[maven-release-plugin] prepare release github-api-1.130

Chore(deps-dev): Bump org.eclipse.jgit from 5.11.0.202103091610-r to 5.11.1.202105131744-r

.gitattributes

@@ -0,0 +1 @@
+*.java text eol=lf

.github/PULL_REQUEST_TEMPLATE.md

@@ -1,16 +1,16 @@
-# Description 
-** Describe your change here** 
+# Description
+
+<!-- Describe your change here -->
 
 # Before submitting a PR:
-We love getting PRs, but we hate asking people for the same basic changes every time. 
+We love getting PRs, but we hate asking people for the same basic changes every time.
 
-- [ ] Push your changes to a branch other than `master`. Create your PR from that branch.    
+- [ ] Push your changes to a branch other than `main`. Create your PR from that branch.
 - [ ] Add JavaDocs and other comments
 - [ ] Write tests that run and pass in CI. See [CONTRIBUTING.md](CONTRIBUTING.md) for details on how to capture snapshot data.
-- [ ] Run `mvn clean compile` locally. This may reformat your code, commit those changes.
 - [ ] Run `mvn -D enable-ci clean install site` locally. If this command doesn't succeed, your change will not pass CI.
 
 # When creating a PR: 
 
-- [ ] Fill in the "Description" above. 
-- [ ] Enable "Allow edits from maintainers". 
+- [ ] Fill in the "Description" above.
+- [ ] Enable "Allow edits from maintainers".

.github/workflows/codeql-analysis.yml

@@ -0,0 +1,67 @@
+# For most projects, this workflow file will not need changing; you simply need
+# to commit it to your repository.
+#
+# You may wish to alter this file to override the set of languages analyzed,
+# or to provide custom queries or build logic.
+#
+# ******** NOTE ********
+# We have attempted to detect the languages in your repository. Please check
+# the `language` matrix defined below to confirm you have the correct set of
+# supported CodeQL languages.
+#
+name: "CodeQL"
+
+on:
+  push:
+    branches: [ main, gh-pages ]
+  pull_request:
+    # The branches below must be a subset of the branches above
+    branches: [ main ]
+  schedule:
+    - cron: '20 0 * * 6'
+
+jobs:
+  analyze:
+    name: Analyze
+    runs-on: ubuntu-latest
+
+    strategy:
+      fail-fast: false
+      matrix:
+        language: [ 'java' ]
+        # CodeQL supports [ 'cpp', 'csharp', 'go', 'java', 'javascript', 'python' ]
+        # Learn more:
+        # https://docs.github.com/en/free-pro-team@latest/github/finding-security-vulnerabilities-and-errors-in-your-code/configuring-code-scanning#changing-the-languages-that-are-analyzed
+
+    steps:
+    - name: Checkout repository
+      uses: actions/checkout@v2
+
+    # Initializes the CodeQL tools for scanning.
+    - name: Initialize CodeQL
+      uses: github/codeql-action/init@v1
+      with:
+        languages: ${{ matrix.language }}
+        # If you wish to specify custom queries, you can do so here or in a config file.
+        # By default, queries listed here will override any specified in a config file.
+        # Prefix the list here with "+" to use these queries and those in the config file.
+        # queries: ./path/to/local/query, your-org/your-repo/queries@main
+
+    # Autobuild attempts to build any compiled languages  (C/C++, C#, or Java).
+    # If this step fails, then you should remove it and run the build manually (see below)
+    - name: Autobuild
+      uses: github/codeql-action/autobuild@v1
+
+    # ℹ️ Command-line programs to run using the OS shell.
+    # 📚 https://git.io/JvXDl
+
+    # ✏️ If the Autobuild fails above, remove it and uncomment the following three lines
+    #    and modify them (or add more) to build your code if your project
+    #    uses a compiled language
+
+    #- run: |
+    #   make bootstrap
+    #   make release
+
+    - name: Perform CodeQL Analysis
+      uses: github/codeql-action/analyze@v1

.github/workflows/maven-build.yml

@@ -2,42 +2,51 @@ name: CI
 
 on: [push, pull_request]
 
+# this is required by spotless for JDK 16+
+env:
+  JAVA_11_PLUS_MAVEN_OPTS: "--add-opens jdk.compiler/com.sun.tools.javac.util=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.file=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.parser=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.tree=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.api=ALL-UNNAMED"
 
 jobs:
   build:
     name: build-only (Java ${{ matrix.java }})
     runs-on: ubuntu-latest
     strategy:
+      fail-fast: false
       matrix:
-        java: [ 13 ]
+        java: [ 16 ]
     steps:
       - uses: actions/checkout@v2
       - name: Set up JDK
-        uses: actions/setup-java@v1
+        uses: actions/setup-java@v2
         with:
           java-version: ${{ matrix.java }}
+          distribution: 'adopt'
       - name: Cached .m2
-        uses: actions/cache@v2
+        uses: actions/cache@v2.1.6
         with:
           path: ~/.m2/repository
           key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
           restore-keys: |
             ${{ runner.os }}-maven-
       - name: Maven Install (skipTests)
-        run: mvn -B install -DskipTests -D enable-ci --file pom.xml
+        env:
+          MAVEN_OPTS: ${{ env.JAVA_11_PLUS_MAVEN_OPTS }}
+        run: mvn -B install -DskipTests --file pom.xml
   site:
     name: site (Java ${{ matrix.java }})
     runs-on: ubuntu-latest
     strategy:
+      fail-fast: false
       matrix:
         java: [ 8, 11 ]
     steps:
       - uses: actions/checkout@v2
       - name: Set up JDK
-        uses: actions/setup-java@v1
+        uses: actions/setup-java@v2
         with:
           java-version: ${{ matrix.java }}
-      - uses: actions/cache@v2
+          distribution: 'adopt'
+      - uses: actions/cache@v2.1.6
         with:
           path: ~/.m2/repository
           key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
@@ -49,24 +58,41 @@ jobs:
     name: test (${{ matrix.os }}, Java ${{ matrix.java }})
     runs-on: ${{ matrix.os }}-latest
     strategy:
+      fail-fast: false
       matrix:
         os: [ ubuntu, windows ]
-        java: [ 8, 11, 13, 15-ea ]
+        java: [ 8, 11, 16 ]
     steps:
     - uses: actions/checkout@v2
     - name: Set up JDK
-      uses: actions/setup-java@v1
+      uses: actions/setup-java@v2
       with:
         java-version: ${{ matrix.java }}
-    - uses: actions/cache@v2
+        distribution: 'adopt'
+    - uses: actions/cache@v2.1.6
       with:
         path: ~/.m2/repository
         key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
         restore-keys: |
           ${{ runner.os }}-maven-
+    # JDK 8
     - name: Maven Install without Code Coverage
-      if: matrix.os == 'windows'
+      if: matrix.os == 'windows' && matrix.java == '8'
       run: mvn -B install --file pom.xml
     - name: Maven Install with Code Coverage
-      if: matrix.os != 'windows'
+      if: matrix.os != 'windows' && matrix.java == '8'
       run: mvn -B install -D enable-ci --file pom.xml
+    - name: Codecov Report 
+      if: matrix.os != 'windows' && matrix.java == '8'
+      uses: codecov/codecov-action@v1.5.0  
+    # JDK 11+
+    - name: Maven Install without Code Coverage
+      if: matrix.os == 'windows' && matrix.java != '8'
+      env:
+        MAVEN_OPTS: ${{ env.JAVA_11_PLUS_MAVEN_OPTS }}
+      run: mvn -B install --file pom.xml "-Dsurefire.argLine=--add-opens java.base/java.net=ALL-UNNAMED"
+    - name: Maven Install with Code Coverage
+      if: matrix.os != 'windows' && matrix.java != '8'
+      env:
+        MAVEN_OPTS: ${{ env.JAVA_11_PLUS_MAVEN_OPTS }}
+      run: mvn -B install -D enable-ci --file pom.xml "-Dsurefire.argLine=--add-opens java.base/java.net=ALL-UNNAMED"

.github/workflows/release-drafter.yml

@@ -0,0 +1,14 @@
+
+name: Release Drafter
+
+on:
+  push:
+    branches:
+      - main
+
+jobs:
+  update_release_draft:
+    runs-on: ubuntu-latest
+    steps:
+      - name: Release Drafter
+        uses: release-drafter/release-drafter@v5.15.0

CONTRIBUTING.md

@@ -14,10 +14,14 @@ Example:
 
 This the default behavior.
 
+Example for a single test case:
+
+`mvn install -Dtest=WireMockStatusReporterTest#user_whenProxying_AuthCorrectlyConfigured`
+
 
 ### Setting up credential
 
-1. Create an OAuth token on github.com
+1. Create a "Personal access token" on https://github.com/ (`Settings` > `Developer settings` > `Personal access tokens`)
 2. Set the GITHUB_OAUTH environment variable to the value of that token
 3. Set the system property `test.github.useProxy` (usually like "-Dtest.github.useProxy" as a Java VM option)
 
@@ -27,21 +31,37 @@ This the default behavior.
 
     `WireMockStatusReporterTest: GitHub proxying and user auth correctly configured for user login: <your login>`
 
-Whenever you run tests with `-Dtest.github.useProxy`, they will try to get data from local files but will fallback to proxying to github if not found.
-
+Whenever you run tests with `-Dtest.github.useProxy`, they will try to get data from local files but will fallback to proxying to GitHub if not found.
 
 ### Writing a new test
 
 Once you have credentials setup, you add new test classes and test methods as you would normally.
-Keep `useProxy` enabled and iterate on your tests as needed. Remember, while proxying your tests are interacting with GitHub - you will need to clean up your state between runs.
 
-When you are ready to create a snapshot of your test data,
-run your test with `test.github.takeSnapshot` ("-Dtest.github.takeSnapshot" as a Java VM option).  For example:
+#### Running tests using GitHub test proxy
 
-    `mvn install -Dtest.github.takeSnapshot -Dtest=YourTestClassName`
+Keep `useProxy` enabled and iterate on your tests as needed. With `useProxy` enabled your tests will interact with 
+GitHub - you will need to clean up your server-state between runs. This can be done manually to start with.
+Once your test code is somewhat stable, use `getNonRecordingGitHub()` to get a `GitHub` instance for test setup and cleanup.
+Interactions with that `GitHub` instance will not be recorded as part of the test, keeping the test data files to a minimum. 
 
-The above command would create snapshot WireMock data files under the path `src/test/resources/org/kohsuhke/github/YourTestClassName/wiremock`.
-Each method would get a separate director that would hold the data files for that test method.
+#### Running tests against your personal GitHub user account
+
+By default, test helper methods such as `getTempRepository()` target the `hub4j-test-org` GitHub organization.
+Please request access to this org to record your tests before submitting a PR.  This helps keep the project stable and nimble.
+Until you have access (or if you don't want access), you can set the following additional system property to target 
+your personal github account.
+
+    `mvn install -Dtest.github.org=false -Dtest=YourTestClassName`
+
+#### Taking a snapshot 
+
+When you are ready to create a snapshot of your test data, run your test with `test.github.takeSnapshot`  ("-Dtest.github.takeSnapshot" as 
+a Java VM option). For example:
+
+    `mvn install -Dtest.github.takeSnapshot -Dtest.github.org=false -Dtest=YourTestClassName`
+
+The above command will create snapshot WireMock data files under the path `src/test/resources/org/kohsuhke/github/YourTestClassName/wiremock`.
+Each method will get a separate directory that will hold the data files for that test method.
 
 Add all files including the generated data to your commit and submit a PR.
 

README.md

@@ -2,7 +2,7 @@
 
 [![Sonatype Nexus (Releases)](https://img.shields.io/nexus/r/org.kohsuke/github-api?server=https%3A%2F%2Foss.sonatype.org)](https://mvnrepository.com/artifact/org.kohsuke/github-api)
 [![Join the chat at https://gitter.im/hub4j/github-api](https://badges.gitter.im/Join%20Chat.svg)](https://gitter.im/hub4j/github-api?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
-![CI](https://github.com/hub4j/github-api/workflows/CI/badge.svg?branch=master)
+![CI](https://github.com/hub4j/github-api/workflows/CI/badge.svg?branch=main)
 
 
 

codecov.yml

@@ -0,0 +1,7 @@
+ignore:
+  - "**/extras/okhttp3/ObsoleteUrlFactory**"
+  - "**/extras/OkHttpConnector"
+  - "**/extras/OkHttp3Connector"
+  - "**/example/**"
+  - "**/github/EnforcementLevel"
+

pom.xml

@@ -2,7 +2,7 @@
   <modelVersion>4.0.0</modelVersion>
   <groupId>org.kohsuke</groupId>
   <artifactId>github-api</artifactId>
-  <version>1.117</version>
+  <version>1.130</version>
   <name>GitHub API for Java</name>
   <url>https://github-api.kohsuke.org/</url>
   <description>GitHub API for Java</description>
@@ -11,7 +11,7 @@
     <connection>scm:git:git@github.com/hub4j/${project.artifactId}.git</connection>
     <developerConnection>scm:git:ssh://git@github.com/hub4j/${project.artifactId}.git</developerConnection>
     <url>https://github.com/hub4j/github-api/</url>
-    <tag>github-api-1.117</tag>
+    <tag>github-api-1.130</tag>
   </scm>
 
   <distributionManagement>
@@ -33,19 +33,21 @@
 
   <properties>
     <project.build.sourceEncoding>UTF-8</project.build.sourceEncoding>
-    <spotbugs-maven-plugin.version>4.0.4</spotbugs-maven-plugin.version>
-    <spotbugs.version>4.1.2</spotbugs.version>
+    <spotbugs-maven-plugin.version>4.2.3</spotbugs-maven-plugin.version>
+    <spotbugs.version>4.2.3</spotbugs.version>
     <spotbugs-maven-plugin.failOnError>true</spotbugs-maven-plugin.failOnError>
     <hamcrest.version>2.2</hamcrest.version>
     <okhttp3.version>4.4.1</okhttp3.version>
     <okio.version>2.5.0</okio.version>
-    <formatter-maven-plugin.goal>format</formatter-maven-plugin.goal>
-    <impsort-maven-plugin.goal>sort</impsort-maven-plugin.goal>
     <!-- Using this as the minimum bar for code coverage.  Adding methods without covering them will fail this. -->
-    <jacoco.coverage.target.bundle.method>0.60</jacoco.coverage.target.bundle.method>
-    <jacoco.coverage.target.class.method>0.25</jacoco.coverage.target.class.method>
+    <jacoco.coverage.target.bundle.method>0.70</jacoco.coverage.target.bundle.method>
+    <jacoco.coverage.target.class.method>0.50</jacoco.coverage.target.class.method>
     <!-- For non-ci builds we'd like the build to still complete if jacoco metrics aren't met. -->
     <jacoco.haltOnFailure>false</jacoco.haltOnFailure>
+    <jjwt.suite.version>0.11.2</jjwt.suite.version>
+
+    <jacoco.surefire.argLine />
+    <surefire.argLine />
   </properties>
 
   <build>
@@ -100,12 +102,17 @@
         <plugin>
           <groupId>org.jacoco</groupId>
           <artifactId>jacoco-maven-plugin</artifactId>
-          <version>0.8.6</version>
+          <version>0.8.7</version>
           <executions>
             <execution>
               <goals>
                 <goal>prepare-agent</goal>
               </goals>
+              <configuration>
+                <propertyName>jacoco.surefire.argLine</propertyName>
+                <!-- no need to get data about external code. It dramatically reduces performance of JaCoCo for nothing -->
+                <include>org.kohsuke.*</include>
+              </configuration>
             </execution>
             <!-- attached to Maven test phase -->
             <execution>
@@ -153,59 +160,41 @@
                       <!-- Sample only -->
                       <exclude>org.kohsuke.github.example.*</exclude>
 
-                      <!-- No methods -->
-                      <exclude>org.kohsuke.github.Previews</exclude>
 
                       <!-- Deprecated -->
+                      <exclude>org.kohsuke.github.extras.OkHttpConnector</exclude>
                       <exclude>org.kohsuke.github.extras.OkHttp3Connector</exclude>
                       <exclude>org.kohsuke.github.EnforcementLevel</exclude>
                       <exclude>org.kohsuke.github.GHPerson.1</exclude>
-
-                      <!-- These fail coverage on windows because tests are disabled -->
-                      <exclude>org.kohsuke.github.GHAsset</exclude>
-                      <exclude>org.kohsuke.github.GHReleaseBuilder</exclude>
-                      <exclude>org.kohsuke.github.GHRelease</exclude>
+                      
+                      <!-- TODO: Some coverage, but more needed -->
+                      <exclude>org.kohsuke.github.GHPullRequestReviewBuilder.DraftReviewComment</exclude>
+                      <exclude>org.kohsuke.github.GHIssue.PullRequest</exclude>
+                      <exclude>org.kohsuke.github.GHCommitSearchBuilder</exclude>
+                      <exclude>org.kohsuke.github.GHRepositorySearchBuilder</exclude>
+                      <exclude>org.kohsuke.github.GHUserSearchBuilder</exclude>
 
