[maven-release-plugin] prepare release github-api-1.125

Implement GHWorkflow, GHWorkflowRun and associated payloads

.gitattributes

@@ -0,0 +1 @@
+*.java text eol=lf

.github/PULL_REQUEST_TEMPLATE.md

@@ -7,8 +7,7 @@ We love getting PRs, but we hate asking people for the same basic changes every
 - [ ] Push your changes to a branch other than `master`. Create your PR from that branch.    
 - [ ] Add JavaDocs and other comments
 - [ ] Write tests that run and pass in CI. See [CONTRIBUTING.md](CONTRIBUTING.md) for details on how to capture snapshot data.
-- [ ] Run `mvn clean compile` locally. This may reformat your code, commit those changes.
-- [ ] Run `mvn -D enable-ci clean install site` locally. If this command doesn't succeed, your change will not pass CI.
+- [ ] Run `mvn -D enable-ci clean install site` locally. If this command doesn't succeed, your change will not pass CI. 
 
 # When creating a PR: 
 

.github/workflows/maven-build.yml

@@ -2,14 +2,18 @@ name: CI
 
 on: [push, pull_request]
 
+# this is required by spotless for JDK 16+
+env:
+  JAVA_11_PLUS_MAVEN_OPTS: "--add-opens jdk.compiler/com.sun.tools.javac.util=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.file=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.parser=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.tree=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.api=ALL-UNNAMED"
 
 jobs:
   build:
     name: build-only (Java ${{ matrix.java }})
     runs-on: ubuntu-latest
     strategy:
+      fail-fast: false
       matrix:
-        java: [ 13 ]
+        java: [ 16 ]
     steps:
       - uses: actions/checkout@v2
       - name: Set up JDK
@@ -17,18 +21,21 @@ jobs:
         with:
           java-version: ${{ matrix.java }}
       - name: Cached .m2
-        uses: actions/cache@v2
+        uses: actions/cache@v2.1.4
         with:
           path: ~/.m2/repository
           key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
           restore-keys: |
             ${{ runner.os }}-maven-
       - name: Maven Install (skipTests)
+        env:
+          MAVEN_OPTS: ${{ env.JAVA_11_PLUS_MAVEN_OPTS }}
         run: mvn -B install -DskipTests -D enable-ci --file pom.xml
   site:
     name: site (Java ${{ matrix.java }})
     runs-on: ubuntu-latest
     strategy:
+      fail-fast: false
       matrix:
         java: [ 8, 11 ]
     steps:
@@ -37,7 +44,7 @@ jobs:
         uses: actions/setup-java@v1
         with:
           java-version: ${{ matrix.java }}
-      - uses: actions/cache@v2
+      - uses: actions/cache@v2.1.4
         with:
           path: ~/.m2/repository
           key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
@@ -49,24 +56,37 @@ jobs:
     name: test (${{ matrix.os }}, Java ${{ matrix.java }})
     runs-on: ${{ matrix.os }}-latest
     strategy:
+      fail-fast: false
       matrix:
         os: [ ubuntu, windows ]
-        java: [ 8, 11, 13, 15-ea ]
+        java: [ 8, 11, 16 ]
     steps:
     - uses: actions/checkout@v2
     - name: Set up JDK
       uses: actions/setup-java@v1
       with:
         java-version: ${{ matrix.java }}
-    - uses: actions/cache@v2
+    - uses: actions/cache@v2.1.4
       with:
         path: ~/.m2/repository
         key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
         restore-keys: |
           ${{ runner.os }}-maven-
+    # JDK 8
     - name: Maven Install without Code Coverage
-      if: matrix.os == 'windows'
+      if: matrix.os == 'windows' && matrix.java == '8'
       run: mvn -B install --file pom.xml
     - name: Maven Install with Code Coverage
-      if: matrix.os != 'windows'
+      if: matrix.os != 'windows' && matrix.java == '8'
+      run: mvn -B install -D enable-ci --file pom.xml
+    # JDK 11+
+    - name: Maven Install without Code Coverage
+      if: matrix.os == 'windows' && matrix.java != '8'
+      env:
+        MAVEN_OPTS: ${{ env.JAVA_11_PLUS_MAVEN_OPTS }}
+      run: mvn -B install --file pom.xml
+    - name: Maven Install with Code Coverage
+      if: matrix.os != 'windows' && matrix.java != '8'
+      env:
+        MAVEN_OPTS: ${{ env.JAVA_11_PLUS_MAVEN_OPTS }}
       run: mvn -B install -D enable-ci --file pom.xml

CONTRIBUTING.md

@@ -21,7 +21,7 @@ Example for a single test case:
 
 ### Setting up credential
 
-1. Create an OAuth token on github.com
+1. Create a "Personal access token" on https://github.com/ (`Settings` > `Developer settings` > `Personal access tokens`)
 2. Set the GITHUB_OAUTH environment variable to the value of that token
 3. Set the system property `test.github.useProxy` (usually like "-Dtest.github.useProxy" as a Java VM option)
 

pom.xml

@@ -2,7 +2,7 @@
   <modelVersion>4.0.0</modelVersion>
   <groupId>org.kohsuke</groupId>
   <artifactId>github-api</artifactId>
-  <version>1.118</version>
+  <version>1.125</version>
   <name>GitHub API for Java</name>
   <url>https://github-api.kohsuke.org/</url>
   <description>GitHub API for Java</description>
@@ -11,7 +11,7 @@
     <connection>scm:git:git@github.com/hub4j/${project.artifactId}.git</connection>
     <developerConnection>scm:git:ssh://git@github.com/hub4j/${project.artifactId}.git</developerConnection>
     <url>https://github.com/hub4j/github-api/</url>
-    <tag>github-api-1.118</tag>
+    <tag>github-api-1.125</tag>
   </scm>
 
   <distributionManagement>
@@ -33,18 +33,20 @@
 
   <properties>
     <project.build.sourceEncoding>UTF-8</project.build.sourceEncoding>
-    <spotbugs-maven-plugin.version>4.1.4</spotbugs-maven-plugin.version>
-    <spotbugs.version>4.1.3</spotbugs.version>
+    <spotbugs-maven-plugin.version>4.2.0</spotbugs-maven-plugin.version>
+    <spotbugs.version>4.2.1</spotbugs.version>
     <spotbugs-maven-plugin.failOnError>true</spotbugs-maven-plugin.failOnError>
     <hamcrest.version>2.2</hamcrest.version>
     <okhttp3.version>4.4.1</okhttp3.version>
     <okio.version>2.5.0</okio.version>
-    <spotless-maven-plugin.goal>apply</spotless-maven-plugin.goal>
     <!-- Using this as the minimum bar for code coverage.  Adding methods without covering them will fail this. -->
-    <jacoco.coverage.target.bundle.method>0.60</jacoco.coverage.target.bundle.method>
-    <jacoco.coverage.target.class.method>0.25</jacoco.coverage.target.class.method>
+    <jacoco.coverage.target.bundle.method>0.70</jacoco.coverage.target.bundle.method>
+    <jacoco.coverage.target.class.method>0.50</jacoco.coverage.target.class.method>
     <!-- For non-ci builds we'd like the build to still complete if jacoco metrics aren't met. -->
     <jacoco.haltOnFailure>false</jacoco.haltOnFailure>
+    <jjwt.suite.version>0.11.2</jjwt.suite.version>
+
+    <surefire.argLine />
   </properties>
 
   <build>
@@ -152,59 +154,39 @@
                       <!-- Sample only -->
                       <exclude>org.kohsuke.github.example.*</exclude>
 
-                      <!-- No methods -->
-                      <exclude>org.kohsuke.github.Previews</exclude>
 
                       <!-- Deprecated -->
                       <exclude>org.kohsuke.github.extras.OkHttp3Connector</exclude>
                       <exclude>org.kohsuke.github.EnforcementLevel</exclude>
                       <exclude>org.kohsuke.github.GHPerson.1</exclude>
-
-                      <!-- These fail coverage on windows because tests are disabled -->
-                      <exclude>org.kohsuke.github.GHAsset</exclude>
-                      <exclude>org.kohsuke.github.GHReleaseBuilder</exclude>
-                      <exclude>org.kohsuke.github.GHRelease</exclude>
+                      <!-- TODO: Some coverage, but more needed -->
+                      <exclude>org.kohsuke.github.GHPullRequestReviewBuilder.DraftReviewComment</exclude>
+                      <exclude>org.kohsuke.github.GHIssue.PullRequest</exclude>
+                      <exclude>org.kohsuke.github.GHCommitSearchBuilder</exclude>
+                      <exclude>org.kohsuke.github.GHRepositorySearchBuilder</exclude>
+                      <exclude>org.kohsuke.github.GHUserSearchBuilder</exclude>
 
                       <!-- TODO: These still need test coverage -->
                       <exclude>org.kohsuke.github.GHBranchProtection.RequiredSignatures</exclude>
                       <exclude>org.kohsuke.github.GHBranchProtectionBuilder.Restrictions</exclude>
                       <exclude>org.kohsuke.github.GHBranchProtection.Restrictions</exclude>
                       <exclude>org.kohsuke.github.GHCommentAuthorAssociation</exclude>
-                      <exclude>org.kohsuke.github.GHCommitBuilder.UserInfo</exclude>
-                      <exclude>org.kohsuke.github.GHCommitState</exclude>
                       <exclude>org.kohsuke.github.GHCompare.Commit</exclude>
                       <exclude>org.kohsuke.github.GHCompare.InnerCommit</exclude>
-                      <exclude>org.kohsuke.github.GHCompare.Status</exclude>
                       <exclude>org.kohsuke.github.GHCompare.Tree</exclude>
                       <exclude>org.kohsuke.github.GHCompare.User</exclude>
                       <exclude>org.kohsuke.github.GHCompare</exclude>
                       <exclude>org.kohsuke.github.GHDeployKey</exclude>
-                      <exclude>org.kohsuke.github.GHDeploymentStatusBuilder</exclude>
-                      <exclude>org.kohsuke.github.GHDirection</exclude>
                       <exclude>org.kohsuke.github.GHEmail</exclude>
-                      <exclude>org.kohsuke.github.GHEventPayload.Ping</exclude>
-                      <exclude>org.kohsuke.github.GHEventPayload.Release</exclude>
-                      <exclude>org.kohsuke.github.GHException</exclude>
-                      <exclude>org.kohsuke.github.GHHook</exclude>
-                      <exclude>org.kohsuke.github.GHHooks.OrgContext</exclude>
                       <exclude>org.kohsuke.github.GHInvitation</exclude>
-                      <exclude>org.kohsuke.github.GHMilestoneState</exclude>
-                      <exclude>org.kohsuke.github.GHOrgHook</exclude>
-                      <exclude>org.kohsuke.github.GHProject.ProjectStateFilter</exclude>
                       <exclude>org.kohsuke.github.GHPullRequestCommitDetail.Authorship</exclude>
                       <exclude>org.kohsuke.github.GHPullRequestCommitDetail.Commit</exclude>
                       <exclude>org.kohsuke.github.GHPullRequestCommitDetail.CommitPointer</exclude>
                       <exclude>org.kohsuke.github.GHPullRequestCommitDetail.Tree</exclude>
                       <exclude>org.kohsuke.github.GHPullRequestCommitDetail</exclude>
                       <exclude>org.kohsuke.github.GHPullRequestFileDetail</exclude>
-                      <exclude>org.kohsuke.github.GHPullRequestQueryBuilder.Sort</exclude>
                       <exclude>org.kohsuke.github.GHReleaseUpdater</exclude>
-                      <exclude>org.kohsuke.github.GHRepository.ForkSort</exclude>
                       <exclude>org.kohsuke.github.GHRequestedAction</exclude>
-                      <exclude>org.kohsuke.github.GHStargazer</exclude>
-                      <exclude>org.kohsuke.github.GHTagObject</exclude>
-                      <exclude>org.kohsuke.github.GHTeam.Role</exclude>
-                      <exclude>org.kohsuke.github.GHUserSearchBuilder.Sort</exclude>
                       <exclude>org.kohsuke.github.GHVerifiedKey</exclude>
                     </excludes>
                   </rule>
@@ -292,18 +274,7 @@
             <id>default-test</id>
             <configuration>
               <excludesFile>src/test/resources/slow-or-flaky-tests.txt</excludesFile>
-            </configuration>
-          </execution>
-          <execution>
-            <id>slow-or-flaky-test</id>
-            <phase>test</phase>
-            <goals>
-              <goal>test</goal>
-            </goals>
-            <configuration>
-              <rerunFailingTestsCount>2</rerunFailingTestsCount>
-              <!-- There are some tests that take longer or are a little flaky.  Run them here. -->
-              <includesFile>src/test/resources/slow-or-flaky-tests.txt</includesFile>
+              <argLine>${surefire.argLine}</argLine>
             </configuration>
           </execution>
         </executions>
@@ -311,7 +282,7 @@
       <plugin>
         <groupId>org.codehaus.mojo</groupId>
         <artifactId>animal-sniffer-maven-plugin</artifactId>
-        <version>1.19</version>
+        <version>1.20</version>
         <configuration>
           <signature>
             <groupId>org.codehaus.mojo.signature</groupId>
@@ -344,13 +315,14 @@
       <plugin>
         <groupId>com.diffplug.spotless</groupId>
         <artifactId>spotless-maven-plugin</artifactId>
-        <version>2.6.1</version>
+        <version>2.8.1</version>
         <executions>
           <execution>
             <id>spotless-check</id>
-            <phase>process-sources</phase>
+            <!-- runs in verify phase by default -->
             <goals>
-              <goal>${spotless-maven-plugin.goal}</goal>
+              <!-- can be disabled using -Dspotless.check.skip=true -->
+              <goal>check</goal>
             </goals>
           </execution>
         </executions>
@@ -409,7 +381,7 @@
     <dependency>
       <groupId>com.tngtech.archunit</groupId>
       <artifactId>archunit</artifactId>
-      <version>0.15.0</version>
+      <version>0.17.0</version>
       <scope>test</scope>
     </dependency>
     <dependency>
@@ -434,13 +406,19 @@
     <dependency>
       <groupId>junit</groupId>
       <artifactId>junit</artifactId>
-      <version>4.13.1</version>
+      <version>4.13.2</version>
+      <scope>test</scope>
+    </dependency>
+    <dependency>
+      <groupId>org.awaitility</groupId>
+      <artifactId>awaitility</artifactId>
+      <version>4.0.3</version>
       <scope>test</scope>
     </dependency>
     <dependency>
       <groupId>com.fasterxml.jackson.core</groupId>
       <artifactId>jackson-databind</artifactId>
-      <version>2.10.2</version>
+      <version>2.12.1</version>
     </dependency>
     <dependency>
       <groupId>commons-io</groupId>
@@ -489,20 +467,20 @@
     <dependency>
       <groupId>io.jsonwebtoken</groupId>
       <artifactId>jjwt-api</artifactId>
-      <version>0.11.2</version>
-      <scope>test</scope>
+      <version>${jjwt.suite.version}</version>
+      <optional>true</optional>
     </dependency>
     <dependency>
       <groupId>io.jsonwebtoken</groupId>
       <artifactId>jjwt-impl</artifactId>
-      <version>0.11.2</version>
-      <scope>test</scope>
+      <version>${jjwt.suite.version}</version>
+      <optional>true</optional>
     </dependency>
     <dependency>
       <groupId>io.jsonwebtoken</groupId>
       <artifactId>jjwt-jackson</artifactId>
-      <version>0.11.2</version>
-      <scope>test</scope>
+      <version>${jjwt.suite.version}</version>
+      <optional>true</optional>
     </dependency>
     <dependency>
       <groupId>com.squareup.okio</groupId>
@@ -539,7 +517,7 @@
     <dependency>
       <groupId>org.mockito</groupId>
       <artifactId>mockito-core</artifactId>
-      <version>3.6.28</version>
+      <version>3.7.7</version>
       <scope>test</scope>
     </dependency>
     <dependency>
@@ -580,6 +558,48 @@
     </pluginRepository>
   </pluginRepositories>
   <profiles>
+    <!-- only enable slow-or-flaky-test if -Dtest= is not present -->
+    <profile>
+      <id>slow-or-flaky-test</id>
+      <activation>
+        <property>
+          <name>!test</name>
+        </property>
+      </activation>
+      <build>
+        <plugins>
+          <plugin>
+            <artifactId>maven-surefire-plugin</artifactId>
+            <executions>
+              <execution>
+                <id>slow-or-flaky-test</id>
+                <phase>test</phase>
+                <goals>
+                  <goal>test</goal>
+                </goals>
+                <configuration>
+                  <rerunFailingTestsCount>2</rerunFailingTestsCount>
+                  <!-- There are some tests that take longer or are a little
+                    flaky. Run them here. -->
+                  <includesFile>src/test/resources/slow-or-flaky-tests.txt</includesFile>
+                  <argLine>${surefire.argLine}</argLine>
+                </configuration>
+              </execution>
+            </executions>
+          </plugin>
+        </plugins>
+      </build>
+    </profile>
+    <profile>
+      <id>jdk11+</id>
+      <activation>
+        <jdk>[11,)</jdk>
+      </activation>
+      <properties>
+        <!-- this is required for GithubHttpUrlConnectionClient#setRequestMethod() to work with JDK 16+ -->
+        <surefire.argLine>--add-opens java.base/java.net=ALL-UNNAMED</surefire.argLine>
+      </properties>
+    </profile>
     <profile>
       <id>ci-non-windows</id>
       <activation>
@@ -591,7 +611,8 @@
         </os>
       </activation>
       <properties>
-        <spotless-maven-plugin.goal>check</spotless-maven-plugin.goal>
+        <!-- Only fail code coverage on non-windows machines -->
+        <jacoco.haltOnFailure>true</jacoco.haltOnFailure>
       </properties>
     </profile>
     <profile>
@@ -601,23 +622,31 @@
           <name>enable-ci</name>
         </property>
       </activation>
-      <properties>
-        <jacoco.haltOnFailure>true</jacoco.haltOnFailure>
-      </properties>
       <build>
         <plugins>
           <plugin>
             <groupId>org.jacoco</groupId>
             <artifactId>jacoco-maven-plugin</artifactId>
           </plugin>
+          <plugin>
+            <groupId>com.diffplug.spotless</groupId>
+            <artifactId>spotless-maven-plugin</artifactId>
+            <executions>
+              <execution>
+                <id>spotless-check</id>
+                <!-- In CI, run check early in the build -->
+                <phase>process-sources</phase>
+                <goals>
+                  <goal>check</goal>
+                </goals>
+              </execution>
+            </executions>
+          </plugin>
         </plugins>
       </build>
     </profile>
     <profile>
       <id>release</id>
-      <properties>
-        <spotless-maven-plugin.goal>check</spotless-maven-plugin.goal>
-      </properties>
       <build>
         <plugins>
           <plugin>

src/main/java/org/kohsuke/github/GHApp.java

@@ -5,7 +5,7 @@ import java.net.URL;
 import java.util.List;
 import java.util.Map;
 
-import static org.kohsuke.github.Previews.MACHINE_MAN;
+import static org.kohsuke.github.internal.Previews.MACHINE_MAN;
 
 /**
  * A Github App.

src/main/java/org/kohsuke/github/GHAppCreateTokenBuilder.java

@@ -5,7 +5,7 @@ import java.util.HashMap;
 import java.util.List;
 import java.util.Map;
 
-import static org.kohsuke.github.Previews.MACHINE_MAN;
+import static org.kohsuke.github.internal.Previews.MACHINE_MAN;
 
 /**
  * Creates a access token for a GitHub App Installation

src/main/java/org/kohsuke/github/GHAppInstallation.java

@@ -8,8 +8,8 @@ import java.net.URL;
 import java.util.List;
 import java.util.Map;
 
-import static org.kohsuke.github.Previews.GAMBIT;
-import static org.kohsuke.github.Previews.MACHINE_MAN;
+import static org.kohsuke.github.internal.Previews.GAMBIT;
+import static org.kohsuke.github.internal.Previews.MACHINE_MAN;
 
 /**
  * A Github App Installation.

src/main/java/org/kohsuke/github/GHBranch.java

@@ -3,6 +3,7 @@ package org.kohsuke.github;
 import com.fasterxml.jackson.annotation.JsonCreator;
 import com.fasterxml.jackson.annotation.JsonProperty;
 import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
+import org.kohsuke.github.internal.Previews;
 
 import java.io.IOException;
 import java.net.URL;

src/main/java/org/kohsuke/github/GHBranchProtection.java

@@ -6,7 +6,7 @@ import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
 import java.io.IOException;
 import java.util.Collection;
 
-import static org.kohsuke.github.Previews.ZZZAX;
+import static org.kohsuke.github.internal.Previews.ZZZAX;
 
 /**
  * The type GHBranchProtection.

src/main/java/org/kohsuke/github/GHBranchProtectionBuilder.java

@@ -12,7 +12,7 @@ import java.util.List;
 import java.util.Map;
 import java.util.Set;
 
-import static org.kohsuke.github.Previews.*;
+import static org.kohsuke.github.internal.Previews.LUKE_CAGE;
 
 /**
  * Builder to configure the branch protection settings.

src/main/java/org/kohsuke/github/GHCheckRun.java

@@ -1,8 +1,13 @@
 package org.kohsuke.github;
 
 import com.fasterxml.jackson.annotation.JsonProperty;
+import com.infradna.tool.bridge_method_injector.WithBridgeMethods;
 import edu.umd.cs.findbugs.annotations.NonNull;
 import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
+import org.kohsuke.github.GHWorkflowRun.Conclusion;
+import org.kohsuke.github.GHWorkflowRun.Status;
+import org.kohsuke.github.internal.EnumUtils;
+import org.kohsuke.github.internal.Previews;
 
 import java.io.IOException;
 import java.net.URL;
@@ -10,6 +15,7 @@ import java.util.Arrays;
 import java.util.Collections;
 import java.util.Date;
 import java.util.List;
+import java.util.Locale;
 
 /**
  * Represents a check run.
@@ -79,12 +85,27 @@ public class GHCheckRun extends GHObject {
      * @return Status of the check run
      * @see Status
      */
-    public String getStatus() {
+    @WithBridgeMethods(value = String.class, adapterMethod = "statusAsStr")
+    public Status getStatus() {
+        return Status.from(status);
+    }
+
+    @SuppressFBWarnings(value = "UPM_UNCALLED_PRIVATE_METHOD", justification = "Bridge method of getStatus")
+    private Object statusAsStr(Status status, Class type) {
         return status;
     }
 
     public static enum Status {
-        QUEUED, IN_PROGRESS, COMPLETED
+        QUEUED, IN_PROGRESS, COMPLETED, UNKNOWN;
+
+        public static Status from(String value) {
+            return EnumUtils.getNullableEnumOrDefault(Status.class, value, Status.UNKNOWN);
+        }
+
+        @Override
+        public String toString() {
+            return name().toLowerCase(Locale.ROOT);
+        }
     }
 
     /**
@@ -93,7 +114,13 @@ public class GHCheckRun extends GHObject {
      * @return Status of the check run
      * @see Conclusion
      */
-    public String getConclusion() {
+    @WithBridgeMethods(value = String.class, adapterMethod = "conclusionAsStr")
+    public Conclusion getConclusion() {
+        return Conclusion.from(conclusion);
+    }
+
+    @SuppressFBWarnings(value = "UPM_UNCALLED_PRIVATE_METHOD", justification = "Bridge method of getConclusion")
+    private Object conclusionAsStr(Conclusion conclusion, Class type) {
         return conclusion;
     }
 
@@ -104,7 +131,16 @@ public class GHCheckRun extends GHObject {
      * Parameters - <code>conclusion</code></a>.
      */
     public static enum Conclusion {
-        SUCCESS, FAILURE, NEUTRAL, CANCELLED, TIMED_OUT, ACTION_REQUIRED, SKIPPED
+        ACTION_REQUIRED, CANCELLED, FAILURE, NEUTRAL, SUCCESS, SKIPPED, STALE, TIMED_OUT, UNKNOWN;
+
+        public static Conclusion from(String value) {
+            return EnumUtils.getNullableEnumOrDefault(Conclusion.class, value, Conclusion.UNKNOWN);
+        }
+
+        @Override
+        public String toString() {
+            return name().toLowerCase(Locale.ROOT);
+        }
     }
 
     /**

src/main/java/org/kohsuke/github/GHCheckRunBuilder.java

@@ -28,6 +28,7 @@ import com.fasterxml.jackson.annotation.JsonInclude;
 import edu.umd.cs.findbugs.annotations.CheckForNull;
 import edu.umd.cs.findbugs.annotations.NonNull;
 import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
+import org.kohsuke.github.internal.Previews;
 
 import java.io.IOException;
 import java.util.Collections;
@@ -151,7 +152,7 @@ public final class GHCheckRunBuilder {
         }
         GHCheckRun run = requester.with("output", output).with("actions", actions).fetch(GHCheckRun.class).wrap(repo);
         while (!extraAnnotations.isEmpty()) {
-            Output output2 = new Output(output.title, output.summary);
+            Output output2 = new Output(output.title, output.summary).withText(output.text);
             int i = Math.min(extraAnnotations.size(), MAX_ANNOTATIONS);
             output2.annotations = extraAnnotations.subList(0, i);
             extraAnnotations = extraAnnotations.subList(i, extraAnnotations.size());

src/main/java/org/kohsuke/github/GHCommit.java

@@ -11,8 +11,8 @@ import java.util.Collections;
 import java.util.Date;
 import java.util.List;
 
-import static org.kohsuke.github.Previews.ANTIOPE;
-import static org.kohsuke.github.Previews.GROOT;
+import static org.kohsuke.github.internal.Previews.ANTIOPE;
+import static org.kohsuke.github.internal.Previews.GROOT;
 
 /**
  * A commit in a repository.

src/main/java/org/kohsuke/github/GHCommitComment.java

@@ -5,7 +5,7 @@ import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
 import java.io.IOException;
 import java.net.URL;
 
-import static org.kohsuke.github.Previews.*;
+import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
 
 /**
  * A comment attached to a commit (or a specific line in a specific file of a commit.)

src/main/java/org/kohsuke/github/GHCommitSearchBuilder.java

@@ -1,6 +1,7 @@
 package org.kohsuke.github;
 
 import org.apache.commons.lang3.StringUtils;
+import org.kohsuke.github.internal.Previews;
 
 import java.io.IOException;
 

src/main/java/org/kohsuke/github/GHCreateRepositoryBuilder.java

@@ -2,7 +2,7 @@ package org.kohsuke.github;
 
 import java.io.IOException;
 
-import static org.kohsuke.github.Previews.BAPTISTE;
+import static org.kohsuke.github.internal.Previews.BAPTISTE;
 
 /**
  * Creates a repository

src/main/java/org/kohsuke/github/GHDeployment.java

@@ -1,5 +1,7 @@
 package org.kohsuke.github;
 
+import org.kohsuke.github.internal.Previews;
+
 import java.io.IOException;
 import java.net.URL;
 import java.util.Map;

src/main/java/org/kohsuke/github/GHDeploymentBuilder.java

@@ -1,5 +1,7 @@
 package org.kohsuke.github;
 
+import org.kohsuke.github.internal.Previews;
+
 import java.io.IOException;
 import java.util.List;
 

src/main/java/org/kohsuke/github/GHDeploymentState.java

@@ -1,5 +1,7 @@
 package org.kohsuke.github;
 
+import org.kohsuke.github.internal.Previews;
+
 /**
  * Represents the state of deployment
  */

src/main/java/org/kohsuke/github/GHDeploymentStatus.java

@@ -1,5 +1,7 @@
 package org.kohsuke.github;
 
+import org.kohsuke.github.internal.Previews;
+
 import java.net.URL;
 import java.util.Locale;
 

src/main/java/org/kohsuke/github/GHDeploymentStatusBuilder.java

@@ -1,5 +1,7 @@
 package org.kohsuke.github;
 
+import org.kohsuke.github.internal.Previews;
+
 import java.io.IOException;
 
 /**

src/main/java/org/kohsuke/github/GHDiscussion.java

@@ -1,6 +1,7 @@
 package org.kohsuke.github;
 
 import com.fasterxml.jackson.annotation.JsonProperty;
+import org.kohsuke.github.internal.Previews;
 
 import java.io.IOException;
 import java.net.URL;

src/main/java/org/kohsuke/github/GHEvent.java

@@ -12,6 +12,7 @@ import java.util.Locale;
 public enum GHEvent {
     CHECK_RUN,
     CHECK_SUITE,
+    CODE_SCANNING_ALERT,
     COMMIT_COMMENT,
     CONTENT_REFERENCE,
     CREATE,

src/main/java/org/kohsuke/github/GHEventPayload.java

@@ -5,7 +5,9 @@ import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
 
 import java.io.IOException;
 import java.io.Reader;
+import java.util.Date;
 import java.util.List;
+import java.util.Map;
 
 /**
  * Base type for types used in databinding of the event payload.
@@ -380,9 +382,9 @@ public class GHEventPayload extends GitHubInteractiveObject {
         }
 
         /**
-         * Gets label.
+         * Gets the added or removed label for labeled/unlabeled events.
          *
-         * @return the label
+         * @return label the added or removed label
          */
         public GHLabel getLabel() {
             return label;
@@ -519,6 +521,10 @@ public class GHEventPayload extends GitHubInteractiveObject {
     public static class Issue extends GHEventPayload {
         private GHIssue issue;
 
+        private GHLabel label;
+
+        private GHIssueChanges changes;
+
         /**
          * Gets issue.
          *
@@ -538,6 +544,24 @@ public class GHEventPayload extends GitHubInteractiveObject {
             this.issue = issue;
         }
 
+        /**
+         * Gets the added or removed label for labeled/unlabeled events.
+         *
+         * @return label the added or removed label
+         */
+        public GHLabel getLabel() {
+            return label;
+        }
+
+        /**
+         * Get changes (for action="edited")
+         *
+         * @return changes
+         */
+        public GHIssueChanges getChanges() {
+            return changes;
+        }
+
         @Override
         void wrapUp(GitHub root) {
             super.wrapUp(root);
@@ -1067,7 +1091,7 @@ public class GHEventPayload extends GitHubInteractiveObject {
         public static class PushCommit {
             private GitUser author;
             private GitUser committer;
-            private String url, sha, message;
+            private String url, sha, message, timestamp;
             private boolean distinct;
             private List<String> added, removed, modified;
 
@@ -1156,6 +1180,15 @@ public class GHEventPayload extends GitHubInteractiveObject {
             public List<String> getModified() {
                 return modified;
             }
+
+            /**
+             * Obtains the timestamp of the commit
+             *
+             * @return the timestamp
+             */
+            public Date getTimestamp() {
+                return GitHubClient.parseDate(timestamp);
+            }
         }
     }
 
