[maven-release-plugin] prepare release github-api-1.130

Chore(deps-dev): Bump org.eclipse.jgit from 5.11.0.202103091610-r to 5.11.1.202105131744-r

.gitattributes

@@ -0,0 +1 @@
+*.java text eol=lf

.github/PULL_REQUEST_TEMPLATE.md

@@ -1,16 +1,16 @@
-# Description 
-** Describe your change here** 
+# Description
+
+<!-- Describe your change here -->
 
 # Before submitting a PR:
-We love getting PRs, but we hate asking people for the same basic changes every time. 
+We love getting PRs, but we hate asking people for the same basic changes every time.
 
-- [ ] Push your changes to a branch other than `master`. Create your PR from that branch.    
+- [ ] Push your changes to a branch other than `main`. Create your PR from that branch.
 - [ ] Add JavaDocs and other comments
 - [ ] Write tests that run and pass in CI. See [CONTRIBUTING.md](CONTRIBUTING.md) for details on how to capture snapshot data.
-- [ ] Run `mvn clean compile` locally. This may reformat your code, commit those changes.
 - [ ] Run `mvn -D enable-ci clean install site` locally. If this command doesn't succeed, your change will not pass CI.
 
 # When creating a PR: 
 
-- [ ] Fill in the "Description" above. 
-- [ ] Enable "Allow edits from maintainers". 
+- [ ] Fill in the "Description" above.
+- [ ] Enable "Allow edits from maintainers".

.github/workflows/codeql-analysis.yml

@@ -0,0 +1,67 @@
+# For most projects, this workflow file will not need changing; you simply need
+# to commit it to your repository.
+#
+# You may wish to alter this file to override the set of languages analyzed,
+# or to provide custom queries or build logic.
+#
+# ******** NOTE ********
+# We have attempted to detect the languages in your repository. Please check
+# the `language` matrix defined below to confirm you have the correct set of
+# supported CodeQL languages.
+#
+name: "CodeQL"
+
+on:
+  push:
+    branches: [ main, gh-pages ]
+  pull_request:
+    # The branches below must be a subset of the branches above
+    branches: [ main ]
+  schedule:
+    - cron: '20 0 * * 6'
+
+jobs:
+  analyze:
+    name: Analyze
+    runs-on: ubuntu-latest
+
+    strategy:
+      fail-fast: false
+      matrix:
+        language: [ 'java' ]
+        # CodeQL supports [ 'cpp', 'csharp', 'go', 'java', 'javascript', 'python' ]
+        # Learn more:
+        # https://docs.github.com/en/free-pro-team@latest/github/finding-security-vulnerabilities-and-errors-in-your-code/configuring-code-scanning#changing-the-languages-that-are-analyzed
+
+    steps:
+    - name: Checkout repository
+      uses: actions/checkout@v2
+
+    # Initializes the CodeQL tools for scanning.
+    - name: Initialize CodeQL
+      uses: github/codeql-action/init@v1
+      with:
+        languages: ${{ matrix.language }}
+        # If you wish to specify custom queries, you can do so here or in a config file.
+        # By default, queries listed here will override any specified in a config file.
+        # Prefix the list here with "+" to use these queries and those in the config file.
+        # queries: ./path/to/local/query, your-org/your-repo/queries@main
+
+    # Autobuild attempts to build any compiled languages  (C/C++, C#, or Java).
+    # If this step fails, then you should remove it and run the build manually (see below)
+    - name: Autobuild
+      uses: github/codeql-action/autobuild@v1
+
+    # ℹ️ Command-line programs to run using the OS shell.
+    # 📚 https://git.io/JvXDl
+
+    # ✏️ If the Autobuild fails above, remove it and uncomment the following three lines
+    #    and modify them (or add more) to build your code if your project
+    #    uses a compiled language
+
+    #- run: |
+    #   make bootstrap
+    #   make release
+
+    - name: Perform CodeQL Analysis
+      uses: github/codeql-action/analyze@v1

.github/workflows/maven-build.yml

@@ -2,42 +2,51 @@ name: CI
 
 on: [push, pull_request]
 
+# this is required by spotless for JDK 16+
+env:
+  JAVA_11_PLUS_MAVEN_OPTS: "--add-opens jdk.compiler/com.sun.tools.javac.util=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.file=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.parser=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.tree=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.api=ALL-UNNAMED"
 
 jobs:
   build:
     name: build-only (Java ${{ matrix.java }})
     runs-on: ubuntu-latest
     strategy:
+      fail-fast: false
       matrix:
-        java: [ 13 ]
+        java: [ 16 ]
     steps:
       - uses: actions/checkout@v2
       - name: Set up JDK
-        uses: actions/setup-java@v1
+        uses: actions/setup-java@v2
         with:
           java-version: ${{ matrix.java }}
+          distribution: 'adopt'
       - name: Cached .m2
-        uses: actions/cache@v2
+        uses: actions/cache@v2.1.6
         with:
           path: ~/.m2/repository
           key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
           restore-keys: |
             ${{ runner.os }}-maven-
       - name: Maven Install (skipTests)
-        run: mvn -B install -DskipTests -D enable-ci --file pom.xml
+        env:
+          MAVEN_OPTS: ${{ env.JAVA_11_PLUS_MAVEN_OPTS }}
+        run: mvn -B install -DskipTests --file pom.xml
   site:
     name: site (Java ${{ matrix.java }})
     runs-on: ubuntu-latest
     strategy:
+      fail-fast: false
       matrix:
         java: [ 8, 11 ]
     steps:
       - uses: actions/checkout@v2
       - name: Set up JDK
-        uses: actions/setup-java@v1
+        uses: actions/setup-java@v2
         with:
           java-version: ${{ matrix.java }}
-      - uses: actions/cache@v2
+          distribution: 'adopt'
+      - uses: actions/cache@v2.1.6
         with:
           path: ~/.m2/repository
           key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
@@ -49,24 +58,41 @@ jobs:
     name: test (${{ matrix.os }}, Java ${{ matrix.java }})
     runs-on: ${{ matrix.os }}-latest
     strategy:
+      fail-fast: false
       matrix:
         os: [ ubuntu, windows ]
-        java: [ 8, 11, 13, 15-ea ]
+        java: [ 8, 11, 16 ]
     steps:
     - uses: actions/checkout@v2
     - name: Set up JDK
-      uses: actions/setup-java@v1
+      uses: actions/setup-java@v2
       with:
         java-version: ${{ matrix.java }}
-    - uses: actions/cache@v2
+        distribution: 'adopt'
+    - uses: actions/cache@v2.1.6
       with:
         path: ~/.m2/repository
         key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
         restore-keys: |
           ${{ runner.os }}-maven-
+    # JDK 8
     - name: Maven Install without Code Coverage
-      if: matrix.os == 'windows'
+      if: matrix.os == 'windows' && matrix.java == '8'
       run: mvn -B install --file pom.xml
     - name: Maven Install with Code Coverage
-      if: matrix.os != 'windows'
+      if: matrix.os != 'windows' && matrix.java == '8'
       run: mvn -B install -D enable-ci --file pom.xml
+    - name: Codecov Report 
+      if: matrix.os != 'windows' && matrix.java == '8'
+      uses: codecov/codecov-action@v1.5.0  
+    # JDK 11+
+    - name: Maven Install without Code Coverage
+      if: matrix.os == 'windows' && matrix.java != '8'
+      env:
+        MAVEN_OPTS: ${{ env.JAVA_11_PLUS_MAVEN_OPTS }}
+      run: mvn -B install --file pom.xml "-Dsurefire.argLine=--add-opens java.base/java.net=ALL-UNNAMED"
+    - name: Maven Install with Code Coverage
+      if: matrix.os != 'windows' && matrix.java != '8'
+      env:
+        MAVEN_OPTS: ${{ env.JAVA_11_PLUS_MAVEN_OPTS }}
+      run: mvn -B install -D enable-ci --file pom.xml "-Dsurefire.argLine=--add-opens java.base/java.net=ALL-UNNAMED"

.github/workflows/release-drafter.yml

@@ -0,0 +1,14 @@
+
+name: Release Drafter
+
+on:
+  push:
+    branches:
+      - main
+
+jobs:
+  update_release_draft:
+    runs-on: ubuntu-latest
+    steps:
+      - name: Release Drafter
+        uses: release-drafter/release-drafter@v5.15.0

CONTRIBUTING.md

@@ -21,7 +21,7 @@ Example for a single test case:
 
 ### Setting up credential
 
-1. Create an OAuth token on github.com
+1. Create a "Personal access token" on https://github.com/ (`Settings` > `Developer settings` > `Personal access tokens`)
 2. Set the GITHUB_OAUTH environment variable to the value of that token
 3. Set the system property `test.github.useProxy` (usually like "-Dtest.github.useProxy" as a Java VM option)
 
@@ -41,7 +41,7 @@ Once you have credentials setup, you add new test classes and test methods as yo
 
 Keep `useProxy` enabled and iterate on your tests as needed. With `useProxy` enabled your tests will interact with 
 GitHub - you will need to clean up your server-state between runs. This can be done manually to start with.
-Once your test code is somewhat stable, use `getGitHubBeforeAfter()` to get a `GitHub` instance for test setup and cleanup.
+Once your test code is somewhat stable, use `getNonRecordingGitHub()` to get a `GitHub` instance for test setup and cleanup.
 Interactions with that `GitHub` instance will not be recorded as part of the test, keeping the test data files to a minimum. 
 
 #### Running tests against your personal GitHub user account

README.md

@@ -2,7 +2,7 @@
 
 [![Sonatype Nexus (Releases)](https://img.shields.io/nexus/r/org.kohsuke/github-api?server=https%3A%2F%2Foss.sonatype.org)](https://mvnrepository.com/artifact/org.kohsuke/github-api)
 [![Join the chat at https://gitter.im/hub4j/github-api](https://badges.gitter.im/Join%20Chat.svg)](https://gitter.im/hub4j/github-api?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
-![CI](https://github.com/hub4j/github-api/workflows/CI/badge.svg?branch=master)
+![CI](https://github.com/hub4j/github-api/workflows/CI/badge.svg?branch=main)
 
 
 

codecov.yml

@@ -0,0 +1,7 @@
+ignore:
+  - "**/extras/okhttp3/ObsoleteUrlFactory**"
+  - "**/extras/OkHttpConnector"
+  - "**/extras/OkHttp3Connector"
+  - "**/example/**"
+  - "**/github/EnforcementLevel"
+

pom.xml

@@ -2,7 +2,7 @@
   <modelVersion>4.0.0</modelVersion>
   <groupId>org.kohsuke</groupId>
   <artifactId>github-api</artifactId>
-  <version>1.118</version>
+  <version>1.130</version>
   <name>GitHub API for Java</name>
   <url>https://github-api.kohsuke.org/</url>
   <description>GitHub API for Java</description>
@@ -11,7 +11,7 @@
     <connection>scm:git:git@github.com/hub4j/${project.artifactId}.git</connection>
     <developerConnection>scm:git:ssh://git@github.com/hub4j/${project.artifactId}.git</developerConnection>
     <url>https://github.com/hub4j/github-api/</url>
-    <tag>github-api-1.118</tag>
+    <tag>github-api-1.130</tag>
   </scm>
 
   <distributionManagement>
@@ -33,18 +33,21 @@
 
   <properties>
     <project.build.sourceEncoding>UTF-8</project.build.sourceEncoding>
-    <spotbugs-maven-plugin.version>4.1.4</spotbugs-maven-plugin.version>
-    <spotbugs.version>4.1.3</spotbugs.version>
+    <spotbugs-maven-plugin.version>4.2.3</spotbugs-maven-plugin.version>
+    <spotbugs.version>4.2.3</spotbugs.version>
     <spotbugs-maven-plugin.failOnError>true</spotbugs-maven-plugin.failOnError>
     <hamcrest.version>2.2</hamcrest.version>
     <okhttp3.version>4.4.1</okhttp3.version>
     <okio.version>2.5.0</okio.version>
-    <spotless-maven-plugin.goal>apply</spotless-maven-plugin.goal>
     <!-- Using this as the minimum bar for code coverage.  Adding methods without covering them will fail this. -->
-    <jacoco.coverage.target.bundle.method>0.60</jacoco.coverage.target.bundle.method>
-    <jacoco.coverage.target.class.method>0.25</jacoco.coverage.target.class.method>
+    <jacoco.coverage.target.bundle.method>0.70</jacoco.coverage.target.bundle.method>
+    <jacoco.coverage.target.class.method>0.50</jacoco.coverage.target.class.method>
     <!-- For non-ci builds we'd like the build to still complete if jacoco metrics aren't met. -->
     <jacoco.haltOnFailure>false</jacoco.haltOnFailure>
+    <jjwt.suite.version>0.11.2</jjwt.suite.version>
+
+    <jacoco.surefire.argLine />
+    <surefire.argLine />
   </properties>
 
   <build>
@@ -99,12 +102,17 @@
         <plugin>
           <groupId>org.jacoco</groupId>
           <artifactId>jacoco-maven-plugin</artifactId>
-          <version>0.8.6</version>
+          <version>0.8.7</version>
           <executions>
             <execution>
               <goals>
                 <goal>prepare-agent</goal>
               </goals>
+              <configuration>
+                <propertyName>jacoco.surefire.argLine</propertyName>
+                <!-- no need to get data about external code. It dramatically reduces performance of JaCoCo for nothing -->
+                <include>org.kohsuke.*</include>
+              </configuration>
             </execution>
             <!-- attached to Maven test phase -->
             <execution>
@@ -152,59 +160,41 @@
                       <!-- Sample only -->
                       <exclude>org.kohsuke.github.example.*</exclude>
 
-                      <!-- No methods -->
-                      <exclude>org.kohsuke.github.Previews</exclude>
 
                       <!-- Deprecated -->
+                      <exclude>org.kohsuke.github.extras.OkHttpConnector</exclude>
                       <exclude>org.kohsuke.github.extras.OkHttp3Connector</exclude>
                       <exclude>org.kohsuke.github.EnforcementLevel</exclude>
                       <exclude>org.kohsuke.github.GHPerson.1</exclude>
-
-                      <!-- These fail coverage on windows because tests are disabled -->
-                      <exclude>org.kohsuke.github.GHAsset</exclude>
-                      <exclude>org.kohsuke.github.GHReleaseBuilder</exclude>
-                      <exclude>org.kohsuke.github.GHRelease</exclude>
+                      
+                      <!-- TODO: Some coverage, but more needed -->
+                      <exclude>org.kohsuke.github.GHPullRequestReviewBuilder.DraftReviewComment</exclude>
+                      <exclude>org.kohsuke.github.GHIssue.PullRequest</exclude>
+                      <exclude>org.kohsuke.github.GHCommitSearchBuilder</exclude>
+                      <exclude>org.kohsuke.github.GHRepositorySearchBuilder</exclude>
+                      <exclude>org.kohsuke.github.GHUserSearchBuilder</exclude>
 
                       <!-- TODO: These still need test coverage -->
                       <exclude>org.kohsuke.github.GHBranchProtection.RequiredSignatures</exclude>
                       <exclude>org.kohsuke.github.GHBranchProtectionBuilder.Restrictions</exclude>
                       <exclude>org.kohsuke.github.GHBranchProtection.Restrictions</exclude>
                       <exclude>org.kohsuke.github.GHCommentAuthorAssociation</exclude>
-                      <exclude>org.kohsuke.github.GHCommitBuilder.UserInfo</exclude>
-                      <exclude>org.kohsuke.github.GHCommitState</exclude>
                       <exclude>org.kohsuke.github.GHCompare.Commit</exclude>
                       <exclude>org.kohsuke.github.GHCompare.InnerCommit</exclude>
-                      <exclude>org.kohsuke.github.GHCompare.Status</exclude>
                       <exclude>org.kohsuke.github.GHCompare.Tree</exclude>
                       <exclude>org.kohsuke.github.GHCompare.User</exclude>
                       <exclude>org.kohsuke.github.GHCompare</exclude>
                       <exclude>org.kohsuke.github.GHDeployKey</exclude>
-                      <exclude>org.kohsuke.github.GHDeploymentStatusBuilder</exclude>
-                      <exclude>org.kohsuke.github.GHDirection</exclude>
                       <exclude>org.kohsuke.github.GHEmail</exclude>
-                      <exclude>org.kohsuke.github.GHEventPayload.Ping</exclude>
-                      <exclude>org.kohsuke.github.GHEventPayload.Release</exclude>
-                      <exclude>org.kohsuke.github.GHException</exclude>
-                      <exclude>org.kohsuke.github.GHHook</exclude>
-                      <exclude>org.kohsuke.github.GHHooks.OrgContext</exclude>
                       <exclude>org.kohsuke.github.GHInvitation</exclude>
-                      <exclude>org.kohsuke.github.GHMilestoneState</exclude>
-                      <exclude>org.kohsuke.github.GHOrgHook</exclude>
-                      <exclude>org.kohsuke.github.GHProject.ProjectStateFilter</exclude>
                       <exclude>org.kohsuke.github.GHPullRequestCommitDetail.Authorship</exclude>
                       <exclude>org.kohsuke.github.GHPullRequestCommitDetail.Commit</exclude>
                       <exclude>org.kohsuke.github.GHPullRequestCommitDetail.CommitPointer</exclude>
                       <exclude>org.kohsuke.github.GHPullRequestCommitDetail.Tree</exclude>
                       <exclude>org.kohsuke.github.GHPullRequestCommitDetail</exclude>
                       <exclude>org.kohsuke.github.GHPullRequestFileDetail</exclude>
-                      <exclude>org.kohsuke.github.GHPullRequestQueryBuilder.Sort</exclude>
                       <exclude>org.kohsuke.github.GHReleaseUpdater</exclude>
-                      <exclude>org.kohsuke.github.GHRepository.ForkSort</exclude>
                       <exclude>org.kohsuke.github.GHRequestedAction</exclude>
-                      <exclude>org.kohsuke.github.GHStargazer</exclude>
-                      <exclude>org.kohsuke.github.GHTagObject</exclude>
-                      <exclude>org.kohsuke.github.GHTeam.Role</exclude>
-                      <exclude>org.kohsuke.github.GHUserSearchBuilder.Sort</exclude>
                       <exclude>org.kohsuke.github.GHVerifiedKey</exclude>
                     </excludes>
                   </rule>
@@ -216,7 +206,7 @@
         <plugin>
           <groupId>org.apache.maven.plugins</groupId>
           <artifactId>maven-javadoc-plugin</artifactId>
-          <version>3.2.0</version>
+          <version>3.3.0</version>
           <configuration>
             <source>8</source>
             <failOnWarnings>true</failOnWarnings>
@@ -260,7 +250,7 @@
       <plugin>
         <groupId>org.apache.maven.plugins</groupId>
         <artifactId>maven-project-info-reports-plugin</artifactId>
-        <version>3.1.1</version>
+        <version>3.1.2</version>
         <dependencies>
           <dependency>
             <groupId>org.apache.bcel</groupId>
@@ -292,18 +282,7 @@
             <id>default-test</id>
             <configuration>
               <excludesFile>src/test/resources/slow-or-flaky-tests.txt</excludesFile>
-            </configuration>
-          </execution>
-          <execution>
-            <id>slow-or-flaky-test</id>
-            <phase>test</phase>
-            <goals>
-              <goal>test</goal>
-            </goals>
-            <configuration>
-              <rerunFailingTestsCount>2</rerunFailingTestsCount>
-              <!-- There are some tests that take longer or are a little flaky.  Run them here. -->
-              <includesFile>src/test/resources/slow-or-flaky-tests.txt</includesFile>
+              <argLine>@{jacoco.surefire.argLine} ${surefire.argLine}</argLine>
             </configuration>
           </execution>
         </executions>
@@ -311,7 +290,7 @@
       <plugin>
         <groupId>org.codehaus.mojo</groupId>
         <artifactId>animal-sniffer-maven-plugin</artifactId>
-        <version>1.19</version>
+        <version>1.20</version>
         <configuration>
           <signature>
             <groupId>org.codehaus.mojo.signature</groupId>
@@ -344,13 +323,14 @@
       <plugin>
         <groupId>com.diffplug.spotless</groupId>
         <artifactId>spotless-maven-plugin</artifactId>
-        <version>2.6.1</version>
+        <version>2.11.1</version>
         <executions>
           <execution>
             <id>spotless-check</id>
-            <phase>process-sources</phase>
+            <!-- runs in verify phase by default -->
             <goals>
-              <goal>${spotless-maven-plugin.goal}</goal>
+              <!-- can be disabled using -Dspotless.check.skip=true -->
+              <goal>check</goal>
             </goals>
           </execution>
         </executions>
@@ -409,7 +389,7 @@
     <dependency>
       <groupId>com.tngtech.archunit</groupId>
       <artifactId>archunit</artifactId>
-      <version>0.15.0</version>
+      <version>0.19.0</version>
       <scope>test</scope>
     </dependency>
     <dependency>
@@ -434,23 +414,29 @@
     <dependency>
       <groupId>junit</groupId>
       <artifactId>junit</artifactId>
-      <version>4.13.1</version>
+      <version>4.13.2</version>
+      <scope>test</scope>
+    </dependency>
+    <dependency>
+      <groupId>org.awaitility</groupId>
+      <artifactId>awaitility</artifactId>
+      <version>4.1.0</version>
       <scope>test</scope>
     </dependency>
     <dependency>
       <groupId>com.fasterxml.jackson.core</groupId>
       <artifactId>jackson-databind</artifactId>
-      <version>2.10.2</version>
+      <version>2.12.3</version>
     </dependency>
     <dependency>
       <groupId>commons-io</groupId>
       <artifactId>commons-io</artifactId>
-      <version>2.4</version>
+      <version>2.8.0</version>
     </dependency>
     <dependency>
       <groupId>com.infradna.tool</groupId>
       <artifactId>bridge-method-annotation</artifactId>
-      <version>1.18</version>
+      <version>1.21</version>
       <optional>true</optional>
     </dependency>
     <!-- for stapler-jetty -->
@@ -471,7 +457,7 @@
     <dependency>
       <groupId>org.kohsuke.stapler</groupId>
       <artifactId>stapler</artifactId>
-      <version>1.262</version>
+      <version>1.263</version>
       <scope>test</scope>
     </dependency>
     <dependency>
@@ -483,26 +469,26 @@
     <dependency>
       <groupId>org.eclipse.jgit</groupId>
       <artifactId>org.eclipse.jgit</artifactId>
-      <version>5.10.0.202012080955-r</version>
+      <version>5.11.1.202105131744-r</version>
       <scope>test</scope>
     </dependency>
     <dependency>
       <groupId>io.jsonwebtoken</groupId>
       <artifactId>jjwt-api</artifactId>
-      <version>0.11.2</version>
-      <scope>test</scope>
+      <version>${jjwt.suite.version}</version>
+      <optional>true</optional>
     </dependency>
     <dependency>
       <groupId>io.jsonwebtoken</groupId>
       <artifactId>jjwt-impl</artifactId>
-      <version>0.11.2</version>
-      <scope>test</scope>
+      <version>${jjwt.suite.version}</version>
+      <optional>true</optional>
     </dependency>
     <dependency>
       <groupId>io.jsonwebtoken</groupId>
       <artifactId>jjwt-jackson</artifactId>
-      <version>0.11.2</version>
-      <scope>test</scope>
+      <version>${jjwt.suite.version}</version>
+      <optional>true</optional>
     </dependency>
     <dependency>
       <groupId>com.squareup.okio</groupId>
@@ -533,13 +519,13 @@
     <dependency>
       <groupId>org.kohsuke</groupId>
       <artifactId>wordnet-random-name</artifactId>
-      <version>1.3</version>
+      <version>1.5</version>
       <scope>test</scope>
     </dependency>
     <dependency>
       <groupId>org.mockito</groupId>
       <artifactId>mockito-core</artifactId>
-      <version>3.6.28</version>
+      <version>3.10.0</version>
       <scope>test</scope>
     </dependency>
     <dependency>
@@ -551,13 +537,13 @@
     <dependency>
       <groupId>com.github.tomakehurst</groupId>
       <artifactId>wiremock-jre8-standalone</artifactId>
-      <version>2.27.2</version>
+      <version>2.28.0</version>
       <scope>test</scope>
     </dependency>
     <dependency>
       <groupId>com.google.code.gson</groupId>
       <artifactId>gson</artifactId>
-      <version>2.8.6</version>
+      <version>2.8.7</version>
       <scope>test</scope>
     </dependency>
     <dependency>
@@ -580,6 +566,38 @@
     </pluginRepository>
   </pluginRepositories>
   <profiles>
+    <!-- only enable slow-or-flaky-test if -Dtest= is not present -->
+    <profile>
+      <id>slow-or-flaky-test</id>
+      <activation>
+        <property>
+          <name>!test</name>
+        </property>
+      </activation>
+      <build>
+        <plugins>
+          <plugin>
+            <artifactId>maven-surefire-plugin</artifactId>
+            <executions>
+              <execution>
+                <id>slow-or-flaky-test</id>
+                <phase>test</phase>
+                <goals>
+                  <goal>test</goal>
+                </goals>
+                <configuration>
+                  <rerunFailingTestsCount>2</rerunFailingTestsCount>
+                  <!-- There are some tests that take longer or are a little
+                    flaky. Run them here. -->
+                  <includesFile>src/test/resources/slow-or-flaky-tests.txt</includesFile>
+                  <argLine>@{jacoco.surefire.argLine} ${surefire.argLine}</argLine>
+                </configuration>
+              </execution>
+            </executions>
+          </plugin>
+        </plugins>
+      </build>
+    </profile>
     <profile>
       <id>ci-non-windows</id>
       <activation>
@@ -591,7 +609,8 @@
         </os>
       </activation>
       <properties>
-        <spotless-maven-plugin.goal>check</spotless-maven-plugin.goal>
+        <!-- Only fail code coverage on non-windows machines -->
+        <jacoco.haltOnFailure>true</jacoco.haltOnFailure>
       </properties>
     </profile>
     <profile>
@@ -601,23 +620,55 @@
           <name>enable-ci</name>
         </property>
       </activation>
-      <properties>
-        <jacoco.haltOnFailure>true</jacoco.haltOnFailure>
-      </properties>
       <build>
         <plugins>
           <plugin>
             <groupId>org.jacoco</groupId>
             <artifactId>jacoco-maven-plugin</artifactId>
           </plugin>
+          <plugin>
+            <groupId>com.diffplug.spotless</groupId>
+            <artifactId>spotless-maven-plugin</artifactId>
+            <executions>
+              <execution>
+                <id>spotless-check</id>
+                <!-- In CI, run check early in the build -->
+                <phase>process-sources</phase>
+                <goals>
+                  <goal>check</goal>
+                </goals>
+              </execution>
+            </executions>
+          </plugin>
+          <plugin>
+            <groupId>org.apache.maven.plugins</groupId>
+            <artifactId>maven-enforcer-plugin</artifactId>
+            <version>3.0.0-M3</version>
+            <executions>
+              <execution>
+                <id>enforce-jacoco-exist</id>
+                <phase>verify</phase>
+                <goals>
+                  <goal>enforce</goal>
+                </goals>
+                <configuration>
+                  <rules>
+                    <requireFilesExist>
+                      <files>
+                        <file>${project.build.directory}/jacoco.exec</file>
+                      </files>
+                    </requireFilesExist>
+                  </rules>
+                  <fail>true</fail>
+                </configuration>
+              </execution>
+            </executions>
+          </plugin>
         </plugins>
       </build>
     </profile>
     <profile>
       <id>release</id>
-      <properties>
-        <spotless-maven-plugin.goal>check</spotless-maven-plugin.goal>
-      </properties>
       <build>
         <plugins>
           <plugin>

src/main/java/org/kohsuke/github/GHApp.java

@@ -1,11 +1,14 @@
 package org.kohsuke.github;
 
+import org.kohsuke.github.internal.EnumUtils;
+
 import java.io.IOException;
 import java.net.URL;
 import java.util.List;
 import java.util.Map;
+import java.util.stream.Collectors;
 
-import static org.kohsuke.github.Previews.MACHINE_MAN;
+import static org.kohsuke.github.internal.Previews.MACHINE_MAN;
 
 /**
  * A Github App.
@@ -20,7 +23,7 @@ public class GHApp extends GHObject {
     private String description;
     private String externalUrl;
     private Map<String, String> permissions;
-    private List<GHEvent> events;
+    private List<String> events;
     private long installationsCount;
     private String htmlUrl;
 
@@ -114,7 +117,9 @@ public class GHApp extends GHObject {
      * @return the events
      */
     public List<GHEvent> getEvents() {
-        return events;
+        return events.stream()
+                .map(e -> EnumUtils.getEnumOrDefault(GHEvent.class, e, GHEvent.UNKNOWN))
+                .collect(Collectors.toList());
     }
 
     /**
@@ -126,7 +131,7 @@ public class GHApp extends GHObject {
      */
     @Deprecated
     public void setEvents(List<GHEvent> events) {
-        this.events = events;
+        this.events = events.stream().map(GHEvent::symbol).collect(Collectors.toList());
     }
 
     /**

src/main/java/org/kohsuke/github/GHAppCreateTokenBuilder.java

@@ -5,7 +5,7 @@ import java.util.HashMap;
 import java.util.List;
 import java.util.Map;
 
-import static org.kohsuke.github.Previews.MACHINE_MAN;
+import static org.kohsuke.github.internal.Previews.MACHINE_MAN;
 
 /**
  * Creates a access token for a GitHub App Installation

src/main/java/org/kohsuke/github/GHAppInstallation.java

@@ -1,15 +1,17 @@
 package org.kohsuke.github;
 
 import com.fasterxml.jackson.annotation.JsonProperty;
+import org.kohsuke.github.internal.EnumUtils;
 
 import java.io.IOException;
 import java.net.MalformedURLException;
 import java.net.URL;
 import java.util.List;
 import java.util.Map;
+import java.util.stream.Collectors;
 
-import static org.kohsuke.github.Previews.GAMBIT;
-import static org.kohsuke.github.Previews.MACHINE_MAN;
+import static org.kohsuke.github.internal.Previews.GAMBIT;
+import static org.kohsuke.github.internal.Previews.MACHINE_MAN;
 
 /**
  * A Github App Installation.
@@ -35,7 +37,7 @@ public class GHAppInstallation extends GHObject {
     @JsonProperty("target_type")
     private GHTargetType targetType;
     private Map<String, GHPermissionType> permissions;
-    private List<GHEvent> events;
+    private List<String> events;
     @JsonProperty("single_file_name")
     private String singleFileName;
     @JsonProperty("repository_selection")
@@ -250,7 +252,9 @@ public class GHAppInstallation extends GHObject {
      * @return the events
      */
     public List<GHEvent> getEvents() {
-        return events;
+        return events.stream()
+                .map(e -> EnumUtils.getEnumOrDefault(GHEvent.class, e, GHEvent.UNKNOWN))
+                .collect(Collectors.toList());
     }
 
     /**
@@ -262,7 +266,7 @@ public class GHAppInstallation extends GHObject {
      */
     @Deprecated
     public void setEvents(List<GHEvent> events) {
-        this.events = events;
+        this.events = events.stream().map(GHEvent::symbol).collect(Collectors.toList());
     }
 
     /**

src/main/java/org/kohsuke/github/GHArtifact.java

@@ -0,0 +1,140 @@
+package org.kohsuke.github;
+
+import com.fasterxml.jackson.annotation.JsonIgnore;
+import org.apache.commons.lang3.StringUtils;
+import org.kohsuke.github.function.InputStreamFunction;
+
+import java.io.IOException;
+import java.net.URL;
+import java.util.Date;
+import java.util.Objects;
+
+import static java.util.Objects.requireNonNull;
+
+/**
+ * An artifact from a workflow run.
+ *
+ * @author Guillaume Smet
+ */
+public class GHArtifact extends GHObject {
+
+    // Not provided by the API.
+    @JsonIgnore
+    private GHRepository owner;
+
+    private String name;
+    private long sizeInBytes;
+    private String archiveDownloadUrl;
+    private boolean expired;
+    private String expiresAt;
+
+    /**
+     * Gets the name.
+     *
+     * @return the name
+     */
+    public String getName() {
+        return name;
+    }
+
+    /**
+     * Gets the size of the artifact in bytes.
+     *
+     * @return the size
+     */
+    public long getSizeInBytes() {
+        return sizeInBytes;
+    }
+
+    /**
+     * Gets the archive download URL.
+     *
+     * @return the archive download URL
+     */
+    public URL getArchiveDownloadUrl() {
+        return GitHubClient.parseURL(archiveDownloadUrl);
+    }
+
+    /**
+     * If this artifact has expired.
+     *
+     * @return if the artifact has expired
+     */
+    public boolean isExpired() {
+        return expired;
+    }
+
+    /**
+     * Gets the date at which this artifact will expire.
+     *
+     * @return the date of expiration
+     */
+    public Date getExpiresAt() {
+        return GitHubClient.parseDate(expiresAt);
+    }
+
+    /**
+     * Repository to which the artifact belongs.
+     *
+     * @return the repository
+     */
+    public GHRepository getRepository() {
+        return owner;
+    }
+
+    /**
+     * @deprecated This object has no HTML URL.
+     */
+    @Override
+    public URL getHtmlUrl() throws IOException {
+        return null;
+    }
+
+    /**
+     * Deletes the artifact.
+     *
+     * @throws IOException
+     *             the io exception
+     */
+    public void delete() throws IOException {
+        root.createRequest().method("DELETE").withUrlPath(getApiRoute()).fetchHttpStatusCode();
+    }
+
+    /**
+     * Downloads the artifact.
+     *
+     * @param <T>
+     *            the type of result
+     * @param streamFunction
+     *            The {@link InputStreamFunction} that will process the stream
+     * @throws IOException
+     *             The IO exception.
+     * @return the result of reading the stream.
+     */
+    public <T> T download(InputStreamFunction<T> streamFunction) throws IOException {
+        requireNonNull(streamFunction, "Stream function must not be null");
+
+        return root.createRequest().method("GET").withUrlPath(getApiRoute(), "zip").fetchStream(streamFunction);
+    }
+
+    private String getApiRoute() {
+        if (owner == null) {
+            // Workflow runs returned from search to do not have an owner. Attempt to use url.
+            final URL url = Objects.requireNonNull(getUrl(), "Missing instance URL!");
+            return StringUtils.prependIfMissing(url.toString().replace(root.getApiUrl(), ""), "/");
+        }
+        return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/actions/artifacts/" + getId();
+    }
+
+    GHArtifact wrapUp(GHRepository owner) {
+        this.owner = owner;
+        return wrapUp(owner.root);
+    }
+
+    GHArtifact wrapUp(GitHub root) {
+        this.root = root;
+        if (owner != null)
+            owner.wrap(root);
+        return this;
+    }
+}

src/main/java/org/kohsuke/github/GHArtifactsIterable.java

@@ -0,0 +1,49 @@
+package org.kohsuke.github;
+
+import java.net.MalformedURLException;
+import java.util.Iterator;
+
+import javax.annotation.Nonnull;
+
+/**
+ * Iterable for artifacts listing.
+ */
+class GHArtifactsIterable extends PagedIterable<GHArtifact> {
+    private final transient GHRepository owner;
+    private final GitHubRequest request;
+
+    private GHArtifactsPage result;
+
+    public GHArtifactsIterable(GHRepository owner, GitHubRequest.Builder<?> requestBuilder) {
+        this.owner = owner;
+        try {
+            this.request = requestBuilder.build();
+        } catch (MalformedURLException e) {
+            throw new GHException("Malformed URL", e);
+        }
+    }
+
+    @Nonnull
+    @Override
+    public PagedIterator<GHArtifact> _iterator(int pageSize) {
+        return new PagedIterator<>(
+                adapt(GitHubPageIterator.create(owner.getRoot().getClient(), GHArtifactsPage.class, request, pageSize)),
+                null);
+    }
+
+    protected Iterator<GHArtifact[]> adapt(final Iterator<GHArtifactsPage> base) {
+        return new Iterator<GHArtifact[]>() {
+            public boolean hasNext() {
+                return base.hasNext();
+            }
+
+            public GHArtifact[] next() {
+                GHArtifactsPage v = base.next();
+                if (result == null) {
+                    result = v;
+                }
+                return v.getArtifacts(owner);
+            }
+        };
+    }
+}

src/main/java/org/kohsuke/github/GHArtifactsPage.java

@@ -0,0 +1,20 @@
+package org.kohsuke.github;
+
+/**
+ * Represents the one page of artifacts result when listing artifacts.
+ */
+class GHArtifactsPage {
+    private int total_count;
+    private GHArtifact[] artifacts;
+
+    public int getTotalCount() {
+        return total_count;
+    }
+
+    GHArtifact[] getArtifacts(GHRepository owner) {
+        for (GHArtifact artifact : artifacts) {
+            artifact.wrapUp(owner);
+        }
+        return artifacts;
+    }
+}

src/main/java/org/kohsuke/github/GHBranch.java

@@ -3,6 +3,7 @@ package org.kohsuke.github;
 import com.fasterxml.jackson.annotation.JsonCreator;
 import com.fasterxml.jackson.annotation.JsonProperty;
 import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
+import org.kohsuke.github.internal.Previews;
 
 import java.io.IOException;
 import java.net.URL;

src/main/java/org/kohsuke/github/GHBranchProtection.java

@@ -6,7 +6,7 @@ import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
 import java.io.IOException;
 import java.util.Collection;
 