                       <!-- TODO: These still need test coverage -->
                       <exclude>org.kohsuke.github.GHBranchProtection.RequiredSignatures</exclude>
                       <exclude>org.kohsuke.github.GHBranchProtectionBuilder.Restrictions</exclude>
                       <exclude>org.kohsuke.github.GHBranchProtection.Restrictions</exclude>
                       <exclude>org.kohsuke.github.GHCommentAuthorAssociation</exclude>
-                      <exclude>org.kohsuke.github.GHCommitBuilder.UserInfo</exclude>
-                      <exclude>org.kohsuke.github.GHCommitState</exclude>
                       <exclude>org.kohsuke.github.GHCompare.Commit</exclude>
                       <exclude>org.kohsuke.github.GHCompare.InnerCommit</exclude>
-                      <exclude>org.kohsuke.github.GHCompare.Status</exclude>
                       <exclude>org.kohsuke.github.GHCompare.Tree</exclude>
                       <exclude>org.kohsuke.github.GHCompare.User</exclude>
                       <exclude>org.kohsuke.github.GHCompare</exclude>
                       <exclude>org.kohsuke.github.GHDeployKey</exclude>
-                      <exclude>org.kohsuke.github.GHDeploymentStatusBuilder</exclude>
-                      <exclude>org.kohsuke.github.GHDirection</exclude>
                       <exclude>org.kohsuke.github.GHEmail</exclude>
-                      <exclude>org.kohsuke.github.GHEventPayload.Ping</exclude>
-                      <exclude>org.kohsuke.github.GHEventPayload.Release</exclude>
-                      <exclude>org.kohsuke.github.GHException</exclude>
-                      <exclude>org.kohsuke.github.GHHook</exclude>
-                      <exclude>org.kohsuke.github.GHHooks.OrgContext</exclude>
                       <exclude>org.kohsuke.github.GHInvitation</exclude>
-                      <exclude>org.kohsuke.github.GHMilestoneState</exclude>
-                      <exclude>org.kohsuke.github.GHOrgHook</exclude>
-                      <exclude>org.kohsuke.github.GHProject.ProjectStateFilter</exclude>
                       <exclude>org.kohsuke.github.GHPullRequestCommitDetail.Authorship</exclude>
                       <exclude>org.kohsuke.github.GHPullRequestCommitDetail.Commit</exclude>
                       <exclude>org.kohsuke.github.GHPullRequestCommitDetail.CommitPointer</exclude>
                       <exclude>org.kohsuke.github.GHPullRequestCommitDetail.Tree</exclude>
                       <exclude>org.kohsuke.github.GHPullRequestCommitDetail</exclude>
                       <exclude>org.kohsuke.github.GHPullRequestFileDetail</exclude>
-                      <exclude>org.kohsuke.github.GHPullRequestQueryBuilder.Sort</exclude>
                       <exclude>org.kohsuke.github.GHReleaseUpdater</exclude>
-                      <exclude>org.kohsuke.github.GHRepository.ForkSort</exclude>
                       <exclude>org.kohsuke.github.GHRequestedAction</exclude>
-                      <exclude>org.kohsuke.github.GHStargazer</exclude>
-                      <exclude>org.kohsuke.github.GHTagObject</exclude>
-                      <exclude>org.kohsuke.github.GHTeam.Role</exclude>
-                      <exclude>org.kohsuke.github.GHUserSearchBuilder.Sort</exclude>
                       <exclude>org.kohsuke.github.GHVerifiedKey</exclude>
                     </excludes>
                   </rule>
@@ -217,7 +206,7 @@
         <plugin>
           <groupId>org.apache.maven.plugins</groupId>
           <artifactId>maven-javadoc-plugin</artifactId>
-          <version>3.2.0</version>
+          <version>3.3.0</version>
           <configuration>
             <source>8</source>
             <failOnWarnings>true</failOnWarnings>
@@ -261,7 +250,7 @@
       <plugin>
         <groupId>org.apache.maven.plugins</groupId>
         <artifactId>maven-project-info-reports-plugin</artifactId>
-        <version>3.1.0</version>
+        <version>3.1.2</version>
         <dependencies>
           <dependency>
             <groupId>org.apache.bcel</groupId>
@@ -293,18 +282,7 @@
             <id>default-test</id>
             <configuration>
               <excludesFile>src/test/resources/slow-or-flaky-tests.txt</excludesFile>
-            </configuration>
-          </execution>
-          <execution>
-            <id>slow-or-flaky-test</id>
-            <phase>test</phase>
-            <goals>
-              <goal>test</goal>
-            </goals>
-            <configuration>
-              <rerunFailingTestsCount>2</rerunFailingTestsCount>
-              <!-- There are some tests that take longer or are a little flaky.  Run them here. -->
-              <includesFile>src/test/resources/slow-or-flaky-tests.txt</includesFile>
+              <argLine>@{jacoco.surefire.argLine} ${surefire.argLine}</argLine>
             </configuration>
           </execution>
         </executions>
@@ -312,7 +290,7 @@
       <plugin>
         <groupId>org.codehaus.mojo</groupId>
         <artifactId>animal-sniffer-maven-plugin</artifactId>
-        <version>1.19</version>
+        <version>1.20</version>
         <configuration>
           <signature>
             <groupId>org.codehaus.mojo.signature</groupId>
@@ -343,37 +321,35 @@
         </executions>
       </plugin>
       <plugin>
-        <groupId>net.revelc.code.formatter</groupId>
-        <artifactId>formatter-maven-plugin</artifactId>
-        <version>2.12.1</version>
+        <groupId>com.diffplug.spotless</groupId>
+        <artifactId>spotless-maven-plugin</artifactId>
+        <version>2.11.1</version>
         <executions>
           <execution>
+            <id>spotless-check</id>
+            <!-- runs in verify phase by default -->
             <goals>
-              <goal>${formatter-maven-plugin.goal}</goal>
+              <!-- can be disabled using -Dspotless.check.skip=true -->
+              <goal>check</goal>
             </goals>
-            <configuration>
-              <configFile>src/main/resources/eclipse/formatter.xml</configFile>
-              <cachedir>${project.build.directory}/.cache</cachedir>
-            </configuration>
           </execution>
         </executions>
-      </plugin>
-      <plugin>
-        <groupId>net.revelc.code</groupId>
-        <artifactId>impsort-maven-plugin</artifactId>
-        <version>1.4.1</version>
         <configuration>
-          <groups>*,java.,javax.</groups>
-          <removeUnused>true</removeUnused>
-          <staticAfter>true</staticAfter>
+          <java>
+            <eclipse>
+              <file>${basedir}/src/build/eclipse/formatter.xml</file>
+            </eclipse>
+
+            <importOrder>
+              <file>${basedir}/src/build/eclipse/eclipse.importorder</file>
+            </importOrder>
+            <removeUnusedImports />
+
+            <trimTrailingWhitespace />
+            <endWithNewline />
+
+          </java>
         </configuration>
-        <executions>
-          <execution>
-            <goals>
-              <goal>${impsort-maven-plugin.goal}</goal>
-            </goals>
-          </execution>
-        </executions>
       </plugin>
       <plugin>
         <groupId>com.github.spotbugs</groupId>
@@ -410,6 +386,12 @@
       <artifactId>commons-lang3</artifactId>
       <version>3.9</version>
     </dependency>
+    <dependency>
+      <groupId>com.tngtech.archunit</groupId>
+      <artifactId>archunit</artifactId>
+      <version>0.19.0</version>
+      <scope>test</scope>
+    </dependency>
     <dependency>
       <groupId>org.hamcrest</groupId>
       <artifactId>hamcrest</artifactId>
@@ -432,23 +414,29 @@
     <dependency>
       <groupId>junit</groupId>
       <artifactId>junit</artifactId>
-      <version>4.13.1</version>
+      <version>4.13.2</version>
+      <scope>test</scope>
+    </dependency>
+    <dependency>
+      <groupId>org.awaitility</groupId>
+      <artifactId>awaitility</artifactId>
+      <version>4.1.0</version>
       <scope>test</scope>
     </dependency>
     <dependency>
       <groupId>com.fasterxml.jackson.core</groupId>
       <artifactId>jackson-databind</artifactId>
-      <version>2.10.2</version>
+      <version>2.12.3</version>
     </dependency>
     <dependency>
       <groupId>commons-io</groupId>
       <artifactId>commons-io</artifactId>
-      <version>2.4</version>
+      <version>2.8.0</version>
     </dependency>
     <dependency>
       <groupId>com.infradna.tool</groupId>
       <artifactId>bridge-method-annotation</artifactId>
-      <version>1.18</version>
+      <version>1.21</version>
       <optional>true</optional>
     </dependency>
     <!-- for stapler-jetty -->
@@ -469,7 +457,7 @@
     <dependency>
       <groupId>org.kohsuke.stapler</groupId>
       <artifactId>stapler</artifactId>
-      <version>1.260</version>
+      <version>1.263</version>
       <scope>test</scope>
     </dependency>
     <dependency>
@@ -481,26 +469,26 @@
     <dependency>
       <groupId>org.eclipse.jgit</groupId>
       <artifactId>org.eclipse.jgit</artifactId>
-      <version>5.9.0.202009080501-r</version>
+      <version>5.11.1.202105131744-r</version>
       <scope>test</scope>
     </dependency>
     <dependency>
       <groupId>io.jsonwebtoken</groupId>
       <artifactId>jjwt-api</artifactId>
-      <version>0.11.2</version>
-      <scope>test</scope>
+      <version>${jjwt.suite.version}</version>
+      <optional>true</optional>
     </dependency>
     <dependency>
       <groupId>io.jsonwebtoken</groupId>
       <artifactId>jjwt-impl</artifactId>
-      <version>0.11.2</version>
-      <scope>test</scope>
+      <version>${jjwt.suite.version}</version>
+      <optional>true</optional>
     </dependency>
     <dependency>
       <groupId>io.jsonwebtoken</groupId>
       <artifactId>jjwt-jackson</artifactId>
-      <version>0.11.2</version>
-      <scope>test</scope>
+      <version>${jjwt.suite.version}</version>
+      <optional>true</optional>
     </dependency>
     <dependency>
       <groupId>com.squareup.okio</groupId>
@@ -531,13 +519,13 @@
     <dependency>
       <groupId>org.kohsuke</groupId>
       <artifactId>wordnet-random-name</artifactId>
-      <version>1.3</version>
+      <version>1.5</version>
       <scope>test</scope>
     </dependency>
     <dependency>
       <groupId>org.mockito</groupId>
       <artifactId>mockito-core</artifactId>
-      <version>3.6.0</version>
+      <version>3.10.0</version>
       <scope>test</scope>
     </dependency>
     <dependency>
@@ -549,19 +537,19 @@
     <dependency>
       <groupId>com.github.tomakehurst</groupId>
       <artifactId>wiremock-jre8-standalone</artifactId>
-      <version>2.27.2</version>
+      <version>2.28.0</version>
       <scope>test</scope>
     </dependency>
     <dependency>
       <groupId>com.google.code.gson</groupId>
       <artifactId>gson</artifactId>
-      <version>2.8.6</version>
+      <version>2.8.7</version>
       <scope>test</scope>
     </dependency>
     <dependency>
       <groupId>org.slf4j</groupId>
       <artifactId>slf4j-simple</artifactId>
-      <version>1.7.2</version>
+      <version>1.7.30</version>
       <scope>test</scope>
     </dependency>
   </dependencies>
@@ -578,6 +566,38 @@
     </pluginRepository>
   </pluginRepositories>
   <profiles>
+    <!-- only enable slow-or-flaky-test if -Dtest= is not present -->
+    <profile>
+      <id>slow-or-flaky-test</id>
+      <activation>
+        <property>
+          <name>!test</name>
+        </property>
+      </activation>
+      <build>
+        <plugins>
+          <plugin>
+            <artifactId>maven-surefire-plugin</artifactId>
+            <executions>
+              <execution>
+                <id>slow-or-flaky-test</id>
+                <phase>test</phase>
+                <goals>
+                  <goal>test</goal>
+                </goals>
+                <configuration>
+                  <rerunFailingTestsCount>2</rerunFailingTestsCount>
+                  <!-- There are some tests that take longer or are a little
+                    flaky. Run them here. -->
+                  <includesFile>src/test/resources/slow-or-flaky-tests.txt</includesFile>
+                  <argLine>@{jacoco.surefire.argLine} ${surefire.argLine}</argLine>
+                </configuration>
+              </execution>
+            </executions>
+          </plugin>
+        </plugins>
+      </build>
+    </profile>
     <profile>
       <id>ci-non-windows</id>
       <activation>
@@ -589,8 +609,8 @@
         </os>
       </activation>
       <properties>
-        <formatter-maven-plugin.goal>validate</formatter-maven-plugin.goal>
-        <impsort-maven-plugin.goal>check</impsort-maven-plugin.goal>
+        <!-- Only fail code coverage on non-windows machines -->
+        <jacoco.haltOnFailure>true</jacoco.haltOnFailure>
       </properties>
     </profile>
     <profile>
@@ -600,24 +620,55 @@
           <name>enable-ci</name>
         </property>
       </activation>
-      <properties>
-        <jacoco.haltOnFailure>true</jacoco.haltOnFailure>
-      </properties>
       <build>
         <plugins>
           <plugin>
             <groupId>org.jacoco</groupId>
             <artifactId>jacoco-maven-plugin</artifactId>
           </plugin>
+          <plugin>
+            <groupId>com.diffplug.spotless</groupId>
+            <artifactId>spotless-maven-plugin</artifactId>
+            <executions>
+              <execution>
+                <id>spotless-check</id>
+                <!-- In CI, run check early in the build -->
+                <phase>process-sources</phase>
+                <goals>
+                  <goal>check</goal>
+                </goals>
+              </execution>
+            </executions>
+          </plugin>
+          <plugin>
+            <groupId>org.apache.maven.plugins</groupId>
+            <artifactId>maven-enforcer-plugin</artifactId>
+            <version>3.0.0-M3</version>
+            <executions>
+              <execution>
+                <id>enforce-jacoco-exist</id>
+                <phase>verify</phase>
+                <goals>
+                  <goal>enforce</goal>
+                </goals>
+                <configuration>
+                  <rules>
+                    <requireFilesExist>
+                      <files>
+                        <file>${project.build.directory}/jacoco.exec</file>
+                      </files>
+                    </requireFilesExist>
+                  </rules>
+                  <fail>true</fail>
+                </configuration>
+              </execution>
+            </executions>
+          </plugin>
         </plugins>
       </build>
     </profile>
     <profile>
       <id>release</id>
-      <properties>
-        <formatter-maven-plugin.goal>validate</formatter-maven-plugin.goal>
-        <impsort-maven-plugin.goal>check</impsort-maven-plugin.goal>
-      </properties>
       <build>
         <plugins>
           <plugin>

src/build/eclipse/eclipse.importorder

@@ -0,0 +1,6 @@
+#Organize Import Order
+# Import this file in Window -> Preferences -> Java -> Code Style -> Organize Imports -> Import...
+0=
+1=java
+2=javax
+3=\#

src/main/java/org/kohsuke/github/AbstractBuilder.java

@@ -12,14 +12,14 @@ import javax.annotation.Nonnull;
  * <p>
  * Batching looks like this:
  * </p>
- * 
+ *
  * <pre>
  * update().someName(value).otherName(value).done()
  * </pre>
  * <p>
  * Single changes look like this:
  * </p>
- * 
+ *
  * <pre>
  * set().someName(value);
  * set().otherName(value);
@@ -38,7 +38,7 @@ import javax.annotation.Nonnull;
  *            Intermediate return type for this builder returned by calls to {@link #with(String, Object)}. If {@link S}
  *            the same as {@link R}, this builder will commit changes after each call to {@link #with(String, Object)}.
  */
-abstract class AbstractBuilder<R, S> {
+abstract class AbstractBuilder<R, S> extends GitHubInteractiveObject {
 
     @Nonnull
     private final Class<R> returnType;
@@ -75,6 +75,7 @@ abstract class AbstractBuilder<R, S> {
             @Nonnull Class<S> intermediateReturnType,
             @Nonnull GitHub root,
             @CheckForNull R baseInstance) {
+        super(root);
         this.requester = root.createRequest();
         this.returnType = finalReturnType;
         this.commitChangesImmediately = returnType.equals(intermediateReturnType);
@@ -97,7 +98,7 @@ abstract class AbstractBuilder<R, S> {
      *             if there is an I/O Exception
      */
     @Nonnull
-    @Preview
+    @BetaApi
     @Deprecated
     public R done() throws IOException {
         R result;
@@ -127,7 +128,7 @@ abstract class AbstractBuilder<R, S> {
      *             if an I/O error occurs
      */
     @Nonnull
-    @Preview
+    @BetaApi
     @Deprecated
     protected S with(@Nonnull String name, Object value) throws IOException {
         requester.with(name, value);
@@ -148,7 +149,7 @@ abstract class AbstractBuilder<R, S> {
      *             if an I/O error occurs
      */
     @Nonnull
-    @Preview
+    @BetaApi
     @Deprecated
     protected S continueOrDone() throws IOException {
         // This little bit of roughness in this base class means all inheriting builders get to create Updater and

src/main/java/org/kohsuke/github/BetaApi.java

@@ -0,0 +1,18 @@
+package org.kohsuke.github;
+
+import java.lang.annotation.Documented;
+import java.lang.annotation.Retention;
+import java.lang.annotation.RetentionPolicy;
+
+/**
+ * Indicates that the method/class/etc marked is a beta implementation of an sdk feature.
+ * <p>
+ * These APIs are subject to change and not a part of the backward compatibility commitment. Always used in conjunction
+ * with 'deprecated' to raise awareness to clients.
+ * </p>
+ *
+ */
+@Retention(RetentionPolicy.RUNTIME)
+@Documented
+public @interface BetaApi {
+}

src/main/java/org/kohsuke/github/GHApp.java

@@ -1,11 +1,14 @@
 package org.kohsuke.github;
 
+import org.kohsuke.github.internal.EnumUtils;
+
 import java.io.IOException;
 import java.net.URL;
 import java.util.List;
 import java.util.Map;
+import java.util.stream.Collectors;
 
-import static org.kohsuke.github.Previews.MACHINE_MAN;
+import static org.kohsuke.github.internal.Previews.MACHINE_MAN;
 
 /**
  * A Github App.
@@ -15,13 +18,12 @@ import static org.kohsuke.github.Previews.MACHINE_MAN;
  */
 public class GHApp extends GHObject {
 
-    private GitHub root;
     private GHUser owner;
     private String name;
     private String description;
     private String externalUrl;
     private Map<String, String> permissions;
-    private List<GHEvent> events;
+    private List<String> events;
     private long installationsCount;
     private String htmlUrl;
 
@@ -115,7 +117,9 @@ public class GHApp extends GHObject {
      * @return the events
      */
     public List<GHEvent> getEvents() {
-        return events;
+        return events.stream()
+                .map(e -> EnumUtils.getEnumOrDefault(GHEvent.class, e, GHEvent.UNKNOWN))
+                .collect(Collectors.toList());
     }
 
     /**
@@ -127,7 +131,7 @@ public class GHApp extends GHObject {
      */
     @Deprecated
     public void setEvents(List<GHEvent> events) {
-        this.events = events;
+        this.events = events.stream().map(GHEvent::symbol).collect(Collectors.toList());
     }
 
     /**
@@ -189,7 +193,7 @@ public class GHApp extends GHObject {
      * @return a list of App installations
      * @see <a href="https://developer.github.com/v3/apps/#list-installations">List installations</a>
      */
-    @Preview
+    @Preview(MACHINE_MAN)
     @Deprecated
     public PagedIterable<GHAppInstallation> listInstallations() {
         return root.createRequest()
@@ -210,7 +214,7 @@ public class GHApp extends GHObject {
      *             on error
      * @see <a href="https://developer.github.com/v3/apps/#get-an-installation">Get an installation</a>
      */
-    @Preview
+    @Preview(MACHINE_MAN)
     @Deprecated
     public GHAppInstallation getInstallationById(long id) throws IOException {
         return root.createRequest()
@@ -233,7 +237,7 @@ public class GHApp extends GHObject {
      * @see <a href="https://developer.github.com/v3/apps/#get-an-organization-installation">Get an organization
      *      installation</a>
      */
-    @Preview
+    @Preview(MACHINE_MAN)
     @Deprecated
     public GHAppInstallation getInstallationByOrganization(String name) throws IOException {
         return root.createRequest()
@@ -258,7 +262,7 @@ public class GHApp extends GHObject {
      * @see <a href="https://developer.github.com/v3/apps/#get-a-repository-installation">Get a repository
      *      installation</a>
      */
-    @Preview
+    @Preview(MACHINE_MAN)
     @Deprecated
     public GHAppInstallation getInstallationByRepository(String ownerName, String repositoryName) throws IOException {
         return root.createRequest()
@@ -280,7 +284,7 @@ public class GHApp extends GHObject {
      *             on error
      * @see <a href="https://developer.github.com/v3/apps/#get-a-user-installation">Get a user installation</a>
      */
-    @Preview
+    @Preview(MACHINE_MAN)
     @Deprecated
     public GHAppInstallation getInstallationByUser(String name) throws IOException {
         return root.createRequest()

src/main/java/org/kohsuke/github/GHAppCreateTokenBuilder.java

@@ -5,7 +5,7 @@ import java.util.HashMap;
 import java.util.List;
 import java.util.Map;
 
-import static org.kohsuke.github.Previews.MACHINE_MAN;
+import static org.kohsuke.github.internal.Previews.MACHINE_MAN;
 
 /**
  * Creates a access token for a GitHub App Installation
@@ -14,12 +14,11 @@ import static org.kohsuke.github.Previews.MACHINE_MAN;
  * @see GHAppInstallation#createToken(Map) GHAppInstallation#createToken(Map)
  * @see GHAppInstallation#createToken() GHAppInstallation#createToken()
  */
-public class GHAppCreateTokenBuilder {
-    private final GitHub root;
+public class GHAppCreateTokenBuilder extends GitHubInteractiveObject {
     protected final Requester builder;
     private final String apiUrlTail;
 
-    @Preview
+    @BetaApi
     @Deprecated
     GHAppCreateTokenBuilder(GitHub root, String apiUrlTail) {
         this.root = root;
@@ -27,7 +26,7 @@ public class GHAppCreateTokenBuilder {
         this.builder = root.createRequest();
     }
 
-    @Preview
+    @BetaApi
     @Deprecated
     GHAppCreateTokenBuilder(GitHub root, String apiUrlTail, Map<String, GHPermissionType> permissions) {
         this(root, apiUrlTail);
@@ -43,7 +42,7 @@ public class GHAppCreateTokenBuilder {
      *            Array containing the repositories Ids
      * @return a GHAppCreateTokenBuilder
      */
-    @Preview
+    @BetaApi
     @Deprecated
     public GHAppCreateTokenBuilder repositoryIds(List<Long> repositoryIds) {
         this.builder.with("repository_ids", repositoryIds);
@@ -58,7 +57,7 @@ public class GHAppCreateTokenBuilder {
      *            Map containing the permission names and types.
      * @return a GHAppCreateTokenBuilder
      */
-    @Preview
+    @BetaApi
     @Deprecated
     public GHAppCreateTokenBuilder permissions(Map<String, GHPermissionType> permissions) {
         Map<String, String> retMap = new HashMap<>();
@@ -78,7 +77,7 @@ public class GHAppCreateTokenBuilder {
      * @throws IOException
      *             on error
      */
-    @Preview
+    @Preview(MACHINE_MAN)
     @Deprecated
     public GHAppInstallationToken create() throws IOException {
         return builder.method("POST")

src/main/java/org/kohsuke/github/GHAppInstallation.java

@@ -1,15 +1,17 @@
 package org.kohsuke.github;
 
 import com.fasterxml.jackson.annotation.JsonProperty;
+import org.kohsuke.github.internal.EnumUtils;
 
 import java.io.IOException;
 import java.net.MalformedURLException;
 import java.net.URL;
 import java.util.List;
 import java.util.Map;
+import java.util.stream.Collectors;
 
-import static org.kohsuke.github.Previews.GAMBIT;
-import static org.kohsuke.github.Previews.MACHINE_MAN;
+import static org.kohsuke.github.internal.Previews.GAMBIT;
+import static org.kohsuke.github.internal.Previews.MACHINE_MAN;
 
 /**
  * A Github App Installation.
@@ -22,7 +24,6 @@ import static org.kohsuke.github.Previews.MACHINE_MAN;
  * @see GHApp#getInstallationByUser(String) GHApp#getInstallationByUser(String)
  */
 public class GHAppInstallation extends GHObject {
-    private GitHub root;
     private GHUser account;
 
     @JsonProperty("access_tokens_url")
@@ -36,7 +37,7 @@ public class GHAppInstallation extends GHObject {
     @JsonProperty("target_type")
     private GHTargetType targetType;
     private Map<String, GHPermissionType> permissions;
-    private List<GHEvent> events;
+    private List<String> events;
     @JsonProperty("single_file_name")
     private String singleFileName;
     @JsonProperty("repository_selection")
@@ -124,7 +125,7 @@ public class GHAppInstallation extends GHObject {
      *
      * @return the paged iterable
      */
-    @Preview
+    @Preview(MACHINE_MAN)
     @Deprecated
     public PagedSearchIterable<GHRepository> listRepositories() {
         GitHubRequest request;
@@ -251,7 +252,9 @@ public class GHAppInstallation extends GHObject {
      * @return the events
      */
     public List<GHEvent> getEvents() {
-        return events;
+        return events.stream()
+                .map(e -> EnumUtils.getEnumOrDefault(GHEvent.class, e, GHEvent.UNKNOWN))
+                .collect(Collectors.toList());
     }
 
     /**
@@ -263,7 +266,7 @@ public class GHAppInstallation extends GHObject {
      */
     @Deprecated
     public void setEvents(List<GHEvent> events) {
-        this.events = events;
+        this.events = events.stream().map(GHEvent::symbol).collect(Collectors.toList());
     }
 
     /**
@@ -322,7 +325,7 @@ public class GHAppInstallation extends GHObject {
      *             on error
      * @see <a href="https://developer.github.com/v3/apps/#delete-an-installation">Delete an installation</a>
      */
-    @Preview
+    @Preview(GAMBIT)
     @Deprecated
     public void deleteInstallation() throws IOException {
         root.createRequest()
@@ -344,7 +347,7 @@ public class GHAppInstallation extends GHObject {
      * @return a GHAppCreateTokenBuilder instance
      * @deprecated Use {@link GHAppInstallation#createToken()} instead.
      */
-    @Preview
+    @BetaApi
     @Deprecated
     public GHAppCreateTokenBuilder createToken(Map<String, GHPermissionType> permissions) {
         return new GHAppCreateTokenBuilder(root,
@@ -361,7 +364,7 @@ public class GHAppInstallation extends GHObject {
      *
      * @return a GHAppCreateTokenBuilder instance
      */
-    @Preview
+    @BetaApi
     @Deprecated
     public GHAppCreateTokenBuilder createToken() {
         return new GHAppCreateTokenBuilder(root, String.format("/app/installations/%d/access_tokens", getId()));

src/main/java/org/kohsuke/github/GHAppInstallationToken.java

@@ -14,9 +14,7 @@ import java.util.Map;
  * @author Paulo Miguel Almeida
  * @see GHAppInstallation#createToken(Map) GHAppInstallation#createToken(Map)
  */
-public class GHAppInstallationToken {
-    private GitHub root;
-
+public class GHAppInstallationToken extends GitHubInteractiveObject {
     private String token;
     protected String expires_at;
     private Map<String, String> permissions;

src/main/java/org/kohsuke/github/GHArtifact.java

@@ -0,0 +1,140 @@
+package org.kohsuke.github;
+
+import com.fasterxml.jackson.annotation.JsonIgnore;
+import org.apache.commons.lang3.StringUtils;
+import org.kohsuke.github.function.InputStreamFunction;
+
+import java.io.IOException;
+import java.net.URL;
+import java.util.Date;
+import java.util.Objects;
+
+import static java.util.Objects.requireNonNull;
+
+/**
+ * An artifact from a workflow run.
+ *
+ * @author Guillaume Smet
+ */
+public class GHArtifact extends GHObject {
+
+    // Not provided by the API.
+    @JsonIgnore
+    private GHRepository owner;
+
+    private String name;
+    private long sizeInBytes;
+    private String archiveDownloadUrl;
+    private boolean expired;
+    private String expiresAt;
+
+    /**
+     * Gets the name.
+     *
+     * @return the name
+     */
+    public String getName() {
+        return name;
+    }
+
+    /**
+     * Gets the size of the artifact in bytes.
+     *
+     * @return the size
+     */
+    public long getSizeInBytes() {
+        return sizeInBytes;
+    }
+
+    /**
+     * Gets the archive download URL.
+     *
+     * @return the archive download URL
+     */
+    public URL getArchiveDownloadUrl() {
+        return GitHubClient.parseURL(archiveDownloadUrl);
+    }
+
+    /**
+     * If this artifact has expired.
+     *
+     * @return if the artifact has expired
+     */
+    public boolean isExpired() {
+        return expired;
+    }
+
+    /**
+     * Gets the date at which this artifact will expire.
+     *
+     * @return the date of expiration
+     */
+    public Date getExpiresAt() {
+        return GitHubClient.parseDate(expiresAt);
+    }
+
+    /**
+     * Repository to which the artifact belongs.
+     *
+     * @return the repository
+     */
+    public GHRepository getRepository() {
+        return owner;
+    }
+
+    /**
+     * @deprecated This object has no HTML URL.
+     */
+    @Override
+    public URL getHtmlUrl() throws IOException {
+        return null;
+    }
+
+    /**
+     * Deletes the artifact.
+     *
+     * @throws IOException
+     *             the io exception
+     */
+    public void delete() throws IOException {
+        root.createRequest().method("DELETE").withUrlPath(getApiRoute()).fetchHttpStatusCode();
+    }
+
+    /**
+     * Downloads the artifact.
+     *
+     * @param <T>
+     *            the type of result
+     * @param streamFunction
+     *            The {@link InputStreamFunction} that will process the stream
+     * @throws IOException
+     *             The IO exception.
+     * @return the result of reading the stream.
+     */
+    public <T> T download(InputStreamFunction<T> streamFunction) throws IOException {
+        requireNonNull(streamFunction, "Stream function must not be null");
+
+        return root.createRequest().method("GET").withUrlPath(getApiRoute(), "zip").fetchStream(streamFunction);
+    }
+
+    private String getApiRoute() {
+        if (owner == null) {
+            // Workflow runs returned from search to do not have an owner. Attempt to use url.
+            final URL url = Objects.requireNonNull(getUrl(), "Missing instance URL!");
+            return StringUtils.prependIfMissing(url.toString().replace(root.getApiUrl(), ""), "/");
+        }
+        return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/actions/artifacts/" + getId();
+    }
+
+    GHArtifact wrapUp(GHRepository owner) {
+        this.owner = owner;
+        return wrapUp(owner.root);
+    }
+
+    GHArtifact wrapUp(GitHub root) {
+        this.root = root;
+        if (owner != null)
+            owner.wrap(root);
+        return this;
+    }
+}