@@ -1294,4 +1327,86 @@ public class GHEventPayload extends GitHubInteractiveObject {
             }
         }
     }
+
+    /**
+     * Occurs when someone triggered a workflow run or sends a POST request to the "Create a workflow dispatch event"
+     * endpoint.
+     *
+     * @see <a href=
+     *      "https://docs.github.com/en/developers/webhooks-and-events/webhook-events-and-payloads#workflow_dispatch">
+     *      workflow dispatch event</a>
+     * @see <a href=
+     *      "https://docs.github.com/en/actions/reference/events-that-trigger-workflows#workflow_dispatch">Events that
+     *      trigger workflows</a>
+     */
+    public static class WorkflowDispatch extends GHEventPayload {
+        private Map<String, Object> inputs;
+        private String ref;
+        private String workflow;
+
+        /**
+         * Gets the map of input parameters passed to the workflow.
+         *
+         * @return the map of input parameters
+         */
+        public Map<String, Object> getInputs() {
+            return inputs;
+        }
+
+        /**
+         * Gets the ref of the branch (e.g. refs/heads/main)
+         *
+         * @return the ref of the branch
+         */
+        public String getRef() {
+            return ref;
+        }
+
+        /**
+         * Gets the path of the workflow file (e.g. .github/workflows/hello-world-workflow.yml).
+         *
+         * @return the path of the workflow file
+         */
+        public String getWorkflow() {
+            return workflow;
+        }
+    }
+
+    /**
+     * A workflow run was requested or completed.
+     *
+     * @see <a href=
+     *      "https://docs.github.com/en/developers/webhooks-and-events/webhook-events-and-payloads#workflow_run">
+     *      workflow run event</a>
+     * @see <a href="https://docs.github.com/en/rest/reference/actions#workflow-runs">Actions Workflow Runs</a>
+     */
+    public static class WorkflowRun extends GHEventPayload {
+        private GHWorkflowRun workflowRun;
+        private GHWorkflow workflow;
+
+        public GHWorkflowRun getWorkflowRun() {
+            return workflowRun;
+        }
+
+        public GHWorkflow getWorkflow() {
+            return workflow;
+        }
+
+        @Override
+        void wrapUp(GitHub root) {
+            super.wrapUp(root);
+            if (workflowRun == null || workflow == null) {
+                throw new IllegalStateException(
+                        "Expected workflow and workflow_run payload, but got something else. Maybe we've got another type of event?");
+            }
+            GHRepository repository = getRepository();
+            if (repository != null) {
+                workflowRun.wrapUp(repository);
+                workflow.wrapUp(repository);
+            } else {
+                workflowRun.wrapUp(root);
+                workflow.wrapUp(root);
+            }
+        }
+    }
 }

src/main/java/org/kohsuke/github/GHIssue.java

@@ -39,7 +39,7 @@ import java.util.List;
 import java.util.Locale;
 import java.util.Objects;
 
-import static org.kohsuke.github.Previews.SQUIRREL_GIRL;
+import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
 
 /**
  * Represents an issue on GitHub.
@@ -312,7 +312,7 @@ public class GHIssue extends GHObject implements Reactable {
     }
 
     /**
-     * Sets labels.
+     * Sets labels on the target to a specific list.
      *
      * @param labels
      *            the labels
@@ -326,6 +326,8 @@ public class GHIssue extends GHObject implements Reactable {
     /**
      * Adds labels to the issue.
      *
+     * Labels that are already present on the target are ignored.
+     *
      * @param names
      *            Names of the label
      * @throws IOException
@@ -338,6 +340,8 @@ public class GHIssue extends GHObject implements Reactable {
     /**
      * Add labels.
      *
+     * Labels that are already present on the target are ignored.
+     *
      * @param labels
      *            the labels
      * @throws IOException
@@ -350,6 +354,8 @@ public class GHIssue extends GHObject implements Reactable {
     /**
      * Add labels.
      *
+     * Labels that are already present on the target are ignored.
+     *
      * @param labels
      *            the labels
      * @throws IOException
@@ -360,21 +366,27 @@ public class GHIssue extends GHObject implements Reactable {
     }
 
     private void _addLabels(Collection<String> names) throws IOException {
-        List<String> newLabels = new ArrayList<String>();
-
-        for (GHLabel label : getLabels()) {
-            newLabels.add(label.getName());
-        }
-        for (String name : names) {
-            if (!newLabels.contains(name)) {
-                newLabels.add(name);
-            }
-        }
-        setLabels(newLabels.toArray(new String[0]));
+        root.createRequest().with("labels", names).method("POST").withUrlPath(getIssuesApiRoute() + "/labels").send();
     }
 
     /**
-     * Remove a given label by name from this issue.
+     * Remove a single label.
+     *
+     * Attempting to remove a label that is not present throws {@link GHFileNotFoundException}.
+     *
+     * @param name
+     *            the name
+     * @throws IOException
+     *             the io exception, throws {@link GHFileNotFoundException} if label was not present.
+     */
+    public void removeLabel(String name) throws IOException {
+        root.createRequest().method("DELETE").withUrlPath(getIssuesApiRoute() + "/labels", name).send();
+    }
+
+    /**
+     * Remove a collection of labels.
+     *
+     * Attempting to remove labels that are not present on the target are ignored.
      *
      * @param names
      *            the names
@@ -386,7 +398,9 @@ public class GHIssue extends GHObject implements Reactable {
     }
 
     /**
-     * Remove labels.
+     * Remove a collection of labels.
+     *
+     * Attempting to remove labels that are not present on the target are ignored.
      *
      * @param labels
      *            the labels
@@ -399,7 +413,9 @@ public class GHIssue extends GHObject implements Reactable {
     }
 
     /**
-     * Remove labels.
+     * Remove a collection of labels.
+     *
+     * Attempting to remove labels that are not present on the target are ignored.
      *
      * @param labels
      *            the labels
@@ -411,15 +427,13 @@ public class GHIssue extends GHObject implements Reactable {
     }
 
     private void _removeLabels(Collection<String> names) throws IOException {
-        List<String> newLabels = new ArrayList<String>();
-
-        for (GHLabel l : getLabels()) {
-            if (!names.contains(l.getName())) {
-                newLabels.add(l.getName());
+        for (String name : names) {
+            try {
+                removeLabel(name);
+            } catch (GHFileNotFoundException e) {
+                // when trying to remove multiple labels, we ignore already removed
             }
         }
-
-        setLabels(newLabels.toArray(new String[0]));
     }
 
     /**

src/main/java/org/kohsuke/github/GHIssueChanges.java

@@ -0,0 +1,49 @@
+package org.kohsuke.github;
+
+import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
+
+/**
+ * Wrapper to define changed fields on issues action="edited"
+ *
+ * @see GHEventPayload.Issue
+ */
+@SuppressFBWarnings("UWF_UNWRITTEN_FIELD")
+public class GHIssueChanges {
+
+    private GHFrom title;
+    private GHFrom body;
+
+    /**
+     * Old issue title.
+     *
+     * @return old issue title (or null if not changed)
+     */
+    public GHFrom getTitle() {
+        return title;
+    }
+
+    /**
+     * Old issue body.
+     *
+     * @return old issue body (or null if not changed)
+     */
+    public GHFrom getBody() {
+        return body;
+    }
+
+    /**
+     * Wrapper for changed values.
+     */
+    public static class GHFrom {
+        private String from;
+
+        /**
+         * Previous value that was changed.
+         *
+         * @return previous value
+         */
+        public String getFrom() {
+            return from;
+        }
+    }
+}

src/main/java/org/kohsuke/github/GHIssueComment.java

@@ -26,7 +26,7 @@ package org.kohsuke.github;
 import java.io.IOException;
 import java.net.URL;
 
-import static org.kohsuke.github.Previews.*;
+import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
 
 /**
  * Comment to the issue

src/main/java/org/kohsuke/github/GHLabel.java

@@ -2,6 +2,7 @@ package org.kohsuke.github;
 
 import com.fasterxml.jackson.annotation.JacksonInject;
 import com.fasterxml.jackson.annotation.JsonCreator;
+import com.fasterxml.jackson.annotation.JsonProperty;
 
 import java.io.IOException;
 import java.util.ArrayList;
@@ -22,6 +23,11 @@ import javax.annotation.Nonnull;
  */
 public class GHLabel extends GitHubInteractiveObject {
 
+    private long id;
+    private String nodeId;
+    @JsonProperty("default")
+    private boolean default_;
+
     @Nonnull
     private String url, name, color;
 
@@ -42,6 +48,24 @@ public class GHLabel extends GitHubInteractiveObject {
         return Objects.requireNonNull(root);
     }
 
+    /**
+     * Gets id.
+     *
+     * @return the id
+     */
+    public long getId() {
+        return id;
+    }
+
+    /**
+     * Gets node id.
+     *
+     * @return the node id.
+     */
+    public String getNodeId() {
+        return nodeId;
+    }
+
     /**
      * Gets url.
      *
@@ -82,6 +106,15 @@ public class GHLabel extends GitHubInteractiveObject {
         return description;
     }
 
+    /**
+     * If the label is one of the default labels created by GitHub automatically.
+     *
+     * @return true if the label is a default one
+     */
+    public boolean isDefault() {
+        return default_;
+    }
+
     /**
      * Sets color.
      *

src/main/java/org/kohsuke/github/GHOrganization.java

@@ -10,7 +10,7 @@ import java.util.List;
 import java.util.Map;
 import java.util.TreeMap;
 
-import static org.kohsuke.github.Previews.INERTIA;
+import static org.kohsuke.github.internal.Previews.INERTIA;
 
 /**
  * The type GHOrganization.

src/main/java/org/kohsuke/github/GHProject.java

@@ -28,7 +28,7 @@ import java.io.IOException;
 import java.net.URL;
 import java.util.Locale;
 
-import static org.kohsuke.github.Previews.INERTIA;
+import static org.kohsuke.github.internal.Previews.INERTIA;
 
 /**
  * A GitHub project.

src/main/java/org/kohsuke/github/GHProjectCard.java

@@ -6,7 +6,7 @@ import java.io.FileNotFoundException;
 import java.io.IOException;
 import java.net.URL;
 
-import static org.kohsuke.github.Previews.INERTIA;
+import static org.kohsuke.github.internal.Previews.INERTIA;
 
 /**
  * The type GHProjectCard.

src/main/java/org/kohsuke/github/GHProjectColumn.java

@@ -4,7 +4,7 @@ import java.io.FileNotFoundException;
 import java.io.IOException;
 import java.net.URL;
 
-import static org.kohsuke.github.Previews.INERTIA;
+import static org.kohsuke.github.internal.Previews.INERTIA;
 
 /**
  * The type GHProjectColumn.

src/main/java/org/kohsuke/github/GHPullRequest.java

@@ -36,8 +36,8 @@ import java.util.Objects;
 
 import javax.annotation.CheckForNull;
 
-import static org.kohsuke.github.Previews.LYDIAN;
-import static org.kohsuke.github.Previews.SHADOW_CAT;
+import static org.kohsuke.github.internal.Previews.LYDIAN;
+import static org.kohsuke.github.internal.Previews.SHADOW_CAT;
 
 /**
  * A pull request.

src/main/java/org/kohsuke/github/GHPullRequestQueryBuilder.java

@@ -1,6 +1,6 @@
 package org.kohsuke.github;
 
-import static org.kohsuke.github.Previews.SHADOW_CAT;
+import static org.kohsuke.github.internal.Previews.SHADOW_CAT;
 
 /**
  * Lists up pull requests with some filtering and sorting.

src/main/java/org/kohsuke/github/GHPullRequestReviewComment.java

@@ -28,7 +28,7 @@ import java.net.URL;
 
 import javax.annotation.CheckForNull;
 
-import static org.kohsuke.github.Previews.*;
+import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
 
 /**
  * Review comment to the pull request
@@ -153,7 +153,20 @@ public class GHPullRequestReviewComment extends GHObject implements Reactable {
      * @return the api route
      */
     protected String getApiRoute() {
-        return "/repos/" + owner.getRepository().getFullName() + "/pulls/comments/" + getId();
+        return getApiRoute(false);
+    }
+
+    /**
+     * Gets api route.
+     *
+     * @param includePullNumber
+     *            if true, includes the owning pull request's number in the route.
+     *
+     * @return the api route
+     */
+    protected String getApiRoute(boolean includePullNumber) {
+        return "/repos/" + owner.getRepository().getFullName() + "/pulls"
+                + (includePullNumber ? "/" + owner.getNumber() : "") + "/comments/" + getId();
     }
 
     /**
@@ -192,8 +205,7 @@ public class GHPullRequestReviewComment extends GHObject implements Reactable {
         return owner.root.createRequest()
                 .method("POST")
                 .with("body", body)
-                .with("in_reply_to", getId())
-                .withUrlPath(getApiRoute() + "/comments")
+                .withUrlPath(getApiRoute(true) + "/replies")
                 .fetch(GHPullRequestReviewComment.class)
                 .wrapUp(owner);
     }

src/main/java/org/kohsuke/github/GHReaction.java

@@ -3,7 +3,7 @@ package org.kohsuke.github;
 import java.io.IOException;
 import java.net.URL;
 
-import static org.kohsuke.github.Previews.*;
+import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
 
 /**
  * Reaction to issue, comment, PR, and so on.

src/main/java/org/kohsuke/github/GHRepository.java

@@ -30,6 +30,7 @@ import edu.umd.cs.findbugs.annotations.CheckForNull;
 import edu.umd.cs.findbugs.annotations.NonNull;
 import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
 import org.apache.commons.lang3.StringUtils;
+import org.kohsuke.github.function.InputStreamFunction;
 
 import java.io.FileNotFoundException;
 import java.io.IOException;
@@ -49,7 +50,6 @@ import java.util.Iterator;
 import java.util.LinkedHashSet;
 import java.util.List;
 import java.util.Map;
-import java.util.Objects;
 import java.util.Set;
 import java.util.TreeMap;
 import java.util.WeakHashMap;
@@ -57,7 +57,8 @@ import java.util.WeakHashMap;
 import javax.annotation.Nonnull;
 
 import static java.util.Arrays.*;
-import static org.kohsuke.github.Previews.*;
+import static java.util.Objects.requireNonNull;
+import static org.kohsuke.github.internal.Previews.*;
 
 /**
  * A repository on GitHub.
@@ -1782,7 +1783,7 @@ public class GHRepository extends GHObject {
         return root.createRequest()
                 .withHeader("Accept", "application/vnd.github.v3.raw")
                 .withUrlPath(target)
-                .fetchStream();
+                .fetchStream(Requester::copyInputStream);
     }
 
     /**
@@ -2809,7 +2810,7 @@ public class GHRepository extends GHObject {
                         .with("mode", mode == null ? null : mode.toString())
                         .with("context", getFullName())
                         .withUrlPath("/markdown")
-                        .fetchStream(),
+                        .fetchStream(Requester::copyInputStream),
                 "UTF-8");
     }
 
@@ -2897,6 +2898,71 @@ public class GHRepository extends GHObject {
                 .wrapUp(root);
     }
 
+    /**
+     * Lists all the workflows of this repository.
+     *
+     * @return the paged iterable
+     */
+    public PagedIterable<GHWorkflow> listWorkflows() {
+        return root.createRequest()
+                .withUrlPath(getApiTailUrl("actions/workflows"))
+                .toIterable(GHWorkflow[].class, item -> item.wrapUp(root));
+    }
+
+    /**
+     * Gets a workflow by id.
+     *
+     * @param id
+     *            the id of the workflow run
+     * @return the workflow run
+     * @throws IOException
+     *             the io exception
+     */
+    public GHWorkflow getWorkflow(long id) throws IOException {
+        return getWorkflow(String.valueOf(id));
+    }
+
+    /**
+     * Gets a workflow by name of the file.
+     *
+     * @param nameOrId
+     *            either the name of the file (e.g. my-workflow.yml) or the id as a string
+     * @return the workflow run
+     * @throws IOException
+     *             the io exception
+     */
+    public GHWorkflow getWorkflow(String nameOrId) throws IOException {
+        return root.createRequest()
+                .withUrlPath(getApiTailUrl("actions/workflows"), nameOrId)
+                .fetch(GHWorkflow.class)
+                .wrapUp(this);
+    }
+
+    /**
+     * Retrieves workflow runs.
+     *
+     * @return the workflow run query builder
+     */
+    public GHWorkflowRunQueryBuilder queryWorkflowRuns() {
+        return new GHWorkflowRunQueryBuilder(this);
+    }
+
+    /**
+     * Gets a workflow run.
+     *
+     * @param id
+     *            the id of the workflow run
+     * @return the workflow run
+     * @throws IOException
+     *             the io exception
+     */
+    public GHWorkflowRun getWorkflowRun(long id) throws IOException {
+        return root.createRequest()
+                .withUrlPath(getApiTailUrl("actions/runs"), String.valueOf(id))
+                .fetch(GHWorkflowRun.class)
+                .wrapUp(this);
+    }
+
     // Only used within listTopics().
     private static class Topics {
         public List<String> names;
@@ -2963,6 +3029,52 @@ public class GHRepository extends GHObject {
                 .wrap(this);
     }
 
+    /**
+     * Streams a zip archive of the repository, optionally at a given <code>ref</code>.
+     *
+     * @param <T>
+     *            the type of result
+     * @param streamFunction
+     *            The {@link InputStreamFunction} that will process the stream
+     * @param ref
+     *            if <code>null</code> the repository's default branch, usually <code>master</code>,
+     * @throws IOException
+     *             The IO exception.
+     * @return the result of reading the stream.
+     */
+    public <T> T readZip(InputStreamFunction<T> streamFunction, String ref) throws IOException {
+        return downloadArchive("zip", ref, streamFunction);
+    }
+
+    /**
+     * Streams a tar archive of the repository, optionally at a given <code>ref</code>.
+     *
+     * @param <T>
+     *            the type of result
+     * @param streamFunction
+     *            The {@link InputStreamFunction} that will process the stream
+     * @param ref
+     *            if <code>null</code> the repository's default branch, usually <code>master</code>,
+     * @throws IOException
+     *             The IO exception.
+     * @return the result of reading the stream.
+     */
+    public <T> T readTar(InputStreamFunction<T> streamFunction, String ref) throws IOException {
+        return downloadArchive("tar", ref, streamFunction);
+    }
+
+    private <T> T downloadArchive(@Nonnull String type,
+            @CheckForNull String ref,
+            @Nonnull InputStreamFunction<T> streamFunction) throws IOException {
+        requireNonNull(streamFunction, "Sink must not be null");
+        String tailUrl = getApiTailUrl(type + "ball");
+        if (ref != null) {
+            tailUrl += "/" + ref;
+        }
+        final Requester builder = root.createRequest().method("GET").withUrlPath(tailUrl);
+        return builder.fetchStream(streamFunction);
+    }
+
     /**
      * Populate this object.
      *
@@ -2974,7 +3086,7 @@ public class GHRepository extends GHObject {
             return; // can't populate if the root is offline
         }
 
-        final URL url = Objects.requireNonNull(getUrl(), "Missing instance URL!");
+        final URL url = requireNonNull(getUrl(), "Missing instance URL!");
 
         try {
             // IMPORTANT: the url for repository records does not reliably point to the API url.

src/main/java/org/kohsuke/github/GHRepositoryBuilder.java

@@ -3,7 +3,7 @@ package org.kohsuke.github;
 import java.io.IOException;
 import java.net.URL;
 
-import static org.kohsuke.github.Previews.BAPTISTE;
+import static org.kohsuke.github.internal.Previews.BAPTISTE;
 
 abstract class GHRepositoryBuilder<S> extends AbstractBuilder<GHRepository, S> {
 

src/main/java/org/kohsuke/github/GHWorkflow.java

@@ -0,0 +1,149 @@
+package org.kohsuke.github;
+
+import com.fasterxml.jackson.annotation.JsonIgnore;
+import org.apache.commons.lang3.StringUtils;
+
+import java.io.IOException;
+import java.net.URL;
+import java.util.Collections;
+import java.util.Map;
+import java.util.Objects;
+
+/**
+ * A workflow.
+ *
+ * @author Guillaume Smet
+ * @see GHRepository#getWorkflow(long)
+ */
+public class GHWorkflow extends GHObject {
+
+    // Not provided by the API.
+    @JsonIgnore
+    private GHRepository owner;
+
+    private String name;
+    private String path;
+    private String state;
+
+    private String htmlUrl;
+    private String badgeUrl;
+
+    /**
+     * The name of the workflow.
+     *
+     * @return the name
+     */
+    public String getName() {
+        return name;
+    }
+
+    /**
+     * The path of the workflow e.g. .github/workflows/blank.yaml
+     *
+     * @return the path
+     */
+    public String getPath() {
+        return path;
+    }
+
+    /**
+     * The state of the workflow.
+     *
+     * @return the state
+     */
+    public String getState() {
+        return state;
+    }
+
+    @Override
+    public URL getHtmlUrl() throws IOException {
+        return GitHubClient.parseURL(htmlUrl);
+    }
+
+    /**
+     * The badge URL, like https://github.com/octo-org/octo-repo/workflows/CI/badge.svg
+     *
+     * @return the badge url
+     */
+    public URL getBadgeUrl() {
+        return GitHubClient.parseURL(badgeUrl);
+    }
+
+    /**
+     * Disable the workflow.
+     *
+     * @throws IOException
+     *             the io exception
+     */
+    public void disable() throws IOException {
+        root.createRequest().method("PUT").withUrlPath(getApiRoute(), "disable").fetchHttpStatusCode();
+    }
+
+    /**
+     * Enable the workflow.
+     *
+     * @throws IOException
+     *             the io exception
+     */
+    public void enable() throws IOException {
+        root.createRequest().method("PUT").withUrlPath(getApiRoute(), "enable").fetchHttpStatusCode();
+    }
+
+    /**
+     * Create a workflow dispatch event which triggers a manual workflow run.
+     *
+     * @param ref
+     *            the git reference for the workflow. The reference can be a branch or tag name.
+     * @throws IOException
+     *             the io exception
+     */
+    public void dispatch(String ref) throws IOException {
+        dispatch(ref, Collections.emptyMap());
+    }
+
+    /**
+     * Create a workflow dispatch event which triggers a manual workflow run.
+     *
+     * @param ref
+     *            the git reference for the workflow. The reference can be a branch or tag name.
+     * @param inputs
+     *            input keys and values configured in the workflow file. The maximum number of properties is 10. Any
+     *            default properties configured in the workflow file will be used when inputs are omitted.
+     * @throws IOException
+     *             the io exception
+     */
+    public void dispatch(String ref, Map<String, Object> inputs) throws IOException {
+        Requester requester = root.createRequest()
+                .method("POST")
+                .withUrlPath(getApiRoute(), "dispatches")
+                .with("ref", ref);
+
+        if (!inputs.isEmpty()) {
+            requester.with("inputs", inputs);
+        }
+
+        requester.fetchHttpStatusCode();
+    }
+
+    private String getApiRoute() {
+        if (owner == null) {
+            // Workflow runs returned from search to do not have an owner. Attempt to use url.
+            final URL url = Objects.requireNonNull(getUrl(), "Missing instance URL!");
+            return StringUtils.prependIfMissing(url.toString().replace(root.getApiUrl(), ""), "/");
+
+        }
+        return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/actions/workflows/" + getId();
+    }
+
+    GHWorkflow wrapUp(GHRepository owner) {
+        this.owner = owner;
+        return wrapUp(owner.root);
+    }
+
+    GHWorkflow wrapUp(GitHub root) {
+        this.root = root;
+        if (owner != null)
+            owner.wrap(root);
+        return this;
+    }
+}

src/main/java/org/kohsuke/github/GHWorkflowRun.java

@@ -0,0 +1,387 @@
+package org.kohsuke.github;
+
+import com.fasterxml.jackson.annotation.JsonProperty;
+import org.apache.commons.lang3.StringUtils;
+import org.kohsuke.github.internal.EnumUtils;
+
+import java.io.IOException;
+import java.net.URL;
+import java.util.Arrays;
+import java.util.Collections;
+import java.util.Date;
+import java.util.List;
+import java.util.Locale;
+import java.util.Objects;
+
+/**
+ * A workflow run.
+ *
+ * @author Guillaume Smet
+ * @see GHRepository#getWorkflowRun(long)
+ */
+public class GHWorkflowRun extends GHObject {
+
+    @JsonProperty("repository")
+    private GHRepository owner;
+
+    private String name;
+    private long runNumber;
+    private long workflowId;
+
+    private String htmlUrl;
+    private String jobsUrl;
+    private String logsUrl;
+    private String checkSuiteUrl;
+    private String artifactsUrl;
+    private String cancelUrl;
+    private String rerunUrl;
+    private String workflowUrl;
+
+    private String headBranch;
+    private String headSha;
+    private GHRepository headRepository;
+    private HeadCommit headCommit;
+
+    private String event;
+    private String status;
+    private String conclusion;
+
+    private GHPullRequest[] pullRequests;
+
+    /**
+     * The name of the workflow run.
+     *
+     * @return the name
+     */
+    public String getName() {
+        return name;
+    }
+
+    /**
+     * The run number.
+     *
+     * @return the run number
+     */
+    public long getRunNumber() {
+        return runNumber;
+    }
+
+    /**
+     * The workflow id.
+     *
+     * @return the workflow id
+     */
+    public long getWorkflowId() {
+        return workflowId;
+    }
+
+    @Override
+    public URL getHtmlUrl() throws IOException {
+        return GitHubClient.parseURL(htmlUrl);
+    }
+
+    /**
+     * The jobs URL, like https://api.github.com/repos/octo-org/octo-repo/actions/runs/30433642/jobs
+     *
+     * @return the diff url
+     */
+    public URL getJobsUrl() {
+        return GitHubClient.parseURL(jobsUrl);
+    }
+
+    /**
+     * The logs URL, like https://api.github.com/repos/octo-org/octo-repo/actions/runs/30433642/logs
+     *
+     * @return the diff url
+     */
+    public URL getLogsUrl() {
+        return GitHubClient.parseURL(logsUrl);
+    }
+
+    /**
+     * The check suite URL, like https://api.github.com/repos/octo-org/octo-repo/check-suites/414944374
+     *
+     * @return the diff url
+     */
+    public URL getCheckSuiteUrl() {
+        return GitHubClient.parseURL(checkSuiteUrl);
+    }
+
+    /**
+     * The artifacts URL, like https://api.github.com/repos/octo-org/octo-repo/actions/runs/30433642/artifacts
+     *
+     * @return the diff url
+     */
+    public URL getArtifactsUrl() {
+        return GitHubClient.parseURL(artifactsUrl);
+    }
+
+    /**
+     * The cancel URL, like https://api.github.com/repos/octo-org/octo-repo/actions/runs/30433642/cancel
+     *
+     * @return the diff url
+     */
+    public URL getCancelUrl() {
+        return GitHubClient.parseURL(cancelUrl);
+    }
+
+    /**
+     * The rerun URL, like https://api.github.com/repos/octo-org/octo-repo/actions/runs/30433642/rerun
+     *
+     * @return the diff url
+     */
+    public URL getRerunUrl() {
+        return GitHubClient.parseURL(rerunUrl);
+    }
+
+    /**
+     * The workflow URL, like https://api.github.com/repos/octo-org/octo-repo/actions/workflows/159038
+     *
+     * @return the diff url
+     */
+    public URL getWorkflowUrl() {
+        return GitHubClient.parseURL(workflowUrl);
+    }
+
+    /**
+     * The head branch name the changes are on.
+     *
+     * @return head branch name
+     */
+    public String getHeadBranch() {
+        return headBranch;
+    }
+
+    /**
+     * Gets the HEAD SHA.
+     *
+     * @return sha for the HEAD commit
+     */
+    public String getHeadSha() {
+        return headSha;
+    }
+
+    /**
+     * The commit of current head.
+     *
+     * @return head commit
+     */
+    public HeadCommit getHeadCommit() {
+        return headCommit;
+    }
+
+    /**
+     * The repository of current head.
+     *
+     * @return head repository
+     */
+    public GHRepository getHeadRepository() {
+        return headRepository;
+    }
+
+    /**
+     * The type of event that triggered the build.
+     *
+     * @return type of event
+     */
+    public GHEvent getEvent() {
+        return Enum.valueOf(GHEvent.class, event.toUpperCase(Locale.ROOT));
+    }
+
+    /**
+     * Gets status of the workflow run.
+     * <p>
+     * Can be {@code UNKNOWN} if the value returned by GitHub is unknown from the API.
+     *
+     * @return status of the workflow run
+     */
+    public Status getStatus() {
+        return Status.from(status);
+    }
+
+    /**
+     * Gets the conclusion of the workflow run.
+     * <p>
+     * Can be {@code UNKNOWN} if the value returned by GitHub is unknown from the API.
+     *
+     * @return conclusion of the workflow run
+     */
+    public Conclusion getConclusion() {
+        return Conclusion.from(conclusion);
+    }
+
+    /**
+     * Gets the pull requests participated in this workflow run.
+     *
+     * Note this field is only populated for events. When getting a {@link GHWorkflowRun} outside of an event, this is
+     * always empty.
+     *
+     * @return the list of {@link GHPullRequest}s for this workflow run. Only populated for events.
+     * @throws IOException
+     *             the io exception
+     */
+    public List<GHPullRequest> getPullRequests() throws IOException {
+        if (pullRequests != null && pullRequests.length != 0) {
+            for (GHPullRequest pullRequest : pullRequests) {
+                // Only refresh if we haven't do so before
+                pullRequest.refresh(pullRequest.getTitle());
+            }
+            return Collections.unmodifiableList(Arrays.asList(pullRequests));
+        }
+        return Collections.emptyList();
+    }
+
+    /**
+     * Cancel the workflow run.
+     *
+     * @throws IOException
+     *             the io exception
+     */
+    public void cancel() throws IOException {
+        root.createRequest().method("POST").withUrlPath(getApiRoute(), "cancel").fetchHttpStatusCode();
+    }
+
+    /**
+     * Delete the workflow run.
+     *
+     * @throws IOException
+     *             the io exception
+     */
+    public void delete() throws IOException {
+        root.createRequest().method("DELETE").withUrlPath(getApiRoute()).fetchHttpStatusCode();
+    }
+
+    /**
+     * Rerun the workflow run.
+     *
+     * @throws IOException
+     *             the io exception
+     */
+    public void rerun() throws IOException {
+        root.createRequest().method("POST").withUrlPath(getApiRoute(), "rerun").fetchHttpStatusCode();
+    }
+
+    private String getApiRoute() {
+        if (owner == null) {
+            // Workflow runs returned from search to do not have an owner. Attempt to use url.
+            final URL url = Objects.requireNonNull(getUrl(), "Missing instance URL!");
+            return StringUtils.prependIfMissing(url.toString().replace(root.getApiUrl(), ""), "/");
+
+        }
+        return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/actions/runs/" + getId();
+    }
+
+    GHWorkflowRun wrapUp(GHRepository owner) {
+        this.owner = owner;
+        return wrapUp(owner.root);
+    }
+
+    GHWorkflowRun wrapUp(GitHub root) {
+        this.root = root;
+        if (owner != null) {
+            owner.wrap(root);
+            if (pullRequests != null) {
+                for (GHPullRequest singlePull : pullRequests) {
+                    singlePull.wrap(owner);
+                }
+            }
+        } else if (pullRequests != null) {
+            for (GHPullRequest singlePull : pullRequests) {
+                singlePull.wrap(root);
+            }
+        }
+        if (headRepository != null) {
+            headRepository.wrap(root);
+        }
+        return this;
+    }
+
+    public static class HeadCommit {
+        private String id;
+        private String treeId;
+        private String message;
+        private String timestamp;
+        private GitUser author;
+        private GitUser committer;
+
+        /**
+         * Gets id of the commit
+         *
+         * @return id of the commit
+         */
+        public String getId() {
+            return id;
+        }
+
+        /**
+         * Gets id of the tree.
+         *
+         * @return id of the tree
+         */
+        public String getTreeId() {
+            return treeId;
+        }
+
+        /**
+         * Gets message.
+         *
+         * @return commit message.
+         */
+        public String getMessage() {
+            return message;
+        }
+
+        /**
+         * Gets timestamp of the commit.
+         *
+         * @return timestamp of the commit
+         */
+        public Date getTimestamp() {
+            return GitHubClient.parseDate(timestamp);
+        }
+
+        /**
+         * Gets author.
+         *
+         * @return the author
+         */
+        public GitUser getAuthor() {
+            return author;
+        }
+
+        /**
+         * Gets committer.
+         *
+         * @return the committer
+         */
+        public GitUser getCommitter() {
+            return committer;
+        }
+    }
+
+    public static enum Status {
+        QUEUED, IN_PROGRESS, COMPLETED, UNKNOWN;
+
+        public static Status from(String value) {
+            return EnumUtils.getNullableEnumOrDefault(Status.class, value, Status.UNKNOWN);
+        }
+
+        @Override
+        public String toString() {
+            return name().toLowerCase(Locale.ROOT);
+        }
+    }
+
+    public static enum Conclusion {
+        ACTION_REQUIRED, CANCELLED, FAILURE, NEUTRAL, SUCCESS, SKIPPED, STALE, TIMED_OUT, UNKNOWN;
+
+        public static Conclusion from(String value) {
+            return EnumUtils.getNullableEnumOrDefault(Conclusion.class, value, Conclusion.UNKNOWN);
+        }
+
+        @Override
+        public String toString() {
+            return name().toLowerCase(Locale.ROOT);
+        }
+    }
+}