-import static org.kohsuke.github.Previews.ZZZAX;
+import static org.kohsuke.github.internal.Previews.ZZZAX;
 
 /**
  * The type GHBranchProtection.

src/main/java/org/kohsuke/github/GHBranchProtectionBuilder.java

@@ -12,7 +12,7 @@ import java.util.List;
 import java.util.Map;
 import java.util.Set;
 
-import static org.kohsuke.github.Previews.*;
+import static org.kohsuke.github.internal.Previews.LUKE_CAGE;
 
 /**
  * Builder to configure the branch protection settings.

src/main/java/org/kohsuke/github/GHCheckRun.java

@@ -1,8 +1,13 @@
 package org.kohsuke.github;
 
 import com.fasterxml.jackson.annotation.JsonProperty;
+import com.infradna.tool.bridge_method_injector.WithBridgeMethods;
 import edu.umd.cs.findbugs.annotations.NonNull;
 import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
+import org.kohsuke.github.GHWorkflowRun.Conclusion;
+import org.kohsuke.github.GHWorkflowRun.Status;
+import org.kohsuke.github.internal.EnumUtils;
+import org.kohsuke.github.internal.Previews;
 
 import java.io.IOException;
 import java.net.URL;
@@ -10,6 +15,7 @@ import java.util.Arrays;
 import java.util.Collections;
 import java.util.Date;
 import java.util.List;
+import java.util.Locale;
 
 /**
  * Represents a check run.
@@ -79,12 +85,27 @@ public class GHCheckRun extends GHObject {
      * @return Status of the check run
      * @see Status
      */
-    public String getStatus() {
+    @WithBridgeMethods(value = String.class, adapterMethod = "statusAsStr")
+    public Status getStatus() {
+        return Status.from(status);
+    }
+
+    @SuppressFBWarnings(value = "UPM_UNCALLED_PRIVATE_METHOD", justification = "Bridge method of getStatus")
+    private Object statusAsStr(Status status, Class type) {
         return status;
     }
 
     public static enum Status {
-        QUEUED, IN_PROGRESS, COMPLETED
+        QUEUED, IN_PROGRESS, COMPLETED, UNKNOWN;
+
+        public static Status from(String value) {
+            return EnumUtils.getNullableEnumOrDefault(Status.class, value, Status.UNKNOWN);
+        }
+
+        @Override
+        public String toString() {
+            return name().toLowerCase(Locale.ROOT);
+        }
     }
 
     /**
@@ -93,7 +114,13 @@ public class GHCheckRun extends GHObject {
      * @return Status of the check run
      * @see Conclusion
      */
-    public String getConclusion() {
+    @WithBridgeMethods(value = String.class, adapterMethod = "conclusionAsStr")
+    public Conclusion getConclusion() {
+        return Conclusion.from(conclusion);
+    }
+
+    @SuppressFBWarnings(value = "UPM_UNCALLED_PRIVATE_METHOD", justification = "Bridge method of getConclusion")
+    private Object conclusionAsStr(Conclusion conclusion, Class type) {
         return conclusion;
     }
 
@@ -104,7 +131,16 @@ public class GHCheckRun extends GHObject {
      * Parameters - <code>conclusion</code></a>.
      */
     public static enum Conclusion {
-        SUCCESS, FAILURE, NEUTRAL, CANCELLED, TIMED_OUT, ACTION_REQUIRED, SKIPPED
+        ACTION_REQUIRED, CANCELLED, FAILURE, NEUTRAL, SUCCESS, SKIPPED, STALE, TIMED_OUT, UNKNOWN;
+
+        public static Conclusion from(String value) {
+            return EnumUtils.getNullableEnumOrDefault(Conclusion.class, value, Conclusion.UNKNOWN);
+        }
+
+        @Override
+        public String toString() {
+            return name().toLowerCase(Locale.ROOT);
+        }
     }
 
     /**

src/main/java/org/kohsuke/github/GHCheckRunBuilder.java

@@ -28,6 +28,7 @@ import com.fasterxml.jackson.annotation.JsonInclude;
 import edu.umd.cs.findbugs.annotations.CheckForNull;
 import edu.umd.cs.findbugs.annotations.NonNull;
 import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
+import org.kohsuke.github.internal.Previews;
 
 import java.io.IOException;
 import java.util.Collections;
@@ -151,7 +152,7 @@ public final class GHCheckRunBuilder {
         }
         GHCheckRun run = requester.with("output", output).with("actions", actions).fetch(GHCheckRun.class).wrap(repo);
         while (!extraAnnotations.isEmpty()) {
-            Output output2 = new Output(output.title, output.summary);
+            Output output2 = new Output(output.title, output.summary).withText(output.text);
             int i = Math.min(extraAnnotations.size(), MAX_ANNOTATIONS);
             output2.annotations = extraAnnotations.subList(0, i);
             extraAnnotations = extraAnnotations.subList(i, extraAnnotations.size());

src/main/java/org/kohsuke/github/GHCheckRunsIterable.java

@@ -8,13 +8,13 @@ import javax.annotation.Nonnull;
  * Iterable for check-runs listing.
  */
 class GHCheckRunsIterable extends PagedIterable<GHCheckRun> {
-    private final transient GitHub root;
+    private final GHRepository owner;
     private final GitHubRequest request;
 
     private GHCheckRunsPage result;
 
-    public GHCheckRunsIterable(GitHub root, GitHubRequest request) {
-        this.root = root;
+    public GHCheckRunsIterable(GHRepository owner, GitHubRequest request) {
+        this.owner = owner;
         this.request = request;
     }
 
@@ -22,7 +22,7 @@ class GHCheckRunsIterable extends PagedIterable<GHCheckRun> {
     @Override
     public PagedIterator<GHCheckRun> _iterator(int pageSize) {
         return new PagedIterator<>(
-                adapt(GitHubPageIterator.create(root.getClient(), GHCheckRunsPage.class, request, pageSize)),
+                adapt(GitHubPageIterator.create(owner.getRoot().getClient(), GHCheckRunsPage.class, request, pageSize)),
                 null);
     }
 
@@ -37,7 +37,7 @@ class GHCheckRunsIterable extends PagedIterable<GHCheckRun> {
                 if (result == null) {
                     result = v;
                 }
-                return v.getCheckRuns(root);
+                return v.getCheckRuns(owner);
             }
         };
     }

src/main/java/org/kohsuke/github/GHCheckRunsPage.java

@@ -11,9 +11,9 @@ class GHCheckRunsPage {
         return total_count;
     }
 
-    GHCheckRun[] getCheckRuns(GitHub root) {
+    GHCheckRun[] getCheckRuns(GHRepository owner) {
         for (GHCheckRun check_run : check_runs) {
-            check_run.wrap(root);
+            check_run.wrap(owner);
         }
         return check_runs;
     }

src/main/java/org/kohsuke/github/GHCommit.java

@@ -11,8 +11,8 @@ import java.util.Collections;
 import java.util.Date;
 import java.util.List;
 
-import static org.kohsuke.github.Previews.ANTIOPE;
-import static org.kohsuke.github.Previews.GROOT;
+import static org.kohsuke.github.internal.Previews.ANTIOPE;
+import static org.kohsuke.github.internal.Previews.GROOT;
 
 /**
  * A commit in a repository.

src/main/java/org/kohsuke/github/GHCommitComment.java

@@ -5,7 +5,7 @@ import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
 import java.io.IOException;
 import java.net.URL;
 
-import static org.kohsuke.github.Previews.*;
+import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
 
 /**
  * A comment attached to a commit (or a specific line in a specific file of a commit.)

src/main/java/org/kohsuke/github/GHCommitSearchBuilder.java

@@ -1,6 +1,7 @@
 package org.kohsuke.github;
 
 import org.apache.commons.lang3.StringUtils;
+import org.kohsuke.github.internal.Previews;
 
 import java.io.IOException;
 

src/main/java/org/kohsuke/github/GHContentSearchBuilder.java

@@ -118,6 +118,41 @@ public class GHContentSearchBuilder extends GHSearchBuilder<GHContent> {
         return q("repo:" + v);
     }
 
+    /**
+     * Order gh content search builder.
+     *
+     * @param v
+     *            the v
+     * @return the gh content search builder
+     */
+    public GHContentSearchBuilder order(GHDirection v) {
+        req.with("order", v);
+        return this;
+    }
+
+    /**
+     * Sort gh content search builder.
+     *
+     * @param sort
+     *            the sort
+     * @return the gh content search builder
+     */
+    public GHContentSearchBuilder sort(GHContentSearchBuilder.Sort sort) {
+        if (Sort.BEST_MATCH.equals(sort)) {
+            req.remove("sort");
+        } else {
+            req.with("sort", sort);
+        }
+        return this;
+    }
+
+    /**
+     * The enum Sort.
+     */
+    public enum Sort {
+        BEST_MATCH, INDEXED
+    }
+
     private static class ContentSearchResult extends SearchResult<GHContent> {
         private GHContent[] items;
 

src/main/java/org/kohsuke/github/GHCreateRepositoryBuilder.java

@@ -2,7 +2,7 @@ package org.kohsuke.github;
 
 import java.io.IOException;
 
-import static org.kohsuke.github.Previews.BAPTISTE;
+import static org.kohsuke.github.internal.Previews.BAPTISTE;
 
 /**
  * Creates a repository

src/main/java/org/kohsuke/github/GHDeployment.java

@@ -1,5 +1,7 @@
 package org.kohsuke.github;
 
+import org.kohsuke.github.internal.Previews;
+
 import java.io.IOException;
 import java.net.URL;
 import java.util.Map;

src/main/java/org/kohsuke/github/GHDeploymentBuilder.java

@@ -1,5 +1,7 @@
 package org.kohsuke.github;
 
+import org.kohsuke.github.internal.Previews;
+
 import java.io.IOException;
 import java.util.List;
 

src/main/java/org/kohsuke/github/GHDeploymentState.java

@@ -1,5 +1,7 @@
 package org.kohsuke.github;
 
+import org.kohsuke.github.internal.Previews;
+
 /**
  * Represents the state of deployment
  */

src/main/java/org/kohsuke/github/GHDeploymentStatus.java

@@ -1,5 +1,7 @@
 package org.kohsuke.github;
 
+import org.kohsuke.github.internal.Previews;
+
 import java.net.URL;
 import java.util.Locale;
 

src/main/java/org/kohsuke/github/GHDeploymentStatusBuilder.java

@@ -1,5 +1,7 @@
 package org.kohsuke.github;
 
+import org.kohsuke.github.internal.Previews;
+
 import java.io.IOException;
 
 /**

src/main/java/org/kohsuke/github/GHDiscussion.java

@@ -1,6 +1,7 @@
 package org.kohsuke.github;
 
 import com.fasterxml.jackson.annotation.JsonProperty;
+import org.kohsuke.github.internal.Previews;
 
 import java.io.IOException;
 import java.net.URL;

src/main/java/org/kohsuke/github/GHEvent.java

@@ -12,6 +12,7 @@ import java.util.Locale;
 public enum GHEvent {
     CHECK_RUN,
     CHECK_SUITE,
+    CODE_SCANNING_ALERT,
     COMMIT_COMMENT,
     CONTENT_REFERENCE,
     CREATE,
@@ -19,6 +20,8 @@ public enum GHEvent {
     DEPLOY_KEY,
     DEPLOYMENT,
     DEPLOYMENT_STATUS,
+    DISCUSSION,
+    DISCUSSION_COMMENT,
     DOWNLOAD,
     FOLLOW,
     FORK,
@@ -56,6 +59,7 @@ public enum GHEvent {
     REPOSITORY,
     REPOSITORY_IMPORT,
     REPOSITORY_VULNERABILITY_ALERT,
+    SCHEDULE,
     SECURITY_ADVISORY,
     STAR,
     STATUS,
@@ -65,6 +69,11 @@ public enum GHEvent {
     WORKFLOW_DISPATCH,
     WORKFLOW_RUN,
 
+    /**
+     * Special event type that means we haven't found an enum value corresponding to the event.
+     */
+    UNKNOWN,
+
     /**
      * Special event type that means "every possible event"
      */

src/main/java/org/kohsuke/github/GHEventInfo.java

@@ -4,7 +4,7 @@ import com.fasterxml.jackson.databind.node.ObjectNode;
 import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
 
 import java.io.IOException;
-import java.util.Date;
+import java.util.*;
 
 /**
  * Represents an event.
@@ -18,6 +18,16 @@ public class GHEventInfo extends GitHubInteractiveObject {
 
     private long id;
     private String created_at;
+
+    /**
+     * Representation of GitHub Event API Event Type.
+     *
+     * This is not the same as the values used for hook methods such as
+     * {@link GHRepository#createHook(String, Map, Collection, boolean)}.
+     *
+     * @see <a href="https://docs.github.com/en/developers/webhooks-and-events/github-event-types">GitHub event
+     *      types</a>
+     */
     private String type;
 
     // these are all shallow objects
@@ -40,20 +50,45 @@ public class GHEventInfo extends GitHubInteractiveObject {
         private String name; // owner/repo
     }
 
+    static final Map<String, GHEvent> mapTypeStringToEvent = createEventMap();
+
+    /**
+     * Map for GitHub Event API Event Type to GHEvent.
+     *
+     * @see <a href="https://docs.github.com/en/developers/webhooks-and-events/github-event-types">GitHub event
+     *      types</a>
+     */
+    private static Map<String, GHEvent> createEventMap() {
+        HashMap<String, GHEvent> map = new HashMap<>();
+        map.put("CommitCommentEvent", GHEvent.COMMIT_COMMENT);
+        map.put("CreateEvent", GHEvent.CREATE);
+        map.put("DeleteEvent", GHEvent.DELETE);
+        map.put("ForkEvent", GHEvent.FORK);
+        map.put("GollumEvent", GHEvent.GOLLUM);
+        map.put("IssueCommentEvent", GHEvent.ISSUE_COMMENT);
+        map.put("IssuesEvent", GHEvent.ISSUES);
+        map.put("MemberEvent", GHEvent.MEMBER);
+        map.put("PublicEvent", GHEvent.PUBLIC);
+        map.put("PullRequestEvent", GHEvent.PULL_REQUEST);
+        map.put("PullRequestReviewEvent", GHEvent.PULL_REQUEST_REVIEW);
+        map.put("PullRequestReviewCommentEvent", GHEvent.PULL_REQUEST_REVIEW_COMMENT);
+        map.put("PushEvent", GHEvent.PUSH);
+        map.put("ReleaseEvent", GHEvent.RELEASE);
+        map.put("WatchEvent", GHEvent.WATCH);
+        return Collections.unmodifiableMap(map);
+    }
+
+    static GHEvent transformTypeToGHEvent(String type) {
+        return mapTypeStringToEvent.getOrDefault(type, GHEvent.UNKNOWN);
+    }
+
     /**
      * Gets type.
      *
      * @return the type
      */
     public GHEvent getType() {
-        String t = type;
-        if (t.endsWith("Event"))
-            t = t.substring(0, t.length() - 5);
-        for (GHEvent e : GHEvent.values()) {
-            if (e.name().replace("_", "").equalsIgnoreCase(t))
-                return e;
-        }
-        return null; // unknown event type
+        return transformTypeToGHEvent(type);
     }
 
     GHEventInfo wrapUp(GitHub root) {

src/main/java/org/kohsuke/github/GHEventPayload.java

@@ -5,7 +5,9 @@ import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
 
 import java.io.IOException;
 import java.io.Reader;
+import java.util.Date;
 import java.util.List;
+import java.util.Map;
 
 /**
  * Base type for types used in databinding of the event payload.
@@ -380,9 +382,9 @@ public class GHEventPayload extends GitHubInteractiveObject {
         }
 
         /**
-         * Gets label.
+         * Gets the added or removed label for labeled/unlabeled events.
          *
-         * @return the label
+         * @return label the added or removed label
          */
         public GHLabel getLabel() {
             return label;
@@ -519,6 +521,10 @@ public class GHEventPayload extends GitHubInteractiveObject {
     public static class Issue extends GHEventPayload {
         private GHIssue issue;
 
+        private GHLabel label;
+
+        private GHIssueChanges changes;
+
         /**
          * Gets issue.
          *
@@ -538,6 +544,24 @@ public class GHEventPayload extends GitHubInteractiveObject {
             this.issue = issue;
         }
 
+        /**
+         * Gets the added or removed label for labeled/unlabeled events.
+         *
+         * @return label the added or removed label
+         */
+        public GHLabel getLabel() {
+            return label;
+        }
+
+        /**
+         * Get changes (for action="edited")
+         *
+         * @return changes
+         */
+        public GHIssueChanges getChanges() {
+            return changes;
+        }
+
         @Override
         void wrapUp(GitHub root) {
             super.wrapUp(root);
@@ -687,9 +711,11 @@ public class GHEventPayload extends GitHubInteractiveObject {
         }
 
         /**
-         * Gets master branch.
+         * Gets default branch.
          *
-         * @return the master branch
+         * Name is an artifact of when "master" was the most common default.
+         *
+         * @return the default branch
          */
         @SuppressFBWarnings(value = "UWF_UNWRITTEN_FIELD", justification = "Comes from JSON deserialization")
         public String getMasterBranch() {
@@ -935,7 +961,7 @@ public class GHEventPayload extends GitHubInteractiveObject {
         }
 
         /**
-         * The full Git ref that was pushed. Example: “refs/heads/master”
+         * The full Git ref that was pushed. Example: “refs/heads/main”
          *
          * @return the ref
          */
@@ -1067,7 +1093,7 @@ public class GHEventPayload extends GitHubInteractiveObject {
         public static class PushCommit {
             private GitUser author;
             private GitUser committer;
-            private String url, sha, message;
+            private String url, sha, message, timestamp;
             private boolean distinct;
             private List<String> added, removed, modified;
 
@@ -1156,6 +1182,15 @@ public class GHEventPayload extends GitHubInteractiveObject {
             public List<String> getModified() {
                 return modified;
             }
+
+            /**
+             * Obtains the timestamp of the commit
+             *
+             * @return the timestamp
+             */
+            public Date getTimestamp() {
+                return GitHubClient.parseDate(timestamp);
+            }
         }
     }
 
@@ -1294,4 +1329,125 @@ public class GHEventPayload extends GitHubInteractiveObject {
             }
         }
     }
+
+    /**
+     * Occurs when someone triggered a workflow run or sends a POST request to the "Create a workflow dispatch event"
+     * endpoint.
+     *
+     * @see <a href=
+     *      "https://docs.github.com/en/developers/webhooks-and-events/webhook-events-and-payloads#workflow_dispatch">
+     *      workflow dispatch event</a>
+     * @see <a href=
+     *      "https://docs.github.com/en/actions/reference/events-that-trigger-workflows#workflow_dispatch">Events that
+     *      trigger workflows</a>
+     */
+    public static class WorkflowDispatch extends GHEventPayload {
+        private Map<String, Object> inputs;
+        private String ref;
+        private String workflow;
+
+        /**
+         * Gets the map of input parameters passed to the workflow.
+         *
+         * @return the map of input parameters
+         */
+        public Map<String, Object> getInputs() {
+            return inputs;
+        }
+
+        /**
+         * Gets the ref of the branch (e.g. refs/heads/main)
+         *
+         * @return the ref of the branch
+         */
+        public String getRef() {
+            return ref;
+        }
+
+        /**
+         * Gets the path of the workflow file (e.g. .github/workflows/hello-world-workflow.yml).
+         *
+         * @return the path of the workflow file
+         */
+        public String getWorkflow() {
+            return workflow;
+        }
+    }
+
+    /**
+     * A workflow run was requested or completed.
+     *
+     * @see <a href=
+     *      "https://docs.github.com/en/developers/webhooks-and-events/webhook-events-and-payloads#workflow_run">
+     *      workflow run event</a>
+     * @see <a href="https://docs.github.com/en/rest/reference/actions#workflow-runs">Actions Workflow Runs</a>
+     */
+    public static class WorkflowRun extends GHEventPayload {
+        private GHWorkflowRun workflowRun;
+        private GHWorkflow workflow;
+
+        /**
+         * Gets the workflow run.
+         *
+         * @return the workflow run
+         */
+        public GHWorkflowRun getWorkflowRun() {
+            return workflowRun;
+        }
+
+        /**
+         * Gets the associated workflow.
+         *
+         * @return the associated workflow
+         */
+        public GHWorkflow getWorkflow() {
+            return workflow;
+        }
+
+        @Override
+        void wrapUp(GitHub root) {
+            super.wrapUp(root);
+            if (workflowRun == null || workflow == null) {
+                throw new IllegalStateException(
+                        "Expected workflow and workflow_run payload, but got something else. Maybe we've got another type of event?");
+            }
+            GHRepository repository = getRepository();
+            if (repository == null) {
+                throw new IllegalStateException("Repository must not be null");
+            }
+            workflowRun.wrapUp(repository);
+            workflow.wrapUp(repository);
+        }
+    }
+
+    /**
+     * A label was created, edited or deleted.
+     *
+     * @see <a href= "https://docs.github.com/en/developers/webhooks-and-events/webhook-events-and-payloads#label">
+     *      label event</a>
+     */
+    public static class Label extends GHEventPayload {
+
+        private GHLabel label;
+
+        private GHLabelChanges changes;
+
+        /**
+         * Gets the label.
+         *
+         * @return the label
+         */
+        public GHLabel getLabel() {
+            return label;
+        }
+
+        /**
+         * Gets changes (for action="edited")
+         *
+         * @return changes
+         */
+        public GHLabelChanges getChanges() {
+            return changes;
+        }
+    }
 }

src/main/java/org/kohsuke/github/GHHook.java

@@ -1,13 +1,13 @@
 package org.kohsuke.github;
 
 import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
+import org.kohsuke.github.internal.EnumUtils;
 
 import java.io.IOException;
 import java.net.URL;
 import java.util.Collections;
 import java.util.EnumSet;
 import java.util.List;
-import java.util.Locale;
 import java.util.Map;
 
 /**
@@ -40,10 +40,7 @@ public abstract class GHHook extends GHObject {
     public EnumSet<GHEvent> getEvents() {
         EnumSet<GHEvent> s = EnumSet.noneOf(GHEvent.class);
         for (String e : events) {
-            if (e.equals("*"))
-                s.add(GHEvent.ALL);
-            else
-                s.add(Enum.valueOf(GHEvent.class, e.toUpperCase(Locale.ENGLISH)));
+            s.add(e.equals("*") ? GHEvent.ALL : EnumUtils.getEnumOrDefault(GHEvent.class, e, GHEvent.UNKNOWN));
         }
         return s;
     }

src/main/java/org/kohsuke/github/GHIssue.java

@@ -39,7 +39,7 @@ import java.util.List;
 import java.util.Locale;
 import java.util.Objects;
 
-import static org.kohsuke.github.Previews.SQUIRREL_GIRL;
+import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
 
 /**
  * Represents an issue on GitHub.
@@ -312,7 +312,7 @@ public class GHIssue extends GHObject implements Reactable {
     }
 
     /**
-     * Sets labels.
+     * Sets labels on the target to a specific list.
      *
      * @param labels
      *            the labels
@@ -326,100 +326,137 @@ public class GHIssue extends GHObject implements Reactable {
     /**
      * Adds labels to the issue.
      *
+     * Labels that are already present on the target are ignored.
+     *
+     * @return the complete list of labels including the new additions
      * @param names
      *            Names of the label
      * @throws IOException
      *             the io exception
      */
-    public void addLabels(String... names) throws IOException {
-        _addLabels(Arrays.asList(names));
+    @WithBridgeMethods(void.class)
+    public List<GHLabel> addLabels(String... names) throws IOException {
+        return _addLabels(Arrays.asList(names));
     }
 
     /**
      * Add labels.
      *
+     * Labels that are already present on the target are ignored.
+     *
+     * @return the complete list of labels including the new additions
      * @param labels
      *            the labels
      * @throws IOException
      *             the io exception
      */
-    public void addLabels(GHLabel... labels) throws IOException {
-        addLabels(Arrays.asList(labels));
+    @WithBridgeMethods(void.class)
+    public List<GHLabel> addLabels(GHLabel... labels) throws IOException {
+        return addLabels(Arrays.asList(labels));
     }
 
     /**
      * Add labels.
      *
+     * Labels that are already present on the target are ignored.
+     *
+     * @return the complete list of labels including the new additions
      * @param labels
      *            the labels
      * @throws IOException
      *             the io exception
      */
-    public void addLabels(Collection<GHLabel> labels) throws IOException {
-        _addLabels(GHLabel.toNames(labels));
+    @WithBridgeMethods(void.class)
+    public List<GHLabel> addLabels(Collection<GHLabel> labels) throws IOException {
+        return _addLabels(GHLabel.toNames(labels));
     }
 
-    private void _addLabels(Collection<String> names) throws IOException {
-        List<String> newLabels = new ArrayList<String>();
-
-        for (GHLabel label : getLabels()) {
-            newLabels.add(label.getName());
-        }
-        for (String name : names) {
-            if (!newLabels.contains(name)) {
-                newLabels.add(name);
-            }
-        }
-        setLabels(newLabels.toArray(new String[0]));
+    private List<GHLabel> _addLabels(Collection<String> names) throws IOException {
+        return Arrays.asList(root.createRequest()
+                .with("labels", names)
+                .method("POST")
+                .withUrlPath(getIssuesApiRoute() + "/labels")
+                .fetch(GHLabel[].class));
     }
 
     /**
-     * Remove a given label by name from this issue.
+     * Remove a single label.
      *
+     * Attempting to remove a label that is not present throws {@link GHFileNotFoundException}.
+     *
+     * @return the remaining list of labels
+     * @param name
+     *            the name
+     * @throws IOException
+     *             the io exception, throws {@link GHFileNotFoundException} if label was not present.
+     */
+    @WithBridgeMethods(void.class)
+    public List<GHLabel> removeLabel(String name) throws IOException {
+        return Arrays.asList(root.createRequest()
+                .method("DELETE")
+                .withUrlPath(getIssuesApiRoute() + "/labels", name)
+                .fetch(GHLabel[].class));
+    }
+
+    /**
+     * Remove a collection of labels.
+     *
+     * Attempting to remove labels that are not present on the target are ignored.
+     *
+     * @return the remaining list of labels
      * @param names
      *            the names
      * @throws IOException
      *             the io exception
      */
-    public void removeLabels(String... names) throws IOException {
-        _removeLabels(Arrays.asList(names));
+    @WithBridgeMethods(void.class)
+    public List<GHLabel> removeLabels(String... names) throws IOException {
+        return _removeLabels(Arrays.asList(names));
     }
 
     /**
-     * Remove labels.
+     * Remove a collection of labels.
      *
+     * Attempting to remove labels that are not present on the target are ignored.
+     *
+     * @return the remaining list of labels
      * @param labels
      *            the labels
      * @throws IOException
      *             the io exception
      * @see #removeLabels(String...) #removeLabels(String...)
      */
-    public void removeLabels(GHLabel... labels) throws IOException {
-        removeLabels(Arrays.asList(labels));
+    @WithBridgeMethods(void.class)
+    public List<GHLabel> removeLabels(GHLabel... labels) throws IOException {
+        return removeLabels(Arrays.asList(labels));
     }
 
     /**
-     * Remove labels.
+     * Remove a collection of labels.
      *
+     * Attempting to remove labels that are not present on the target are ignored.
+     *
+     * @return the remaining list of labels
      * @param labels
      *            the labels
      * @throws IOException
      *             the io exception
      */
-    public void removeLabels(Collection<GHLabel> labels) throws IOException {
-        _removeLabels(GHLabel.toNames(labels));
+    @WithBridgeMethods(void.class)
+    public List<GHLabel> removeLabels(Collection<GHLabel> labels) throws IOException {
+        return _removeLabels(GHLabel.toNames(labels));
     }
 
-    private void _removeLabels(Collection<String> names) throws IOException {
-        List<String> newLabels = new ArrayList<String>();
-
-        for (GHLabel l : getLabels()) {
-            if (!names.contains(l.getName())) {
-                newLabels.add(l.getName());
+    private List<GHLabel> _removeLabels(Collection<String> names) throws IOException {
+        List<GHLabel> remainingLabels = Collections.emptyList();
+        for (String name : names) {
+            try {
+                remainingLabels = removeLabel(name);
+            } catch (GHFileNotFoundException e) {
+                // when trying to remove multiple labels, we ignore already removed
             }
         }
-
-        setLabels(newLabels.toArray(new String[0]));
+        return remainingLabels;
     }
 
     /**

src/main/java/org/kohsuke/github/GHIssueChanges.java

@@ -0,0 +1,49 @@
+package org.kohsuke.github;
+
+import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
+
+/**
+ * Wrapper to define changed fields on issues action="edited"
+ *
+ * @see GHEventPayload.Issue
+ */
+@SuppressFBWarnings("UWF_UNWRITTEN_FIELD")
+public class GHIssueChanges {
+
+    private GHFrom title;
+    private GHFrom body;
+
+    /**
+     * Old issue title.
+     *
+     * @return old issue title (or null if not changed)
+     */
+    public GHFrom getTitle() {
+        return title;
+    }
+
+    /**
+     * Old issue body.
+     *
+     * @return old issue body (or null if not changed)
+     */
+    public GHFrom getBody() {
+        return body;
+    }
+
+    /**
+     * Wrapper for changed values.
+     */
+    public static class GHFrom {
+        private String from;
+
+        /**
+         * Previous value that was changed.
+         *
+         * @return previous value
+         */
+        public String getFrom() {
+            return from;
+        }
+    }
+}

src/main/java/org/kohsuke/github/GHIssueComment.java

@@ -26,7 +26,7 @@ package org.kohsuke.github;
 import java.io.IOException;
 import java.net.URL;
 
-import static org.kohsuke.github.Previews.*;
+import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
 
 /**
  * Comment to the issue

src/main/java/org/kohsuke/github/GHLabel.java

@@ -2,6 +2,7 @@ package org.kohsuke.github;
 
 import com.fasterxml.jackson.annotation.JacksonInject;
 import com.fasterxml.jackson.annotation.JsonCreator;
+import com.fasterxml.jackson.annotation.JsonProperty;
 
 import java.io.IOException;
 import java.util.ArrayList;
@@ -22,6 +23,11 @@ import javax.annotation.Nonnull;
  */
 public class GHLabel extends GitHubInteractiveObject {
 
+    private long id;
+    private String nodeId;
+    @JsonProperty("default")
+    private boolean default_;
+
     @Nonnull
     private String url, name, color;
 
@@ -42,6 +48,24 @@ public class GHLabel extends GitHubInteractiveObject {
         return Objects.requireNonNull(root);
     }
 
+    /**
+     * Gets id.
+     *
+     * @return the id
+     */
+    public long getId() {
+        return id;
+    }
+
+    /**
+     * Gets node id.
+     *
+     * @return the node id.
+     */
+    public String getNodeId() {
+        return nodeId;
+    }
+
     /**
      * Gets url.
      *
@@ -82,6 +106,15 @@ public class GHLabel extends GitHubInteractiveObject {
         return description;
     }
 
+    /**
+     * If the label is one of the default labels created by GitHub automatically.
+     *
+     * @return true if the label is a default one
+     */
+    public boolean isDefault() {
+        return default_;
+    }
+
     /**
      * Sets color.
      *

src/main/java/org/kohsuke/github/GHLabelChanges.java

@@ -0,0 +1,49 @@
+package org.kohsuke.github;
+
+import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
+
+/**
+ * Wrapper to define changed fields on label action="edited"
+ *
+ * @see GHEventPayload.Label
+ */
+@SuppressFBWarnings("UWF_UNWRITTEN_FIELD")
+public class GHLabelChanges {
+
+    private GHFrom name;
+    private GHFrom color;
+
+    /**
+     * Old label name.
+     *
+     * @return old label name (or null if not changed)
+     */
+    public GHFrom getName() {
+        return name;
+    }
+
+    /**
+     * Old label color.
+     *
+     * @return old label color (or null if not changed)
+     */
+    public GHFrom getColor() {
+        return color;
+    }
+
+    /**
+     * Wrapper for changed values.
+     */
+    public static class GHFrom {
+        private String from;
+
+        /**
+         * Previous value that was changed.
+         *
+         * @return previous value
+         */
+        public String getFrom() {
+            return from;
+        }
+    }
+}

src/main/java/org/kohsuke/github/GHMeta.java

@@ -23,6 +23,9 @@ public class GHMeta {
     private List<String> api;
     private List<String> pages;
     private List<String> importer = new ArrayList<>();
+    private List<String> packages;
+    private List<String> actions;
+    private List<String> dependabot;
 
     /**
      * Is verifiable password authentication boolean.
@@ -86,4 +89,31 @@ public class GHMeta {
     public List<String> getImporter() {
         return Collections.unmodifiableList(importer);
     }
+
+    /**
+     * Gets package.
+     *
+     * @return the package
+     */
+    public List<String> getPackages() {
+        return Collections.unmodifiableList(packages);
+    }
+
+    /**
+     * Gets actions.
+     *
+     * @return the actions
+     */
+    public List<String> getActions() {
+        return Collections.unmodifiableList(actions);
+    }
+
+    /**
+     * Gets dependabot.
+     *
+     * @return the dependabot
+     */
+    public List<String> getDependabot() {
+        return Collections.unmodifiableList(dependabot);
+    }
 }

src/main/java/org/kohsuke/github/GHOrganization.java

@@ -10,7 +10,7 @@ import java.util.List;
 import java.util.Map;
 import java.util.TreeMap;
 
