j-test-org_github-api-test_deployments-3.json

@@ -0,0 +1,39 @@
+{
+  "url": "https://api.github.com/repos/hub4j-test-org/github-api-test/deployments/315601644",
+  "id": 315601644,
+  "node_id": "MDEwOkRlcGxveW1lbnQzMTU2MDE2NDQ=",
+  "task": "deploy",
+  "original_environment": "production",
+  "environment": "production",
+  "description": "question",
+  "created_at": "2021-01-23T05:30:54Z",
+  "updated_at": "2021-01-23T05:30:54Z",
+  "statuses_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/deployments/315601644/statuses",
+  "repository_url": "https://api.github.com/repos/hub4j-test-org/github-api-test",
+  "creator": {
+    "login": "bitwiseman",
+    "id": 1958953,
+    "node_id": "MDQ6VXNlcjE5NTg5NTM=",
+    "avatar_url": "https://avatars.githubusercontent.com/u/1958953?v=4",
+    "gravatar_id": "",
+    "url": "https://api.github.com/users/bitwiseman",
+    "html_url": "https://github.com/bitwiseman",
+    "followers_url": "https://api.github.com/users/bitwiseman/followers",
+    "following_url": "https://api.github.com/users/bitwiseman/following{/other_user}",
+    "gists_url": "https://api.github.com/users/bitwiseman/gists{/gist_id}",
+    "starred_url": "https://api.github.com/users/bitwiseman/starred{/owner}{/repo}",
+    "subscriptions_url": "https://api.github.com/users/bitwiseman/subscriptions",
+    "organizations_url": "https://api.github.com/users/bitwiseman/orgs",
+    "repos_url": "https://api.github.com/users/bitwiseman/repos",
+    "events_url": "https://api.github.com/users/bitwiseman/events{/privacy}",
+    "received_events_url": "https://api.github.com/users/bitwiseman/received_events",
+    "type": "User",
+    "site_admin": false
+  },
+  "sha": "3ca6395616e9decaba9f350f59eb5b007462e2e7",
+  "ref": "main",
+  "payload": "{\"user\":\"atmos\",\"room_id\":123456}",
+  "transient_environment": false,
+  "production_environment": false,
+  "performed_via_github_app": null
+}

src/test/resources/org/kohsuke/github/AppTest/wiremock/testGetDeploymentStatuses/__files/repos_hub4j-test-org_github-api-test_deployments_315601644_statuses-4.json

@@ -0,0 +1,36 @@
+{
+  "url": "https://api.github.com/repos/hub4j-test-org/github-api-test/deployments/315601644/statuses/466129562",
+  "id": 466129562,
+  "node_id": "MDE2OkRlcGxveW1lbnRTdGF0dXM0NjYxMjk1NjI=",
+  "state": "queued",
+  "creator": {
+    "login": "bitwiseman",
+    "id": 1958953,
+    "node_id": "MDQ6VXNlcjE5NTg5NTM=",
+    "avatar_url": "https://avatars.githubusercontent.com/u/1958953?v=4",
+    "gravatar_id": "",
+    "url": "https://api.github.com/users/bitwiseman",
+    "html_url": "https://github.com/bitwiseman",
+    "followers_url": "https://api.github.com/users/bitwiseman/followers",
+    "following_url": "https://api.github.com/users/bitwiseman/following{/other_user}",
+    "gists_url": "https://api.github.com/users/bitwiseman/gists{/gist_id}",
+    "starred_url": "https://api.github.com/users/bitwiseman/starred{/owner}{/repo}",
+    "subscriptions_url": "https://api.github.com/users/bitwiseman/subscriptions",
+    "organizations_url": "https://api.github.com/users/bitwiseman/orgs",
+    "repos_url": "https://api.github.com/users/bitwiseman/repos",
+    "events_url": "https://api.github.com/users/bitwiseman/events{/privacy}",
+    "received_events_url": "https://api.github.com/users/bitwiseman/received_events",
+    "type": "User",
+    "site_admin": false
+  },
+  "description": "success",
+  "environment": "new-ci-env",
+  "target_url": "http://www.github.com/logurl",
+  "created_at": "2021-01-23T05:30:54Z",
+  "updated_at": "2021-01-23T05:30:55Z",
+  "deployment_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/deployments/315601644",
+  "repository_url": "https://api.github.com/repos/hub4j-test-org/github-api-test",
+  "environment_url": "http://www.github.com/envurl",
+  "log_url": "http://www.github.com/logurl",
+  "performed_via_github_app": null
+}

src/test/resources/org/kohsuke/github/AppTest/wiremock/testGetDeploymentStatuses/__files/repos_hub4j-test-org_github-api-test_deployments_315601644_statuses-5.json