src/main/java/org/kohsuke/github/GHWorkflowRunQueryBuilder.java

@@ -0,0 +1,101 @@
+package org.kohsuke.github;
+
+import org.kohsuke.github.GHWorkflowRun.Status;
+
+import java.net.MalformedURLException;
+
+/**
+ * Lists up workflow runs with some filtering and sorting.
+ *
+ * @author Guillaume Smet
+ * @see GHRepository#queryWorkflowRuns()
+ */
+public class GHWorkflowRunQueryBuilder extends GHQueryBuilder<GHWorkflowRun> {
+    private final GHRepository repo;
+
+    GHWorkflowRunQueryBuilder(GHRepository repo) {
+        super(repo.root);
+        this.repo = repo;
+    }
+
+    /**
+     * Actor workflow run query builder.
+     *
+     * @param actor
+     *            the actor
+     * @return the gh workflow run query builder
+     */
+    public GHWorkflowRunQueryBuilder actor(String actor) {
+        req.with("actor", actor);
+        return this;
+    }
+
+    /**
+     * Actor workflow run query builder.
+     *
+     * @param actor
+     *            the actor
+     * @return the gh workflow run query builder
+     */
+    public GHWorkflowRunQueryBuilder actor(GHUser actor) {
+        req.with("actor", actor.getLogin());
+        return this;
+    }
+
+    /**
+     * Branch workflow run query builder.
+     *
+     * @param branch
+     *            the branch
+     * @return the gh workflow run query builder
+     */
+    public GHWorkflowRunQueryBuilder branch(String branch) {
+        req.with("branch", branch);
+        return this;
+    }
+
+    /**
+     * Event workflow run query builder.
+     *
+     * @param event
+     *            the event
+     * @return the gh workflow run query builder
+     */
+    public GHWorkflowRunQueryBuilder event(GHEvent event) {
+        req.with("event", event.symbol());
+        return this;
+    }
+
+    /**
+     * Event workflow run query builder.
+     *
+     * @param event
+     *            the event
+     * @return the gh workflow run query builder
+     */
+    public GHWorkflowRunQueryBuilder event(String event) {
+        req.with("event", event);
+        return this;
+    }
+
+    /**
+     * Status workflow run query builder.
+     *
+     * @param status
+     *            the status
+     * @return the gh workflow run query builder
+     */
+    public GHWorkflowRunQueryBuilder status(Status status) {
+        req.with("status", status.toString());
+        return this;
+    }
+
+    @Override
+    public PagedIterable<GHWorkflowRun> list() {
+        try {
+            return new GHWorkflowRunsIterable(root, req.withUrlPath(repo.getApiTailUrl("actions/runs")).build());
+        } catch (MalformedURLException e) {
+            throw new GHException(e.getMessage(), e);
+        }
+    }
+}

src/main/java/org/kohsuke/github/GHWorkflowRunsIterable.java

@@ -0,0 +1,44 @@
+package org.kohsuke.github;
+
+import java.util.Iterator;
+
+import javax.annotation.Nonnull;
+
+/**
+ * Iterable for workflow runs listing.
+ */
+class GHWorkflowRunsIterable extends PagedIterable<GHWorkflowRun> {
+    private final transient GitHub root;
+    private final GitHubRequest request;
+
+    private GHWorkflowRunsPage result;
+
+    public GHWorkflowRunsIterable(GitHub root, GitHubRequest request) {
+        this.root = root;
+        this.request = request;
+    }
+
+    @Nonnull
+    @Override
+    public PagedIterator<GHWorkflowRun> _iterator(int pageSize) {
+        return new PagedIterator<>(
+                adapt(GitHubPageIterator.create(root.getClient(), GHWorkflowRunsPage.class, request, pageSize)),
+                null);
+    }
+
+    protected Iterator<GHWorkflowRun[]> adapt(final Iterator<GHWorkflowRunsPage> base) {
+        return new Iterator<GHWorkflowRun[]>() {
+            public boolean hasNext() {
+                return base.hasNext();
+            }
+
+            public GHWorkflowRun[] next() {
+                GHWorkflowRunsPage v = base.next();
+                if (result == null) {
+                    result = v;
+                }
+                return v.getWorkflowRuns(root);
+            }
+        };
+    }
+}

src/main/java/org/kohsuke/github/GHWorkflowRunsPage.java

@@ -0,0 +1,20 @@
+package org.kohsuke.github;
+
+/**
+ * Represents the one page of workflow runs result when listing workflow runs.
+ */
+class GHWorkflowRunsPage {
+    private int totalCount;
+    private GHWorkflowRun[] workflowRuns;
+
+    public int getTotalCount() {
+        return totalCount;
+    }
+
+    GHWorkflowRun[] getWorkflowRuns(GitHub root) {
+        for (GHWorkflowRun workflowRun : workflowRuns) {
+            workflowRun.wrapUp(root);
+        }
+        return workflowRuns;
+    }
+}

src/main/java/org/kohsuke/github/GitHub.java

@@ -26,6 +26,8 @@ package org.kohsuke.github;
 import com.fasterxml.jackson.databind.ObjectReader;
 import com.fasterxml.jackson.databind.ObjectWriter;
 import com.infradna.tool.bridge_method_injector.WithBridgeMethods;
+import org.kohsuke.github.authorization.AuthorizationProvider;
+import org.kohsuke.github.internal.Previews;
 
 import java.io.*;
 import java.util.*;
@@ -37,8 +39,8 @@ import java.util.logging.Logger;
 import javax.annotation.CheckForNull;
 import javax.annotation.Nonnull;
 
-import static org.kohsuke.github.Previews.INERTIA;
-import static org.kohsuke.github.Previews.MACHINE_MAN;
+import static org.kohsuke.github.internal.Previews.INERTIA;
+import static org.kohsuke.github.internal.Previews.MACHINE_MAN;
 
 /**
  * Root of the GitHub API.
@@ -93,39 +95,112 @@ public class GitHub {
      *            "http://ghe.acme.com/api/v3". Note that GitHub Enterprise has <code>/api/v3</code> in the URL. For
      *            historical reasons, this parameter still accepts the bare domain name, but that's considered
      *            deprecated. Password is also considered deprecated as it is no longer required for api usage.
-     * @param login
-     *            The user ID on GitHub that you are logging in as. Can be omitted if the OAuth token is provided or if
-     *            logging in anonymously. Specifying this would save one API call.
-     * @param oauthAccessToken
-     *            Secret OAuth token.
-     * @param password
-     *            User's password. Always used in conjunction with the {@code login} parameter
      * @param connector
-     *            HttpConnector to use. Pass null to use default connector.
+     *            a connector
+     * @param rateLimitHandler
+     *            rateLimitHandler
+     * @param abuseLimitHandler
+     *            abuseLimitHandler
+     * @param rateLimitChecker
+     *            rateLimitChecker
+     * @param authorizationProvider
+     *            a authorization provider
      */
     GitHub(String apiUrl,
-            String login,
-            String oauthAccessToken,
-            String jwtToken,
-            String password,
             HttpConnector connector,
             RateLimitHandler rateLimitHandler,
             AbuseLimitHandler abuseLimitHandler,
-            GitHubRateLimitChecker rateLimitChecker) throws IOException {
+            GitHubRateLimitChecker rateLimitChecker,
+            AuthorizationProvider authorizationProvider) throws IOException {
+        if (authorizationProvider instanceof DependentAuthorizationProvider) {
+            ((DependentAuthorizationProvider) authorizationProvider).bind(this);
+        }
+
         this.client = new GitHubHttpUrlConnectionClient(apiUrl,
-                login,
-                oauthAccessToken,
-                jwtToken,
-                password,
                 connector,
                 rateLimitHandler,
                 abuseLimitHandler,
                 rateLimitChecker,
-                (myself) -> setMyself(myself));
+                (myself) -> setMyself(myself),
+                authorizationProvider);
         users = new ConcurrentHashMap<>();
         orgs = new ConcurrentHashMap<>();
     }
 
+    private GitHub(GitHubClient client) {
+        this.client = client;
+        users = new ConcurrentHashMap<>();
+        orgs = new ConcurrentHashMap<>();
+    }
+
+    public static abstract class DependentAuthorizationProvider implements AuthorizationProvider {
+
+        private GitHub baseGitHub;
+        private GitHub gitHub;
+        private final AuthorizationProvider authorizationProvider;
+
+        /**
+         * An AuthorizationProvider that requires an authenticated GitHub instance to provide its authorization.
+         *
+         * @param authorizationProvider
+         *            A authorization provider to be used when refreshing this authorization provider.
+         */
+        @BetaApi
+        @Deprecated
+        protected DependentAuthorizationProvider(AuthorizationProvider authorizationProvider) {
+            this.authorizationProvider = authorizationProvider;
+        }
+
+        /**
+         * Binds this authorization provider to a github instance.
+         *
+         * Only needs to be implemented by dynamic credentials providers that use a github instance in order to refresh.
+         *
+         * @param github
+         *            The github instance to be used for refreshing dynamic credentials
+         */
+        synchronized void bind(GitHub github) {
+            if (baseGitHub != null) {
+                throw new IllegalStateException("Already bound to another GitHub instance.");
+            }
+            this.baseGitHub = github;
+        }
+
+        protected synchronized final GitHub gitHub() {
+            if (gitHub == null) {
+                gitHub = new GitHub.AuthorizationRefreshGitHubWrapper(this.baseGitHub, authorizationProvider);
+            }
+            return gitHub;
+        }
+    }
+
+    private static class AuthorizationRefreshGitHubWrapper extends GitHub {
+
+        private final AuthorizationProvider authorizationProvider;
+
+        AuthorizationRefreshGitHubWrapper(GitHub github, AuthorizationProvider authorizationProvider) {
+            super(github.client);
+            this.authorizationProvider = authorizationProvider;
+
+            // no dependent authorization providers nest like this currently, but they might in future
+            if (authorizationProvider instanceof DependentAuthorizationProvider) {
+                ((DependentAuthorizationProvider) authorizationProvider).bind(this);
+            }
+        }
+
+        @Nonnull
+        @Override
+        Requester createRequest() {
+            try {
+                // Override
+                return super.createRequest().setHeader("Authorization", authorizationProvider.getEncodedAuthorization())
+                        .rateLimit(RateLimitTarget.NONE);
+            } catch (IOException e) {
+                throw new GHException("Failed to create requester to refresh credentials", e);
+            }
+        }
+    }
+
     /**
      * Obtains the credential from "~/.github" or from the System Environment Properties.
      *
@@ -557,11 +632,28 @@ public class GitHub {
      * @return the repository by id
      * @throws IOException
      *             the io exception
+     *
+     * @deprecated Do not use this method. It was added due to misunderstanding of the type of parameter. Use
+     *             {@link #getRepositoryById(long)} instead
      */
+    @Deprecated
     public GHRepository getRepositoryById(String id) throws IOException {
         return createRequest().withUrlPath("/repositories/" + id).fetch(GHRepository.class).wrap(this);
     }
 
+    /**
+     * Gets the repository object from its ID
+     *
+     * @param id
+     *            the id
+     * @return the repository by id
+     * @throws IOException
+     *             the io exception
+     */
+    public GHRepository getRepositoryById(long id) throws IOException {
+        return createRequest().withUrlPath("/repositories/" + id).fetch(GHRepository.class).wrap(this);
+    }
+
     /**
      * Returns a list of popular open source licenses
      *
@@ -1203,7 +1295,7 @@ public class GitHub {
                         .with(new ByteArrayInputStream(text.getBytes("UTF-8")))
                         .contentType("text/plain;charset=UTF-8")
                         .withUrlPath("/markdown/raw")
-                        .fetchStream(),
+                        .fetchStream(Requester::copyInputStream),
                 "UTF-8");
     }
 

src/main/java/org/kohsuke/github/GitHubBuilder.java

@@ -1,6 +1,8 @@
 package org.kohsuke.github;
 
 import org.apache.commons.io.IOUtils;
+import org.kohsuke.github.authorization.AuthorizationProvider;
+import org.kohsuke.github.authorization.ImmutableAuthorizationProvider;
 import org.kohsuke.github.extras.ImpatientHttpConnector;
 
 import java.io.File;
@@ -24,16 +26,13 @@ public class GitHubBuilder implements Cloneable {
 
     // default scoped so unit tests can read them.
     /* private */ String endpoint = GitHubClient.GITHUB_URL;
-    /* private */ String user;
-    /* private */ String password;
-    /* private */ String oauthToken;
-    /* private */ String jwtToken;
 
     private HttpConnector connector;
 
     private RateLimitHandler rateLimitHandler = RateLimitHandler.WAIT;
     private AbuseLimitHandler abuseLimitHandler = AbuseLimitHandler.WAIT;
     private GitHubRateLimitChecker rateLimitChecker = new GitHubRateLimitChecker();
+    /* private */ AuthorizationProvider authorizationProvider = AuthorizationProvider.ANONYMOUS;
 
     /**
      * Instantiates a new Git hub builder.
@@ -61,13 +60,13 @@ public class GitHubBuilder implements Cloneable {
 
         builder = fromEnvironment();
 
-        if (builder.oauthToken != null || builder.user != null || builder.jwtToken != null)
+        if (builder.authorizationProvider != null)
             return builder;
 
         try {
             builder = fromPropertyFile();
 
-            if (builder.oauthToken != null || builder.user != null || builder.jwtToken != null)
+            if (builder.authorizationProvider != null)
                 return builder;
         } catch (FileNotFoundException e) {
             // fall through
@@ -215,9 +214,20 @@ public class GitHubBuilder implements Cloneable {
      */
     public static GitHubBuilder fromProperties(Properties props) {
         GitHubBuilder self = new GitHubBuilder();
-        self.withOAuthToken(props.getProperty("oauth"), props.getProperty("login"));
-        self.withJwtToken(props.getProperty("jwt"));
-        self.withPassword(props.getProperty("login"), props.getProperty("password"));
+        String oauth = props.getProperty("oauth");
+        String jwt = props.getProperty("jwt");
+        String login = props.getProperty("login");
+        String password = props.getProperty("password");
+
+        if (oauth != null) {
+            self.withOAuthToken(oauth, login);
+        }
+        if (jwt != null) {
+            self.withJwtToken(jwt);
+        }
+        if (password != null) {
+            self.withPassword(login, password);
+        }
         self.withEndpoint(props.getProperty("endpoint", GitHubClient.GITHUB_URL));
         return self;
     }
@@ -247,9 +257,7 @@ public class GitHubBuilder implements Cloneable {
      * @return the git hub builder
      */
     public GitHubBuilder withPassword(String user, String password) {
-        this.user = user;
-        this.password = password;
-        return this;
+        return withAuthorizationProvider(ImmutableAuthorizationProvider.fromLoginAndPassword(user, password));
     }
 
     /**
@@ -260,7 +268,7 @@ public class GitHubBuilder implements Cloneable {
      * @return the git hub builder
      */
     public GitHubBuilder withOAuthToken(String oauthToken) {
-        return withOAuthToken(oauthToken, null);
+        return withAuthorizationProvider(ImmutableAuthorizationProvider.fromOauthToken(oauthToken));
     }
 
     /**
@@ -273,8 +281,21 @@ public class GitHubBuilder implements Cloneable {
      * @return the git hub builder
      */
     public GitHubBuilder withOAuthToken(String oauthToken, String user) {
-        this.oauthToken = oauthToken;
-        this.user = user;
+        return withAuthorizationProvider(ImmutableAuthorizationProvider.fromOauthToken(oauthToken, user));
+    }
+
+    /**
+     * Configures a {@link AuthorizationProvider} for this builder
+     *
+     * There can be only one authorization provider per client instance.
+     *
+     * @param authorizationProvider
+     *            the authorization provider
+     * @return the git hub builder
+     *
+     */
+    public GitHubBuilder withAuthorizationProvider(final AuthorizationProvider authorizationProvider) {
+        this.authorizationProvider = authorizationProvider;
         return this;
     }
 
@@ -287,7 +308,7 @@ public class GitHubBuilder implements Cloneable {
      * @see GHAppInstallation#createToken(java.util.Map) GHAppInstallation#createToken(java.util.Map)
      */
     public GitHubBuilder withAppInstallationToken(String appInstallationToken) {
-        return withOAuthToken(appInstallationToken, "");
+        return withAuthorizationProvider(ImmutableAuthorizationProvider.fromAppInstallationToken(appInstallationToken));
     }
 
     /**
@@ -298,8 +319,7 @@ public class GitHubBuilder implements Cloneable {
      * @return the git hub builder
      */
     public GitHubBuilder withJwtToken(String jwtToken) {
-        this.jwtToken = jwtToken;
-        return this;
+        return withAuthorizationProvider(ImmutableAuthorizationProvider.fromJwtToken(jwtToken));
     }
 
     /**
@@ -421,14 +441,11 @@ public class GitHubBuilder implements Cloneable {
      */
     public GitHub build() throws IOException {
         return new GitHub(endpoint,
-                user,
-                oauthToken,
-                jwtToken,
-                password,
                 connector,
                 rateLimitHandler,
                 abuseLimitHandler,
-                rateLimitChecker);
+                rateLimitChecker,
+                authorizationProvider);
     }
 
     @Override

src/main/java/org/kohsuke/github/GitHubClient.java

@@ -1,33 +1,19 @@
 package org.kohsuke.github;
 
-import com.fasterxml.jackson.databind.DeserializationFeature;
-import com.fasterxml.jackson.databind.InjectableValues;
-import com.fasterxml.jackson.databind.MapperFeature;
-import com.fasterxml.jackson.databind.ObjectMapper;
-import com.fasterxml.jackson.databind.ObjectReader;
-import com.fasterxml.jackson.databind.ObjectWriter;
-import com.fasterxml.jackson.databind.PropertyNamingStrategy;
+import com.fasterxml.jackson.databind.*;
 import com.fasterxml.jackson.databind.introspect.VisibilityChecker;
 import org.apache.commons.io.IOUtils;
+import org.kohsuke.github.authorization.AuthorizationProvider;
+import org.kohsuke.github.authorization.UserAuthorizationProvider;
 
 import java.io.FileNotFoundException;
 import java.io.IOException;
 import java.io.InterruptedIOException;
-import java.net.HttpURLConnection;
-import java.net.MalformedURLException;
-import java.net.SocketException;
-import java.net.SocketTimeoutException;
-import java.net.URL;
-import java.nio.charset.StandardCharsets;
+import java.net.*;
 import java.time.Instant;
 import java.time.format.DateTimeFormatter;
 import java.time.temporal.ChronoUnit;
-import java.util.Base64;
-import java.util.Date;
-import java.util.HashMap;
-import java.util.List;
-import java.util.Map;
-import java.util.Objects;
+import java.util.*;
 import java.util.function.Consumer;
 import java.util.logging.Logger;
 
@@ -56,17 +42,13 @@ abstract class GitHubClient {
     static final int retryTimeoutMillis = 100;
     /* private */ final String login;
 
-    /**
-     * Value of the authorization header to be sent with the request.
-     */
-    /* private */ final String encodedAuthorization;
-
     // Cache of myself object.
     private final String apiUrl;
 
     protected final RateLimitHandler rateLimitHandler;
     protected final AbuseLimitHandler abuseLimitHandler;
     private final GitHubRateLimitChecker rateLimitChecker;
+    private final AuthorizationProvider authorizationProvider;
 
     private HttpConnector connector;
 
@@ -91,15 +73,12 @@ abstract class GitHubClient {
     }
 
     GitHubClient(String apiUrl,
-            String login,
-            String oauthAccessToken,
-            String jwtToken,
-            String password,
             HttpConnector connector,
             RateLimitHandler rateLimitHandler,
             AbuseLimitHandler abuseLimitHandler,
             GitHubRateLimitChecker rateLimitChecker,
-            Consumer<GHMyself> myselfConsumer) throws IOException {
+            Consumer<GHMyself> myselfConsumer,
+            AuthorizationProvider authorizationProvider) throws IOException {
 
         if (apiUrl.endsWith("/")) {
             apiUrl = apiUrl.substring(0, apiUrl.length() - 1); // normalize
@@ -111,33 +90,38 @@ abstract class GitHubClient {
         this.apiUrl = apiUrl;
         this.connector = connector;
 
-        if (oauthAccessToken != null) {
-            encodedAuthorization = "token " + oauthAccessToken;
-        } else {
-            if (jwtToken != null) {
-                encodedAuthorization = "Bearer " + jwtToken;
-            } else if (password != null) {
-                String authorization = (login + ':' + password);
-                String charsetName = StandardCharsets.UTF_8.name();
-                encodedAuthorization = "Basic "
-                        + Base64.getEncoder().encodeToString(authorization.getBytes(charsetName));
-            } else {// anonymous access
-                encodedAuthorization = null;
-            }
-        }
+        // Prefer credential configuration via provider
+        this.authorizationProvider = authorizationProvider;
 
         this.rateLimitHandler = rateLimitHandler;
         this.abuseLimitHandler = abuseLimitHandler;
         this.rateLimitChecker = rateLimitChecker;
 
-        if (login == null && encodedAuthorization != null && jwtToken == null) {
-            GHMyself myself = fetch(GHMyself.class, "/user");
-            login = myself.getLogin();
-            if (myselfConsumer != null) {
-                myselfConsumer.accept(myself);
+        this.login = getCurrentUser(myselfConsumer);
+    }
+
+    private String getCurrentUser(Consumer<GHMyself> myselfConsumer) throws IOException {
+        String login = null;
+        if (this.authorizationProvider instanceof UserAuthorizationProvider
+                && this.authorizationProvider.getEncodedAuthorization() != null) {
+
+            UserAuthorizationProvider userAuthorizationProvider = (UserAuthorizationProvider) this.authorizationProvider;
+
+            login = userAuthorizationProvider.getLogin();
+
+            if (login == null) {
+                try {
+                    GHMyself myself = fetch(GHMyself.class, "/user");
+                    if (myselfConsumer != null) {
+                        myselfConsumer.accept(myself);
+                    }
+                    login = myself.getLogin();
+                } catch (IOException e) {
+                    return null;
+                }
             }
         }
-        this.login = login;
+        return login;
     }
 
     private <T> T fetch(Class<T> type, String urlPath) throws IOException {
@@ -202,7 +186,13 @@ abstract class GitHubClient {
      * @return {@code true} if operations that require authentication will fail.
      */
     public boolean isAnonymous() {
-        return login == null && encodedAuthorization == null;
+        try {
+            return login == null && this.authorizationProvider.getEncodedAuthorization() == null;
+        } catch (IOException e) {
+            // An exception here means that the provider failed to provide authorization parameters,
+            // basically meaning the same as "no auth"
+            return false;
+        }
     }
 
     /**
@@ -224,6 +214,11 @@ abstract class GitHubClient {
         return getRateLimit(RateLimitTarget.NONE);
     }
 
+    @CheckForNull
+    protected String getEncodedAuthorization() throws IOException {
+        return authorizationProvider.getEncodedAuthorization();
+    }
+
     @Nonnull
     GHRateLimit getRateLimit(@Nonnull RateLimitTarget rateLimitTarget) throws IOException {
         GHRateLimit result;
@@ -394,7 +389,6 @@ abstract class GitHubClient {
                                 "GitHub API request [" + (login == null ? "anonymous" : login) + "]: "
                                         + request.method() + " " + request.url().toString());
                     }
-
                     rateLimitChecker.checkRateLimit(this, request);
 
                     responseInfo = getResponseInfo(request);

src/main/java/org/kohsuke/github/GitHubHttpUrlConnectionClient.java

@@ -1,6 +1,7 @@
 package org.kohsuke.github;
 
 import org.apache.commons.io.IOUtils;
+import org.kohsuke.github.authorization.AuthorizationProvider;
 
 import java.io.IOException;
 import java.io.InputStream;
@@ -33,25 +34,19 @@ import static org.apache.commons.lang3.StringUtils.defaultString;
 class GitHubHttpUrlConnectionClient extends GitHubClient {
 
     GitHubHttpUrlConnectionClient(String apiUrl,
-            String login,
-            String oauthAccessToken,
-            String jwtToken,
-            String password,
             HttpConnector connector,
             RateLimitHandler rateLimitHandler,
             AbuseLimitHandler abuseLimitHandler,
             GitHubRateLimitChecker rateLimitChecker,
-            Consumer<GHMyself> myselfConsumer) throws IOException {
+            Consumer<GHMyself> myselfConsumer,
+            AuthorizationProvider authorizationProvider) throws IOException {
         super(apiUrl,
-                login,
-                oauthAccessToken,
-                jwtToken,
-                password,
                 connector,
                 rateLimitHandler,
                 abuseLimitHandler,
                 rateLimitChecker,
-                myselfConsumer);
+                myselfConsumer,
+                authorizationProvider);
     }
 
     @Nonnull
@@ -114,8 +109,12 @@ class GitHubHttpUrlConnectionClient extends GitHubClient {
 
             // if the authentication is needed but no credential is given, try it anyway (so that some calls
             // that do work with anonymous access in the reduced form should still work.)
-            if (client.encodedAuthorization != null)
-                connection.setRequestProperty("Authorization", client.encodedAuthorization);
+            if (!request.headers().containsKey("Authorization")) {
+                String authorization = client.getEncodedAuthorization();
+                if (authorization != null) {
+                    connection.setRequestProperty("Authorization", client.getEncodedAuthorization());
+                }
+            }
 
             setRequestMethod(request.method(), connection);
             buildRequest(request, connection);

src/main/java/org/kohsuke/github/GitHubInteractiveObject.java

@@ -20,4 +20,8 @@ abstract class GitHubInteractiveObject {
     GitHubInteractiveObject(GitHub root) {
         this.root = root;
     }
+
+    GitHub getRoot() {
+        return root;
+    }
 }

src/main/java/org/kohsuke/github/GitHubRequest.java

@@ -2,6 +2,7 @@ package org.kohsuke.github;
 
 import edu.umd.cs.findbugs.annotations.NonNull;
 import org.apache.commons.lang3.StringUtils;
+import org.kohsuke.github.internal.Previews;
 
 import java.io.InputStream;
 import java.io.UnsupportedEncodingException;

src/main/java/org/kohsuke/github/GitHubResponse.java

@@ -4,6 +4,7 @@ import com.fasterxml.jackson.core.JsonParseException;
 import com.fasterxml.jackson.databind.InjectableValues;
 import com.fasterxml.jackson.databind.JsonMappingException;
 import org.apache.commons.io.IOUtils;
+import org.kohsuke.github.function.FunctionThrows;
 
 import java.io.Closeable;
 import java.io.IOException;
@@ -194,24 +195,11 @@ class GitHubResponse<T> {
     /**
      * Represents a supplier of results that can throw.
      *
-     * <p>
-     * This is a <a href="package-summary.html">functional interface</a> whose functional method is
-     * {@link #apply(ResponseInfo)}.
-     *
      * @param <T>
      *            the type of results supplied by this supplier
      */
     @FunctionalInterface
-    interface BodyHandler<T> {
-
-        /**
-         * Gets a result.
-         *
-         * @return a result
-         * @throws IOException
-         *             if an I/O Exception occurs.
-         */
-        T apply(ResponseInfo input) throws IOException;
+    interface BodyHandler<T> extends FunctionThrows<ResponseInfo, T, IOException> {
     }
 
     /**

src/main/java/org/kohsuke/github/Preview.java

@@ -1,5 +1,7 @@
 package org.kohsuke.github;
 
+import org.kohsuke.github.internal.Previews;
+
 import java.lang.annotation.Documented;
 import java.lang.annotation.Retention;
 import java.lang.annotation.RetentionPolicy;

src/main/java/org/kohsuke/github/Reactable.java

@@ -2,7 +2,7 @@ package org.kohsuke.github;
 
 import java.io.IOException;
 
-import static org.kohsuke.github.Previews.SQUIRREL_GIRL;
+import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
 
 /**
  * Those {@link GHObject}s that can have {@linkplain GHReaction reactions}.

src/main/java/org/kohsuke/github/Requester.java

@@ -23,7 +23,9 @@
  */
 package org.kohsuke.github;
 
+import edu.umd.cs.findbugs.annotations.NonNull;
 import org.apache.commons.io.IOUtils;
+import org.kohsuke.github.function.InputStreamFunction;
 
 import java.io.ByteArrayInputStream;
 import java.io.IOException;
@@ -106,15 +108,31 @@ class Requester extends GitHubRequest.Builder<Requester> {
      * Response input stream. There are scenarios where direct stream reading is needed, however it is better to use
      * {@link #fetch(Class)} where possible.
      *
-     * @return the input stream
      * @throws IOException
      *             the io exception
      */
-    public InputStream fetchStream() throws IOException {
-        return client
-                .sendRequest(this,
-                        (responseInfo) -> new ByteArrayInputStream(IOUtils.toByteArray(responseInfo.bodyStream())))
-                .body();
+    public <T> T fetchStream(@Nonnull InputStreamFunction<T> handler) throws IOException {
+        return client.sendRequest(this, (responseInfo) -> handler.apply(responseInfo.bodyStream())).body();
+    }
+
+    /**
+     * Helper function to make it easy to pull streams.
+     *
+     * Copies an input stream to an in-memory input stream. The performance on this is not great but
+     * {@link GitHubResponse.ResponseInfo#bodyStream()} is closed at the end of every call to
+     * {@link GitHubClient#sendRequest(GitHubRequest, GitHubResponse.BodyHandler)}, so any reads to the original input
+     * stream must be completed before then. There are a number of deprecated methods that return {@link InputStream}.
+     * This method keeps all of them using the same code path.
+     *
+     * @param inputStream
+     *            the input stream to be copied
+     * @return an in-memory copy of the passed input stream
+     * @throws IOException
+     *             if an error occurs while copying the stream
+     */
+    @NonNull
+    public static InputStream copyInputStream(InputStream inputStream) throws IOException {
+        return new ByteArrayInputStream(IOUtils.toByteArray(inputStream));
     }
 