-import static org.kohsuke.github.Previews.INERTIA;
+import static org.kohsuke.github.internal.Previews.INERTIA;
 
 /**
  * The type GHOrganization.
@@ -18,6 +18,9 @@ import static org.kohsuke.github.Previews.INERTIA;
  * @author Kohsuke Kawaguchi
  */
 public class GHOrganization extends GHPerson {
+
+    private boolean has_organization_projects;
+
     GHOrganization wrapUp(GitHub root) {
         return (GHOrganization) super.wrapUp(root);
     }
@@ -367,6 +370,35 @@ public class GHOrganization extends GHPerson {
         root.createRequest().method("DELETE").withUrlPath("/orgs/" + login + "/public_members/" + u.getLogin()).send();
     }
 
+    /**
+     * Are projects enabled for organization boolean.
+     *
+     * @return the boolean
+     */
+    public boolean areOrganizationProjectsEnabled() {
+        return has_organization_projects;
+    }
+
+    /**
+     * Sets organization projects enabled status boolean
+     *
+     * @param newStatus
+     *            enable status
+     * @throws IOException
+     *             the io exception
+     */
+    public void enableOrganizationProjects(boolean newStatus) throws IOException {
+        edit("has_organization_projects", newStatus);
+    }
+
+    private void edit(String key, Object value) throws IOException {
+        root.createRequest()
+                .withUrlPath(String.format("/orgs/%s", login))
+                .method("PATCH")
+                .with(key, value)
+                .fetchInto(this);
+    }
+
     /**
      * Returns the projects for this organization.
      *

src/main/java/org/kohsuke/github/GHProject.java

@@ -28,7 +28,7 @@ import java.io.IOException;
 import java.net.URL;
 import java.util.Locale;
 
-import static org.kohsuke.github.Previews.INERTIA;
+import static org.kohsuke.github.internal.Previews.INERTIA;
 
 /**
  * A GitHub project.

src/main/java/org/kohsuke/github/GHProjectCard.java

@@ -6,7 +6,7 @@ import java.io.FileNotFoundException;
 import java.io.IOException;
 import java.net.URL;
 
-import static org.kohsuke.github.Previews.INERTIA;
+import static org.kohsuke.github.internal.Previews.INERTIA;
 
 /**
  * The type GHProjectCard.

src/main/java/org/kohsuke/github/GHProjectColumn.java

@@ -4,7 +4,7 @@ import java.io.FileNotFoundException;
 import java.io.IOException;
 import java.net.URL;
 
-import static org.kohsuke.github.Previews.INERTIA;
+import static org.kohsuke.github.internal.Previews.INERTIA;
 
 /**
  * The type GHProjectColumn.

src/main/java/org/kohsuke/github/GHPullRequest.java

@@ -36,8 +36,8 @@ import java.util.Objects;
 
 import javax.annotation.CheckForNull;
 
-import static org.kohsuke.github.Previews.LYDIAN;
-import static org.kohsuke.github.Previews.SHADOW_CAT;
+import static org.kohsuke.github.internal.Previews.LYDIAN;
+import static org.kohsuke.github.internal.Previews.SHADOW_CAT;
 
 /**
  * A pull request.

src/main/java/org/kohsuke/github/GHPullRequestQueryBuilder.java

@@ -1,6 +1,6 @@
 package org.kohsuke.github;
 
-import static org.kohsuke.github.Previews.SHADOW_CAT;
+import static org.kohsuke.github.internal.Previews.SHADOW_CAT;
 
 /**
  * Lists up pull requests with some filtering and sorting.

src/main/java/org/kohsuke/github/GHPullRequestReviewComment.java

@@ -28,7 +28,7 @@ import java.net.URL;
 
 import javax.annotation.CheckForNull;
 
-import static org.kohsuke.github.Previews.*;
+import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
 
 /**
  * Review comment to the pull request
@@ -153,7 +153,20 @@ public class GHPullRequestReviewComment extends GHObject implements Reactable {
      * @return the api route
      */
     protected String getApiRoute() {
-        return "/repos/" + owner.getRepository().getFullName() + "/pulls/comments/" + getId();
+        return getApiRoute(false);
+    }
+
+    /**
+     * Gets api route.
+     *
+     * @param includePullNumber
+     *            if true, includes the owning pull request's number in the route.
+     *
+     * @return the api route
+     */
+    protected String getApiRoute(boolean includePullNumber) {
+        return "/repos/" + owner.getRepository().getFullName() + "/pulls"
+                + (includePullNumber ? "/" + owner.getNumber() : "") + "/comments/" + getId();
     }
 
     /**
@@ -192,8 +205,7 @@ public class GHPullRequestReviewComment extends GHObject implements Reactable {
         return owner.root.createRequest()
                 .method("POST")
                 .with("body", body)
-                .with("in_reply_to", getId())
-                .withUrlPath(getApiRoute() + "/comments")
+                .withUrlPath(getApiRoute(true) + "/replies")
                 .fetch(GHPullRequestReviewComment.class)
                 .wrapUp(owner);
     }

src/main/java/org/kohsuke/github/GHRateLimit.java

@@ -12,6 +12,7 @@ import java.time.format.DateTimeFormatter;
 import java.time.format.DateTimeParseException;
 import java.util.Date;
 import java.util.Objects;
+import java.util.concurrent.atomic.AtomicReference;
 import java.util.logging.Logger;
 
 import javax.annotation.CheckForNull;
@@ -344,7 +345,7 @@ public class GHRateLimit {
         private static final UnknownLimitRecord DEFAULT = new UnknownLimitRecord(Long.MIN_VALUE);
 
         // The starting current UnknownLimitRecord is an expired record.
-        private static UnknownLimitRecord current = DEFAULT;
+        private static final AtomicReference<UnknownLimitRecord> current = new AtomicReference<>(DEFAULT);
 
         /**
          * Create a new unknown record that resets at the specified time.
@@ -356,18 +357,20 @@ public class GHRateLimit {
             super(unknownLimit, unknownRemaining, resetEpochSeconds);
         }
 
-        static synchronized Record current() {
-            if (current.isExpired()) {
-                current = new UnknownLimitRecord(System.currentTimeMillis() / 1000L + unknownLimitResetSeconds);
+        static Record current() {
+            Record result = current.get();
+            if (result.isExpired()) {
+                current.set(new UnknownLimitRecord(System.currentTimeMillis() / 1000L + unknownLimitResetSeconds));
+                result = current.get();
             }
-            return current;
+            return result;
         }
 
         /**
          * Reset the current UnknownLimitRecord. For use during testing only.
          */
-        static synchronized void reset() {
-            current = DEFAULT;
+        static void reset() {
+            current.set(DEFAULT);
             unknownLimitResetSeconds = defaultUnknownLimitResetSeconds;
         }
     }

src/main/java/org/kohsuke/github/GHReaction.java

@@ -3,7 +3,7 @@ package org.kohsuke.github;
 import java.io.IOException;
 import java.net.URL;
 
-import static org.kohsuke.github.Previews.*;
+import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
 
 /**
  * Reaction to issue, comment, PR, and so on.

src/main/java/org/kohsuke/github/GHReleaseBuilder.java

@@ -41,7 +41,7 @@ public class GHReleaseBuilder {
      * Specifies the commitish value that determines where the Git tag is created from. Can be any branch or commit SHA.
      *
      * @param commitish
-     *            Defaults to the repository’s default branch (usually "master"). Unused if the Git tag already exists.
+     *            Defaults to the repository’s default branch (usually "main"). Unused if the Git tag already exists.
      * @return the gh release builder
      */
     public GHReleaseBuilder commitish(String commitish) {

src/main/java/org/kohsuke/github/GHReleaseUpdater.java

@@ -45,7 +45,7 @@ public class GHReleaseUpdater {
      * Specifies the commitish value that determines where the Git tag is created from. Can be any branch or commit SHA.
      *
      * @param commitish
-     *            Defaults to the repository’s default branch (usually "master"). Unused if the Git tag already exists.
+     *            Defaults to the repository’s default branch (usually "main"). Unused if the Git tag already exists.
      * @return the gh release updater
      */
     public GHReleaseUpdater commitish(String commitish) {

src/main/java/org/kohsuke/github/GHRepository.java

@@ -30,6 +30,8 @@ import edu.umd.cs.findbugs.annotations.CheckForNull;
 import edu.umd.cs.findbugs.annotations.NonNull;
 import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
 import org.apache.commons.lang3.StringUtils;
+import org.kohsuke.github.function.InputStreamFunction;
+import org.kohsuke.github.internal.EnumUtils;
 
 import java.io.FileNotFoundException;
 import java.io.IOException;
@@ -48,16 +50,24 @@ import java.util.HashSet;
 import java.util.Iterator;
 import java.util.LinkedHashSet;
 import java.util.List;
+import java.util.Locale;
 import java.util.Map;
-import java.util.Objects;
 import java.util.Set;
 import java.util.TreeMap;
 import java.util.WeakHashMap;
 
 import javax.annotation.Nonnull;
 
-import static java.util.Arrays.*;
-import static org.kohsuke.github.Previews.*;
+import static java.util.Arrays.asList;
+import static java.util.Objects.requireNonNull;
+import static org.kohsuke.github.internal.Previews.ANTIOPE;
+import static org.kohsuke.github.internal.Previews.ANT_MAN;
+import static org.kohsuke.github.internal.Previews.BAPTISTE;
+import static org.kohsuke.github.internal.Previews.FLASH;
+import static org.kohsuke.github.internal.Previews.INERTIA;
+import static org.kohsuke.github.internal.Previews.MERCY;
+import static org.kohsuke.github.internal.Previews.NEBULA;
+import static org.kohsuke.github.internal.Previews.SHADOW_CAT;
 
 /**
  * A repository on GitHub.
@@ -97,6 +107,8 @@ public class GHRepository extends GHObject {
     @JsonProperty("private")
     private boolean _private;
 
+    private String visibility;
+
     private int forks_count, stargazers_count, watchers_count, size, open_issues_count, subscribers_count;
 
     private String pushed_at;
@@ -449,7 +461,7 @@ public class GHRepository extends GHObject {
      * Creates a named ref, such as tag, branch, etc.
      *
      * @param name
-     *            The name of the fully qualified reference (ie: refs/heads/master). If it doesn't start with 'refs' and
+     *            The name of the fully qualified reference (ie: refs/heads/main). If it doesn't start with 'refs' and
      *            have at least two slashes, it will be rejected.
      * @param sha
      *            The SHA1 value to set this reference to
@@ -566,7 +578,15 @@ public class GHRepository extends GHObject {
      *             the io exception
      */
     public Map<String, Long> listLanguages() throws IOException {
-        return root.createRequest().withUrlPath(getApiTailUrl("languages")).fetch(HashMap.class);
+        HashMap<String, Long> result = new HashMap<>();
+        root.createRequest().withUrlPath(getApiTailUrl("languages")).fetch(HashMap.class).forEach((key, value) -> {
+            Long addValue = -1L;
+            if (value instanceof Integer) {
+                addValue = Long.valueOf((Integer) value);
+            }
+            result.put(key.toString(), addValue);
+        });
+        return result;
     }
 
     /**
@@ -703,6 +723,41 @@ public class GHRepository extends GHObject {
         return _private;
     }
 
+    /**
+     * Visibility of a repository.
+     */
+    public enum Visibility {
+        PUBLIC, INTERNAL, PRIVATE, UNKNOWN;
+
+        public static Visibility from(String value) {
+            return EnumUtils.getNullableEnumOrDefault(Visibility.class, value, Visibility.UNKNOWN);
+        }
+
+        @Override
+        public String toString() {
+            return name().toLowerCase(Locale.ROOT);
+        }
+    }
+
+    /**
+     * Gets the visibility of the repository.
+     *
+     * @return the visibility
+     */
+    @Deprecated
+    @Preview(NEBULA)
+    public Visibility getVisibility() {
+        if (visibility == null) {
+            try {
+                populate();
+            } catch (final IOException e) {
+                // Convert this to a runtime exception to avoid messy method signature
+                throw new GHException("Could not populate the visibility of the repository", e);
+            }
+        }
+        return Visibility.from(visibility);
+    }
+
     /**
      * Is template boolean.
      *
@@ -793,16 +848,18 @@ public class GHRepository extends GHObject {
     /**
      * Returns the primary branch you'll configure in the "Admin &gt; Options" config page.
      *
-     * @return This field is null until the user explicitly configures the master branch.
+     * @return This field is null until the user explicitly configures the default branch.
      */
     public String getDefaultBranch() {
         return default_branch;
     }
 
     /**
-     * Gets master branch.
+     * Gets default branch.
      *
-     * @return the master branch
+     * Name is an artifact of when "master" was the most common default.
+     *
+     * @return the default branch
      * @deprecated Renamed to {@link #getDefaultBranch()}
      */
     @Deprecated
@@ -1195,6 +1252,26 @@ public class GHRepository extends GHObject {
         set().private_(value);
     }
 
+    /**
+     * Sets visibility.
+     *
+     * @param value
+     *            the value
+     * @throws IOException
+     *             the io exception
+     */
+    @Deprecated
+    @Preview(NEBULA)
+    public void setVisibility(final Visibility value) throws IOException {
+        root.createRequest()
+                .method("PATCH")
+                .withPreview(NEBULA)
+                .with("name", name)
+                .with("visibility", value)
+                .withUrlPath(getApiTailUrl(""))
+                .send();
+    }
+
     /**
      * Allow squash merge.
      *
@@ -1700,7 +1777,7 @@ public class GHRepository extends GHObject {
      * Retrive a tree of the given type for the current GitHub repository.
      *
      * @param sha
-     *            sha number or branch name ex: "master"
+     *            sha number or branch name ex: "main"
      * @return refs matching the request type
      * @throws IOException
      *             on failure communicating with GitHub, potentially due to an invalid tree type being requested
@@ -1724,7 +1801,7 @@ public class GHRepository extends GHObject {
      * https://developer.github.com/v3/git/trees/#get-a-tree-recursively
      *
      * @param sha
-     *            sha number or branch name ex: "master"
+     *            sha number or branch name ex: "main"
      * @param recursive
      *            use 1
      * @return the tree recursive
@@ -1782,7 +1859,7 @@ public class GHRepository extends GHObject {
         return root.createRequest()
                 .withHeader("Accept", "application/vnd.github.v3.raw")
                 .withUrlPath(target)
-                .fetchStream();
+                .fetchStream(Requester::copyInputStream);
     }
 
     /**
@@ -1943,7 +2020,7 @@ public class GHRepository extends GHObject {
                 .withUrlPath(String.format("/repos/%s/%s/commits/%s/check-runs", getOwnerName(), name, ref))
                 .withPreview(ANTIOPE)
                 .build();
-        return new GHCheckRunsIterable(root, request);
+        return new GHCheckRunsIterable(this, request);
     }
 
     /**
@@ -2809,7 +2886,7 @@ public class GHRepository extends GHObject {
                         .with("mode", mode == null ? null : mode.toString())
                         .with("context", getFullName())
                         .withUrlPath("/markdown")
-                        .fetchStream(),
+                        .fetchStream(Requester::copyInputStream),
                 "UTF-8");
     }
 
@@ -2897,6 +2974,110 @@ public class GHRepository extends GHObject {
                 .wrapUp(root);
     }
 
+    /**
+     * Lists all the workflows of this repository.
+     *
+     * @return the paged iterable
+     */
+    public PagedIterable<GHWorkflow> listWorkflows() {
+        return new GHWorkflowsIterable(this);
+    }
+
+    /**
+     * Gets a workflow by id.
+     *
+     * @param id
+     *            the id of the workflow run
+     * @return the workflow run
+     * @throws IOException
+     *             the io exception
+     */
+    public GHWorkflow getWorkflow(long id) throws IOException {
+        return getWorkflow(String.valueOf(id));
+    }
+
+    /**
+     * Gets a workflow by name of the file.
+     *
+     * @param nameOrId
+     *            either the name of the file (e.g. my-workflow.yml) or the id as a string
+     * @return the workflow run
+     * @throws IOException
+     *             the io exception
+     */
+    public GHWorkflow getWorkflow(String nameOrId) throws IOException {
+        return root.createRequest()
+                .withUrlPath(getApiTailUrl("actions/workflows"), nameOrId)
+                .fetch(GHWorkflow.class)
+                .wrapUp(this);
+    }
+
+    /**
+     * Retrieves workflow runs.
+     *
+     * @return the workflow run query builder
+     */
+    public GHWorkflowRunQueryBuilder queryWorkflowRuns() {
+        return new GHWorkflowRunQueryBuilder(this);
+    }
+
+    /**
+     * Gets a workflow run.
+     *
+     * @param id
+     *            the id of the workflow run
+     * @return the workflow run
+     * @throws IOException
+     *             the io exception
+     */
+    public GHWorkflowRun getWorkflowRun(long id) throws IOException {
+        return root.createRequest()
+                .withUrlPath(getApiTailUrl("actions/runs"), String.valueOf(id))
+                .fetch(GHWorkflowRun.class)
+                .wrapUp(this);
+    }
+
+    /**
+     * Lists all the artifacts of this repository.
+     *
+     * @return the paged iterable
+     */
+    public PagedIterable<GHArtifact> listArtifacts() {
+        return new GHArtifactsIterable(this, root.createRequest().withUrlPath(getApiTailUrl("actions/artifacts")));
+    }
+
+    /**
+     * Gets an artifact by id.
+     *
+     * @param id
+     *            the id of the artifact
+     * @return the artifact
+     * @throws IOException
+     *             the io exception
+     */
+    public GHArtifact getArtifact(long id) throws IOException {
+        return root.createRequest()
+                .withUrlPath(getApiTailUrl("actions/artifacts"), String.valueOf(id))
+                .fetch(GHArtifact.class)
+                .wrapUp(this);
+    }
+
+    /**
+     * Gets a job from a workflow run by id.
+     *
+     * @param id
+     *            the id of the job
+     * @return the job
+     * @throws IOException
+     *             the io exception
+     */
+    public GHWorkflowJob getWorkflowJob(long id) throws IOException {
+        return root.createRequest()
+                .withUrlPath(getApiTailUrl("/actions/jobs"), String.valueOf(id))
+                .fetch(GHWorkflowJob.class)
+                .wrapUp(this);
+    }
+
     // Only used within listTopics().
     private static class Topics {
         public List<String> names;
@@ -2963,6 +3144,52 @@ public class GHRepository extends GHObject {
                 .wrap(this);
     }
 
+    /**
+     * Streams a zip archive of the repository, optionally at a given <code>ref</code>.
+     *
+     * @param <T>
+     *            the type of result
+     * @param streamFunction
+     *            The {@link InputStreamFunction} that will process the stream
+     * @param ref
+     *            if <code>null</code> the repository's default branch, usually <code>main</code>,
+     * @throws IOException
+     *             The IO exception.
+     * @return the result of reading the stream.
+     */
+    public <T> T readZip(InputStreamFunction<T> streamFunction, String ref) throws IOException {
+        return downloadArchive("zip", ref, streamFunction);
+    }
+
+    /**
+     * Streams a tar archive of the repository, optionally at a given <code>ref</code>.
+     *
+     * @param <T>
+     *            the type of result
+     * @param streamFunction
+     *            The {@link InputStreamFunction} that will process the stream
+     * @param ref
+     *            if <code>null</code> the repository's default branch, usually <code>main</code>,
+     * @throws IOException
+     *             The IO exception.
+     * @return the result of reading the stream.
+     */
+    public <T> T readTar(InputStreamFunction<T> streamFunction, String ref) throws IOException {
+        return downloadArchive("tar", ref, streamFunction);
+    }
+
+    private <T> T downloadArchive(@Nonnull String type,
+            @CheckForNull String ref,
+            @Nonnull InputStreamFunction<T> streamFunction) throws IOException {
+        requireNonNull(streamFunction, "Sink must not be null");
+        String tailUrl = getApiTailUrl(type + "ball");
+        if (ref != null) {
+            tailUrl += "/" + ref;
+        }
+        final Requester builder = root.createRequest().method("GET").withUrlPath(tailUrl);
+        return builder.fetchStream(streamFunction);
+    }
+
     /**
      * Populate this object.
      *
@@ -2974,18 +3201,24 @@ public class GHRepository extends GHObject {
             return; // can't populate if the root is offline
         }
 
-        final URL url = Objects.requireNonNull(getUrl(), "Missing instance URL!");
+        final URL url = requireNonNull(getUrl(), "Missing instance URL!");
 
         try {
             // IMPORTANT: the url for repository records does not reliably point to the API url.
             // There is bug in Push event payloads that returns the wrong url.
             // All other occurrences of "url" take the form "https://api.github.com/...".
             // For Push event repository records, they take the form "https://github.com/{fullName}".
-            root.createRequest().withPreview(BAPTISTE).setRawUrlPath(url.toString()).fetchInto(this).wrap(root);
+            root.createRequest()
+                    .withPreview(BAPTISTE)
+                    .withPreview(NEBULA)
+                    .setRawUrlPath(url.toString())
+                    .fetchInto(this)
+                    .wrap(root);
         } catch (HttpException e) {
             if (e.getCause() instanceof JsonParseException) {
                 root.createRequest()
                         .withPreview(BAPTISTE)
+                        .withPreview(NEBULA)
                         .withUrlPath("/repos/" + full_name)
                         .fetchInto(this)
                         .wrap(root);

src/main/java/org/kohsuke/github/GHRepositoryBuilder.java

@@ -1,9 +1,12 @@
 package org.kohsuke.github;
 
+import org.kohsuke.github.GHRepository.Visibility;
+
 import java.io.IOException;
 import java.net.URL;
 
-import static org.kohsuke.github.Previews.BAPTISTE;
+import static org.kohsuke.github.internal.Previews.BAPTISTE;
+import static org.kohsuke.github.internal.Previews.NEBULA;
 
 abstract class GHRepositoryBuilder<S> extends AbstractBuilder<GHRepository, S> {
 
@@ -146,6 +149,20 @@ abstract class GHRepositoryBuilder<S> extends AbstractBuilder<GHRepository, S> {
         return with("private", enabled);
     }
 
+    /**
+     * Sets the repository visibility
+     *
+     * @param visibility
+     *            visibility of repository
+     * @return a builder to continue with building
+     * @throws IOException
+     *             In case of any networking error or error from the server.
+     */
+    public S visibility(final Visibility visibility) throws IOException {
+        requester.withPreview(NEBULA);
+        return with("visibility", visibility);
+    }
+
     /**
      * Enables issue tracker
      *

src/main/java/org/kohsuke/github/GHWorkflow.java

@@ -0,0 +1,158 @@
+package org.kohsuke.github;
+
+import com.fasterxml.jackson.annotation.JsonIgnore;
+import org.apache.commons.lang3.StringUtils;
+
+import java.io.IOException;
+import java.net.URL;
+import java.util.Collections;
+import java.util.Map;
+import java.util.Objects;
+
+/**
+ * A workflow.
+ *
+ * @author Guillaume Smet
+ * @see GHRepository#getWorkflow(long)
+ */
+public class GHWorkflow extends GHObject {
+
+    // Not provided by the API.
+    @JsonIgnore
+    private GHRepository owner;
+
+    private String name;
+    private String path;
+    private String state;
+
+    private String htmlUrl;
+    private String badgeUrl;
+
+    /**
+     * The name of the workflow.
+     *
+     * @return the name
+     */
+    public String getName() {
+        return name;
+    }
+
+    /**
+     * The path of the workflow e.g. .github/workflows/blank.yaml
+     *
+     * @return the path
+     */
+    public String getPath() {
+        return path;
+    }
+
+    /**
+     * The state of the workflow.
+     *
+     * @return the state
+     */
+    public String getState() {
+        return state;
+    }
+
+    @Override
+    public URL getHtmlUrl() throws IOException {
+        return GitHubClient.parseURL(htmlUrl);
+    }
+
+    /**
+     * Repository to which the workflow belongs.
+     *
+     * @return the repository
+     */
+    public GHRepository getRepository() {
+        return owner;
+    }
+
+    /**
+     * The badge URL, like https://github.com/octo-org/octo-repo/workflows/CI/badge.svg
+     *
+     * @return the badge url
+     */
+    public URL getBadgeUrl() {
+        return GitHubClient.parseURL(badgeUrl);
+    }
+
+    /**
+     * Disable the workflow.
+     *
+     * @throws IOException
+     *             the io exception
+     */
+    public void disable() throws IOException {
+        root.createRequest().method("PUT").withUrlPath(getApiRoute(), "disable").fetchHttpStatusCode();
+    }
+
+    /**
+     * Enable the workflow.
+     *
+     * @throws IOException
+     *             the io exception
+     */
+    public void enable() throws IOException {
+        root.createRequest().method("PUT").withUrlPath(getApiRoute(), "enable").fetchHttpStatusCode();
+    }
+
+    /**
+     * Create a workflow dispatch event which triggers a manual workflow run.
+     *
+     * @param ref
+     *            the git reference for the workflow. The reference can be a branch or tag name.
+     * @throws IOException
+     *             the io exception
+     */
+    public void dispatch(String ref) throws IOException {
+        dispatch(ref, Collections.emptyMap());
+    }
+
+    /**
+     * Create a workflow dispatch event which triggers a manual workflow run.
+     *
+     * @param ref
+     *            the git reference for the workflow. The reference can be a branch or tag name.
+     * @param inputs
+     *            input keys and values configured in the workflow file. The maximum number of properties is 10. Any
+     *            default properties configured in the workflow file will be used when inputs are omitted.
+     * @throws IOException
+     *             the io exception
+     */
+    public void dispatch(String ref, Map<String, Object> inputs) throws IOException {
+        Requester requester = root.createRequest()
+                .method("POST")
+                .withUrlPath(getApiRoute(), "dispatches")
+                .with("ref", ref);
+
+        if (!inputs.isEmpty()) {
+            requester.with("inputs", inputs);
+        }
+
+        requester.fetchHttpStatusCode();
+    }
+
+    private String getApiRoute() {
+        if (owner == null) {
+            // Workflow runs returned from search to do not have an owner. Attempt to use url.
+            final URL url = Objects.requireNonNull(getUrl(), "Missing instance URL!");
+            return StringUtils.prependIfMissing(url.toString().replace(root.getApiUrl(), ""), "/");
+
+        }
+        return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/actions/workflows/" + getId();
+    }
+
+    GHWorkflow wrapUp(GHRepository owner) {
+        this.owner = owner;
+        return wrapUp(owner.root);
+    }
+
+    GHWorkflow wrapUp(GitHub root) {
+        this.root = root;
+        if (owner != null)
+            owner.wrap(root);
+        return this;
+    }
+}

src/main/java/org/kohsuke/github/GHWorkflowJob.java

@@ -0,0 +1,256 @@
+package org.kohsuke.github;
+
+import com.fasterxml.jackson.annotation.JsonIgnore;
+import org.apache.commons.lang3.StringUtils;
+import org.kohsuke.github.GHWorkflowRun.Conclusion;
+import org.kohsuke.github.GHWorkflowRun.Status;
+import org.kohsuke.github.function.InputStreamFunction;
+
+import java.io.IOException;
+import java.net.URL;
+import java.util.ArrayList;
+import java.util.Date;
+import java.util.List;
+import java.util.Objects;
+
+import static java.util.Objects.requireNonNull;
+
+/**
+ * A workflow run job.
+ *
+ * @author Guillaume Smet
+ */
+public class GHWorkflowJob extends GHObject {
+
+    // Not provided by the API.
+    @JsonIgnore
+    private GHRepository owner;
+
+    private String name;
+
+    private String headSha;
+
+    private String startedAt;
+    private String completedAt;
+
+    private String status;
+    private String conclusion;
+
+    private long runId;
+
+    private String htmlUrl;
+    private String checkRunUrl;
+
+    private List<Step> steps = new ArrayList<>();
+
+    /**
+     * The name of the job.
+     *
+     * @return the name
+     */
+    public String getName() {
+        return name;
+    }
+
+    /**
+     * Gets the HEAD SHA.
+     *
+     * @return sha for the HEAD commit
+     */
+    public String getHeadSha() {
+        return headSha;
+    }
+
+    /**
+     * When was this job started?
+     *
+     * @return start date
+     */
+    public Date getStartedAt() {
+        return GitHubClient.parseDate(startedAt);
+    }
+
+    /**
+     * When was this job completed?
+     *
+     * @return completion date
+     */
+    public Date getCompletedAt() {
+        return GitHubClient.parseDate(completedAt);
+    }
+
+    /**
+     * Gets status of the job.
+     * <p>
+     * Can be {@code UNKNOWN} if the value returned by GitHub is unknown from the API.
+     *
+     * @return status of the job
+     */
+    public Status getStatus() {
+        return Status.from(status);
+    }
+
+    /**
+     * Gets the conclusion of the job.
+     * <p>
+     * Can be {@code UNKNOWN} if the value returned by GitHub is unknown from the API.
+     *
+     * @return conclusion of the job
+     */
+    public Conclusion getConclusion() {
+        return Conclusion.from(conclusion);
+    }
+
+    /**
+     * The run id.
+     *
+     * @return the run id
+     */
+    public long getRunId() {
+        return runId;
+    }
+
+    @Override
+    public URL getHtmlUrl() {
+        return GitHubClient.parseURL(htmlUrl);
+    }
+
+    /**
+     * The check run URL.
+     *
+     * @return the check run url
+     */
+    public URL getCheckRunUrl() {
+        return GitHubClient.parseURL(checkRunUrl);
+    }
+
+    /**
+     * Gets the execution steps of this job.
+     *
+     * @return the execution steps
+     */
+    public List<Step> getSteps() {
+        return steps;
+    }
+
+    /**
+     * Repository to which the job belongs.
+     *
+     * @return the repository
+     */
+    public GHRepository getRepository() {
+        return owner;
+    }
+
+    /**
+     * Downloads the logs.
+     * <p>
+     * The logs are returned as a text file.
+     *
+     * @param <T>
+     *            the type of result
+     * @param streamFunction
+     *            The {@link InputStreamFunction} that will process the stream
+     * @throws IOException
+     *             The IO exception.
+     * @return the result of reading the stream.
+     */
+    public <T> T downloadLogs(InputStreamFunction<T> streamFunction) throws IOException {
+        requireNonNull(streamFunction, "Stream function must not be null");
+
+        return root.createRequest().method("GET").withUrlPath(getApiRoute(), "logs").fetchStream(streamFunction);
+    }
+
+    private String getApiRoute() {
+        if (owner == null) {
+            // Workflow runs returned from search to do not have an owner. Attempt to use url.
+            final URL url = Objects.requireNonNull(getUrl(), "Missing instance URL!");
+            return StringUtils.prependIfMissing(url.toString().replace(root.getApiUrl(), ""), "/");
+
+        }
+        return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/actions/jobs/" + getId();
+    }
+
+    GHWorkflowJob wrapUp(GHRepository owner) {
+        this.owner = owner;
+        return wrapUp(owner.root);
+    }
+
+    GHWorkflowJob wrapUp(GitHub root) {
+        this.root = root;
+        if (owner != null) {
+            owner.wrap(root);
+        }
+        return this;
+    }
+
+    public static class Step {
+
+        private String name;
+        private int number;
+
+        private String startedAt;
+        private String completedAt;
+
+        private String status;
+        private String conclusion;
+
+        /**
+         * Gets the name of the step.
+         *
+         * @return name
+         */
+        public String getName() {
+            return name;
+        }
+
+        /**
+         * Gets the sequential number of the step.
+         *
+         * @return number
+         */
+        public int getNumber() {
+            return number;
+        }
+
+        /**
+         * When was this step started?
+         *
+         * @return start date
+         */
+        public Date getStartedAt() {
+            return GitHubClient.parseDate(startedAt);
+        }
+
+        /**
+         * When was this step completed?
+         *
+         * @return completion date
+         */
+        public Date getCompletedAt() {
+            return GitHubClient.parseDate(completedAt);
+        }
+
+        /**
+         * Gets status of the step.
+         * <p>
+         * Can be {@code UNKNOWN} if the value returned by GitHub is unknown from the API.
+         *
+         * @return status of the step
+         */
+        public Status getStatus() {
+            return Status.from(status);
+        }
+
+        /**
+         * Gets the conclusion of the step.
+         * <p>
+         * Can be {@code UNKNOWN} if the value returned by GitHub is unknown from the API.
+         *
+         * @return conclusion of the step
+         */
+        public Conclusion getConclusion() {
+            return Conclusion.from(conclusion);
+        }
+    }
+}

src/main/java/org/kohsuke/github/GHWorkflowJobQueryBuilder.java

@@ -0,0 +1,47 @@
+package org.kohsuke.github;
+
+import java.net.MalformedURLException;
+
+/**
+ * Lists up jobs of a workflow run with some filtering.
+ *
+ * @author Guillaume Smet
+ */
+public class GHWorkflowJobQueryBuilder extends GHQueryBuilder<GHWorkflowJob> {
+    private final GHRepository repo;
+
+    GHWorkflowJobQueryBuilder(GHWorkflowRun workflowRun) {
+        super(workflowRun.getRepository().root);
+        this.repo = workflowRun.getRepository();
+        req.withUrlPath(repo.getApiTailUrl("actions/runs"), String.valueOf(workflowRun.getId()), "jobs");
+    }
+
+    /**
+     * Apply a filter to only return the jobs of the most recent execution of the workflow run.
+     *
+     * @return the workflow run job query builder
+     */
+    public GHWorkflowJobQueryBuilder latest() {
+        req.with("filter", "latest");
+        return this;
+    }
+
+    /**
+     * Apply a filter to return jobs from all executions of this workflow run.
+     *
+     * @return the workflow run job run query builder
+     */
+    public GHWorkflowJobQueryBuilder all() {
+        req.with("filter", "all");
+        return this;
+    }
+
+    @Override
+    public PagedIterable<GHWorkflowJob> list() {
+        try {
+            return new GHWorkflowJobsIterable(repo, req.build());
+        } catch (MalformedURLException e) {
+            throw new GHException(e.getMessage(), e);
+        }
+    }
+}

src/main/java/org/kohsuke/github/GHWorkflowJobsIterable.java

@@ -0,0 +1,44 @@
+package org.kohsuke.github;
+
+import java.util.Iterator;
+
+import javax.annotation.Nonnull;
+
+/**
+ * Iterable for workflow run jobs listing.
+ */
+class GHWorkflowJobsIterable extends PagedIterable<GHWorkflowJob> {
+    private final GHRepository repo;
+    private final GitHubRequest request;
+
+    private GHWorkflowJobsPage result;
+
+    public GHWorkflowJobsIterable(GHRepository repo, GitHubRequest request) {
+        this.repo = repo;
+        this.request = request;
+    }
+
+    @Nonnull
+    @Override
+    public PagedIterator<GHWorkflowJob> _iterator(int pageSize) {
+        return new PagedIterator<>(
+                adapt(GitHubPageIterator.create(repo.root.getClient(), GHWorkflowJobsPage.class, request, pageSize)),
+                null);
+    }
+
+    protected Iterator<GHWorkflowJob[]> adapt(final Iterator<GHWorkflowJobsPage> base) {
+        return new Iterator<GHWorkflowJob[]>() {
+            public boolean hasNext() {
+                return base.hasNext();
+            }
+
+            public GHWorkflowJob[] next() {
+                GHWorkflowJobsPage v = base.next();
+                if (result == null) {
+                    result = v;
+                }
+                return v.getWorkflowJobs(repo);
+            }
+        };
+    }
+}