@@ -0,0 +1,38 @@
+[
+  {
+    "url": "https://api.github.com/repos/hub4j-test-org/github-api-test/deployments/315601644/statuses/466129562",
+    "id": 466129562,
+    "node_id": "MDE2OkRlcGxveW1lbnRTdGF0dXM0NjYxMjk1NjI=",
+    "state": "queued",
+    "creator": {
+      "login": "bitwiseman",
+      "id": 1958953,
+      "node_id": "MDQ6VXNlcjE5NTg5NTM=",
+      "avatar_url": "https://avatars.githubusercontent.com/u/1958953?v=4",
+      "gravatar_id": "",
+      "url": "https://api.github.com/users/bitwiseman",
+      "html_url": "https://github.com/bitwiseman",
+      "followers_url": "https://api.github.com/users/bitwiseman/followers",
+      "following_url": "https://api.github.com/users/bitwiseman/following{/other_user}",
+      "gists_url": "https://api.github.com/users/bitwiseman/gists{/gist_id}",
+      "starred_url": "https://api.github.com/users/bitwiseman/starred{/owner}{/repo}",
+      "subscriptions_url": "https://api.github.com/users/bitwiseman/subscriptions",
+      "organizations_url": "https://api.github.com/users/bitwiseman/orgs",
+      "repos_url": "https://api.github.com/users/bitwiseman/repos",
+      "events_url": "https://api.github.com/users/bitwiseman/events{/privacy}",
+      "received_events_url": "https://api.github.com/users/bitwiseman/received_events",
+      "type": "User",
+      "site_admin": false
+    },
+    "description": "success",
+    "environment": "new-ci-env",
+    "target_url": "http://www.github.com/logurl",
+    "created_at": "2021-01-23T05:30:54Z",
+    "updated_at": "2021-01-23T05:30:55Z",
+    "deployment_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/deployments/315601644",
+    "repository_url": "https://api.github.com/repos/hub4j-test-org/github-api-test",
+    "environment_url": "http://www.github.com/envurl",
+    "log_url": "http://www.github.com/logurl",
+    "performed_via_github_app": null
+  }
+]

src/test/resources/org/kohsuke/github/AppTest/wiremock/testGetDeploymentStatuses/__files/repos_hub4j-test-org_github-api-test_deployments_315601644_statuses-6.json

@@ -0,0 +1,38 @@
+[
+  {
+    "url": "https://api.github.com/repos/hub4j-test-org/github-api-test/deployments/315601644/statuses/466129562",
+    "id": 466129562,
+    "node_id": "MDE2OkRlcGxveW1lbnRTdGF0dXM0NjYxMjk1NjI=",
+    "state": "queued",
+    "creator": {
+      "login": "bitwiseman",
+      "id": 1958953,
+      "node_id": "MDQ6VXNlcjE5NTg5NTM=",
+      "avatar_url": "https://avatars.githubusercontent.com/u/1958953?v=4",
+      "gravatar_id": "",
+      "url": "https://api.github.com/users/bitwiseman",
+      "html_url": "https://github.com/bitwiseman",
+      "followers_url": "https://api.github.com/users/bitwiseman/followers",
+      "following_url": "https://api.github.com/users/bitwiseman/following{/other_user}",
+      "gists_url": "https://api.github.com/users/bitwiseman/gists{/gist_id}",
+      "starred_url": "https://api.github.com/users/bitwiseman/starred{/owner}{/repo}",
+      "subscriptions_url": "https://api.github.com/users/bitwiseman/subscriptions",
+      "organizations_url": "https://api.github.com/users/bitwiseman/orgs",
+      "repos_url": "https://api.github.com/users/bitwiseman/repos",
+      "events_url": "https://api.github.com/users/bitwiseman/events{/privacy}",
+      "received_events_url": "https://api.github.com/users/bitwiseman/received_events",
+      "type": "User",
+      "site_admin": false
+    },
+    "description": "success",
+    "environment": "new-ci-env",
+    "target_url": "http://www.github.com/logurl",
+    "created_at": "2021-01-23T05:30:54Z",
+    "updated_at": "2021-01-23T05:30:55Z",
+    "deployment_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/deployments/315601644",
+    "repository_url": "https://api.github.com/repos/hub4j-test-org/github-api-test",
+    "environment_url": "http://www.github.com/envurl",
+    "log_url": "http://www.github.com/logurl",
+    "performed_via_github_app": null
+  }
+]