     /**

src/main/java/org/kohsuke/github/authorization/AuthorizationProvider.java

@@ -0,0 +1,43 @@
+package org.kohsuke.github.authorization;
+
+import java.io.IOException;
+
+/**
+ * Provides a functional interface that returns a valid encodedAuthorization. This strategy allows for a provider that
+ * dynamically changes the credentials. Each request will request the credentials from the provider.
+ */
+public interface AuthorizationProvider {
+    /**
+     * An static instance for an ANONYMOUS authorization provider
+     */
+    AuthorizationProvider ANONYMOUS = new AnonymousAuthorizationProvider();
+
+    /**
+     * Returns the credentials to be used with a given request. As an example, a authorization provider for a bearer
+     * token will return something like:
+     *
+     * <pre>
+     * {@code
+     *  &#64;Override
+     *  public String getEncodedAuthorization() {
+     *  return "Bearer myBearerToken";
+     *  }
+     * }
+     * </pre>
+     *
+     * @return encoded authorization string, can be null
+     * @throws IOException
+     *             on any error that prevents the provider from getting a valid authorization
+     */
+    String getEncodedAuthorization() throws IOException;
+
+    /**
+     * A {@link AuthorizationProvider} that ensures that no credentials are returned
+     */
+    class AnonymousAuthorizationProvider implements AuthorizationProvider {
+        @Override
+        public String getEncodedAuthorization() throws IOException {
+            return null;
+        }
+    }
+}

src/main/java/org/kohsuke/github/authorization/ImmutableAuthorizationProvider.java

@@ -0,0 +1,123 @@
+package org.kohsuke.github.authorization;
+
+import java.io.UnsupportedEncodingException;
+import java.nio.charset.StandardCharsets;
+import java.util.Base64;
+
+import javax.annotation.CheckForNull;
+
+/**
+ * A {@link AuthorizationProvider} that always returns the same credentials
+ */
+public class ImmutableAuthorizationProvider implements AuthorizationProvider {
+
+    private final String authorization;
+
+    public ImmutableAuthorizationProvider(String authorization) {
+        this.authorization = authorization;
+    }
+
+    /**
+     * Builds and returns a {@link AuthorizationProvider} from a given oauthAccessToken
+     *
+     * @param oauthAccessToken
+     *            The token
+     * @return a correctly configured {@link AuthorizationProvider} that will always return the same provided
+     *         oauthAccessToken
+     */
+    public static AuthorizationProvider fromOauthToken(String oauthAccessToken) {
+        return new UserProvider(String.format("token %s", oauthAccessToken));
+    }
+
+    /**
+     * Builds and returns a {@link AuthorizationProvider} from a given oauthAccessToken
+     *
+     * @param oauthAccessToken
+     *            The token
+     * @param login
+     *            The login for this token
+     *
+     * @return a correctly configured {@link AuthorizationProvider} that will always return the same provided
+     *         oauthAccessToken
+     */
+    public static AuthorizationProvider fromOauthToken(String oauthAccessToken, String login) {
+        return new UserProvider(String.format("token %s", oauthAccessToken), login);
+    }
+
+    /**
+     * Builds and returns a {@link AuthorizationProvider} from a given App Installation Token
+     *
+     * @param appInstallationToken
+     *            A string containing the GitHub App installation token
+     * @return the configured Builder from given GitHub App installation token.
+     */
+    public static AuthorizationProvider fromAppInstallationToken(String appInstallationToken) {
+        return fromOauthToken(appInstallationToken, "");
+    }
+
+    /**
+     * Builds and returns a {@link AuthorizationProvider} from a given jwtToken
+     *
+     * @param jwtToken
+     *            The JWT token
+     * @return a correctly configured {@link AuthorizationProvider} that will always return the same provided jwtToken
+     */
+    public static AuthorizationProvider fromJwtToken(String jwtToken) {
+        return new ImmutableAuthorizationProvider(String.format("Bearer %s", jwtToken));
+    }
+
+    /**
+     * Builds and returns a {@link AuthorizationProvider} from the given user/password pair
+     *
+     * @param login
+     *            The login for the user, usually the same as the username
+     * @param password
+     *            The password for the associated user
+     * @return a correctly configured {@link AuthorizationProvider} that will always return the credentials for the same
+     *         user and password combo
+     * @deprecated Login with password credentials are no longer supported by GitHub
+     */
+    @Deprecated
+    public static AuthorizationProvider fromLoginAndPassword(String login, String password) {
+        try {
+            String authorization = (String.format("%s:%s", login, password));
+            String charsetName = StandardCharsets.UTF_8.name();
+            String b64encoded = Base64.getEncoder().encodeToString(authorization.getBytes(charsetName));
+            String encodedAuthorization = String.format("Basic %s", b64encoded);
+            return new UserProvider(encodedAuthorization, login);
+        } catch (UnsupportedEncodingException e) {
+            // If UTF-8 isn't supported, there are bigger problems
+            throw new IllegalStateException("Could not generate encoded authorization", e);
+        }
+    }
+
+    @Override
+    public String getEncodedAuthorization() {
+        return this.authorization;
+    }
+
+    /**
+     * An internal class representing all user-related credentials, which are credentials that have a login or should
+     * query the user endpoint for the login matching this credential.
+     */
+    private static class UserProvider extends ImmutableAuthorizationProvider implements UserAuthorizationProvider {
+
+        private final String login;
+
+        UserProvider(String authorization) {
+            this(authorization, null);
+        }
+
+        UserProvider(String authorization, String login) {
+            super(authorization);
+            this.login = login;
+        }
+
+        @CheckForNull
+        @Override
+        public String getLogin() {
+            return login;
+        }
+
+    }
+}

src/main/java/org/kohsuke/github/authorization/OrgAppInstallationAuthorizationProvider.java

@@ -0,0 +1,63 @@
+package org.kohsuke.github.authorization;
+
+import org.kohsuke.github.BetaApi;
+import org.kohsuke.github.GHAppInstallation;
+import org.kohsuke.github.GHAppInstallationToken;
+import org.kohsuke.github.GitHub;
+
+import java.io.IOException;
+import java.time.Duration;
+import java.time.Instant;
+import java.util.Objects;
+
+import javax.annotation.Nonnull;
+
+/**
+ * Provides an AuthorizationProvider that performs automatic token refresh.
+ */
+public class OrgAppInstallationAuthorizationProvider extends GitHub.DependentAuthorizationProvider {
+
+    private final String organizationName;
+
+    private String latestToken;
+
+    @Nonnull
+    private Instant validUntil = Instant.MIN;
+
+    /**
+     * Provides an AuthorizationProvider that performs automatic token refresh, based on an previously authenticated
+     * github client.
+     *
+     * @param organizationName
+     *            The name of the organization where the application is installed
+     * @param authorizationProvider
+     *            A authorization provider that returns a JWT token that can be used to refresh the App Installation
+     *            token from GitHub.
+     */
+    @BetaApi
+    @Deprecated
+    public OrgAppInstallationAuthorizationProvider(String organizationName,
+            AuthorizationProvider authorizationProvider) {
+        super(authorizationProvider);
+        this.organizationName = organizationName;
+    }
+
+    @Override
+    public String getEncodedAuthorization() throws IOException {
+        synchronized (this) {
+            if (latestToken == null || Instant.now().isAfter(this.validUntil)) {
+                refreshToken();
+            }
+            return String.format("token %s", latestToken);
+        }
+    }
+
+    private void refreshToken() throws IOException {
+        GitHub gitHub = this.gitHub();
+        GHAppInstallation installationByOrganization = gitHub.getApp()
+                .getInstallationByOrganization(this.organizationName);
+        GHAppInstallationToken ghAppInstallationToken = installationByOrganization.createToken().create();
+        this.validUntil = ghAppInstallationToken.getExpiresAt().toInstant().minus(Duration.ofMinutes(5));
+        this.latestToken = Objects.requireNonNull(ghAppInstallationToken.getToken());
+    }
+}

src/main/java/org/kohsuke/github/authorization/UserAuthorizationProvider.java

@@ -0,0 +1,22 @@
+package org.kohsuke.github.authorization;
+
+import javax.annotation.CheckForNull;
+
+/**
+ * Interface for all user-related authorization providers.
+ *
+ * {@link AuthorizationProvider}s can apply to a number of different account types. This interface applies to providers
+ * for user accounts, ones that have a login or should query the "/user" endpoint for the login matching this
+ * credential.
+ */
+public interface UserAuthorizationProvider extends AuthorizationProvider {
+
+    /**
+     * Gets the user login name.
+     *
+     * @return the user login for this provider, or {@code null} if the login value should be queried from the "/user"
+     *         endpoint.
+     */
+    @CheckForNull
+    String getLogin();
+}

src/main/java/org/kohsuke/github/extras/authorization/JWTTokenProvider.java

@@ -0,0 +1,130 @@
+package org.kohsuke.github.extras.authorization;
+
+import io.jsonwebtoken.JwtBuilder;
+import io.jsonwebtoken.Jwts;
+import io.jsonwebtoken.SignatureAlgorithm;
+import org.kohsuke.github.authorization.AuthorizationProvider;
+
+import java.io.File;
+import java.io.IOException;
+import java.nio.charset.StandardCharsets;
+import java.nio.file.Files;
+import java.nio.file.Path;
+import java.security.GeneralSecurityException;
+import java.security.KeyFactory;
+import java.security.PrivateKey;
+import java.security.spec.InvalidKeySpecException;
+import java.security.spec.PKCS8EncodedKeySpec;
+import java.time.Duration;
+import java.time.Instant;
+import java.util.Base64;
+import java.util.Date;
+
+import javax.annotation.Nonnull;
+
+/**
+ * A authorization provider that gives valid JWT tokens. These tokens are then used to create a time-based token to
+ * authenticate as an application. This token provider does not provide any kind of caching, and will always request a
+ * new token to the API.
+ */
+public class JWTTokenProvider implements AuthorizationProvider {
+
+    private final PrivateKey privateKey;
+
+    @Nonnull
+    private Instant validUntil = Instant.MIN;
+
+    private String token;
+
+    /**
+     * The identifier for the application
+     */
+    private final String applicationId;
+
+    public JWTTokenProvider(String applicationId, File keyFile) throws GeneralSecurityException, IOException {
+        this(applicationId, keyFile.toPath());
+    }
+
+    public JWTTokenProvider(String applicationId, Path keyPath) throws GeneralSecurityException, IOException {
+        this(applicationId, new String(Files.readAllBytes(keyPath), StandardCharsets.UTF_8));
+    }
+
+    public JWTTokenProvider(String applicationId, String keyString) throws GeneralSecurityException {
+        this(applicationId, getPrivateKeyFromString(keyString));
+    }
+
+    public JWTTokenProvider(String applicationId, PrivateKey privateKey) {
+        this.privateKey = privateKey;
+        this.applicationId = applicationId;
+    }
+
+    @Override
+    public String getEncodedAuthorization() throws IOException {
+        synchronized (this) {
+            if (Instant.now().isAfter(validUntil)) {
+                token = refreshJWT();
+            }
+            return String.format("Bearer %s", token);
+        }
+    }
+
+    /**
+     * Convert a PKCS#8 formatted private key in string format into a java PrivateKey
+     *
+     * @param key
+     *            PCKS#8 string
+     * @return private key
+     * @throws GeneralSecurityException
+     *             if we couldn't parse the string
+     */
+    private static PrivateKey getPrivateKeyFromString(final String key) throws GeneralSecurityException {
+        if (key.contains(" RSA ")) {
+            throw new InvalidKeySpecException(
+                    "Private key must be a PKCS#8 formatted string, to convert it from PKCS#1 use: "
+                            + "openssl pkcs8 -topk8 -inform PEM -outform PEM -in current-key.pem -out new-key.pem -nocrypt");
+        }
+
+        // Remove all comments and whitespace from PEM
+        // such as "-----BEGIN PRIVATE KEY-----" and newlines
+        String privateKeyContent = key.replaceAll("(?m)^--.*", "").replaceAll("\\s", "");
+
+        KeyFactory kf = KeyFactory.getInstance("RSA");
+
+        try {
+            byte[] decode = Base64.getDecoder().decode(privateKeyContent);
+            PKCS8EncodedKeySpec keySpecPKCS8 = new PKCS8EncodedKeySpec(decode);
+
+            return kf.generatePrivate(keySpecPKCS8);
+        } catch (IllegalArgumentException e) {
+            throw new InvalidKeySpecException("Failed to decode private key: " + e.getMessage(), e);
+        }
+    }
+
+    private String refreshJWT() {
+        Instant now = Instant.now();
+
+        // Max token expiration is 10 minutes for GitHub
+        // We use a smaller window since we likely will not need more than a few seconds
+        Instant expiration = now.plus(Duration.ofMinutes(8));
+
+        // Setting the issued at to a time in the past to allow for clock skew
+        Instant issuedAt = getIssuedAt(now);
+
+        // Let's set the JWT Claims
+        JwtBuilder builder = Jwts.builder()
+                .setIssuedAt(Date.from(issuedAt))
+                .setExpiration(Date.from(expiration))
+                .setIssuer(this.applicationId)
+                .signWith(privateKey, SignatureAlgorithm.RS256);
+
+        // Token will refresh 2 minutes before it expires
+        validUntil = expiration.minus(Duration.ofMinutes(2));
+
+        // Builds the JWT and serializes it to a compact, URL-safe string
+        return builder.compact();
+    }
+
+    Instant getIssuedAt(Instant now) {
+        return now.minus(Duration.ofMinutes(2));
+    }
+}

src/main/java/org/kohsuke/github/function/FunctionThrows.java

@@ -0,0 +1,25 @@
+package org.kohsuke.github.function;
+
+/**
+ * A functional interface, equivalent to {@link java.util.function.Function} but that allows throwing {@link Throwable}
+ *
+ * @param <T>
+ *            the type of input
+ * @param <R>
+ *            the type of output
+ * @param <E>
+ *            the type of error
+ */
+@FunctionalInterface
+public interface FunctionThrows<T, R, E extends Throwable> {
+    /**
+     * Apply r.
+     *
+     * @param input
+     *            the input
+     * @return the r
+     * @throws E
+     *             the e
+     */
+    R apply(T input) throws E;
+}

src/main/java/org/kohsuke/github/function/InputStreamFunction.java

@@ -0,0 +1,14 @@
+package org.kohsuke.github.function;
+
+import java.io.IOException;
+import java.io.InputStream;
+
+/**
+ * A functional interface, equivalent to {@link java.util.function.Function} but that allows throwing {@link Throwable}
+ *
+ * @param <R>
+ *            the type to of object to be returned
+ */
+@FunctionalInterface
+public interface InputStreamFunction<R> extends FunctionThrows<InputStream, R, IOException> {
+}

src/main/java/org/kohsuke/github/internal/EnumUtils.java

@@ -0,0 +1,39 @@
+package org.kohsuke.github.internal;
+
+import java.util.Locale;
+
+/**
+ * Utils for Enums.
+ */
+public final class EnumUtils {
+
+    /**
+     * Returns an enum value matching the value if found, null if the value is null and {@code defaultEnum} if the value
+     * cannot be matched to a value of the enum.
+     * <p>
+     * The value is converted to uppercase before being matched to the enum values.
+     *
+     * @param <E>
+     *            the type of the enum
+     * @param enumClass
+     *            the type of the enum
+     * @param value
+     *            the value to interpret
+     * @param defaultEnum
+     *            the default enum value if the value doesn't match one of the enum value
+     * @return an enum value or null
+     */
+    public static <E extends Enum<E>> E getNullableEnumOrDefault(Class<E> enumClass, String value, E defaultEnum) {
+        if (value == null) {
+            return null;
+        }
+        try {
+            return Enum.valueOf(enumClass, value.toUpperCase(Locale.ROOT));
+        } catch (IllegalArgumentException e) {
+            return defaultEnum;
+        }
+    }
+
+    private EnumUtils() {
+    }
+}

src/main/java/org/kohsuke/github/internal/Previews.java

@@ -1,4 +1,4 @@
-package org.kohsuke.github;
+package org.kohsuke.github.internal;
 
 /**
  * Provides the media type strings for GitHub API previews
@@ -7,7 +7,7 @@ package org.kohsuke.github;
  *
  * @author Kohsuke Kawaguchi
  */
-enum Previews {
+public enum Previews {
 
     /**
      * Check-runs and check-suites

src/test/java/org/kohsuke/github/AbstractGHAppInstallationTest.java

@@ -2,8 +2,14 @@ package org.kohsuke.github;
 
 import io.jsonwebtoken.Jwts;
 import org.apache.commons.io.IOUtils;
+import org.kohsuke.github.authorization.AuthorizationProvider;
+import org.kohsuke.github.extras.authorization.JWTTokenProvider;
 
+import java.io.File;
 import java.io.IOException;
+import java.nio.charset.StandardCharsets;
+import java.nio.file.Files;
+import java.security.GeneralSecurityException;
 import java.security.KeyFactory;
 import java.security.PrivateKey;
 import java.security.spec.PKCS8EncodedKeySpec;
@@ -21,6 +27,26 @@ public class AbstractGHAppInstallationTest extends AbstractGitHubWireMockTest {
     private static String PRIVATE_KEY_FILE_APP_2 = "/ghapi-test-app-2.private-key.pem";
     private static String PRIVATE_KEY_FILE_APP_3 = "/ghapi-test-app-3.private-key.pem";
 
+    private static AuthorizationProvider JWT_PROVIDER_1;
+    private static AuthorizationProvider JWT_PROVIDER_2;
+    private static AuthorizationProvider JWT_PROVIDER_3;
+
+    AbstractGHAppInstallationTest() {
+        try {
+            JWT_PROVIDER_1 = new JWTTokenProvider(TEST_APP_ID_1,
+                    new File(this.getClass().getResource(PRIVATE_KEY_FILE_APP_1).getFile()));
+            JWT_PROVIDER_2 = new JWTTokenProvider(TEST_APP_ID_2,
+                    new File(this.getClass().getResource(PRIVATE_KEY_FILE_APP_2).getFile()).toPath());
+            JWT_PROVIDER_3 = new JWTTokenProvider(TEST_APP_ID_3,
+                    new String(
+                            Files.readAllBytes(
+                                    new File(this.getClass().getResource(PRIVATE_KEY_FILE_APP_3).getFile()).toPath()),
+                            StandardCharsets.UTF_8));
+        } catch (GeneralSecurityException | IOException e) {
+            throw new RuntimeException("These should never fail", e);
+        }
+    }
+
     private String createJwtToken(String keyFileResouceName, String appId) {
         try {
             String keyPEM = IOUtils.toString(this.getClass().getResource(keyFileResouceName), "US-ASCII")
@@ -54,24 +80,25 @@ public class AbstractGHAppInstallationTest extends AbstractGitHubWireMockTest {
                 .findFirst()
                 .get();
 
-        appInstallation
-                .setRoot(getGitHubBuilder().withAppInstallationToken(appInstallation.createToken().create().getToken())
-                        .withEndpoint(mockGitHub.apiServer().baseUrl())
-                        .build());
+        // TODO: this is odd
+        // appInstallation
+        // .setRoot(getGitHubBuilder().withAppInstallationToken(appInstallation.createToken().create().getToken())
+        // .withEndpoint(mockGitHub.apiServer().baseUrl())
+        // .build());
 
         return appInstallation;
     }
 
     protected GHAppInstallation getAppInstallationWithTokenApp1() throws IOException {
-        return getAppInstallationWithToken(createJwtToken(PRIVATE_KEY_FILE_APP_1, TEST_APP_ID_1));
+        return getAppInstallationWithToken(JWT_PROVIDER_1.getEncodedAuthorization());
     }
 
     protected GHAppInstallation getAppInstallationWithTokenApp2() throws IOException {
-        return getAppInstallationWithToken(createJwtToken(PRIVATE_KEY_FILE_APP_2, TEST_APP_ID_2));
+        return getAppInstallationWithToken(JWT_PROVIDER_2.getEncodedAuthorization());
     }
 
     protected GHAppInstallation getAppInstallationWithTokenApp3() throws IOException {
-        return getAppInstallationWithToken(createJwtToken(PRIVATE_KEY_FILE_APP_3, TEST_APP_ID_3));
+        return getAppInstallationWithToken(JWT_PROVIDER_3.getEncodedAuthorization());
     }
 
 }

src/test/java/org/kohsuke/github/AbstractGitHubWireMockTest.java

@@ -100,7 +100,6 @@ public abstract class AbstractGitHubWireMockTest extends Assert {
             // This sets the user and password to a placeholder for wiremock testing
             // This makes the tests believe they are running with permissions
             // The recorded stubs will behave like they running with permissions
-            builder.oauthToken = null;
             builder.withPassword(STUBBED_USER_LOGIN, STUBBED_USER_PASSWORD);
         }
 

src/test/java/org/kohsuke/github/AppTest.java

@@ -19,10 +19,7 @@ import java.util.*;
 import java.util.Map.Entry;
 import java.util.regex.Pattern;
 
-import static org.hamcrest.CoreMatchers.*;
-import static org.hamcrest.CoreMatchers.sameInstance;
-import static org.hamcrest.Matchers.hasProperty;
-import static org.hamcrest.Matchers.oneOf;
+import static org.hamcrest.Matchers.*;
 
 /**
  * Unit test for simple App.
@@ -37,10 +34,11 @@ public class AppTest extends AbstractGitHubWireMockTest {
         cleanupUserRepository("github-api-test-rename");
         cleanupUserRepository(targetName);
 
-        GHRepository r = gitHub.createRepository("github-api-test-rename",
-                "a test repository",
-                "http://github-api.kohsuke.org/",
-                true);
+        GHRepository r = gitHub.createRepository("github-api-test-rename")
+                .description("a test repository")
+                .homepage("http://github-api.kohsuke.org/")
+                .private_(false)
+                .create();
 
         assertThat(r.hasIssues(), is(true));
         assertThat(r.hasWiki(), is(true));
@@ -137,13 +135,36 @@ public class AppTest extends AbstractGitHubWireMockTest {
     @Test
     public void testIssueWithNoComment() throws IOException {
         GHRepository repository = gitHub.getRepository("kohsuke/test");
-        List<GHIssueComment> v = repository.getIssue(4).getComments();
+        GHIssue i = repository.getIssue(4);
+        List<GHIssueComment> v = i.getComments();
         // System.out.println(v);
         assertTrue(v.isEmpty());
 
-        v = repository.getIssue(3).getComments();
+        i = repository.getIssue(3);
+        v = i.getComments();
         // System.out.println(v);
-        assertTrue(v.size() == 3);
+        assertThat(v.size(), equalTo(3));
+        assertThat(v.get(0).getHtmlUrl().toString(),
+                equalTo("https://github.com/kohsuke/test/issues/3#issuecomment-8547249"));
+        assertThat(v.get(0).getUrl().toString(), endsWith("/repos/kohsuke/test/issues/comments/8547249"));
+        assertThat(v.get(0).getNodeId(), equalTo("MDEyOklzc3VlQ29tbWVudDg1NDcyNDk="));
+        assertThat(v.get(0).getParent().getNumber(), equalTo(3));
+        assertThat(v.get(0).getParent().getId(), equalTo(6863845L));
+        assertThat(v.get(0).getUser().getLogin(), equalTo("kohsuke"));
+        assertThat(v.get(0).listReactions().toList().size(), equalTo(0));
+
+        assertThat(v.get(1).getHtmlUrl().toString(),
+                equalTo("https://github.com/kohsuke/test/issues/3#issuecomment-8547251"));
+        assertThat(v.get(1).getUrl().toString(), endsWith("/repos/kohsuke/test/issues/comments/8547251"));
+        assertThat(v.get(1).getNodeId(), equalTo("MDEyOklzc3VlQ29tbWVudDg1NDcyNTE="));
+        assertThat(v.get(1).getParent().getNumber(), equalTo(3));
+        assertThat(v.get(1).getUser().getLogin(), equalTo("kohsuke"));
+        List<GHReaction> reactions = v.get(1).listReactions().toList();
+        assertThat(reactions.size(), equalTo(3));
+
+        // TODO: Add comment CRUD test
+        // TODO: Add reactions CRUD test
+
     }
 
     @Test
@@ -165,49 +186,60 @@ public class AppTest extends AbstractGitHubWireMockTest {
     @Test
     public void testCreateAndListDeployments() throws IOException {
         GHRepository repository = getTestRepository();
-        GHDeployment deployment = repository.createDeployment("master")
+        GHDeployment deployment = repository.createDeployment("main")
                 .payload("{\"user\":\"atmos\",\"room_id\":123456}")
                 .description("question")
                 .environment("unittest")
                 .create();
-        assertNotNull(deployment.getCreator());
-        assertNotNull(deployment.getId());
-        List<GHDeployment> deployments = repository.listDeployments(null, "master", null, "unittest").toList();
-        assertNotNull(deployments);
-        assertFalse(Iterables.isEmpty(deployments));
-        GHDeployment unitTestDeployment = deployments.get(0);
-        assertEquals("unittest", unitTestDeployment.getEnvironment());
-        assertEquals("unittest", unitTestDeployment.getOriginalEnvironment());
-        assertEquals(false, unitTestDeployment.isProductionEnvironment());
-        assertEquals(true, unitTestDeployment.isTransientEnvironment());
-        assertEquals("master", unitTestDeployment.getRef());
+        try {
+            assertNotNull(deployment.getCreator());
+            assertNotNull(deployment.getId());
+            List<GHDeployment> deployments = repository.listDeployments(null, "main", null, "unittest").toList();
+            assertNotNull(deployments);
+            assertFalse(Iterables.isEmpty(deployments));
+            GHDeployment unitTestDeployment = deployments.get(0);
+            assertEquals("unittest", unitTestDeployment.getEnvironment());
+            assertEquals("unittest", unitTestDeployment.getOriginalEnvironment());
+            assertEquals(false, unitTestDeployment.isProductionEnvironment());
+            assertEquals(false, unitTestDeployment.isTransientEnvironment());
+            assertEquals("main", unitTestDeployment.getRef());
+        } finally {
+            // deployment.delete();
+            assert true;
+        }
     }
 
-    @Ignore("Needs mocking check")
     @Test
     public void testGetDeploymentStatuses() throws IOException {
         GHRepository repository = getTestRepository();
-        GHDeployment deployment = repository.createDeployment("master")
+        GHDeployment deployment = repository.createDeployment("main")
                 .description("question")
                 .payload("{\"user\":\"atmos\",\"room_id\":123456}")
                 .create();
-        GHDeploymentStatus ghDeploymentStatus = deployment.createStatus(GHDeploymentState.QUEUED)
-                .description("success")
-                .targetUrl("http://www.github.com")
-                .logUrl("http://www.github.com/logurl")
-                .environmentUrl("http://www.github.com/envurl")
-                .environment("new-ci-env")
-                .create();
-        Iterable<GHDeploymentStatus> deploymentStatuses = deployment.listStatuses();
-        assertNotNull(deploymentStatuses);
-        assertEquals(1, Iterables.size(deploymentStatuses));
-        GHDeploymentStatus actualStatus = Iterables.get(deploymentStatuses, 0);
-        assertEquals(ghDeploymentStatus.getId(), actualStatus.getId());
-        assertEquals(ghDeploymentStatus.getState(), actualStatus.getState());
-        assertEquals(ghDeploymentStatus.getLogUrl(), actualStatus.getLogUrl());
-        // Target url was deprecated and replaced with log url. The gh api will
-        // prefer the log url value and return it in place of target url.
-        assertEquals(ghDeploymentStatus.getTargetUrl(), actualStatus.getLogUrl());
+        try {
+            GHDeploymentStatus ghDeploymentStatus = deployment.createStatus(GHDeploymentState.QUEUED)
+                    .description("success")
+                    .targetUrl("http://www.github.com")
+                    .logUrl("http://www.github.com/logurl")
+                    .environmentUrl("http://www.github.com/envurl")
+                    .environment("new-ci-env")
+                    .create();
+            Iterable<GHDeploymentStatus> deploymentStatuses = deployment.listStatuses();
+            assertNotNull(deploymentStatuses);
+            assertEquals(1, Iterables.size(deploymentStatuses));
+            GHDeploymentStatus actualStatus = Iterables.get(deploymentStatuses, 0);
+            assertEquals(ghDeploymentStatus.getId(), actualStatus.getId());
+            assertEquals(ghDeploymentStatus.getState(), actualStatus.getState());
+            assertEquals(ghDeploymentStatus.getLogUrl(), actualStatus.getLogUrl());
+            // Target url was deprecated and replaced with log url. The gh api will
+            // prefer the log url value and return it in place of target url.
+            assertEquals(ghDeploymentStatus.getTargetUrl(), actualStatus.getLogUrl());
+            assertThat(ghDeploymentStatus.getDeploymentUrl(), equalTo(deployment.getUrl()));
+            assertThat(ghDeploymentStatus.getRepositoryUrl(), equalTo(repository.getUrl()));
+        } finally {
+            // deployment.delete();
+            assert true;
+        }
     }
 
     @Test
@@ -324,7 +356,7 @@ public class AppTest extends AbstractGitHubWireMockTest {
         assertEquals(teamByName.getId(), teamById.getId());
         assertEquals(teamByName.getDescription(), teamById.getDescription());
 
-        GHTeam teamById2 = organization.getTeam((int) teamByName.getId());
+        GHTeam teamById2 = organization.getTeam(teamByName.getId());
         assertNotNull(teamById2);
 
         assertEquals(teamByName.getId(), teamById2.getId());
@@ -445,6 +477,16 @@ public class AppTest extends AbstractGitHubWireMockTest {
 
         File f = commit.getFiles().get(0);
         assertEquals(48, f.getLinesChanged());
+        assertThat(f.getLinesAdded(), equalTo(40));
+        assertThat(f.getLinesDeleted(), equalTo(8));
+        assertThat(f.getPreviousFilename(), nullValue());
+        assertThat(f.getPatch(), startsWith("@@ -54,6 +54,14 @@\n"));
+        assertThat(f.getSha(), equalTo("04d3e54017542ad0ff46355eababacd4850ccba5"));
+        assertThat(f.getBlobUrl().toString(),
+                equalTo("https://github.com/jenkinsci/jenkins/blob/08c1c9970af4d609ae754fbe803e06186e3206f7/changelog.html"));
+        assertThat(f.getRawUrl().toString(),
+                equalTo("https://github.com/jenkinsci/jenkins/raw/08c1c9970af4d609ae754fbe803e06186e3206f7/changelog.html"));
+
         assertEquals("modified", f.getStatus());
         assertEquals("changelog.html", f.getFileName());
 
@@ -464,22 +506,6 @@ public class AppTest extends AbstractGitHubWireMockTest {
         assertEquals(1, sha1.size());
     }
 
-    public void testQueryCommits() throws Exception {
-        List<String> sha1 = new ArrayList<String>();
-        for (GHCommit c : gitHub.getUser("jenkinsci")
-                .getRepository("jenkins")
-                .queryCommits()
-                .since(new Date(1199174400000L))
-                .until(1201852800000L)
-                .path("pom.xml")
-                .list()) {
-            // System.out.println(c.getSHA1());
-            sha1.add(c.getSHA1());
-        }
-        assertEquals("1cccddb22e305397151b2b7b87b4b47d74ca337b", sha1.get(0));
-        assertEquals(29, sha1.size());
-    }
-
     @Ignore("Needs mocking check")
     @Test
     public void testBranches() throws Exception {
@@ -504,23 +530,65 @@ public class AppTest extends AbstractGitHubWireMockTest {
                 .getRepository("sandbox-ant")
                 .getCommit("8ae38db0ea5837313ab5f39d43a6f73de3bd9000");
         GHCommitComment c = commit.createComment("[testing](http://kohsuse.org/)");
-        // System.out.println(c);
-        c.update("updated text");
-        // System.out.println(c);
-        c.delete();
+        try {
+            assertThat(c.getPath(), nullValue());
+            assertThat(c.getLine(), equalTo(-1));
+            assertThat(c.getHtmlUrl().toString(),
+                    containsString(
+                            "kohsuke/sandbox-ant/commit/8ae38db0ea5837313ab5f39d43a6f73de3bd9000#commitcomment-"));
+            assertThat(c.listReactions().toList(), is(empty()));
+
+            c.update("updated text");
+            assertThat(c.getBody(), equalTo("updated text"));
+        } finally {
+            c.delete();
+        }
     }
 