src/main/java/org/kohsuke/github/GHWorkflowJobsPage.java

@@ -0,0 +1,20 @@
+package org.kohsuke.github;
+
+/**
+ * Represents the one page of jobs result when listing jobs from a workflow run.
+ */
+class GHWorkflowJobsPage {
+    private int total_count;
+    private GHWorkflowJob[] jobs;
+
+    public int getTotalCount() {
+        return total_count;
+    }
+
+    GHWorkflowJob[] getWorkflowJobs(GHRepository repo) {
+        for (GHWorkflowJob job : jobs) {
+            job.wrapUp(repo);
+        }
+        return jobs;
+    }
+}

src/main/java/org/kohsuke/github/GHWorkflowRun.java

@@ -0,0 +1,457 @@
+package org.kohsuke.github;
+
+import com.fasterxml.jackson.annotation.JsonProperty;
+import org.apache.commons.lang3.StringUtils;
+import org.kohsuke.github.function.InputStreamFunction;
+import org.kohsuke.github.internal.EnumUtils;
+
+import java.io.IOException;
+import java.net.URL;
+import java.util.Arrays;
+import java.util.Collections;
+import java.util.Date;
+import java.util.List;
+import java.util.Locale;
+import java.util.Objects;
+
+import static java.util.Objects.requireNonNull;
+
+/**
+ * A workflow run.
+ *
+ * @author Guillaume Smet
+ * @see GHRepository#getWorkflowRun(long)
+ */
+public class GHWorkflowRun extends GHObject {
+
+    @JsonProperty("repository")
+    private GHRepository owner;
+
+    private String name;
+    private long runNumber;
+    private long workflowId;
+
+    private String htmlUrl;
+    private String jobsUrl;
+    private String logsUrl;
+    private String checkSuiteUrl;
+    private String artifactsUrl;
+    private String cancelUrl;
+    private String rerunUrl;
+    private String workflowUrl;
+
+    private String headBranch;
+    private String headSha;
+    private GHRepository headRepository;
+    private HeadCommit headCommit;
+
+    private String event;
+    private String status;
+    private String conclusion;
+
+    private GHPullRequest[] pullRequests;
+
+    /**
+     * The name of the workflow run.
+     *
+     * @return the name
+     */
+    public String getName() {
+        return name;
+    }
+
+    /**
+     * The run number.
+     *
+     * @return the run number
+     */
+    public long getRunNumber() {
+        return runNumber;
+    }
+
+    /**
+     * The workflow id.
+     *
+     * @return the workflow id
+     */
+    public long getWorkflowId() {
+        return workflowId;
+    }
+
+    @Override
+    public URL getHtmlUrl() throws IOException {
+        return GitHubClient.parseURL(htmlUrl);
+    }
+
+    /**
+     * The jobs URL, like https://api.github.com/repos/octo-org/octo-repo/actions/runs/30433642/jobs
+     *
+     * @return the jobs url
+     */
+    public URL getJobsUrl() {
+        return GitHubClient.parseURL(jobsUrl);
+    }
+
+    /**
+     * The logs URL, like https://api.github.com/repos/octo-org/octo-repo/actions/runs/30433642/logs
+     *
+     * @return the logs url
+     */
+    public URL getLogsUrl() {
+        return GitHubClient.parseURL(logsUrl);
+    }
+
+    /**
+     * The check suite URL, like https://api.github.com/repos/octo-org/octo-repo/check-suites/414944374
+     *
+     * @return the check suite url
+     */
+    public URL getCheckSuiteUrl() {
+        return GitHubClient.parseURL(checkSuiteUrl);
+    }
+
+    /**
+     * The artifacts URL, like https://api.github.com/repos/octo-org/octo-repo/actions/runs/30433642/artifacts
+     *
+     * @return the artifacts url
+     */
+    public URL getArtifactsUrl() {
+        return GitHubClient.parseURL(artifactsUrl);
+    }
+
+    /**
+     * The cancel URL, like https://api.github.com/repos/octo-org/octo-repo/actions/runs/30433642/cancel
+     *
+     * @return the cancel url
+     */
+    public URL getCancelUrl() {
+        return GitHubClient.parseURL(cancelUrl);
+    }
+
+    /**
+     * The rerun URL, like https://api.github.com/repos/octo-org/octo-repo/actions/runs/30433642/rerun
+     *
+     * @return the rerun url
+     */
+    public URL getRerunUrl() {
+        return GitHubClient.parseURL(rerunUrl);
+    }
+
+    /**
+     * The workflow URL, like https://api.github.com/repos/octo-org/octo-repo/actions/workflows/159038
+     *
+     * @return the workflow url
+     */
+    public URL getWorkflowUrl() {
+        return GitHubClient.parseURL(workflowUrl);
+    }
+
+    /**
+     * The head branch name the changes are on.
+     *
+     * @return head branch name
+     */
+    public String getHeadBranch() {
+        return headBranch;
+    }
+
+    /**
+     * Gets the HEAD SHA.
+     *
+     * @return sha for the HEAD commit
+     */
+    public String getHeadSha() {
+        return headSha;
+    }
+
+    /**
+     * The commit of current head.
+     *
+     * @return head commit
+     */
+    public HeadCommit getHeadCommit() {
+        return headCommit;
+    }
+
+    /**
+     * The repository of current head.
+     *
+     * @return head repository
+     */
+    public GHRepository getHeadRepository() {
+        return headRepository;
+    }
+
+    /**
+     * The type of event that triggered the build.
+     *
+     * @return type of event
+     */
+    public GHEvent getEvent() {
+        return EnumUtils.getNullableEnumOrDefault(GHEvent.class, event, GHEvent.UNKNOWN);
+    }
+
+    /**
+     * Gets status of the workflow run.
+     * <p>
+     * Can be {@code UNKNOWN} if the value returned by GitHub is unknown from the API.
+     *
+     * @return status of the workflow run
+     */
+    public Status getStatus() {
+        return Status.from(status);
+    }
+
+    /**
+     * Gets the conclusion of the workflow run.
+     * <p>
+     * Can be {@code UNKNOWN} if the value returned by GitHub is unknown from the API.
+     *
+     * @return conclusion of the workflow run
+     */
+    public Conclusion getConclusion() {
+        return Conclusion.from(conclusion);
+    }
+
+    /**
+     * Repository to which the workflow run belongs.
+     *
+     * @return the repository
+     */
+    public GHRepository getRepository() {
+        return owner;
+    }
+
+    /**
+     * Gets the pull requests participated in this workflow run.
+     *
+     * Note this field is only populated for events. When getting a {@link GHWorkflowRun} outside of an event, this is
+     * always empty.
+     *
+     * @return the list of {@link GHPullRequest}s for this workflow run. Only populated for events.
+     * @throws IOException
+     *             the io exception
+     */
+    public List<GHPullRequest> getPullRequests() throws IOException {
+        if (pullRequests != null && pullRequests.length != 0) {
+            for (GHPullRequest pullRequest : pullRequests) {
+                // Only refresh if we haven't do so before
+                pullRequest.refresh(pullRequest.getTitle());
+            }
+            return Collections.unmodifiableList(Arrays.asList(pullRequests));
+        }
+        return Collections.emptyList();
+    }
+
+    /**
+     * Cancel the workflow run.
+     *
+     * @throws IOException
+     *             the io exception
+     */
+    public void cancel() throws IOException {
+        root.createRequest().method("POST").withUrlPath(getApiRoute(), "cancel").fetchHttpStatusCode();
+    }
+
+    /**
+     * Delete the workflow run.
+     *
+     * @throws IOException
+     *             the io exception
+     */
+    public void delete() throws IOException {
+        root.createRequest().method("DELETE").withUrlPath(getApiRoute()).fetchHttpStatusCode();
+    }
+
+    /**
+     * Rerun the workflow run.
+     *
+     * @throws IOException
+     *             the io exception
+     */
+    public void rerun() throws IOException {
+        root.createRequest().method("POST").withUrlPath(getApiRoute(), "rerun").fetchHttpStatusCode();
+    }
+
+    /**
+     * Lists the artifacts attached to this workflow run.
+     *
+     * @return the paged iterable
+     */
+    public PagedIterable<GHArtifact> listArtifacts() {
+        return new GHArtifactsIterable(owner, root.createRequest().withUrlPath(getApiRoute(), "artifacts"));
+    }
+
+    /**
+     * Downloads the logs.
+     * <p>
+     * The logs are in the form of a zip archive.
+     * <p>
+     * Note that the archive is the same as the one downloaded from a workflow run so it contains the logs for all jobs.
+     *
+     * @param <T>
+     *            the type of result
+     * @param streamFunction
+     *            The {@link InputStreamFunction} that will process the stream
+     * @throws IOException
+     *             The IO exception.
+     * @return the result of reading the stream.
+     */
+    public <T> T downloadLogs(InputStreamFunction<T> streamFunction) throws IOException {
+        requireNonNull(streamFunction, "Stream function must not be null");
+
+        return root.createRequest().method("GET").withUrlPath(getApiRoute(), "logs").fetchStream(streamFunction);
+    }
+
+    /**
+     * Delete the logs.
+     *
+     * @throws IOException
+     *             the io exception
+     */
+    public void deleteLogs() throws IOException {
+        root.createRequest().method("DELETE").withUrlPath(getApiRoute(), "logs").fetchHttpStatusCode();
+    }
+
+    /**
+     * Returns the list of jobs of this workflow run for the last execution.
+     *
+     * @return list of jobs from the last execution
+     */
+    public PagedIterable<GHWorkflowJob> listJobs() {
+        return new GHWorkflowJobQueryBuilder(this).latest().list();
+    }
+
+    /**
+     * Returns the list of jobs from all the executions of this workflow run.
+     *
+     * @return list of jobs from all the executions
+     */
+    public PagedIterable<GHWorkflowJob> listAllJobs() {
+        return new GHWorkflowJobQueryBuilder(this).all().list();
+    }
+
+    private String getApiRoute() {
+        if (owner == null) {
+            // Workflow runs returned from search to do not have an owner. Attempt to use url.
+            final URL url = Objects.requireNonNull(getUrl(), "Missing instance URL!");
+            return StringUtils.prependIfMissing(url.toString().replace(root.getApiUrl(), ""), "/");
+
+        }
+        return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/actions/runs/" + getId();
+    }
+
+    GHWorkflowRun wrapUp(GHRepository owner) {
+        this.owner = owner;
+        return wrapUp(owner.root);
+    }
+
+    GHWorkflowRun wrapUp(GitHub root) {
+        this.root = root;
+        if (owner != null) {
+            owner.wrap(root);
+            if (pullRequests != null) {
+                for (GHPullRequest singlePull : pullRequests) {
+                    singlePull.wrap(owner);
+                }
+            }
+        } else if (pullRequests != null) {
+            for (GHPullRequest singlePull : pullRequests) {
+                singlePull.wrap(root);
+            }
+        }
+        if (headRepository != null) {
+            headRepository.wrap(root);
+        }
+        return this;
+    }
+
+    public static class HeadCommit {
+        private String id;
+        private String treeId;
+        private String message;
+        private String timestamp;
+        private GitUser author;
+        private GitUser committer;
+
+        /**
+         * Gets id of the commit
+         *
+         * @return id of the commit
+         */
+        public String getId() {
+            return id;
+        }
+
+        /**
+         * Gets id of the tree.
+         *
+         * @return id of the tree
+         */
+        public String getTreeId() {
+            return treeId;
+        }
+
+        /**
+         * Gets message.
+         *
+         * @return commit message.
+         */
+        public String getMessage() {
+            return message;
+        }
+
+        /**
+         * Gets timestamp of the commit.
+         *
+         * @return timestamp of the commit
+         */
+        public Date getTimestamp() {
+            return GitHubClient.parseDate(timestamp);
+        }
+
+        /**
+         * Gets author.
+         *
+         * @return the author
+         */
+        public GitUser getAuthor() {
+            return author;
+        }
+
+        /**
+         * Gets committer.
+         *
+         * @return the committer
+         */
+        public GitUser getCommitter() {
+            return committer;
+        }
+    }
+
+    public static enum Status {
+        QUEUED, IN_PROGRESS, COMPLETED, UNKNOWN;
+
+        public static Status from(String value) {
+            return EnumUtils.getNullableEnumOrDefault(Status.class, value, Status.UNKNOWN);
+        }
+
+        @Override
+        public String toString() {
+            return name().toLowerCase(Locale.ROOT);
+        }
+    }
+
+    public static enum Conclusion {
+        ACTION_REQUIRED, CANCELLED, FAILURE, NEUTRAL, SUCCESS, SKIPPED, STALE, TIMED_OUT, UNKNOWN;
+
+        public static Conclusion from(String value) {
+            return EnumUtils.getNullableEnumOrDefault(Conclusion.class, value, Conclusion.UNKNOWN);
+        }
+
+        @Override
+        public String toString() {
+            return name().toLowerCase(Locale.ROOT);
+        }
+    }
+}

src/main/java/org/kohsuke/github/GHWorkflowRunQueryBuilder.java

@@ -0,0 +1,101 @@
+package org.kohsuke.github;
+
+import org.kohsuke.github.GHWorkflowRun.Status;
+
+import java.net.MalformedURLException;
+
+/**
+ * Lists up workflow runs with some filtering and sorting.
+ *
+ * @author Guillaume Smet
+ * @see GHRepository#queryWorkflowRuns()
+ */
+public class GHWorkflowRunQueryBuilder extends GHQueryBuilder<GHWorkflowRun> {
+    private final GHRepository repo;
+
+    GHWorkflowRunQueryBuilder(GHRepository repo) {
+        super(repo.root);
+        this.repo = repo;
+    }
+
+    /**
+     * Actor workflow run query builder.
+     *
+     * @param actor
+     *            the actor
+     * @return the gh workflow run query builder
+     */
+    public GHWorkflowRunQueryBuilder actor(String actor) {
+        req.with("actor", actor);
+        return this;
+    }
+
+    /**
+     * Actor workflow run query builder.
+     *
+     * @param actor
+     *            the actor
+     * @return the gh workflow run query builder
+     */
+    public GHWorkflowRunQueryBuilder actor(GHUser actor) {
+        req.with("actor", actor.getLogin());
+        return this;
+    }
+
+    /**
+     * Branch workflow run query builder.
+     *
+     * @param branch
+     *            the branch
+     * @return the gh workflow run query builder
+     */
+    public GHWorkflowRunQueryBuilder branch(String branch) {
+        req.with("branch", branch);
+        return this;
+    }
+
+    /**
+     * Event workflow run query builder.
+     *
+     * @param event
+     *            the event
+     * @return the gh workflow run query builder
+     */
+    public GHWorkflowRunQueryBuilder event(GHEvent event) {
+        req.with("event", event.symbol());
+        return this;
+    }
+
+    /**
+     * Event workflow run query builder.
+     *
+     * @param event
+     *            the event
+     * @return the gh workflow run query builder
+     */
+    public GHWorkflowRunQueryBuilder event(String event) {
+        req.with("event", event);
+        return this;
+    }
+
+    /**
+     * Status workflow run query builder.
+     *
+     * @param status
+     *            the status
+     * @return the gh workflow run query builder
+     */
+    public GHWorkflowRunQueryBuilder status(Status status) {
+        req.with("status", status.toString());
+        return this;
+    }
+
+    @Override
+    public PagedIterable<GHWorkflowRun> list() {
+        try {
+            return new GHWorkflowRunsIterable(repo, req.withUrlPath(repo.getApiTailUrl("actions/runs")).build());
+        } catch (MalformedURLException e) {
+            throw new GHException(e.getMessage(), e);
+        }
+    }
+}

src/main/java/org/kohsuke/github/GHWorkflowRunsIterable.java

@@ -0,0 +1,45 @@
+package org.kohsuke.github;
+
+import java.util.Iterator;
+
+import javax.annotation.Nonnull;
+
+/**
+ * Iterable for workflow runs listing.
+ */
+class GHWorkflowRunsIterable extends PagedIterable<GHWorkflowRun> {
+    private final GHRepository owner;
+    private final GitHubRequest request;
+
+    private GHWorkflowRunsPage result;
+
+    public GHWorkflowRunsIterable(GHRepository owner, GitHubRequest request) {
+        this.owner = owner;
+        this.request = request;
+    }
+
+    @Nonnull
+    @Override
+    public PagedIterator<GHWorkflowRun> _iterator(int pageSize) {
+        return new PagedIterator<>(
+                adapt(GitHubPageIterator
+                        .create(owner.getRoot().getClient(), GHWorkflowRunsPage.class, request, pageSize)),
+                null);
+    }
+
+    protected Iterator<GHWorkflowRun[]> adapt(final Iterator<GHWorkflowRunsPage> base) {
+        return new Iterator<GHWorkflowRun[]>() {
+            public boolean hasNext() {
+                return base.hasNext();
+            }
+
+            public GHWorkflowRun[] next() {
+                GHWorkflowRunsPage v = base.next();
+                if (result == null) {
+                    result = v;
+                }
+                return v.getWorkflowRuns(owner);
+            }
+        };
+    }
+}

src/main/java/org/kohsuke/github/GHWorkflowRunsPage.java

@@ -0,0 +1,20 @@
+package org.kohsuke.github;
+
+/**
+ * Represents the one page of workflow runs result when listing workflow runs.
+ */
+class GHWorkflowRunsPage {
+    private int totalCount;
+    private GHWorkflowRun[] workflowRuns;
+
+    public int getTotalCount() {
+        return totalCount;
+    }
+
+    GHWorkflowRun[] getWorkflowRuns(GHRepository owner) {
+        for (GHWorkflowRun workflowRun : workflowRuns) {
+            workflowRun.wrapUp(owner);
+        }
+        return workflowRuns;
+    }
+}

src/main/java/org/kohsuke/github/GHWorkflowsIterable.java

@@ -0,0 +1,53 @@
+package org.kohsuke.github;
+
+import java.net.MalformedURLException;
+import java.util.Iterator;
+
+import javax.annotation.Nonnull;
+
+/**
+ * Iterable for workflows listing.
+ */
+class GHWorkflowsIterable extends PagedIterable<GHWorkflow> {
+    private final transient GHRepository owner;
+
+    private GHWorkflowsPage result;
+
+    public GHWorkflowsIterable(GHRepository owner) {
+        this.owner = owner;
+    }
+
+    @Nonnull
+    @Override
+    public PagedIterator<GHWorkflow> _iterator(int pageSize) {
+        try {
+            GitHubRequest request = owner.getRoot()
+                    .createRequest()
+                    .withUrlPath(owner.getApiTailUrl("actions/workflows"))
+                    .build();
+
+            return new PagedIterator<>(
+                    adapt(GitHubPageIterator
+                            .create(owner.getRoot().getClient(), GHWorkflowsPage.class, request, pageSize)),
+                    null);
+        } catch (MalformedURLException e) {
+            throw new GHException("Malformed URL", e);
+        }
+    }
+
+    protected Iterator<GHWorkflow[]> adapt(final Iterator<GHWorkflowsPage> base) {
+        return new Iterator<GHWorkflow[]>() {
+            public boolean hasNext() {
+                return base.hasNext();
+            }
+
+            public GHWorkflow[] next() {
+                GHWorkflowsPage v = base.next();
+                if (result == null) {
+                    result = v;
+                }
+                return v.getWorkflows(owner);
+            }
+        };
+    }
+}

src/main/java/org/kohsuke/github/GHWorkflowsPage.java

@@ -0,0 +1,20 @@
+package org.kohsuke.github;
+
+/**
+ * Represents the one page of workflow result when listing workflows.
+ */
+class GHWorkflowsPage {
+    private int total_count;
+    private GHWorkflow[] workflows;
+
+    public int getTotalCount() {
+        return total_count;
+    }
+
+    GHWorkflow[] getWorkflows(GHRepository owner) {
+        for (GHWorkflow workflow : workflows) {
+            workflow.wrapUp(owner);
+        }
+        return workflows;
+    }
+}

src/main/java/org/kohsuke/github/GitHub.java

@@ -26,6 +26,8 @@ package org.kohsuke.github;
 import com.fasterxml.jackson.databind.ObjectReader;
 import com.fasterxml.jackson.databind.ObjectWriter;
 import com.infradna.tool.bridge_method_injector.WithBridgeMethods;
+import org.kohsuke.github.authorization.AuthorizationProvider;
+import org.kohsuke.github.internal.Previews;
 
 import java.io.*;
 import java.util.*;
@@ -37,8 +39,8 @@ import java.util.logging.Logger;
 import javax.annotation.CheckForNull;
 import javax.annotation.Nonnull;
 
-import static org.kohsuke.github.Previews.INERTIA;
-import static org.kohsuke.github.Previews.MACHINE_MAN;
+import static org.kohsuke.github.internal.Previews.INERTIA;
+import static org.kohsuke.github.internal.Previews.MACHINE_MAN;
 
 /**
  * Root of the GitHub API.
@@ -93,39 +95,112 @@ public class GitHub {
      *            "http://ghe.acme.com/api/v3". Note that GitHub Enterprise has <code>/api/v3</code> in the URL. For
      *            historical reasons, this parameter still accepts the bare domain name, but that's considered
      *            deprecated. Password is also considered deprecated as it is no longer required for api usage.
-     * @param login
-     *            The user ID on GitHub that you are logging in as. Can be omitted if the OAuth token is provided or if
-     *            logging in anonymously. Specifying this would save one API call.
-     * @param oauthAccessToken
-     *            Secret OAuth token.
-     * @param password
-     *            User's password. Always used in conjunction with the {@code login} parameter
      * @param connector
-     *            HttpConnector to use. Pass null to use default connector.
+     *            a connector
+     * @param rateLimitHandler
+     *            rateLimitHandler
+     * @param abuseLimitHandler
+     *            abuseLimitHandler
+     * @param rateLimitChecker
+     *            rateLimitChecker
+     * @param authorizationProvider
+     *            a authorization provider
      */
     GitHub(String apiUrl,
-            String login,
-            String oauthAccessToken,
-            String jwtToken,
-            String password,
             HttpConnector connector,
             RateLimitHandler rateLimitHandler,
             AbuseLimitHandler abuseLimitHandler,
-            GitHubRateLimitChecker rateLimitChecker) throws IOException {
+            GitHubRateLimitChecker rateLimitChecker,
+            AuthorizationProvider authorizationProvider) throws IOException {
+        if (authorizationProvider instanceof DependentAuthorizationProvider) {
+            ((DependentAuthorizationProvider) authorizationProvider).bind(this);
+        }
+
         this.client = new GitHubHttpUrlConnectionClient(apiUrl,
-                login,
-                oauthAccessToken,
-                jwtToken,
-                password,
                 connector,
                 rateLimitHandler,
                 abuseLimitHandler,
                 rateLimitChecker,
-                (myself) -> setMyself(myself));
+                (myself) -> setMyself(myself),
+                authorizationProvider);
         users = new ConcurrentHashMap<>();
         orgs = new ConcurrentHashMap<>();
     }
 
+    private GitHub(GitHubClient client) {
+        this.client = client;
+        users = new ConcurrentHashMap<>();
+        orgs = new ConcurrentHashMap<>();
+    }
+
+    public static abstract class DependentAuthorizationProvider implements AuthorizationProvider {
+
+        private GitHub baseGitHub;
+        private GitHub gitHub;
+        private final AuthorizationProvider authorizationProvider;
+
+        /**
+         * An AuthorizationProvider that requires an authenticated GitHub instance to provide its authorization.
+         *
+         * @param authorizationProvider
+         *            A authorization provider to be used when refreshing this authorization provider.
+         */
+        @BetaApi
+        @Deprecated
+        protected DependentAuthorizationProvider(AuthorizationProvider authorizationProvider) {
+            this.authorizationProvider = authorizationProvider;
+        }
+
+        /**
+         * Binds this authorization provider to a github instance.
+         *
+         * Only needs to be implemented by dynamic credentials providers that use a github instance in order to refresh.
+         *
+         * @param github
+         *            The github instance to be used for refreshing dynamic credentials
+         */
+        synchronized void bind(GitHub github) {
+            if (baseGitHub != null) {
+                throw new IllegalStateException("Already bound to another GitHub instance.");
+            }
+            this.baseGitHub = github;
+        }
+
+        protected synchronized final GitHub gitHub() {
+            if (gitHub == null) {
+                gitHub = new GitHub.AuthorizationRefreshGitHubWrapper(this.baseGitHub, authorizationProvider);
+            }
+            return gitHub;
+        }
+    }
+
+    private static class AuthorizationRefreshGitHubWrapper extends GitHub {
+
+        private final AuthorizationProvider authorizationProvider;
+
+        AuthorizationRefreshGitHubWrapper(GitHub github, AuthorizationProvider authorizationProvider) {
+            super(github.client);
+            this.authorizationProvider = authorizationProvider;
+
+            // no dependent authorization providers nest like this currently, but they might in future
+            if (authorizationProvider instanceof DependentAuthorizationProvider) {
+                ((DependentAuthorizationProvider) authorizationProvider).bind(this);
+            }
+        }
+
+        @Nonnull
+        @Override
+        Requester createRequest() {
+            try {
+                // Override
+                return super.createRequest().setHeader("Authorization", authorizationProvider.getEncodedAuthorization())
+                        .rateLimit(RateLimitTarget.NONE);
+            } catch (IOException e) {
+                throw new GHException("Failed to create requester to refresh credentials", e);
+            }
+        }
+    }
+
     /**
      * Obtains the credential from "~/.github" or from the System Environment Properties.
      *
@@ -557,11 +632,28 @@ public class GitHub {
      * @return the repository by id
      * @throws IOException
      *             the io exception
+     *
+     * @deprecated Do not use this method. It was added due to misunderstanding of the type of parameter. Use
+     *             {@link #getRepositoryById(long)} instead
      */
+    @Deprecated
     public GHRepository getRepositoryById(String id) throws IOException {
         return createRequest().withUrlPath("/repositories/" + id).fetch(GHRepository.class).wrap(this);
     }
 
+    /**
+     * Gets the repository object from its ID
+     *
+     * @param id
+     *            the id
+     * @return the repository by id
+     * @throws IOException
+     *             the io exception
+     */
+    public GHRepository getRepositoryById(long id) throws IOException {
+        return createRequest().withUrlPath("/repositories/" + id).fetch(GHRepository.class).wrap(this);
+    }
+
     /**
      * Returns a list of popular open source licenses
      *
@@ -1203,7 +1295,7 @@ public class GitHub {
                         .with(new ByteArrayInputStream(text.getBytes("UTF-8")))
                         .contentType("text/plain;charset=UTF-8")
                         .withUrlPath("/markdown/raw")
-                        .fetchStream(),
+                        .fetchStream(Requester::copyInputStream),
                 "UTF-8");
     }
 

src/main/java/org/kohsuke/github/GitHubBuilder.java

@@ -1,6 +1,8 @@
 package org.kohsuke.github;
 
 import org.apache.commons.io.IOUtils;
+import org.kohsuke.github.authorization.AuthorizationProvider;
+import org.kohsuke.github.authorization.ImmutableAuthorizationProvider;
 import org.kohsuke.github.extras.ImpatientHttpConnector;
 
 import java.io.File;
@@ -22,18 +24,18 @@ import javax.annotation.Nonnull;
  */
 public class GitHubBuilder implements Cloneable {
 
+    // for testing
+    static File HOME_DIRECTORY = null;
+
     // default scoped so unit tests can read them.
     /* private */ String endpoint = GitHubClient.GITHUB_URL;
-    /* private */ String user;
-    /* private */ String password;
-    /* private */ String oauthToken;
-    /* private */ String jwtToken;
 
     private HttpConnector connector;
 
     private RateLimitHandler rateLimitHandler = RateLimitHandler.WAIT;
     private AbuseLimitHandler abuseLimitHandler = AbuseLimitHandler.WAIT;
     private GitHubRateLimitChecker rateLimitChecker = new GitHubRateLimitChecker();
+    /* private */ AuthorizationProvider authorizationProvider = AuthorizationProvider.ANONYMOUS;
 
     /**
      * Instantiates a new Git hub builder.
@@ -61,13 +63,13 @@ public class GitHubBuilder implements Cloneable {
 
         builder = fromEnvironment();
 
-        if (builder.oauthToken != null || builder.user != null || builder.jwtToken != null)
+        if (builder.authorizationProvider != AuthorizationProvider.ANONYMOUS)
             return builder;
 
         try {
             builder = fromPropertyFile();
 
-            if (builder.oauthToken != null || builder.user != null || builder.jwtToken != null)
+            if (builder.authorizationProvider != AuthorizationProvider.ANONYMOUS)
                 return builder;
         } catch (FileNotFoundException e) {
             // fall through
@@ -179,7 +181,7 @@ public class GitHubBuilder implements Cloneable {
      *             the io exception
      */
     public static GitHubBuilder fromPropertyFile() throws IOException {
-        File homeDir = new File(System.getProperty("user.home"));
+        File homeDir = HOME_DIRECTORY != null ? HOME_DIRECTORY : new File(System.getProperty("user.home"));
         File propertyFile = new File(homeDir, ".github");
         return fromPropertyFile(propertyFile.getPath());
     }
@@ -215,9 +217,20 @@ public class GitHubBuilder implements Cloneable {
      */
     public static GitHubBuilder fromProperties(Properties props) {
         GitHubBuilder self = new GitHubBuilder();
-        self.withOAuthToken(props.getProperty("oauth"), props.getProperty("login"));
-        self.withJwtToken(props.getProperty("jwt"));
-        self.withPassword(props.getProperty("login"), props.getProperty("password"));
+        String oauth = props.getProperty("oauth");
+        String jwt = props.getProperty("jwt");
+        String login = props.getProperty("login");
+        String password = props.getProperty("password");
+
+        if (oauth != null) {
+            self.withOAuthToken(oauth, login);
+        }
+        if (jwt != null) {
+            self.withJwtToken(jwt);
+        }
+        if (password != null) {
+            self.withPassword(login, password);
+        }
         self.withEndpoint(props.getProperty("endpoint", GitHubClient.GITHUB_URL));
         return self;
     }
@@ -247,9 +260,7 @@ public class GitHubBuilder implements Cloneable {
      * @return the git hub builder
      */
     public GitHubBuilder withPassword(String user, String password) {
-        this.user = user;
-        this.password = password;
-        return this;
+        return withAuthorizationProvider(ImmutableAuthorizationProvider.fromLoginAndPassword(user, password));
     }
 
     /**
@@ -260,7 +271,7 @@ public class GitHubBuilder implements Cloneable {
      * @return the git hub builder
      */
     public GitHubBuilder withOAuthToken(String oauthToken) {
-        return withOAuthToken(oauthToken, null);
+        return withAuthorizationProvider(ImmutableAuthorizationProvider.fromOauthToken(oauthToken));
     }
 
     /**
@@ -273,8 +284,21 @@ public class GitHubBuilder implements Cloneable {
      * @return the git hub builder
      */
     public GitHubBuilder withOAuthToken(String oauthToken, String user) {
-        this.oauthToken = oauthToken;
-        this.user = user;
+        return withAuthorizationProvider(ImmutableAuthorizationProvider.fromOauthToken(oauthToken, user));
+    }
+
+    /**
+     * Configures a {@link AuthorizationProvider} for this builder
+     *
+     * There can be only one authorization provider per client instance.
+     *
+     * @param authorizationProvider
+     *            the authorization provider
+     * @return the git hub builder
+     *
+     */
+    public GitHubBuilder withAuthorizationProvider(final AuthorizationProvider authorizationProvider) {
+        this.authorizationProvider = authorizationProvider;
         return this;
     }
 
@@ -287,7 +311,7 @@ public class GitHubBuilder implements Cloneable {
      * @see GHAppInstallation#createToken(java.util.Map) GHAppInstallation#createToken(java.util.Map)
      */
     public GitHubBuilder withAppInstallationToken(String appInstallationToken) {
-        return withOAuthToken(appInstallationToken, "");
+        return withAuthorizationProvider(ImmutableAuthorizationProvider.fromAppInstallationToken(appInstallationToken));
     }
 
     /**
@@ -298,8 +322,7 @@ public class GitHubBuilder implements Cloneable {
      * @return the git hub builder
      */
     public GitHubBuilder withJwtToken(String jwtToken) {
-        this.jwtToken = jwtToken;
-        return this;
+        return withAuthorizationProvider(ImmutableAuthorizationProvider.fromJwtToken(jwtToken));
     }
 
     /**
@@ -421,14 +444,11 @@ public class GitHubBuilder implements Cloneable {
      */
     public GitHub build() throws IOException {
         return new GitHub(endpoint,
-                user,
-                oauthToken,
-                jwtToken,
-                password,
                 connector,
                 rateLimitHandler,
                 abuseLimitHandler,
-                rateLimitChecker);
+                rateLimitChecker,
+                authorizationProvider);
     }
 
     @Override

src/main/java/org/kohsuke/github/GitHubClient.java

@@ -1,33 +1,20 @@
 package org.kohsuke.github;
 
-import com.fasterxml.jackson.databind.DeserializationFeature;
-import com.fasterxml.jackson.databind.InjectableValues;
-import com.fasterxml.jackson.databind.MapperFeature;
-import com.fasterxml.jackson.databind.ObjectMapper;
-import com.fasterxml.jackson.databind.ObjectReader;
-import com.fasterxml.jackson.databind.ObjectWriter;
-import com.fasterxml.jackson.databind.PropertyNamingStrategy;
+import com.fasterxml.jackson.databind.*;
 import com.fasterxml.jackson.databind.introspect.VisibilityChecker;
 import org.apache.commons.io.IOUtils;
+import org.kohsuke.github.authorization.AuthorizationProvider;
+import org.kohsuke.github.authorization.UserAuthorizationProvider;
 
 import java.io.FileNotFoundException;
 import java.io.IOException;
 import java.io.InterruptedIOException;
-import java.net.HttpURLConnection;
-import java.net.MalformedURLException;
-import java.net.SocketException;
-import java.net.SocketTimeoutException;
-import java.net.URL;
-import java.nio.charset.StandardCharsets;
+import java.net.*;
 import java.time.Instant;
 import java.time.format.DateTimeFormatter;
 import java.time.temporal.ChronoUnit;
-import java.util.Base64;
-import java.util.Date;
-import java.util.HashMap;
-import java.util.List;
-import java.util.Map;
-import java.util.Objects;
+import java.util.*;
+import java.util.concurrent.atomic.AtomicReference;
 import java.util.function.Consumer;
 import java.util.logging.Logger;
 
@@ -56,24 +43,18 @@ abstract class GitHubClient {
     static final int retryTimeoutMillis = 100;
     /* private */ final String login;
 
-    /**
-     * Value of the authorization header to be sent with the request.
-     */
-    /* private */ final String encodedAuthorization;
-
     // Cache of myself object.
     private final String apiUrl;
 
     protected final RateLimitHandler rateLimitHandler;
     protected final AbuseLimitHandler abuseLimitHandler;
     private final GitHubRateLimitChecker rateLimitChecker;
+    private final AuthorizationProvider authorizationProvider;
 
     private HttpConnector connector;
 
-    private final Object rateLimitLock = new Object();
-
     @Nonnull
-    private GHRateLimit rateLimit = GHRateLimit.DEFAULT;
+    private final AtomicReference<GHRateLimit> rateLimit = new AtomicReference<>(GHRateLimit.DEFAULT);
 
     private static final Logger LOGGER = Logger.getLogger(GitHubClient.class.getName());
 