src/main/java/org/kohsuke/github/GHArtifactsIterable.java

@@ -0,0 +1,49 @@
+package org.kohsuke.github;
+
+import java.net.MalformedURLException;
+import java.util.Iterator;
+
+import javax.annotation.Nonnull;
+
+/**
+ * Iterable for artifacts listing.
+ */
+class GHArtifactsIterable extends PagedIterable<GHArtifact> {
+    private final transient GHRepository owner;
+    private final GitHubRequest request;
+
+    private GHArtifactsPage result;
+
+    public GHArtifactsIterable(GHRepository owner, GitHubRequest.Builder<?> requestBuilder) {
+        this.owner = owner;
+        try {
+            this.request = requestBuilder.build();
+        } catch (MalformedURLException e) {
+            throw new GHException("Malformed URL", e);
+        }
+    }
+
+    @Nonnull
+    @Override
+    public PagedIterator<GHArtifact> _iterator(int pageSize) {
+        return new PagedIterator<>(
+                adapt(GitHubPageIterator.create(owner.getRoot().getClient(), GHArtifactsPage.class, request, pageSize)),
+                null);
+    }
+
+    protected Iterator<GHArtifact[]> adapt(final Iterator<GHArtifactsPage> base) {
+        return new Iterator<GHArtifact[]>() {
+            public boolean hasNext() {
+                return base.hasNext();
+            }
+
+            public GHArtifact[] next() {
+                GHArtifactsPage v = base.next();
+                if (result == null) {
+                    result = v;
+                }
+                return v.getArtifacts(owner);
+            }
+        };
+    }
+}

src/main/java/org/kohsuke/github/GHArtifactsPage.java

@@ -0,0 +1,20 @@
+package org.kohsuke.github;
+
+/**
+ * Represents the one page of artifacts result when listing artifacts.
+ */
+class GHArtifactsPage {
+    private int total_count;
+    private GHArtifact[] artifacts;
+
+    public int getTotalCount() {
+        return total_count;
+    }
+
+    GHArtifact[] getArtifacts(GHRepository owner) {
+        for (GHArtifact artifact : artifacts) {
+            artifact.wrapUp(owner);
+        }
+        return artifacts;
+    }
+}

src/main/java/org/kohsuke/github/GHAsset.java

@@ -9,7 +9,6 @@ import java.net.URL;
  * @see GHRelease#getAssets() GHRelease#getAssets()
  */
 public class GHAsset extends GHObject {
-    GitHub root;
     GHRepository owner;
     private String name;
     private String label;

src/main/java/org/kohsuke/github/GHAuthorization.java

@@ -33,7 +33,6 @@ public class GHAuthorization extends GHObject {
     public static final String WRITE_KEY = "write:public_key";
     public static final String ADMIN_KEY = "admin:public_key";
 
-    private GitHub root;
     private List<String> scopes;
     private String token;
     private String token_last_eight;

src/main/java/org/kohsuke/github/GHBranch.java

@@ -3,6 +3,7 @@ package org.kohsuke.github;
 import com.fasterxml.jackson.annotation.JsonCreator;
 import com.fasterxml.jackson.annotation.JsonProperty;
 import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
+import org.kohsuke.github.internal.Previews;
 
 import java.io.IOException;
 import java.net.URL;
@@ -20,8 +21,7 @@ import javax.annotation.CheckForNull;
         value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD",
                 "URF_UNREAD_FIELD" },
         justification = "JSON API")
-public class GHBranch {
-    private GitHub root;
+public class GHBranch extends GitHubInteractiveObject {
     private GHRepository owner;
 
     private String name;
@@ -78,7 +78,7 @@ public class GHBranch {
      *
      * @return true if the push to this branch is restricted via branch protection.
      */
-    @Preview
+    @Preview(Previews.LUKE_CAGE)
     @Deprecated
     public boolean isProtected() {
         return protection;
@@ -89,7 +89,7 @@ public class GHBranch {
      *
      * @return API URL that deals with the protection of this branch.
      */
-    @Preview
+    @Preview(Previews.LUKE_CAGE)
     @Deprecated
     public URL getProtectionUrl() {
         return GitHubClient.parseURL(protection_url);
@@ -102,6 +102,8 @@ public class GHBranch {
      * @throws IOException
      *             the io exception
      */
+    @Preview(Previews.LUKE_CAGE)
+    @Deprecated
     public GHBranchProtection getProtection() throws IOException {
         return root.createRequest()
                 .withPreview(Previews.LUKE_CAGE)
@@ -135,7 +137,7 @@ public class GHBranch {
      * @return GHBranchProtectionBuilder for enabling protection
      * @see GHCommitStatus#getContext() GHCommitStatus#getContext()
      */
-    @Preview
+    @Preview(Previews.LUKE_CAGE)
     @Deprecated
     public GHBranchProtectionBuilder enableProtection() {
         return new GHBranchProtectionBuilder(this);

src/main/java/org/kohsuke/github/GHBranchProtection.java

@@ -6,7 +6,7 @@ import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
 import java.io.IOException;
 import java.util.Collection;
 
-import static org.kohsuke.github.Previews.ZZZAX;
+import static org.kohsuke.github.internal.Previews.ZZZAX;
 
 /**
  * The type GHBranchProtection.
@@ -17,14 +17,12 @@ import static org.kohsuke.github.Previews.ZZZAX;
         value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD",
                 "URF_UNREAD_FIELD" },
         justification = "JSON API")
-public class GHBranchProtection {
+public class GHBranchProtection extends GitHubInteractiveObject {
     private static final String REQUIRE_SIGNATURES_URI = "/required_signatures";
 
     @JsonProperty
     private EnforceAdmins enforceAdmins;
 
-    private GitHub root;
-
     @JsonProperty("required_pull_request_reviews")
     private RequiredReviews requiredReviews;
 
@@ -43,7 +41,7 @@ public class GHBranchProtection {
      * @throws IOException
      *             the io exception
      */
-    @Preview
+    @Preview(ZZZAX)
     @Deprecated
     public void enabledSignedCommits() throws IOException {
         requester().method("POST").withUrlPath(url + REQUIRE_SIGNATURES_URI).fetch(RequiredSignatures.class);
@@ -55,7 +53,7 @@ public class GHBranchProtection {
      * @throws IOException
      *             the io exception
      */
-    @Preview
+    @Preview(ZZZAX)
     @Deprecated
     public void disableSignedCommits() throws IOException {
         requester().method("DELETE").withUrlPath(url + REQUIRE_SIGNATURES_URI).send();
@@ -86,7 +84,7 @@ public class GHBranchProtection {
      * @throws IOException
      *             the io exception
      */
-    @Preview
+    @Preview(ZZZAX)
     @Deprecated
     public boolean getRequiredSignatures() throws IOException {
         return requester().withUrlPath(url + REQUIRE_SIGNATURES_URI).fetch(RequiredSignatures.class).enabled;

src/main/java/org/kohsuke/github/GHBranchProtectionBuilder.java

@@ -12,7 +12,7 @@ import java.util.List;
 import java.util.Map;
 import java.util.Set;
 
-import static org.kohsuke.github.Previews.*;
+import static org.kohsuke.github.internal.Previews.LUKE_CAGE;
 
 /**
  * Builder to configure the branch protection settings.

src/main/java/org/kohsuke/github/GHCheckRun.java

@@ -1,8 +1,13 @@
 package org.kohsuke.github;
 
 import com.fasterxml.jackson.annotation.JsonProperty;
+import com.infradna.tool.bridge_method_injector.WithBridgeMethods;
 import edu.umd.cs.findbugs.annotations.NonNull;
 import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
+import org.kohsuke.github.GHWorkflowRun.Conclusion;
+import org.kohsuke.github.GHWorkflowRun.Status;
+import org.kohsuke.github.internal.EnumUtils;
+import org.kohsuke.github.internal.Previews;
 
 import java.io.IOException;
 import java.net.URL;
@@ -10,6 +15,7 @@ import java.util.Arrays;
 import java.util.Collections;
 import java.util.Date;
 import java.util.List;
+import java.util.Locale;
 
 /**
  * Represents a check run.
@@ -22,7 +28,6 @@ public class GHCheckRun extends GHObject {
 
     @JsonProperty("repository")
     GHRepository owner;
-    GitHub root;
 
     private String status;
     private String conclusion;
@@ -80,12 +85,27 @@ public class GHCheckRun extends GHObject {
      * @return Status of the check run
      * @see Status
      */
-    public String getStatus() {
+    @WithBridgeMethods(value = String.class, adapterMethod = "statusAsStr")
+    public Status getStatus() {
+        return Status.from(status);
+    }
+
+    @SuppressFBWarnings(value = "UPM_UNCALLED_PRIVATE_METHOD", justification = "Bridge method of getStatus")
+    private Object statusAsStr(Status status, Class type) {
         return status;
     }
 
     public static enum Status {
-        QUEUED, IN_PROGRESS, COMPLETED
+        QUEUED, IN_PROGRESS, COMPLETED, UNKNOWN;
+
+        public static Status from(String value) {
+            return EnumUtils.getNullableEnumOrDefault(Status.class, value, Status.UNKNOWN);
+        }
+
+        @Override
+        public String toString() {
+            return name().toLowerCase(Locale.ROOT);
+        }
     }
 
     /**
@@ -94,7 +114,13 @@ public class GHCheckRun extends GHObject {
      * @return Status of the check run
      * @see Conclusion
      */
-    public String getConclusion() {
+    @WithBridgeMethods(value = String.class, adapterMethod = "conclusionAsStr")
+    public Conclusion getConclusion() {
+        return Conclusion.from(conclusion);
+    }
+
+    @SuppressFBWarnings(value = "UPM_UNCALLED_PRIVATE_METHOD", justification = "Bridge method of getConclusion")
+    private Object conclusionAsStr(Conclusion conclusion, Class type) {
         return conclusion;
     }
 
@@ -105,7 +131,16 @@ public class GHCheckRun extends GHObject {
      * Parameters - <code>conclusion</code></a>.
      */
     public static enum Conclusion {
-        SUCCESS, FAILURE, NEUTRAL, CANCELLED, TIMED_OUT, ACTION_REQUIRED, SKIPPED
+        ACTION_REQUIRED, CANCELLED, FAILURE, NEUTRAL, SUCCESS, SKIPPED, STALE, TIMED_OUT, UNKNOWN;
+
+        public static Conclusion from(String value) {
+            return EnumUtils.getNullableEnumOrDefault(Conclusion.class, value, Conclusion.UNKNOWN);
+        }
+
+        @Override
+        public String toString() {
+            return name().toLowerCase(Locale.ROOT);
+        }
     }
 
     /**
@@ -295,10 +330,10 @@ public class GHCheckRun extends GHObject {
 
     /**
      * Updates this check run.
-     * 
+     *
      * @return a builder which you should customize, then call {@link GHCheckRunBuilder#create}
      */
-    @Preview
+    @Preview(Previews.ANTIOPE)
     @Deprecated
     public @NonNull GHCheckRunBuilder update() {
         return new GHCheckRunBuilder(owner, getId());

src/main/java/org/kohsuke/github/GHCheckRunBuilder.java

@@ -28,6 +28,7 @@ import com.fasterxml.jackson.annotation.JsonInclude;
 import edu.umd.cs.findbugs.annotations.CheckForNull;
 import edu.umd.cs.findbugs.annotations.NonNull;
 import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
+import org.kohsuke.github.internal.Previews;
 
 import java.io.IOException;
 import java.util.Collections;
@@ -46,7 +47,7 @@ import java.util.Locale;
  * @see <a href="https://developer.github.com/v3/checks/runs/#update-a-check-run">documentation</a>
  */
 @SuppressFBWarnings(value = "URF_UNREAD_FIELD", justification = "Jackson serializes these even without a getter")
-@Preview
+@Preview(Previews.ANTIOPE)
 @Deprecated
 public final class GHCheckRunBuilder {
 
@@ -151,7 +152,7 @@ public final class GHCheckRunBuilder {
         }
         GHCheckRun run = requester.with("output", output).with("actions", actions).fetch(GHCheckRun.class).wrap(repo);
         while (!extraAnnotations.isEmpty()) {
-            Output output2 = new Output(output.title, output.summary);
+            Output output2 = new Output(output.title, output.summary).withText(output.text);
             int i = Math.min(extraAnnotations.size(), MAX_ANNOTATIONS);
             output2.annotations = extraAnnotations.subList(0, i);
             extraAnnotations = extraAnnotations.subList(i, extraAnnotations.size());

src/main/java/org/kohsuke/github/GHCheckRunsIterable.java

@@ -8,13 +8,13 @@ import javax.annotation.Nonnull;
  * Iterable for check-runs listing.
  */
 class GHCheckRunsIterable extends PagedIterable<GHCheckRun> {
-    private GitHub root;
+    private final GHRepository owner;
     private final GitHubRequest request;
 
     private GHCheckRunsPage result;
 
-    public GHCheckRunsIterable(GitHub root, GitHubRequest request) {
-        this.root = root;
+    public GHCheckRunsIterable(GHRepository owner, GitHubRequest request) {
+        this.owner = owner;
         this.request = request;
     }
 
@@ -22,7 +22,7 @@ class GHCheckRunsIterable extends PagedIterable<GHCheckRun> {
     @Override
     public PagedIterator<GHCheckRun> _iterator(int pageSize) {
         return new PagedIterator<>(
-                adapt(GitHubPageIterator.create(root.getClient(), GHCheckRunsPage.class, request, pageSize)),
+                adapt(GitHubPageIterator.create(owner.getRoot().getClient(), GHCheckRunsPage.class, request, pageSize)),
                 null);
     }
 
@@ -37,7 +37,7 @@ class GHCheckRunsIterable extends PagedIterable<GHCheckRun> {
                 if (result == null) {
                     result = v;
                 }
-                return v.getCheckRuns(root);
+                return v.getCheckRuns(owner);
             }
         };
     }

src/main/java/org/kohsuke/github/GHCheckRunsPage.java

@@ -11,9 +11,9 @@ class GHCheckRunsPage {
         return total_count;
     }
 
-    GHCheckRun[] getCheckRuns(GitHub root) {
+    GHCheckRun[] getCheckRuns(GHRepository owner) {
         for (GHCheckRun check_run : check_runs) {
-            check_run.wrap(root);
+            check_run.wrap(owner);
         }
         return check_runs;
     }

src/main/java/org/kohsuke/github/GHCheckSuite.java

@@ -21,7 +21,6 @@ public class GHCheckSuite extends GHObject {
 
     @JsonProperty("repository")
     GHRepository owner;
-    GitHub root;
 
     private String nodeId;
     private String headBranch;

src/main/java/org/kohsuke/github/GHCommit.java

@@ -11,7 +11,8 @@ import java.util.Collections;
 import java.util.Date;
 import java.util.List;
 
-import static org.kohsuke.github.Previews.GROOT;
+import static org.kohsuke.github.internal.Previews.ANTIOPE;
+import static org.kohsuke.github.internal.Previews.GROOT;
 
 /**
  * A commit in a repository.
@@ -65,7 +66,7 @@ public class GHCommit {
          * @return the authored date
          */
         public Date getAuthoredDate() {
-            return GitHubClient.parseDate(author.date);
+            return author.getDate();
         }
 
         /**
@@ -84,7 +85,7 @@ public class GHCommit {
          * @return the commit date
          */
         public Date getCommitDate() {
-            return GitHubClient.parseDate(committer.date);
+            return committer.getDate();
         }
 
         /**
@@ -121,7 +122,6 @@ public class GHCommit {
      * @deprecated Use {@link GitUser} instead.
      */
     public static class GHAuthor extends GitUser {
-        private String date;
     }
 
     /**
@@ -453,7 +453,7 @@ public class GHCommit {
      *
      * @return {@link PagedIterable} with the pull requests which contain this commit
      */
-    @Preview
+    @Preview(GROOT)
     @Deprecated
     public PagedIterable<GHPullRequest> listPullRequests() {
         return owner.root.createRequest()
@@ -469,7 +469,7 @@ public class GHCommit {
      * @throws IOException
      *             the io exception
      */
-    @Preview
+    @Preview(GROOT)
     @Deprecated
     public PagedIterable<GHBranch> listBranchesWhereHead() throws IOException {
         return owner.root.createRequest()
@@ -565,7 +565,7 @@ public class GHCommit {
      * @throws IOException
      *             on error
      */
-    @Preview
+    @Preview(ANTIOPE)
     @Deprecated
     public PagedIterable<GHCheckRun> getCheckRuns() throws IOException {
         return owner.getCheckRuns(sha);
@@ -573,7 +573,7 @@ public class GHCommit {
 
     /**
      * Some of the fields are not always filled in when this object is retrieved as a part of another API call.
-     * 
+     *
      * @throws IOException
      *             on error
      */

src/main/java/org/kohsuke/github/GHCommitComment.java

@@ -5,7 +5,7 @@ import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
 import java.io.IOException;
 import java.net.URL;
 
-import static org.kohsuke.github.Previews.*;
+import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
 
 /**
  * A comment attached to a commit (or a specific line in a specific file of a commit.)
@@ -121,7 +121,7 @@ public class GHCommitComment extends GHObject implements Reactable {
         this.body = body;
     }
 
-    @Preview
+    @Preview(SQUIRREL_GIRL)
     @Deprecated
     public GHReaction createReaction(ReactionContent content) throws IOException {
         return owner.root.createRequest()
@@ -133,7 +133,7 @@ public class GHCommitComment extends GHObject implements Reactable {
                 .wrap(owner.root);
     }
 
-    @Preview
+    @Preview(SQUIRREL_GIRL)
     @Deprecated
     public PagedIterable<GHReaction> listReactions() {
         return owner.root.createRequest()

src/main/java/org/kohsuke/github/GHCommitSearchBuilder.java

@@ -1,6 +1,7 @@
 package org.kohsuke.github;
 
 import org.apache.commons.lang3.StringUtils;
+import org.kohsuke.github.internal.Previews;
 
 import java.io.IOException;
 
@@ -10,7 +11,7 @@ import java.io.IOException;
  * @author Marc de Verdelhan
  * @see GitHub#searchCommits() GitHub#searchCommits()
  */
-@Preview
+@Preview(Previews.CLOAK)
 @Deprecated
 public class GHCommitSearchBuilder extends GHSearchBuilder<GHCommit> {
     GHCommitSearchBuilder(GitHub root) {

src/main/java/org/kohsuke/github/GHCommitStatus.java

@@ -18,8 +18,6 @@ public class GHCommitStatus extends GHObject {
     String context;
     GHUser creator;
 
-    private GitHub root;
-
     GHCommitStatus wrapUp(GitHub root) {
         if (creator != null)
             creator.wrapUp(root);

src/main/java/org/kohsuke/github/GHContent.java

@@ -15,15 +15,13 @@ import java.util.Base64;
  * @see GHRepository#getFileContent(String) GHRepository#getFileContent(String)
  */
 @SuppressWarnings({ "UnusedDeclaration" })
-public class GHContent implements Refreshable {
+public class GHContent extends GitHubInteractiveObject implements Refreshable {
     /*
      * In normal use of this class, repository field is set via wrap(), but in the code search API, there's a nested
      * 'repository' field that gets populated from JSON.
      */
     private GHRepository repository;
 
-    private GitHub root;
-
     private String type;
     private String encoding;
     private long size;
@@ -102,7 +100,7 @@ public class GHContent implements Refreshable {
 
     /**
      * Gets target of a symlink. This will only be set if {@code "symlink".equals(getType())}
-     * 
+     *
      * @return the target
      */
     public String getTarget() {

src/main/java/org/kohsuke/github/GHContentSearchBuilder.java

@@ -118,6 +118,41 @@ public class GHContentSearchBuilder extends GHSearchBuilder<GHContent> {
         return q("repo:" + v);
     }
 
+    /**
+     * Order gh content search builder.
+     *
+     * @param v
+     *            the v
+     * @return the gh content search builder
+     */
+    public GHContentSearchBuilder order(GHDirection v) {
+        req.with("order", v);
+        return this;
+    }
+
+    /**
+     * Sort gh content search builder.
+     *
+     * @param sort
+     *            the sort
+     * @return the gh content search builder
+     */
+    public GHContentSearchBuilder sort(GHContentSearchBuilder.Sort sort) {
+        if (Sort.BEST_MATCH.equals(sort)) {
+            req.remove("sort");
+        } else {
+            req.with("sort", sort);
+        }
+        return this;
+    }
+
+    /**
+     * The enum Sort.
+     */
+    public enum Sort {
+        BEST_MATCH, INDEXED
+    }
+
     private static class ContentSearchResult extends SearchResult<GHContent> {
         private GHContent[] items;
 

src/main/java/org/kohsuke/github/GHCreateRepositoryBuilder.java

@@ -1,168 +1,25 @@
 package org.kohsuke.github;
 
 import java.io.IOException;
-import java.net.URL;
 
-import static org.kohsuke.github.Previews.BAPTISE;
+import static org.kohsuke.github.internal.Previews.BAPTISTE;
 
 /**
  * Creates a repository
  *
  * @author Kohsuke Kawaguchi
  */
-public class GHCreateRepositoryBuilder {
-    private final GitHub root;
-    protected final Requester builder;
-    private String apiUrlTail;
+public class GHCreateRepositoryBuilder extends GHRepositoryBuilder<GHCreateRepositoryBuilder> {
 
-    GHCreateRepositoryBuilder(GitHub root, String apiUrlTail, String name) {
-        this.root = root;
-        this.apiUrlTail = apiUrlTail;
-        this.builder = root.createRequest();
-        this.builder.with("name", name);
-    }
+    public GHCreateRepositoryBuilder(String name, GitHub root, String apiTail) {
+        super(GHCreateRepositoryBuilder.class, root, null);
+        requester.method("POST").withUrlPath(apiTail);
 