     @Test
     public void tryHook() throws Exception {
-        kohsuke();
-        GHRepository r = gitHub.getOrganization(GITHUB_API_TEST_ORG).getRepository("github-api");
-        GHHook hook = r.createWebHook(new URL("http://www.google.com/"));
-        // System.out.println(hook);
+        GHOrganization o = gitHub.getOrganization(GITHUB_API_TEST_ORG);
+        GHRepository r = o.getRepository("github-api");
+        try {
+            GHHook hook = r.createWebHook(new URL("http://www.google.com/"));
+            assertThat(hook.getName(), equalTo("web"));
+            assertThat(hook.getEvents().size(), equalTo(1));
+            assertThat(hook.getEvents(), contains(GHEvent.PUSH));
+            assertThat(hook.getConfig().size(), equalTo(3));
+            assertThat(hook.isActive(), equalTo(true));
 
-        if (mockGitHub.isUseProxy()) {
-            r = getGitHubBeforeAfter().getOrganization(GITHUB_API_TEST_ORG).getRepository("github-api");
-            for (GHHook h : r.getHooks()) {
-                h.delete();
+            GHHook hook2 = r.getHook((int) hook.getId());
+            assertThat(hook2.getName(), equalTo("web"));
+            assertThat(hook2.getEvents().size(), equalTo(1));
+            assertThat(hook2.getEvents(), contains(GHEvent.PUSH));
+            assertThat(hook2.getConfig().size(), equalTo(3));
+            assertThat(hook2.isActive(), equalTo(true));
+            hook2.ping();
+            hook2.delete();
+
+            hook = o.createWebHook(new URL("http://www.google.com/"));
+            assertThat(hook.getName(), equalTo("web"));
+            assertThat(hook.getEvents().size(), equalTo(1));
+            assertThat(hook.getEvents(), contains(GHEvent.PUSH));
+            assertThat(hook.getConfig().size(), equalTo(3));
+            assertThat(hook.isActive(), equalTo(true));
+
+            hook2 = o.getHook((int) hook.getId());
+            assertThat(hook2.getName(), equalTo("web"));
+            assertThat(hook2.getEvents().size(), equalTo(1));
+            assertThat(hook2.getEvents(), contains(GHEvent.PUSH));
+            assertThat(hook2.getConfig().size(), equalTo(3));
+            assertThat(hook2.isActive(), equalTo(true));
+            hook2.ping();
+            hook2.delete();
+
+            // System.out.println(hook);
+        } finally {
+            if (mockGitHub.isUseProxy()) {
+                r = getGitHubBeforeAfter().getOrganization(GITHUB_API_TEST_ORG).getRepository("github-api");
+                for (GHHook h : r.getHooks()) {
+                    h.delete();
+                }
             }
         }
     }
@@ -529,6 +597,14 @@ public class AppTest extends AbstractGitHubWireMockTest {
     public void testEventApi() throws Exception {
         for (GHEventInfo ev : gitHub.getEvents()) {
             if (ev.getType() == GHEvent.PULL_REQUEST) {
+                if (ev.getId() == 10680625394L) {
+                    assertThat(ev.getActorLogin(), equalTo("pull[bot]"));
+                    assertThat(ev.getOrganization(), nullValue());
+                    assertThat(ev.getRepository().getFullName(), equalTo("daddyfatstacksBIG/lerna"));
+                    assertThat(ev.getCreatedAt(), equalTo(GitHubClient.parseDate("2019-10-21T21:54:52Z")));
+                    assertThat(ev.getType(), equalTo(GHEvent.PULL_REQUEST));
+                }
+
                 GHEventPayload.PullRequest pr = ev.getPayload(GHEventPayload.PullRequest.class);
                 assertThat(pr.getNumber(), is(pr.getPullRequest().getNumber()));
             }
@@ -859,8 +935,18 @@ public class AppTest extends AbstractGitHubWireMockTest {
         for (GHTreeEntry e : masterTree.getTree()) {
             if (e.getPath().endsWith(AppTest.class.getSimpleName() + ".java")) {
                 foundThisFile = true;
+                assertThat(e.getPath(), equalTo("src/test/java/org/kohsuke/github/AppTest.java"));
+                assertThat(e.getSha(), equalTo("baad7a7c4cf409f610a0e8c7eba17664eb655c44"));
+                assertThat(e.getMode(), equalTo("100755"));
+                assertThat(e.getSize(), greaterThan(30000L));
+                assertThat(e.getUrl().toString(),
+                        containsString("/repos/hub4j/github-api/git/blobs/baad7a7c4cf409f610a0e8c7eba17664eb655c44"));
+                GHBlob blob = e.asBlob();
+                assertThat(e.asBlob().getUrl().toString(),
+                        containsString("/repos/hub4j/github-api/git/blobs/baad7a7c4cf409f610a0e8c7eba17664eb655c44"));
                 break;
             }
+
         }
         assertTrue(foundThisFile);
     }
@@ -879,6 +965,9 @@ public class AppTest extends AbstractGitHubWireMockTest {
         GHLabel e = r.getLabel("enhancement");
         assertEquals("enhancement", e.getName());
         assertNotNull(e.getUrl());
+        assertEquals(177339106, e.getId());
+        assertEquals("MDU6TGFiZWwxNzczMzkxMDY=", e.getNodeId());
+        assertTrue(e.isDefault());
         assertTrue(Pattern.matches("[0-9a-fA-F]{6}", e.getColor()));
 
         GHLabel t = null;
@@ -890,12 +979,17 @@ public class AppTest extends AbstractGitHubWireMockTest {
             assertThat(t, not(sameInstance(t2)));
             assertThat(t, equalTo(t2));
 
+            assertFalse(t2.isDefault());
+
+            assertEquals(t.getId(), t2.getId());
+            assertEquals(t.getNodeId(), t2.getNodeId());
             assertEquals(t.getName(), t2.getName());
             assertEquals(t.getColor(), "123456");
             assertEquals(t.getColor(), t2.getColor());
             assertEquals(t.getDescription(), "");
             assertEquals(t.getDescription(), t2.getDescription());
             assertEquals(t.getUrl(), t2.getUrl());
+            assertEquals(t.isDefault(), t2.isDefault());
 
             // update works on multiple changes in one call
             t3 = t.update().color("000000").description("It is dark!").done();

src/test/java/org/kohsuke/github/BridgeMethodTest.java

@@ -33,6 +33,7 @@ public class BridgeMethodTest extends Assert {
         verifyBridgeMethods(GHIssue.class, "getCreatedAt", Date.class, String.class);
         verifyBridgeMethods(GHIssue.class, "getId", int.class, long.class, String.class);
         verifyBridgeMethods(GHIssue.class, "getUrl", String.class, URL.class);
+        verifyBridgeMethods(GHIssue.class, "comment", 1, void.class, GHIssueComment.class);
 
         verifyBridgeMethods(GHOrganization.class, "getHtmlUrl", String.class, URL.class);
         verifyBridgeMethods(GHOrganization.class, "getId", int.class, long.class, String.class);
@@ -55,12 +56,17 @@ public class BridgeMethodTest extends Assert {
     }
 
     void verifyBridgeMethods(@Nonnull Class<?> targetClass, @Nonnull String methodName, Class<?>... returnTypes) {
+        verifyBridgeMethods(targetClass, methodName, 0, returnTypes);
+    }
+
+    void verifyBridgeMethods(@Nonnull Class<?> targetClass,
+            @Nonnull String methodName,
+            int parameterCount,
+            Class<?>... returnTypes) {
         List<Class<?>> foundMethods = new ArrayList<>();
         Method[] methods = targetClass.getMethods();
         for (Method method : methods) {
-            if (method.getName().equalsIgnoreCase(methodName)) {
-                // Bridge methods are only
-                assertThat(method.getParameterCount(), equalTo(0));
+            if (method.getName().equalsIgnoreCase(methodName) && method.getParameterCount() == parameterCount) {
                 foundMethods.add(method.getReturnType());
             }
         }

src/test/java/org/kohsuke/github/CommitTest.java

@@ -4,7 +4,9 @@ import com.google.common.collect.Iterables;
 import org.junit.Test;
 
 import java.io.IOException;
+import java.util.ArrayList;
 import java.util.Arrays;
+import java.util.Date;
 import java.util.List;
 
 import static org.hamcrest.Matchers.equalTo;
@@ -29,6 +31,85 @@ public class CommitTest extends AbstractGitHubWireMockTest {
         }
     }
 
+    @Test
+    public void testQueryCommits() throws Exception {
+        List<String> sha1 = new ArrayList<String>();
+        List<GHCommit> commits = gitHub.getUser("jenkinsci")
+                .getRepository("jenkins")
+                .queryCommits()
+                .since(1199174400000L)
+                .until(1201852800000L)
+                .path("pom.xml")
+                .pageSize(100)
+                .list()
+                .toList();
+
+        assertThat(commits.get(0).getSHA1(), equalTo("1cccddb22e305397151b2b7b87b4b47d74ca337b"));
+        assertThat(commits.size(), equalTo(29));
+
+        commits = gitHub.getUser("jenkinsci")
+                .getRepository("jenkins")
+                .queryCommits()
+                .since(new Date(1199174400000L))
+                .until(new Date(1201852800000L))
+                .path("pom.xml")
+                .pageSize(100)
+                .list()
+                .toList();
+
+        assertThat(commits.get(0).getSHA1(), equalTo("1cccddb22e305397151b2b7b87b4b47d74ca337b"));
+        assertThat(commits.get(15).getSHA1(), equalTo("a5259970acaec9813e2a12a91f37dfc7871a5ef5"));
+        assertThat(commits.size(), equalTo(29));
+
+        commits = gitHub.getUser("jenkinsci")
+                .getRepository("jenkins")
+                .queryCommits()
+                .since(new Date(1199174400000L))
+                .until(new Date(1201852800000L))
+                .path("pom.xml")
+                .from("a5259970acaec9813e2a12a91f37dfc7871a5ef5")
+                .list()
+                .toList();
+
+        assertThat(commits.get(0).getSHA1(), equalTo("a5259970acaec9813e2a12a91f37dfc7871a5ef5"));
+        assertThat(commits.size(), equalTo(14));
+
+        commits = gitHub.getUser("jenkinsci")
+                .getRepository("jenkins")
+                .queryCommits()
+                .until(new Date(1201852800000L))
+                .path("pom.xml")
+                .author("kohsuke")
+                .list()
+                .toList();
+
+        assertThat(commits.size(), equalTo(0));
+
+        commits = gitHub.getUser("jenkinsci")
+                .getRepository("jenkins")
+                .queryCommits()
+                .until(new Date(1201852800000L))
+                .path("pom.xml")
+                .pageSize(100)
+                .author("kohsuke@71c3de6d-444a-0410-be80-ed276b4c234a")
+                .list()
+                .toList();
+
+        assertThat(commits.size(), equalTo(266));
+
+        commits = gitHub.getUser("jenkinsci")
+                .getRepository("jenkins")
+                .queryCommits()
+                .path("pom.xml")
+                .pageSize(100)
+                .author("kohsuke@71c3de6d-444a-0410-be80-ed276b4c234a")
+                .list()
+                .toList();
+
+        assertThat(commits.size(), equalTo(648));
+
+    }
+
     @Test
     public void listPullRequestsOfNotIncludedCommit() throws Exception {
         GHRepository repo = gitHub.getOrganization("hub4j-test-org").getRepository("listPrsListHeads");

src/test/java/org/kohsuke/github/EnumTest.java

@@ -0,0 +1,84 @@
+package org.kohsuke.github;
+
+import org.junit.Test;
+
+import static org.hamcrest.CoreMatchers.*;
+
+/**
+ * Unit test for {@link GitHub} static helpers.
+ *
+ * @author Liam Newman
+ */
+public class EnumTest extends AbstractGitHubWireMockTest {
+
+    @Test
+    public void touchEnums() {
+        assertThat(GHCheckRun.AnnotationLevel.values().length, equalTo(3));
+        assertThat(GHCheckRun.Conclusion.values().length, equalTo(9));
+        assertThat(GHCheckRun.Status.values().length, equalTo(4));
+
+        assertThat(GHCommentAuthorAssociation.values().length, equalTo(7));
+
+        assertThat(GHCommitState.values().length, equalTo(4));
+
+        assertThat(GHCompare.Status.values().length, equalTo(4));
+
+        assertThat(GHDeploymentState.values().length, equalTo(7));
+
+        assertThat(GHDirection.values().length, equalTo(2));
+
+        assertThat(GHEvent.values().length, equalTo(56));
+        assertThat(GHEvent.ALL.symbol(), equalTo("*"));
+        assertThat(GHEvent.PULL_REQUEST.symbol(), equalTo(GHEvent.PULL_REQUEST.toString().toLowerCase()));
+
+        assertThat(GHIssueSearchBuilder.Sort.values().length, equalTo(3));
+
+        assertThat(GHIssueState.values().length, equalTo(3));
+
+        assertThat(GHMarketplaceAccountType.values().length, equalTo(2));
+
+        assertThat(GHMarketplaceListAccountBuilder.Sort.values().length, equalTo(2));
+
+        assertThat(GHMarketplacePriceModel.values().length, equalTo(3));
+
+        assertThat(GHMembership.Role.values().length, equalTo(2));
+
+        assertThat(GHMilestoneState.values().length, equalTo(2));
+
+        assertThat(GHMyself.RepositoryListFilter.values().length, equalTo(5));
+
+        assertThat(GHOrganization.Role.values().length, equalTo(2));
+        assertThat(GHOrganization.Permission.values().length, equalTo(5));
+
+        assertThat(GHPermissionType.values().length, equalTo(4));
+
+        assertThat(GHProject.ProjectState.values().length, equalTo(2));
+        assertThat(GHProject.ProjectStateFilter.values().length, equalTo(3));
+
+        assertThat(GHPullRequest.MergeMethod.values().length, equalTo(3));
+
+        assertThat(GHPullRequestQueryBuilder.Sort.values().length, equalTo(4));
+
+        assertThat(GHPullRequestReviewEvent.values().length, equalTo(4));
+        assertThat(GHPullRequestReviewEvent.PENDING.toState(), equalTo(GHPullRequestReviewState.PENDING));
+        assertThat(GHPullRequestReviewEvent.PENDING.action(), nullValue());
+
+        assertThat(GHPullRequestReviewState.values().length, equalTo(6));
+        assertThat(GHPullRequestReviewState.PENDING.toEvent(), equalTo(GHPullRequestReviewEvent.PENDING));
+        assertThat(GHPullRequestReviewState.APPROVED.action(), equalTo(GHPullRequestReviewEvent.APPROVE.action()));
+        assertThat(GHPullRequestReviewState.DISMISSED.toEvent(), nullValue());
+
+        assertThat(GHRepository.CollaboratorAffiliation.values().length, equalTo(3));
+        assertThat(GHRepository.ForkSort.values().length, equalTo(3));
+
+        assertThat(GHRepositorySearchBuilder.Sort.values().length, equalTo(3));
+
+        assertThat(GHRepositorySelection.values().length, equalTo(2));
+
+        assertThat(GHTeam.Role.values().length, equalTo(2));
+        assertThat(GHTeam.Privacy.values().length, equalTo(2));
+
+        assertThat(GHUserSearchBuilder.Sort.values().length, equalTo(3));
+    }
+
+}

src/test/java/org/kohsuke/github/GHAppTest.java

@@ -103,7 +103,8 @@ public class GHAppTest extends AbstractGitHubWireMockTest {
         permissions.put("metadata", GHPermissionType.READ);
 
         // Create token specifying both permissions and repository ids
-        GHAppInstallationToken installationToken = installation.createToken(permissions)
+        GHAppInstallationToken installationToken = installation.createToken()
+                .permissions(permissions)
                 .repositoryIds(Collections.singletonList((long) 111111111))
                 .create();
 

src/test/java/org/kohsuke/github/GHCheckRunBuilderTest.java

@@ -25,11 +25,13 @@
 package org.kohsuke.github;
 
 import org.junit.Test;
+import org.kohsuke.github.GHCheckRun.Status;
 
 import java.io.IOException;
 import java.util.Date;
 
 import static org.hamcrest.Matchers.containsString;
+import static org.hamcrest.Matchers.equalTo;
 
 @SuppressWarnings("deprecation") // preview
 public class GHCheckRunBuilderTest extends AbstractGHAppInstallationTest {
@@ -48,7 +50,7 @@ public class GHCheckRunBuilderTest extends AbstractGHAppInstallationTest {
                 .withExternalID("whatever")
                 .withStartedAt(new Date(999_999_000))
                 .withCompletedAt(new Date(999_999_999))
-                .add(new GHCheckRunBuilder.Output("Some Title", "what happened…")
+                .add(new GHCheckRunBuilder.Output("Some Title", "what happened…").withText("Hello Text!")
                         .add(new GHCheckRunBuilder.Annotation("stuff.txt",
                                 1,
                                 GHCheckRun.AnnotationLevel.NOTICE,
@@ -58,14 +60,17 @@ public class GHCheckRunBuilderTest extends AbstractGHAppInstallationTest {
                                         .withCaption("Princess Unikitty")))
                 .add(new GHCheckRunBuilder.Action("Help", "what I need help with", "doit"))
                 .create();
-        assertEquals("completed", checkRun.getStatus());
+        assertEquals(Status.COMPLETED, checkRun.getStatus());
         assertEquals(1, checkRun.getOutput().getAnnotationsCount());
         assertEquals(1424883286, checkRun.getId());
+        assertEquals("Hello Text!", checkRun.getOutput().getText());
     }
 
     @Test
     public void createCheckRunManyAnnotations() throws Exception {
-        GHCheckRunBuilder.Output output = new GHCheckRunBuilder.Output("Big Run", "Lots of stuff here »");
+        GHCheckRunBuilder.Output output = new GHCheckRunBuilder.Output("Big Run", "Lots of stuff here »")
+                .withText("Hello Text!");
+
         for (int i = 0; i < 101; i++) {
             output.add(
                     new GHCheckRunBuilder.Annotation("stuff.txt", 1, GHCheckRun.AnnotationLevel.NOTICE, "hello #" + i));
@@ -75,10 +80,11 @@ public class GHCheckRunBuilderTest extends AbstractGHAppInstallationTest {
                 .withConclusion(GHCheckRun.Conclusion.SUCCESS)
                 .add(output)
                 .create();
-        assertEquals("completed", checkRun.getStatus());
+        assertEquals(Status.COMPLETED, checkRun.getStatus());
         assertEquals("Big Run", checkRun.getOutput().getTitle());
         assertEquals("Lots of stuff here »", checkRun.getOutput().getSummary());
         assertEquals(101, checkRun.getOutput().getAnnotationsCount());
+        assertEquals("Hello Text!", checkRun.getOutput().getText());
         assertEquals(1424883599, checkRun.getId());
     }
 
@@ -89,7 +95,7 @@ public class GHCheckRunBuilderTest extends AbstractGHAppInstallationTest {
                 .withConclusion(GHCheckRun.Conclusion.NEUTRAL)
                 .add(new GHCheckRunBuilder.Output("Quick note", "nothing more to see here"))
                 .create();
-        assertEquals("completed", checkRun.getStatus());
+        assertEquals(Status.COMPLETED, checkRun.getStatus());
         assertEquals(0, checkRun.getOutput().getAnnotationsCount());
         assertEquals(1424883957, checkRun.getId());
     }
@@ -100,7 +106,7 @@ public class GHCheckRunBuilderTest extends AbstractGHAppInstallationTest {
                 .createCheckRun("outstanding", "89a9ae301e35e667756034fdc933b1fc94f63fc1")
                 .withStatus(GHCheckRun.Status.IN_PROGRESS)
                 .create();
-        assertEquals("in_progress", checkRun.getStatus());
+        assertEquals(Status.IN_PROGRESS, checkRun.getStatus());
         assertNull(checkRun.getConclusion());
         assertEquals(1424883451, checkRun.getId());
     }
@@ -116,6 +122,8 @@ public class GHCheckRunBuilderTest extends AbstractGHAppInstallationTest {
         } catch (HttpException x) {
             assertEquals(422, x.getResponseCode());
             assertThat(x.getMessage(), containsString("\\\"conclusion\\\" wasn't supplied"));
+            assertThat(x.getUrl(), containsString("/repos/hub4j-test-org/test-checks/check-runs"));
+            assertThat(x.getResponseMessage(), equalTo("422 Unprocessable Entity"));
         }
     }
 

src/test/java/org/kohsuke/github/GHContentIntegrationTest.java

@@ -45,6 +45,14 @@ public class GHContentIntegrationTest extends AbstractGitHubWireMockTest {
         repo = gitHub.getRepository("hub4j-test-org/GHContentIntegrationTest");
     }
 
+    @Test
+    public void testGetRepository() throws Exception {
+        GHRepository testRepo = gitHub.getRepositoryById(repo.getId());
+        assertThat(testRepo.getName(), equalTo(repo.getName()));
+        testRepo = gitHub.getRepositoryById(Long.toString(repo.getId()));
+        assertThat(testRepo.getName(), equalTo(repo.getName()));
+    }
+
     @Test
     public void testGetFileContent() throws Exception {
         repo = gitHub.getRepository("hub4j-test-org/GHContentIntegrationTest");

src/test/java/org/kohsuke/github/GHEventPayloadTest.java

@@ -2,14 +2,26 @@ package org.kohsuke.github;
 
 import org.junit.Rule;
 import org.junit.Test;
+import org.kohsuke.github.GHCheckRun.Conclusion;
+import org.kohsuke.github.GHCheckRun.Status;
 
 import java.io.IOException;
 import java.text.SimpleDateFormat;
 import java.util.Collections;
+import java.util.List;
 import java.util.TimeZone;
 
 import static java.lang.Boolean.TRUE;
-import static org.hamcrest.Matchers.*;
+import static org.hamcrest.Matchers.aMapWithSize;
+import static org.hamcrest.Matchers.contains;
+import static org.hamcrest.Matchers.endsWith;
+import static org.hamcrest.Matchers.equalTo;
+import static org.hamcrest.Matchers.hasToString;
+import static org.hamcrest.Matchers.is;
+import static org.hamcrest.Matchers.lessThanOrEqualTo;
+import static org.hamcrest.Matchers.notNullValue;
+import static org.hamcrest.Matchers.nullValue;
+import static org.hamcrest.Matchers.startsWith;
 
 public class GHEventPayloadTest extends AbstractGitHubWireMockTest {
 
@@ -141,6 +153,45 @@ public class GHEventPayloadTest extends AbstractGitHubWireMockTest {
         assertThat(event.getSender().getLogin(), is("baxterthehacker"));
     }
 
+    @Test
+    public void issue_labeled() throws Exception {
+        GHEventPayload.Issue event = GitHub.offline().parseEventPayload(payload.asReader(), GHEventPayload.Issue.class);
+        assertThat(event.getAction(), is("labeled"));
+        assertThat(event.getIssue().getNumber(), is(42));
+        assertThat(event.getIssue().getTitle(), is("Test GHEventPayload.Issue label/unlabel"));
+        assertThat(event.getIssue().getLabels().size(), is(1));
+        assertThat(event.getIssue().getLabels().iterator().next().getName(), is("enhancement"));
+        assertThat(event.getLabel().getName(), is("enhancement"));
+    }
+
+    @Test
+    public void issue_unlabeled() throws Exception {
+        GHEventPayload.Issue event = GitHub.offline().parseEventPayload(payload.asReader(), GHEventPayload.Issue.class);
+        assertThat(event.getAction(), is("unlabeled"));
+        assertThat(event.getIssue().getNumber(), is(42));
+        assertThat(event.getIssue().getTitle(), is("Test GHEventPayload.Issue label/unlabel"));
+        assertThat(event.getIssue().getLabels().size(), is(0));
+        assertThat(event.getLabel().getName(), is("enhancement"));
+    }
+
+    @Test
+    public void issue_title_edited() throws Exception {
+        GHEventPayload.Issue event = GitHub.offline().parseEventPayload(payload.asReader(), GHEventPayload.Issue.class);
+        assertThat(event.getAction(), is("edited"));
+        assertThat(event.getIssue().getNumber(), is(43));
+        assertThat(event.getIssue().getTitle(), is("Test GHEventPayload.Issue changes [updated]"));
+        assertThat(event.getChanges().getTitle().getFrom(), is("Test GHEventPayload.Issue changes"));
+    }
+
+    @Test
+    public void issue_body_edited() throws Exception {
+        GHEventPayload.Issue event = GitHub.offline().parseEventPayload(payload.asReader(), GHEventPayload.Issue.class);
+        assertThat(event.getAction(), is("edited"));
+        assertThat(event.getIssue().getNumber(), is(43));
+        assertThat(event.getIssue().getBody(), is("Description [updated]."));
+        assertThat(event.getChanges().getBody().getFrom(), is("Description."));
+    }
+
     // TODO implement support classes and write test
     // @Test
     // public void label() throws Exception {}
@@ -361,6 +412,9 @@ public class GHEventPayloadTest extends AbstractGitHubWireMockTest {
         assertThat(event.getCommits().get(0).getRemoved().size(), is(0));
         assertThat(event.getCommits().get(0).getModified().size(), is(1));
         assertThat(event.getCommits().get(0).getModified().get(0), is("README.md"));
+        SimpleDateFormat formatter = new SimpleDateFormat("yyyy-MM-dd'T'HH:mm:ss'Z'");
+        formatter.setTimeZone(TimeZone.getTimeZone("UTC"));
+        assertThat(formatter.format(event.getCommits().get(0).getTimestamp()), is("2015-05-05T23:40:15Z"));
         assertThat(event.getRepository().getName(), is("public-repo"));
         assertThat(event.getRepository().getOwnerName(), is("baxterthehacker"));
         assertThat(event.getRepository().getUrl().toExternalForm(),
@@ -515,12 +569,13 @@ public class GHEventPayloadTest extends AbstractGitHubWireMockTest {
         assertThat(event.getRepository().getName(), is("Hello-World"));
         assertThat(event.getRepository().getOwner().getLogin(), is("Codertocat"));
         assertThat(event.getAction(), is("created"));
+        assertThat(event.getRequestedAction(), nullValue());
 
         // Checks the deserialization of check_run
         GHCheckRun checkRun = event.getCheckRun();
         assertThat(checkRun.getName(), is("Octocoders-linter"));
         assertThat(checkRun.getHeadSha(), is("ec26c3e57ca3a959ca5aad62de7213c562f8c821"));
-        assertThat(checkRun.getStatus(), is("completed"));
+        assertThat(checkRun.getStatus(), is(Status.COMPLETED));
         assertThat(checkRun.getNodeId(), is("MDg6Q2hlY2tSdW4xMjg2MjAyMjg="));
         assertThat(checkRun.getExternalId(), is(""));
 
@@ -529,7 +584,7 @@ public class GHEventPayloadTest extends AbstractGitHubWireMockTest {
         assertThat(formatter.format(checkRun.getStartedAt()), is("2019-05-15T15:21:12Z"));
         assertThat(formatter.format(checkRun.getCompletedAt()), is("2019-05-15T20:22:22Z"));
 
-        assertThat(checkRun.getConclusion(), is("success"));
+        assertThat(checkRun.getConclusion(), is(Conclusion.SUCCESS));
         assertThat(checkRun.getUrl().toString(), endsWith("/repos/Codertocat/Hello-World/check-runs/128620228"));
         assertThat(checkRun.getHtmlUrl().toString(),
                 endsWith("https://github.com/Codertocat/Hello-World/runs/128620228"));
@@ -650,4 +705,104 @@ public class GHEventPayloadTest extends AbstractGitHubWireMockTest {
 
         assertThat(event.getSender().getLogin(), is("octocat"));
     }
+
+    @Test
+    public void workflow_dispatch() throws Exception {
+        GHEventPayload.WorkflowDispatch workflowDispatchPayload = GitHub.offline()
+                .parseEventPayload(payload.asReader(), GHEventPayload.WorkflowDispatch.class);
+
+        assertThat(workflowDispatchPayload.getRef(), is("refs/heads/main"));
+        assertThat(workflowDispatchPayload.getAction(), is(nullValue()));
+        assertThat(workflowDispatchPayload.getWorkflow(), is(".github/workflows/main.yml"));
+        assertThat(workflowDispatchPayload.getInputs(), aMapWithSize(1));
+        assertThat(workflowDispatchPayload.getInputs().keySet(), contains("logLevel"));
+        assertThat(workflowDispatchPayload.getInputs().values(), contains("warning"));
+        assertThat(workflowDispatchPayload.getRepository().getName(), is("quarkus-bot-java-playground"));
+        assertThat(workflowDispatchPayload.getSender().getLogin(), is("gsmet"));
+    }
+
+    @Test
+    public void workflow_run() throws Exception {
+        GHEventPayload.WorkflowRun workflowRunPayload = GitHub.offline()
+                .parseEventPayload(payload.asReader(), GHEventPayload.WorkflowRun.class);
+
+        assertThat(workflowRunPayload.getAction(), is("completed"));
+        assertThat(workflowRunPayload.getRepository().getFullName(), is("gsmet/quarkus-bot-java-playground"));
+        assertThat(workflowRunPayload.getSender().getLogin(), is("gsmet"));
+
+        GHWorkflow workflow = workflowRunPayload.getWorkflow();
+        assertThat(workflow.getId(), is(7087581L));
+        assertThat(workflow.getName(), is("CI"));
+        assertThat(workflow.getPath(), is(".github/workflows/main.yml"));
+        assertThat(workflow.getState(), is("active"));
+        assertThat(workflow.getUrl().toString(),
+                is("https://api.github.com/repos/gsmet/quarkus-bot-java-playground/actions/workflows/7087581"));
+        assertThat(workflow.getHtmlUrl().toString(),
+                is("https://github.com/gsmet/quarkus-bot-java-playground/blob/main/.github/workflows/main.yml"));
+        assertThat(workflow.getBadgeUrl().toString(),
+                is("https://github.com/gsmet/quarkus-bot-java-playground/workflows/CI/badge.svg"));
+
+        GHWorkflowRun workflowRun = workflowRunPayload.getWorkflowRun();
+        assertThat(workflowRun.getId(), is(680604745L));
+        assertThat(workflowRun.getName(), is("CI"));
+        assertThat(workflowRun.getHeadBranch(), is("main"));
+        assertThat(workflowRun.getHeadSha(), is("dbea8d8b6ed2cf764dfd84a215f3f9040b3d4423"));
+        assertThat(workflowRun.getRunNumber(), is(6L));
+        assertThat(workflowRun.getEvent(), is(GHEvent.WORKFLOW_DISPATCH));
+        assertThat(workflowRun.getStatus(), is(GHWorkflowRun.Status.COMPLETED));
+        assertThat(workflowRun.getConclusion(), is(GHWorkflowRun.Conclusion.SUCCESS));
+        assertThat(workflowRun.getWorkflowId(), is(7087581L));
+        assertThat(workflowRun.getUrl().toString(),
+                is("https://api.github.com/repos/gsmet/quarkus-bot-java-playground/actions/runs/680604745"));
+        assertThat(workflowRun.getHtmlUrl().toString(),
+                is("https://github.com/gsmet/quarkus-bot-java-playground/actions/runs/680604745"));
+        assertThat(workflowRun.getJobsUrl().toString(),
+                is("https://api.github.com/repos/gsmet/quarkus-bot-java-playground/actions/runs/680604745/jobs"));
+        assertThat(workflowRun.getLogsUrl().toString(),
+                is("https://api.github.com/repos/gsmet/quarkus-bot-java-playground/actions/runs/680604745/logs"));
+        assertThat(workflowRun.getCheckSuiteUrl().toString(),
+                is("https://api.github.com/repos/gsmet/quarkus-bot-java-playground/check-suites/2327154397"));
+        assertThat(workflowRun.getArtifactsUrl().toString(),
+                is("https://api.github.com/repos/gsmet/quarkus-bot-java-playground/actions/runs/680604745/artifacts"));
+        assertThat(workflowRun.getCancelUrl().toString(),
+                is("https://api.github.com/repos/gsmet/quarkus-bot-java-playground/actions/runs/680604745/cancel"));
+        assertThat(workflowRun.getRerunUrl().toString(),
+                is("https://api.github.com/repos/gsmet/quarkus-bot-java-playground/actions/runs/680604745/rerun"));
+        assertThat(workflowRun.getWorkflowUrl().toString(),
+                is("https://api.github.com/repos/gsmet/quarkus-bot-java-playground/actions/workflows/7087581"));
+        assertThat(workflowRun.getCreatedAt().getTime(), is(1616524526000L));
+        assertThat(workflowRun.getUpdatedAt().getTime(), is(1616524543000L));
+        assertThat(workflowRun.getHeadCommit().getId(), is("dbea8d8b6ed2cf764dfd84a215f3f9040b3d4423"));
+        assertThat(workflowRun.getHeadCommit().getTreeId(), is("b17089e6a2574ec1002566fe980923e62dce3026"));
+        assertThat(workflowRun.getHeadCommit().getMessage(), is("Update main.yml"));
+        assertThat(workflowRun.getHeadCommit().getTimestamp().getTime(), is(1616523390000L));
+        assertThat(workflowRun.getHeadCommit().getAuthor().getName(), is("Guillaume Smet"));
+        assertThat(workflowRun.getHeadCommit().getAuthor().getEmail(), is("guillaume.smet@gmail.com"));
+        assertThat(workflowRun.getHeadCommit().getCommitter().getName(), is("GitHub"));
+        assertThat(workflowRun.getHeadCommit().getCommitter().getEmail(), is("noreply@github.com"));
+        assertThat(workflowRun.getHeadRepository().getFullName(), is("gsmet/quarkus-bot-java-playground"));
+    }
+
+    @Test
+    public void workflow_run_pull_request() throws Exception {
+        GHEventPayload.WorkflowRun workflowRunPayload = GitHub.offline()
+                .parseEventPayload(payload.asReader(), GHEventPayload.WorkflowRun.class);
+
+        List<GHPullRequest> pullRequests = workflowRunPayload.getWorkflowRun().getPullRequests();
+        assertThat(pullRequests.size(), is(1));
+
+        GHPullRequest pullRequest = pullRequests.get(0);
+        assertThat(pullRequest.getId(), is(599098265L));
+    }
+
+    @Test
+    public void workflow_run_other_repository() throws Exception {
+        GHEventPayload.WorkflowRun workflowRunPayload = GitHub.offline()
+                .parseEventPayload(payload.asReader(), GHEventPayload.WorkflowRun.class);
+        GHWorkflowRun workflowRun = workflowRunPayload.getWorkflowRun();
+
+        assertThat(workflowRunPayload.getRepository().getFullName(), is("gsmet/quarkus-bot-java-playground"));
+        assertThat(workflowRun.getHeadRepository().getFullName(),
+                is("gsmet-bot-playground/quarkus-bot-java-playground"));
+    }
 }

src/test/java/org/kohsuke/github/GHIssueEventTest.java

@@ -18,7 +18,7 @@ public class GHIssueEventTest extends AbstractGitHubWireMockTest {
         GHIssue issue = builder.create();
 