@@ -91,15 +72,12 @@ abstract class GitHubClient {
     }
 
     GitHubClient(String apiUrl,
-            String login,
-            String oauthAccessToken,
-            String jwtToken,
-            String password,
             HttpConnector connector,
             RateLimitHandler rateLimitHandler,
             AbuseLimitHandler abuseLimitHandler,
             GitHubRateLimitChecker rateLimitChecker,
-            Consumer<GHMyself> myselfConsumer) throws IOException {
+            Consumer<GHMyself> myselfConsumer,
+            AuthorizationProvider authorizationProvider) throws IOException {
 
         if (apiUrl.endsWith("/")) {
             apiUrl = apiUrl.substring(0, apiUrl.length() - 1); // normalize
@@ -111,33 +89,38 @@ abstract class GitHubClient {
         this.apiUrl = apiUrl;
         this.connector = connector;
 
-        if (oauthAccessToken != null) {
-            encodedAuthorization = "token " + oauthAccessToken;
-        } else {
-            if (jwtToken != null) {
-                encodedAuthorization = "Bearer " + jwtToken;
-            } else if (password != null) {
-                String authorization = (login + ':' + password);
-                String charsetName = StandardCharsets.UTF_8.name();
-                encodedAuthorization = "Basic "
-                        + Base64.getEncoder().encodeToString(authorization.getBytes(charsetName));
-            } else {// anonymous access
-                encodedAuthorization = null;
-            }
-        }
+        // Prefer credential configuration via provider
+        this.authorizationProvider = authorizationProvider;
 
         this.rateLimitHandler = rateLimitHandler;
         this.abuseLimitHandler = abuseLimitHandler;
         this.rateLimitChecker = rateLimitChecker;
 
-        if (login == null && encodedAuthorization != null && jwtToken == null) {
-            GHMyself myself = fetch(GHMyself.class, "/user");
-            login = myself.getLogin();
-            if (myselfConsumer != null) {
-                myselfConsumer.accept(myself);
+        this.login = getCurrentUser(myselfConsumer);
+    }
+
+    private String getCurrentUser(Consumer<GHMyself> myselfConsumer) throws IOException {
+        String login = null;
+        if (this.authorizationProvider instanceof UserAuthorizationProvider
+                && this.authorizationProvider.getEncodedAuthorization() != null) {
+
+            UserAuthorizationProvider userAuthorizationProvider = (UserAuthorizationProvider) this.authorizationProvider;
+
+            login = userAuthorizationProvider.getLogin();
+
+            if (login == null) {
+                try {
+                    GHMyself myself = fetch(GHMyself.class, "/user");
+                    if (myselfConsumer != null) {
+                        myselfConsumer.accept(myself);
+                    }
+                    login = myself.getLogin();
+                } catch (IOException e) {
+                    return null;
+                }
             }
         }
-        this.login = login;
+        return login;
     }
 
     private <T> T fetch(Class<T> type, String urlPath) throws IOException {
@@ -157,10 +140,9 @@ abstract class GitHubClient {
             getRateLimit();
             return true;
         } catch (IOException e) {
-            if (LOGGER.isLoggable(FINE))
-                LOGGER.log(FINE,
-                        "Exception validating credentials on " + getApiUrl() + " with login '" + login + "' " + e,
-                        e);
+            LOGGER.log(FINE,
+                    "Exception validating credentials on " + getApiUrl() + " with login '" + login + "' " + e,
+                    e);
             return false;
         }
     }
@@ -202,7 +184,13 @@ abstract class GitHubClient {
      * @return {@code true} if operations that require authentication will fail.
      */
     public boolean isAnonymous() {
-        return login == null && encodedAuthorization == null;
+        try {
+            return login == null && this.authorizationProvider.getEncodedAuthorization() == null;
+        } catch (IOException e) {
+            // An exception here means that the provider failed to provide authorization parameters,
+            // basically meaning the same as "no auth"
+            return false;
+        }
     }
 
     /**
@@ -224,6 +212,11 @@ abstract class GitHubClient {
         return getRateLimit(RateLimitTarget.NONE);
     }
 
+    @CheckForNull
+    protected String getEncodedAuthorization() throws IOException {
+        return authorizationProvider.getEncodedAuthorization();
+    }
+
     @Nonnull
     GHRateLimit getRateLimit(@Nonnull RateLimitTarget rateLimitTarget) throws IOException {
         GHRateLimit result;
@@ -261,9 +254,7 @@ abstract class GitHubClient {
     @Nonnull
     @Deprecated
     GHRateLimit lastRateLimit() {
-        synchronized (rateLimitLock) {
-            return rateLimit;
-        }
+        return rateLimit.get();
     }
 
     /**
@@ -283,12 +274,19 @@ abstract class GitHubClient {
      */
     @Nonnull
     GHRateLimit rateLimit(@Nonnull RateLimitTarget rateLimitTarget) throws IOException {
-        synchronized (rateLimitLock) {
-            if (rateLimit.getRecord(rateLimitTarget).isExpired()) {
-                getRateLimit(rateLimitTarget);
+        GHRateLimit result = rateLimit.get();
+        // Most of the time rate limit is not expired, so try to avoid locking.
+        if (result.getRecord(rateLimitTarget).isExpired()) {
+            // if the rate limit is expired, synchronize to ensure
+            // only one call to getRateLimit() is made to refresh it.
+            synchronized (this) {
+                if (rateLimit.get().getRecord(rateLimitTarget).isExpired()) {
+                    getRateLimit(rateLimitTarget);
+                }
             }
-            return rateLimit;
+            result = rateLimit.get();
         }
+        return result;
     }
 
     /**
@@ -301,15 +299,9 @@ abstract class GitHubClient {
      *            {@link GHRateLimit.Record} constructed from the response header information
      */
     private GHRateLimit updateRateLimit(@Nonnull GHRateLimit observed) {
-        synchronized (rateLimitLock) {
-            observed = rateLimit.getMergedRateLimit(observed);
-
-            if (rateLimit != observed) {
-                rateLimit = observed;
-                LOGGER.log(FINE, "Rate limit now: {0}", rateLimit);
-            }
-            return rateLimit;
-        }
+        GHRateLimit result = rateLimit.accumulateAndGet(observed, (current, x) -> current.getMergedRateLimit(x));
+        LOGGER.log(FINEST, "Rate limit now: {0}", rateLimit.get());
+        return result;
     }
 
     /**
@@ -389,12 +381,7 @@ abstract class GitHubClient {
             GitHubResponse.ResponseInfo responseInfo = null;
             try {
                 try {
-                    if (LOGGER.isLoggable(FINE)) {
-                        LOGGER.log(FINE,
-                                "GitHub API request [" + (login == null ? "anonymous" : login) + "]: "
-                                        + request.method() + " " + request.url().toString());
-                    }
-
+                    logRequest(request);
                     rateLimitChecker.checkRateLimit(this, request);
 
                     responseInfo = getResponseInfo(request);
@@ -430,6 +417,12 @@ abstract class GitHubClient {
         throw new GHIOException("Ran out of retries for URL: " + request.url().toString());
     }
 
+    private void logRequest(@Nonnull final GitHubRequest request) {
+        LOGGER.log(FINE,
+                () -> "GitHub API request [" + (login == null ? "anonymous" : login) + "]: " + request.method() + " "
+                        + request.url().toString());
+    }
+
     @Nonnull
     protected abstract GitHubResponse.ResponseInfo getResponseInfo(GitHubRequest request) throws IOException;
 
@@ -443,20 +436,15 @@ abstract class GitHubClient {
             // special case handling for 304 unmodified, as the content will be ""
         } else if (responseInfo.statusCode() == HttpURLConnection.HTTP_ACCEPTED) {
 
-            // Response code 202 means data is being generated.
+            // Response code 202 means data is being generated or an action that can require some time is triggered.
             // This happens in specific cases:
             // statistics - See https://developer.github.com/v3/repos/statistics/#a-word-about-caching
             // fork creation - See https://developer.github.com/v3/repos/forks/#create-a-fork
+            // workflow run cancellation - See https://docs.github.com/en/rest/reference/actions#cancel-a-workflow-run
 
-            if (responseInfo.url().toString().endsWith("/forks")) {
-                LOGGER.log(INFO, "The fork is being created. Please try again in 5 seconds.");
-            } else if (responseInfo.url().toString().endsWith("/statistics")) {
-                LOGGER.log(INFO, "The statistics are being generated. Please try again in 5 seconds.");
-            } else {
-                LOGGER.log(INFO,
-                        "Received 202 from " + responseInfo.url().toString() + " . Please try again in 5 seconds.");
-            }
-            // Maybe throw an exception instead?
+            LOGGER.log(FINE,
+                    "Received HTTP_ACCEPTED(202) from " + responseInfo.url().toString()
+                            + " . Please try again in 5 seconds.");
         } else if (handler != null) {
             body = handler.apply(responseInfo);
         }
@@ -568,9 +556,7 @@ abstract class GitHubClient {
             GHRateLimit.Record observed = new GHRateLimit.Record(limit, remaining, reset, responseInfo);
             updateRateLimit(GHRateLimit.fromRecord(observed, responseInfo.request().rateLimitTarget()));
         } catch (NumberFormatException | NullPointerException e) {
-            if (LOGGER.isLoggable(FINEST)) {
-                LOGGER.log(FINEST, "Missing or malformed X-RateLimit header: ", e);
-            }
+            LOGGER.log(FINEST, "Missing or malformed X-RateLimit header: ", e);
         }
     }
 

src/main/java/org/kohsuke/github/GitHubHttpUrlConnectionClient.java

@@ -1,6 +1,7 @@
 package org.kohsuke.github;
 
 import org.apache.commons.io.IOUtils;
+import org.kohsuke.github.authorization.AuthorizationProvider;
 
 import java.io.IOException;
 import java.io.InputStream;
@@ -33,25 +34,19 @@ import static org.apache.commons.lang3.StringUtils.defaultString;
 class GitHubHttpUrlConnectionClient extends GitHubClient {
 
     GitHubHttpUrlConnectionClient(String apiUrl,
-            String login,
-            String oauthAccessToken,
-            String jwtToken,
-            String password,
             HttpConnector connector,
             RateLimitHandler rateLimitHandler,
             AbuseLimitHandler abuseLimitHandler,
             GitHubRateLimitChecker rateLimitChecker,
-            Consumer<GHMyself> myselfConsumer) throws IOException {
+            Consumer<GHMyself> myselfConsumer,
+            AuthorizationProvider authorizationProvider) throws IOException {
         super(apiUrl,
-                login,
-                oauthAccessToken,
-                jwtToken,
-                password,
                 connector,
                 rateLimitHandler,
                 abuseLimitHandler,
                 rateLimitChecker,
-                myselfConsumer);
+                myselfConsumer,
+                authorizationProvider);
     }
 
     @Nonnull
@@ -114,8 +109,12 @@ class GitHubHttpUrlConnectionClient extends GitHubClient {
 
             // if the authentication is needed but no credential is given, try it anyway (so that some calls
             // that do work with anonymous access in the reduced form should still work.)
-            if (client.encodedAuthorization != null)
-                connection.setRequestProperty("Authorization", client.encodedAuthorization);
+            if (!request.headers().containsKey("Authorization")) {
+                String authorization = client.getEncodedAuthorization();
+                if (authorization != null) {
+                    connection.setRequestProperty("Authorization", client.getEncodedAuthorization());
+                }
+            }
 
             setRequestMethod(request.method(), connection);
             buildRequest(request, connection);

src/main/java/org/kohsuke/github/GitHubInteractiveObject.java

@@ -20,4 +20,8 @@ abstract class GitHubInteractiveObject {
     GitHubInteractiveObject(GitHub root) {
         this.root = root;
     }
+
+    GitHub getRoot() {
+        return root;
+    }
 }

src/main/java/org/kohsuke/github/GitHubRequest.java

@@ -2,6 +2,7 @@ package org.kohsuke.github;
 
 import edu.umd.cs.findbugs.annotations.NonNull;
 import org.apache.commons.lang3.StringUtils;
+import org.kohsuke.github.internal.Previews;
 
 import java.io.InputStream;
 import java.io.UnsupportedEncodingException;
@@ -601,13 +602,27 @@ class GitHubRequest {
          * @return the request builder
          */
         public B set(String key, Object value) {
-            for (int index = 0; index < args.size(); index++) {
+            remove(key);
+            return with(key, value);
+
+        }
+
+        /**
+         * Removes all arg entries for a specific key.
+         *
+         * @param key
+         *            the key
+         * @return the request builder
+         */
+        public B remove(String key) {
+            for (int index = 0; index < args.size();) {
                 if (args.get(index).key.equals(key)) {
-                    args.set(index, new Entry(key, value));
-                    return (B) this;
+                    args.remove(index);
+                } else {
+                    index++;
                 }
             }
-            return with(key, value);
+            return (B) this;
         }
 
         /**

src/main/java/org/kohsuke/github/GitHubResponse.java

@@ -4,6 +4,7 @@ import com.fasterxml.jackson.core.JsonParseException;
 import com.fasterxml.jackson.databind.InjectableValues;
 import com.fasterxml.jackson.databind.JsonMappingException;
 import org.apache.commons.io.IOUtils;
+import org.kohsuke.github.function.FunctionThrows;
 
 import java.io.Closeable;
 import java.io.IOException;
@@ -194,24 +195,11 @@ class GitHubResponse<T> {
     /**
      * Represents a supplier of results that can throw.
      *
-     * <p>
-     * This is a <a href="package-summary.html">functional interface</a> whose functional method is
-     * {@link #apply(ResponseInfo)}.
-     *
      * @param <T>
      *            the type of results supplied by this supplier
      */
     @FunctionalInterface
-    interface BodyHandler<T> {
-
-        /**
-         * Gets a result.
-         *
-         * @return a result
-         * @throws IOException
-         *             if an I/O Exception occurs.
-         */
-        T apply(ResponseInfo input) throws IOException;
+    interface BodyHandler<T> extends FunctionThrows<ResponseInfo, T, IOException> {
     }
 
     /**

src/main/java/org/kohsuke/github/Preview.java

@@ -1,5 +1,7 @@
 package org.kohsuke.github;
 
+import org.kohsuke.github.internal.Previews;
+
 import java.lang.annotation.Documented;
 import java.lang.annotation.Retention;
 import java.lang.annotation.RetentionPolicy;

src/main/java/org/kohsuke/github/Reactable.java

@@ -2,7 +2,7 @@ package org.kohsuke.github;
 
 import java.io.IOException;
 
-import static org.kohsuke.github.Previews.SQUIRREL_GIRL;
+import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
 
 /**
  * Those {@link GHObject}s that can have {@linkplain GHReaction reactions}.

src/main/java/org/kohsuke/github/Requester.java

@@ -23,7 +23,9 @@
  */
 package org.kohsuke.github;
 
+import edu.umd.cs.findbugs.annotations.NonNull;
 import org.apache.commons.io.IOUtils;
+import org.kohsuke.github.function.InputStreamFunction;
 
 import java.io.ByteArrayInputStream;
 import java.io.IOException;
@@ -106,15 +108,31 @@ class Requester extends GitHubRequest.Builder<Requester> {
      * Response input stream. There are scenarios where direct stream reading is needed, however it is better to use
      * {@link #fetch(Class)} where possible.
      *
-     * @return the input stream
      * @throws IOException
      *             the io exception
      */
-    public InputStream fetchStream() throws IOException {
-        return client
-                .sendRequest(this,
-                        (responseInfo) -> new ByteArrayInputStream(IOUtils.toByteArray(responseInfo.bodyStream())))
-                .body();
+    public <T> T fetchStream(@Nonnull InputStreamFunction<T> handler) throws IOException {
+        return client.sendRequest(this, (responseInfo) -> handler.apply(responseInfo.bodyStream())).body();
+    }
+
+    /**
+     * Helper function to make it easy to pull streams.
+     *
+     * Copies an input stream to an in-memory input stream. The performance on this is not great but
+     * {@link GitHubResponse.ResponseInfo#bodyStream()} is closed at the end of every call to
+     * {@link GitHubClient#sendRequest(GitHubRequest, GitHubResponse.BodyHandler)}, so any reads to the original input
+     * stream must be completed before then. There are a number of deprecated methods that return {@link InputStream}.
+     * This method keeps all of them using the same code path.
+     *
+     * @param inputStream
+     *            the input stream to be copied
+     * @return an in-memory copy of the passed input stream
+     * @throws IOException
+     *             if an error occurs while copying the stream
+     */
+    @NonNull
+    public static InputStream copyInputStream(InputStream inputStream) throws IOException {
+        return new ByteArrayInputStream(IOUtils.toByteArray(inputStream));
     }
 
     /**

src/main/java/org/kohsuke/github/authorization/AuthorizationProvider.java

@@ -0,0 +1,43 @@
+package org.kohsuke.github.authorization;
+
+import java.io.IOException;
+
+/**
+ * Provides a functional interface that returns a valid encodedAuthorization. This strategy allows for a provider that
+ * dynamically changes the credentials. Each request will request the credentials from the provider.
+ */
+public interface AuthorizationProvider {
+    /**
+     * An static instance for an ANONYMOUS authorization provider
+     */
+    AuthorizationProvider ANONYMOUS = new AnonymousAuthorizationProvider();
+
+    /**
+     * Returns the credentials to be used with a given request. As an example, a authorization provider for a bearer
+     * token will return something like:
+     *
+     * <pre>
+     * {@code
+     *  &#64;Override
+     *  public String getEncodedAuthorization() {
+     *  return "Bearer myBearerToken";
+     *  }
+     * }
+     * </pre>
+     *
+     * @return encoded authorization string, can be null
+     * @throws IOException
+     *             on any error that prevents the provider from getting a valid authorization
+     */
+    String getEncodedAuthorization() throws IOException;
+
+    /**
+     * A {@link AuthorizationProvider} that ensures that no credentials are returned
+     */
+    class AnonymousAuthorizationProvider implements AuthorizationProvider {
+        @Override
+        public String getEncodedAuthorization() throws IOException {
+            return null;
+        }
+    }
+}

src/main/java/org/kohsuke/github/authorization/ImmutableAuthorizationProvider.java

@@ -0,0 +1,123 @@
+package org.kohsuke.github.authorization;
+
+import java.io.UnsupportedEncodingException;
+import java.nio.charset.StandardCharsets;
+import java.util.Base64;
+
+import javax.annotation.CheckForNull;
+
+/**
+ * A {@link AuthorizationProvider} that always returns the same credentials
+ */
+public class ImmutableAuthorizationProvider implements AuthorizationProvider {
+
+    private final String authorization;
+
+    public ImmutableAuthorizationProvider(String authorization) {
+        this.authorization = authorization;
+    }
+
+    /**
+     * Builds and returns a {@link AuthorizationProvider} from a given oauthAccessToken
+     *
+     * @param oauthAccessToken
+     *            The token
+     * @return a correctly configured {@link AuthorizationProvider} that will always return the same provided
+     *         oauthAccessToken
+     */
+    public static AuthorizationProvider fromOauthToken(String oauthAccessToken) {
+        return new UserProvider(String.format("token %s", oauthAccessToken));
+    }
+
+    /**
+     * Builds and returns a {@link AuthorizationProvider} from a given oauthAccessToken
+     *
+     * @param oauthAccessToken
+     *            The token
+     * @param login
+     *            The login for this token
+     *
+     * @return a correctly configured {@link AuthorizationProvider} that will always return the same provided
+     *         oauthAccessToken
+     */
+    public static AuthorizationProvider fromOauthToken(String oauthAccessToken, String login) {
+        return new UserProvider(String.format("token %s", oauthAccessToken), login);
+    }
+
+    /**
+     * Builds and returns a {@link AuthorizationProvider} from a given App Installation Token
+     *
+     * @param appInstallationToken
+     *            A string containing the GitHub App installation token
+     * @return the configured Builder from given GitHub App installation token.
+     */
+    public static AuthorizationProvider fromAppInstallationToken(String appInstallationToken) {
+        return fromOauthToken(appInstallationToken, "");
+    }
+
+    /**
+     * Builds and returns a {@link AuthorizationProvider} from a given jwtToken
+     *
+     * @param jwtToken
+     *            The JWT token
+     * @return a correctly configured {@link AuthorizationProvider} that will always return the same provided jwtToken
+     */
+    public static AuthorizationProvider fromJwtToken(String jwtToken) {
+        return new ImmutableAuthorizationProvider(String.format("Bearer %s", jwtToken));
+    }
+
+    /**
+     * Builds and returns a {@link AuthorizationProvider} from the given user/password pair
+     *
+     * @param login
+     *            The login for the user, usually the same as the username
+     * @param password
+     *            The password for the associated user
+     * @return a correctly configured {@link AuthorizationProvider} that will always return the credentials for the same
+     *         user and password combo
+     * @deprecated Login with password credentials are no longer supported by GitHub
+     */
+    @Deprecated
+    public static AuthorizationProvider fromLoginAndPassword(String login, String password) {
+        try {
+            String authorization = (String.format("%s:%s", login, password));
+            String charsetName = StandardCharsets.UTF_8.name();
+            String b64encoded = Base64.getEncoder().encodeToString(authorization.getBytes(charsetName));
+            String encodedAuthorization = String.format("Basic %s", b64encoded);
+            return new UserProvider(encodedAuthorization, login);
+        } catch (UnsupportedEncodingException e) {
+            // If UTF-8 isn't supported, there are bigger problems
+            throw new IllegalStateException("Could not generate encoded authorization", e);
+        }
+    }
+
+    @Override
+    public String getEncodedAuthorization() {
+        return this.authorization;
+    }
+
+    /**
+     * An internal class representing all user-related credentials, which are credentials that have a login or should
+     * query the user endpoint for the login matching this credential.
+     */
+    private static class UserProvider extends ImmutableAuthorizationProvider implements UserAuthorizationProvider {
+
+        private final String login;
+
+        UserProvider(String authorization) {
+            this(authorization, null);
+        }
+
+        UserProvider(String authorization, String login) {
+            super(authorization);
+            this.login = login;
+        }
+
+        @CheckForNull
+        @Override
+        public String getLogin() {
+            return login;
+        }
+
+    }
+}

src/main/java/org/kohsuke/github/authorization/OrgAppInstallationAuthorizationProvider.java

@@ -0,0 +1,63 @@
+package org.kohsuke.github.authorization;
+
+import org.kohsuke.github.BetaApi;
+import org.kohsuke.github.GHAppInstallation;
+import org.kohsuke.github.GHAppInstallationToken;
+import org.kohsuke.github.GitHub;
+
+import java.io.IOException;
+import java.time.Duration;
+import java.time.Instant;
+import java.util.Objects;
+
+import javax.annotation.Nonnull;
+
+/**
+ * Provides an AuthorizationProvider that performs automatic token refresh.
+ */
+public class OrgAppInstallationAuthorizationProvider extends GitHub.DependentAuthorizationProvider {
+
+    private final String organizationName;
+
+    private String latestToken;
+
+    @Nonnull
+    private Instant validUntil = Instant.MIN;
+
+    /**
+     * Provides an AuthorizationProvider that performs automatic token refresh, based on an previously authenticated
+     * github client.
+     *
+     * @param organizationName
+     *            The name of the organization where the application is installed
+     * @param authorizationProvider
+     *            A authorization provider that returns a JWT token that can be used to refresh the App Installation
+     *            token from GitHub.
+     */
+    @BetaApi
+    @Deprecated
+    public OrgAppInstallationAuthorizationProvider(String organizationName,
+            AuthorizationProvider authorizationProvider) {
+        super(authorizationProvider);
+        this.organizationName = organizationName;
+    }
+
+    @Override
+    public String getEncodedAuthorization() throws IOException {
+        synchronized (this) {
+            if (latestToken == null || Instant.now().isAfter(this.validUntil)) {
+                refreshToken();
+            }
+            return String.format("token %s", latestToken);
+        }
+    }
+
+    private void refreshToken() throws IOException {
+        GitHub gitHub = this.gitHub();
+        GHAppInstallation installationByOrganization = gitHub.getApp()
+                .getInstallationByOrganization(this.organizationName);
+        GHAppInstallationToken ghAppInstallationToken = installationByOrganization.createToken().create();
+        this.validUntil = ghAppInstallationToken.getExpiresAt().toInstant().minus(Duration.ofMinutes(5));
+        this.latestToken = Objects.requireNonNull(ghAppInstallationToken.getToken());
+    }
+}

src/main/java/org/kohsuke/github/authorization/UserAuthorizationProvider.java

@@ -0,0 +1,22 @@
+package org.kohsuke.github.authorization;
+
+import javax.annotation.CheckForNull;
+
+/**
+ * Interface for all user-related authorization providers.
+ *
+ * {@link AuthorizationProvider}s can apply to a number of different account types. This interface applies to providers
+ * for user accounts, ones that have a login or should query the "/user" endpoint for the login matching this
+ * credential.
+ */
+public interface UserAuthorizationProvider extends AuthorizationProvider {
+
+    /**
+     * Gets the user login name.
+     *
+     * @return the user login for this provider, or {@code null} if the login value should be queried from the "/user"
+     *         endpoint.
+     */
+    @CheckForNull
+    String getLogin();
+}

src/main/java/org/kohsuke/github/extras/authorization/JWTTokenProvider.java

@@ -0,0 +1,130 @@
+package org.kohsuke.github.extras.authorization;
+
+import io.jsonwebtoken.JwtBuilder;
+import io.jsonwebtoken.Jwts;
+import io.jsonwebtoken.SignatureAlgorithm;
+import org.kohsuke.github.authorization.AuthorizationProvider;
+
+import java.io.File;
+import java.io.IOException;
+import java.nio.charset.StandardCharsets;
+import java.nio.file.Files;
+import java.nio.file.Path;
+import java.security.GeneralSecurityException;
+import java.security.KeyFactory;
+import java.security.PrivateKey;
+import java.security.spec.InvalidKeySpecException;
+import java.security.spec.PKCS8EncodedKeySpec;
+import java.time.Duration;
+import java.time.Instant;
+import java.util.Base64;
+import java.util.Date;
+
+import javax.annotation.Nonnull;
+
+/**
+ * A authorization provider that gives valid JWT tokens. These tokens are then used to create a time-based token to
+ * authenticate as an application. This token provider does not provide any kind of caching, and will always request a
+ * new token to the API.
+ */
+public class JWTTokenProvider implements AuthorizationProvider {
+
+    private final PrivateKey privateKey;
+
+    @Nonnull
+    private Instant validUntil = Instant.MIN;
+
+    private String token;
+
+    /**
+     * The identifier for the application
+     */
+    private final String applicationId;
+
+    public JWTTokenProvider(String applicationId, File keyFile) throws GeneralSecurityException, IOException {
+        this(applicationId, keyFile.toPath());
+    }
+
+    public JWTTokenProvider(String applicationId, Path keyPath) throws GeneralSecurityException, IOException {
+        this(applicationId, new String(Files.readAllBytes(keyPath), StandardCharsets.UTF_8));
+    }
+
+    public JWTTokenProvider(String applicationId, String keyString) throws GeneralSecurityException {
+        this(applicationId, getPrivateKeyFromString(keyString));
+    }
+
+    public JWTTokenProvider(String applicationId, PrivateKey privateKey) {
+        this.privateKey = privateKey;
+        this.applicationId = applicationId;
+    }
+
+    @Override
+    public String getEncodedAuthorization() throws IOException {
+        synchronized (this) {
+            if (Instant.now().isAfter(validUntil)) {
+                token = refreshJWT();
+            }
+            return String.format("Bearer %s", token);
+        }
+    }
+
+    /**
+     * Convert a PKCS#8 formatted private key in string format into a java PrivateKey
+     *
+     * @param key
+     *            PCKS#8 string
+     * @return private key
+     * @throws GeneralSecurityException
+     *             if we couldn't parse the string
+     */
+    private static PrivateKey getPrivateKeyFromString(final String key) throws GeneralSecurityException {
+        if (key.contains(" RSA ")) {
+            throw new InvalidKeySpecException(
+                    "Private key must be a PKCS#8 formatted string, to convert it from PKCS#1 use: "
+                            + "openssl pkcs8 -topk8 -inform PEM -outform PEM -in current-key.pem -out new-key.pem -nocrypt");
+        }
+
+        // Remove all comments and whitespace from PEM
+        // such as "-----BEGIN PRIVATE KEY-----" and newlines
+        String privateKeyContent = key.replaceAll("(?m)^--.*", "").replaceAll("\\s", "");
+
+        KeyFactory kf = KeyFactory.getInstance("RSA");
+
+        try {
+            byte[] decode = Base64.getDecoder().decode(privateKeyContent);
+            PKCS8EncodedKeySpec keySpecPKCS8 = new PKCS8EncodedKeySpec(decode);
+
+            return kf.generatePrivate(keySpecPKCS8);
+        } catch (IllegalArgumentException e) {
+            throw new InvalidKeySpecException("Failed to decode private key: " + e.getMessage(), e);
+        }
+    }
+
+    private String refreshJWT() {
+        Instant now = Instant.now();
+
+        // Max token expiration is 10 minutes for GitHub
+        // We use a smaller window since we likely will not need more than a few seconds
+        Instant expiration = now.plus(Duration.ofMinutes(8));
+
+        // Setting the issued at to a time in the past to allow for clock skew
+        Instant issuedAt = getIssuedAt(now);
+
+        // Let's set the JWT Claims
+        JwtBuilder builder = Jwts.builder()
+                .setIssuedAt(Date.from(issuedAt))
+                .setExpiration(Date.from(expiration))
+                .setIssuer(this.applicationId)
+                .signWith(privateKey, SignatureAlgorithm.RS256);
+
+        // Token will refresh 2 minutes before it expires
+        validUntil = expiration.minus(Duration.ofMinutes(2));
+
+        // Builds the JWT and serializes it to a compact, URL-safe string
+        return builder.compact();
+    }
+
+    Instant getIssuedAt(Instant now) {
+        return now.minus(Duration.ofMinutes(2));
+    }
+}

src/main/java/org/kohsuke/github/function/FunctionThrows.java

@@ -0,0 +1,25 @@
+package org.kohsuke.github.function;
+
+/**
+ * A functional interface, equivalent to {@link java.util.function.Function} but that allows throwing {@link Throwable}
+ *
+ * @param <T>
+ *            the type of input
+ * @param <R>
+ *            the type of output
+ * @param <E>
+ *            the type of error
+ */
+@FunctionalInterface
+public interface FunctionThrows<T, R, E extends Throwable> {
+    /**
+     * Apply r.
+     *
+     * @param input
+     *            the input
+     * @return the r
+     * @throws E
+     *             the e
+     */
+    R apply(T input) throws E;
+}

src/main/java/org/kohsuke/github/function/InputStreamFunction.java

@@ -0,0 +1,14 @@
+package org.kohsuke.github.function;
+
+import java.io.IOException;
+import java.io.InputStream;
+
+/**
+ * A functional interface, equivalent to {@link java.util.function.Function} but that allows throwing {@link Throwable}
+ *
+ * @param <R>
+ *            the type to of object to be returned
+ */
+@FunctionalInterface
+public interface InputStreamFunction<R> extends FunctionThrows<InputStream, R, IOException> {
+}

src/main/java/org/kohsuke/github/internal/EnumUtils.java

@@ -0,0 +1,62 @@
+package org.kohsuke.github.internal;
+
+import java.util.Locale;
+import java.util.logging.Logger;
+
+/**
+ * Utils for Enums.
+ */
+public final class EnumUtils {
+
+    private static final Logger LOGGER = Logger.getLogger(EnumUtils.class.getName());
+
+    /**
+     * Returns an enum value matching the value if found, null if the value is null and {@code defaultEnum} if the value
+     * cannot be matched to a value of the enum.
+     * <p>
+     * The value is converted to uppercase before being matched to the enum values.
+     *
+     * @param <E>
+     *            the type of the enum
+     * @param enumClass
+     *            the type of the enum
+     * @param value
+     *            the value to interpret
+     * @param defaultEnum
+     *            the default enum value if the value doesn't match one of the enum value
+     * @return an enum value or null
+     */
+    public static <E extends Enum<E>> E getNullableEnumOrDefault(Class<E> enumClass, String value, E defaultEnum) {
+        if (value == null) {
+            return null;
+        }
+        return getEnumOrDefault(enumClass, value, defaultEnum);
+    }
+
+    /**
+     * Returns an enum value matching the value if found, {@code defaultEnum} if the value is null or cannot be matched
+     * to a value of the enum.
+     *
+     * @param <E>
+     *            the type of the enum
+     * @param enumClass
+     *            the type of the enum
+     * @param value
+     *            the value to interpret
+     * @param defaultEnum
+     *            the default enum value if the value doesn't match one of the enum value
+     * @return an enum value
+     */
+    public static <E extends Enum<E>> E getEnumOrDefault(Class<E> enumClass, String value, E defaultEnum) {
+        try {
+            return Enum.valueOf(enumClass, value.toUpperCase(Locale.ROOT));
+        } catch (NullPointerException | IllegalArgumentException e) {
+            LOGGER.warning("Unknown value " + value + " for enum class " + enumClass.getName() + ", defaulting to "
+                    + defaultEnum.name());
+            return defaultEnum;
+        }
+    }
+
+    private EnumUtils() {
+    }
+}

src/main/java/org/kohsuke/github/internal/Previews.java

@@ -1,4 +1,4 @@
-package org.kohsuke.github;
+package org.kohsuke.github.internal;
 
 /**
  * Provides the media type strings for GitHub API previews
@@ -7,7 +7,7 @@ package org.kohsuke.github;
  *
  * @author Kohsuke Kawaguchi
  */
-enum Previews {
+public enum Previews {
 
     /**
      * Check-runs and check-suites

src/test/java/org/kohsuke/github/AbstractGHAppInstallationTest.java

@@ -2,8 +2,14 @@ package org.kohsuke.github;
 
 import io.jsonwebtoken.Jwts;
 import org.apache.commons.io.IOUtils;
+import org.kohsuke.github.authorization.AuthorizationProvider;
+import org.kohsuke.github.extras.authorization.JWTTokenProvider;
 
+import java.io.File;
 import java.io.IOException;
+import java.nio.charset.StandardCharsets;
+import java.nio.file.Files;
+import java.security.GeneralSecurityException;
 import java.security.KeyFactory;
 import java.security.PrivateKey;
 import java.security.spec.PKCS8EncodedKeySpec;
@@ -21,6 +27,26 @@ public class AbstractGHAppInstallationTest extends AbstractGitHubWireMockTest {
     private static String PRIVATE_KEY_FILE_APP_2 = "/ghapi-test-app-2.private-key.pem";
     private static String PRIVATE_KEY_FILE_APP_3 = "/ghapi-test-app-3.private-key.pem";
 
