mirror of
https://github.com/jlengrand/github-api.git
synced 2026-04-07 08:21:22 +00:00
Compare commits
793 Commits
github-api
...
69db654f-4
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
3ced4fc9c8 | ||
|
|
4748db2bc3 | ||
|
|
e0ebec5d5c | ||
|
|
b1ff0a4453 | ||
|
|
6564648230 | ||
|
|
48cadbc814 | ||
|
|
fbfba70714 | ||
|
|
30a6cc504e | ||
|
|
54d8fe93a8 | ||
|
|
4abf33acdb | ||
|
|
c00d562b48 | ||
|
|
fad4753f0f | ||
|
|
c24df1d022 | ||
|
|
823465590e | ||
|
|
804db70049 | ||
|
|
1782e5a483 | ||
|
|
b6283a0493 | ||
|
|
0bb18ee7c5 | ||
|
|
1a77dd270f | ||
|
|
1c6ab19d59 | ||
|
|
ef4e64dcdd | ||
|
|
946b4e963b | ||
|
|
0d7867daf6 | ||
|
|
3044b5437b | ||
|
|
4a2886531d | ||
|
|
c5e2d8b2ae | ||
|
|
3041431468 | ||
|
|
63b9188dad | ||
|
|
2436ed0431 | ||
|
|
0295ad82fa | ||
|
|
c197dc6b7b | ||
|
|
a79971e406 | ||
|
|
1a56f9d093 | ||
|
|
35852055e8 | ||
|
|
196ee25452 | ||
|
|
7d8335423d | ||
|
|
eac4990eac | ||
|
|
0f17812732 | ||
|
|
3bafb965c5 | ||
|
|
0e02444c07 | ||
|
|
4dcc479d48 | ||
|
|
a564c97763 | ||
|
|
80e17109de | ||
|
|
c395b9d6b3 | ||
|
|
e34d33f1cd | ||
|
|
1c920dee06 | ||
|
|
955d2e0a07 | ||
|
|
d0912009dd | ||
|
|
e68950e619 | ||
|
|
93c026b7af | ||
|
|
5254839ff7 | ||
|
|
6ca0d83b70 | ||
|
|
8ed832a303 | ||
|
|
dbf6d3bf37 | ||
|
|
081a454ec8 | ||
|
|
543b643fdb | ||
|
|
d02f194668 | ||
|
|
9c8c00b77c | ||
|
|
a23de4707b | ||
|
|
301303bd90 | ||
|
|
4689b8f885 | ||
|
|
c4de682493 | ||
|
|
b23934a5a1 | ||
|
|
f2eecc3cc5 | ||
|
|
f5310965dc | ||
|
|
47ffff3407 | ||
|
|
f2a70a46ad | ||
|
|
acd5c6baa6 | ||
|
|
06d02059cb | ||
|
|
603288c361 | ||
|
|
09ee3168f9 | ||
|
|
1559d063c7 | ||
|
|
cfdcb182a4 | ||
|
|
d526b13d7d | ||
|
|
fffe31220e | ||
|
|
ce17396ea6 | ||
|
|
d18e81dc74 | ||
|
|
6ae5acba5d | ||
|
|
0a1c803f69 | ||
|
|
fa0865b208 | ||
|
|
886887913c | ||
|
|
5c64fec032 | ||
|
|
892f60ea16 | ||
|
|
f28f966040 | ||
|
|
0e9cc90d31 | ||
|
|
72dc5c5d18 | ||
|
|
02e02d39b0 | ||
|
|
e629a23bd4 | ||
|
|
f6e8a2c7c6 | ||
|
|
76bea5174f | ||
|
|
2be27d1a41 | ||
|
|
cd1454ac03 | ||
|
|
b550910f4c | ||
|
|
d13e490be2 | ||
|
|
3d451526ef | ||
|
|
bd38897d48 | ||
|
|
63ccbaf064 | ||
|
|
2beb806b8a | ||
|
|
552ba6693e | ||
|
|
2452add4d7 | ||
|
|
0dc931ceed | ||
|
|
1dfedc6a58 | ||
|
|
e33046a624 | ||
|
|
002b3f03da | ||
|
|
fd1817d111 | ||
|
|
7526b46f9d | ||
|
|
169fd18a54 | ||
|
|
0708812456 | ||
|
|
7d86070ac8 | ||