-    /**
-     * Description for repository
-     *
-     * @param description
-     *            description of repository
-     * @return a builder to continue with building
-     */
-    public GHCreateRepositoryBuilder description(String description) {
-        this.builder.with("description", description);
-        return this;
-    }
-
-    /**
-     * Homepage for repository
-     *
-     * @param homepage
-     *            homepage of repository
-     * @return a builder to continue with building
-     */
-    public GHCreateRepositoryBuilder homepage(URL homepage) {
-        return homepage(homepage.toExternalForm());
-    }
-
-    /**
-     * Homepage for repository
-     *
-     * @param homepage
-     *            homepage of repository
-     * @return a builder to continue with building
-     */
-    public GHCreateRepositoryBuilder homepage(String homepage) {
-        this.builder.with("homepage", homepage);
-        return this;
-    }
-
-    /**
-     * Creates a private repository
-     *
-     * @param enabled
-     *            private if true
-     * @return a builder to continue with building
-     */
-    public GHCreateRepositoryBuilder private_(boolean enabled) {
-        this.builder.with("private", enabled);
-        return this;
-    }
-
-    /**
-     * Enables issue tracker
-     *
-     * @param enabled
-     *            true if enabled
-     * @return a builder to continue with building
-     */
-    public GHCreateRepositoryBuilder issues(boolean enabled) {
-        this.builder.with("has_issues", enabled);
-        return this;
-    }
-
-    /**
-     * Enables projects
-     *
-     * @param enabled
-     *            true if enabled
-     * @return a builder to continue with building
-     */
-    public GHCreateRepositoryBuilder projects(boolean enabled) {
-        this.builder.with("has_projects", enabled);
-        return this;
-    }
-
-    /**
-     * Enables wiki
-     *
-     * @param enabled
-     *            true if enabled
-     * @return a builder to continue with building
-     */
-    public GHCreateRepositoryBuilder wiki(boolean enabled) {
-        this.builder.with("has_wiki", enabled);
-        return this;
-    }
-
-    /**
-     * Enables downloads
-     *
-     * @param enabled
-     *            true if enabled
-     * @return a builder to continue with building
-     */
-    public GHCreateRepositoryBuilder downloads(boolean enabled) {
-        this.builder.with("has_downloads", enabled);
-        return this;
-    }
-
-    /**
-     * If true, create an initial commit with empty README.
-     *
-     * @param enabled
-     *            true if enabled
-     * @return a builder to continue with building
-     */
-    public GHCreateRepositoryBuilder autoInit(boolean enabled) {
-        this.builder.with("auto_init", enabled);
-        return this;
-    }
-
-    /**
-     * Allow or disallow squash-merging pull requests.
-     *
-     * @param enabled
-     *            true if enabled
-     * @return a builder to continue with building
-     */
-    public GHCreateRepositoryBuilder allowSquashMerge(boolean enabled) {
-        this.builder.with("allow_squash_merge", enabled);
-        return this;
-    }
-
-    /**
-     * Allow or disallow merging pull requests with a merge commit.
-     *
-     * @param enabled
-     *            true if enabled
-     * @return a builder to continue with building
-     */
-    public GHCreateRepositoryBuilder allowMergeCommit(boolean enabled) {
-        this.builder.with("allow_merge_commit", enabled);
-        return this;
-    }
-
-    /**
-     * Allow or disallow rebase-merging pull requests.
-     *
-     * @param enabled
-     *            true if enabled
-     * @return a builder to continue with building
-     */
-    public GHCreateRepositoryBuilder allowRebaseMerge(boolean enabled) {
-        this.builder.with("allow_rebase_merge", enabled);
-        return this;
+        try {
+            name(name);
+        } catch (IOException e) {
+            // not going to happen here
+        }
     }
 
     /**
@@ -171,10 +28,11 @@ public class GHCreateRepositoryBuilder {
      * @param language
      *            template to base the ignore file on
      * @return a builder to continue with building See https://developer.github.com/v3/repos/#create
+     * @throws IOException
+     *             In case of any networking error or error from the server.
      */
-    public GHCreateRepositoryBuilder gitignoreTemplate(String language) {
-        this.builder.with("gitignore_template", language);
-        return this;
+    public GHCreateRepositoryBuilder gitignoreTemplate(String language) throws IOException {
+        return with("gitignore_template", language);
     }
 
     /**
@@ -183,10 +41,24 @@ public class GHCreateRepositoryBuilder {
      * @param license
      *            template to base the license file on
      * @return a builder to continue with building See https://developer.github.com/v3/repos/#create
+     * @throws IOException
+     *             In case of any networking error or error from the server.
      */
-    public GHCreateRepositoryBuilder licenseTemplate(String license) {
-        this.builder.with("license_template", license);
-        return this;
+    public GHCreateRepositoryBuilder licenseTemplate(String license) throws IOException {
+        return with("license_template", license);
+    }
+
+    /**
+     * If true, create an initial commit with empty README.
+     *
+     * @param enabled
+     *            true if enabled
+     * @return a builder to continue with building
+     * @throws IOException
+     *             In case of any networking error or error from the server.
+     */
+    public GHCreateRepositoryBuilder autoInit(boolean enabled) throws IOException {
+        return with("auto_init", enabled);
     }
 
     /**
@@ -195,10 +67,12 @@ public class GHCreateRepositoryBuilder {
      * @param team
      *            team to grant access to
      * @return a builder to continue with building
+     * @throws IOException
+     *             In case of any networking error or error from the server.
      */
-    public GHCreateRepositoryBuilder team(GHTeam team) {
+    public GHCreateRepositoryBuilder team(GHTeam team) throws IOException {
         if (team != null)
-            this.builder.with("team_id", team.getId());
+            return with("team_id", team.getId());
         return this;
     }
 
@@ -208,13 +82,13 @@ public class GHCreateRepositoryBuilder {
      * @param enabled
      *            true if enabled
      * @return a builder to continue with building
+     * @throws IOException
+     *             In case of any networking error or error from the server.
+     * @deprecated Use {@link #isTemplate(boolean)} method instead
      */
-    @Preview
     @Deprecated
-    public GHCreateRepositoryBuilder templateRepository(boolean enabled) {
-        this.builder.withPreview(BAPTISE);
-        this.builder.with("is_template", enabled);
-        return this;
+    public GHCreateRepositoryBuilder templateRepository(boolean enabled) throws IOException {
+        return isTemplate(enabled);
     }
 
     /**
@@ -223,14 +97,15 @@ public class GHCreateRepositoryBuilder {
      * @param owner
      *            organization or personage
      * @return a builder to continue with building
+     * @throws IOException
+     *             In case of any networking error or error from the server.
      */
-    public GHCreateRepositoryBuilder owner(String owner) {
-        this.builder.with("owner", owner);
-        return this;
+    public GHCreateRepositoryBuilder owner(String owner) throws IOException {
+        return with("owner", owner);
     }
 
     /**
-     * Create repository from template repository.
+     * Create repository from template repository
      *
      * @param templateOwner
      *            template repository owner
@@ -239,11 +114,10 @@ public class GHCreateRepositoryBuilder {
      * @return a builder to continue with building
      * @see <a href="https://developer.github.com/v3/previews/">GitHub API Previews</a>
      */
-    @Preview
+    @Preview(BAPTISTE)
     @Deprecated
     public GHCreateRepositoryBuilder fromTemplateRepository(String templateOwner, String templateRepo) {
-        this.builder.withPreview(BAPTISE);
-        this.apiUrlTail = "/repos/" + templateOwner + "/" + templateRepo + "/generate";
+        requester.withPreview(BAPTISTE).withUrlPath("/repos/" + templateOwner + "/" + templateRepo + "/generate");
         return this;
     }
 
@@ -252,10 +126,9 @@ public class GHCreateRepositoryBuilder {
      *
      * @return the gh repository
      * @throws IOException
-     *             if repsitory cannot be created
+     *             if repository cannot be created
      */
     public GHRepository create() throws IOException {
-        return builder.method("POST").withUrlPath(apiUrlTail).fetch(GHRepository.class).wrap(root);
+        return done();
     }
-
 }

src/main/java/org/kohsuke/github/GHDeployment.java

@@ -1,5 +1,7 @@
 package org.kohsuke.github;
 
+import org.kohsuke.github.internal.Previews;
+
 import java.io.IOException;
 import java.net.URL;
 import java.util.Map;
@@ -14,7 +16,6 @@ import java.util.Map;
  */
 public class GHDeployment extends GHObject {
     private GHRepository owner;
-    private GitHub root;
     protected String sha;
     protected String ref;
     protected String task;
@@ -24,6 +25,9 @@ public class GHDeployment extends GHObject {
     protected String statuses_url;
     protected String repository_url;
     protected GHUser creator;
+    protected String original_environment;
+    protected boolean transient_environment;
+    protected boolean production_environment;
 
     GHDeployment wrap(GHRepository owner) {
         this.owner = owner;
@@ -82,13 +86,26 @@ public class GHDeployment extends GHObject {
 
     /**
      * Gets payload without assuming its type. It could be a String or a Map.
-     * 
+     *
      * @return the payload
      */
     public Object getPayloadObject() {
         return payload;
     }
 
+    /**
+     * The environment defined when the deployment was first created.
+     *
+     * @deprecated until preview feature has graduated to stable
+     *
+     * @return the original deployment environment
+     */
+    @Deprecated
+    @Preview(Previews.FLASH)
+    public String getOriginalEnvironment() {
+        return original_environment;
+    }
+
     /**
      * Gets environment.
      *
@@ -98,6 +115,33 @@ public class GHDeployment extends GHObject {
         return environment;
     }
 
+    /**
+     * Specifies if the given environment is specific to the deployment and will no longer exist at some point in the
+     * future.
+     *
+     * @deprecated until preview feature has graduated to stable
+     *
+     * @return the environment is transient
+     */
+    @Deprecated
+    @Preview(Previews.ANT_MAN)
+    public boolean isTransientEnvironment() {
+        return transient_environment;
+    }
+
+    /**
+     * Specifies if the given environment is one that end-users directly interact with.
+     *
+     * @deprecated until preview feature has graduated to stable
+     *
+     * @return the environment is used by end-users directly
+     */
+    @Deprecated
+    @Preview(Previews.ANT_MAN)
+    public boolean isProductionEnvironment() {
+        return production_environment;
+    }
+
     /**
      * Gets creator.
      *
@@ -154,6 +198,8 @@ public class GHDeployment extends GHObject {
     public PagedIterable<GHDeploymentStatus> listStatuses() {
         return root.createRequest()
                 .withUrlPath(statuses_url)
+                .withPreview(Previews.ANT_MAN)
+                .withPreview(Previews.FLASH)
                 .toIterable(GHDeploymentStatus[].class, item -> item.wrap(owner));
     }
 

src/main/java/org/kohsuke/github/GHDeploymentBuilder.java

@@ -1,5 +1,7 @@
 package org.kohsuke.github;
 
+import org.kohsuke.github.internal.Previews;
+
 import java.io.IOException;
 import java.util.List;
 
@@ -19,7 +21,10 @@ public class GHDeploymentBuilder {
      */
     public GHDeploymentBuilder(GHRepository repo) {
         this.repo = repo;
-        this.builder = repo.root.createRequest().method("POST");
+        this.builder = repo.root.createRequest()
+                .withPreview(Previews.ANT_MAN)
+                .withPreview(Previews.FLASH)
+                .method("POST");
     }
 
     /**
@@ -40,6 +45,7 @@ public class GHDeploymentBuilder {
      *
      * @param branch
      *            the branch
+     *
      * @return the gh deployment builder
      */
     public GHDeploymentBuilder ref(String branch) {
@@ -52,6 +58,7 @@ public class GHDeploymentBuilder {
      *
      * @param task
      *            the task
+     *
      * @return the gh deployment builder
      */
     public GHDeploymentBuilder task(String task) {
@@ -64,6 +71,7 @@ public class GHDeploymentBuilder {
      *
      * @param autoMerge
      *            the auto merge
+     *
      * @return the gh deployment builder
      */
     public GHDeploymentBuilder autoMerge(boolean autoMerge) {
@@ -76,6 +84,7 @@ public class GHDeploymentBuilder {
      *
      * @param requiredContexts
      *            the required contexts
+     *
      * @return the gh deployment builder
      */
     public GHDeploymentBuilder requiredContexts(List<String> requiredContexts) {
@@ -88,6 +97,7 @@ public class GHDeploymentBuilder {
      *
      * @param payload
      *            the payload
+     *
      * @return the gh deployment builder
      */
     public GHDeploymentBuilder payload(String payload) {
@@ -100,6 +110,7 @@ public class GHDeploymentBuilder {
      *
      * @param environment
      *            the environment
+     *
      * @return the gh deployment builder
      */
     public GHDeploymentBuilder environment(String environment) {
@@ -107,11 +118,47 @@ public class GHDeploymentBuilder {
         return this;
     }
 
+    /**
+     * Specifies if the given environment is specific to the deployment and will no longer exist at some point in the
+     * future.
+     *
+     * @deprecated until preview feature has graduated to stable
+     *
+     * @param transientEnvironment
+     *            the environment is transient
+     *
+     * @return the gh deployment builder
+     */
+    @Deprecated
+    @Preview(Previews.ANT_MAN)
+    public GHDeploymentBuilder transientEnvironment(boolean transientEnvironment) {
+        builder.with("transient_environment", transientEnvironment);
+        return this;
+    }
+
+    /**
+     * Specifies if the given environment is one that end-users directly interact with.
+     *
+     * @deprecated until preview feature has graduated to stable
+     *
+     * @param productionEnvironment
+     *            the environment is used by end-users directly
+     *
+     * @return the gh deployment builder
+     */
+    @Deprecated
+    @Preview(Previews.ANT_MAN)
+    public GHDeploymentBuilder productionEnvironment(boolean productionEnvironment) {
+        builder.with("production_environment", productionEnvironment);
+        return this;
+    }
+
     /**
      * Description gh deployment builder.
      *
      * @param description
      *            the description
+     *
      * @return the gh deployment builder
      */
     public GHDeploymentBuilder description(String description) {
@@ -123,6 +170,7 @@ public class GHDeploymentBuilder {
      * Create gh deployment.
      *
      * @return the gh deployment
+     *
      * @throws IOException
      *             the io exception
      */

src/main/java/org/kohsuke/github/GHDeploymentState.java

@@ -1,8 +1,40 @@
 package org.kohsuke.github;
 
+import org.kohsuke.github.internal.Previews;
+
 /**
  * Represents the state of deployment
  */
 public enum GHDeploymentState {
-    PENDING, SUCCESS, ERROR, FAILURE
+    PENDING,
+    SUCCESS,
+    ERROR,
+    FAILURE,
+
+    /**
+     * The state of the deployment currently reflects it's in progress.
+     *
+     * @deprecated until preview feature has graduated to stable
+     */
+    @Deprecated
+    @Preview(Previews.FLASH)
+    IN_PROGRESS,
+
+    /**
+     * The state of the deployment currently reflects it's queued up for processing.
+     *
+     * @deprecated until preview feature has graduated to stable
+     */
+    @Deprecated
+    @Preview(Previews.FLASH)
+    QUEUED,
+
+    /**
+     * The state of the deployment currently reflects it's no longer active.
+     *
+     * @deprecated until preview feature has graduated to stable
+     */
+    @Deprecated
+    @Preview(Previews.ANT_MAN)
+    INACTIVE
 }

src/main/java/org/kohsuke/github/GHDeploymentStatus.java

@@ -1,5 +1,7 @@
 package org.kohsuke.github;
 
+import org.kohsuke.github.internal.Previews;
+
 import java.net.URL;
 import java.util.Locale;
 
@@ -8,19 +10,21 @@ import java.util.Locale;
  */
 public class GHDeploymentStatus extends GHObject {
     private GHRepository owner;
-    private GitHub root;
     protected GHUser creator;
     protected String state;
     protected String description;
     protected String target_url;
+    protected String log_url;
     protected String deployment_url;
     protected String repository_url;
+    protected String environment_url;
 
     /**
      * Wrap gh deployment status.
      *
      * @param owner
      *            the owner
+     *
      * @return the gh deployment status
      */
     public GHDeploymentStatus wrap(GHRepository owner) {
@@ -34,12 +38,30 @@ public class GHDeploymentStatus extends GHObject {
     /**
      * Gets target url.
      *
+     * @deprecated Target url is deprecated in favor of {@link #getLogUrl() getLogUrl}
+     *
      * @return the target url
      */
+    @Deprecated
     public URL getTargetUrl() {
         return GitHubClient.parseURL(target_url);
     }
 
+    /**
+     * Gets target url.
+     * <p>
+     * This method replaces {@link #getTargetUrl() getTargetUrl}}.
+     *
+     * @deprecated until preview feature has graduated to stable
+     *
+     * @return the target url
+     */
+    @Deprecated
+    @Preview(Previews.ANT_MAN)
+    public URL getLogUrl() {
+        return GitHubClient.parseURL(log_url);
+    }
+
     /**
      * Gets deployment url.
      *
@@ -49,6 +71,19 @@ public class GHDeploymentStatus extends GHObject {
         return GitHubClient.parseURL(deployment_url);
     }
 
+    /**
+     * Gets deployment environment url.
+     *
+     * @deprecated until preview feature has graduated to stable
+     *
+     * @return the deployment environment url
+     */
+    @Deprecated
+    @Preview(Previews.ANT_MAN)
+    public URL getEnvironmentUrl() {
+        return GitHubClient.parseURL(environment_url);
+    }
+
     /**
      * Gets repository url.
      *

src/main/java/org/kohsuke/github/GHDeploymentStatusBuilder.java

@@ -1,5 +1,7 @@
 package org.kohsuke.github;
 
+import org.kohsuke.github.internal.Previews;
+
 import java.io.IOException;
 
 /**
@@ -21,6 +23,7 @@ public class GHDeploymentStatusBuilder {
      *            the deployment id
      * @param state
      *            the state
+     *
      * @deprecated Use {@link GHDeployment#createStatus(GHDeploymentState)}
      */
     @Deprecated
@@ -31,15 +34,38 @@ public class GHDeploymentStatusBuilder {
     GHDeploymentStatusBuilder(GHRepository repo, long deploymentId, GHDeploymentState state) {
         this.repo = repo;
         this.deploymentId = deploymentId;
-        this.builder = repo.root.createRequest().method("POST");
+        this.builder = repo.root.createRequest()
+                .withPreview(Previews.ANT_MAN)
+                .withPreview(Previews.FLASH)
+                .method("POST");
+
         this.builder.with("state", state);
     }
 
+    /**
+     * Add an inactive status to all prior non-transient, non-production environment deployments with the same
+     * repository and environment name as the created status's deployment.
+     *
+     * @deprecated until preview feature has graduated to stable
+     *
+     * @param autoInactive
+     *            Add inactive status flag
+     *
+     * @return the gh deployment status builder
+     */
+    @Deprecated
+    @Preview({ Previews.ANT_MAN, Previews.FLASH })
+    public GHDeploymentStatusBuilder autoInactive(boolean autoInactive) {
+        this.builder.with("auto_inactive", autoInactive);
+        return this;
+    }
+
     /**
      * Description gh deployment status builder.
      *
      * @param description
      *            the description
+     *
      * @return the gh deployment status builder
      */
     public GHDeploymentStatusBuilder description(String description) {
@@ -47,13 +73,70 @@ public class GHDeploymentStatusBuilder {
         return this;
     }
 
+    /**
+     * Name for the target deployment environment, which can be changed when setting a deploy status.
+     *
+     * @deprecated until preview feature has graduated to stable
+     *
+     * @param environment
+     *            the environment name
+     *
+     * @return the gh deployment status builder
+     */
+    @Deprecated
+    @Preview(Previews.FLASH)
+    public GHDeploymentStatusBuilder environment(String environment) {
+        this.builder.with("environment", environment);
+        return this;
+    }
+
+    /**
+     * The URL for accessing the environment
+     *
+     * @deprecated until preview feature has graduated to stable
+     *
+     * @param environmentUrl
+     *            the environment url
+     *
+     * @return the gh deployment status builder
+     */
+    @Deprecated
+    @Preview(Previews.ANT_MAN)
+    public GHDeploymentStatusBuilder environmentUrl(String environmentUrl) {
+        this.builder.with("environment_url", environmentUrl);
+        return this;
+    }
+
+    /**
+     * The full URL of the deployment's output.
+     * <p>
+     * This method replaces {@link #targetUrl(String) targetUrl}.
+     *
+     * @deprecated until preview feature has graduated to stable
+     *
+     * @param logUrl
+     *            the deployment output url
+     *
+     * @return the gh deployment status builder
+     */
+    @Deprecated
+    @Preview(Previews.ANT_MAN)
+    public GHDeploymentStatusBuilder logUrl(String logUrl) {
+        this.builder.with("log_url", logUrl);
+        return this;
+    }
+
     /**
      * Target url gh deployment status builder.
      *
+     * @deprecated Target url is deprecated in favor of {@link #logUrl(String) logUrl}
+     *
      * @param targetUrl
      *            the target url
+     *
      * @return the gh deployment status builder
      */
+    @Deprecated
     public GHDeploymentStatusBuilder targetUrl(String targetUrl) {
         this.builder.with("target_url", targetUrl);
         return this;
@@ -63,6 +146,7 @@ public class GHDeploymentStatusBuilder {
      * Create gh deployment status.
      *
      * @return the gh deployment status
+     *
      * @throws IOException
      *             the io exception
      */

src/main/java/org/kohsuke/github/GHDiscussion.java

@@ -1,7 +1,7 @@
 package org.kohsuke.github;
 
-import com.fasterxml.jackson.annotation.JacksonInject;
 import com.fasterxml.jackson.annotation.JsonProperty;
+import org.kohsuke.github.internal.Previews;
 
 import java.io.IOException;
 import java.net.URL;
@@ -18,8 +18,6 @@ import javax.annotation.Nonnull;
  */
 public class GHDiscussion extends GHObject {
 
-    @JacksonInject
-    private GitHub root;
     private GHTeam team;
     private long number;
     private String body, title, htmlUrl;
@@ -130,7 +128,7 @@ public class GHDiscussion extends GHObject {
      *
      * @return a {@link GHDiscussion.Updater}
      */
-    @Preview
+    @Preview(Previews.SQUIRREL_GIRL)
     @Deprecated
     public GHDiscussion.Updater update() {
         return new GHDiscussion.Updater(this);
@@ -141,7 +139,7 @@ public class GHDiscussion extends GHObject {
      *
      * @return a {@link GHDiscussion.Setter}
      */
-    @Preview
+    @Preview(Previews.SQUIRREL_GIRL)
     @Deprecated
     public GHDiscussion.Setter set() {
         return new GHDiscussion.Setter(this);

src/main/java/org/kohsuke/github/GHEvent.java

@@ -12,6 +12,7 @@ import java.util.Locale;
 public enum GHEvent {
     CHECK_RUN,
     CHECK_SUITE,
+    CODE_SCANNING_ALERT,
     COMMIT_COMMENT,
     CONTENT_REFERENCE,
     CREATE,
@@ -19,6 +20,8 @@ public enum GHEvent {
     DEPLOY_KEY,
     DEPLOYMENT,
     DEPLOYMENT_STATUS,
+    DISCUSSION,
+    DISCUSSION_COMMENT,
     DOWNLOAD,
     FOLLOW,
     FORK,
@@ -56,6 +59,7 @@ public enum GHEvent {
     REPOSITORY,
     REPOSITORY_IMPORT,
     REPOSITORY_VULNERABILITY_ALERT,
+    SCHEDULE,
     SECURITY_ADVISORY,
     STAR,
     STATUS,
@@ -65,6 +69,11 @@ public enum GHEvent {
     WORKFLOW_DISPATCH,
     WORKFLOW_RUN,
 