+    private static AuthorizationProvider JWT_PROVIDER_1;
+    private static AuthorizationProvider JWT_PROVIDER_2;
+    private static AuthorizationProvider JWT_PROVIDER_3;
+
+    AbstractGHAppInstallationTest() {
+        try {
+            JWT_PROVIDER_1 = new JWTTokenProvider(TEST_APP_ID_1,
+                    new File(this.getClass().getResource(PRIVATE_KEY_FILE_APP_1).getFile()));
+            JWT_PROVIDER_2 = new JWTTokenProvider(TEST_APP_ID_2,
+                    new File(this.getClass().getResource(PRIVATE_KEY_FILE_APP_2).getFile()).toPath());
+            JWT_PROVIDER_3 = new JWTTokenProvider(TEST_APP_ID_3,
+                    new String(
+                            Files.readAllBytes(
+                                    new File(this.getClass().getResource(PRIVATE_KEY_FILE_APP_3).getFile()).toPath()),
+                            StandardCharsets.UTF_8));
+        } catch (GeneralSecurityException | IOException e) {
+            throw new RuntimeException("These should never fail", e);
+        }
+    }
+
     private String createJwtToken(String keyFileResouceName, String appId) {
         try {
             String keyPEM = IOUtils.toString(this.getClass().getResource(keyFileResouceName), "US-ASCII")
@@ -54,24 +80,25 @@ public class AbstractGHAppInstallationTest extends AbstractGitHubWireMockTest {
                 .findFirst()
                 .get();
 
-        appInstallation
-                .setRoot(getGitHubBuilder().withAppInstallationToken(appInstallation.createToken().create().getToken())
-                        .withEndpoint(mockGitHub.apiServer().baseUrl())
-                        .build());
+        // TODO: this is odd
+        // appInstallation
+        // .setRoot(getGitHubBuilder().withAppInstallationToken(appInstallation.createToken().create().getToken())
+        // .withEndpoint(mockGitHub.apiServer().baseUrl())
+        // .build());
 
         return appInstallation;
     }
 
     protected GHAppInstallation getAppInstallationWithTokenApp1() throws IOException {
-        return getAppInstallationWithToken(createJwtToken(PRIVATE_KEY_FILE_APP_1, TEST_APP_ID_1));
+        return getAppInstallationWithToken(JWT_PROVIDER_1.getEncodedAuthorization());
     }
 
     protected GHAppInstallation getAppInstallationWithTokenApp2() throws IOException {
-        return getAppInstallationWithToken(createJwtToken(PRIVATE_KEY_FILE_APP_2, TEST_APP_ID_2));
+        return getAppInstallationWithToken(JWT_PROVIDER_2.getEncodedAuthorization());
     }
 
     protected GHAppInstallation getAppInstallationWithTokenApp3() throws IOException {
-        return getAppInstallationWithToken(createJwtToken(PRIVATE_KEY_FILE_APP_3, TEST_APP_ID_3));
+        return getAppInstallationWithToken(JWT_PROVIDER_3.getEncodedAuthorization());
     }
 
 }

src/test/java/org/kohsuke/github/AbstractGitHubWireMockTest.java

@@ -4,10 +4,9 @@ import com.github.tomakehurst.wiremock.core.WireMockConfiguration;
 import com.github.tomakehurst.wiremock.extension.responsetemplating.ResponseTemplateTransformer;
 import com.github.tomakehurst.wiremock.extension.responsetemplating.helpers.HandlebarsCurrentDateHelper;
 import org.apache.commons.io.IOUtils;
-import org.hamcrest.Description;
 import org.hamcrest.Matcher;
+import org.hamcrest.MatcherAssert;
 import org.hamcrest.Matchers;
-import org.hamcrest.StringDescription;
 import org.junit.After;
 import org.junit.Assert;
 import org.junit.Before;
@@ -21,13 +20,14 @@ import java.io.FileInputStream;
 import java.io.IOException;
 import java.util.*;
 
+import static org.hamcrest.Matchers.*;
 import static org.junit.Assume.assumeFalse;
 import static org.junit.Assume.assumeTrue;
 
 /**
  * @author Liam Newman
  */
-public abstract class AbstractGitHubWireMockTest extends Assert {
+public abstract class AbstractGitHubWireMockTest {
 
     private final GitHubBuilder githubBuilder = createGitHubBuilder();
 
@@ -45,7 +45,7 @@ public abstract class AbstractGitHubWireMockTest extends Assert {
      */
     protected GitHub gitHub;
 
-    private GitHub gitHubBeforeAfter;
+    private GitHub nonRecordingGitHub;
 
     protected final String baseFilesClassPath = this.getClass().getName().replace('.', '/');
     protected final String baseRecordPath = "src/test/resources/" + baseFilesClassPath + "/wiremock";
@@ -100,7 +100,6 @@ public abstract class AbstractGitHubWireMockTest extends Assert {
             // This sets the user and password to a placeholder for wiremock testing
             // This makes the tests believe they are running with permissions
             // The recorded stubs will behave like they running with permissions
-            builder.oauthToken = null;
             builder.withPassword(STUBBED_USER_LOGIN, STUBBED_USER_PASSWORD);
         }
 
@@ -116,9 +115,9 @@ public abstract class AbstractGitHubWireMockTest extends Assert {
         }
 
         if (mockGitHub.isUseProxy()) {
-            gitHubBeforeAfter = getGitHubBuilder().withEndpoint("https://api.github.com/").build();
+            nonRecordingGitHub = getGitHubBuilder().withEndpoint("https://api.github.com/").build();
         } else {
-            gitHubBeforeAfter = null;
+            nonRecordingGitHub = null;
         }
     }
 
@@ -211,7 +210,7 @@ public abstract class AbstractGitHubWireMockTest extends Assert {
         if (mockGitHub.isUseProxy()) {
             tempGitHubRepositories.add(fullName);
             try {
-                GHRepository repository = getGitHubBeforeAfter().getRepository(fullName);
+                GHRepository repository = getNonRecordingGitHub().getRepository(fullName);
                 if (repository != null) {
                     repository.delete();
                 }
@@ -228,22 +227,22 @@ public abstract class AbstractGitHubWireMockTest extends Assert {
      *
      * @return a github instance after checking Authentication
      */
-    public GitHub getGitHubBeforeAfter() {
-        verifyAuthenticated(gitHubBeforeAfter);
-        return gitHubBeforeAfter;
+    public GitHub getNonRecordingGitHub() {
+        verifyAuthenticated(nonRecordingGitHub);
+        return nonRecordingGitHub;
     }
 
     protected void kohsuke() {
         // No-op for now
         // Generally this means the test is doing something that requires additional access rights
         // Not always clear which ones.
-        // TODO: Add helpers that assert the expected rights using gitHubBeforeAfter and only when proxy is enabled
+        // TODO: Add helpers that assert the expected rights using nonRecordingGitHub and only when proxy is enabled
         // String login = getUserTest().getLogin();
         // assumeTrue(login.equals("kohsuke") || login.equals("kohsuke2"));
     }
 
     private GHCreateRepositoryBuilder getCreateBuilder(String name) throws IOException {
-        GitHub github = getGitHubBeforeAfter();
+        GitHub github = getNonRecordingGitHub();
 
         if (mockGitHub.isTestWithOrg()) {
             return github.getOrganization(GITHUB_API_TEST_ORG).createRepository(name);
@@ -256,52 +255,23 @@ public abstract class AbstractGitHubWireMockTest extends Assert {
         return mockGitHub.isTestWithOrg() ? GITHUB_API_TEST_ORG : gitHub.getMyself().getLogin();
     }
 
+    public static void fail() {
+        Assert.fail();
+    }
+    public static void fail(String reason) {
+        Assert.fail(reason);
+    }
+
     public static <T> void assertThat(T actual, Matcher<? super T> matcher) {
-        assertThat("", actual, matcher);
+        MatcherAssert.assertThat("", actual, matcher);
     }
 
     public static <T> void assertThat(String reason, T actual, Matcher<? super T> matcher) {
-        if (!matcher.matches(actual)) {
-            Description description = new StringDescription();
-            description.appendText(reason)
-                    .appendText(System.lineSeparator())
-                    .appendText("Expected: ")
-                    .appendDescriptionOf(matcher)
-                    .appendText(System.lineSeparator())
-                    .appendText("     but: ");
-            matcher.describeMismatch(actual, description);
-            throw new AssertionError(description.toString());
-        }
+        MatcherAssert.assertThat(reason, actual, matcher);
     }
 
     public static void assertThat(String reason, boolean assertion) {
-        if (!assertion) {
-            throw new AssertionError(reason);
-        }
-    }
-
-    public static void assertEquals(Object expected, Object actual) {
-        assertThat(actual, Matchers.equalTo(expected));
-    }
-
-    public static void assertNotEquals(Object expected, Object actual) {
-        assertThat(actual, Matchers.not(expected));
-    }
-
-    public static void assertNotNull(Object actual) {
-        assertThat(actual, Matchers.notNullValue());
-    }
-
-    public static void assertNull(Object actual) {
-        assertThat(actual, Matchers.nullValue());
-    }
-
-    public static void assertTrue(Boolean condition) {
-        assertThat(condition, Matchers.is(true));
-    }
-
-    public static void assertFalse(Boolean condition) {
-        assertThat(condition, Matchers.is(false));
+        MatcherAssert.assertThat(reason, assertion);
     }
 
     protected static class TemplatingHelper {

src/test/java/org/kohsuke/github/AppTest.java

@@ -17,12 +17,8 @@ import java.net.URL;
 import java.nio.charset.StandardCharsets;
 import java.util.*;
 import java.util.Map.Entry;
-import java.util.regex.Pattern;
 
-import static org.hamcrest.CoreMatchers.*;
-import static org.hamcrest.CoreMatchers.sameInstance;
-import static org.hamcrest.Matchers.hasProperty;
-import static org.hamcrest.Matchers.oneOf;
+import static org.hamcrest.Matchers.*;
 
 /**
  * Unit test for simple App.
@@ -37,10 +33,11 @@ public class AppTest extends AbstractGitHubWireMockTest {
         cleanupUserRepository("github-api-test-rename");
         cleanupUserRepository(targetName);
 
-        GHRepository r = gitHub.createRepository("github-api-test-rename",
-                "a test repository",
-                "http://github-api.kohsuke.org/",
-                true);
+        GHRepository r = gitHub.createRepository("github-api-test-rename")
+                .description("a test repository")
+                .homepage("http://github-api.kohsuke.org/")
+                .private_(false)
+                .create();
 
         assertThat(r.hasIssues(), is(true));
         assertThat(r.hasWiki(), is(true));
@@ -86,20 +83,20 @@ public class AppTest extends AbstractGitHubWireMockTest {
         if (mockGitHub.isUseProxy()) {
             Thread.sleep(3000);
         }
-        assertNotNull(r.getReadme());
+        assertThat(r.getReadme(), notNullValue());
 
         r.delete();
     }
 
     private void cleanupUserRepository(final String name) throws IOException {
         if (mockGitHub.isUseProxy()) {
-            cleanupRepository(getUser(getGitHubBeforeAfter()).getLogin() + "/" + name);
+            cleanupRepository(getUser(getNonRecordingGitHub()).getLogin() + "/" + name);
         }
     }
 
     @Test
     public void testCredentialValid() throws IOException {
-        assertTrue(gitHub.isCredentialValid());
+        assertThat(gitHub.isCredentialValid(), is(true));
         assertThat(gitHub.lastRateLimit().getCore(), not(instanceOf(GHRateLimit.UnknownLimitRecord.class)));
         assertThat(gitHub.lastRateLimit().getCore().getLimit(), equalTo(5000));
 
@@ -107,7 +104,7 @@ public class AppTest extends AbstractGitHubWireMockTest {
                 .withEndpoint(mockGitHub.apiServer().baseUrl())
                 .build();
         assertThat(gitHub.lastRateLimit(), sameInstance(GHRateLimit.DEFAULT));
-        assertFalse(gitHub.isCredentialValid());
+        assertThat(gitHub.isCredentialValid(), is(false));
         // For invalid credentials, we get a 401 but it includes anonymous rate limit headers
         assertThat(gitHub.lastRateLimit().getCore(), not(instanceOf(GHRateLimit.UnknownLimitRecord.class)));
         assertThat(gitHub.lastRateLimit().getCore().getLimit(), equalTo(60));
@@ -118,7 +115,7 @@ public class AppTest extends AbstractGitHubWireMockTest {
         // Simulated GHE: getRateLimit returns 404
         assertThat(gitHub.lastRateLimit(), sameInstance(GHRateLimit.DEFAULT));
         assertThat(gitHub.lastRateLimit().getCore().isExpired(), is(true));
-        assertTrue(gitHub.isCredentialValid());
+        assertThat(gitHub.isCredentialValid(), is(true));
 
         // lastRateLimitUpdates because 404 still includes header rate limit info
         assertThat(gitHub.lastRateLimit(), notNullValue());
@@ -129,7 +126,7 @@ public class AppTest extends AbstractGitHubWireMockTest {
                 .withEndpoint(mockGitHub.apiServer().baseUrl())
                 .build();
         assertThat(gitHub.lastRateLimit(), sameInstance(GHRateLimit.DEFAULT));
-        assertFalse(gitHub.isCredentialValid());
+        assertThat(gitHub.isCredentialValid(), is(false));
         // Simulated GHE: For invalid credentials, we get a 401 that does not include ratelimit info
         assertThat(gitHub.lastRateLimit(), sameInstance(GHRateLimit.DEFAULT));
     }
@@ -137,13 +134,36 @@ public class AppTest extends AbstractGitHubWireMockTest {
     @Test
     public void testIssueWithNoComment() throws IOException {
         GHRepository repository = gitHub.getRepository("kohsuke/test");
-        List<GHIssueComment> v = repository.getIssue(4).getComments();
+        GHIssue i = repository.getIssue(4);
+        List<GHIssueComment> v = i.getComments();
         // System.out.println(v);
-        assertTrue(v.isEmpty());
+        assertThat(v, is(empty()));
 
-        v = repository.getIssue(3).getComments();
+        i = repository.getIssue(3);
+        v = i.getComments();
         // System.out.println(v);
-        assertTrue(v.size() == 3);
+        assertThat(v.size(), equalTo(3));
+        assertThat(v.get(0).getHtmlUrl().toString(),
+                equalTo("https://github.com/kohsuke/test/issues/3#issuecomment-8547249"));
+        assertThat(v.get(0).getUrl().toString(), endsWith("/repos/kohsuke/test/issues/comments/8547249"));
+        assertThat(v.get(0).getNodeId(), equalTo("MDEyOklzc3VlQ29tbWVudDg1NDcyNDk="));
+        assertThat(v.get(0).getParent().getNumber(), equalTo(3));
+        assertThat(v.get(0).getParent().getId(), equalTo(6863845L));
+        assertThat(v.get(0).getUser().getLogin(), equalTo("kohsuke"));
+        assertThat(v.get(0).listReactions().toList(), is(empty()));
+
+        assertThat(v.get(1).getHtmlUrl().toString(),
+                equalTo("https://github.com/kohsuke/test/issues/3#issuecomment-8547251"));
+        assertThat(v.get(1).getUrl().toString(), endsWith("/repos/kohsuke/test/issues/comments/8547251"));
+        assertThat(v.get(1).getNodeId(), equalTo("MDEyOklzc3VlQ29tbWVudDg1NDcyNTE="));
+        assertThat(v.get(1).getParent().getNumber(), equalTo(3));
+        assertThat(v.get(1).getUser().getLogin(), equalTo("kohsuke"));
+        List<GHReaction> reactions = v.get(1).listReactions().toList();
+        assertThat(reactions.size(), equalTo(3));
+
+        // TODO: Add comment CRUD test
+        // TODO: Add reactions CRUD test
+
     }
 
     @Test
@@ -158,56 +178,67 @@ public class AppTest extends AbstractGitHubWireMockTest {
                 .label("question")
                 .milestone(milestone)
                 .create();
-        assertNotNull(o);
+        assertThat(o, notNullValue());
         o.close();
     }
 
     @Test
     public void testCreateAndListDeployments() throws IOException {
         GHRepository repository = getTestRepository();
-        GHDeployment deployment = repository.createDeployment("master")
+        GHDeployment deployment = repository.createDeployment("main")
                 .payload("{\"user\":\"atmos\",\"room_id\":123456}")
                 .description("question")
                 .environment("unittest")
                 .create();
-        assertNotNull(deployment.getCreator());
-        assertNotNull(deployment.getId());
-        List<GHDeployment> deployments = repository.listDeployments(null, "master", null, "unittest").toList();
-        assertNotNull(deployments);
-        assertFalse(Iterables.isEmpty(deployments));
-        GHDeployment unitTestDeployment = deployments.get(0);
-        assertEquals("unittest", unitTestDeployment.getEnvironment());
-        assertEquals("unittest", unitTestDeployment.getOriginalEnvironment());
-        assertEquals(false, unitTestDeployment.isProductionEnvironment());
-        assertEquals(true, unitTestDeployment.isTransientEnvironment());
-        assertEquals("master", unitTestDeployment.getRef());
+        try {
+            assertThat(deployment.getCreator(), notNullValue());
+            assertThat(deployment.getId(), notNullValue());
+            List<GHDeployment> deployments = repository.listDeployments(null, "main", null, "unittest").toList();
+            assertThat(deployments, notNullValue());
+            assertThat(deployments, is(not(emptyIterable())));
+            GHDeployment unitTestDeployment = deployments.get(0);
+            assertThat(unitTestDeployment.getEnvironment(), equalTo("unittest"));
+            assertThat(unitTestDeployment.getOriginalEnvironment(), equalTo("unittest"));
+            assertThat(unitTestDeployment.isProductionEnvironment(), equalTo(false));
+            assertThat(unitTestDeployment.isTransientEnvironment(), equalTo(false));
+            assertThat(unitTestDeployment.getRef(), equalTo("main"));
+        } finally {
+            // deployment.delete();
+            assert true;
+        }
     }
 
-    @Ignore("Needs mocking check")
     @Test
     public void testGetDeploymentStatuses() throws IOException {
         GHRepository repository = getTestRepository();
-        GHDeployment deployment = repository.createDeployment("master")
+        GHDeployment deployment = repository.createDeployment("main")
                 .description("question")
                 .payload("{\"user\":\"atmos\",\"room_id\":123456}")
                 .create();
-        GHDeploymentStatus ghDeploymentStatus = deployment.createStatus(GHDeploymentState.QUEUED)
-                .description("success")
-                .targetUrl("http://www.github.com")
-                .logUrl("http://www.github.com/logurl")
-                .environmentUrl("http://www.github.com/envurl")
-                .environment("new-ci-env")
-                .create();
-        Iterable<GHDeploymentStatus> deploymentStatuses = deployment.listStatuses();
-        assertNotNull(deploymentStatuses);
-        assertEquals(1, Iterables.size(deploymentStatuses));
-        GHDeploymentStatus actualStatus = Iterables.get(deploymentStatuses, 0);
-        assertEquals(ghDeploymentStatus.getId(), actualStatus.getId());
-        assertEquals(ghDeploymentStatus.getState(), actualStatus.getState());
-        assertEquals(ghDeploymentStatus.getLogUrl(), actualStatus.getLogUrl());
-        // Target url was deprecated and replaced with log url. The gh api will
-        // prefer the log url value and return it in place of target url.
-        assertEquals(ghDeploymentStatus.getTargetUrl(), actualStatus.getLogUrl());
+        try {
+            GHDeploymentStatus ghDeploymentStatus = deployment.createStatus(GHDeploymentState.QUEUED)
+                    .description("success")
+                    .targetUrl("http://www.github.com")
+                    .logUrl("http://www.github.com/logurl")
+                    .environmentUrl("http://www.github.com/envurl")
+                    .environment("new-ci-env")
+                    .create();
+            Iterable<GHDeploymentStatus> deploymentStatuses = deployment.listStatuses();
+            assertThat(deploymentStatuses, notNullValue());
+            assertThat(Iterables.size(deploymentStatuses), equalTo(1));
+            GHDeploymentStatus actualStatus = Iterables.get(deploymentStatuses, 0);
+            assertThat(actualStatus.getId(), equalTo(ghDeploymentStatus.getId()));
+            assertThat(actualStatus.getState(), equalTo(ghDeploymentStatus.getState()));
+            assertThat(actualStatus.getLogUrl(), equalTo(ghDeploymentStatus.getLogUrl()));
+            // Target url was deprecated and replaced with log url. The gh api will
+            // prefer the log url value and return it in place of target url.
+            assertThat(actualStatus.getLogUrl(), equalTo(ghDeploymentStatus.getTargetUrl()));
+            assertThat(ghDeploymentStatus.getDeploymentUrl(), equalTo(deployment.getUrl()));
+            assertThat(ghDeploymentStatus.getRepositoryUrl(), equalTo(repository.getUrl()));
+        } finally {
+            // deployment.delete();
+            assert true;
+        }
     }
 
     @Test
@@ -216,7 +247,7 @@ public class AppTest extends AbstractGitHubWireMockTest {
                 .getRepository("github-api")
                 .getIssues(GHIssueState.CLOSED);
         // prior to using PagedIterable GHRepository.getIssues(GHIssueState) would only retrieve 30 issues
-        assertTrue(closedIssues.size() > 150);
+        assertThat(closedIssues.size(), greaterThan(150));
         String readRepoString = GitHub.getMappingObjectWriter().writeValueAsString(closedIssues.get(0));
     }
 
@@ -232,11 +263,11 @@ public class AppTest extends AbstractGitHubWireMockTest {
 
         int x = 0;
         for (GHIssue issue : closedIssues) {
-            assertNotNull(issue);
+            assertThat(issue, notNullValue());
             x++;
         }
 
-        assertTrue(x > 150);
+        assertThat(x, greaterThan(150));
     }
 
     @Test
@@ -247,7 +278,7 @@ public class AppTest extends AbstractGitHubWireMockTest {
     @Test
     public void testMyOrganizations() throws IOException {
         Map<String, GHOrganization> org = gitHub.getMyOrganizations();
-        assertFalse(org.keySet().contains(null));
+        assertThat(org.containsKey(null), is(false));
         // System.out.println(org);
     }
 
@@ -257,7 +288,7 @@ public class AppTest extends AbstractGitHubWireMockTest {
         Map<String, GHOrganization> myOrganizations = gitHub.getMyOrganizations();
         // GitHub no longer has default 'owners' team, so there may be organization memberships without a team
         // https://help.github.com/articles/about-improved-organization-permissions/
-        assertTrue(myOrganizations.keySet().containsAll(teams.keySet()));
+        assertThat(myOrganizations.keySet().containsAll(teams.keySet()), is(true));
     }
 
     @Test
@@ -267,7 +298,7 @@ public class AppTest extends AbstractGitHubWireMockTest {
             String organizationName = teamsPerOrg.getKey();
             for (GHTeam team : teamsPerOrg.getValue()) {
                 String teamName = team.getName();
-                assertTrue("Team " + teamName + " in organization " + organizationName + " does not contain myself",
+                assertThat("Team " + teamName + " in organization " + organizationName + " does not contain myself",
                         shouldBelongToTeam(organizationName, teamName));
             }
         }
@@ -280,7 +311,7 @@ public class AppTest extends AbstractGitHubWireMockTest {
         user.login = "kohsuke";
 
         Map<String, GHOrganization> orgs = gitHub.getUserPublicOrganizations(user);
-        assertFalse(orgs.isEmpty());
+        assertThat(orgs.size(), greaterThan(0));
     }
 
     @Test
@@ -290,14 +321,14 @@ public class AppTest extends AbstractGitHubWireMockTest {
         user.login = "bitwiseman";
 
         Map<String, GHOrganization> orgs = gitHub.getUserPublicOrganizations(user);
-        assertTrue(orgs.isEmpty());
+        assertThat(orgs.size(), equalTo(0));
     }
 
     private boolean shouldBelongToTeam(String organizationName, String teamName) throws IOException {
         GHOrganization org = gitHub.getOrganization(organizationName);
-        assertNotNull(org);
+        assertThat(org, notNullValue());
         GHTeam team = org.getTeamByName(teamName);
-        assertNotNull(team);
+        assertThat(team, notNullValue());
         return team.hasMember(gitHub.getMyself());
     }
 
@@ -307,10 +338,10 @@ public class AppTest extends AbstractGitHubWireMockTest {
         GHTeam teamByName = organization.getTeams().get("Core Developers");
 
         GHTeam teamById = gitHub.getTeam((int) teamByName.getId());
-        assertNotNull(teamById);
+        assertThat(teamById, notNullValue());
 
-        assertEquals(teamByName.getId(), teamById.getId());
-        assertEquals(teamByName.getDescription(), teamById.getDescription());
+        assertThat(teamById.getId(), equalTo(teamByName.getId()));
+        assertThat(teamById.getDescription(), equalTo(teamByName.getDescription()));
     }
 
     @Test
@@ -319,16 +350,16 @@ public class AppTest extends AbstractGitHubWireMockTest {
         GHTeam teamByName = organization.getTeams().get("Core Developers");
 
         GHTeam teamById = organization.getTeam(teamByName.getId());
-        assertNotNull(teamById);
+        assertThat(teamById, notNullValue());
 
-        assertEquals(teamByName.getId(), teamById.getId());
-        assertEquals(teamByName.getDescription(), teamById.getDescription());
+        assertThat(teamById.getId(), equalTo(teamByName.getId()));
+        assertThat(teamById.getDescription(), equalTo(teamByName.getDescription()));
 
-        GHTeam teamById2 = organization.getTeam((int) teamByName.getId());
-        assertNotNull(teamById2);
+        GHTeam teamById2 = organization.getTeam(teamByName.getId());
+        assertThat(teamById2, notNullValue());
 
-        assertEquals(teamByName.getId(), teamById2.getId());
-        assertEquals(teamByName.getDescription(), teamById2.getDescription());
+        assertThat(teamById2.getId(), equalTo(teamByName.getId()));
+        assertThat(teamById2.getDescription(), equalTo(teamByName.getDescription()));
 
     }
 
@@ -336,7 +367,8 @@ public class AppTest extends AbstractGitHubWireMockTest {
     @Test
     public void testFetchPullRequest() throws Exception {
         GHRepository r = gitHub.getOrganization("jenkinsci").getRepository("jenkins");
-        assertEquals("master", r.getMasterBranch());
+        assertThat(r.getMasterBranch(), equalTo("main"));
+        assertThat(r.getDefaultBranch(), equalTo("main"));
         r.getPullRequest(1);
         r.getPullRequests(GHIssueState.OPEN);
     }
@@ -345,11 +377,11 @@ public class AppTest extends AbstractGitHubWireMockTest {
     @Test
     public void testFetchPullRequestAsList() throws Exception {
         GHRepository r = gitHub.getRepository("hub4j/github-api");
-        assertEquals("master", r.getMasterBranch());
+        assertThat(r.getMasterBranch(), equalTo("main"));
         PagedIterable<GHPullRequest> i = r.listPullRequests(GHIssueState.CLOSED);
         List<GHPullRequest> prs = i.toList();
-        assertNotNull(prs);
-        assertTrue(prs.size() > 0);
+        assertThat(prs, notNullValue());
+        assertThat(prs, is(not(empty())));
     }
 
     @Ignore("Needs mocking check")
@@ -358,26 +390,26 @@ public class AppTest extends AbstractGitHubWireMockTest {
         kohsuke();
 
         GHRepository r = gitHub.getOrganization(GITHUB_API_TEST_ORG).getRepository("github-api");
-        assertTrue(r.hasPullAccess());
+        assertThat(r.hasPullAccess(), is(true));
 
         r = gitHub.getOrganization("github").getRepository("hub");
-        assertFalse(r.hasAdminAccess());
+        assertThat(r.hasAdminAccess(), is(false));
     }
 
     @Test
     public void testGetMyself() throws Exception {
         GHMyself me = gitHub.getMyself();
-        assertNotNull(me);
-        assertNotNull(gitHub.getUser("bitwiseman"));
+        assertThat(me, notNullValue());
+        assertThat(gitHub.getUser("bitwiseman"), notNullValue());
         PagedIterable<GHRepository> ghRepositories = me.listRepositories();
-        assertTrue(ghRepositories.iterator().hasNext());
+        assertThat(ghRepositories, is(not(emptyIterable())));
     }
 
     @Ignore("Needs mocking check")
     @Test
     public void testPublicKeys() throws Exception {
         List<GHKey> keys = gitHub.getMyself().getPublicKeys();
-        assertFalse(keys.isEmpty());
+        assertThat(keys, is(not(empty())));
     }
 
     @Test
@@ -390,8 +422,8 @@ public class AppTest extends AbstractGitHubWireMockTest {
     public void testGetTeamsForRepo() throws Exception {
         kohsuke();
         // 'Core Developers' and 'Owners'
-        assertEquals(2,
-                gitHub.getOrganization(GITHUB_API_TEST_ORG).getRepository("testGetTeamsForRepo").getTeams().size());
+        assertThat(gitHub.getOrganization(GITHUB_API_TEST_ORG).getRepository("testGetTeamsForRepo").getTeams().size(),
+                equalTo(2));
     }
 
     @Test
@@ -413,24 +445,24 @@ public class AppTest extends AbstractGitHubWireMockTest {
         kohsuke();
         int sz = 0;
         for (GHTeam t : gitHub.getOrganization(GITHUB_API_TEST_ORG).listTeams()) {
-            assertNotNull(t.getName());
+            assertThat(t.getName(), notNullValue());
             sz++;
         }
-        assertTrue(sz < 100);
+        assertThat(sz, lessThan(100));
     }
 
     @Test
     public void testOrgTeamByName() throws Exception {
         kohsuke();
         GHTeam e = gitHub.getOrganization(GITHUB_API_TEST_ORG).getTeamByName("Core Developers");
-        assertNotNull(e);
+        assertThat(e, notNullValue());
     }
 
     @Test
     public void testOrgTeamBySlug() throws Exception {
         kohsuke();
         GHTeam e = gitHub.getOrganization(GITHUB_API_TEST_ORG).getTeamBySlug("core-developers");
-        assertNotNull(e);
+        assertThat(e, notNullValue());
     }
 
     @Test
@@ -438,20 +470,30 @@ public class AppTest extends AbstractGitHubWireMockTest {
         GHCommit commit = gitHub.getUser("jenkinsci")
                 .getRepository("jenkins")
                 .getCommit("08c1c9970af4d609ae754fbe803e06186e3206f7");
-        assertEquals(1, commit.getParents().size());
-        assertEquals(1, commit.getFiles().size());
-        assertEquals("https://github.com/jenkinsci/jenkins/commit/08c1c9970af4d609ae754fbe803e06186e3206f7",
-                commit.getHtmlUrl().toString());
+        assertThat(commit.getParents().size(), equalTo(1));
+        assertThat(commit.getFiles().size(), equalTo(1));
+        assertThat(commit.getHtmlUrl().toString(),
+                equalTo("https://github.com/jenkinsci/jenkins/commit/08c1c9970af4d609ae754fbe803e06186e3206f7"));
 
         File f = commit.getFiles().get(0);
-        assertEquals(48, f.getLinesChanged());
-        assertEquals("modified", f.getStatus());
-        assertEquals("changelog.html", f.getFileName());
+        assertThat(f.getLinesChanged(), equalTo(48));
+        assertThat(f.getLinesAdded(), equalTo(40));
+        assertThat(f.getLinesDeleted(), equalTo(8));
+        assertThat(f.getPreviousFilename(), nullValue());
+        assertThat(f.getPatch(), startsWith("@@ -54,6 +54,14 @@\n"));
+        assertThat(f.getSha(), equalTo("04d3e54017542ad0ff46355eababacd4850ccba5"));
+        assertThat(f.getBlobUrl().toString(),
+                equalTo("https://github.com/jenkinsci/jenkins/blob/08c1c9970af4d609ae754fbe803e06186e3206f7/changelog.html"));
+        assertThat(f.getRawUrl().toString(),
+                equalTo("https://github.com/jenkinsci/jenkins/raw/08c1c9970af4d609ae754fbe803e06186e3206f7/changelog.html"));
+
+        assertThat(f.getStatus(), equalTo("modified"));
+        assertThat(f.getFileName(), equalTo("changelog.html"));
 
         // walk the tree
         GHTree t = commit.getTree();
         assertThat(IOUtils.toString(t.getEntry("todo.txt").readAsBlob()), containsString("executor rendering"));
-        assertNotNull(t.getEntry("war").asTree());
+        assertThat(t.getEntry("war").asTree(), notNullValue());
     }
 
     @Test
@@ -460,24 +502,8 @@ public class AppTest extends AbstractGitHubWireMockTest {
         for (GHCommit c : gitHub.getUser("kohsuke").getRepository("empty-commit").listCommits()) {
             sha1.add(c.getSHA1());
         }
-        assertEquals("fdfad6be4db6f96faea1f153fb447b479a7a9cb7", sha1.get(0));
-        assertEquals(1, sha1.size());
-    }
-
-    public void testQueryCommits() throws Exception {
-        List<String> sha1 = new ArrayList<String>();
-        for (GHCommit c : gitHub.getUser("jenkinsci")
-                .getRepository("jenkins")
-                .queryCommits()
-                .since(new Date(1199174400000L))
-                .until(1201852800000L)
-                .path("pom.xml")
-                .list()) {
-            // System.out.println(c.getSHA1());
-            sha1.add(c.getSHA1());
-        }
-        assertEquals("1cccddb22e305397151b2b7b87b4b47d74ca337b", sha1.get(0));
-        assertEquals(29, sha1.size());
+        assertThat(sha1.get(0), equalTo("fdfad6be4db6f96faea1f153fb447b479a7a9cb7"));
+        assertThat(sha1.size(), equalTo(1));
     }
 
     @Ignore("Needs mocking check")
@@ -494,7 +520,7 @@ public class AppTest extends AbstractGitHubWireMockTest {
         List<GHCommitComment> batch = comments.iterator().nextPage();
         for (GHCommitComment comment : batch) {
             // System.out.println(comment.getBody());
-            assertSame(comment.getOwner(), r);
+            assertThat(r, sameInstance(comment.getOwner()));
         }
     }
 
@@ -504,23 +530,65 @@ public class AppTest extends AbstractGitHubWireMockTest {
                 .getRepository("sandbox-ant")
                 .getCommit("8ae38db0ea5837313ab5f39d43a6f73de3bd9000");
         GHCommitComment c = commit.createComment("[testing](http://kohsuse.org/)");
-        // System.out.println(c);
-        c.update("updated text");
-        // System.out.println(c);
-        c.delete();
+        try {
+            assertThat(c.getPath(), nullValue());
+            assertThat(c.getLine(), equalTo(-1));
+            assertThat(c.getHtmlUrl().toString(),
+                    containsString(
+                            "kohsuke/sandbox-ant/commit/8ae38db0ea5837313ab5f39d43a6f73de3bd9000#commitcomment-"));
+            assertThat(c.listReactions().toList(), is(empty()));
+
+            c.update("updated text");
+            assertThat(c.getBody(), equalTo("updated text"));
+        } finally {
+            c.delete();
+        }
     }
 
     @Test
     public void tryHook() throws Exception {
-        kohsuke();
-        GHRepository r = gitHub.getOrganization(GITHUB_API_TEST_ORG).getRepository("github-api");
-        GHHook hook = r.createWebHook(new URL("http://www.google.com/"));
-        // System.out.println(hook);
+        GHOrganization o = gitHub.getOrganization(GITHUB_API_TEST_ORG);
+        GHRepository r = o.getRepository("github-api");
+        try {
+            GHHook hook = r.createWebHook(new URL("http://www.google.com/"));
+            assertThat(hook.getName(), equalTo("web"));
+            assertThat(hook.getEvents().size(), equalTo(1));
+            assertThat(hook.getEvents(), contains(GHEvent.PUSH));
+            assertThat(hook.getConfig().size(), equalTo(3));
+            assertThat(hook.isActive(), equalTo(true));
 