         // Generate some events.
-        issue.addLabels("test-label");
+        issue.setLabels("test-label");
 
         // Test that the events are present.
         List<GHIssueEvent> list = issue.listEvents().toList();

src/test/java/org/kohsuke/github/GHLicenseTest.java

@@ -79,9 +79,19 @@ public class GHLicenseTest extends AbstractGitHubWireMockTest {
         String key = "mit";
         GHLicense license = gitHub.getLicense(key);
         assertNotNull(license);
-        assertTrue("The name is correct", license.getName().equals("MIT License"));
-        assertTrue("The HTML URL is correct",
-                license.getHtmlUrl().equals(new URL("http://choosealicense.com/licenses/mit/")));
+        assertThat("The name is correct", license.getName(), equalTo("MIT License"));
+        assertThat("The HTML URL is correct",
+                license.getHtmlUrl(),
+                equalTo(new URL("http://choosealicense.com/licenses/mit/")));
+        assertThat(license.getBody(), startsWith("MIT License\n" + "\n" + "Copyright (c) [year] [fullname]\n\n"));
+        assertThat(license.getForbidden().size(), equalTo(0));
+        assertThat(license.getPermitted().size(), equalTo(0));
+        assertThat(license.getImplementation(),
+                equalTo("Create a text file (typically named LICENSE or LICENSE.txt) in the root of your source code and copy the text of the license into the file. Replace [year] with the current year and [fullname] with the name (or names) of the copyright holders."));
+        assertThat(license.getCategory(), nullValue());
+        assertThat(license.isFeatured(), equalTo(true));
+        assertThat(license.equals(null), equalTo(false));
+        assertThat(license.equals(gitHub.getLicense(key)), equalTo(true));
     }
 
     /**

src/test/java/org/kohsuke/github/GHOrganizationTest.java

@@ -36,11 +36,12 @@ public class GHOrganizationTest extends AbstractGitHubWireMockTest {
         cleanupRepository(GITHUB_API_TEST_ORG + '/' + GITHUB_API_TEST);
 
         GHOrganization org = gitHub.getOrganization(GITHUB_API_TEST_ORG);
-        GHRepository repository = org.createRepository(GITHUB_API_TEST,
-                "a test repository used to test kohsuke's github-api",
-                "http://github-api.kohsuke.org/",
-                "Core Developers",
-                true);
+        GHRepository repository = org.createRepository(GITHUB_API_TEST)
+                .description("a test repository used to test kohsuke's github-api")
+                .homepage("http://github-api.kohsuke.org/")
+                .team(org.getTeamByName("Core Developers"))
+                .private_(false)
+                .create();
         Assert.assertNotNull(repository);
     }
 
@@ -72,7 +73,7 @@ public class GHOrganizationTest extends AbstractGitHubWireMockTest {
                 .homepage("http://github-api.kohsuke.org/")
                 .team(team)
                 .autoInit(true)
-                .templateRepository(true)
+                .isTemplate(true)
                 .create();
         Assert.assertNotNull(repository);
         assertThat(mockGitHub.getRequestCount(), equalTo(requestCount + 1));
@@ -136,7 +137,7 @@ public class GHOrganizationTest extends AbstractGitHubWireMockTest {
     public void testListMembersWithFilter() throws IOException {
         GHOrganization org = gitHub.getOrganization(GITHUB_API_TEST_ORG);
 
-        List<GHUser> admins = org.listMembersWithFilter("all").asList();
+        List<GHUser> admins = org.listMembersWithFilter("all").toList();
 
         assertNotNull(admins);
         assertTrue(admins.size() >= 12); // In case more are added in the future
@@ -158,7 +159,7 @@ public class GHOrganizationTest extends AbstractGitHubWireMockTest {
     public void testListMembersWithRole() throws IOException {
         GHOrganization org = gitHub.getOrganization(GITHUB_API_TEST_ORG);
 
-        List<GHUser> admins = org.listMembersWithRole("admin").asList();
+        List<GHUser> admins = org.listMembersWithRole("admin").toList();
 
         assertNotNull(admins);
         assertTrue(admins.size() >= 12); // In case more are added in the future

src/test/java/org/kohsuke/github/GHPullRequestMockTest.java

@@ -0,0 +1,21 @@
+package org.kohsuke.github;
+
+import org.junit.Test;
+
+import java.io.IOException;
+
+import static org.junit.Assert.assertTrue;
+import static org.mockito.Mockito.mock;
+import static org.mockito.Mockito.when;
+
+public class GHPullRequestMockTest {
+
+    @Test
+    public void shouldMockGHPullRequest() throws IOException {
+        GHPullRequest pullRequest = mock(GHPullRequest.class);
+        when(pullRequest.isDraft()).thenReturn(true);
+
+        assertTrue("Mock should return true", pullRequest.isDraft());
+    }
+
+}

src/test/java/org/kohsuke/github/GHPullRequestTest.java

@@ -5,12 +5,18 @@ import org.junit.Before;
 import org.junit.Test;
 
 import java.io.IOException;
-import java.net.URL;
 import java.util.Collection;
 import java.util.Collections;
 import java.util.List;
 
-import static org.hamcrest.CoreMatchers.*;
+import static org.hamcrest.Matchers.containsInAnyOrder;
+import static org.hamcrest.Matchers.containsString;
+import static org.hamcrest.Matchers.equalTo;
+import static org.hamcrest.Matchers.hasProperty;
+import static org.hamcrest.Matchers.instanceOf;
+import static org.hamcrest.Matchers.is;
+import static org.hamcrest.Matchers.notNullValue;
+import static org.hamcrest.Matchers.nullValue;
 
 /**
  * @author Kohsuke Kawaguchi
@@ -112,28 +118,52 @@ public class GHPullRequestTest extends AbstractGitHubWireMockTest {
     public void pullRequestReviewComments() throws Exception {
         String name = "pullRequestReviewComments";
         GHPullRequest p = getRepository().createPullRequest(name, "test/stable", "master", "## test");
-        // System.out.println(p.getUrl());
-        assertTrue(p.listReviewComments().toList().isEmpty());
-        p.createReviewComment("Sample review comment", p.getHead().getSha(), "README.md", 1);
-        List<GHPullRequestReviewComment> comments = p.listReviewComments().toList();
-        assertEquals(1, comments.size());
-        GHPullRequestReviewComment comment = comments.get(0);
-        assertEquals("Sample review comment", comment.getBody());
+        try {
+            // System.out.println(p.getUrl());
+            assertTrue(p.listReviewComments().toList().isEmpty());
+            p.createReviewComment("Sample review comment", p.getHead().getSha(), "README.md", 1);
+            List<GHPullRequestReviewComment> comments = p.listReviewComments().toList();
+            assertEquals(1, comments.size());
+            GHPullRequestReviewComment comment = comments.get(0);
+            assertEquals("Sample review comment", comment.getBody());
+            assertThat(comment.getInReplyToId(), equalTo(-1L));
+            assertThat(comment.getPath(), equalTo("README.md"));
+            assertThat(comment.getPosition(), equalTo(1));
+            assertThat(comment.getUser(), notNullValue());
+            // Assert htmlUrl is not null
+            assertThat(comment.getHtmlUrl(), notNullValue());
+            assertThat(comment.getHtmlUrl().toString(),
+                    containsString("hub4j-test-org/github-api/pull/" + p.getNumber()));
 
-        // Assert htmlUrl is not null
-        assertNotNull(comment.getHtmlUrl());
-        assertEquals(new URL("https://github.com/hub4j-test-org/github-api/pull/266#discussion_r321995146"),
-                comment.getHtmlUrl());
+            List<GHReaction> reactions = comment.listReactions().toList();
+            assertThat(reactions.size(), equalTo(0));
 
-        comment.update("Updated review comment");
-        comments = p.listReviewComments().toList();
-        assertEquals(1, comments.size());
-        comment = comments.get(0);
-        assertEquals("Updated review comment", comment.getBody());
+            GHReaction reaction = comment.createReaction(ReactionContent.CONFUSED);
+            assertThat(reaction.getContent(), equalTo(ReactionContent.CONFUSED));
 
-        comment.delete();
-        comments = p.listReviewComments().toList();
-        assertTrue(comments.isEmpty());
+            reactions = comment.listReactions().toList();
+            assertThat(reactions.size(), equalTo(1));
+
+            GHPullRequestReviewComment reply = comment.reply("This is a reply.");
+            assertThat(reply.getInReplyToId(), equalTo(comment.getId()));
+            comments = p.listReviewComments().toList();
+
+            assertEquals(2, comments.size());
+
+            comment.update("Updated review comment");
+            comments = p.listReviewComments().toList();
+            comment = comments.get(0);
+            assertEquals("Updated review comment", comment.getBody());
+
+            comment.delete();
+            comments = p.listReviewComments().toList();
+            // Reply is still present after delete of original comment, but no longer has replyToId
+            assertThat(comments.size(), equalTo(1));
+            assertThat(comments.get(0).getId(), equalTo(reply.getId()));
+            assertThat(comments.get(0).getInReplyToId(), equalTo(-1L));
+        } finally {
+            p.close();
+        }
     }
 
     @Test
@@ -395,7 +425,93 @@ public class GHPullRequestTest extends AbstractGitHubWireMockTest {
 
         Collection<GHLabel> labels = getRepository().getPullRequest(p.getNumber()).getLabels();
         assertEquals(1, labels.size());
-        assertEquals(label, labels.iterator().next().getName());
+        GHLabel savedLabel = labels.iterator().next();
+        assertEquals(label, savedLabel.getName());
+        assertNotNull(savedLabel.getId());
+        assertNotNull(savedLabel.getNodeId());
+        assertFalse(savedLabel.isDefault());
+    }
+
+    @Test
+    // Requires push access to the test repo to pass
+    public void addLabels() throws Exception {
+        GHPullRequest p = getRepository().createPullRequest("addLabels", "test/stable", "master", "## test");
+        String addedLabel1 = "addLabels_label_name_1";
+        String addedLabel2 = "addLabels_label_name_2";
+        String addedLabel3 = "addLabels_label_name_3";
+
+        p.addLabels(addedLabel1);
+
+        int requestCount = mockGitHub.getRequestCount();
+        p.addLabels(addedLabel2, addedLabel3);
+        // multiple labels can be added with one api call
+        assertThat(mockGitHub.getRequestCount(), equalTo(requestCount + 1));
+
+        Collection<GHLabel> labels = getRepository().getPullRequest(p.getNumber()).getLabels();
+        assertEquals(3, labels.size());
+        assertThat(labels,
+                containsInAnyOrder(hasProperty("name", equalTo(addedLabel1)),
+                        hasProperty("name", equalTo(addedLabel2)),
+                        hasProperty("name", equalTo(addedLabel3))));
+
+        // Adding a label which is already present does not throw an error
+        p.addLabels(addedLabel1);
+    }
+
+    @Test
+    // Requires push access to the test repo to pass
+    public void addLabelsConcurrencyIssue() throws Exception {
+        String addedLabel1 = "addLabelsConcurrencyIssue_label_name_1";
+        String addedLabel2 = "addLabelsConcurrencyIssue_label_name_2";
+
+        GHPullRequest p1 = getRepository()
+                .createPullRequest("addLabelsConcurrencyIssue", "test/stable", "master", "## test");
+        p1.getLabels();
+
+        GHPullRequest p2 = getRepository().getPullRequest(p1.getNumber());
+        p2.addLabels(addedLabel2);
+
+        p1.addLabels(addedLabel1);
+
+        Collection<GHLabel> labels = getRepository().getPullRequest(p1.getNumber()).getLabels();
+        assertEquals(2, labels.size());
+        assertThat(labels,
+                containsInAnyOrder(hasProperty("name", equalTo(addedLabel1)),
+                        hasProperty("name", equalTo(addedLabel2))));
+    }
+
+    @Test
+    // Requires push access to the test repo to pass
+    public void removeLabels() throws Exception {
+        GHPullRequest p = getRepository().createPullRequest("removeLabels", "test/stable", "master", "## test");
+        String label1 = "removeLabels_label_name_1";
+        String label2 = "removeLabels_label_name_2";
+        String label3 = "removeLabels_label_name_3";
+        p.setLabels(label1, label2, label3);
+
+        Collection<GHLabel> labels = getRepository().getPullRequest(p.getNumber()).getLabels();
+        assertEquals(3, labels.size());
+
+        int requestCount = mockGitHub.getRequestCount();
+        p.removeLabels(label2, label3);
+        // each label deleted is a separate api call
+        assertThat(mockGitHub.getRequestCount(), equalTo(requestCount + 2));
+
+        labels = getRepository().getPullRequest(p.getNumber()).getLabels();
+        assertEquals(1, labels.size());
+        assertEquals(label1, labels.iterator().next().getName());
+
+        // Removing some labels that are not present does not throw
+        // This is consistent with earlier behavior and with addLabels()
+        p.removeLabels(label3);
+
+        // Calling removeLabel() on label that is not present will throw
+        try {
+            p.removeLabel(label3);
+            fail("Expected GHFileNotFoundException");
+        } catch (GHFileNotFoundException e) {
+            assertThat(e.getMessage(), containsString("Label does not exist"));
+        }
     }
 
     @Test
@@ -412,15 +528,15 @@ public class GHPullRequestTest extends AbstractGitHubWireMockTest {
     public void getUserTest() throws IOException {
         GHPullRequest p = getRepository().createPullRequest("getUserTest", "test/stable", "master", "## test");
         GHPullRequest prSingle = getRepository().getPullRequest(p.getNumber());
-        assertNotNull(prSingle.getUser().root);
+        assertNotNull(prSingle.getUser().getRoot());
         prSingle.getMergeable();
-        assertNotNull(prSingle.getUser().root);
+        assertNotNull(prSingle.getUser().getRoot());
 
         PagedIterable<GHPullRequest> ghPullRequests = getRepository().listPullRequests(GHIssueState.OPEN);
         for (GHPullRequest pr : ghPullRequests) {
-            assertNotNull(pr.getUser().root);
+            assertNotNull(pr.getUser().getRoot());
             pr.getMergeable();
-            assertNotNull(pr.getUser().root);
+            assertNotNull(pr.getUser().getRoot());
         }
     }
 

src/test/java/org/kohsuke/github/GHRateLimitTest.java

@@ -312,9 +312,6 @@ public class GHRateLimitTest extends AbstractGitHubWireMockTest {
         // Give this a moment
         Thread.sleep(1500);
 
-        // lastRateLimit the same as rateLimit
-        assertThat(gitHub.lastRateLimit(), sameInstance(rateLimit));
-
         // ratelimit() tries not to make additional requests, uses queried rate limit since header not available
         Thread.sleep(1500);
         assertThat(gitHub.rateLimit(), sameInstance(rateLimit));
@@ -490,9 +487,6 @@ public class GHRateLimitTest extends AbstractGitHubWireMockTest {
         assertThat("rateLimit() selects header instance when not expired, does not ask server",
                 gitHub.rateLimit(),
                 sameInstance(headerRateLimit));
-        assertThat("lastRateLimit() always selects header instance, does not ask server",
-                gitHub.lastRateLimit(),
-                sameInstance(headerRateLimit));
 
         assertThat(mockGitHub.getRequestCount(), equalTo(1));
 

src/test/java/org/kohsuke/github/GHRepositoryStatisticsTest.java

@@ -34,6 +34,7 @@ public class GHRepositoryStatisticsTest extends AbstractGitHubWireMockTest {
         for (GHRepositoryStatistics.ContributorStats statsForAuthor : list) {
             if (authorLogin.equals(statsForAuthor.getAuthor().getLogin())) {
                 assertEquals(715, statsForAuthor.getTotal());
+                assertEquals("kohsuke made 715 contributions over 494 weeks", statsForAuthor.toString());
 
                 List<GHRepositoryStatistics.ContributorStats.Week> weeks = statsForAuthor.getWeeks();
                 assertEquals(494, weeks.size());
@@ -46,6 +47,8 @@ public class GHRepositoryStatisticsTest extends AbstractGitHubWireMockTest {
                     assertEquals(63, week.getNumberOfAdditions());
                     assertEquals(56, week.getNumberOfDeletions());
                     assertEquals(5, week.getNumberOfCommits());
+                    assertEquals("Week starting 1541289600 - Additions: 63, Deletions: 56, Commits: 5",
+                            week.toString());
                 } catch (NoSuchElementException e) {
                     fail("Did not find week 1546128000");
                 }
@@ -131,6 +134,7 @@ public class GHRepositoryStatisticsTest extends AbstractGitHubWireMockTest {
             if (item.getWeekTimestamp() == 1535241600) {
                 assertEquals(185, item.getAdditions());
                 assertEquals(-243, item.getDeletions());
+                assertEquals("Week starting 1535241600 has 185 additions and 243 deletions", item.toString());
                 foundWeek = true;
                 break;
             }
@@ -196,6 +200,7 @@ public class GHRepositoryStatisticsTest extends AbstractGitHubWireMockTest {
                 // TODO: Make an easier access method. Perhaps wrap in an
                 // object and have a method such as GetCommits(1, 16).
                 assertEquals(16, item.getNumberOfCommits());
+                assertEquals("Day 2 Hour 10: 16 commits", item.toString());
                 hourFound = true;
                 break;
             }

src/test/java/org/kohsuke/github/GHRepositoryTest.java

@@ -3,11 +3,15 @@ package org.kohsuke.github;
 import com.fasterxml.jackson.databind.JsonMappingException;
 import org.apache.commons.io.IOUtils;
 import org.junit.Test;
+import org.kohsuke.github.GHCheckRun.Conclusion;
 
+import java.io.ByteArrayInputStream;
 import java.io.FileNotFoundException;
 import java.io.IOException;
+import java.io.InputStream;
 import java.net.URL;
 import java.util.ArrayList;
+import java.util.Date;
 import java.util.List;
 import java.util.Set;
 
@@ -28,6 +32,20 @@ public class GHRepositoryTest extends AbstractGitHubWireMockTest {
         return gitHub.getOrganization("hub4j-test-org").getRepository("github-api");
     }
 
+    @Test
+    public void testZipball() throws IOException {
+        getTempRepository().readZip((InputStream inputstream) -> {
+            return new ByteArrayInputStream(IOUtils.toByteArray(inputstream));
+        }, null);
+    }
+
+    @Test
+    public void testTarball() throws IOException {
+        getTempRepository().readTar((InputStream inputstream) -> {
+            return new ByteArrayInputStream(IOUtils.toByteArray(inputstream));
+        }, null);
+    }
+
     @Test
     public void testGetters() throws IOException {
         GHRepository r = getTempRepository();
@@ -110,6 +128,19 @@ public class GHRepositoryTest extends AbstractGitHubWireMockTest {
         assertEquals(UNKNOWN_SIGNATURE_TYPE, verification.getReason());
     }
 
+    @Test
+    public void listStargazers() throws IOException {
+        GHRepository repository = getRepository();
+        assertThat(repository.listStargazers2().toList(), empty());
+
+        repository = gitHub.getOrganization("hub4j").getRepository("github-api");
+        Iterable<GHStargazer> stargazers = repository.listStargazers2();
+        GHStargazer stargazer = stargazers.iterator().next();
+        assertThat(stargazer.getStarredAt(), equalTo(new Date(1271650383000L)));
+        assertThat(stargazer.getUser().getLogin(), equalTo("nielswind"));
+        assertThat(stargazer.getRepository(), sameInstance(repository));
+    }
+
     // Issue #607
     @Test
     public void getBranchNonExistentBut200Status() throws Exception {
@@ -135,11 +166,20 @@ public class GHRepositoryTest extends AbstractGitHubWireMockTest {
     public void subscription() throws Exception {
         GHRepository r = getRepository();
         assertNull(r.getSubscription());
-
         GHSubscription s = r.subscribe(true, false);
-        assertEquals(s.getRepository(), r);
+        try {
 
-        s.delete();
+            assertEquals(s.getRepository(), r);
+            assertThat(s.isIgnored(), equalTo(false));
+            assertThat(s.isSubscribed(), equalTo(true));
+            assertThat(s.getRepositoryUrl().toString(), containsString("/repos/hub4j-test-org/github-api"));
+            assertThat(s.getUrl().toString(), containsString("/repos/hub4j-test-org/github-api/subscription"));
+
+            assertThat(s.getReason(), nullValue());
+            assertThat(s.getCreatedAt(), equalTo(new Date(1611377286000L)));
+        } finally {
+            s.delete();
+        }
 
         assertNull(r.getSubscription());
     }
@@ -641,17 +681,6 @@ public class GHRepositoryTest extends AbstractGitHubWireMockTest {
             assertThat(e, instanceOf(GHFileNotFoundException.class));
             assertThat(e.getMessage(), containsString("/repos/hub4j-test-org/temp-listRefsEmptyTags/git/refs/tags"));
         }
-
-        try {
-            GHRepository repo = getTempRepository();
-            repo.listRefs("tags").asList();
-            fail();
-        } catch (Exception e) {
-            assertThat(e, instanceOf(GHException.class));
-            assertThat(e.getMessage(), containsString("Failed to retrieve "));
-            assertThat(e.getMessage(), containsString("/repos/hub4j-test-org/temp-listRefsEmptyTags/git/refs/tags"));
-            assertThat(e.getCause(), instanceOf(GHFileNotFoundException.class));
-        }
     }
 
     @Test
@@ -715,7 +744,7 @@ public class GHRepositoryTest extends AbstractGitHubWireMockTest {
         // Check if the checkruns are all succeeded and if we got all of them
         int checkRunsCount = 0;
         for (GHCheckRun checkRun : checkRuns) {
-            assertThat(checkRun.getConclusion(), equalTo("success"));
+            assertThat(checkRun.getConclusion(), equalTo(Conclusion.SUCCESS));
             checkRunsCount++;
         }
         assertThat(checkRunsCount, equalTo(expectedCount));

src/test/java/org/kohsuke/github/GHTagTest.java

@@ -6,6 +6,7 @@ import org.junit.Test;
 
 import java.io.IOException;
 
+import static org.hamcrest.Matchers.*;
 import static org.junit.Assert.assertEquals;
 import static org.junit.Assert.assertNotNull;
 
@@ -49,6 +50,10 @@ public class GHTagTest extends AbstractGitHubWireMockTest {
         assertEquals(commitSha, tag.getObject().getSha());
         assertFalse(tag.getVerification().isVerified());
         assertEquals(tag.getVerification().getReason(), GHVerification.Reason.UNSIGNED);
+        assertThat(tag.getUrl(),
+                containsString("/repos/hub4j-test-org/github-api/git/tags/e7aa6d4afbaa48669f0bbe11ca3c4d787b2b153c"));
+        assertThat(tag.getOwner().getId(), equalTo(repo.getId()));
+        assertThat(tag.getTagger().getEmail(), equalTo("martin.vanzijl@gmail.com"));
 
         // Make a reference to the newly created tag.
         GHRef ref = repo.createRef("refs/tags/" + tagName, tag.getSha());

src/test/java/org/kohsuke/github/GHTeamTest.java

@@ -41,7 +41,7 @@ public class GHTeamTest extends AbstractGitHubWireMockTest {
 
         GHTeam team = gitHub.getOrganization(GITHUB_API_TEST_ORG).getTeamBySlug(teamSlug);
 
-        List<GHUser> admins = team.listMembers("admin").asList();
+        List<GHUser> admins = team.listMembers("admin").toList();
 
         assertNotNull(admins);
         assertThat("One admin in dummy team", admins.size() == 1);
@@ -55,7 +55,7 @@ public class GHTeamTest extends AbstractGitHubWireMockTest {
 
         GHTeam team = gitHub.getOrganization(GITHUB_API_TEST_ORG).getTeamBySlug(teamSlug);
 
-        List<GHUser> justMembers = team.listMembers("member").asList();
+        List<GHUser> justMembers = team.listMembers("member").toList();
 
         assertThat("No regular members in team", justMembers.isEmpty());
     }

src/test/java/org/kohsuke/github/GHTreeBuilderTest.java

@@ -7,7 +7,9 @@ import org.junit.Test;
 
 import java.io.IOException;
 import java.util.Arrays;
+import java.util.Date;
 
+import static org.hamcrest.Matchers.*;
 import static org.junit.Assert.assertEquals;
 
 public class GHTreeBuilderTest extends AbstractGitHubWireMockTest {
@@ -87,22 +89,30 @@ public class GHTreeBuilderTest extends AbstractGitHubWireMockTest {
         treeBuilder.add(PATH_DATA1, CONTENT_DATA1, false);
         treeBuilder.add(PATH_DATA2, CONTENT_DATA2, false);
 
-        updateTree();
+        GHCommit commit = updateTree();
 
         assertEquals(CONTENT_SCRIPT.length(), getFileSize(PATH_SCRIPT));
         assertEquals(CONTENT_README.length(), getFileSize(PATH_README));
         assertEquals(CONTENT_DATA1.length, getFileSize(PATH_DATA1));
         assertEquals(CONTENT_DATA2.length, getFileSize(PATH_DATA2));
+
+        assertThat(commit.getCommitShortInfo().getAuthor().getEmail(), equalTo("author@author.com"));
+        assertThat(commit.getCommitShortInfo().getCommitter().getEmail(), equalTo("committer@committer.com"));
+
     }
 