+    /**
+     * Special event type that means we haven't found an enum value corresponding to the event.
+     */
+    UNKNOWN,
+
     /**
      * Special event type that means "every possible event"
      */

src/main/java/org/kohsuke/github/GHEventInfo.java

@@ -4,7 +4,7 @@ import com.fasterxml.jackson.databind.node.ObjectNode;
 import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
 
 import java.io.IOException;
-import java.util.Date;
+import java.util.*;
 
 /**
  * Represents an event.
@@ -12,14 +12,22 @@ import java.util.Date;
  * @author Kohsuke Kawaguchi
  */
 @SuppressFBWarnings(value = "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", justification = "JSON API")
-public class GHEventInfo {
-    private GitHub root;
-
+public class GHEventInfo extends GitHubInteractiveObject {
     // we don't want to expose Jackson dependency to the user. This needs databinding
     private ObjectNode payload;
 
     private long id;
     private String created_at;
+
+    /**
+     * Representation of GitHub Event API Event Type.
+     *
+     * This is not the same as the values used for hook methods such as
+     * {@link GHRepository#createHook(String, Map, Collection, boolean)}.
+     *
+     * @see <a href="https://docs.github.com/en/developers/webhooks-and-events/github-event-types">GitHub event
+     *      types</a>
+     */
     private String type;
 
     // these are all shallow objects
@@ -42,20 +50,45 @@ public class GHEventInfo {
         private String name; // owner/repo
     }
 
+    static final Map<String, GHEvent> mapTypeStringToEvent = createEventMap();
+
+    /**
+     * Map for GitHub Event API Event Type to GHEvent.
+     *
+     * @see <a href="https://docs.github.com/en/developers/webhooks-and-events/github-event-types">GitHub event
+     *      types</a>
+     */
+    private static Map<String, GHEvent> createEventMap() {
+        HashMap<String, GHEvent> map = new HashMap<>();
+        map.put("CommitCommentEvent", GHEvent.COMMIT_COMMENT);
+        map.put("CreateEvent", GHEvent.CREATE);
+        map.put("DeleteEvent", GHEvent.DELETE);
+        map.put("ForkEvent", GHEvent.FORK);
+        map.put("GollumEvent", GHEvent.GOLLUM);
+        map.put("IssueCommentEvent", GHEvent.ISSUE_COMMENT);
+        map.put("IssuesEvent", GHEvent.ISSUES);
+        map.put("MemberEvent", GHEvent.MEMBER);
+        map.put("PublicEvent", GHEvent.PUBLIC);
+        map.put("PullRequestEvent", GHEvent.PULL_REQUEST);
+        map.put("PullRequestReviewEvent", GHEvent.PULL_REQUEST_REVIEW);
+        map.put("PullRequestReviewCommentEvent", GHEvent.PULL_REQUEST_REVIEW_COMMENT);
+        map.put("PushEvent", GHEvent.PUSH);
+        map.put("ReleaseEvent", GHEvent.RELEASE);
+        map.put("WatchEvent", GHEvent.WATCH);
+        return Collections.unmodifiableMap(map);
+    }
+
+    static GHEvent transformTypeToGHEvent(String type) {
+        return mapTypeStringToEvent.getOrDefault(type, GHEvent.UNKNOWN);
+    }
+
     /**
      * Gets type.
      *
      * @return the type
      */
     public GHEvent getType() {
-        String t = type;
-        if (t.endsWith("Event"))
-            t = t.substring(0, t.length() - 5);
-        for (GHEvent e : GHEvent.values()) {
-            if (e.name().replace("_", "").equalsIgnoreCase(t))
-                return e;
-        }
-        return null; // unknown event type
+        return transformTypeToGHEvent(type);
     }
 
     GHEventInfo wrapUp(GitHub root) {

src/main/java/org/kohsuke/github/GHEventPayload.java

@@ -5,7 +5,9 @@ import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
 
 import java.io.IOException;
 import java.io.Reader;
+import java.util.Date;
 import java.util.List;
+import java.util.Map;
 
 /**
  * Base type for types used in databinding of the event payload.
@@ -17,9 +19,7 @@ import java.util.List;
  */
 @SuppressWarnings("UnusedDeclaration")
 @SuppressFBWarnings("UWF_UNWRITTEN_FIELD")
-public class GHEventPayload {
-    protected GitHub root;
-
+public class GHEventPayload extends GitHubInteractiveObject {
     // https://docs.github.com/en/free-pro-team@latest/developers/webhooks-and-events/webhook-events-and-payloads#webhook-payload-object-common-properties
     // Webhook payload object common properties: action, sender, repository, organization, installation
     private String action;
@@ -382,9 +382,9 @@ public class GHEventPayload {
         }
 
         /**
-         * Gets label.
+         * Gets the added or removed label for labeled/unlabeled events.
          *
-         * @return the label
+         * @return label the added or removed label
          */
         public GHLabel getLabel() {
             return label;
@@ -521,6 +521,10 @@ public class GHEventPayload {
     public static class Issue extends GHEventPayload {
         private GHIssue issue;
 
+        private GHLabel label;
+
+        private GHIssueChanges changes;
+
         /**
          * Gets issue.
          *
@@ -540,6 +544,24 @@ public class GHEventPayload {
             this.issue = issue;
         }
 
+        /**
+         * Gets the added or removed label for labeled/unlabeled events.
+         *
+         * @return label the added or removed label
+         */
+        public GHLabel getLabel() {
+            return label;
+        }
+
+        /**
+         * Get changes (for action="edited")
+         *
+         * @return changes
+         */
+        public GHIssueChanges getChanges() {
+            return changes;
+        }
+
         @Override
         void wrapUp(GitHub root) {
             super.wrapUp(root);
@@ -689,9 +711,11 @@ public class GHEventPayload {
         }
 
         /**
-         * Gets master branch.
+         * Gets default branch.
          *
-         * @return the master branch
+         * Name is an artifact of when "master" was the most common default.
+         *
+         * @return the default branch
          */
         @SuppressFBWarnings(value = "UWF_UNWRITTEN_FIELD", justification = "Comes from JSON deserialization")
         public String getMasterBranch() {
@@ -937,7 +961,7 @@ public class GHEventPayload {
         }
 
         /**
-         * The full Git ref that was pushed. Example: “refs/heads/master”
+         * The full Git ref that was pushed. Example: “refs/heads/main”
          *
          * @return the ref
          */
@@ -1069,7 +1093,7 @@ public class GHEventPayload {
         public static class PushCommit {
             private GitUser author;
             private GitUser committer;
-            private String url, sha, message;
+            private String url, sha, message, timestamp;
             private boolean distinct;
             private List<String> added, removed, modified;
 
@@ -1158,6 +1182,15 @@ public class GHEventPayload {
             public List<String> getModified() {
                 return modified;
             }
+
+            /**
+             * Obtains the timestamp of the commit
+             *
+             * @return the timestamp
+             */
+            public Date getTimestamp() {
+                return GitHubClient.parseDate(timestamp);
+            }
         }
     }
 
@@ -1216,19 +1249,29 @@ public class GHEventPayload {
         private String description;
         private GHCommitState state;
         private GHCommit commit;
+        private String targetUrl;
 
         /**
          * Gets the status content.
-         * 
+         *
          * @return status content
          */
         public String getContext() {
             return context;
         }
 
+        /**
+         * The optional link added to the status.
+         *
+         * @return a url
+         */
+        public String getTargetUrl() {
+            return targetUrl;
+        }
+
         /**
          * Gets the status description.
-         * 
+         *
          * @return status description
          */
         public String getDescription() {
@@ -1237,7 +1280,7 @@ public class GHEventPayload {
 
         /**
          * Gets the status state.
-         * 
+         *
          * @return status state
          */
         public GHCommitState getState() {
@@ -1246,7 +1289,7 @@ public class GHEventPayload {
 
         /**
          * Sets the status stage.
-         * 
+         *
          * @param state
          *            status state
          */
@@ -1256,7 +1299,7 @@ public class GHEventPayload {
 
         /**
          * Gets the commit associated with the status event.
-         * 
+         *
          * @return commit
          */
         public GHCommit getCommit() {
@@ -1265,7 +1308,7 @@ public class GHEventPayload {
 
         /**
          * Sets the commit associated with the status event.
-         * 
+         *
          * @param commit
          *            commit
          */
@@ -1286,4 +1329,125 @@ public class GHEventPayload {
             }
         }
     }
+
+    /**
+     * Occurs when someone triggered a workflow run or sends a POST request to the "Create a workflow dispatch event"
+     * endpoint.
+     *
+     * @see <a href=
+     *      "https://docs.github.com/en/developers/webhooks-and-events/webhook-events-and-payloads#workflow_dispatch">
+     *      workflow dispatch event</a>
+     * @see <a href=
+     *      "https://docs.github.com/en/actions/reference/events-that-trigger-workflows#workflow_dispatch">Events that
+     *      trigger workflows</a>
+     */
+    public static class WorkflowDispatch extends GHEventPayload {
+        private Map<String, Object> inputs;
+        private String ref;
+        private String workflow;
+
+        /**
+         * Gets the map of input parameters passed to the workflow.
+         *
+         * @return the map of input parameters
+         */
+        public Map<String, Object> getInputs() {
+            return inputs;
+        }
+
+        /**
+         * Gets the ref of the branch (e.g. refs/heads/main)
+         *
+         * @return the ref of the branch
+         */
+        public String getRef() {
+            return ref;
+        }
+
+        /**
+         * Gets the path of the workflow file (e.g. .github/workflows/hello-world-workflow.yml).
+         *
+         * @return the path of the workflow file
+         */
+        public String getWorkflow() {
+            return workflow;
+        }
+    }
+
+    /**
+     * A workflow run was requested or completed.
+     *
+     * @see <a href=
+     *      "https://docs.github.com/en/developers/webhooks-and-events/webhook-events-and-payloads#workflow_run">
+     *      workflow run event</a>
+     * @see <a href="https://docs.github.com/en/rest/reference/actions#workflow-runs">Actions Workflow Runs</a>
+     */
+    public static class WorkflowRun extends GHEventPayload {
+        private GHWorkflowRun workflowRun;
+        private GHWorkflow workflow;
+
+        /**
+         * Gets the workflow run.
+         *
+         * @return the workflow run
+         */
+        public GHWorkflowRun getWorkflowRun() {
+            return workflowRun;
+        }
+
+        /**
+         * Gets the associated workflow.
+         *
+         * @return the associated workflow
+         */
+        public GHWorkflow getWorkflow() {
+            return workflow;
+        }
+
+        @Override
+        void wrapUp(GitHub root) {
+            super.wrapUp(root);
+            if (workflowRun == null || workflow == null) {
+                throw new IllegalStateException(
+                        "Expected workflow and workflow_run payload, but got something else. Maybe we've got another type of event?");
+            }
+            GHRepository repository = getRepository();
+            if (repository == null) {
+                throw new IllegalStateException("Repository must not be null");
+            }
+            workflowRun.wrapUp(repository);
+            workflow.wrapUp(repository);
+        }
+    }
+
+    /**
+     * A label was created, edited or deleted.
+     *
+     * @see <a href= "https://docs.github.com/en/developers/webhooks-and-events/webhook-events-and-payloads#label">
+     *      label event</a>
+     */
+    public static class Label extends GHEventPayload {
+
+        private GHLabel label;
+
+        private GHLabelChanges changes;
+
+        /**
+         * Gets the label.
+         *
+         * @return the label
+         */
+        public GHLabel getLabel() {
+            return label;
+        }
+
+        /**
+         * Gets changes (for action="edited")
+         *
+         * @return changes
+         */
+        public GHLabelChanges getChanges() {
+            return changes;
+        }
+    }
 }

src/main/java/org/kohsuke/github/GHGist.java

@@ -23,7 +23,6 @@ import java.util.Map.Entry;
 public class GHGist extends GHObject {
 
     final GHUser owner;
-    final GitHub root;
 
     private String forks_url, commits_url, id, git_pull_url, git_push_url, html_url;
 
@@ -123,7 +122,7 @@ public class GHGist extends GHObject {
 
     /**
      * Get the html url.
-     * 
+     *
      * @return the github html url
      */
     public URL getHtmlUrl() {

src/main/java/org/kohsuke/github/GHGistBuilder.java

@@ -13,7 +13,6 @@ import javax.annotation.Nonnull;
  * @see GitHub#createGist() GitHub#createGist()
  */
 public class GHGistBuilder {
-    private final GitHub root;
     private final Requester req;
     private final LinkedHashMap<String, Object> files = new LinkedHashMap<String, Object>();
 
@@ -24,7 +23,6 @@ public class GHGistBuilder {
      *            the root
      */
     public GHGistBuilder(GitHub root) {
-        this.root = root;
         req = root.createRequest().method("POST");
     }
 

src/main/java/org/kohsuke/github/GHHook.java

@@ -1,13 +1,13 @@
 package org.kohsuke.github;
 
 import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
+import org.kohsuke.github.internal.EnumUtils;
 
 import java.io.IOException;
 import java.net.URL;
 import java.util.Collections;
 import java.util.EnumSet;
 import java.util.List;
-import java.util.Locale;
 import java.util.Map;
 
 /**
@@ -40,10 +40,7 @@ public abstract class GHHook extends GHObject {
     public EnumSet<GHEvent> getEvents() {
         EnumSet<GHEvent> s = EnumSet.noneOf(GHEvent.class);
         for (String e : events) {
-            if (e.equals("*"))
-                s.add(GHEvent.ALL);
-            else
-                s.add(Enum.valueOf(GHEvent.class, e.toUpperCase(Locale.ENGLISH)));
+            s.add(e.equals("*") ? GHEvent.ALL : EnumUtils.getEnumOrDefault(GHEvent.class, e, GHEvent.UNKNOWN));
         }
         return s;
     }

src/main/java/org/kohsuke/github/GHHooks.java

@@ -12,8 +12,7 @@ import java.util.Map;
  * functionality
  */
 class GHHooks {
-    static abstract class Context {
-        private final GitHub root;
+    static abstract class Context extends GitHubInteractiveObject {
 
         private Context(GitHub root) {
             this.root = root;

src/main/java/org/kohsuke/github/GHInvitation.java

@@ -16,7 +16,6 @@ import java.net.URL;
                 "UUF_UNUSED_FIELD" },
         justification = "JSON API")
 public class GHInvitation extends GHObject {
-    /* package almost final */ GitHub root;
 
     private int id;
     private GHRepository repository;

src/main/java/org/kohsuke/github/GHIssue.java

@@ -39,7 +39,7 @@ import java.util.List;
 import java.util.Locale;
 import java.util.Objects;
 
-import static org.kohsuke.github.Previews.SQUIRREL_GIRL;
+import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
 
 /**
  * Represents an issue on GitHub.
@@ -53,7 +53,6 @@ import static org.kohsuke.github.Previews.SQUIRREL_GIRL;
 public class GHIssue extends GHObject implements Reactable {
     private static final String ASSIGNEES = "assignees";
 
-    GitHub root;
     GHRepository owner;
 
     // API v3
@@ -313,7 +312,7 @@ public class GHIssue extends GHObject implements Reactable {
     }
 
     /**
-     * Sets labels.
+     * Sets labels on the target to a specific list.
      *
      * @param labels
      *            the labels
@@ -327,100 +326,137 @@ public class GHIssue extends GHObject implements Reactable {
     /**
      * Adds labels to the issue.
      *
+     * Labels that are already present on the target are ignored.
+     *
+     * @return the complete list of labels including the new additions
      * @param names
      *            Names of the label
      * @throws IOException
      *             the io exception
      */
-    public void addLabels(String... names) throws IOException {
-        _addLabels(Arrays.asList(names));
+    @WithBridgeMethods(void.class)
+    public List<GHLabel> addLabels(String... names) throws IOException {
+        return _addLabels(Arrays.asList(names));
     }
 
     /**
      * Add labels.
      *
+     * Labels that are already present on the target are ignored.
+     *
+     * @return the complete list of labels including the new additions
      * @param labels
      *            the labels
      * @throws IOException
      *             the io exception
      */
-    public void addLabels(GHLabel... labels) throws IOException {
-        addLabels(Arrays.asList(labels));
+    @WithBridgeMethods(void.class)
+    public List<GHLabel> addLabels(GHLabel... labels) throws IOException {
+        return addLabels(Arrays.asList(labels));
     }
 
     /**
      * Add labels.
      *
+     * Labels that are already present on the target are ignored.
+     *
+     * @return the complete list of labels including the new additions
      * @param labels
      *            the labels
      * @throws IOException
      *             the io exception
      */
-    public void addLabels(Collection<GHLabel> labels) throws IOException {
-        _addLabels(GHLabel.toNames(labels));
+    @WithBridgeMethods(void.class)
+    public List<GHLabel> addLabels(Collection<GHLabel> labels) throws IOException {
+        return _addLabels(GHLabel.toNames(labels));
     }
 
-    private void _addLabels(Collection<String> names) throws IOException {
-        List<String> newLabels = new ArrayList<String>();
-
-        for (GHLabel label : getLabels()) {
-            newLabels.add(label.getName());
-        }
-        for (String name : names) {
-            if (!newLabels.contains(name)) {
-                newLabels.add(name);
-            }
-        }
-        setLabels(newLabels.toArray(new String[0]));
+    private List<GHLabel> _addLabels(Collection<String> names) throws IOException {
+        return Arrays.asList(root.createRequest()
+                .with("labels", names)
+                .method("POST")
+                .withUrlPath(getIssuesApiRoute() + "/labels")
+                .fetch(GHLabel[].class));
     }
 
     /**
-     * Remove a given label by name from this issue.
+     * Remove a single label.
      *
+     * Attempting to remove a label that is not present throws {@link GHFileNotFoundException}.
+     *
+     * @return the remaining list of labels
+     * @param name
+     *            the name
+     * @throws IOException
+     *             the io exception, throws {@link GHFileNotFoundException} if label was not present.
+     */
+    @WithBridgeMethods(void.class)
+    public List<GHLabel> removeLabel(String name) throws IOException {
+        return Arrays.asList(root.createRequest()
+                .method("DELETE")
+                .withUrlPath(getIssuesApiRoute() + "/labels", name)
+                .fetch(GHLabel[].class));
+    }
+
+    /**
+     * Remove a collection of labels.
+     *
+     * Attempting to remove labels that are not present on the target are ignored.
+     *
+     * @return the remaining list of labels
      * @param names
      *            the names
      * @throws IOException
      *             the io exception
      */
-    public void removeLabels(String... names) throws IOException {
-        _removeLabels(Arrays.asList(names));
+    @WithBridgeMethods(void.class)
+    public List<GHLabel> removeLabels(String... names) throws IOException {
+        return _removeLabels(Arrays.asList(names));
     }
 
     /**
-     * Remove labels.
+     * Remove a collection of labels.
      *
+     * Attempting to remove labels that are not present on the target are ignored.
+     *
+     * @return the remaining list of labels
      * @param labels
      *            the labels
      * @throws IOException
      *             the io exception
      * @see #removeLabels(String...) #removeLabels(String...)
      */
-    public void removeLabels(GHLabel... labels) throws IOException {
-        removeLabels(Arrays.asList(labels));
+    @WithBridgeMethods(void.class)
+    public List<GHLabel> removeLabels(GHLabel... labels) throws IOException {
+        return removeLabels(Arrays.asList(labels));
     }
 
     /**
-     * Remove labels.
+     * Remove a collection of labels.
      *
+     * Attempting to remove labels that are not present on the target are ignored.
+     *
+     * @return the remaining list of labels
      * @param labels
      *            the labels
      * @throws IOException
      *             the io exception
      */
-    public void removeLabels(Collection<GHLabel> labels) throws IOException {
-        _removeLabels(GHLabel.toNames(labels));
+    @WithBridgeMethods(void.class)
+    public List<GHLabel> removeLabels(Collection<GHLabel> labels) throws IOException {
+        return _removeLabels(GHLabel.toNames(labels));
     }
 
-    private void _removeLabels(Collection<String> names) throws IOException {
-        List<String> newLabels = new ArrayList<String>();
-
-        for (GHLabel l : getLabels()) {
-            if (!names.contains(l.getName())) {
-                newLabels.add(l.getName());
+    private List<GHLabel> _removeLabels(Collection<String> names) throws IOException {
+        List<GHLabel> remainingLabels = Collections.emptyList();
+        for (String name : names) {
+            try {
+                remainingLabels = removeLabel(name);
+            } catch (GHFileNotFoundException e) {
+                // when trying to remove multiple labels, we ignore already removed
             }
         }
-
-        setLabels(newLabels.toArray(new String[0]));
+        return remainingLabels;
     }
 
     /**
@@ -448,7 +484,7 @@ public class GHIssue extends GHObject implements Reactable {
                 .toIterable(GHIssueComment[].class, item -> item.wrapUp(this));
     }
 
-    @Preview
+    @Preview(SQUIRREL_GIRL)
     @Deprecated
     public GHReaction createReaction(ReactionContent content) throws IOException {
         return root.createRequest()
@@ -460,7 +496,7 @@ public class GHIssue extends GHObject implements Reactable {
                 .wrap(root);
     }
 
-    @Preview
+    @Preview(SQUIRREL_GIRL)
     @Deprecated
     public PagedIterable<GHReaction> listReactions() {
         return root.createRequest()

src/main/java/org/kohsuke/github/GHIssueChanges.java

@@ -0,0 +1,49 @@
+package org.kohsuke.github;
+
+import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
+
+/**
+ * Wrapper to define changed fields on issues action="edited"
+ *
+ * @see GHEventPayload.Issue
+ */
+@SuppressFBWarnings("UWF_UNWRITTEN_FIELD")
+public class GHIssueChanges {
+
+    private GHFrom title;
+    private GHFrom body;
+
+    /**
+     * Old issue title.
+     *
+     * @return old issue title (or null if not changed)
+     */
+    public GHFrom getTitle() {
+        return title;
+    }
+
+    /**
+     * Old issue body.
+     *
+     * @return old issue body (or null if not changed)
+     */
+    public GHFrom getBody() {
+        return body;
+    }
+
+    /**
+     * Wrapper for changed values.
+     */
+    public static class GHFrom {
+        private String from;
+
+        /**
+         * Previous value that was changed.
+         *
+         * @return previous value
+         */
+        public String getFrom() {
+            return from;
+        }
+    }
+}

src/main/java/org/kohsuke/github/GHIssueComment.java

@@ -26,7 +26,7 @@ package org.kohsuke.github;
 import java.io.IOException;
 import java.net.URL;
 
-import static org.kohsuke.github.Previews.*;
+import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
 
 /**
  * Comment to the issue
@@ -126,7 +126,7 @@ public class GHIssueComment extends GHObject implements Reactable {
         owner.root.createRequest().method("DELETE").withUrlPath(getApiRoute()).send();
     }
 