|
|
713b85f9de | ||
|
|
4fef5bb1fc | ||
|
|
f3eadcddb6 | ||
|
|
237171727d | ||
|
|
31212d33ae | ||
|
|
8af66133d2 | ||
|
|
9578e027b1 | ||
|
|
2c75b42b4e | ||
|
|
7854b30a76 | ||
|
|
cf2571858c | ||
|
|
092815747a | ||
|
|
649d7ed87f | ||
|
|
684560ef67 | ||
|
|
adf054ba5d | ||
|
|
dcdfee67cd | ||
|
|
9d7209ec62 | ||
|
|
b97e8a2c38 | ||
|
|
8bd3f391da | ||
|
|
5d0dbf6e2f | ||
|
|
38f3595552 | ||
|
|
b72e7fa2ee | ||
|
|
659b32f5ec | ||
|
|
d0c326bbf5 | ||
|
|
4a5aceb1f9 | ||
|
|
884248930e | ||
|
|
530d524366 | ||
|
|
5957da3d6d | ||
|
|
6efe428f57 | ||
|
|
25b9a2ce33 | ||
|
|
0ce78016cc | ||
|
|
696dd90b23 | ||
|
|
e66a72387e | ||
|
|
874ce23dd7 | ||
|
|
7479cac9a7 | ||
|
|
064ce1b0bc | ||
|
|
941573af49 | ||
|
|
2f9ff32176 | ||
|
|
b84d5a7c39 | ||
|
|
bd19f23b3f | ||
|
|
ee047ea9b5 | ||
|
|
601f18016a | ||
|
|
93abb0ed36 | ||
|
|
6453e585a9 | ||
|
|
3a1ed5a5b7 | ||
|
|
c5b45523d6 | ||
|
|
bf082f2a46 | ||
|
|
672febd88b | ||
|
|
927843ea83 | ||
|
|
8fac7d317e | ||
|
|
626574ae36 | ||
|
|
8c9eb3393b | ||
|
|
0c4728f46a | ||
|
|
837526ce5d | ||
|
|
afcfa906b8 | ||
|
|
8b3f50d4d3 | ||
|
|
9022455d85 | ||
|
|
8e20f4d9f5 | ||
|
|
7c8a7ff26e | ||
|
|
064d6944f3 | ||
|
|
b8b3cf9c80 | ||
|
|
18e7138812 | ||
|
|
bfb3b94478 | ||
|
|
6167d196d9 | ||
|
|
43ed7c7ac7 | ||
|
|
fc98e72569 | ||
|
|
258acf79f6 | ||
|
|
b509076d6f | ||
|
|
f57ea4c4e9 | ||
|
|
578fe085ce | ||
|
|
2553a79b02 | ||
|
|
4770316898 | ||
|
|
99f192d33c | ||
|
|
fc3bac0e77 | ||
|
|
ad2990b1b6 | ||
|
|
fab848a0d3 | ||
|
|
4a2244e661 | ||
|
|
bab5399327 | ||
|
|
52705ac695 | ||
|
|
73d2e1db5c | ||
|
|
83aa9d04ef | ||
|
|
97652c6803 | ||
|
|
f40daf8488 | ||
|
|
3e6a5bc718 | ||
|
|
78ffe5a759 | ||
|
|
9abfdc805b | ||
|
|
9e47a2b8c6 | ||
|
|
feba6ed8b6 | ||
|
|
acab40b704 | ||
|
|
435272065f | ||
|
|
c5c04672fc | ||
|
|
5eef764cba | ||
|
|
2682e0a1e2 | ||
|
|
a68d16d5de | ||
|
|
304ab10cf9 | ||
|
|
dc46341432 | ||
|
|
99aea9296e | ||
|
|
b0693037f3 | ||
|
|
c19cfd98d1 | ||
|
|
cdc0e2ad6b | ||
|
|
6606b5c7d1 | ||
|
|
551dbf2a06 | ||
|
|
d734237788 | ||
|
|
47e2a5aea1 | ||
|
|
57cdc308e8 | ||
|
|
8919c5f8c7 | ||
|
|
b8f00bc699 | ||
|
|
042038f480 | ||
|
|
fb03e749bd | ||
|
|
e522239832 | ||
|
|
ae69324196 | ||
|
|
5194c2d9bc | ||
|
|
daf5c5eb98 | ||
|
|
a7b4c97020 | ||
|
|
420d5d06f3 | ||
|
|
a7cd052b7c | ||
|
|
6e1b943823 | ||
|
|
8a3559ada5 | ||
|
|
ea3cbd4c71 | ||
|