-    private void updateTree() throws IOException {
+    private GHCommit updateTree() throws IOException {
         String treeSha = treeBuilder.create().getSha();
-        String commitSha = new GHCommitBuilder(repo).message("Add files")
+        GHCommit commit = new GHCommitBuilder(repo).message("Add files")
                 .tree(treeSha)
+                .author("author", "author@author.com", new Date(1611433225969L))
+                .committer("committer", "committer@committer.com", new Date(1611433225968L))
                 .parent(masterRef.getObject().getSha())
-                .create()
-                .getSHA1();
+                .create();
+
+        String commitSha = commit.getSHA1();
         masterRef.updateTo(commitSha);
+        return commit;
     }
 
     private long getFileSize(String path) throws IOException {

src/test/java/org/kohsuke/github/GHUserTest.java

@@ -39,14 +39,27 @@ public class GHUserTest extends AbstractGitHubWireMockTest {
             }
         });
         assertEquals(1066173, ghKeys.get(0).getId());
+        assertThat(ghKeys.get(0).getTitle(), nullValue());
+        assertThat(ghKeys.get(0).getUrl(), nullValue());
+        assertThat(ghKeys.get(0).isVerified(), equalTo(false));
+        assertThat(ghKeys.get(0).toString(),
+                containsString(
+                        "title=<null>,id=1066173,key=ssh-rsa AAAAB3NzaC1yc2EAAAABIwAAAQEAueiy12T5bvFhsc9YjfLc3aVIxgySd3gDxQWy/bletIoZL8omKmzocBYJ7F58U1asoyfWsy2ToTOY8jJp1eToXmbD6L5+xvHba0A7djYh9aQRrFam7doKQ0zp0ZSUF6+R1v0OM4nnWqK4n2ECIYd+Bdzrp+xA5+XlW3ZSNzlnW2BeWznzmgRMcp6wI+zQ9GMHWviR1cxpml5Z6wrxTZ0aX91btvnNPqoOGva976B6e6403FOEkkIFTk6CC1TFKwc/VjbqxYBg4kU0JhiTP+iEZibcQrYjWdYUgAotYbFVe5/DneHMLNsMPdeihba4PUwt62rXyNegenuCRmCntLcaFQ=="));
+
         assertEquals(
                 "ssh-rsa AAAAB3NzaC1yc2EAAAABIwAAAQEAueiy12T5bvFhsc9YjfLc3aVIxgySd3gDxQWy/bletIoZL8omKmzocBYJ7F58U1asoyfWsy2ToTOY8jJp1eToXmbD6L5+xvHba0A7djYh9aQRrFam7doKQ0zp0ZSUF6+R1v0OM4nnWqK4n2ECIYd+Bdzrp+xA5+XlW3ZSNzlnW2BeWznzmgRMcp6wI+zQ9GMHWviR1cxpml5Z6wrxTZ0aX91btvnNPqoOGva976B6e6403FOEkkIFTk6CC1TFKwc/VjbqxYBg4kU0JhiTP+iEZibcQrYjWdYUgAotYbFVe5/DneHMLNsMPdeihba4PUwt62rXyNegenuCRmCntLcaFQ==",
                 ghKeys.get(0).getKey());
         assertEquals(28136459, ghKeys.get(1).getId());
+        assertThat(ghKeys.get(1).getTitle(), nullValue());
+        assertThat(ghKeys.get(1).getUrl(), nullValue());
+        assertThat(ghKeys.get(1).isVerified(), equalTo(false));
         assertEquals(
                 "ssh-rsa AAAAB3NzaC1yc2EAAAADAQABAAABAQDTU0s5OKCC6VpKZGL9NJD4mNLY0AtujkVB1JkkuQ4OkMi2YGUHJtGhTbTwEVhNxpm0x2dM5KSzse6MLDYuGBW0qkE/VVuD9+9I73hbq461KqP0+WlupNh+Qc86kbiLBDv64+vWc+50mp1dbINpoM5xvaPYxgjnemydPv7vu5bhCHBugW7aN8VcLgfFgcp8vZCEanMtd3hIRjRU8v8Skk233ZGu1bXkG8iIOBQPabvEtZ0VDMg9pT3Q1R6lnnKqfCwHXd6zP6uAtejFSxvKRGKpu3OLGQMHwk7NlImVuhkVdaEFBq7pQtpOaGuP2eLKcN1wy5jsTYE+ZB6pvHCi2ecb",
                 ghKeys.get(1).getKey());
         assertEquals(31452581, ghKeys.get(2).getId());
+        assertThat(ghKeys.get(2).getTitle(), nullValue());
+        assertThat(ghKeys.get(2).getUrl(), nullValue());
+        assertThat(ghKeys.get(2).isVerified(), equalTo(false));
         assertEquals(
                 "ssh-rsa AAAAB3NzaC1yc2EAAAADAQABAAACAQC3JhH2FZBDmHLjXTcBoV6tdcYKmsQ7sgu8k1RsUhwxGsXm65+Cuas6GcMVoA1DncKfJGQkulHDFiTxIROIBmedh9/otHWBlZ4HqYZ4MQ1A8W5quULkXwX/kF+UdRBUxFvjigibEbuHB+LARVxRRzFlPnTSE9rAfAv8OOEsb3lNUGT/IGhN8w1vwe8GclB90tgqN1RBDgrVqwLFwn5AfrW9kUIa2f2oT4RjYu1OrhKhVIIzfHADo85aD+s8wEhqwI96BCJG3qTWrypoHwBUoj1O6Ak5CGc1iKz9o8XyTMjudRt2ddCjfOtxsuwSlTbVtQXJGIpgKviX1sgh4pPvGh7BVAFP+mdAK4F+mEugDnuj47GO/K5KGGDRCL56kh9+h28l4q/+fZvp7DhtmSN2EzrVAdQFskF8yY/6Xit/aAvjeKm03DcjbylSXbG26EJefaLHlwYFq2mUFRMak25wuuCZS71GF3RC3Sl/bMoxBKRYkyfYtGafeaYTFNGn8Dbd+hfVUCz31ebI8cvmlQR5b5AbCre3T7HTVgw8FKbAxWRf1Fio56PnqHsj+sT1KVj255Zo1F8iD9GrgERSVAlkh5bY/CKszQ8ZSd01c9Qp2a47/gR7XAAbxhzGHP+cSOlrqDlJ24fbPtcpVsM0llqKUcxpmoOBFNboRmE1QqnSmAf9ww==",
                 ghKeys.get(2).getKey());
@@ -109,5 +122,11 @@ public class GHUserTest extends AbstractGitHubWireMockTest {
         assertThat(u.getBio(), equalTo("I like to program things and I hope to program something cool one day :D"));
         assertTrue(u.isHireable());
         assertNotNull(u.getTwitterUsername());
+        assertThat(u.getBlog(), equalTo("https://chew.pw"));
+        assertThat(u.getCompany(), equalTo("@Memerator"));
+        assertThat(u.getFollowersCount(), equalTo(29));
+        assertThat(u.getFollowingCount(), equalTo(3));
+        assertThat(u.getPublicGistCount(), equalTo(4));
+        assertThat(u.getPublicRepoCount(), equalTo(96));
     }
 }

src/test/java/org/kohsuke/github/GHWorkflowRunTest.java

@@ -0,0 +1,233 @@
+package org.kohsuke.github;
+
+import org.awaitility.Awaitility;
+import org.junit.Assert;
+import org.junit.Before;
+import org.junit.Test;
+import org.kohsuke.github.GHWorkflowRun.Conclusion;
+import org.kohsuke.github.GHWorkflowRun.Status;
+
+import java.io.IOException;
+import java.time.Duration;
+import java.util.List;
+import java.util.Optional;
+import java.util.function.Function;
+
+public class GHWorkflowRunTest extends AbstractGitHubWireMockTest {
+
+    private static final String REPO_NAME = "hub4j-test-org/GHWorkflowRunTest";
+    private static final String MAIN_BRANCH = "main";
+    private static final String SECOND_BRANCH = "second-branch";
+
+    private static final String FAST_WORKFLOW_PATH = "fast-workflow.yml";
+    private static final String FAST_WORKFLOW_NAME = "Fast workflow";
+
+    private static final String SLOW_WORKFLOW_PATH = "slow-workflow.yml";
+    private static final String SLOW_WORKFLOW_NAME = "Slow workflow";
+
+    private GHRepository repo;
+
+    @Before
+    public void setUp() throws Exception {
+        repo = gitHub.getRepository(REPO_NAME);
+    }
+
+    @Test
+    public void testManualRunAndBasicInformation() throws IOException {
+        GHWorkflow workflow = repo.getWorkflow(FAST_WORKFLOW_PATH);
+
+        long latestPreexistingWorkflowRunId = getLatestPreexistingWorkflowRunId();
+
+        workflow.dispatch(MAIN_BRANCH);
+
+        await((nonRecordingRepo) -> getWorkflowRun(nonRecordingRepo,
+                FAST_WORKFLOW_NAME,
+                MAIN_BRANCH,
+                Status.COMPLETED,
+                latestPreexistingWorkflowRunId).isPresent());
+
+        GHWorkflowRun workflowRun = getWorkflowRun(FAST_WORKFLOW_NAME,
+                MAIN_BRANCH,
+                Status.COMPLETED,
+                latestPreexistingWorkflowRunId).orElseThrow(
+                        () -> new IllegalStateException("We must have a valid workflow run starting from here"));
+
+        assertEquals(workflow.getId(), workflowRun.getWorkflowId());
+        assertTrue(workflowRun.getUrl().getPath().contains("/actions/runs/"));
+        assertTrue(workflowRun.getHtmlUrl().getPath().contains("/actions/runs/"));
+        assertTrue(workflowRun.getJobsUrl().getPath().endsWith("/jobs"));
+        assertTrue(workflowRun.getLogsUrl().getPath().endsWith("/logs"));
+        assertTrue(workflowRun.getCheckSuiteUrl().getPath().contains("/check-suites/"));
+        assertTrue(workflowRun.getArtifactsUrl().getPath().endsWith("/artifacts"));
+        assertTrue(workflowRun.getCancelUrl().getPath().endsWith("/cancel"));
+        assertTrue(workflowRun.getRerunUrl().getPath().endsWith("/rerun"));
+        assertTrue(workflowRun.getWorkflowUrl().getPath().contains("/actions/workflows/"));
+        assertEquals(MAIN_BRANCH, workflowRun.getHeadBranch());
+        assertNotNull(workflowRun.getHeadCommit().getId());
+        assertNotNull(workflowRun.getHeadCommit().getTreeId());
+        assertNotNull(workflowRun.getHeadCommit().getMessage());
+        assertNotNull(workflowRun.getHeadCommit().getTimestamp());
+        assertNotNull(workflowRun.getHeadCommit().getAuthor().getEmail());
+        assertNotNull(workflowRun.getHeadCommit().getCommitter().getEmail());
+        assertEquals(GHEvent.WORKFLOW_DISPATCH, workflowRun.getEvent());
+        assertEquals(Status.COMPLETED, workflowRun.getStatus());
+        assertEquals(Conclusion.SUCCESS, workflowRun.getConclusion());
+        assertNotNull(workflowRun.getHeadSha());
+    }
+
+    @Test
+    public void testCancelAndRerun() throws IOException {
+        GHWorkflow workflow = repo.getWorkflow(SLOW_WORKFLOW_PATH);
+
+        long latestPreexistingWorkflowRunId = getLatestPreexistingWorkflowRunId();
+
+        workflow.dispatch(MAIN_BRANCH);
+
+        // now that we have triggered the workflow run, we will wait until it's in progress and then cancel it
+        await((nonRecordingRepo) -> getWorkflowRun(nonRecordingRepo,
+                SLOW_WORKFLOW_NAME,
+                MAIN_BRANCH,
+                Status.IN_PROGRESS,
+                latestPreexistingWorkflowRunId).isPresent());
+
+        GHWorkflowRun workflowRun = getWorkflowRun(SLOW_WORKFLOW_NAME,
+                MAIN_BRANCH,
+                Status.IN_PROGRESS,
+                latestPreexistingWorkflowRunId).orElseThrow(
+                        () -> new IllegalStateException("We must have a valid workflow run starting from here"));
+
+        assertNotNull(workflowRun.getId());
+
+        workflowRun.cancel();
+        long cancelledWorkflowRunId = workflowRun.getId();
+
+        // let's wait until it's completed
+        await((nonRecordingRepo) -> getWorkflowRunStatus(nonRecordingRepo, cancelledWorkflowRunId) == Status.COMPLETED);
+
+        // let's check that it has been properly cancelled
+        workflowRun = repo.getWorkflowRun(cancelledWorkflowRunId);
+        assertEquals(Conclusion.CANCELLED, workflowRun.getConclusion());
+
+        // now let's rerun it
+        workflowRun.rerun();
+
+        // let's check that it has been rerun
+        await((nonRecordingRepo) -> getWorkflowRunStatus(nonRecordingRepo,
+                cancelledWorkflowRunId) == Status.IN_PROGRESS);
+
+        // cancel it again
+        workflowRun.cancel();
+    }
+
+    @Test
+    public void testDelete() throws IOException {
+        GHWorkflow workflow = repo.getWorkflow(FAST_WORKFLOW_PATH);
+
+        long latestPreexistingWorkflowRunId = getLatestPreexistingWorkflowRunId();
+
+        workflow.dispatch(MAIN_BRANCH);
+
+        await((nonRecordingRepo) -> getWorkflowRun(nonRecordingRepo,
+                FAST_WORKFLOW_NAME,
+                MAIN_BRANCH,
+                Status.COMPLETED,
+                latestPreexistingWorkflowRunId).isPresent());
+
+        GHWorkflowRun workflowRunToDelete = getWorkflowRun(FAST_WORKFLOW_NAME,
+                MAIN_BRANCH,
+                Status.COMPLETED,
+                latestPreexistingWorkflowRunId).orElseThrow(
+                        () -> new IllegalStateException("We must have a valid workflow run starting from here"));
+
+        assertNotNull(workflowRunToDelete.getId());
+
+        workflowRunToDelete.delete();
+
+        try {
+            repo.getWorkflowRun(workflowRunToDelete.getId());
+            Assert.fail("The workflow " + workflowRunToDelete.getId() + " should have been deleted.");
+        } catch (GHFileNotFoundException e) {
+            // success
+        }
+    }
+
+    @Test
+    public void testSearchOnBranch() throws IOException {
+        GHWorkflow workflow = repo.getWorkflow(FAST_WORKFLOW_PATH);
+
+        long latestPreexistingWorkflowRunId = getLatestPreexistingWorkflowRunId();
+
+        workflow.dispatch(SECOND_BRANCH);
+
+        await((nonRecordingRepo) -> getWorkflowRun(nonRecordingRepo,
+                FAST_WORKFLOW_NAME,
+                SECOND_BRANCH,
+                Status.COMPLETED,
+                latestPreexistingWorkflowRunId).isPresent());
+
+        GHWorkflowRun workflowRun = getWorkflowRun(FAST_WORKFLOW_NAME,
+                SECOND_BRANCH,
+                Status.COMPLETED,
+                latestPreexistingWorkflowRunId).orElseThrow(
+                        () -> new IllegalStateException("We must have a valid workflow run starting from here"));
+
+        assertEquals(workflow.getId(), workflowRun.getWorkflowId());
+        assertEquals(SECOND_BRANCH, workflowRun.getHeadBranch());
+        assertEquals(GHEvent.WORKFLOW_DISPATCH, workflowRun.getEvent());
+        assertEquals(Status.COMPLETED, workflowRun.getStatus());
+        assertEquals(Conclusion.SUCCESS, workflowRun.getConclusion());
+    }
+
+    private void await(Function<GHRepository, Boolean> condition) throws IOException {
+        if (!mockGitHub.isUseProxy()) {
+            return;
+        }
+
+        GHRepository nonRecordingRepo = getGitHubBeforeAfter().getRepository(REPO_NAME);
+
+        Awaitility.await().pollInterval(Duration.ofSeconds(5)).atMost(Duration.ofSeconds(60)).until(() -> {
+            return condition.apply(nonRecordingRepo);
+        });
+    }
+
+    private long getLatestPreexistingWorkflowRunId() {
+        return repo.queryWorkflowRuns().list().withPageSize(1).iterator().next().getId();
+    }
+
+    private static Optional<GHWorkflowRun> getWorkflowRun(GHRepository repository,
+            String workflowName,
+            String branch,
+            Status status,
+            long latestPreexistingWorkflowRunId) {
+        List<GHWorkflowRun> workflowRuns = repository.queryWorkflowRuns()
+                .branch(branch)
+                .status(status)
+                .event(GHEvent.WORKFLOW_DISPATCH)
+                .list()
+                .withPageSize(20)
+                .iterator()
+                .nextPage();
+
+        for (GHWorkflowRun workflowRun : workflowRuns) {
+            if (workflowRun.getName().equals(workflowName) && workflowRun.getId() > latestPreexistingWorkflowRunId) {
+                return Optional.of(workflowRun);
+            }
+        }
+        return Optional.empty();
+    }
+
+    private Optional<GHWorkflowRun> getWorkflowRun(String workflowName,
+            String branch,
+            Status status,
+            long latestPreexistingWorkflowRunId) {
+        return getWorkflowRun(this.repo, workflowName, branch, status, latestPreexistingWorkflowRunId);
+    }
+
+    private static Status getWorkflowRunStatus(GHRepository repository, long workflowRunId) {
+        try {
+            return repository.getWorkflowRun(workflowRunId).getStatus();
+        } catch (IOException e) {
+            throw new IllegalStateException("Unable to get workflow run status", e);
+        }
+    }
+}

src/test/java/org/kohsuke/github/GHWorkflowTest.java

@@ -0,0 +1,89 @@
+package org.kohsuke.github;
+
+import org.junit.After;
+import org.junit.Before;
+import org.junit.Test;
+
+import java.io.IOException;
+import java.util.Collections;
+
+import static com.github.tomakehurst.wiremock.client.WireMock.containing;
+import static com.github.tomakehurst.wiremock.client.WireMock.postRequestedFor;
+import static com.github.tomakehurst.wiremock.client.WireMock.urlPathEqualTo;
+import static com.github.tomakehurst.wiremock.client.WireMock.verify;
+
+public class GHWorkflowTest extends AbstractGitHubWireMockTest {
+
+    private static String REPO_NAME = "hub4j-test-org/GHWorkflowTest";
+
+    private GHRepository repo;
+
+    @Before
+    @After
+    public void cleanup() throws Exception {
+        if (mockGitHub.isUseProxy()) {
+            repo = getGitHubBeforeAfter().getRepository(REPO_NAME);
+
+            // we need to make sure the workflow is enabled before the tests
+            GHWorkflow workflow = repo.getWorkflow("test-workflow.yml");
+            if (!workflow.getState().equals("active")) {
+                workflow.enable();
+            }
+        }
+    }
+
+    @Before
+    public void setUp() throws Exception {
+        repo = gitHub.getRepository(REPO_NAME);
+    }
+
+    @Test
+    public void testBasicInformation() throws IOException {
+        GHWorkflow workflow = repo.getWorkflow("test-workflow.yml");
+
+        assertEquals("test-workflow", workflow.getName());
+        assertEquals(".github/workflows/test-workflow.yml", workflow.getPath());
+        assertEquals("active", workflow.getState());
+        assertEquals("/repos/hub4j-test-org/GHWorkflowTest/actions/workflows/6817859", workflow.getUrl().getPath());
+        assertEquals("/hub4j-test-org/GHWorkflowTest/blob/main/.github/workflows/test-workflow.yml",
+                workflow.getHtmlUrl().getPath());
+        assertEquals("/hub4j-test-org/GHWorkflowTest/workflows/test-workflow/badge.svg",
+                workflow.getBadgeUrl().getPath());
+
+        GHWorkflow workflowById = repo.getWorkflow(workflow.getId());
+        assertEquals(workflow.getNodeId(), workflowById.getNodeId());
+    }
+
+    @Test
+    public void testDisableEnable() throws IOException {
+        GHWorkflow workflow = repo.getWorkflow("test-workflow.yml");
+
+        assertEquals("active", workflow.getState());
+
+        workflow.disable();
+
+        workflow = repo.getWorkflow("test-workflow.yml");
+        assertEquals("disabled_manually", workflow.getState());
+
+        workflow.enable();
+
+        workflow = repo.getWorkflow("test-workflow.yml");
+        assertEquals("active", workflow.getState());
+    }
+
+    @Test
+    public void testDispatch() throws IOException {
+        GHWorkflow workflow = repo.getWorkflow("test-workflow.yml");
+
+        workflow.dispatch("main");
+        verify(postRequestedFor(
+                urlPathEqualTo("/repos/hub4j-test-org/GHWorkflowTest/actions/workflows/6817859/dispatches")));
+
+        workflow.dispatch("main", Collections.singletonMap("parameter", "value"));
+        verify(postRequestedFor(
+                urlPathEqualTo("/repos/hub4j-test-org/GHWorkflowTest/actions/workflows/6817859/dispatches"))
+                        .withRequestBody(containing("inputs"))
+                        .withRequestBody(containing("parameter"))
+                        .withRequestBody(containing("value")));
+    }
+}

src/test/java/org/kohsuke/github/GitHubConnectionTest.java

@@ -1,10 +1,20 @@
 package org.kohsuke.github;
 
+import org.junit.Assume;
 import org.junit.Test;
+import org.kohsuke.github.authorization.UserAuthorizationProvider;
 
 import java.io.IOException;
 import java.lang.reflect.Field;
-import java.util.*;
+import java.util.Collections;
+import java.util.HashMap;
+import java.util.Map;
+
+import static org.hamcrest.Matchers.equalTo;
+import static org.hamcrest.Matchers.instanceOf;
+import static org.hamcrest.Matchers.lessThan;
+import static org.hamcrest.Matchers.not;
+import static org.hamcrest.Matchers.nullValue;
 
 /**
  * Unit test for {@link GitHub}.
@@ -53,55 +63,97 @@ public class GitHubConnectionTest extends AbstractGitHubWireMockTest {
 
     @Test
     public void testGitHubBuilderFromEnvironment() throws IOException {
+        // we disable this test for JDK 16+ as the current hacks in setupEnvironment() don't work with JDK 16+
+        Assume.assumeThat(Double.valueOf(System.getProperty("java.specification.version")), lessThan(16.0));
 
         Map<String, String> props = new HashMap<String, String>();
 
-        props.put("login", "bogus");
-        props.put("oauth", "bogus");
-        props.put("password", "bogus");
-        props.put("jwt", "bogus");
-
+        props.put("endpoint", "bogus endpoint url");
+        props.put("oauth", "bogus oauth token string");
         setupEnvironment(props);
-
         GitHubBuilder builder = GitHubBuilder.fromEnvironment();
 
-        assertEquals("bogus", builder.user);
-        assertEquals("bogus", builder.oauthToken);
-        assertEquals("bogus", builder.password);
-        assertEquals("bogus", builder.jwtToken);
+        assertThat(builder.endpoint, equalTo("bogus endpoint url"));
+
+        assertThat(builder.authorizationProvider, instanceOf(UserAuthorizationProvider.class));
+        assertThat(builder.authorizationProvider.getEncodedAuthorization(), equalTo("token bogus oauth token string"));
+        assertThat(((UserAuthorizationProvider) builder.authorizationProvider).getLogin(), nullValue());
+
+        props.put("login", "bogus login");
+        setupEnvironment(props);
+        builder = GitHubBuilder.fromEnvironment();
+
+        assertThat(builder.authorizationProvider, instanceOf(UserAuthorizationProvider.class));
+        assertThat(builder.authorizationProvider.getEncodedAuthorization(), equalTo("token bogus oauth token string"));
+        assertThat(((UserAuthorizationProvider) builder.authorizationProvider).getLogin(), equalTo("bogus login"));
+
+        props.put("jwt", "bogus jwt token string");
+        setupEnvironment(props);
+        builder = GitHubBuilder.fromEnvironment();
+
+        assertThat(builder.authorizationProvider, not(instanceOf(UserAuthorizationProvider.class)));
+        assertThat(builder.authorizationProvider.getEncodedAuthorization(), equalTo("Bearer bogus jwt token string"));
+
+        props.put("password", "bogus weak password");
+        setupEnvironment(props);
+        builder = GitHubBuilder.fromEnvironment();
+
+        assertThat(builder.authorizationProvider, instanceOf(UserAuthorizationProvider.class));
+        assertThat(builder.authorizationProvider.getEncodedAuthorization(),
+                equalTo("Basic Ym9ndXMgbG9naW46Ym9ndXMgd2VhayBwYXNzd29yZA=="));
+        assertThat(((UserAuthorizationProvider) builder.authorizationProvider).getLogin(), equalTo("bogus login"));
 
     }
 
     @Test
     public void testGitHubBuilderFromCustomEnvironment() throws IOException {
+        // we disable this test for JDK 16+ as the current hacks in setupEnvironment() don't work with JDK 16+
+        Assume.assumeThat(Double.valueOf(System.getProperty("java.specification.version")), lessThan(16.0));
+
         Map<String, String> props = new HashMap<String, String>();
 
-        props.put("customLogin", "bogusLogin");
-        props.put("customOauth", "bogusOauth");
-        props.put("customPassword", "bogusPassword");
-        props.put("customEndpoint", "bogusEndpoint");
-
+        props.put("customEndpoint", "bogus endpoint url");
+        props.put("customOauth", "bogus oauth token string");
         setupEnvironment(props);
-
         GitHubBuilder builder = GitHubBuilder
                 .fromEnvironment("customLogin", "customPassword", "customOauth", "customEndpoint");
 
-        assertEquals("bogusLogin", builder.user);
-        assertEquals("bogusOauth", builder.oauthToken);
-        assertEquals("bogusPassword", builder.password);
-        assertEquals("bogusEndpoint", builder.endpoint);
+        assertThat(builder.endpoint, equalTo("bogus endpoint url"));
+
+        assertThat(builder.authorizationProvider, instanceOf(UserAuthorizationProvider.class));
+        assertThat(builder.authorizationProvider.getEncodedAuthorization(), equalTo("token bogus oauth token string"));
+        assertThat(((UserAuthorizationProvider) builder.authorizationProvider).getLogin(), nullValue());
+
+        props.put("customLogin", "bogus login");
+        setupEnvironment(props);
+        builder = GitHubBuilder.fromEnvironment("customLogin", "customPassword", "customOauth", "customEndpoint");
+
+        assertThat(builder.authorizationProvider, instanceOf(UserAuthorizationProvider.class));
+        assertThat(builder.authorizationProvider.getEncodedAuthorization(), equalTo("token bogus oauth token string"));
+        assertThat(((UserAuthorizationProvider) builder.authorizationProvider).getLogin(), equalTo("bogus login"));
+
+        props.put("customPassword", "bogus weak password");
+        setupEnvironment(props);
+        builder = GitHubBuilder.fromEnvironment("customLogin", "customPassword", "customOauth", "customEndpoint");
+
+        assertThat(builder.authorizationProvider, instanceOf(UserAuthorizationProvider.class));
+        assertThat(builder.authorizationProvider.getEncodedAuthorization(),
+                equalTo("Basic Ym9ndXMgbG9naW46Ym9ndXMgd2VhayBwYXNzd29yZA=="));
+        assertThat(((UserAuthorizationProvider) builder.authorizationProvider).getLogin(), equalTo("bogus login"));
     }
 
     @Test
     public void testGithubBuilderWithAppInstallationToken() throws Exception {
-        GitHubBuilder builder = new GitHubBuilder().withAppInstallationToken("bogus");
-        assertEquals("bogus", builder.oauthToken);
-        assertEquals("", builder.user);
+
+        GitHubBuilder builder = new GitHubBuilder().withAppInstallationToken("bogus app token");
+        assertThat(builder.authorizationProvider, instanceOf(UserAuthorizationProvider.class));
+        assertThat(builder.authorizationProvider.getEncodedAuthorization(), equalTo("token bogus app token"));
+        assertThat(((UserAuthorizationProvider) builder.authorizationProvider).getLogin(), equalTo(""));
 
         // test authorization header is set as in the RFC6749
         GitHub github = builder.build();
         // change this to get a request
-        assertEquals("token bogus", github.getClient().encodedAuthorization);
+        assertEquals("token bogus app token", github.getClient().getEncodedAuthorization());
         assertEquals("", github.getClient().login);
     }
 

src/test/java/org/kohsuke/github/GitHubStaticTest.java

@@ -2,7 +2,9 @@ package org.kohsuke.github;
 
 import org.junit.Test;
 
+import java.net.URL;
 import java.text.SimpleDateFormat;
+import java.time.Duration;
 import java.time.Instant;
 import java.time.format.DateTimeParseException;
 import java.time.temporal.ChronoUnit;
@@ -10,6 +12,9 @@ import java.util.Date;
 import java.util.TimeZone;
 
 import static org.hamcrest.CoreMatchers.*;
+import static org.hamcrest.Matchers.containsString;
+import static org.hamcrest.Matchers.not;
+import static org.hamcrest.core.IsInstanceOf.instanceOf;
 import static org.junit.Assert.fail;
 
 /**
@@ -19,6 +24,34 @@ import static org.junit.Assert.fail;
  */
 public class GitHubStaticTest extends AbstractGitHubWireMockTest {
 
+    @Test
+    public void testParseURL() throws Exception {
+        assertThat(GitHubClient.parseURL("https://api.github.com"), equalTo(new URL("https://api.github.com")));
+        assertThat(GitHubClient.parseURL(null), nullValue());
+
+        try {
+            GitHubClient.parseURL("bogus");
+            fail();
+        } catch (IllegalStateException e) {
+            assertThat(e.getMessage(), equalTo("Invalid URL: bogus"));
+        }
+    }
+
+    @Test
+    public void testParseInstant() throws Exception {
+        assertThat(GitHubClient.parseInstant(null), nullValue());
+    }
+
+    @Test
+    public void testRawUrlPathInvalid() throws Exception {
+        try {
+            gitHub.createRequest().setRawUrlPath("invalid.path.com");
+            fail();
+        } catch (GHException e) {
+            assertThat(e.getMessage(), equalTo("Raw URL must start with 'http'"));
+        }
+    }
+
     @Test
     public void timeRoundTrip() throws Exception {
         final long stableInstantEpochMilli = 1533721222255L;
@@ -78,6 +111,62 @@ public class GitHubStaticTest extends AbstractGitHubWireMockTest {
         }
     }
 
+    @Test
+    public void testFromRecord() throws Exception {
+        final long stableInstantEpochSeconds = 11610674762L;
+
+        GHRateLimit rateLimit_none = GHRateLimit.fromRecord(new GHRateLimit.Record(9876,
+                5432,
+                (stableInstantEpochSeconds + Duration.ofMinutes(30).toMillis()) / 1000L), RateLimitTarget.NONE);
+
+        GHRateLimit rateLimit_core = GHRateLimit.fromRecord(new GHRateLimit.Record(9876,
+                5432,
+                (stableInstantEpochSeconds + Duration.ofMinutes(30).toMillis()) / 1000L), RateLimitTarget.CORE);
+
+        GHRateLimit rateLimit_search = GHRateLimit.fromRecord(new GHRateLimit.Record(19876,
+                15432,
+                (stableInstantEpochSeconds + Duration.ofHours(1).toMillis()) / 1000L), RateLimitTarget.SEARCH);
+
+        GHRateLimit rateLimit_graphql = GHRateLimit.fromRecord(new GHRateLimit.Record(29876,
+                25432,
+                (stableInstantEpochSeconds + Duration.ofHours(2).toMillis()) / 1000L), RateLimitTarget.GRAPHQL);
+
+        GHRateLimit rateLimit_integration = GHRateLimit.fromRecord(
+                new GHRateLimit.Record(39876,
+                        35432,
+                        (stableInstantEpochSeconds + Duration.ofHours(3).toMillis()) / 1000L),
+                RateLimitTarget.INTEGRATION_MANIFEST);
+
+        assertThat(rateLimit_none, equalTo(rateLimit_core));
+        assertThat(rateLimit_none, not(sameInstance(rateLimit_core)));
+        assertTrue(rateLimit_none.hashCode() == rateLimit_core.hashCode());
+        assertTrue(rateLimit_none.equals(rateLimit_core));
+
+        assertThat(rateLimit_none, not(equalTo(rateLimit_search)));
+
+        assertThat(rateLimit_none.getCore(), not(sameInstance(rateLimit_core.getCore())));
+
+        assertThat(rateLimit_core.getRecord(RateLimitTarget.NONE), instanceOf(GHRateLimit.UnknownLimitRecord.class));
+        assertThat(rateLimit_core.getRecord(RateLimitTarget.NONE),
+                sameInstance(rateLimit_none.getRecord(RateLimitTarget.NONE)));
+
+        assertThat(rateLimit_core.getRecord(RateLimitTarget.SEARCH), sameInstance(rateLimit_search.getGraphQL()));
+        assertThat(rateLimit_search.getRecord(RateLimitTarget.GRAPHQL),
+                sameInstance(rateLimit_graphql.getIntegrationManifest()));
+        assertThat(rateLimit_graphql.getRecord(RateLimitTarget.INTEGRATION_MANIFEST),
+                sameInstance(rateLimit_integration.getCore()));
+        assertThat(rateLimit_integration.getRecord(RateLimitTarget.CORE), sameInstance(rateLimit_core.getSearch()));
+
+        assertThat(rateLimit_none.getRecord(RateLimitTarget.CORE).getLimit(), equalTo(9876));
+        assertThat(rateLimit_core.getRecord(RateLimitTarget.CORE).getLimit(), equalTo(9876));
+        assertThat(rateLimit_search.getRecord(RateLimitTarget.SEARCH).getLimit(), equalTo(19876));
+        assertThat(rateLimit_graphql.getRecord(RateLimitTarget.GRAPHQL).getLimit(), equalTo(29876));
+        assertThat(rateLimit_integration.getRecord(RateLimitTarget.INTEGRATION_MANIFEST).getLimit(), equalTo(39876));
+
+        assertThat(rateLimit_core.toString(), containsString("GHRateLimit {core {remaining=5432, limit=9876"));
+        assertThat(rateLimit_core.toString(), containsString("search {remaining=999999, limit=1000000"));
+    }
+
     @Test
     public void testGitHubRateLimitShouldReplaceRateLimit() throws Exception {
 
@@ -225,7 +314,7 @@ public class GitHubStaticTest extends AbstractGitHubWireMockTest {
         // this makes sure they don't break.
 