-        if (mockGitHub.isUseProxy()) {
-            r = getGitHubBeforeAfter().getOrganization(GITHUB_API_TEST_ORG).getRepository("github-api");
-            for (GHHook h : r.getHooks()) {
-                h.delete();
+            GHHook hook2 = r.getHook((int) hook.getId());
+            assertThat(hook2.getName(), equalTo("web"));
+            assertThat(hook2.getEvents().size(), equalTo(1));
+            assertThat(hook2.getEvents(), contains(GHEvent.PUSH));
+            assertThat(hook2.getConfig().size(), equalTo(3));
+            assertThat(hook2.isActive(), equalTo(true));
+            hook2.ping();
+            hook2.delete();
+
+            hook = o.createWebHook(new URL("http://www.google.com/"));
+            assertThat(hook.getName(), equalTo("web"));
+            assertThat(hook.getEvents().size(), equalTo(1));
+            assertThat(hook.getEvents(), contains(GHEvent.PUSH));
+            assertThat(hook.getConfig().size(), equalTo(3));
+            assertThat(hook.isActive(), equalTo(true));
+
+            hook2 = o.getHook((int) hook.getId());
+            assertThat(hook2.getName(), equalTo("web"));
+            assertThat(hook2.getEvents().size(), equalTo(1));
+            assertThat(hook2.getEvents(), contains(GHEvent.PUSH));
+            assertThat(hook2.getConfig().size(), equalTo(3));
+            assertThat(hook2.isActive(), equalTo(true));
+            hook2.ping();
+            hook2.delete();
+
+            // System.out.println(hook);
+        } finally {
+            if (mockGitHub.isUseProxy()) {
+                r = getNonRecordingGitHub().getOrganization(GITHUB_API_TEST_ORG).getRepository("github-api");
+                for (GHHook h : r.getHooks()) {
+                    h.delete();
+                }
             }
         }
     }
@@ -529,6 +597,14 @@ public class AppTest extends AbstractGitHubWireMockTest {
     public void testEventApi() throws Exception {
         for (GHEventInfo ev : gitHub.getEvents()) {
             if (ev.getType() == GHEvent.PULL_REQUEST) {
+                if (ev.getId() == 10680625394L) {
+                    assertThat(ev.getActorLogin(), equalTo("pull[bot]"));
+                    assertThat(ev.getOrganization(), nullValue());
+                    assertThat(ev.getRepository().getFullName(), equalTo("daddyfatstacksBIG/lerna"));
+                    assertThat(ev.getCreatedAt(), equalTo(GitHubClient.parseDate("2019-10-21T21:54:52Z")));
+                    assertThat(ev.getType(), equalTo(GHEvent.PULL_REQUEST));
+                }
+
                 GHEventPayload.PullRequest pr = ev.getPayload(GHEventPayload.PullRequest.class);
                 assertThat(pr.getNumber(), is(pr.getPullRequest().getNumber()));
             }
@@ -643,7 +719,7 @@ public class AppTest extends AbstractGitHubWireMockTest {
         GHOrganization j = gitHub.getOrganization(GITHUB_API_TEST_ORG);
         GHTeam t = j.getTeams().get("Core Developers");
 
-        assertNotNull(j.getRepository("jenkins"));
+        assertThat(j.getRepository("jenkins"), notNullValue());
 
         // t.add(labs.getRepository("xyz"));
     }
@@ -660,18 +736,18 @@ public class AppTest extends AbstractGitHubWireMockTest {
         List<GHCommitStatus> lst = r.listCommitStatuses("ecbfdd7315ef2cf04b2be7f11a072ce0bd00c396").toList();
         state = lst.get(0);
         // System.out.println(state);
-        assertEquals("testing!", state.getDescription());
-        assertEquals("http://kohsuke.org/", state.getTargetUrl());
+        assertThat(state.getDescription(), equalTo("testing!"));
+        assertThat(state.getTargetUrl(), equalTo("http://kohsuke.org/"));
     }
 
     @Test
     public void testCommitShortInfo() throws Exception {
         GHRepository r = gitHub.getRepository("hub4j/github-api");
         GHCommit commit = r.getCommit("86a2e245aa6d71d54923655066049d9e21a15f23");
-        assertEquals(commit.getCommitShortInfo().getAuthor().getName(), "Kohsuke Kawaguchi");
-        assertEquals(commit.getCommitShortInfo().getMessage(), "doc");
-        assertFalse(commit.getCommitShortInfo().getVerification().isVerified());
-        assertEquals(commit.getCommitShortInfo().getVerification().getReason(), GHVerification.Reason.UNSIGNED);
+        assertThat("Kohsuke Kawaguchi", equalTo(commit.getCommitShortInfo().getAuthor().getName()));
+        assertThat("doc", equalTo(commit.getCommitShortInfo().getMessage()));
+        assertThat(commit.getCommitShortInfo().getVerification().isVerified(), is(false));
+        assertThat(GHVerification.Reason.UNSIGNED, equalTo(commit.getCommitShortInfo().getVerification().getReason()));
         assertThat(commit.getCommitShortInfo().getAuthor().getDate().toInstant().getEpochSecond(),
                 equalTo(1271650361L));
         assertThat(commit.getCommitShortInfo().getCommitter().getDate().toInstant().getEpochSecond(),
@@ -684,7 +760,7 @@ public class AppTest extends AbstractGitHubWireMockTest {
         GHRepository r = gitHub.getUser("kohsuke").getRepository("github-api");
         GHPullRequest p = r.getPullRequest(17);
         GHUser u = p.getUser();
-        assertNotNull(u.getName());
+        assertThat(u.getName(), notNullValue());
     }
 
     @Test
@@ -694,11 +770,11 @@ public class AppTest extends AbstractGitHubWireMockTest {
         GHUser kohsuke = gitHub.getUser("kohsuke");
         GHUser b = gitHub.getUser("b");
 
-        assertTrue(j.hasMember(kohsuke));
-        assertFalse(j.hasMember(b));
+        assertThat(j.hasMember(kohsuke), is(true));
+        assertThat(j.hasMember(b), is(false));
 
-        assertTrue(j.hasPublicMember(kohsuke));
-        assertFalse(j.hasPublicMember(b));
+        assertThat(j.hasPublicMember(kohsuke), is(true));
+        assertThat(j.hasPublicMember(b), is(false));
     }
 
     @Ignore("Needs mocking check")
@@ -721,7 +797,7 @@ public class AppTest extends AbstractGitHubWireMockTest {
                 if (tagName.equals(tag.getName())) {
                     String ash = tag.getCommit().getSHA1();
                     GHRef ref = r.createRef("refs/heads/" + releaseName, ash);
-                    assertEquals(ref.getRef(), "refs/heads/" + releaseName);
+                    assertThat(("refs/heads/" + releaseName), equalTo(ref.getRef()));
 
                     for (Map.Entry<String, GHBranch> entry : r.getBranches().entrySet()) {
                         // System.out.println(entry.getKey() + "/" + entry.getValue());
@@ -740,9 +816,9 @@ public class AppTest extends AbstractGitHubWireMockTest {
 
     @Test
     public void testRef() throws IOException {
-        GHRef masterRef = gitHub.getRepository("jenkinsci/jenkins").getRef("heads/master");
-        assertEquals(mockGitHub.apiServer().baseUrl() + "/repos/jenkinsci/jenkins/git/refs/heads/master",
-                masterRef.getUrl().toString());
+        GHRef mainRef = gitHub.getRepository("jenkinsci/jenkins").getRef("heads/main");
+        assertThat(mainRef.getUrl().toString(),
+                equalTo(mockGitHub.apiServer().baseUrl() + "/repos/jenkinsci/jenkins/git/refs/heads/main"));
     }
 
     @Test
@@ -765,14 +841,14 @@ public class AppTest extends AbstractGitHubWireMockTest {
         final GHDeployKey newDeployKey = myRepository.addDeployKey("test",
                 "ssh-rsa AAAAB3NzaC1yc2EAAAADAQABAAABAQDUt0RAycC5cS42JKh6SecfFZBR1RrF+2hYMctz4mk74/arBE+wFb7fnSHGzdGKX2h5CFOWODifRCJVhB7hlVxodxe+QkQQYAEL/x1WVCJnGgTGQGOrhOMj95V3UE5pQKhsKD608C+u5tSofcWXLToP1/wZ7U4/AHjqYi08OLsWToHCax55TZkvdt2jo0hbIoYU+XI9Q8Uv4ONDN1oabiOdgeKi8+crvHAuvNleiBhWVBzFh8KdfzaH5uNdw7ihhFjEd1vzqACsjCINCjdMfzl6jD9ExuWuE92nZJnucls2cEoNC6k2aPmrZDg9hA32FXVpyseY+bDUWFU6LO2LG6PB kohsuke@atlas");
         try {
-            assertNotNull(newDeployKey.getId());
+            assertThat(newDeployKey.getId(), notNullValue());
 
             GHDeployKey k = Iterables.find(myRepository.getDeployKeys(), new Predicate<GHDeployKey>() {
                 public boolean apply(GHDeployKey deployKey) {
                     return newDeployKey.getId() == deployKey.getId();
                 }
             });
-            assertNotNull(k);
+            assertThat(k, notNullValue());
         } finally {
             newDeployKey.delete();
         }
@@ -782,10 +858,10 @@ public class AppTest extends AbstractGitHubWireMockTest {
     @Test
     public void testCommitStatusContext() throws IOException {
         GHRepository myRepository = getTestRepository();
-        GHRef masterRef = myRepository.getRef("heads/master");
-        GHCommitStatus commitStatus = myRepository.createCommitStatus(masterRef.getObject()
+        GHRef mainRef = myRepository.getRef("heads/main");
+        GHCommitStatus commitStatus = myRepository.createCommitStatus(mainRef.getObject()
                 .getSha(), GHCommitState.SUCCESS, "http://www.example.com", "test", "test/context");
-        assertEquals("test/context", commitStatus.getContext());
+        assertThat(commitStatus.getContext(), equalTo("test/context"));
 
     }
 
@@ -797,7 +873,7 @@ public class AppTest extends AbstractGitHubWireMockTest {
             // System.out.println(u.getLogin());
             all.add(u);
         }
-        assertFalse(all.isEmpty());
+        assertThat(all, is(not(empty())));
     }
 
     @Test
@@ -808,10 +884,10 @@ public class AppTest extends AbstractGitHubWireMockTest {
                 .author("kohsuke")
                 .sort(GHCommitSearchBuilder.Sort.COMMITTER_DATE)
                 .list();
-        assertTrue(r.getTotalCount() > 0);
+        assertThat(r.getTotalCount(), greaterThan(0));
 
         GHCommit firstCommit = r.iterator().next();
-        assertTrue(firstCommit.getFiles().size() > 0);
+        assertThat(firstCommit.getFiles(), is(not(empty())));
     }
 
     @Test
@@ -821,7 +897,7 @@ public class AppTest extends AbstractGitHubWireMockTest {
                 .isOpen()
                 .sort(GHIssueSearchBuilder.Sort.UPDATED)
                 .list();
-        assertTrue(r.getTotalCount() > 0);
+        assertThat(r.getTotalCount(), greaterThan(0));
         for (GHIssue issue : r) {
             assertThat(issue.getTitle(), notNullValue());
             PagedIterable<GHIssueComment> comments = issue.listComments();
@@ -834,35 +910,45 @@ public class AppTest extends AbstractGitHubWireMockTest {
     @Test // issue #99
     public void testReadme() throws IOException {
         GHContent readme = gitHub.getRepository("hub4j-test-org/test-readme").getReadme();
-        assertEquals(readme.getName(), "README.md");
-        assertEquals(readme.getContent(), "This is a markdown readme.\n");
+        assertThat("README.md", equalTo(readme.getName()));
+        assertThat("This is a markdown readme.\n", equalTo(readme.getContent()));
     }
 
     @Ignore("Needs mocking check")
     @Test
     public void testTrees() throws IOException {
-        GHTree masterTree = gitHub.getRepository("hub4j/github-api").getTree("master");
+        GHTree mainTree = gitHub.getRepository("hub4j/github-api").getTree("main");
         boolean foundReadme = false;
-        for (GHTreeEntry e : masterTree.getTree()) {
+        for (GHTreeEntry e : mainTree.getTree()) {
             if ("readme".equalsIgnoreCase(e.getPath().replaceAll("\\.md", ""))) {
                 foundReadme = true;
                 break;
             }
         }
-        assertTrue(foundReadme);
+        assertThat(foundReadme, is(true));
     }
 
     @Test
     public void testTreesRecursive() throws IOException {
-        GHTree masterTree = gitHub.getRepository("hub4j/github-api").getTreeRecursive("master", 1);
+        GHTree mainTree = gitHub.getRepository("hub4j/github-api").getTreeRecursive("main", 1);
         boolean foundThisFile = false;
-        for (GHTreeEntry e : masterTree.getTree()) {
+        for (GHTreeEntry e : mainTree.getTree()) {
             if (e.getPath().endsWith(AppTest.class.getSimpleName() + ".java")) {
                 foundThisFile = true;
+                assertThat(e.getPath(), equalTo("src/test/java/org/kohsuke/github/AppTest.java"));
+                assertThat(e.getSha(), equalTo("baad7a7c4cf409f610a0e8c7eba17664eb655c44"));
+                assertThat(e.getMode(), equalTo("100755"));
+                assertThat(e.getSize(), greaterThan(30000L));
+                assertThat(e.getUrl().toString(),
+                        containsString("/repos/hub4j/github-api/git/blobs/baad7a7c4cf409f610a0e8c7eba17664eb655c44"));
+                GHBlob blob = e.asBlob();
+                assertThat(e.asBlob().getUrl().toString(),
+                        containsString("/repos/hub4j/github-api/git/blobs/baad7a7c4cf409f610a0e8c7eba17664eb655c44"));
                 break;
             }
+
         }
-        assertTrue(foundThisFile);
+        assertThat(foundThisFile, is(true));
     }
 
     @Test
@@ -875,11 +961,14 @@ public class AppTest extends AbstractGitHubWireMockTest {
         for (GHLabel l : lst) {
             assertThat(l.getUrl(), containsString(l.getName().replace(" ", "%20")));
         }
-        assertTrue(lst.size() > 5);
+        assertThat(lst.size(), greaterThan(5));
         GHLabel e = r.getLabel("enhancement");
-        assertEquals("enhancement", e.getName());
-        assertNotNull(e.getUrl());
-        assertTrue(Pattern.matches("[0-9a-fA-F]{6}", e.getColor()));
+        assertThat(e.getName(), equalTo("enhancement"));
+        assertThat(e.getUrl(), notNullValue());
+        assertThat(e.getId(), equalTo(177339106L));
+        assertThat(e.getNodeId(), equalTo("MDU6TGFiZWwxNzczMzkxMDY="));
+        assertThat(e.isDefault(), is(true));
+        assertThat(e.getColor(), matchesPattern("[0-9a-fA-F]{6}"));
 
         GHLabel t = null;
         GHLabel t2 = null;
@@ -890,12 +979,17 @@ public class AppTest extends AbstractGitHubWireMockTest {
             assertThat(t, not(sameInstance(t2)));
             assertThat(t, equalTo(t2));
 
-            assertEquals(t.getName(), t2.getName());
-            assertEquals(t.getColor(), "123456");
-            assertEquals(t.getColor(), t2.getColor());
-            assertEquals(t.getDescription(), "");
-            assertEquals(t.getDescription(), t2.getDescription());
-            assertEquals(t.getUrl(), t2.getUrl());
+            assertThat(t2.isDefault(), is(false));
+
+            assertThat(t2.getId(), equalTo(t.getId()));
+            assertThat(t2.getNodeId(), equalTo(t.getNodeId()));
+            assertThat(t2.getName(), equalTo(t.getName()));
+            assertThat("123456", equalTo(t.getColor()));
+            assertThat(t2.getColor(), equalTo(t.getColor()));
+            assertThat("", equalTo(t.getDescription()));
+            assertThat(t2.getDescription(), equalTo(t.getDescription()));
+            assertThat(t2.getUrl(), equalTo(t.getUrl()));
+            assertThat(t2.isDefault(), equalTo(t.isDefault()));
 
             // update works on multiple changes in one call
             t3 = t.update().color("000000").description("It is dark!").done();
@@ -907,10 +1001,10 @@ public class AppTest extends AbstractGitHubWireMockTest {
             assertThat(t, not(sameInstance(t3)));
             assertThat(t, not(equalTo(t3)));
 
-            assertEquals(t.getColor(), "123456");
-            assertEquals(t.getDescription(), "");
-            assertEquals(t3.getColor(), "000000");
-            assertEquals(t3.getDescription(), "It is dark!");
+            assertThat("123456", equalTo(t.getColor()));
+            assertThat("", equalTo(t.getDescription()));
+            assertThat("000000", equalTo(t3.getColor()));
+            assertThat("It is dark!", equalTo(t3.getDescription()));
 
             // Test deprecated methods
             t.setDescription("Deprecated");
@@ -918,13 +1012,13 @@ public class AppTest extends AbstractGitHubWireMockTest {
 
             // By using the old instance t when calling setDescription it also sets color to the old value
             // this is a bad behavior, but it is expected
-            assertEquals(t.getColor(), "123456");
-            assertEquals(t.getDescription(), "Deprecated");
+            assertThat("123456", equalTo(t.getColor()));
+            assertThat("Deprecated", equalTo(t.getDescription()));
 
             t.setColor("000000");
             t = r.getLabel("test");
-            assertEquals(t.getColor(), "000000");
-            assertEquals(t.getDescription(), "Deprecated");
+            assertThat("000000", equalTo(t.getColor()));
+            assertThat("Deprecated", equalTo(t.getDescription()));
 
             // set() makes a single change
             t3 = t.set().description("this is also a test");
@@ -933,8 +1027,8 @@ public class AppTest extends AbstractGitHubWireMockTest {
             assertThat(t, not(sameInstance(t3)));
             assertThat(t, not(equalTo(t3)));
 
-            assertEquals(t3.getColor(), "000000");
-            assertEquals(t3.getDescription(), "this is also a test");
+            assertThat("000000", equalTo(t3.getColor()));
+            assertThat("this is also a test", equalTo(t3.getDescription()));
 
             t.delete();
             try {
@@ -947,12 +1041,12 @@ public class AppTest extends AbstractGitHubWireMockTest {
             t = r.createLabel("test2", "123457", "this is a different test");
             t2 = r.getLabel("test2");
 
-            assertEquals(t.getName(), t2.getName());
-            assertEquals(t.getColor(), "123457");
-            assertEquals(t.getColor(), t2.getColor());
-            assertEquals(t.getDescription(), "this is a different test");
-            assertEquals(t.getDescription(), t2.getDescription());
-            assertEquals(t.getUrl(), t2.getUrl());
+            assertThat(t2.getName(), equalTo(t.getName()));
+            assertThat("123457", equalTo(t.getColor()));
+            assertThat(t2.getColor(), equalTo(t.getColor()));
+            assertThat("this is a different test", equalTo(t.getDescription()));
+            assertThat(t2.getDescription(), equalTo(t.getDescription()));
+            assertThat(t2.getUrl(), equalTo(t.getUrl()));
             t.delete();
 
             // Allow null description
@@ -969,7 +1063,7 @@ public class AppTest extends AbstractGitHubWireMockTest {
     void cleanupLabel(String name) {
         if (mockGitHub.isUseProxy()) {
             try {
-                GHLabel t = getGitHubBeforeAfter().getRepository("hub4j-test-org/test-labels").getLabel(name);
+                GHLabel t = getNonRecordingGitHub().getRepository("hub4j-test-org/test-labels").getLabel(name);
                 t.delete();
             } catch (IOException e) {
 
@@ -984,13 +1078,13 @@ public class AppTest extends AbstractGitHubWireMockTest {
         for (GHUser u : mr.listSubscribers()) {
             bitwiseman |= u.getLogin().equals("bitwiseman");
         }
-        assertTrue(bitwiseman);
+        assertThat(bitwiseman, is(true));
 
         boolean githubApiFound = false;
         for (GHRepository r : gitHub.getUser("bitwiseman").listRepositories()) {
             githubApiFound |= r.equals(mr);
         }
-        assertTrue(githubApiFound);
+        assertThat(githubApiFound, is(true));
     }
 
     @Test
@@ -1021,7 +1115,7 @@ public class AppTest extends AbstractGitHubWireMockTest {
             assertThat(t.getCreatedAt(), nullValue());
 
         }
-        assertTrue(found);
+        assertThat(found, is(true));
         gitHub.listNotifications().markAsRead();
     }
 
@@ -1101,8 +1195,8 @@ public class AppTest extends AbstractGitHubWireMockTest {
         GHMyself me = gitHub.getMyself();
         for (GHMembership m : me.listOrgMemberships()) {
             assertThat(m.getUser(), is((GHUser) me));
-            assertNotNull(m.getState());
-            assertNotNull(m.getRole());
+            assertThat(m.getState(), notNullValue());
+            assertThat(m.getRole(), notNullValue());
         }
     }
 
@@ -1113,15 +1207,15 @@ public class AppTest extends AbstractGitHubWireMockTest {
         GHRepository r = gitHub.getRepository("hub4j/github-api");
         String sha1 = "a12243f2fc5b8c2ba47dd677d0b0c7583539584d";
 
-        assertBlobContent(r.readBlob(sha1));
+        verifyBlobContent(r.readBlob(sha1));
 
         GHBlob blob = r.getBlob(sha1);
-        assertBlobContent(blob.read());
+        verifyBlobContent(blob.read());
         assertThat(blob.getSha(), is("a12243f2fc5b8c2ba47dd677d0b0c7583539584d"));
         assertThat(blob.getSize(), is(1104L));
     }
 
-    private void assertBlobContent(InputStream is) throws Exception {
+    private void verifyBlobContent(InputStream is) throws Exception {
         String content = new String(IOUtils.toByteArray(is), StandardCharsets.UTF_8);
         assertThat(content, containsString("Copyright (c) 2011- Kohsuke Kawaguchi and other contributors"));
         assertThat(content, containsString("FROM, OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR"));

src/test/java/org/kohsuke/github/ArchTests.java

@@ -1,20 +1,42 @@
 package org.kohsuke.github;
 
 import com.tngtech.archunit.base.DescribedPredicate;
-import com.tngtech.archunit.core.domain.JavaAnnotation;
-import com.tngtech.archunit.core.domain.JavaClasses;
+import com.tngtech.archunit.core.domain.*;
+import com.tngtech.archunit.core.domain.properties.HasName;
+import com.tngtech.archunit.core.domain.properties.HasOwner;
 import com.tngtech.archunit.core.importer.ClassFileImporter;
 import com.tngtech.archunit.core.importer.ImportOption;
+import com.tngtech.archunit.lang.ArchCondition;
 import com.tngtech.archunit.lang.ArchRule;
+import org.apache.commons.io.IOUtils;
+import org.apache.commons.lang3.StringUtils;
+import org.apache.commons.lang3.builder.ReflectionToStringBuilder;
+import org.apache.commons.lang3.builder.ToStringBuilder;
+import org.apache.commons.lang3.builder.ToStringStyle;
 import org.junit.BeforeClass;
 import org.junit.Test;
 
-import static com.tngtech.archunit.lang.conditions.ArchConditions.beAnnotatedWith;
-import static com.tngtech.archunit.lang.conditions.ArchConditions.not;
+import java.io.Closeable;
+import java.io.InputStream;
+import java.io.Reader;
+import java.lang.reflect.Field;
+import java.nio.charset.Charset;
+
+import static com.google.common.base.Preconditions.checkNotNull;
+import static com.tngtech.archunit.core.domain.JavaCall.Predicates.target;
+import static com.tngtech.archunit.core.domain.JavaClass.Predicates.resideInAPackage;
+import static com.tngtech.archunit.core.domain.JavaClass.Predicates.type;
+import static com.tngtech.archunit.core.domain.JavaClass.namesOf;
+import static com.tngtech.archunit.core.domain.properties.HasName.Predicates.name;
+import static com.tngtech.archunit.core.domain.properties.HasName.Predicates.nameContaining;
+import static com.tngtech.archunit.core.domain.properties.HasOwner.Predicates.With.owner;
+import static com.tngtech.archunit.core.domain.properties.HasParameterTypes.Predicates.rawParameterTypes;
+import static com.tngtech.archunit.lang.conditions.ArchConditions.*;
 import static com.tngtech.archunit.lang.syntax.ArchRuleDefinition.classes;
 import static com.tngtech.archunit.lang.syntax.ArchRuleDefinition.fields;
 import static com.tngtech.archunit.lang.syntax.ArchRuleDefinition.methods;
-import static org.junit.Assert.assertTrue;
+import static org.hamcrest.MatcherAssert.assertThat;
+import static org.hamcrest.Matchers.greaterThan;
 
 public class ArchTests {
 
@@ -23,6 +45,13 @@ public class ArchTests {
             .withImportOption(new ImportOption.DoNotIncludeJars())
             .importPackages("org.kohsuke.github");
 
+    private static final JavaClasses apacheCommons = new ClassFileImporter().importPackages("org.apache.commons.lang3");
+
+    private static final JavaClasses testClassFiles = new ClassFileImporter()
+            .withImportOption(new ImportOption.OnlyIncludeTests())
+            .withImportOption(new ImportOption.DoNotIncludeJars())
+            .importPackages("org.kohsuke.github");
+
     private static final DescribedPredicate<JavaAnnotation<?>> previewAnnotationWithNoMediaType = new DescribedPredicate<JavaAnnotation<?>>(
             "preview has no required media types defined") {
 
@@ -36,7 +65,7 @@ public class ArchTests {
 
     @BeforeClass
     public static void beforeClass() {
-        assertTrue(classFiles.size() > 0);
+        assertThat(classFiles.size(), greaterThan(0));
     }
 
     @Test
@@ -105,4 +134,107 @@ public class ArchTests {
         methodRule.check(classFiles);
 
     }
+
+    @Test
+    public void testRequireUseOfAssertThat() {
+
+        final String reason = "This project uses `assertThat(...)` instead of other `assert*()` methods.";
+
+        final DescribedPredicate<HasName> assertMethodOtherThanAssertThat = nameContaining("assert")
+                .and(DescribedPredicate.not(name("assertThat")));
+
+        final ArchRule onlyAssertThatRule = classes()
+                .should(not(callMethodWhere(target(assertMethodOtherThanAssertThat))))
+                .because(reason);
+
+        onlyAssertThatRule.check(testClassFiles);
+    }
+
+    @Test
+    public void testRequireUseOfOnlySpecificApacheCommons() {
+
+        final ArchRule onlyApprovedApacheCommonsMethods = classes()
+                .should(notCallMethodsInPackageUnless("org.apache.commons..",
+                        // unless it is one of these methods
+                        targetMethodIs(StringUtils.class, "capitalize", String.class),
+                        targetMethodIs(StringUtils.class, "defaultString", String.class, String.class),
+                        targetMethodIs(StringUtils.class, "equals", CharSequence.class, CharSequence.class),
+                        targetMethodIs(StringUtils.class, "isBlank", CharSequence.class),
+                        targetMethodIs(StringUtils.class, "isEmpty", CharSequence.class),
+                        targetMethodIs(StringUtils.class, "join", Iterable.class, String.class),
+                        targetMethodIs(StringUtils.class,
+                                "prependIfMissing",
+                                String.class,
+                                CharSequence.class,
+                                CharSequence[].class),
+                        targetMethodIs(ToStringBuilder.class, "toString"),
+                        targetMethodIs(ToStringBuilder.class, "append", String.class, Object.class),
+                        targetMethodIs(ToStringBuilder.class, "append", String.class, long.class),
+                        targetMethodIs(ToStringBuilder.class, "append", String.class, int.class),
+                        targetMethodIs(ToStringBuilder.class, "isEmpty"),
+                        targetMethodIs(ToStringBuilder.class, "equals"),
+                        targetMethodIs(ToStringBuilder.class, "capitalize"),
+                        targetMethodIs(ToStringStyle.class,
+                                "append",
+                                StringBuffer.class,
+                                String.class,
+                                Object.class,
+                                Boolean.class),
+                        targetMethodIs(ReflectionToStringBuilder.class, "accept", Field.class),
+                        targetMethodIs(IOUtils.class, "closeQuietly", InputStream.class),
+                        targetMethodIs(IOUtils.class, "closeQuietly", Closeable.class),
+                        targetMethodIs(IOUtils.class, "toString", InputStream.class, Charset.class),
+                        targetMethodIs(IOUtils.class, "toString", Reader.class),
+                        targetMethodIs(IOUtils.class, "toByteArray", InputStream.class)))
+                .because(
+                        "Commons methods must be manually verified to be compatible with commons-io:2.4 or earlier and commons-lang3:3.9 or earlier.");
+
+        onlyApprovedApacheCommonsMethods.check(classFiles);
+    }
+
+    public static ArchCondition<JavaClass> notCallMethodsInPackageUnless(final String packageIdentifier,
+            final DescribedPredicate<JavaCall<?>>... unlessPredicates) {
+        DescribedPredicate<JavaCall<?>> restrictedPackageCalls = target(
+                HasOwner.Predicates.With.<JavaClass>owner(resideInAPackage(packageIdentifier)));
+
+        if (unlessPredicates.length > 0) {
+            DescribedPredicate<JavaCall<?>> allowed = unlessPredicates[0];
+            for (int x = 1; x < unlessPredicates.length; x++) {
+                allowed = allowed.or(unlessPredicates[x]);
+            }
+            restrictedPackageCalls = unless(restrictedPackageCalls, allowed);
+        }
+        return not(callMethodWhere(restrictedPackageCalls));
+    }
+
+    public static DescribedPredicate<JavaCall<?>> targetMethodIs(Class<?> owner,
+            String methodName,
+            Class<?>... parameterTypes) {
+        return JavaCall.Predicates.target(owner(type(owner)))
+                .and(JavaCall.Predicates.target(name(methodName)))
+                .and(JavaCall.Predicates.target(rawParameterTypes(parameterTypes)))
+                .as("method is %s",
+                        Formatters.formatMethodSimple(owner.getSimpleName(), methodName, namesOf(parameterTypes)));
+    }
+
+    public static <T> DescribedPredicate<T> unless(DescribedPredicate<? super T> first,
+            DescribedPredicate<? super T> second) {
+        return new UnlessPredicate(first, second);
+    }
+
+    private static class UnlessPredicate<T> extends DescribedPredicate<T> {
+        private final DescribedPredicate<T> current;
+        private final DescribedPredicate<? super T> other;
+
+        UnlessPredicate(DescribedPredicate<T> current, DescribedPredicate<? super T> other) {
+            super(current.getDescription() + " unless " + other.getDescription());
+            this.current = checkNotNull(current);
+            this.other = checkNotNull(other);
+        }
+
+        @Override
+        public boolean apply(T input) {
+            return current.apply(input) && !other.apply(input);
+        }
+    }
 }

src/test/java/org/kohsuke/github/BridgeMethodTest.java

@@ -33,6 +33,7 @@ public class BridgeMethodTest extends Assert {
         verifyBridgeMethods(GHIssue.class, "getCreatedAt", Date.class, String.class);
         verifyBridgeMethods(GHIssue.class, "getId", int.class, long.class, String.class);
         verifyBridgeMethods(GHIssue.class, "getUrl", String.class, URL.class);
+        verifyBridgeMethods(GHIssue.class, "comment", 1, void.class, GHIssueComment.class);
 
         verifyBridgeMethods(GHOrganization.class, "getHtmlUrl", String.class, URL.class);
         verifyBridgeMethods(GHOrganization.class, "getId", int.class, long.class, String.class);
@@ -55,12 +56,17 @@ public class BridgeMethodTest extends Assert {
     }
 
     void verifyBridgeMethods(@Nonnull Class<?> targetClass, @Nonnull String methodName, Class<?>... returnTypes) {
+        verifyBridgeMethods(targetClass, methodName, 0, returnTypes);
+    }
+
+    void verifyBridgeMethods(@Nonnull Class<?> targetClass,
+            @Nonnull String methodName,
+            int parameterCount,
+            Class<?>... returnTypes) {
         List<Class<?>> foundMethods = new ArrayList<>();
         Method[] methods = targetClass.getMethods();
         for (Method method : methods) {
-            if (method.getName().equalsIgnoreCase(methodName)) {
-                // Bridge methods are only
-                assertThat(method.getParameterCount(), equalTo(0));
+            if (method.getName().equalsIgnoreCase(methodName) && method.getParameterCount() == parameterCount) {
                 foundMethods.add(method.getReturnType());
             }
         }

src/test/java/org/kohsuke/github/CommitTest.java

@@ -4,10 +4,12 @@ import com.google.common.collect.Iterables;
 import org.junit.Test;
 
 import java.io.IOException;
+import java.util.ArrayList;
 import java.util.Arrays;
+import java.util.Date;
 import java.util.List;
 
-import static org.hamcrest.Matchers.equalTo;
+import static org.hamcrest.Matchers.*;
 
 /**
  * @author Kohsuke Kawaguchi
@@ -16,7 +18,7 @@ public class CommitTest extends AbstractGitHubWireMockTest {
     @Test // issue 152
     public void lastStatus() throws IOException {
         GHTag t = gitHub.getRepository("stapler/stapler").listTags().iterator().next();
-        assertNotNull(t.getCommit().getLastStatus());
+        assertThat(t.getCommit().getLastStatus(), notNullValue());
     }
 
     @Test // issue 230
@@ -25,10 +27,89 @@ public class CommitTest extends AbstractGitHubWireMockTest {
         PagedIterable<GHCommit> commits = repo.queryCommits().path("pom.xml").list();
         for (GHCommit commit : Iterables.limit(commits, 10)) {
             GHCommit expected = repo.getCommit(commit.getSHA1());
-            assertEquals(expected.getFiles().size(), commit.getFiles().size());
+            assertThat(commit.getFiles().size(), equalTo(expected.getFiles().size()));
         }
     }
 