src/test/resources/org/kohsuke/github/AppTest/wiremock/testGetDeploymentStatuses/__files/user-1.json

@@ -0,0 +1,46 @@
+{
+  "login": "bitwiseman",
+  "id": 1958953,
+  "node_id": "MDQ6VXNlcjE5NTg5NTM=",
+  "avatar_url": "https://avatars.githubusercontent.com/u/1958953?v=4",
+  "gravatar_id": "",
+  "url": "https://api.github.com/users/bitwiseman",
+  "html_url": "https://github.com/bitwiseman",
+  "followers_url": "https://api.github.com/users/bitwiseman/followers",
+  "following_url": "https://api.github.com/users/bitwiseman/following{/other_user}",
+  "gists_url": "https://api.github.com/users/bitwiseman/gists{/gist_id}",
+  "starred_url": "https://api.github.com/users/bitwiseman/starred{/owner}{/repo}",
+  "subscriptions_url": "https://api.github.com/users/bitwiseman/subscriptions",
+  "organizations_url": "https://api.github.com/users/bitwiseman/orgs",
+  "repos_url": "https://api.github.com/users/bitwiseman/repos",
+  "events_url": "https://api.github.com/users/bitwiseman/events{/privacy}",
+  "received_events_url": "https://api.github.com/users/bitwiseman/received_events",
+  "type": "User",
+  "site_admin": false,
+  "name": "Liam Newman",
+  "company": "Cloudbees, Inc.",
+  "blog": "",
+  "location": "Seattle, WA, USA",
+  "email": "bitwiseman@gmail.com",
+  "hireable": null,
+  "bio": null,
+  "twitter_username": "bitwiseman",
+  "public_repos": 201,
+  "public_gists": 7,
+  "followers": 176,
+  "following": 11,
+  "created_at": "2012-07-11T20:38:33Z",
+  "updated_at": "2021-01-22T16:38:42Z",
+  "private_gists": 19,
+  "total_private_repos": 17,
+  "owned_private_repos": 0,
+  "disk_usage": 33700,
+  "collaborators": 0,
+  "two_factor_authentication": true,
+  "plan": {
+    "name": "free",
+    "space": 976562499,
+    "collaborators": 0,
+    "private_repos": 10000
+  }
+}

src/test/resources/org/kohsuke/github/AppTest/wiremock/testGetDeploymentStatuses/mappings/repos_hub4j-test-org_github-api-test-2.json