-    @Preview
+    @Preview(SQUIRREL_GIRL)
     @Deprecated
     public GHReaction createReaction(ReactionContent content) throws IOException {
         return owner.root.createRequest()
@@ -138,7 +138,7 @@ public class GHIssueComment extends GHObject implements Reactable {
                 .wrap(owner.root);
     }
 
-    @Preview
+    @Preview(SQUIRREL_GIRL)
     @Deprecated
     public PagedIterable<GHReaction> listReactions() {
         return owner.root.createRequest()

src/main/java/org/kohsuke/github/GHIssueEvent.java

@@ -9,9 +9,7 @@ import java.util.Date;
  *
  * @author Martin van Zijl
  */
-public class GHIssueEvent {
-    private GitHub root;
-
+public class GHIssueEvent extends GitHubInteractiveObject {
     private long id;
     private String node_id;
     private String url;

src/main/java/org/kohsuke/github/GHIssueState.java

@@ -31,4 +31,4 @@ package org.kohsuke.github;
  */
 public enum GHIssueState {
     OPEN, CLOSED, ALL
-}
+}

src/main/java/org/kohsuke/github/GHKey.java

@@ -9,9 +9,7 @@ import org.apache.commons.lang3.builder.ToStringBuilder;
  * @author Kohsuke Kawaguchi
  */
 @SuppressFBWarnings(value = "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", justification = "JSON API")
-public class GHKey {
-    /* package almost final */ GitHub root;
-
+public class GHKey extends GitHubInteractiveObject {
     protected String url, key, title;
     protected boolean verified;
     protected int id;

src/main/java/org/kohsuke/github/GHLabel.java

@@ -2,6 +2,7 @@ package org.kohsuke.github;
 
 import com.fasterxml.jackson.annotation.JacksonInject;
 import com.fasterxml.jackson.annotation.JsonCreator;
+import com.fasterxml.jackson.annotation.JsonProperty;
 
 import java.io.IOException;
 import java.util.ArrayList;
@@ -20,7 +21,12 @@ import javax.annotation.Nonnull;
  * @see GHIssue#getLabels() GHIssue#getLabels()
  * @see GHRepository#listLabels() GHRepository#listLabels()
  */
-public class GHLabel {
+public class GHLabel extends GitHubInteractiveObject {
+
+    private long id;
+    private String nodeId;
+    @JsonProperty("default")
+    private boolean default_;
 
     @Nonnull
     private String url, name, color;
@@ -28,9 +34,6 @@ public class GHLabel {
     @CheckForNull
     private String description;
 
-    @Nonnull
-    private final GitHub root;
-
     @JsonCreator
     private GHLabel(@JacksonInject @Nonnull GitHub root) {
         this.root = root;
@@ -45,6 +48,24 @@ public class GHLabel {
         return Objects.requireNonNull(root);
     }
 
+    /**
+     * Gets id.
+     *
+     * @return the id
+     */
+    public long getId() {
+        return id;
+    }
+
+    /**
+     * Gets node id.
+     *
+     * @return the node id.
+     */
+    public String getNodeId() {
+        return nodeId;
+    }
+
     /**
      * Gets url.
      *
@@ -85,6 +106,15 @@ public class GHLabel {
         return description;
     }
 
+    /**
+     * If the label is one of the default labels created by GitHub automatically.
+     *
+     * @return true if the label is a default one
+     */
+    public boolean isDefault() {
+        return default_;
+    }
+
     /**
      * Sets color.
      *
@@ -132,7 +162,7 @@ public class GHLabel {
      * @throws IOException
      *             the io exception
      */
-    @Preview
+    @BetaApi
     @Deprecated
     static Creator create(GHRepository repository) throws IOException {
         return new Creator(repository);
@@ -179,7 +209,7 @@ public class GHLabel {
      *
      * @return a {@link Updater}
      */
-    @Preview
+    @BetaApi
     @Deprecated
     public Updater update() {
         return new Updater(this);
@@ -187,10 +217,10 @@ public class GHLabel {
 
     /**
      * Begins a single property update.
-     * 
+     *
      * @return a {@link Setter}
      */
-    @Preview
+    @BetaApi
     @Deprecated
     public Setter set() {
         return new Setter(this);
@@ -227,7 +257,7 @@ public class GHLabel {
      *
      * {@link #done()} is called automatically after the property is set.
      */
-    @Preview
+    @BetaApi
     @Deprecated
     public static class Setter extends GHLabelBuilder<GHLabel> {
         private Setter(@Nonnull GHLabel base) {
@@ -241,7 +271,7 @@ public class GHLabel {
      *
      * Consumer must call {@link #done()} to commit changes.
      */
-    @Preview
+    @BetaApi
     @Deprecated
     public static class Updater extends GHLabelBuilder<Updater> {
         private Updater(@Nonnull GHLabel base) {
@@ -255,7 +285,7 @@ public class GHLabel {
      *
      * Consumer must call {@link #done()} to create the new instance.
      */
-    @Preview
+    @BetaApi
     @Deprecated
     public static class Creator extends GHLabelBuilder<Creator> {
         private Creator(@Nonnull GHRepository repository) {

src/main/java/org/kohsuke/github/GHLabelBuilder.java

@@ -38,21 +38,21 @@ class GHLabelBuilder<S> extends AbstractBuilder<GHLabel, S> {
     }
 
     @Nonnull
-    @Preview
+    @BetaApi
     @Deprecated
     public S name(String value) throws IOException {
         return with("name", value);
     }
 
     @Nonnull
-    @Preview
+    @BetaApi
     @Deprecated
     public S color(String value) throws IOException {
         return with("color", value);
     }
 
     @Nonnull
-    @Preview
+    @BetaApi
     @Deprecated
     public S description(String value) throws IOException {
         return with("description", value);

src/main/java/org/kohsuke/github/GHLabelChanges.java

@@ -0,0 +1,49 @@
+package org.kohsuke.github;
+
+import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
+
+/**
+ * Wrapper to define changed fields on label action="edited"
+ *
+ * @see GHEventPayload.Label
+ */
+@SuppressFBWarnings("UWF_UNWRITTEN_FIELD")
+public class GHLabelChanges {
+
+    private GHFrom name;
+    private GHFrom color;
+
+    /**
+     * Old label name.
+     *
+     * @return old label name (or null if not changed)
+     */
+    public GHFrom getName() {
+        return name;
+    }
+
+    /**
+     * Old label color.
+     *
+     * @return old label color (or null if not changed)
+     */
+    public GHFrom getColor() {
+        return color;
+    }
+
+    /**
+     * Wrapper for changed values.
+     */
+    public static class GHFrom {
+        private String from;
+
+        /**
+         * Previous value that was changed.
+         *
+         * @return previous value
+         */
+        public String getFrom() {
+            return from;
+        }
+    }
+}

src/main/java/org/kohsuke/github/GHLicense.java

@@ -44,9 +44,6 @@ import java.util.Objects;
 @SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
         justification = "JSON API")
 public class GHLicense extends GHObject {
-    @SuppressFBWarnings("IS2_INCONSISTENT_SYNC")
-    // root is set before the object is returned to the app
-    /* package almost final */ GitHub root;
 
     // these fields are always present, even in the short form
     protected String key, name;

src/main/java/org/kohsuke/github/GHMarketplaceAccount.java

@@ -9,9 +9,7 @@ import java.net.URL;
  * @see GitHub#getMyMarketplacePurchases()
  * @see GHMarketplaceListAccountBuilder#createRequest()
  */
-public class GHMarketplaceAccount {
-
-    protected GitHub root;
+public class GHMarketplaceAccount extends GitHubInteractiveObject {
     private String url;
     private long id;
     private String login;

src/main/java/org/kohsuke/github/GHMarketplaceListAccountBuilder.java

@@ -8,8 +8,7 @@ import java.io.IOException;
  * @author Paulo Miguel Almeida
  * @see GHMarketplacePlan#listAccounts()
  */
-public class GHMarketplaceListAccountBuilder {
-    private final GitHub root;
+public class GHMarketplaceListAccountBuilder extends GitHubInteractiveObject {
     private final Requester builder;
     private final long planId;
 

src/main/java/org/kohsuke/github/GHMarketplacePendingChange.java

@@ -10,8 +10,7 @@ import java.util.Date;
  * @author Paulo Miguel Almeida
  * @see GHMarketplaceListAccountBuilder#createRequest()
  */
-public class GHMarketplacePendingChange {
-    private GitHub root;
+public class GHMarketplacePendingChange extends GitHubInteractiveObject {
     private long id;
     @SuppressFBWarnings(value = "UWF_UNWRITTEN_FIELD", justification = "Field comes from JSON deserialization")
     private Long unitCount;

src/main/java/org/kohsuke/github/GHMarketplacePlan.java

@@ -11,9 +11,7 @@ import java.util.List;
  * @author Paulo Miguel Almeida
  * @see GitHub#listMarketplacePlans()
  */
-public class GHMarketplacePlan {
-
-    private GitHub root;
+public class GHMarketplacePlan extends GitHubInteractiveObject {
     private String url;
     private String accountsUrl;
     private long id;

src/main/java/org/kohsuke/github/GHMarketplacePurchase.java

@@ -10,9 +10,8 @@ import java.util.Date;
  * @author Paulo Miguel Almeida
  * @see GHMarketplaceListAccountBuilder#createRequest() GHMarketplaceListAccountBuilder#createRequest()
  */
-public class GHMarketplacePurchase {
+public class GHMarketplacePurchase extends GitHubInteractiveObject {
 
-    private GitHub root;
     private String billingCycle;
     private String nextBillingDate;
     private boolean onFreeTrial;

src/main/java/org/kohsuke/github/GHMarketplaceUserPurchase.java

@@ -10,8 +10,7 @@ import java.util.Date;
  * @author Paulo Miguel Almeida
  * @see GitHub#getMyMarketplacePurchases()
  */
-public class GHMarketplaceUserPurchase {
-    protected GitHub root;
+public class GHMarketplaceUserPurchase extends GitHubInteractiveObject {
     private String billingCycle;
     private String nextBillingDate;
     private boolean onFreeTrial;

src/main/java/org/kohsuke/github/GHMembership.java

@@ -10,9 +10,7 @@ import java.util.Locale;
  * @author Kohsuke Kawaguchi
  * @see GHMyself#listOrgMemberships() GHMyself#listOrgMemberships()
  */
-public class GHMembership /* extends GHObject --- but it doesn't have id, created_at, etc. */ {
-    GitHub root;
-
+public class GHMembership extends GitHubInteractiveObject {
     String url;
     String state;
     String role;

src/main/java/org/kohsuke/github/GHMeta.java

@@ -23,6 +23,9 @@ public class GHMeta {
     private List<String> api;
     private List<String> pages;
     private List<String> importer = new ArrayList<>();
+    private List<String> packages;
+    private List<String> actions;
+    private List<String> dependabot;
 
     /**
      * Is verifiable password authentication boolean.
@@ -86,4 +89,31 @@ public class GHMeta {
     public List<String> getImporter() {
         return Collections.unmodifiableList(importer);
     }
+
+    /**
+     * Gets package.
+     *
+     * @return the package
+     */
+    public List<String> getPackages() {
+        return Collections.unmodifiableList(packages);
+    }
+
+    /**
+     * Gets actions.
+     *
+     * @return the actions
+     */
+    public List<String> getActions() {
+        return Collections.unmodifiableList(actions);
+    }
+
+    /**
+     * Gets dependabot.
+     *
+     * @return the dependabot
+     */
+    public List<String> getDependabot() {
+        return Collections.unmodifiableList(dependabot);
+    }
 }

src/main/java/org/kohsuke/github/GHMilestone.java

@@ -11,7 +11,6 @@ import java.util.Locale;
  * @author Yusuke Kokubo
  */
 public class GHMilestone extends GHObject {
-    GitHub root;
     GHRepository owner;
 
     GHUser creator;

src/main/java/org/kohsuke/github/GHMilestoneState.java

@@ -7,4 +7,4 @@ package org.kohsuke.github;
  */
 public enum GHMilestoneState {
     OPEN, CLOSED
-}
+}

src/main/java/org/kohsuke/github/GHNotificationStream.java

@@ -23,9 +23,7 @@ import java.util.NoSuchElementException;
  * @see GitHub#listNotifications() GitHub#listNotifications()
  * @see GHRepository#listNotifications() GHRepository#listNotifications()
  */
-public class GHNotificationStream implements Iterable<GHThread> {
-    private final GitHub root;
-
+public class GHNotificationStream extends GitHubInteractiveObject implements Iterable<GHThread> {
     private Boolean all, participating;
     private String since;
     private String apiUrl;

src/main/java/org/kohsuke/github/GHObject.java

@@ -20,7 +20,7 @@ import javax.annotation.CheckForNull;
  */
 @SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
         justification = "JSON API")
-public abstract class GHObject {
+public abstract class GHObject extends GitHubInteractiveObject {
     /**
      * Capture response HTTP headers on the state object.
      */
@@ -38,7 +38,7 @@ public abstract class GHObject {
 
     /**
      * Called by Jackson
-     * 
+     *
      * @param responseInfo
      *            the {@link GitHubResponse.ResponseInfo} to get headers from.
      */

src/main/java/org/kohsuke/github/GHOrganization.java

@@ -10,7 +10,7 @@ import java.util.List;
 import java.util.Map;
 import java.util.TreeMap;
 
-import static org.kohsuke.github.Previews.INERTIA;
+import static org.kohsuke.github.internal.Previews.INERTIA;
 
 /**
  * The type GHOrganization.
@@ -18,6 +18,9 @@ import static org.kohsuke.github.Previews.INERTIA;
  * @author Kohsuke Kawaguchi
  */
 public class GHOrganization extends GHPerson {
+
+    private boolean has_organization_projects;
+
     GHOrganization wrapUp(GitHub root) {
         return (GHOrganization) super.wrapUp(root);
     }
@@ -97,7 +100,7 @@ public class GHOrganization extends GHPerson {
      * @return the gh create repository builder
      */
     public GHCreateRepositoryBuilder createRepository(String name) {
-        return new GHCreateRepositoryBuilder(root, "/orgs/" + login + "/repos", name);
+        return new GHCreateRepositoryBuilder(name, root, "/orgs/" + login + "/repos");
     }
 
     /**
@@ -181,7 +184,7 @@ public class GHOrganization extends GHPerson {
 
     /**
      * Finds a team that has the given slug in its {@link GHTeam#getSlug()}
-     * 
+     *
      * @param slug
      *            the slug
      * @return the team by slug
@@ -367,6 +370,35 @@ public class GHOrganization extends GHPerson {
         root.createRequest().method("DELETE").withUrlPath("/orgs/" + login + "/public_members/" + u.getLogin()).send();
     }
 
+    /**
+     * Are projects enabled for organization boolean.
+     *
+     * @return the boolean
+     */
+    public boolean areOrganizationProjectsEnabled() {
+        return has_organization_projects;
+    }
+
+    /**
+     * Sets organization projects enabled status boolean
+     *
+     * @param newStatus
+     *            enable status
+     * @throws IOException
+     *             the io exception
+     */
+    public void enableOrganizationProjects(boolean newStatus) throws IOException {
+        edit("has_organization_projects", newStatus);
+    }
+
+    private void edit(String key, Object value) throws IOException {
+        root.createRequest()
+                .withUrlPath(String.format("/orgs/%s", login))
+                .method("PATCH")
+                .with(key, value)
+                .fetchInto(this);
+    }
+
     /**
      * Returns the projects for this organization.
      *

src/main/java/org/kohsuke/github/GHPermission.java

@@ -28,7 +28,7 @@ import java.util.Locale;
 
 /**
  * Permission for a user in a repository.
- * 
+ *
  * @see <a href="https://developer.github.com/v3/repos/collaborators/#review-a-users-permission-level">API</a>
  */
 class GHPermission {

src/main/java/org/kohsuke/github/GHPerson.java

@@ -18,7 +18,6 @@ import java.util.TreeMap;
  * @author Kohsuke Kawaguchi
  */
 public abstract class GHPerson extends GHObject {
-    /* package almost final */ GitHub root;
 
     // core data fields that exist even for "small" user data (such as the user info in pull request)
     protected String login, avatar_url;
@@ -236,7 +235,7 @@ public abstract class GHPerson extends GHObject {
 
     /**
      * Gets the Twitter Username of this user, like "GitHub"
-     * 
+     *
      * @return the Twitter username
      * @throws IOException
      *             the io exception

src/main/java/org/kohsuke/github/GHProject.java

@@ -28,7 +28,7 @@ import java.io.IOException;
 import java.net.URL;
 import java.util.Locale;
 
-import static org.kohsuke.github.Previews.INERTIA;
+import static org.kohsuke.github.internal.Previews.INERTIA;
 
 /**
  * A GitHub project.
@@ -37,7 +37,6 @@ import static org.kohsuke.github.Previews.INERTIA;
  * @see <a href="https://developer.github.com/v3/projects/">Projects</a>
  */
 public class GHProject extends GHObject {
-    protected GitHub root;
     protected GHObject owner;
 
     private String owner_url;
@@ -311,4 +310,4 @@ public class GHProject extends GHObject {
                 .fetch(GHProjectColumn.class)
                 .wrap(this);
     }
-}
+}

src/main/java/org/kohsuke/github/GHProjectCard.java

@@ -6,7 +6,7 @@ import java.io.FileNotFoundException;
 import java.io.IOException;
 import java.net.URL;
 
-import static org.kohsuke.github.Previews.INERTIA;
+import static org.kohsuke.github.internal.Previews.INERTIA;
 
 /**
  * The type GHProjectCard.
@@ -14,7 +14,6 @@ import static org.kohsuke.github.Previews.INERTIA;
  * @author Gunnar Skjold
  */
 public class GHProjectCard extends GHObject {
-    private GitHub root;
     private GHProject project;
     private GHProjectColumn column;
 

src/main/java/org/kohsuke/github/GHProjectColumn.java

@@ -4,7 +4,7 @@ import java.io.FileNotFoundException;
 import java.io.IOException;
 import java.net.URL;
 
-import static org.kohsuke.github.Previews.INERTIA;
+import static org.kohsuke.github.internal.Previews.INERTIA;
 
 /**
  * The type GHProjectColumn.
@@ -12,7 +12,6 @@ import static org.kohsuke.github.Previews.INERTIA;
  * @author Gunnar Skjold
  */
 public class GHProjectColumn extends GHObject {
-    protected GitHub root;
     protected GHProject project;
 
     private String name;

src/main/java/org/kohsuke/github/GHPullRequest.java

@@ -36,8 +36,8 @@ import java.util.Objects;
 
 import javax.annotation.CheckForNull;
 
-import static org.kohsuke.github.Previews.LYDIAN;
-import static org.kohsuke.github.Previews.SHADOW_CAT;
+import static org.kohsuke.github.internal.Previews.LYDIAN;
+import static org.kohsuke.github.internal.Previews.SHADOW_CAT;
 
 /**
  * A pull request.
@@ -576,7 +576,7 @@ public class GHPullRequest extends GHIssue implements Refreshable {
      * @throws IOException
      *             the io exception
      */
-    @Preview
+    @Preview(LYDIAN)
     @Deprecated
     public void updateBranch() throws IOException {
         root.createRequest()

src/main/java/org/kohsuke/github/GHPullRequestQueryBuilder.java

@@ -1,6 +1,6 @@
 package org.kohsuke.github;
 
-import static org.kohsuke.github.Previews.SHADOW_CAT;
+import static org.kohsuke.github.internal.Previews.SHADOW_CAT;
 
 /**
  * Lists up pull requests with some filtering and sorting.

src/main/java/org/kohsuke/github/GHPullRequestReviewComment.java

@@ -28,7 +28,7 @@ import java.net.URL;
 
 import javax.annotation.CheckForNull;
 
-import static org.kohsuke.github.Previews.*;
+import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
 
 /**
  * Review comment to the pull request
@@ -153,7 +153,20 @@ public class GHPullRequestReviewComment extends GHObject implements Reactable {
      * @return the api route
      */
     protected String getApiRoute() {
-        return "/repos/" + owner.getRepository().getFullName() + "/pulls/comments/" + getId();
+        return getApiRoute(false);
+    }
+
+    /**
+     * Gets api route.
+     *
+     * @param includePullNumber
+     *            if true, includes the owning pull request's number in the route.
+     *
+     * @return the api route
+     */
+    protected String getApiRoute(boolean includePullNumber) {
+        return "/repos/" + owner.getRepository().getFullName() + "/pulls"
+                + (includePullNumber ? "/" + owner.getNumber() : "") + "/comments/" + getId();
     }
 
     /**
@@ -192,13 +205,12 @@ public class GHPullRequestReviewComment extends GHObject implements Reactable {
         return owner.root.createRequest()
                 .method("POST")
                 .with("body", body)
-                .with("in_reply_to", getId())
-                .withUrlPath(getApiRoute() + "/comments")
+                .withUrlPath(getApiRoute(true) + "/replies")
                 .fetch(GHPullRequestReviewComment.class)
                 .wrapUp(owner);
     }
 
-    @Preview
+    @Preview(SQUIRREL_GIRL)
     @Deprecated
     public GHReaction createReaction(ReactionContent content) throws IOException {
         return owner.root.createRequest()
@@ -210,7 +222,7 @@ public class GHPullRequestReviewComment extends GHObject implements Reactable {
                 .wrap(owner.root);
     }
 
-    @Preview
+    @Preview(SQUIRREL_GIRL)
     @Deprecated
     public PagedIterable<GHReaction> listReactions() {
         return owner.root.createRequest()

src/main/java/org/kohsuke/github/GHQueryBuilder.java

@@ -7,8 +7,7 @@ package org.kohsuke.github;
  *            the type parameter
  * @author Kohsuke Kawaguchi
  */
-public abstract class GHQueryBuilder<T> {
-    protected final GitHub root;
+public abstract class GHQueryBuilder<T> extends GitHubInteractiveObject {
     protected final Requester req;
 
     GHQueryBuilder(GitHub root) {

src/main/java/org/kohsuke/github/GHRateLimit.java

@@ -12,6 +12,7 @@ import java.time.format.DateTimeFormatter;
 import java.time.format.DateTimeParseException;
 import java.util.Date;
 import java.util.Objects;
+import java.util.concurrent.atomic.AtomicReference;
 import java.util.logging.Logger;
 
 import javax.annotation.CheckForNull;
@@ -266,7 +267,7 @@ public class GHRateLimit {
     /**
      * Merge a {@link GHRateLimit} with another one to create a new {@link GHRateLimit} keeping the latest
      * {@link Record}s from each.
-     * 
+     *
      * @param newLimit
      *            {@link GHRateLimit} with potentially updated {@link Record}s.
      * @return a merged {@link GHRateLimit} with the latest {@link Record}s from these two instances. If the merged
@@ -344,7 +345,7 @@ public class GHRateLimit {
         private static final UnknownLimitRecord DEFAULT = new UnknownLimitRecord(Long.MIN_VALUE);
 
         // The starting current UnknownLimitRecord is an expired record.
-        private static UnknownLimitRecord current = DEFAULT;
+        private static final AtomicReference<UnknownLimitRecord> current = new AtomicReference<>(DEFAULT);
 
         /**
          * Create a new unknown record that resets at the specified time.
@@ -356,18 +357,20 @@ public class GHRateLimit {
             super(unknownLimit, unknownRemaining, resetEpochSeconds);
         }
 