+    @Test
+    public void testQueryCommits() throws Exception {
+        List<String> sha1 = new ArrayList<String>();
+        List<GHCommit> commits = gitHub.getUser("jenkinsci")
+                .getRepository("jenkins")
+                .queryCommits()
+                .since(1199174400000L)
+                .until(1201852800000L)
+                .path("pom.xml")
+                .pageSize(100)
+                .list()
+                .toList();
+
+        assertThat(commits.get(0).getSHA1(), equalTo("1cccddb22e305397151b2b7b87b4b47d74ca337b"));
+        assertThat(commits.size(), equalTo(29));
+
+        commits = gitHub.getUser("jenkinsci")
+                .getRepository("jenkins")
+                .queryCommits()
+                .since(new Date(1199174400000L))
+                .until(new Date(1201852800000L))
+                .path("pom.xml")
+                .pageSize(100)
+                .list()
+                .toList();
+
+        assertThat(commits.get(0).getSHA1(), equalTo("1cccddb22e305397151b2b7b87b4b47d74ca337b"));
+        assertThat(commits.get(15).getSHA1(), equalTo("a5259970acaec9813e2a12a91f37dfc7871a5ef5"));
+        assertThat(commits.size(), equalTo(29));
+
+        commits = gitHub.getUser("jenkinsci")
+                .getRepository("jenkins")
+                .queryCommits()
+                .since(new Date(1199174400000L))
+                .until(new Date(1201852800000L))
+                .path("pom.xml")
+                .from("a5259970acaec9813e2a12a91f37dfc7871a5ef5")
+                .list()
+                .toList();
+
+        assertThat(commits.get(0).getSHA1(), equalTo("a5259970acaec9813e2a12a91f37dfc7871a5ef5"));
+        assertThat(commits.size(), equalTo(14));
+
+        commits = gitHub.getUser("jenkinsci")
+                .getRepository("jenkins")
+                .queryCommits()
+                .until(new Date(1201852800000L))
+                .path("pom.xml")
+                .author("kohsuke")
+                .list()
+                .toList();
+
+        assertThat(commits, is(empty()));
+
+        commits = gitHub.getUser("jenkinsci")
+                .getRepository("jenkins")
+                .queryCommits()
+                .until(new Date(1201852800000L))
+                .path("pom.xml")
+                .pageSize(100)
+                .author("kohsuke@71c3de6d-444a-0410-be80-ed276b4c234a")
+                .list()
+                .toList();
+
+        assertThat(commits.size(), equalTo(266));
+
+        commits = gitHub.getUser("jenkinsci")
+                .getRepository("jenkins")
+                .queryCommits()
+                .path("pom.xml")
+                .pageSize(100)
+                .author("kohsuke@71c3de6d-444a-0410-be80-ed276b4c234a")
+                .list()
+                .toList();
+
+        assertThat(commits.size(), equalTo(648));
+
+    }
+
     @Test
     public void listPullRequestsOfNotIncludedCommit() throws Exception {
         GHRepository repo = gitHub.getOrganization("hub4j-test-org").getRepository("listPrsListHeads");
@@ -48,7 +129,7 @@ public class CommitTest extends AbstractGitHubWireMockTest {
 
         List<GHPullRequest> listedPrs = commit.listPullRequests().toList();
 
-        assertEquals(listedPrs.size(), 1);
+        assertThat(1, equalTo(listedPrs.size()));
 
         assertThat("Pull request " + prNumber + " not found by searching from commit.",
                 listedPrs.stream().findFirst().filter(it -> it.getNumber() == prNumber).isPresent());
@@ -63,7 +144,7 @@ public class CommitTest extends AbstractGitHubWireMockTest {
 
         List<GHPullRequest> listedPrs = commit.listPullRequests().toList();
 
-        assertEquals(listedPrs.size(), 2);
+        assertThat(2, equalTo(listedPrs.size()));
 
         listedPrs.stream()
                 .forEach(pr -> assertThat("PR#" + pr.getNumber() + " not expected to be matched.",
@@ -76,12 +157,12 @@ public class CommitTest extends AbstractGitHubWireMockTest {
 
         GHCommit commit = repo.getCommit("ab92e13c0fc844fd51a379a48a3ad0b18231215c");
 
-        assertThat("Commit which was supposed to be HEAD in the \"master\" branch was not found.",
+        assertThat("Commit which was supposed to be HEAD in the \"main\" branch was not found.",
                 commit.listBranchesWhereHead()
                         .toList()
                         .stream()
                         .findFirst()
-                        .filter(it -> it.getName().equals("master"))
+                        .filter(it -> it.getName().equals("main"))
                         .isPresent());
     }
 
@@ -91,9 +172,9 @@ public class CommitTest extends AbstractGitHubWireMockTest {
 
         GHCommit commit = repo.getCommit("ab92e13c0fc844fd51a379a48a3ad0b18231215c");
 
-        assertEquals("Commit which was supposed to be HEAD in 2 branches was not found as such.",
-                2,
-                commit.listBranchesWhereHead().toList().size());
+        assertThat("Commit which was supposed to be HEAD in 2 branches was not found as such.",
+                commit.listBranchesWhereHead().toList().size(),
+                equalTo(2));
     }
 
     @Test
@@ -112,14 +193,14 @@ public class CommitTest extends AbstractGitHubWireMockTest {
         PagedIterable<GHCommit> commits = repo.queryCommits().path("pom.xml").list();
         for (GHCommit commit : Iterables.limit(commits, 10)) {
             GHCommit expected = repo.getCommit(commit.getSHA1());
-            assertEquals(expected.getCommitShortInfo().getVerification().isVerified(),
-                    commit.getCommitShortInfo().getVerification().isVerified());
-            assertEquals(expected.getCommitShortInfo().getVerification().getReason(),
-                    commit.getCommitShortInfo().getVerification().getReason());
-            assertEquals(expected.getCommitShortInfo().getVerification().getSignature(),
-                    commit.getCommitShortInfo().getVerification().getSignature());
-            assertEquals(expected.getCommitShortInfo().getVerification().getPayload(),
-                    commit.getCommitShortInfo().getVerification().getPayload());
+            assertThat(commit.getCommitShortInfo().getVerification().isVerified(),
+                    equalTo(expected.getCommitShortInfo().getVerification().isVerified()));
+            assertThat(commit.getCommitShortInfo().getVerification().getReason(),
+                    equalTo(expected.getCommitShortInfo().getVerification().getReason()));
+            assertThat(commit.getCommitShortInfo().getVerification().getSignature(),
+                    equalTo(expected.getCommitShortInfo().getVerification().getSignature()));
+            assertThat(commit.getCommitShortInfo().getVerification().getPayload(),
+                    equalTo(expected.getCommitShortInfo().getVerification().getPayload()));
         }
     }
 

src/test/java/org/kohsuke/github/EnumTest.java

@@ -0,0 +1,85 @@
+package org.kohsuke.github;
+
+import org.junit.Test;
+
+import static org.hamcrest.CoreMatchers.*;
+
+/**
+ * Unit test for {@link GitHub} static helpers.
+ *
+ * @author Liam Newman
+ */
+public class EnumTest extends AbstractGitHubWireMockTest {
+
+    @Test
+    public void touchEnums() {
+        assertThat(GHCheckRun.AnnotationLevel.values().length, equalTo(3));
+        assertThat(GHCheckRun.Conclusion.values().length, equalTo(9));
+        assertThat(GHCheckRun.Status.values().length, equalTo(4));
+
+        assertThat(GHCommentAuthorAssociation.values().length, equalTo(7));
+
+        assertThat(GHCommitState.values().length, equalTo(4));
+
+        assertThat(GHCompare.Status.values().length, equalTo(4));
+
+        assertThat(GHDeploymentState.values().length, equalTo(7));
+
+        assertThat(GHDirection.values().length, equalTo(2));
+
+        assertThat(GHEvent.values().length, equalTo(60));
+        assertThat(GHEvent.ALL.symbol(), equalTo("*"));
+        assertThat(GHEvent.PULL_REQUEST.symbol(), equalTo(GHEvent.PULL_REQUEST.toString().toLowerCase()));
+
+        assertThat(GHIssueSearchBuilder.Sort.values().length, equalTo(3));
+
+        assertThat(GHIssueState.values().length, equalTo(3));
+
+        assertThat(GHMarketplaceAccountType.values().length, equalTo(2));
+
+        assertThat(GHMarketplaceListAccountBuilder.Sort.values().length, equalTo(2));
+
+        assertThat(GHMarketplacePriceModel.values().length, equalTo(3));
+
+        assertThat(GHMembership.Role.values().length, equalTo(2));
+
+        assertThat(GHMilestoneState.values().length, equalTo(2));
+
+        assertThat(GHMyself.RepositoryListFilter.values().length, equalTo(5));
+
+        assertThat(GHOrganization.Role.values().length, equalTo(2));
+        assertThat(GHOrganization.Permission.values().length, equalTo(5));
+
+        assertThat(GHPermissionType.values().length, equalTo(4));
+
+        assertThat(GHProject.ProjectState.values().length, equalTo(2));
+        assertThat(GHProject.ProjectStateFilter.values().length, equalTo(3));
+
+        assertThat(GHPullRequest.MergeMethod.values().length, equalTo(3));
+
+        assertThat(GHPullRequestQueryBuilder.Sort.values().length, equalTo(4));
+
+        assertThat(GHPullRequestReviewEvent.values().length, equalTo(4));
+        assertThat(GHPullRequestReviewEvent.PENDING.toState(), equalTo(GHPullRequestReviewState.PENDING));
+        assertThat(GHPullRequestReviewEvent.PENDING.action(), nullValue());
+
+        assertThat(GHPullRequestReviewState.values().length, equalTo(6));
+        assertThat(GHPullRequestReviewState.PENDING.toEvent(), equalTo(GHPullRequestReviewEvent.PENDING));
+        assertThat(GHPullRequestReviewState.APPROVED.action(), equalTo(GHPullRequestReviewEvent.APPROVE.action()));
+        assertThat(GHPullRequestReviewState.DISMISSED.toEvent(), nullValue());
+
+        assertThat(GHRepository.CollaboratorAffiliation.values().length, equalTo(3));
+        assertThat(GHRepository.ForkSort.values().length, equalTo(3));
+        assertThat(GHRepository.Visibility.values().length, equalTo(4));
+
+        assertThat(GHRepositorySearchBuilder.Sort.values().length, equalTo(3));
+
+        assertThat(GHRepositorySelection.values().length, equalTo(2));
+
+        assertThat(GHTeam.Role.values().length, equalTo(2));
+        assertThat(GHTeam.Privacy.values().length, equalTo(2));
+
+        assertThat(GHUserSearchBuilder.Sort.values().length, equalTo(3));
+    }
+
+}

src/test/java/org/kohsuke/github/GHAppInstallationTest.java

@@ -5,6 +5,8 @@ import org.junit.Test;
 import java.io.IOException;
 import java.util.List;
 
+import static org.hamcrest.Matchers.*;
+
 public class GHAppInstallationTest extends AbstractGHAppInstallationTest {
 
     @Test
@@ -13,16 +15,16 @@ public class GHAppInstallationTest extends AbstractGHAppInstallationTest {
 
         List<GHRepository> repositories = appInstallation.listRepositories().toList();
 
-        assertEquals(2, repositories.size());
-        assertTrue(repositories.stream().anyMatch(it -> it.getName().equals("empty")));
-        assertTrue(repositories.stream().anyMatch(it -> it.getName().equals("test-readme")));
+        assertThat(repositories.size(), equalTo(2));
+        assertThat(repositories.stream().map(GHRepository::getName).toArray(),
+                arrayContainingInAnyOrder("empty", "test-readme"));
     }
 
     @Test
     public void testListRepositoriesNoPermissions() throws IOException {
         GHAppInstallation appInstallation = getAppInstallationWithTokenApp2();
 
-        assertTrue("App does not have permissions and should have 0 repositories",
+        assertThat("App does not have permissions and should have 0 repositories",
                 appInstallation.listRepositories().toList().isEmpty());
     }
 

src/test/java/org/kohsuke/github/GHAppTest.java

@@ -103,7 +103,8 @@ public class GHAppTest extends AbstractGitHubWireMockTest {
         permissions.put("metadata", GHPermissionType.READ);
 
         // Create token specifying both permissions and repository ids
-        GHAppInstallationToken installationToken = installation.createToken(permissions)
+        GHAppInstallationToken installationToken = installation.createToken()
+                .permissions(permissions)
                 .repositoryIds(Collections.singletonList((long) 111111111))
                 .create();
 
@@ -125,7 +126,7 @@ public class GHAppTest extends AbstractGitHubWireMockTest {
         assertThat(installationToken2.getRepositorySelection(), is(GHRepositorySelection.ALL));
         assertThat(installationToken2.getExpiresAt(), is(GitHubClient.parseDate("2019-12-19T12:27:59Z")));
 
-        assertNull(installationToken2.getRepositories());;
+        assertThat(installationToken2.getRepositories(), nullValue());;
     }
 
     private void testAppInstallation(GHAppInstallation appInstallation) throws IOException {
@@ -153,7 +154,7 @@ public class GHAppTest extends AbstractGitHubWireMockTest {
         assertThat(appInstallation.getEvents(), containsInAnyOrder(events.toArray(new GHEvent[0])));
         assertThat(appInstallation.getCreatedAt(), is(GitHubClient.parseDate("2019-07-04T01:19:36.000Z")));
         assertThat(appInstallation.getUpdatedAt(), is(GitHubClient.parseDate("2019-07-30T22:48:09.000Z")));
-        assertNull(appInstallation.getSingleFileName());
+        assertThat(appInstallation.getSingleFileName(), nullValue());
     }
 
 }

src/test/java/org/kohsuke/github/GHBranchProtectionTest.java

@@ -6,10 +6,10 @@ import org.kohsuke.github.GHBranchProtection.EnforceAdmins;
 import org.kohsuke.github.GHBranchProtection.RequiredReviews;
 import org.kohsuke.github.GHBranchProtection.RequiredStatusChecks;
 
-import static org.hamcrest.CoreMatchers.*;
+import static org.hamcrest.Matchers.*;
 
 public class GHBranchProtectionTest extends AbstractGitHubWireMockTest {
-    private static final String BRANCH = "master";
+    private static final String BRANCH = "main";
     private static final String BRANCH_REF = "heads/" + BRANCH;
 
     private GHBranch branch;
@@ -43,33 +43,33 @@ public class GHBranchProtectionTest extends AbstractGitHubWireMockTest {
 
     private void verifyBranchProtection(GHBranchProtection protection) {
         RequiredStatusChecks statusChecks = protection.getRequiredStatusChecks();
-        assertNotNull(statusChecks);
-        assertTrue(statusChecks.isRequiresBranchUpToDate());
-        assertTrue(statusChecks.getContexts().contains("test-status-check"));
+        assertThat(statusChecks, notNullValue());
+        assertThat(statusChecks.isRequiresBranchUpToDate(), is(true));
+        assertThat(statusChecks.getContexts(), contains("test-status-check"));
 
         RequiredReviews requiredReviews = protection.getRequiredReviews();
-        assertNotNull(requiredReviews);
-        assertTrue(requiredReviews.isDismissStaleReviews());
-        assertTrue(requiredReviews.isRequireCodeOwnerReviews());
-        assertEquals(2, requiredReviews.getRequiredReviewers());
+        assertThat(requiredReviews, notNullValue());
+        assertThat(requiredReviews.isDismissStaleReviews(), is(true));
+        assertThat(requiredReviews.isRequireCodeOwnerReviews(), is(true));
+        assertThat(requiredReviews.getRequiredReviewers(), equalTo(2));
 
         EnforceAdmins enforceAdmins = protection.getEnforceAdmins();
-        assertNotNull(enforceAdmins);
-        assertTrue(enforceAdmins.isEnabled());
+        assertThat(enforceAdmins, notNullValue());
+        assertThat(enforceAdmins.isEnabled(), is(true));
     }
 
     @Test
     public void testEnableProtectionOnly() throws Exception {
         branch.enableProtection().enable();
-        assertTrue(repo.getBranch(BRANCH).isProtected());
+        assertThat(repo.getBranch(BRANCH).isProtected(), is(true));
     }
 
     @Test
     public void testDisableProtectionOnly() throws Exception {
         GHBranchProtection protection = branch.enableProtection().enable();
-        assertTrue(repo.getBranch(BRANCH).isProtected());
+        assertThat(repo.getBranch(BRANCH).isProtected(), is(true));
         branch.disableProtection();
-        assertFalse(repo.getBranch(BRANCH).isProtected());
+        assertThat(repo.getBranch(BRANCH).isProtected(), is(false));
     }
 
     @Test
@@ -77,18 +77,18 @@ public class GHBranchProtectionTest extends AbstractGitHubWireMockTest {
         GHBranchProtection protection = branch.enableProtection().requireReviews().enable();
 
         RequiredReviews requiredReviews = protection.getRequiredReviews();
-        assertNotNull(protection.getRequiredReviews());
-        assertFalse(requiredReviews.isDismissStaleReviews());
-        assertFalse(requiredReviews.isRequireCodeOwnerReviews());
+        assertThat(protection.getRequiredReviews(), notNullValue());
+        assertThat(requiredReviews.isDismissStaleReviews(), is(false));
+        assertThat(requiredReviews.isRequireCodeOwnerReviews(), is(false));
         assertThat(protection.getRequiredReviews().getRequiredReviewers(), equalTo(1));
 
         // Get goes through a different code path. Make sure it also gets the correct data.
         protection = branch.getProtection();
         requiredReviews = protection.getRequiredReviews();
 
-        assertNotNull(protection.getRequiredReviews());
-        assertFalse(requiredReviews.isDismissStaleReviews());
-        assertFalse(requiredReviews.isRequireCodeOwnerReviews());
+        assertThat(protection.getRequiredReviews(), notNullValue());
+        assertThat(requiredReviews.isDismissStaleReviews(), is(false));
+        assertThat(requiredReviews.isRequireCodeOwnerReviews(), is(false));
         assertThat(protection.getRequiredReviews().getRequiredReviewers(), equalTo(1));
     }
 
@@ -96,20 +96,21 @@ public class GHBranchProtectionTest extends AbstractGitHubWireMockTest {
     public void testSignedCommits() throws Exception {
         GHBranchProtection protection = branch.enableProtection().enable();
 
-        assertFalse(protection.getRequiredSignatures());
+        assertThat(protection.getRequiredSignatures(), is(false));
 
         protection.enabledSignedCommits();
-        assertTrue(protection.getRequiredSignatures());
+        assertThat(protection.getRequiredSignatures(), is(true));
 
         protection.disableSignedCommits();
-        assertFalse(protection.getRequiredSignatures());
+        assertThat(protection.getRequiredSignatures(), is(false));
     }
 
     @Test
     public void testGetProtection() throws Exception {
         GHBranchProtection protection = branch.enableProtection().enable();
         GHBranchProtection protectionTest = repo.getBranch(BRANCH).getProtection();
-        assertTrue(protectionTest instanceof GHBranchProtection);
-        assertTrue(repo.getBranch(BRANCH).isProtected());
+        Boolean condition = protectionTest instanceof GHBranchProtection;
+        assertThat(protectionTest, instanceOf(GHBranchProtection.class));
+        assertThat(repo.getBranch(BRANCH).isProtected(), is(true));
     }
 }

src/test/java/org/kohsuke/github/GHBranchTest.java

@@ -16,9 +16,9 @@ public class GHBranchTest extends AbstractGitHubWireMockTest {
     public void testMergeBranch() throws Exception {
         repository = getTempRepository();
 
-        String masterHead = repository.getRef("heads/master").getObject().getSha();
-        createRefAndPostContent(BRANCH_1, masterHead);
-        createRefAndPostContent(BRANCH_2, masterHead);
+        String mainHead = repository.getRef("heads/main").getObject().getSha();
+        createRefAndPostContent(BRANCH_1, mainHead);
+        createRefAndPostContent(BRANCH_2, mainHead);
 
         GHBranch otherBranch = repository.getBranch(BRANCH_2);
         String commitMessage = "merging " + BRANCH_2;
@@ -28,13 +28,13 @@ public class GHBranchTest extends AbstractGitHubWireMockTest {
 
         // Merging commit sha should work
         commitMessage = "merging from " + mergeCommit.getSHA1();
-        GHBranch master = repository.getBranch("master");
-        mergeCommit = master.merge(mergeCommit.getSHA1(), commitMessage);
+        GHBranch main = repository.getBranch("main");
+        mergeCommit = main.merge(mergeCommit.getSHA1(), commitMessage);
 
         assertThat(mergeCommit, notNullValue());
         assertThat(mergeCommit.getCommitShortInfo().getMessage(), equalTo(commitMessage));
 
-        mergeCommit = master.merge(mergeCommit.getSHA1(), commitMessage);
+        mergeCommit = main.merge(mergeCommit.getSHA1(), commitMessage);
         // Should be null since all changes already merged
         assertThat(mergeCommit, nullValue());
     }

src/test/java/org/kohsuke/github/GHCheckRunBuilderTest.java

@@ -25,11 +25,12 @@
 package org.kohsuke.github;
 
 import org.junit.Test;
+import org.kohsuke.github.GHCheckRun.Status;
 
 import java.io.IOException;
 import java.util.Date;
 
-import static org.hamcrest.Matchers.containsString;
+import static org.hamcrest.Matchers.*;
 
 @SuppressWarnings("deprecation") // preview
 public class GHCheckRunBuilderTest extends AbstractGHAppInstallationTest {
@@ -48,7 +49,7 @@ public class GHCheckRunBuilderTest extends AbstractGHAppInstallationTest {
                 .withExternalID("whatever")
                 .withStartedAt(new Date(999_999_000))
                 .withCompletedAt(new Date(999_999_999))
-                .add(new GHCheckRunBuilder.Output("Some Title", "what happened…")
+                .add(new GHCheckRunBuilder.Output("Some Title", "what happened…").withText("Hello Text!")
                         .add(new GHCheckRunBuilder.Annotation("stuff.txt",
                                 1,
                                 GHCheckRun.AnnotationLevel.NOTICE,
@@ -58,14 +59,17 @@ public class GHCheckRunBuilderTest extends AbstractGHAppInstallationTest {
                                         .withCaption("Princess Unikitty")))
                 .add(new GHCheckRunBuilder.Action("Help", "what I need help with", "doit"))
                 .create();
-        assertEquals("completed", checkRun.getStatus());
-        assertEquals(1, checkRun.getOutput().getAnnotationsCount());
-        assertEquals(1424883286, checkRun.getId());
+        assertThat(checkRun.getStatus(), equalTo(Status.COMPLETED));
+        assertThat(checkRun.getOutput().getAnnotationsCount(), equalTo(1));
+        assertThat(checkRun.getId(), equalTo(1424883286L));
+        assertThat(checkRun.getOutput().getText(), equalTo("Hello Text!"));
     }
 
     @Test
     public void createCheckRunManyAnnotations() throws Exception {
-        GHCheckRunBuilder.Output output = new GHCheckRunBuilder.Output("Big Run", "Lots of stuff here »");
+        GHCheckRunBuilder.Output output = new GHCheckRunBuilder.Output("Big Run", "Lots of stuff here »")
+                .withText("Hello Text!");
+
         for (int i = 0; i < 101; i++) {
             output.add(
                     new GHCheckRunBuilder.Annotation("stuff.txt", 1, GHCheckRun.AnnotationLevel.NOTICE, "hello #" + i));
@@ -75,11 +79,12 @@ public class GHCheckRunBuilderTest extends AbstractGHAppInstallationTest {
                 .withConclusion(GHCheckRun.Conclusion.SUCCESS)
                 .add(output)
                 .create();
-        assertEquals("completed", checkRun.getStatus());
-        assertEquals("Big Run", checkRun.getOutput().getTitle());
-        assertEquals("Lots of stuff here »", checkRun.getOutput().getSummary());
-        assertEquals(101, checkRun.getOutput().getAnnotationsCount());
-        assertEquals(1424883599, checkRun.getId());
+        assertThat(checkRun.getStatus(), equalTo(Status.COMPLETED));
+        assertThat(checkRun.getOutput().getTitle(), equalTo("Big Run"));
+        assertThat(checkRun.getOutput().getSummary(), equalTo("Lots of stuff here »"));
+        assertThat(checkRun.getOutput().getAnnotationsCount(), equalTo(101));
+        assertThat(checkRun.getOutput().getText(), equalTo("Hello Text!"));
+        assertThat(checkRun.getId(), equalTo(1424883599L));
     }
 
     @Test
@@ -89,9 +94,9 @@ public class GHCheckRunBuilderTest extends AbstractGHAppInstallationTest {
                 .withConclusion(GHCheckRun.Conclusion.NEUTRAL)
                 .add(new GHCheckRunBuilder.Output("Quick note", "nothing more to see here"))
                 .create();
-        assertEquals("completed", checkRun.getStatus());
-        assertEquals(0, checkRun.getOutput().getAnnotationsCount());
-        assertEquals(1424883957, checkRun.getId());
+        assertThat(checkRun.getStatus(), equalTo(Status.COMPLETED));
+        assertThat(checkRun.getOutput().getAnnotationsCount(), equalTo(0));
+        assertThat(checkRun.getId(), equalTo(1424883957L));
     }
 
     @Test
@@ -100,9 +105,9 @@ public class GHCheckRunBuilderTest extends AbstractGHAppInstallationTest {
                 .createCheckRun("outstanding", "89a9ae301e35e667756034fdc933b1fc94f63fc1")
                 .withStatus(GHCheckRun.Status.IN_PROGRESS)
                 .create();
-        assertEquals("in_progress", checkRun.getStatus());
-        assertNull(checkRun.getConclusion());
-        assertEquals(1424883451, checkRun.getId());
+        assertThat(checkRun.getStatus(), equalTo(Status.IN_PROGRESS));
+        assertThat(checkRun.getConclusion(), nullValue());
+        assertThat(checkRun.getId(), equalTo(1424883451L));
     }
 
     @Test
@@ -114,8 +119,10 @@ public class GHCheckRunBuilderTest extends AbstractGHAppInstallationTest {
                     .create();
             fail("should have been rejected");
         } catch (HttpException x) {
-            assertEquals(422, x.getResponseCode());
+            assertThat(x.getResponseCode(), equalTo(422));
             assertThat(x.getMessage(), containsString("\\\"conclusion\\\" wasn't supplied"));
+            assertThat(x.getUrl(), containsString("/repos/hub4j-test-org/test-checks/check-runs"));
+            assertThat(x.getResponseMessage(), equalTo("422 Unprocessable Entity"));
         }
     }
 
@@ -136,9 +143,9 @@ public class GHCheckRunBuilderTest extends AbstractGHAppInstallationTest {
                 .withConclusion(GHCheckRun.Conclusion.SUCCESS)
                 .withCompletedAt(new Date(999_999_999))
                 .create();
-        assertEquals(updated.getStartedAt(), new Date(999_999_000));
-        assertEquals(updated.getName(), "foo");
-        assertEquals(1, checkRun.getOutput().getAnnotationsCount());
+        assertThat(new Date(999_999_000), equalTo(updated.getStartedAt()));
+        assertThat("foo", equalTo(updated.getName()));
+        assertThat(checkRun.getOutput().getAnnotationsCount(), equalTo(1));
     }
 
 }

src/test/java/org/kohsuke/github/GHContentIntegrationTest.java

@@ -11,8 +11,7 @@ import java.io.InputStreamReader;
 import java.nio.charset.StandardCharsets;
 import java.util.List;
 
-import static org.hamcrest.CoreMatchers.*;
-import static org.hamcrest.Matchers.hasProperty;
+import static org.hamcrest.Matchers.*;
 
 /**
  * Integration test for {@link GHContent}.
@@ -29,7 +28,7 @@ public class GHContentIntegrationTest extends AbstractGitHubWireMockTest {
     @After
     public void cleanup() throws Exception {
         if (mockGitHub.isUseProxy()) {
-            repo = getGitHubBeforeAfter().getRepository("hub4j-test-org/GHContentIntegrationTest");
+            repo = getNonRecordingGitHub().getRepository("hub4j-test-org/GHContentIntegrationTest");
             try {
                 GHContent content = repo.getFileContent(createdFilename);
                 if (content != null) {
@@ -45,36 +44,44 @@ public class GHContentIntegrationTest extends AbstractGitHubWireMockTest {
         repo = gitHub.getRepository("hub4j-test-org/GHContentIntegrationTest");
     }
 
+    @Test
+    public void testGetRepository() throws Exception {
+        GHRepository testRepo = gitHub.getRepositoryById(repo.getId());
+        assertThat(testRepo.getName(), equalTo(repo.getName()));
+        testRepo = gitHub.getRepositoryById(Long.toString(repo.getId()));
+        assertThat(testRepo.getName(), equalTo(repo.getName()));
+    }
+
     @Test
     public void testGetFileContent() throws Exception {
         repo = gitHub.getRepository("hub4j-test-org/GHContentIntegrationTest");
         GHContent content = repo.getFileContent("ghcontent-ro/a-file-with-content");
 
-        assertTrue(content.isFile());
-        assertEquals("thanks for reading me\n", content.getContent());
+        assertThat(content.isFile(), is(true));
+        assertThat(content.getContent(), equalTo("thanks for reading me\n"));
     }
 
     @Test
     public void testGetEmptyFileContent() throws Exception {
         GHContent content = repo.getFileContent("ghcontent-ro/an-empty-file");
 
-        assertTrue(content.isFile());
-        assertEquals("", content.getContent());
+        assertThat(content.isFile(), is(true));
+        assertThat(content.getContent(), is(emptyString()));
     }
 
     @Test
     public void testGetDirectoryContent() throws Exception {
         List<GHContent> entries = repo.getDirectoryContent("ghcontent-ro/a-dir-with-3-entries");
 
-        assertTrue(entries.size() == 3);
+        assertThat(entries.size(), equalTo(3));
     }
 
     @Test
     public void testGetDirectoryContentTrailingSlash() throws Exception {
-        // Used to truncate the ?ref=master, see gh-224 https://github.com/kohsuke/github-api/pull/224
-        List<GHContent> entries = repo.getDirectoryContent("ghcontent-ro/a-dir-with-3-entries/", "master");
+        // Used to truncate the ?ref=main, see gh-224 https://github.com/kohsuke/github-api/pull/224
+        List<GHContent> entries = repo.getDirectoryContent("ghcontent-ro/a-dir-with-3-entries/", "main");
 
-        assertTrue(entries.get(0).getUrl().endsWith("?ref=master"));
+        assertThat(entries.get(0).getUrl(), endsWith("?ref=main"));
     }
 
     @Test
@@ -84,11 +91,11 @@ public class GHContentIntegrationTest extends AbstractGitHubWireMockTest {
                 createdFilename);
         GHContent createdContent = created.getContent();
 
-        assertNotNull(created.getCommit());
-        assertNotNull(created.getContent());
-        assertNotNull(createdContent.getContent());
+        assertThat(created.getCommit(), notNullValue());
+        assertThat(created.getContent(), notNullValue());
+        assertThat(createdContent.getContent(), notNullValue());
         assertThat(createdContent.getPath(), equalTo(createdFilename));
-        assertEquals("this is an awesome file I created\n", createdContent.getContent());
+        assertThat(createdContent.getContent(), equalTo("this is an awesome file I created\n"));
 
         GHContent content = repo.getFileContent(createdFilename);
         assertThat(content, is(notNullValue()));
@@ -108,17 +115,17 @@ public class GHContentIntegrationTest extends AbstractGitHubWireMockTest {
                 "Updated file for integration tests.");
         GHContent updatedContent = updatedContentResponse.getContent();
 
-        assertNotNull(updatedContentResponse.getCommit());
-        assertNotNull(updatedContentResponse.getContent());
+        assertThat(updatedContentResponse.getCommit(), notNullValue());
+        assertThat(updatedContentResponse.getContent(), notNullValue());
         // due to what appears to be a cache propagation delay, this test is too flaky
-        assertEquals("this is some new content",
-                new BufferedReader(new InputStreamReader(updatedContent.read())).readLine());
-        assertEquals("this is some new content\n", updatedContent.getContent());
+        assertThat(new BufferedReader(new InputStreamReader(updatedContent.read())).readLine(),
+                equalTo("this is some new content"));
+        assertThat(updatedContent.getContent(), equalTo("this is some new content\n"));
 
         GHContentUpdateResponse deleteResponse = updatedContent.delete("Enough of this foolishness!");
 
-        assertNotNull(deleteResponse.getCommit());
-        assertNull(deleteResponse.getContent());
+        assertThat(deleteResponse.getCommit(), notNullValue());
+        assertThat(deleteResponse.getContent(), nullValue());
 
         try {
             repo.getFileContent(createdFilename);

src/test/java/org/kohsuke/github/GHDeploymentTest.java

@@ -6,6 +6,8 @@ import java.io.IOException;
 import java.util.Arrays;
 import java.util.Map;
 
+import static org.hamcrest.Matchers.*;
+
 /**
  * @author Martin van Zijl
  */
@@ -15,38 +17,38 @@ public class GHDeploymentTest extends AbstractGitHubWireMockTest {
     public void testGetDeploymentByIdStringPayload() throws IOException {
         final GHRepository repo = getRepository();
         final GHDeployment deployment = repo.getDeployment(178653229);
-        assertNotNull(deployment);
-        assertEquals(178653229, deployment.getId());
-        assertEquals("production", deployment.getEnvironment());
-        assertEquals("custom", deployment.getPayload());
-        assertEquals("custom", deployment.getPayloadObject());
-        assertEquals("master", deployment.getRef());
-        assertEquals("3a09d2de4a9a1322a0ba2c3e2f54a919ca8fe353", deployment.getSha());
-        assertEquals("deploy", deployment.getTask());
-        assertEquals("production", deployment.getOriginalEnvironment());
-        assertEquals(false, deployment.isProductionEnvironment());
-        assertEquals(true, deployment.isTransientEnvironment());
+        assertThat(deployment, notNullValue());
+        assertThat(deployment.getId(), equalTo(178653229L));
+        assertThat(deployment.getEnvironment(), equalTo("production"));
+        assertThat(deployment.getPayload(), equalTo("custom"));
+        assertThat(deployment.getPayloadObject(), equalTo("custom"));
+        assertThat(deployment.getRef(), equalTo("main"));
+        assertThat(deployment.getSha(), equalTo("3a09d2de4a9a1322a0ba2c3e2f54a919ca8fe353"));
+        assertThat(deployment.getTask(), equalTo("deploy"));
+        assertThat(deployment.getOriginalEnvironment(), equalTo("production"));
+        assertThat(deployment.isProductionEnvironment(), equalTo(false));
+        assertThat(deployment.isTransientEnvironment(), equalTo(true));
     }
 
     @Test
     public void testGetDeploymentByIdObjectPayload() throws IOException {
         final GHRepository repo = getRepository();
         final GHDeployment deployment = repo.getDeployment(178653229);
-        assertNotNull(deployment);
-        assertEquals(178653229, deployment.getId());
-        assertEquals("production", deployment.getEnvironment());
-        assertEquals("master", deployment.getRef());
-        assertEquals("3a09d2de4a9a1322a0ba2c3e2f54a919ca8fe353", deployment.getSha());
-        assertEquals("deploy", deployment.getTask());
+        assertThat(deployment, notNullValue());
+        assertThat(deployment.getId(), equalTo(178653229L));
+        assertThat(deployment.getEnvironment(), equalTo("production"));
+        assertThat(deployment.getRef(), equalTo("main"));
+        assertThat(deployment.getSha(), equalTo("3a09d2de4a9a1322a0ba2c3e2f54a919ca8fe353"));
+        assertThat(deployment.getTask(), equalTo("deploy"));
         final Map<String, Object> payload = deployment.getPayloadMap();
-        assertEquals(4, payload.size());
-        assertEquals(1, payload.get("custom1"));
-        assertEquals("two", payload.get("custom2"));
-        assertEquals(Arrays.asList("3", 3, "three"), payload.get("custom3"));
-        assertNull(payload.get("custom4"));
-        assertEquals("production", deployment.getOriginalEnvironment());
-        assertEquals(false, deployment.isProductionEnvironment());
-        assertEquals(true, deployment.isTransientEnvironment());
+        assertThat(payload.size(), equalTo(4));
+        assertThat(payload.get("custom1"), equalTo(1));
+        assertThat(payload.get("custom2"), equalTo("two"));
+        assertThat(payload.get("custom3"), equalTo(Arrays.asList("3", 3, "three")));
+        assertThat(payload.get("custom4"), nullValue());
+        assertThat(deployment.getOriginalEnvironment(), equalTo("production"));
+        assertThat(deployment.isProductionEnvironment(), equalTo(false));
+        assertThat(deployment.isTransientEnvironment(), equalTo(true));
     }
 
     protected GHRepository getRepository() throws IOException {