@@ -0,0 +1,48 @@
+{
+  "id": "ee5eaa4c-2198-4866-9907-c45dc471ccb1",
+  "name": "repos_hub4j-test-org_github-api-test",
+  "request": {
+    "url": "/repos/hub4j-test-org/github-api-test",
+    "method": "GET",
+    "headers": {
+      "Accept": {
+        "equalTo": "text/html, image/gif, image/jpeg, *; q=.2, */*; q=.2"
+      }
+    }
+  },
+  "response": {
+    "status": 200,
+    "bodyFileName": "repos_hub4j-test-org_github-api-test-2.json",
+    "headers": {
+      "Date": "Sat, 23 Jan 2021 05:30:54 GMT",
+      "Content-Type": "application/json; charset=utf-8",
+      "Server": "GitHub.com",
+      "Status": "200 OK",
+      "Cache-Control": "private, max-age=60, s-maxage=60",
+      "Vary": [
+        "Accept, Authorization, Cookie, X-GitHub-OTP",
+        "Accept-Encoding, Accept, X-Requested-With",
+        "Accept-Encoding"
+      ],
+      "ETag": "W/\"92c703ce3aa8785f4b7b9690174f87593bcf624a3363400ae4820270d5ffa36d\"",
+      "last-modified": "Sat, 23 Jan 2021 05:30:52 GMT",
+      "X-OAuth-Scopes": "admin:org, admin:org_hook, admin:public_key, admin:repo_hook, delete_repo, gist, notifications, repo, user, workflow, write:discussion",
+      "X-Accepted-OAuth-Scopes": "repo",
+      "X-GitHub-Media-Type": "unknown, github.v3",
+      "X-RateLimit-Limit": "5000",
+      "X-RateLimit-Remaining": "4893",
+      "X-RateLimit-Reset": "1611382753",
+      "x-ratelimit-used": "107",
+      "Strict-Transport-Security": "max-age=31536000; includeSubdomains; preload",
+      "X-Frame-Options": "deny",
+      "X-Content-Type-Options": "nosniff",
+      "X-XSS-Protection": "1; mode=block",
+      "Referrer-Policy": "origin-when-cross-origin, strict-origin-when-cross-origin",
+      "Content-Security-Policy": "default-src 'none'",
+      "X-GitHub-Request-Id": "DA01:86BF:FC55C:128201:600BB487"
+    }
+  },
+  "uuid": "ee5eaa4c-2198-4866-9907-c45dc471ccb1",
+  "persistent": true,
+  "insertionIndex": 2
+}

src/test/resources/org/kohsuke/github/AppTest/wiremock/testGetDeploymentStatuses/mappings/repos_hub4j-test-org_github-api-test_deployments-3.json

@@ -0,0 +1,56 @@
+{
+  "id": "33e256b4-e4f3-4cf8-8085-d58dd8b6ff48",
+  "name": "repos_hub4j-test-org_github-api-test_deployments",
+  "request": {
+    "url": "/repos/hub4j-test-org/github-api-test/deployments",
+    "method": "POST",
+    "headers": {
+      "Accept": {
+        "equalTo": "application/vnd.github.ant-man-preview+json, application/vnd.github.flash-preview+json"
+      }
+    },
+    "bodyPatterns": [
+      {
+        "equalToJson": "{\"ref\":\"main\",\"payload\":\"{\\\"user\\\":\\\"atmos\\\",\\\"room_id\\\":123456}\",\"description\":\"question\"}",
+        "ignoreArrayOrder": true,
+        "ignoreExtraElements": false
+      }
+    ]
+  },
+  "response": {
+    "status": 201,
+    "bodyFileName": "repos_hub4j-test-org_github-api-test_deployments-3.json",
+    "headers": {
+      "Date": "Sat, 23 Jan 2021 05:30:54 GMT",
+      "Content-Type": "application/json; charset=utf-8",
+      "Server": "GitHub.com",
+      "Status": "201 Created",
+      "Cache-Control": "private, max-age=60, s-maxage=60",
+      "Vary": [
+        "Accept, Authorization, Cookie, X-GitHub-OTP",
+        "Accept-Encoding, Accept, X-Requested-With",
+        "Accept-Encoding"
+      ],
+      "ETag": "\"97fe2f224099c43ac13e32503d65c8a24665a79e620f11e4fe5c8a3185da75b3\"",
+      "last-modified": "Sat, 23 Jan 2021 05:30:54 GMT",
+      "X-OAuth-Scopes": "admin:org, admin:org_hook, admin:public_key, admin:repo_hook, delete_repo, gist, notifications, repo, user, workflow, write:discussion",
+      "X-Accepted-OAuth-Scopes": "",
+      "Location": "https://api.github.com/repos/hub4j-test-org/github-api-test/deployments/315601644",
+      "X-GitHub-Media-Type": "github.ant-man-preview; format=json, github.flash-preview; format=json",
+      "X-RateLimit-Limit": "5000",
+      "X-RateLimit-Remaining": "4892",
+      "X-RateLimit-Reset": "1611382753",
+      "x-ratelimit-used": "108",
+      "Strict-Transport-Security": "max-age=31536000; includeSubdomains; preload",
+      "X-Frame-Options": "deny",
+      "X-Content-Type-Options": "nosniff",
+      "X-XSS-Protection": "1; mode=block",
+      "Referrer-Policy": "origin-when-cross-origin, strict-origin-when-cross-origin",
+      "Content-Security-Policy": "default-src 'none'",
+      "X-GitHub-Request-Id": "DA01:86BF:FC56F:128397:600BB48E"
+    }
+  },
+  "uuid": "33e256b4-e4f3-4cf8-8085-d58dd8b6ff48",
+  "persistent": true,
+  "insertionIndex": 3
+}