-        static synchronized Record current() {
-            if (current.isExpired()) {
-                current = new UnknownLimitRecord(System.currentTimeMillis() / 1000L + unknownLimitResetSeconds);
+        static Record current() {
+            Record result = current.get();
+            if (result.isExpired()) {
+                current.set(new UnknownLimitRecord(System.currentTimeMillis() / 1000L + unknownLimitResetSeconds));
+                result = current.get();
             }
-            return current;
+            return result;
         }
 
         /**
          * Reset the current UnknownLimitRecord. For use during testing only.
          */
-        static synchronized void reset() {
-            current = DEFAULT;
+        static void reset() {
+            current.set(DEFAULT);
             unknownLimitResetSeconds = defaultUnknownLimitResetSeconds;
         }
     }
@@ -458,7 +461,7 @@ public class GHRateLimit {
          * {@link Record}s with earlier {@link #getResetEpochSeconds()} are replaced by those with later.
          * {@link Record}s with the same {@link #getResetEpochSeconds()} are replaced by those with less remaining
          * count.
-         * 
+         *
          * {@link UnknownLimitRecord}s compare with each other like regular {@link Record}s.
          *
          * {@link Record}s are replaced by {@link UnknownLimitRecord}s only when the current {@link Record} is expired

src/main/java/org/kohsuke/github/GHReaction.java

@@ -3,7 +3,7 @@ package org.kohsuke.github;
 import java.io.IOException;
 import java.net.URL;
 
-import static org.kohsuke.github.Previews.*;
+import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
 
 /**
  * Reaction to issue, comment, PR, and so on.
@@ -11,10 +11,9 @@ import static org.kohsuke.github.Previews.*;
  * @author Kohsuke Kawaguchi
  * @see Reactable
  */
-@Preview
+@Preview(SQUIRREL_GIRL)
 @Deprecated
 public class GHReaction extends GHObject {
-    private GitHub root;
 
     private GHUser user;
     private ReactionContent content;

src/main/java/org/kohsuke/github/GHRef.java

@@ -11,9 +11,7 @@ import java.net.URL;
  *
  * @author Michael Clarke
  */
-public class GHRef {
-    /* package almost final */ GitHub root;
-
+public class GHRef extends GitHubInteractiveObject {
     private String ref, url;
     private GHObject object;
 

src/main/java/org/kohsuke/github/GHRelease.java

@@ -19,7 +19,6 @@ import static java.lang.String.*;
  * @see GHRepository#createRelease(String) GHRepository#createRelease(String)
  */
 public class GHRelease extends GHObject {
-    GitHub root;
     GHRepository owner;
 
     private String html_url;
@@ -260,7 +259,6 @@ public class GHRelease extends GHObject {
      *             existing logic in place for backwards compatibility.
      */
     @Deprecated
-    @Preview
     public List<GHAsset> assets() {
         return assets;
     }

src/main/java/org/kohsuke/github/GHReleaseBuilder.java

@@ -41,7 +41,7 @@ public class GHReleaseBuilder {
      * Specifies the commitish value that determines where the Git tag is created from. Can be any branch or commit SHA.
      *
      * @param commitish
-     *            Defaults to the repository’s default branch (usually "master"). Unused if the Git tag already exists.
+     *            Defaults to the repository’s default branch (usually "main"). Unused if the Git tag already exists.
      * @return the gh release builder
      */
     public GHReleaseBuilder commitish(String commitish) {

src/main/java/org/kohsuke/github/GHReleaseUpdater.java

@@ -45,7 +45,7 @@ public class GHReleaseUpdater {
      * Specifies the commitish value that determines where the Git tag is created from. Can be any branch or commit SHA.
      *
      * @param commitish
-     *            Defaults to the repository’s default branch (usually "master"). Unused if the Git tag already exists.
+     *            Defaults to the repository’s default branch (usually "main"). Unused if the Git tag already exists.
      * @return the gh release updater
      */
     public GHReleaseUpdater commitish(String commitish) {

src/main/java/org/kohsuke/github/GHRepository.java

@@ -30,6 +30,8 @@ import edu.umd.cs.findbugs.annotations.CheckForNull;
 import edu.umd.cs.findbugs.annotations.NonNull;
 import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
 import org.apache.commons.lang3.StringUtils;
+import org.kohsuke.github.function.InputStreamFunction;
+import org.kohsuke.github.internal.EnumUtils;
 
 import java.io.FileNotFoundException;
 import java.io.IOException;
@@ -48,14 +50,24 @@ import java.util.HashSet;
 import java.util.Iterator;
 import java.util.LinkedHashSet;
 import java.util.List;
+import java.util.Locale;
 import java.util.Map;
-import java.util.Objects;
 import java.util.Set;
 import java.util.TreeMap;
 import java.util.WeakHashMap;
 
-import static java.util.Arrays.*;
-import static org.kohsuke.github.Previews.*;
+import javax.annotation.Nonnull;
+
+import static java.util.Arrays.asList;
+import static java.util.Objects.requireNonNull;
+import static org.kohsuke.github.internal.Previews.ANTIOPE;
+import static org.kohsuke.github.internal.Previews.ANT_MAN;
+import static org.kohsuke.github.internal.Previews.BAPTISTE;
+import static org.kohsuke.github.internal.Previews.FLASH;
+import static org.kohsuke.github.internal.Previews.INERTIA;
+import static org.kohsuke.github.internal.Previews.MERCY;
+import static org.kohsuke.github.internal.Previews.NEBULA;
+import static org.kohsuke.github.internal.Previews.SHADOW_CAT;
 
 /**
  * A repository on GitHub.
@@ -66,7 +78,6 @@ import static org.kohsuke.github.Previews.*;
 @SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
         justification = "JSON API")
 public class GHRepository extends GHObject {
-    /* package almost final */ transient GitHub root;
 
     private String nodeId, description, homepage, name, full_name;
 
@@ -96,6 +107,8 @@ public class GHRepository extends GHObject {
     @JsonProperty("private")
     private boolean _private;
 
+    private String visibility;
+
     private int forks_count, stargazers_count, watchers_count, size, open_issues_count, subscribers_count;
 
     private String pushed_at;
@@ -163,6 +176,8 @@ public class GHRepository extends GHObject {
                 .with("task", task)
                 .with("environment", environment)
                 .withUrlPath(getApiTailUrl("deployments"))
+                .withPreview(ANT_MAN)
+                .withPreview(FLASH)
                 .toIterable(GHDeployment[].class, item -> item.wrap(this));
     }
 
@@ -178,6 +193,8 @@ public class GHRepository extends GHObject {
     public GHDeployment getDeployment(long id) throws IOException {
         return root.createRequest()
                 .withUrlPath(getApiTailUrl("deployments/" + id))
+                .withPreview(ANT_MAN)
+                .withPreview(FLASH)
                 .fetch(GHDeployment.class)
                 .wrap(this);
     }
@@ -444,7 +461,7 @@ public class GHRepository extends GHObject {
      * Creates a named ref, such as tag, branch, etc.
      *
      * @param name
-     *            The name of the fully qualified reference (ie: refs/heads/master). If it doesn't start with 'refs' and
+     *            The name of the fully qualified reference (ie: refs/heads/main). If it doesn't start with 'refs' and
      *            have at least two slashes, it will be rejected.
      * @param sha
      *            The SHA1 value to set this reference to
@@ -561,7 +578,15 @@ public class GHRepository extends GHObject {
      *             the io exception
      */
     public Map<String, Long> listLanguages() throws IOException {
-        return root.createRequest().withUrlPath(getApiTailUrl("languages")).fetch(HashMap.class);
+        HashMap<String, Long> result = new HashMap<>();
+        root.createRequest().withUrlPath(getApiTailUrl("languages")).fetch(HashMap.class).forEach((key, value) -> {
+            Long addValue = -1L;
+            if (value instanceof Integer) {
+                addValue = Long.valueOf((Integer) value);
+            }
+            result.put(key.toString(), addValue);
+        });
+        return result;
     }
 
     /**
@@ -698,13 +723,48 @@ public class GHRepository extends GHObject {
         return _private;
     }
 
+    /**
+     * Visibility of a repository.
+     */
+    public enum Visibility {
+        PUBLIC, INTERNAL, PRIVATE, UNKNOWN;
+
+        public static Visibility from(String value) {
+            return EnumUtils.getNullableEnumOrDefault(Visibility.class, value, Visibility.UNKNOWN);
+        }
+
+        @Override
+        public String toString() {
+            return name().toLowerCase(Locale.ROOT);
+        }
+    }
+
+    /**
+     * Gets the visibility of the repository.
+     *
+     * @return the visibility
+     */
+    @Deprecated
+    @Preview(NEBULA)
+    public Visibility getVisibility() {
+        if (visibility == null) {
+            try {
+                populate();
+            } catch (final IOException e) {
+                // Convert this to a runtime exception to avoid messy method signature
+                throw new GHException("Could not populate the visibility of the repository", e);
+            }
+        }
+        return Visibility.from(visibility);
+    }
+
     /**
      * Is template boolean.
      *
      * @return the boolean
      */
     @Deprecated
-    @Preview
+    @Preview(BAPTISTE)
     public boolean isTemplate() {
         // isTemplate is still in preview, we do not want to retrieve it unless needed.
         if (isTemplate == null) {
@@ -788,16 +848,18 @@ public class GHRepository extends GHObject {
     /**
      * Returns the primary branch you'll configure in the "Admin &gt; Options" config page.
      *
-     * @return This field is null until the user explicitly configures the master branch.
+     * @return This field is null until the user explicitly configures the default branch.
      */
     public String getDefaultBranch() {
         return default_branch;
     }
 
     /**
-     * Gets master branch.
+     * Gets default branch.
      *
-     * @return the master branch
+     * Name is an artifact of when "master" was the most common default.
+     *
+     * @return the default branch
      * @deprecated Renamed to {@link #getDefaultBranch()}
      */
     @Deprecated
@@ -814,6 +876,13 @@ public class GHRepository extends GHObject {
         return size;
     }
 
+    /**
+     * Affiliation of a repository collaborator
+     */
+    public enum CollaboratorAffiliation {
+        ALL, DIRECT, OUTSIDE
+    }
+
     /**
      * Gets the collaborators on this repository. This set always appear to include the owner.
      *
@@ -837,6 +906,19 @@ public class GHRepository extends GHObject {
         return listUsers("collaborators");
     }
 
+    /**
+     * Lists up the collaborators on this repository.
+     *
+     * @param affiliation
+     *            Filter users by affiliation
+     * @return Users paged iterable
+     * @throws IOException
+     *             the io exception
+     */
+    public PagedIterable<GHUser> listCollaborators(CollaboratorAffiliation affiliation) throws IOException {
+        return listUsers(root.createRequest().with("affiliation", affiliation), "collaborators");
+    }
+
     /**
      * Lists all
      * <a href="https://help.github.com/articles/assigning-issues-and-pull-requests-to-other-github-users/">the
@@ -884,6 +966,29 @@ public class GHRepository extends GHObject {
         return r;
     }
 
+    /**
+     * Gets the names of the collaborators on this repository. This method deviates from the principle of this library
+     * but it works a lot faster than {@link #getCollaborators()}.
+     *
+     * @param affiliation
+     *            Filter users by affiliation
+     * @return the collaborator names
+     * @throws IOException
+     *             the io exception
+     */
+    public Set<String> getCollaboratorNames(CollaboratorAffiliation affiliation) throws IOException {
+        Set<String> r = new HashSet<>();
+        // no initializer - we just want to the logins
+        PagedIterable<GHUser> users = root.createRequest()
+                .withUrlPath(getApiTailUrl("collaborators"))
+                .with("affiliation", affiliation)
+                .toIterable(GHUser[].class, null);
+        for (GHUser u : users.toArray()) {
+            r.add(u.login);
+        }
+        return r;
+    }
+
     /**
      * Obtain permission for a given user in this repository.
      *
@@ -1039,14 +1144,6 @@ public class GHRepository extends GHObject {
                 .send();
     }
 
-    private void edit(String key, String value) throws IOException {
-        Requester requester = root.createRequest();
-        if (!key.equals("name")) {
-            requester.with("name", name); // even when we don't change the name, we need to send it in
-        }
-        requester.with(key, value).method("PATCH").withUrlPath(getApiTailUrl("")).send();
-    }
-
     /**
      * Enables or disables the issue tracker for this repository.
      *
@@ -1056,7 +1153,7 @@ public class GHRepository extends GHObject {
      *             the io exception
      */
     public void enableIssueTracker(boolean v) throws IOException {
-        edit("has_issues", String.valueOf(v));
+        set().issues(v);
     }
 
     /**
@@ -1068,7 +1165,7 @@ public class GHRepository extends GHObject {
      *             the io exception
      */
     public void enableProjects(boolean v) throws IOException {
-        edit("has_projects", String.valueOf(v));
+        set().projects(v);
     }
 
     /**
@@ -1080,7 +1177,7 @@ public class GHRepository extends GHObject {
      *             the io exception
      */
     public void enableWiki(boolean v) throws IOException {
-        edit("has_wiki", String.valueOf(v));
+        set().wiki(v);
     }
 
     /**
@@ -1092,7 +1189,7 @@ public class GHRepository extends GHObject {
      *             the io exception
      */
     public void enableDownloads(boolean v) throws IOException {
-        edit("has_downloads", String.valueOf(v));
+        set().downloads(v);
     }
 
     /**
@@ -1104,7 +1201,7 @@ public class GHRepository extends GHObject {
      *             the io exception
      */
     public void renameTo(String name) throws IOException {
-        edit("name", name);
+        set().name(name);
     }
 
     /**
@@ -1116,7 +1213,7 @@ public class GHRepository extends GHObject {
      *             the io exception
      */
     public void setDescription(String value) throws IOException {
-        edit("description", value);
+        set().description(value);
     }
 
     /**
@@ -1128,7 +1225,7 @@ public class GHRepository extends GHObject {
      *             the io exception
      */
     public void setHomepage(String value) throws IOException {
-        edit("homepage", value);
+        set().homepage(value);
     }
 
     /**
@@ -1140,7 +1237,7 @@ public class GHRepository extends GHObject {
      *             the io exception
      */
     public void setDefaultBranch(String value) throws IOException {
-        edit("default_branch", value);
+        set().defaultBranch(value);
     }
 
     /**
@@ -1152,7 +1249,27 @@ public class GHRepository extends GHObject {
      *             the io exception
      */
     public void setPrivate(boolean value) throws IOException {
-        edit("private", Boolean.toString(value));
+        set().private_(value);
+    }
+
+    /**
+     * Sets visibility.
+     *
+     * @param value
+     *            the value
+     * @throws IOException
+     *             the io exception
+     */
+    @Deprecated
+    @Preview(NEBULA)
+    public void setVisibility(final Visibility value) throws IOException {
+        root.createRequest()
+                .method("PATCH")
+                .withPreview(NEBULA)
+                .with("name", name)
+                .with("visibility", value)
+                .withUrlPath(getApiTailUrl(""))
+                .send();
     }
 
     /**
@@ -1164,7 +1281,7 @@ public class GHRepository extends GHObject {
      *             the io exception
      */
     public void allowSquashMerge(boolean value) throws IOException {
-        edit("allow_squash_merge", Boolean.toString(value));
+        set().allowSquashMerge(value);
     }
 
     /**
@@ -1176,7 +1293,7 @@ public class GHRepository extends GHObject {
      *             the io exception
      */
     public void allowMergeCommit(boolean value) throws IOException {
-        edit("allow_merge_commit", Boolean.toString(value));
+        set().allowMergeCommit(value);
     }
 
     /**
@@ -1188,7 +1305,7 @@ public class GHRepository extends GHObject {
      *             the io exception
      */
     public void allowRebaseMerge(boolean value) throws IOException {
-        edit("allow_rebase_merge", Boolean.toString(value));
+        set().allowRebaseMerge(value);
     }
 
     /**
@@ -1200,7 +1317,7 @@ public class GHRepository extends GHObject {
      *             the io exception
      */
     public void deleteBranchOnMerge(boolean value) throws IOException {
-        edit("delete_branch_on_merge", Boolean.toString(value));
+        set().deleteBranchOnMerge(value);
     }
 
     /**
@@ -1237,12 +1354,30 @@ public class GHRepository extends GHObject {
      *             In case of any networking error or error from the server.
      */
     public void archive() throws IOException {
-        edit("archived", "true");
-        // Generall would not update this record,
-        // but do so here since this will result in any other update actions failing
+        set().archive();
+        // Generally would not update this record,
+        // but doing so here since this will result in any other update actions failing
         archived = true;
     }
 
+    /**
+     * Creates a builder that can be used to bulk update repository settings.
+     *
+     * @return the repository updater
+     */
+    public Updater update() {
+        return new Updater(this);
+    }
+
+    /**
+     * Creates a builder that can be used to bulk update repository settings.
+     *
+     * @return the repository updater
+     */
+    public Setter set() {
+        return new Setter(this);
+    }
+
     /**
      * Sort orders for listing forks
      */
@@ -1642,7 +1777,7 @@ public class GHRepository extends GHObject {
      * Retrive a tree of the given type for the current GitHub repository.
      *
      * @param sha
-     *            sha number or branch name ex: "master"
+     *            sha number or branch name ex: "main"
      * @return refs matching the request type
      * @throws IOException
      *             on failure communicating with GitHub, potentially due to an invalid tree type being requested
@@ -1666,7 +1801,7 @@ public class GHRepository extends GHObject {
      * https://developer.github.com/v3/git/trees/#get-a-tree-recursively
      *
      * @param sha
-     *            sha number or branch name ex: "master"
+     *            sha number or branch name ex: "main"
      * @param recursive
      *            use 1
      * @return the tree recursive
@@ -1724,7 +1859,7 @@ public class GHRepository extends GHObject {
         return root.createRequest()
                 .withHeader("Accept", "application/vnd.github.v3.raw")
                 .withUrlPath(target)
-                .fetchStream();
+                .fetchStream(Requester::copyInputStream);
     }
 
     /**
@@ -1878,14 +2013,14 @@ public class GHRepository extends GHObject {
      * @see <a href="https://developer.github.com/v3/checks/runs/#list-check-runs-for-a-specific-ref">List check runs
      *      for a specific ref</a>
      */
-    @Preview
+    @Preview(ANTIOPE)
     @Deprecated
     public PagedIterable<GHCheckRun> getCheckRuns(String ref) throws IOException {
         GitHubRequest request = root.createRequest()
                 .withUrlPath(String.format("/repos/%s/%s/commits/%s/check-runs", getOwnerName(), name, ref))
                 .withPreview(ANTIOPE)
                 .build();
-        return new GHCheckRunsIterable(root, request);
+        return new GHCheckRunsIterable(this, request);
     }
 
     /**
@@ -1952,7 +2087,7 @@ public class GHRepository extends GHObject {
      *            the commit hash
      * @return a builder which you should customize, then call {@link GHCheckRunBuilder#create}
      */
-    @Preview
+    @Preview(ANTIOPE)
     @Deprecated
     public @NonNull GHCheckRunBuilder createCheckRun(@NonNull String name, @NonNull String headSHA) {
         return new GHCheckRunBuilder(this, name, headSHA);
@@ -1965,7 +2100,7 @@ public class GHRepository extends GHObject {
      *            the existing checkId
      * @return a builder which you should customize, then call {@link GHCheckRunBuilder#create}
      */
-    @Preview
+    @Preview(BAPTISTE)
     @Deprecated
     public @NonNull GHCheckRunBuilder updateCheckRun(long checkId) {
         return new GHCheckRunBuilder(this, checkId);
@@ -2088,9 +2223,11 @@ public class GHRepository extends GHObject {
     }
 
     private PagedIterable<GHUser> listUsers(final String suffix) {
-        return root.createRequest()
-                .withUrlPath(getApiTailUrl(suffix))
-                .toIterable(GHUser[].class, item -> item.wrapUp(root));
+        return listUsers(root.createRequest(), suffix);
+    }
+
+    private PagedIterable<GHUser> listUsers(Requester requester, final String suffix) {
+        return requester.withUrlPath(getApiTailUrl(suffix)).toIterable(GHUser[].class, item -> item.wrapUp(root));
     }
 
     /**
@@ -2153,7 +2290,12 @@ public class GHRepository extends GHObject {
             justification = "It causes a performance degradation, but we have already exposed it to the API")
     @Deprecated
     public Set<URL> getPostCommitHooks() {
-        return postCommitHooks;
+        synchronized (this) {
+            if (postCommitHooks == null) {
+                postCommitHooks = setupPostCommitHooks();
+            }
+            return postCommitHooks;
+        }
     }
 
     /**
@@ -2162,57 +2304,63 @@ public class GHRepository extends GHObject {
     @SuppressFBWarnings(value = "DMI_COLLECTION_OF_URLS",
             justification = "It causes a performance degradation, but we have already exposed it to the API")
     @SkipFromToString
-    private final Set<URL> postCommitHooks = new AbstractSet<URL>() {
-        private List<URL> getPostCommitHooks() {
-            try {
-                List<URL> r = new ArrayList<>();
-                for (GHHook h : getHooks()) {
-                    if (h.getName().equals("web")) {
-                        r.add(new URL(h.getConfig().get("url")));
+    private /* final */ transient Set<URL> postCommitHooks;
+
+    @SuppressFBWarnings(value = "DMI_COLLECTION_OF_URLS",
+            justification = "It causes a performance degradation, but we have already exposed it to the API")
+    private Set<URL> setupPostCommitHooks() {
+        return new AbstractSet<URL>() {
+            private List<URL> getPostCommitHooks() {
+                try {
+                    List<URL> r = new ArrayList<>();
+                    for (GHHook h : getHooks()) {
+                        if (h.getName().equals("web")) {
+                            r.add(new URL(h.getConfig().get("url")));
+                        }
                     }
+                    return r;
+                } catch (IOException e) {
+                    throw new GHException("Failed to retrieve post-commit hooks", e);
                 }
-                return r;
-            } catch (IOException e) {
-                throw new GHException("Failed to retrieve post-commit hooks", e);
             }
-        }
 
-        @Override
-        public Iterator<URL> iterator() {
-            return getPostCommitHooks().iterator();
-        }
-
-        @Override
-        public int size() {
-            return getPostCommitHooks().size();
-        }
-
-        @Override
-        public boolean add(URL url) {
-            try {
-                createWebHook(url);
-                return true;
-            } catch (IOException e) {
-                throw new GHException("Failed to update post-commit hooks", e);
+            @Override
+            public Iterator<URL> iterator() {
+                return getPostCommitHooks().iterator();
             }
-        }
 
-        @Override
-        public boolean remove(Object url) {
-            try {
-                String _url = ((URL) url).toExternalForm();
-                for (GHHook h : getHooks()) {
-                    if (h.getName().equals("web") && h.getConfig().get("url").equals(_url)) {
-                        h.delete();
-                        return true;
+            @Override
+            public int size() {
+                return getPostCommitHooks().size();
+            }
+
+            @Override
+            public boolean add(URL url) {
+                try {
+                    createWebHook(url);
+                    return true;
+                } catch (IOException e) {
+                    throw new GHException("Failed to update post-commit hooks", e);
+                }
+            }
+
+            @Override
+            public boolean remove(Object url) {
+                try {
+                    String _url = ((URL) url).toExternalForm();
+                    for (GHHook h : getHooks()) {
+                        if (h.getName().equals("web") && h.getConfig().get("url").equals(_url)) {
+                            h.delete();
+                            return true;
+                        }
                     }
+                    return false;
+                } catch (IOException e) {
+                    throw new GHException("Failed to update post-commit hooks", e);
                 }
-                return false;
-            } catch (IOException e) {
-                throw new GHException("Failed to update post-commit hooks", e);
             }
-        }
-    };
+        };
+    }
 