         GHRepository repo = getTempRepository();
-        assertThat(repo.root, not(nullValue()));
+        assertThat(repo.getRoot(), not(nullValue()));
         assertThat(repo.getResponseHeaderFields(), not(nullValue()));
 
         String repoString = GitHub.getMappingObjectWriter().writeValueAsString(repo);
@@ -237,13 +326,13 @@ public class GitHubStaticTest extends AbstractGitHubWireMockTest {
                 .readValue(repoString);
 
         // This should never happen if the internal method isn't used
-        assertThat(readRepo.root, nullValue());
+        assertThat(readRepo.getRoot(), nullValue());
         assertThat(readRepo.getResponseHeaderFields(), nullValue());
 
         readRepo = GitHub.getMappingObjectReader().forType(GHRepository.class).readValue(repoString);
 
         // This should never happen if the internal method isn't used
-        assertThat(readRepo.root.getConnector(), equalTo(HttpConnector.OFFLINE));
+        assertThat(readRepo.getRoot().getConnector(), equalTo(HttpConnector.OFFLINE));
         assertThat(readRepo.getResponseHeaderFields(), nullValue());
 
         String readRepoString = GitHub.getMappingObjectWriter().writeValueAsString(readRepo);

src/test/java/org/kohsuke/github/GitHubTest.java

@@ -25,6 +25,22 @@ public class GitHubTest extends AbstractGitHubWireMockTest {
         }
     }
 
+    @Test
+    public void getRepository() throws IOException {
+        GHRepository repo = gitHub.getRepository("hub4j/github-api");
+
+        assertThat(repo.getFullName(), equalTo("hub4j/github-api"));
+
+        GHRepository repo2 = gitHub.getRepositoryById(Long.toString(repo.getId()));
+        assertThat(repo2.getFullName(), equalTo("hub4j/github-api"));
+
+        try {
+            gitHub.getRepository("hub4j_github-api");
+        } catch (IllegalArgumentException e) {
+            assertThat(e.getMessage(), equalTo("Repository name must be in format owner/repo"));
+        }
+    }
+
     @Test
     public void getOrgs() throws IOException {
         int iterations = 10;
@@ -34,6 +50,18 @@ public class GitHubTest extends AbstractGitHubWireMockTest {
             // System.out.println(org.getName());
         }
         assertThat(orgIds.size(), equalTo(iterations));
+
+        GHOrganization org = gitHub.getOrganization("hub4j");
+        GHOrganization org2 = gitHub.getOrganization("hub4j");
+        assertThat(org.getLogin(), equalTo("hub4j"));
+        // caching
+        assertThat(org, sameInstance(org2));
+
+        gitHub.refreshCache();
+        org2 = gitHub.getOrganization("hub4j");
+        assertThat(org2.getLogin(), equalTo("hub4j"));
+        // cache cleared
+        assertThat(org, not(sameInstance(org2)));
     }
 
     @Test

src/test/java/org/kohsuke/github/Github2faTest.java

@@ -6,6 +6,7 @@ import java.io.IOException;
 import java.util.Arrays;
 import java.util.List;
 
+import static org.hamcrest.Matchers.*;
 import static org.junit.Assert.assertFalse;
 import static org.junit.Assert.assertTrue;
 
@@ -24,19 +25,27 @@ public class Github2faTest extends AbstractGitHubWireMockTest {
                                                   // collide with older tokens
 
         GHAuthorization token = gitHub
-                .createToken(asList, nameOfToken, "this is a test token created by a unit test", () -> {
+                .createToken(asList, nameOfToken, "https://localhost/this/is/a/test/token", () -> {
                     String data = "111878";
                     // TO UPDATE run this in debugger mode, put a breakpoint here, and enter the OTP you get into the
                     // value of Data
                     return data;
                 });
-        assert token != null;
+
+        assertThat(token, notNullValue());
+
         for (int i = 0; i < asList.size(); i++) {
             assertTrue(token.getScopes().get(i).contentEquals(asList.get(i)));
         }
 
-        String p = token.getToken();
+        assertThat(token.getToken(), equalTo("63042a99d88bf138e6d6cf5788e0dc4e7a5d7309"));
+        assertThat(token.getTokenLastEight(), equalTo("7a5d7309"));
+        assertThat(token.getHashedToken(), equalTo("12b727a23cad7c5a5caabb806d88e722794dede98464aed7f77cbc00dbf031a2"));
+        assertThat(token.getNote(), equalTo("Test2faTokenCreate"));
+        assertThat(token.getNoteUrl().toString(), equalTo("https://localhost/this/is/a/test/token"));
+        assertThat(token.getAppUrl().toString(), equalTo("https://localhost/this/is/a/test/app/token"));
+        assertThat(token.getFingerprint(), nullValue());
+        assertThat(token.getHtmlUrl(), nullValue());
 
-        assert p != null;
     }
 }

src/test/java/org/kohsuke/github/LifecycleTest.java

@@ -10,7 +10,7 @@ import java.io.IOException;
 import java.io.PrintWriter;
 import java.util.List;
 
-import static org.hamcrest.CoreMatchers.notNullValue;
+import static org.hamcrest.CoreMatchers.*;
 import static org.hamcrest.core.Is.is;
 
 public class LifecycleTest extends AbstractGitHubWireMockTest {
@@ -61,6 +61,13 @@ public class LifecycleTest extends AbstractGitHubWireMockTest {
         List<GHAsset> assets = release.getAssets();
         assertEquals(1, assets.size());
         assertEquals("LICENSE.txt", assets.get(0).getName());
+        assertThat(assets.get(0).getSize(), equalTo(1104L));
+        assertThat(assets.get(0).getContentType(), equalTo("application/text"));
+        assertThat(assets.get(0).getState(), equalTo("uploaded"));
+        assertThat(assets.get(0).getDownloadCount(), equalTo(0L));
+        assertThat(assets.get(0).getOwner(), sameInstance(release.getOwner()));
+        assertThat(assets.get(0).getBrowserDownloadUrl(),
+                containsString("/temp-testCreateRepository/releases/download/release_tag/LICENSE.txt"));
 
         return asset;
     }
@@ -74,6 +81,16 @@ public class LifecycleTest extends AbstractGitHubWireMockTest {
         assertEquals(1, releases.size());
         GHRelease release = releases.get(0);
         assertEquals("Test Release", release.getName());
+        assertThat(release.getBody(), startsWith("How exciting!"));
+        assertThat(release.getOwner(), sameInstance(repository));
+        assertThat(release.getZipballUrl(),
+                endsWith("/repos/hub4j-test-org/temp-testCreateRepository/zipball/release_tag"));
+        assertThat(release.getTarballUrl(),
+                endsWith("/repos/hub4j-test-org/temp-testCreateRepository/tarball/release_tag"));
+        assertThat(release.getTargetCommitish(), equalTo("master"));
+        assertThat(release.getHtmlUrl().toString(),
+                endsWith("/hub4j-test-org/temp-testCreateRepository/releases/tag/release_tag"));
+
         return release;
     }
 

src/test/java/org/kohsuke/github/OrgAppInstallationAuthorizationProviderTest.java

@@ -0,0 +1,43 @@
+package org.kohsuke.github;
+
+import org.junit.Test;
+import org.kohsuke.github.authorization.ImmutableAuthorizationProvider;
+import org.kohsuke.github.authorization.OrgAppInstallationAuthorizationProvider;
+
+import java.io.IOException;
+
+import static org.hamcrest.CoreMatchers.equalTo;
+import static org.hamcrest.CoreMatchers.notNullValue;
+
+public class OrgAppInstallationAuthorizationProviderTest extends AbstractGHAppInstallationTest {
+
+    public OrgAppInstallationAuthorizationProviderTest() {
+        useDefaultGitHub = false;
+    }
+
+    @Test(expected = HttpException.class)
+    public void invalidJWTTokenRaisesException() throws IOException {
+        OrgAppInstallationAuthorizationProvider provider = new OrgAppInstallationAuthorizationProvider(
+                "testOrganization",
+                ImmutableAuthorizationProvider.fromJwtToken("myToken"));
+        gitHub = getGitHubBuilder().withAuthorizationProvider(provider)
+                .withEndpoint(mockGitHub.apiServer().baseUrl())
+                .build();
+
+        provider.getEncodedAuthorization();
+    }
+
+    @Test
+    public void validJWTTokenAllowsOauthTokenRequest() throws IOException {
+        OrgAppInstallationAuthorizationProvider provider = new OrgAppInstallationAuthorizationProvider("hub4j-test-org",
+                ImmutableAuthorizationProvider.fromJwtToken("bogus-valid-token"));
+        gitHub = getGitHubBuilder().withAuthorizationProvider(provider)
+                .withEndpoint(mockGitHub.apiServer().baseUrl())
+                .build();
+        String encodedAuthorization = provider.getEncodedAuthorization();
+
+        assertThat(encodedAuthorization, notNullValue());
+        assertThat(encodedAuthorization, equalTo("token v1.9a12d913f980a45a16ac9c3a9d34d9b7sa314cb6"));
+    }
+
+}

src/test/java/org/kohsuke/github/extras/authorization/JWTTokenProviderTest.java

@@ -0,0 +1,87 @@
+package org.kohsuke.github.extras.authorization;
+
+import org.junit.Test;
+import org.kohsuke.github.AbstractGitHubWireMockTest;
+import org.kohsuke.github.GitHub;
+import org.kohsuke.github.HttpException;
+
+import java.io.File;
+import java.io.IOException;
+import java.security.GeneralSecurityException;
+import java.time.Duration;
+import java.time.Instant;
+
+import static org.hamcrest.Matchers.*;
+
+/*
+ * This test will request an application ensuring that the header for the "Authorization" matches a valid JWT token.
+ * A JWT token in the Authorization header will always start with "ey" which is always the start of the base64
+ * encoding of the JWT Header , so a valid header will look like this:
+ *
+ * <pre>
+ * Authorization: Bearer ey{rest of the header}.{payload}.{signature}
+ * </pre>
+ *
+ * Matched by the regular expression:
+ *
+ * <pre>
+ * ^Bearer (?<JWTHeader>ey\S*)\.(?<JWTPayload>\S*)\.(?<JWTSignature>\S*)$
+ * </pre>
+ *
+ * Which is present in the wiremock matcher. Note that we need to use a matcher because the JWT token is encoded
+ * with a private key and a random nonce, so it will never be the same (under normal conditions). For more
+ * information on the format of a JWT token, see: https://jwt.io/introduction/
+ */
+public class JWTTokenProviderTest extends AbstractGitHubWireMockTest {
+
+    private static String TEST_APP_ID_2 = "83009";
+    private static String PRIVATE_KEY_FILE_APP_2 = "/ghapi-test-app-2.private-key.pem";
+
+    @Test
+    public void testAuthorizationHeaderPattern() throws GeneralSecurityException, IOException {
+        // authorization header check is custom
+        snapshotNotAllowed();
+
+        JWTTokenProvider jwtTokenProvider = new JWTTokenProvider(TEST_APP_ID_2,
+                new File(this.getClass().getResource(PRIVATE_KEY_FILE_APP_2).getFile()));
+        GitHub gh = getGitHubBuilder().withEndpoint(mockGitHub.apiServer().baseUrl())
+                .withAuthorizationProvider(jwtTokenProvider)
+                .build();
+
+        // Request the application, the wiremock matcher will ensure that the header
+        // for the authorization is present and has a the format of a valid JWT token
+        gh.getApp();
+    }
+
+    @Test
+    public void testIssuedAtSkew() throws GeneralSecurityException, IOException {
+        // TODO: This isn't a great test as it doesn't really check anything in CI
+        // This test was accurate when recorded but it doesn't verify that the jwt token is different
+        // or accurate in anyway.
+
+        JWTTokenProvider jwtTokenProvider = new JWTTokenProvider(TEST_APP_ID_2,
+                new File(this.getClass().getResource(PRIVATE_KEY_FILE_APP_2).getFile())) {
+
+            @Override
+            Instant getIssuedAt(Instant now) {
+                return now.plus(Duration.ofMinutes(2));
+            }
+        };
+        GitHub gh = getGitHubBuilder().withEndpoint(mockGitHub.apiServer().baseUrl())
+                .withAuthorizationProvider(jwtTokenProvider)
+                .build();
+
+        try {
+            // Request the application, the wiremock matcher will ensure that the header
+            // for the authorization is present and has a the format of a valid JWT token
+            gh.getApp();
+            fail();
+        } catch (HttpException e) {
+            assertThat(e.getResponseCode(), equalTo(401));
+            assertThat(e.getMessage(),
+                    containsString(
+                            "'Issued at' claim ('iat') must be an Integer representing the time that the assertion was issued"));
+        }
+    }
+
+}

src/test/java/org/kohsuke/github/internal/EnumUtilsTest.java

@@ -0,0 +1,23 @@
+package org.kohsuke.github.internal;
+
+import org.junit.Test;
+
+import static org.junit.Assert.assertEquals;
+import static org.junit.Assert.assertNull;
+
+public class EnumUtilsTest {
+
+    @Test
+    public void testGetEnum() {
+        assertNull(EnumUtils.getNullableEnumOrDefault(TestEnum.class, null, TestEnum.UNKNOWN));
+        assertEquals(TestEnum.UNKNOWN, EnumUtils.getNullableEnumOrDefault(TestEnum.class, "foobar", TestEnum.UNKNOWN));
+        assertEquals(TestEnum.VALUE_1, EnumUtils.getNullableEnumOrDefault(TestEnum.class, "VALUE_1", TestEnum.UNKNOWN));
+        assertEquals(TestEnum.VALUE_1, EnumUtils.getNullableEnumOrDefault(TestEnum.class, "value_1", TestEnum.UNKNOWN));
+        assertEquals(TestEnum.VALUE_2, EnumUtils.getNullableEnumOrDefault(TestEnum.class, "VALUE_2", TestEnum.UNKNOWN));
+        assertEquals(TestEnum.VALUE_2, EnumUtils.getNullableEnumOrDefault(TestEnum.class, "value_2", TestEnum.UNKNOWN));
+    }
+
+    private enum TestEnum {
+        VALUE_1, VALUE_2, UNKNOWN;
+    }
+}

src/test/java/org/kohsuke/github/junit/GitHubWireMockRule.java

@@ -8,6 +8,7 @@ import com.github.tomakehurst.wiremock.extension.ResponseTransformer;
 import com.github.tomakehurst.wiremock.http.*;
 import com.github.tomakehurst.wiremock.matching.RequestPatternBuilder;
 import com.google.gson.*;
+import edu.umd.cs.findbugs.annotations.NonNull;
 
 import java.io.File;
 import java.io.IOException;
@@ -64,6 +65,10 @@ public class GitHubWireMockRule extends WireMockMultiServerRule {
         return servers.get("uploads");
     }
 
+    public WireMockServer codeloadServer() {
+        return servers.get("codeload");
+    }
+
     public boolean isUseProxy() {
         return GitHubWireMockRule.useProxy;
     }
@@ -88,6 +93,10 @@ public class GitHubWireMockRule extends WireMockMultiServerRule {
         if (new File(apiServer().getOptions().filesRoot().getPath() + "_uploads").exists() || isUseProxy()) {
             initializeServer("uploads");
         }
+
+        if (new File(apiServer().getOptions().filesRoot().getPath() + "_codeload").exists() || isUseProxy()) {
+            initializeServer("codeload");
+        }
     }
 
     @Override
@@ -106,6 +115,11 @@ public class GitHubWireMockRule extends WireMockMultiServerRule {
         if (this.uploadsServer() != null) {
             this.uploadsServer().stubFor(proxyAllTo("https://uploads.github.com").atPriority(100));
         }
+
+        if (this.codeloadServer() != null) {
+            this.codeloadServer().stubFor(proxyAllTo("https://codeload.github.com").atPriority(100));
+        }
+
     }
 
     @Override
@@ -121,6 +135,8 @@ public class GitHubWireMockRule extends WireMockMultiServerRule {
         recordSnapshot(this.rawServer(), "https://raw.githubusercontent.com", true);
 
         recordSnapshot(this.uploadsServer(), "https://uploads.github.com", false);
+
+        recordSnapshot(this.codeloadServer(), "https://codeload.github.com", true);
     }
 
     private void recordSnapshot(WireMockServer server, String target, boolean isRawServer) {
@@ -141,7 +157,7 @@ public class GitHubWireMockRule extends WireMockMultiServerRule {
                     .extractTextBodiesOver(255));
 
             // After taking the snapshot, format the output
-            formatTestResources(new File(this.apiServer().getOptions().filesRoot().getPath()).toPath(), false);
+            formatTestResources(new File(server.getOptions().filesRoot().getPath()).toPath(), isRawServer);
         }
     }
 
@@ -213,6 +229,10 @@ public class GitHubWireMockRule extends WireMockMultiServerRule {
                             fileText = fileText.replace(this.uploadsServer().baseUrl(), "https://uploads.github.com");
                         }
 
+                        if (this.codeloadServer() != null) {
+                            fileText = fileText.replace(this.codeloadServer().baseUrl(), "https://codeload.github.com");
+                        }
+
                         // point bodyFile in the mapping to the renamed body file
                         if (entry != null && filePath.toString().contains("mappings")) {
                             fileText = fileText.replace("-" + entry.getKey(), "-" + entry.getValue());
@@ -263,16 +283,23 @@ public class GitHubWireMockRule extends WireMockMultiServerRule {
     public String mapToMockGitHub(String body) {
         body = body.replace("https://api.github.com", this.apiServer().baseUrl());
 
-        if (this.rawServer() != null) {
-            body = body.replace("https://raw.githubusercontent.com", this.rawServer().baseUrl());
-        } else {
-            body = body.replace("https://raw.githubusercontent.com", this.apiServer().baseUrl() + "/raw");
-        }
+        body = replaceTargetServerUrl(body, this.rawServer(), "https://raw.githubusercontent.com", "/raw");
 
-        if (this.uploadsServer() != null) {
-            body = body.replace("https://uploads.github.com", this.uploadsServer().baseUrl());
+        body = replaceTargetServerUrl(body, this.uploadsServer(), "https://uploads.github.com", "/uploads");
+
+        body = replaceTargetServerUrl(body, this.codeloadServer(), "https://codeload.github.com", "/codeload");
+        return body;
+    }
+
+    @NonNull
+    private String replaceTargetServerUrl(String body,
+            WireMockServer wireMockServer,
+            String rawTarget,
+            String inactiveTarget) {
+        if (wireMockServer != null) {
+            body = body.replace(rawTarget, wireMockServer.baseUrl());
         } else {
-            body = body.replace("https://uploads.github.com", this.apiServer().baseUrl() + "/uploads");
+            body = body.replace(rawTarget, this.apiServer().baseUrl() + inactiveTarget);
         }
         return body;
     }
@@ -294,6 +321,7 @@ public class GitHubWireMockRule extends WireMockMultiServerRule {
             Collection<HttpHeader> headers = response.getHeaders().all();
 
             fixListTraversalHeader(response, headers);
+            fixLocationHeader(response, headers);
 
             if ("application/json".equals(response.getHeaders().getContentTypeHeader().mimeTypePart())) {
 
@@ -321,11 +349,20 @@ public class GitHubWireMockRule extends WireMockMultiServerRule {
         }
 
         private void fixListTraversalHeader(Response response, Collection<HttpHeader> headers) {
+            // Lists are broken up into pages. The Link header contains urls for previous and next pages.
             HttpHeader linkHeader = response.getHeaders().getHeader("Link");
             if (linkHeader.isPresent()) {
                 headers.removeIf(item -> item.keyEquals("Link"));
-                headers.add(HttpHeader.httpHeader("Link",
-                        linkHeader.firstValue().replace("https://api.github.com", rule.apiServer().baseUrl())));
+                headers.add(HttpHeader.httpHeader("Link", rule.mapToMockGitHub(linkHeader.firstValue())));
+            }
+        }
+
+        private void fixLocationHeader(Response response, Collection<HttpHeader> headers) {
+            // For redirects, the Location header points to the new target.
+            HttpHeader linkHeader = response.getHeaders().getHeader("Location");
+            if (linkHeader.isPresent()) {
+                headers.removeIf(item -> item.keyEquals("Location"));
+                headers.add(HttpHeader.httpHeader("Location", rule.mapToMockGitHub(linkHeader.firstValue())));
             }
         }
 

src/test/resources/org/kohsuke/github/AppTest/wiremock/testCreateAndListDeployments/__files/repos_hub4j-test-org_github-api-test-2.json

@@ -1,6 +1,6 @@
 {
-  "id": 212656166,
-  "node_id": "MDEwOlJlcG9zaXRvcnkyMTI2NTYxNjY=",
+  "id": 332135400,
+  "node_id": "MDEwOlJlcG9zaXRvcnkzMzIxMzU0MDA=",
   "name": "github-api-test",
   "full_name": "hub4j-test-org/github-api-test",
   "private": false,
@@ -8,7 +8,7 @@
     "login": "hub4j-test-org",
     "id": 7544739,
     "node_id": "MDEyOk9yZ2FuaXphdGlvbjc1NDQ3Mzk=",
-    "avatar_url": "https://avatars3.githubusercontent.com/u/7544739?v=4",
+    "avatar_url": "https://avatars.githubusercontent.com/u/7544739?v=4",
     "gravatar_id": "",
     "url": "https://api.github.com/users/hub4j-test-org",
     "html_url": "https://github.com/hub4j-test-org",
@@ -25,7 +25,7 @@
     "site_admin": false
   },
   "html_url": "https://github.com/hub4j-test-org/github-api-test",
-  "description": "A test repository for testing the github-api project",
+  "description": "A test repository for testing the github-api project: github-api-test",
   "fork": false,
   "url": "https://api.github.com/repos/hub4j-test-org/github-api-test",
   "forks_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/forks",
@@ -64,9 +64,9 @@
   "labels_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/labels{/name}",
   "releases_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/releases{/id}",
   "deployments_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/deployments",
-  "created_at": "2019-10-03T18:57:53Z",
-  "updated_at": "2019-10-03T18:57:57Z",
-  "pushed_at": "2019-10-03T18:57:54Z",
+  "created_at": "2021-01-23T05:30:23Z",
+  "updated_at": "2021-01-23T05:30:27Z",
+  "pushed_at": "2021-01-23T05:30:25Z",
   "git_url": "git://github.com/hub4j-test-org/github-api-test.git",
   "ssh_url": "git@github.com:hub4j-test-org/github-api-test.git",
   "clone_url": "https://github.com/hub4j-test-org/github-api-test.git",
@@ -90,20 +90,22 @@
   "forks": 0,
   "open_issues": 0,
   "watchers": 0,
-  "default_branch": "master",
+  "default_branch": "main",
   "permissions": {
     "admin": true,
     "push": true,
     "pull": true
   },
+  "temp_clone_token": "",
   "allow_squash_merge": true,
   "allow_merge_commit": true,
   "allow_rebase_merge": true,
+  "delete_branch_on_merge": false,
   "organization": {
     "login": "hub4j-test-org",
     "id": 7544739,
     "node_id": "MDEyOk9yZ2FuaXphdGlvbjc1NDQ3Mzk=",
-    "avatar_url": "https://avatars3.githubusercontent.com/u/7544739?v=4",
+    "avatar_url": "https://avatars.githubusercontent.com/u/7544739?v=4",
     "gravatar_id": "",
     "url": "https://api.github.com/users/hub4j-test-org",
     "html_url": "https://github.com/hub4j-test-org",
@@ -120,5 +122,5 @@
     "site_admin": false
   },
   "network_count": 0,
-  "subscribers_count": 2
+  "subscribers_count": 9
 }

src/test/resources/org/kohsuke/github/AppTest/wiremock/testCreateAndListDeployments/__files/repos_hub4j-test-org_github-api-test_deployments-3.json

@@ -1,38 +1,39 @@
 {
-  "url": "http://localhost:62379/repos/hub4j-test-org/github-api-test/deployments/173089055",
-  "id": 173089055,
-  "node_id": "MDEwOkRlcGxveW1lbnQxNzMwODkwNTU=",
-  "sha": "a446d9fa5c6f43d5f9333b625606909cd4635071",
-  "ref": "master",
+  "url": "https://api.github.com/repos/hub4j-test-org/github-api-test/deployments/315601563",
+  "id": 315601563,
+  "node_id": "MDEwOkRlcGxveW1lbnQzMTU2MDE1NjM=",
   "task": "deploy",
-  "payload": "{\"user\":\"atmos\",\"room_id\":123456}",
   "original_environment": "unittest",
   "environment": "unittest",
   "description": "question",
+  "created_at": "2021-01-23T05:30:28Z",
+  "updated_at": "2021-01-23T05:30:28Z",
+  "statuses_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/deployments/315601563/statuses",
+  "repository_url": "https://api.github.com/repos/hub4j-test-org/github-api-test",
   "creator": {
     "login": "bitwiseman",
     "id": 1958953,
     "node_id": "MDQ6VXNlcjE5NTg5NTM=",
-    "avatar_url": "https://avatars3.githubusercontent.com/u/1958953?v=4",
+    "avatar_url": "https://avatars.githubusercontent.com/u/1958953?v=4",
     "gravatar_id": "",
-    "url": "http://localhost:62379/users/bitwiseman",
+    "url": "https://api.github.com/users/bitwiseman",
     "html_url": "https://github.com/bitwiseman",
-    "followers_url": "http://localhost:62379/users/bitwiseman/followers",
-    "following_url": "http://localhost:62379/users/bitwiseman/following{/other_user}",
-    "gists_url": "http://localhost:62379/users/bitwiseman/gists{/gist_id}",
-    "starred_url": "http://localhost:62379/users/bitwiseman/starred{/owner}{/repo}",
-    "subscriptions_url": "http://localhost:62379/users/bitwiseman/subscriptions",
-    "organizations_url": "http://localhost:62379/users/bitwiseman/orgs",
-    "repos_url": "http://localhost:62379/users/bitwiseman/repos",
-    "events_url": "http://localhost:62379/users/bitwiseman/events{/privacy}",
-    "received_events_url": "http://localhost:62379/users/bitwiseman/received_events",
+    "followers_url": "https://api.github.com/users/bitwiseman/followers",
+    "following_url": "https://api.github.com/users/bitwiseman/following{/other_user}",
+    "gists_url": "https://api.github.com/users/bitwiseman/gists{/gist_id}",
+    "starred_url": "https://api.github.com/users/bitwiseman/starred{/owner}{/repo}",
+    "subscriptions_url": "https://api.github.com/users/bitwiseman/subscriptions",
+    "organizations_url": "https://api.github.com/users/bitwiseman/orgs",
+    "repos_url": "https://api.github.com/users/bitwiseman/repos",
+    "events_url": "https://api.github.com/users/bitwiseman/events{/privacy}",
+    "received_events_url": "https://api.github.com/users/bitwiseman/received_events",
     "type": "User",
     "site_admin": false
   },
-  "created_at": "2019-10-03T18:57:57Z",
-  "updated_at": "2019-10-03T18:57:57Z",
-  "statuses_url": "http://localhost:62379/repos/hub4j-test-org/github-api-test/deployments/173089055/statuses",
-  "repository_url": "http://localhost:62379/repos/hub4j-test-org/github-api-test",
-  "transient_environment": true,
-  "production_environment": false
+  "sha": "e53a04ca0ba2fbe6ea3fd590e8ea1391ac61630f",
+  "ref": "main",
+  "payload": "{\"user\":\"atmos\",\"room_id\":123456}",
+  "transient_environment": false,
+  "production_environment": false,
+  "performed_via_github_app": null
 }

src/test/resources/org/kohsuke/github/AppTest/wiremock/testCreateAndListDeployments/__files/repos_hub4j-test-org_github-api-test_deployments-4.json

@@ -1,20 +1,21 @@
 [
   {
-    "url": "https://api.github.com/repos/hub4j-test-org/github-api-test/deployments/173089055",
-    "id": 173089055,
-    "node_id": "MDEwOkRlcGxveW1lbnQxNzMwODkwNTU=",
-    "sha": "a446d9fa5c6f43d5f9333b625606909cd4635071",
-    "ref": "master",
+    "url": "https://api.github.com/repos/hub4j-test-org/github-api-test/deployments/315601563",
+    "id": 315601563,
+    "node_id": "MDEwOkRlcGxveW1lbnQzMTU2MDE1NjM=",
     "task": "deploy",
-    "payload": "{\"user\":\"atmos\",\"room_id\":123456}",
     "original_environment": "unittest",
     "environment": "unittest",
     "description": "question",
+    "created_at": "2021-01-23T05:30:28Z",
+    "updated_at": "2021-01-23T05:30:28Z",
+    "statuses_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/deployments/315601563/statuses",
+    "repository_url": "https://api.github.com/repos/hub4j-test-org/github-api-test",
     "creator": {
       "login": "bitwiseman",
       "id": 1958953,
       "node_id": "MDQ6VXNlcjE5NTg5NTM=",
-      "avatar_url": "https://avatars3.githubusercontent.com/u/1958953?v=4",
+      "avatar_url": "https://avatars.githubusercontent.com/u/1958953?v=4",
       "gravatar_id": "",
       "url": "https://api.github.com/users/bitwiseman",
       "html_url": "https://github.com/bitwiseman",
@@ -30,11 +31,11 @@
       "type": "User",
       "site_admin": false
     },
-    "created_at": "2019-10-03T18:57:57Z",
-    "updated_at": "2019-10-03T18:57:57Z",
-    "statuses_url": "https://api.github.com/repos/hub4j-test-org/github-api-test/deployments/173089055/statuses",
-    "repository_url": "https://api.github.com/repos/hub4j-test-org/github-api-test",
-    "transient_environment": true,
-    "production_environment": false
+    "sha": "e53a04ca0ba2fbe6ea3fd590e8ea1391ac61630f",
+    "ref": "main",
+    "payload": "{\"user\":\"atmos\",\"room_id\":123456}",
+    "transient_environment": false,
+    "production_environment": false,
+    "performed_via_github_app": null
   }
 ]

src/test/resources/org/kohsuke/github/AppTest/wiremock/testCreateAndListDeployments/__files/user-1.json

@@ -2,7 +2,7 @@
   "login": "bitwiseman",
   "id": 1958953,
   "node_id": "MDQ6VXNlcjE5NTg5NTM=",
-  "avatar_url": "https://avatars3.githubusercontent.com/u/1958953?v=4",
+  "avatar_url": "https://avatars.githubusercontent.com/u/1958953?v=4",
   "gravatar_id": "",
   "url": "https://api.github.com/users/bitwiseman",
   "html_url": "https://github.com/bitwiseman",
@@ -23,17 +23,18 @@
   "location": "Seattle, WA, USA",
   "email": "bitwiseman@gmail.com",
   "hireable": null,
-  "bio": "https://twitter.com/bitwiseman",
-  "public_repos": 167,
-  "public_gists": 4,
-  "followers": 136,
-  "following": 9,
+  "bio": null,
+  "twitter_username": "bitwiseman",
+  "public_repos": 201,
+  "public_gists": 7,
+  "followers": 176,
+  "following": 11,
   "created_at": "2012-07-11T20:38:33Z",
-  "updated_at": "2019-09-24T19:32:29Z",
-  "private_gists": 7,
-  "total_private_repos": 9,
+  "updated_at": "2021-01-22T16:38:42Z",
+  "private_gists": 19,
+  "total_private_repos": 17,
   "owned_private_repos": 0,
-  "disk_usage": 33697,
+  "disk_usage": 33700,
   "collaborators": 0,
   "two_factor_authentication": true,
   "plan": {