src/test/resources/org/kohsuke/github/AppTest/wiremock/testGetDeploymentStatuses/mappings/repos_hub4j-test-org_github-api-test_deployments_315601644-7.json

@@ -1,8 +1,8 @@
 {
-  "id": "1e9db334-efda-432b-890e-c9b513935a0b",
-  "name": "repos_kohsuke_sandbox-ant_comments_35673784",
+  "id": "a7a78388-4c8f-4b5d-8eb3-c1bf881b3227",
+  "name": "repos_hub4j-test-org_github-api-test_deployments_315601644",
   "request": {
-    "url": "/repos/kohsuke/sandbox-ant/comments/35673784",
+    "url": "/repos/hub4j-test-org/github-api-test/deployments/315601644",
     "method": "DELETE",
     "headers": {
       "Accept": {
@@ -13,28 +13,30 @@
   "response": {
     "status": 204,
     "headers": {
-      "Date": "Sat, 26 Oct 2019 01:29:00 GMT",
+      "Date": "Sat, 23 Jan 2021 05:30:55 GMT",
       "Server": "GitHub.com",
       "Status": "204 No Content",
-      "X-RateLimit-Limit": "5000",
-      "X-RateLimit-Remaining": "4238",
-      "X-RateLimit-Reset": "1572055286",
-      "X-OAuth-Scopes": "admin:org, admin:org_hook, admin:public_key, admin:repo_hook, delete_repo, gist, notifications, repo, user, write:discussion",
+      "X-OAuth-Scopes": "admin:org, admin:org_hook, admin:public_key, admin:repo_hook, delete_repo, gist, notifications, repo, user, workflow, write:discussion",
       "X-Accepted-OAuth-Scopes": "",
       "X-GitHub-Media-Type": "unknown, github.v3",
-      "Access-Control-Expose-Headers": "ETag, Link, Location, Retry-After, X-GitHub-OTP, X-RateLimit-Limit, X-RateLimit-Remaining, X-RateLimit-Reset, X-OAuth-Scopes, X-Accepted-OAuth-Scopes, X-Poll-Interval, X-GitHub-Media-Type",
-      "Access-Control-Allow-Origin": "*",
+      "X-RateLimit-Limit": "5000",
+      "X-RateLimit-Remaining": "4888",
+      "X-RateLimit-Reset": "1611382753",
+      "x-ratelimit-used": "112",
       "Strict-Transport-Security": "max-age=31536000; includeSubdomains; preload",
       "X-Frame-Options": "deny",
       "X-Content-Type-Options": "nosniff",
       "X-XSS-Protection": "1; mode=block",
       "Referrer-Policy": "origin-when-cross-origin, strict-origin-when-cross-origin",
       "Content-Security-Policy": "default-src 'none'",
-      "Vary": "Accept-Encoding",
-      "X-GitHub-Request-Id": "CB24:8340:ED23D1:116FED8:5DB3A15B"
+      "Vary": [
+        "Accept-Encoding, Accept, X-Requested-With",
+        "Accept-Encoding"
+      ],
+      "X-GitHub-Request-Id": "DA01:86BF:FC594:1283D2:600BB48F"
     }
   },
-  "uuid": "1e9db334-efda-432b-890e-c9b513935a0b",
+  "uuid": "a7a78388-4c8f-4b5d-8eb3-c1bf881b3227",
   "persistent": true,
   "insertionIndex": 7
 }