     GHRepository wrap(GitHub root) {
         this.root = root;
@@ -2738,7 +2886,7 @@ public class GHRepository extends GHObject {
                         .with("mode", mode == null ? null : mode.toString())
                         .with("context", getFullName())
                         .withUrlPath("/markdown")
-                        .fetchStream(),
+                        .fetchStream(Requester::copyInputStream),
                 "UTF-8");
     }
 
@@ -2826,6 +2974,110 @@ public class GHRepository extends GHObject {
                 .wrapUp(root);
     }
 
+    /**
+     * Lists all the workflows of this repository.
+     *
+     * @return the paged iterable
+     */
+    public PagedIterable<GHWorkflow> listWorkflows() {
+        return new GHWorkflowsIterable(this);
+    }
+
+    /**
+     * Gets a workflow by id.
+     *
+     * @param id
+     *            the id of the workflow run
+     * @return the workflow run
+     * @throws IOException
+     *             the io exception
+     */
+    public GHWorkflow getWorkflow(long id) throws IOException {
+        return getWorkflow(String.valueOf(id));
+    }
+
+    /**
+     * Gets a workflow by name of the file.
+     *
+     * @param nameOrId
+     *            either the name of the file (e.g. my-workflow.yml) or the id as a string
+     * @return the workflow run
+     * @throws IOException
+     *             the io exception
+     */
+    public GHWorkflow getWorkflow(String nameOrId) throws IOException {
+        return root.createRequest()
+                .withUrlPath(getApiTailUrl("actions/workflows"), nameOrId)
+                .fetch(GHWorkflow.class)
+                .wrapUp(this);
+    }
+
+    /**
+     * Retrieves workflow runs.
+     *
+     * @return the workflow run query builder
+     */
+    public GHWorkflowRunQueryBuilder queryWorkflowRuns() {
+        return new GHWorkflowRunQueryBuilder(this);
+    }
+
+    /**
+     * Gets a workflow run.
+     *
+     * @param id
+     *            the id of the workflow run
+     * @return the workflow run
+     * @throws IOException
+     *             the io exception
+     */
+    public GHWorkflowRun getWorkflowRun(long id) throws IOException {
+        return root.createRequest()
+                .withUrlPath(getApiTailUrl("actions/runs"), String.valueOf(id))
+                .fetch(GHWorkflowRun.class)
+                .wrapUp(this);
+    }
+
+    /**
+     * Lists all the artifacts of this repository.
+     *
+     * @return the paged iterable
+     */
+    public PagedIterable<GHArtifact> listArtifacts() {
+        return new GHArtifactsIterable(this, root.createRequest().withUrlPath(getApiTailUrl("actions/artifacts")));
+    }
+
+    /**
+     * Gets an artifact by id.
+     *
+     * @param id
+     *            the id of the artifact
+     * @return the artifact
+     * @throws IOException
+     *             the io exception
+     */
+    public GHArtifact getArtifact(long id) throws IOException {
+        return root.createRequest()
+                .withUrlPath(getApiTailUrl("actions/artifacts"), String.valueOf(id))
+                .fetch(GHArtifact.class)
+                .wrapUp(this);
+    }
+
+    /**
+     * Gets a job from a workflow run by id.
+     *
+     * @param id
+     *            the id of the job
+     * @return the job
+     * @throws IOException
+     *             the io exception
+     */
+    public GHWorkflowJob getWorkflowJob(long id) throws IOException {
+        return root.createRequest()
+                .withUrlPath(getApiTailUrl("/actions/jobs"), String.valueOf(id))
+                .fetch(GHWorkflowJob.class)
+                .wrapUp(this);
+    }
+
     // Only used within listTopics().
     private static class Topics {
         public List<String> names;
@@ -2892,6 +3144,52 @@ public class GHRepository extends GHObject {
                 .wrap(this);
     }
 
+    /**
+     * Streams a zip archive of the repository, optionally at a given <code>ref</code>.
+     *
+     * @param <T>
+     *            the type of result
+     * @param streamFunction
+     *            The {@link InputStreamFunction} that will process the stream
+     * @param ref
+     *            if <code>null</code> the repository's default branch, usually <code>main</code>,
+     * @throws IOException
+     *             The IO exception.
+     * @return the result of reading the stream.
+     */
+    public <T> T readZip(InputStreamFunction<T> streamFunction, String ref) throws IOException {
+        return downloadArchive("zip", ref, streamFunction);
+    }
+
+    /**
+     * Streams a tar archive of the repository, optionally at a given <code>ref</code>.
+     *
+     * @param <T>
+     *            the type of result
+     * @param streamFunction
+     *            The {@link InputStreamFunction} that will process the stream
+     * @param ref
+     *            if <code>null</code> the repository's default branch, usually <code>main</code>,
+     * @throws IOException
+     *             The IO exception.
+     * @return the result of reading the stream.
+     */
+    public <T> T readTar(InputStreamFunction<T> streamFunction, String ref) throws IOException {
+        return downloadArchive("tar", ref, streamFunction);
+    }
+
+    private <T> T downloadArchive(@Nonnull String type,
+            @CheckForNull String ref,
+            @Nonnull InputStreamFunction<T> streamFunction) throws IOException {
+        requireNonNull(streamFunction, "Sink must not be null");
+        String tailUrl = getApiTailUrl(type + "ball");
+        if (ref != null) {
+            tailUrl += "/" + ref;
+        }
+        final Requester builder = root.createRequest().method("GET").withUrlPath(tailUrl);
+        return builder.fetchStream(streamFunction);
+    }
+
     /**
      * Populate this object.
      *
@@ -2903,20 +3201,66 @@ public class GHRepository extends GHObject {
             return; // can't populate if the root is offline
         }
 
-        final URL url = Objects.requireNonNull(getUrl(), "Missing instance URL!");
+        final URL url = requireNonNull(getUrl(), "Missing instance URL!");
 
         try {
-            // IMPORTANT: the url for repository records is does not reliably point to the API url.
+            // IMPORTANT: the url for repository records does not reliably point to the API url.
             // There is bug in Push event payloads that returns the wrong url.
             // All other occurrences of "url" take the form "https://api.github.com/...".
             // For Push event repository records, they take the form "https://github.com/{fullName}".
-            root.createRequest().withPreview(BAPTISE).setRawUrlPath(url.toString()).fetchInto(this).wrap(root);
+            root.createRequest()
+                    .withPreview(BAPTISTE)
+                    .withPreview(NEBULA)
+                    .setRawUrlPath(url.toString())
+                    .fetchInto(this)
+                    .wrap(root);
         } catch (HttpException e) {
             if (e.getCause() instanceof JsonParseException) {
-                root.createRequest().withPreview(BAPTISE).withUrlPath("/repos/" + full_name).fetchInto(this).wrap(root);
+                root.createRequest()
+                        .withPreview(BAPTISTE)
+                        .withPreview(NEBULA)
+                        .withUrlPath("/repos/" + full_name)
+                        .fetchInto(this)
+                        .wrap(root);
             } else {
                 throw e;
             }
         }
     }
+
+    /**
+     * A {@link GHRepositoryBuilder} that allows multiple properties to be updated per request.
+     *
+     * Consumer must call {@link #done()} to commit changes.
+     */
+    @BetaApi
+    @Deprecated
+    public static class Updater extends GHRepositoryBuilder<Updater> {
+        protected Updater(@Nonnull GHRepository repository) {
+            super(Updater.class, repository.root, null);
+            // even when we don't change the name, we need to send it in
+            // this requirement may be out-of-date, but we do not want to break it
+            requester.with("name", repository.name);
+
+            requester.method("PATCH").withUrlPath(repository.getApiTailUrl(""));
+        }
+    }
+
+    /**
+     * A {@link GHRepositoryBuilder} that allows multiple properties to be updated per request.
+     *
+     * Consumer must call {@link #done()} to commit changes.
+     */
+    @BetaApi
+    @Deprecated
+    public static class Setter extends GHRepositoryBuilder<GHRepository> {
+        protected Setter(@Nonnull GHRepository repository) {
+            super(GHRepository.class, repository.root, null);
+            // even when we don't change the name, we need to send it in
+            // this requirement may be out-of-date, but we do not want to break it
+            requester.with("name", repository.name);
+
+            requester.method("PATCH").withUrlPath(repository.getApiTailUrl(""));
+        }
+    }
 }

src/main/java/org/kohsuke/github/GHRepositoryBuilder.java

@@ -0,0 +1,252 @@
+package org.kohsuke.github;
+
+import org.kohsuke.github.GHRepository.Visibility;
+
+import java.io.IOException;
+import java.net.URL;
+
+import static org.kohsuke.github.internal.Previews.BAPTISTE;
+import static org.kohsuke.github.internal.Previews.NEBULA;
+
+abstract class GHRepositoryBuilder<S> extends AbstractBuilder<GHRepository, S> {
+
+    protected GHRepositoryBuilder(Class<S> intermediateReturnType, GitHub root, GHRepository baseInstance) {
+        super(GHRepository.class, intermediateReturnType, root, baseInstance);
+    }
+
+    /**
+     * Allow or disallow squash-merging pull requests.
+     *
+     * @param enabled
+     *            true if enabled
+     *
+     * @return a builder to continue with building
+     *
+     * @throws IOException
+     *             In case of any networking error or error from the server.
+     */
+    public S allowSquashMerge(boolean enabled) throws IOException {
+        return with("allow_squash_merge", enabled);
+    }
+
+    /**
+     * Allow or disallow merging pull requests with a merge commit.
+     *
+     * @param enabled
+     *            true if enabled
+     *
+     * @return a builder to continue with building
+     *
+     * @throws IOException
+     *             In case of any networking error or error from the server.
+     */
+    public S allowMergeCommit(boolean enabled) throws IOException {
+        return with("allow_merge_commit", enabled);
+    }
+
+    /**
+     * Allow or disallow rebase-merging pull requests.
+     *
+     * @param enabled
+     *            true if enabled
+     *
+     * @return a builder to continue with building
+     *
+     * @throws IOException
+     *             In case of any networking error or error from the server.
+     */
+    public S allowRebaseMerge(boolean enabled) throws IOException {
+        return with("allow_rebase_merge", enabled);
+    }
+
+    /**
+     * After pull requests are merged, you can have head branches deleted automatically.
+     *
+     * @param enabled
+     *            true if enabled
+     *
+     * @return a builder to continue with building
+     *
+     * @throws IOException
+     *             In case of any networking error or error from the server.
+     */
+    public S deleteBranchOnMerge(boolean enabled) throws IOException {
+        return with("delete_branch_on_merge", enabled);
+    }
+
+    /**
+     * Default repository branch
+     *
+     * @param branch
+     *            branch name
+     *
+     * @return a builder to continue with building
+     *
+     * @throws IOException
+     *             In case of any networking error or error from the server.
+     */
+    public S defaultBranch(String branch) throws IOException {
+        return with("default_branch", branch);
+    }
+
+    /**
+     * Description for repository
+     *
+     * @param description
+     *            description of repository
+     *
+     * @return a builder to continue with building
+     *
+     * @throws IOException
+     *             In case of any networking error or error from the server.
+     */
+    public S description(String description) throws IOException {
+        return with("description", description);
+    }
+
+    /**
+     * Homepage for repository
+     *
+     * @param homepage
+     *            homepage of repository
+     *
+     * @return a builder to continue with building
+     *
+     * @throws IOException
+     *             In case of any networking error or error from the server.
+     */
+    public S homepage(URL homepage) throws IOException {
+        return homepage(homepage.toExternalForm());
+    }
+
+    /**
+     * Homepage for repository
+     *
+     * @param homepage
+     *            homepage of repository
+     *
+     * @return a builder to continue with building
+     *
+     * @throws IOException
+     *             In case of any networking error or error from the server.
+     */
+    public S homepage(String homepage) throws IOException {
+        return with("homepage", homepage);
+    }
+
+    /**
+     * Sets the repository to private
+     *
+     * @param enabled
+     *            private if true
+     *
+     * @return a builder to continue with building
+     *
+     * @throws IOException
+     *             In case of any networking error or error from the server.
+     */
+    public S private_(boolean enabled) throws IOException {
+        return with("private", enabled);
+    }
+
+    /**
+     * Sets the repository visibility
+     *
+     * @param visibility
+     *            visibility of repository
+     * @return a builder to continue with building
+     * @throws IOException
+     *             In case of any networking error or error from the server.
+     */
+    public S visibility(final Visibility visibility) throws IOException {
+        requester.withPreview(NEBULA);
+        return with("visibility", visibility);
+    }
+
+    /**
+     * Enables issue tracker
+     *
+     * @param enabled
+     *            true if enabled
+     *
+     * @return a builder to continue with building
+     *
+     * @throws IOException
+     *             In case of any networking error or error from the server.
+     */
+    public S issues(boolean enabled) throws IOException {
+        return with("has_issues", enabled);
+    }
+
+    /**
+     * Enables projects
+     *
+     * @param enabled
+     *            true if enabled
+     *
+     * @return a builder to continue with building
+     *
+     * @throws IOException
+     *             In case of any networking error or error from the server.
+     */
+    public S projects(boolean enabled) throws IOException {
+        return with("has_projects", enabled);
+    }
+
+    /**
+     * Enables wiki
+     *
+     * @param enabled
+     *            true if enabled
+     * @return a builder to continue with building
+     * @throws IOException
+     *             In case of any networking error or error from the server.
+     */
+    public S wiki(boolean enabled) throws IOException {
+        return with("has_wiki", enabled);
+    }
+
+    /**
+     * Enables downloads
+     *
+     * @param enabled
+     *            true if enabled
+     *
+     * @return a builder to continue with building
+     *
+     * @throws IOException
+     *             In case of any networking error or error from the server.
+     */
+    public S downloads(boolean enabled) throws IOException {
+        return with("has_downloads", enabled);
+    }
+
+    /**
+     * Specifies whether the repository is a template.
+     *
+     * @param enabled
+     *            true if enabled
+     * @return a builder to continue with building
+     * @throws IOException
+     *             In case of any networking error or error from the server.
+     */
+    @Preview(BAPTISTE)
+    @Deprecated
+    public S isTemplate(boolean enabled) throws IOException {
+        requester.withPreview(BAPTISTE);
+        return with("is_template", enabled);
+    }
+
+    @Override
+    public GHRepository done() throws IOException {
+        return super.done().wrap(this.root);
+    }
+
+    S archive() throws IOException {
+        return with("archived", true);
+    }
+
+    S name(String name) throws IOException {
+        return with("name", name);
+    }
+}

src/main/java/org/kohsuke/github/GHRepositoryStatistics.java

@@ -16,10 +16,9 @@ import java.util.NoSuchElementException;
  *
  * @author Martin van Zijl
  */
-public class GHRepositoryStatistics {
+public class GHRepositoryStatistics extends GitHubInteractiveObject {
 
     private final GHRepository repo;
-    private final GitHub root;
 
     private static final int MAX_WAIT_ITERATIONS = 3;
     private static final int WAIT_SLEEP_INTERVAL = 5000;
@@ -60,7 +59,7 @@ public class GHRepositoryStatistics {
      * @throws InterruptedException
      *             the interrupted exception
      */
-    @Preview
+    @BetaApi
     @Deprecated
     @SuppressWarnings("SleepWhileInLoop")
     @SuppressFBWarnings(value = { "RCN_REDUNDANT_NULLCHECK_OF_NONNULL_VALUE" }, justification = "JSON API")
@@ -99,7 +98,6 @@ public class GHRepositoryStatistics {
                     "URF_UNREAD_FIELD" },
             justification = "JSON API")
     public static class ContributorStats extends GHObject {
-        /* package almost final */ private GitHub root;
         private GHUser author;
         private int total;
         private List<Week> weeks;
@@ -255,7 +253,6 @@ public class GHRepositoryStatistics {
             value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
             justification = "JSON API")
     public static class CommitActivity extends GHObject {
-        /* package almost final */ private GitHub root;
         private List<Integer> days;
         private int total;
         private long week;
@@ -398,7 +395,6 @@ public class GHRepositoryStatistics {
      * The type Participation.
      */
     public static class Participation extends GHObject {
-        /* package almost final */ private GitHub root;
         private List<Integer> all;
         private List<Integer> owner;
 

src/main/java/org/kohsuke/github/GHRequestedAction.java

@@ -8,7 +8,6 @@ import java.net.URL;
         justification = "JSON API")
 public class GHRequestedAction extends GHObject {
     private GHRepository owner;
-    private GitHub root;
     private String identifier;
     private String label;
     private String description;
@@ -46,4 +45,4 @@ public class GHRequestedAction extends GHObject {
         return null;
     }
 
-}
+}

src/main/java/org/kohsuke/github/GHSubscription.java

@@ -10,11 +10,10 @@ import java.util.Date;
  * @see GHRepository#getSubscription() GHRepository#getSubscription()
  * @see GHThread#getSubscription() GHThread#getSubscription()
  */
-public class GHSubscription {
+public class GHSubscription extends GitHubInteractiveObject {
     private String created_at, url, repository_url, reason;
     private boolean subscribed, ignored;
 
-    private GitHub root;
     private GHRepository repo;
 
     /**

src/main/java/org/kohsuke/github/GHTag.java

@@ -9,9 +9,8 @@ import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
  */
 @SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
         justification = "JSON API")
-public class GHTag {
+public class GHTag extends GitHubInteractiveObject {
     private GHRepository owner;
-    private GitHub root;
 
     private String name;
     private GHCommit commit;

src/main/java/org/kohsuke/github/GHTagObject.java

@@ -9,9 +9,8 @@ import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
  */
 @SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
         justification = "JSON API")
-public class GHTagObject {
+public class GHTagObject extends GitHubInteractiveObject {
     private GHRepository owner;
-    private GitHub root;
 
     private String tag;
     private String sha;

src/main/java/org/kohsuke/github/GHTeam.java

@@ -24,8 +24,6 @@ public class GHTeam extends GHObject implements Refreshable {
 
     private GHOrganization organization; // populated by GET /user/teams where Teams+Orgs are returned together
 
-    protected /* final */ GitHub root;
-
     public enum Privacy {
         SECRET, // only visible to organization owners and members of this team.
         CLOSED // visible to all members of this organization.

src/main/java/org/kohsuke/github/GHTeamBuilder.java

@@ -7,9 +7,7 @@ import java.io.IOException;
  *
  * https://developer.github.com/v3/teams/#create-team
  */
-public class GHTeamBuilder {
-
-    private final GitHub root;
+public class GHTeamBuilder extends GitHubInteractiveObject {
     protected final Requester builder;
     private final String orgName;
 

src/main/java/org/kohsuke/github/GHThread.java

@@ -17,7 +17,6 @@ import java.util.Date;
 @SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
         justification = "JSON API")
 public class GHThread extends GHObject {
-    private GitHub root;
     private GHRepository repository;
     private Subject subject;
     private String reason;

src/main/java/org/kohsuke/github/GHWorkflow.java

@@ -0,0 +1,158 @@
+package org.kohsuke.github;
+
+import com.fasterxml.jackson.annotation.JsonIgnore;
+import org.apache.commons.lang3.StringUtils;
+
+import java.io.IOException;
+import java.net.URL;
+import java.util.Collections;
+import java.util.Map;
+import java.util.Objects;
+
+/**
+ * A workflow.
+ *
+ * @author Guillaume Smet
+ * @see GHRepository#getWorkflow(long)
+ */
+public class GHWorkflow extends GHObject {
+
+    // Not provided by the API.
+    @JsonIgnore
+    private GHRepository owner;
+
+    private String name;
+    private String path;
+    private String state;
+
+    private String htmlUrl;
+    private String badgeUrl;
+
+    /**
+     * The name of the workflow.
+     *
+     * @return the name
+     */
+    public String getName() {
+        return name;
+    }
+
+    /**
+     * The path of the workflow e.g. .github/workflows/blank.yaml
+     *
+     * @return the path
+     */
+    public String getPath() {
+        return path;
+    }
+
+    /**
+     * The state of the workflow.
+     *
+     * @return the state
+     */
+    public String getState() {
+        return state;
+    }
+
+    @Override
+    public URL getHtmlUrl() throws IOException {
+        return GitHubClient.parseURL(htmlUrl);
+    }
+
+    /**
+     * Repository to which the workflow belongs.
+     *
+     * @return the repository
+     */
+    public GHRepository getRepository() {
+        return owner;
+    }
+
+    /**
+     * The badge URL, like https://github.com/octo-org/octo-repo/workflows/CI/badge.svg
+     *
+     * @return the badge url
+     */
+    public URL getBadgeUrl() {
+        return GitHubClient.parseURL(badgeUrl);
+    }
+
+    /**
+     * Disable the workflow.
+     *
+     * @throws IOException
+     *             the io exception
+     */
+    public void disable() throws IOException {
+        root.createRequest().method("PUT").withUrlPath(getApiRoute(), "disable").fetchHttpStatusCode();
+    }
+
+    /**
+     * Enable the workflow.
+     *
+     * @throws IOException
+     *             the io exception
+     */
+    public void enable() throws IOException {
+        root.createRequest().method("PUT").withUrlPath(getApiRoute(), "enable").fetchHttpStatusCode();
+    }
+
+    /**
+     * Create a workflow dispatch event which triggers a manual workflow run.
+     *
+     * @param ref
+     *            the git reference for the workflow. The reference can be a branch or tag name.
+     * @throws IOException
+     *             the io exception
+     */
+    public void dispatch(String ref) throws IOException {
+        dispatch(ref, Collections.emptyMap());
+    }
+
+    /**
+     * Create a workflow dispatch event which triggers a manual workflow run.
+     *
+     * @param ref
+     *            the git reference for the workflow. The reference can be a branch or tag name.
+     * @param inputs
+     *            input keys and values configured in the workflow file. The maximum number of properties is 10. Any
+     *            default properties configured in the workflow file will be used when inputs are omitted.
+     * @throws IOException
+     *             the io exception
+     */
+    public void dispatch(String ref, Map<String, Object> inputs) throws IOException {
+        Requester requester = root.createRequest()
+                .method("POST")
+                .withUrlPath(getApiRoute(), "dispatches")
+                .with("ref", ref);
+
+        if (!inputs.isEmpty()) {
+            requester.with("inputs", inputs);
+        }
+
+        requester.fetchHttpStatusCode();
+    }
+
+    private String getApiRoute() {
+        if (owner == null) {
+            // Workflow runs returned from search to do not have an owner. Attempt to use url.
+            final URL url = Objects.requireNonNull(getUrl(), "Missing instance URL!");
+            return StringUtils.prependIfMissing(url.toString().replace(root.getApiUrl(), ""), "/");
+
+        }
+        return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/actions/workflows/" + getId();
+    }
+
+    GHWorkflow wrapUp(GHRepository owner) {
+        this.owner = owner;
+        return wrapUp(owner.root);
+    }
+
+    GHWorkflow wrapUp(GitHub root) {
+        this.root = root;
+        if (owner != null)
+            owner.wrap(root);
+        return this;
+    }
+}