|
34a1f9d6e4 | ||
|
|
629bd510c1 | ||
|
|
40937a5cc6 | ||
|
|
8509957102 | ||
|
|
b0aea0c575 | ||
|
|
1f7f646bec | ||
|
|
a59ee6a82d | ||
|
|
1fefc77582 | ||
|
|
199eee4e25 | ||
|
|
854df5321b | ||
|
|
bd509070ac | ||
|
|
a8c7c97d06 | ||
|
|
6d86cfb4f6 | ||
|
|
fb3e956502 | ||
|
|
9b0dbe6f34 | ||
|
|
c10c7237a7 | ||
|
|
36612fe97f | ||
|
|
18e2056a10 | ||
|
|
8c8f1451d4 | ||
|
|
be67f1d9e2 | ||
|
|
90bc250269 | ||
|
|
1bd178654f | ||
|
|
f22bf160f9 | ||
|
|
4261c42949 | ||
|
|
40cfb85a8e | ||
|
|
f08299b134 | ||
|
|
a04ab45abc | ||
|
|
0647df2d2b | ||
|
|
d4cc3af1e9 | ||
|
|
936ab499ce | ||
|
|
453f475b4e | ||
|
|
bda3855b86 | ||
|
|
772a6c112b | ||
|
|
9b4134cada | ||
|
|
ed9f54006d | ||
|
|
3b1f176544 | ||
|
|
d2732bcf54 | ||
|
|
a1461f401a | ||
|
|
f9fd30275c | ||
|
|
eeea14dab4 | ||
|
|
1df807a198 | ||
|
|
0848287069 | ||
|
|
334b37a256 | ||
|
|
8776a3b672 | ||
|
|
657550f767 | ||
|
|
45a0114f75 | ||
|
|
a8ddd3e12a | ||
|
|
b668396151 | ||
|
|
9e7c33369c | ||
|
|
8943ca6d1a | ||
|
|
b3460c1f9d | ||
|
|
5166c9265f | ||
|
|
35c8cfa01d | ||
|
|
8e6dbf3772 | ||
|
|
cb381dfa06 | ||
|
|
80124e3b85 | ||
|
|
7aae27e36f | ||
|
|
b212956fbb | ||
|
|
d033355e84 | ||
|
|
59d7a117d0 | ||
|
|
dfbb38c5f1 | ||
|
|
3f9954144a | ||
|
|
1b84efdbfa | ||
|
|
c33e78a7dc | ||
|
|
747c759bbb | ||
|
|
e0a709676e | ||
|
|
a96275c286 | ||
|
|
ca7c809feb | ||
|
|
a8a0bcb7db | ||
|
|
0e2bf23830 | ||
|
|
44a8b797fb | ||
|
|
cdede298a9 | ||
|
|
f6ac4d3559 | ||
|
|
7e1531dbca | ||
|
|
9aeb422157 | ||
|
|
fba0f8cf8e | ||
|
|
0f4a5227e1 | ||
|
|
d16a752b43 | ||
|
|
4d9aed90d6 | ||
|
|
4bec27fd49 | ||
|
|
be3bd74bb7 | ||
|
|
f1720b7bbc | ||
|
|
7a79a18d8f | ||
|
|
472034c950 | ||
|
|
0b14cee817 | ||
|
|
b50ab56f9e | ||
|
|
26d30663c4 | ||
|
|
ffecc390eb | ||
|
|
252ca04084 | ||
|
|
aae5c56a31 | ||
|
|
6670446037 | ||
|
|
bd39b07bb5 | ||
|
|
a9438b6121 | ||
|
|
f546cf4521 | ||
|
|
43efa78750 | ||
|
|
9e3de43802 | ||
|
|
dc615e432e | ||
|
|
cf9caa6af5 | ||
|
|
15f748358d | ||
|
|
b30d648623 | ||
|
|
33d70560b8 | ||
|
|
865a49d2e8 | ||
|
|
4fca68c25c | ||
|
|
f131a0c1c2 | ||
|
|
cd4368fa79 | ||
|
|
4ec4b160b0 | ||
|
|
a585b4957f | ||
|
|
e6b02b3bed | ||
|
|
1ef0ec0432 | ||
|
|
2e87bd86a1 | ||
|
|
0228a0d023 | ||
|
|
6365f3749d | ||
|
|
25c18130f9 | ||
|
|
436c19634d | ||
|
|
1a6facc685 | ||
|
|
bd0093c8ea | ||
|
|
e150280010 | ||
|
|
827fd5e472 | ||
|
|
f89fbc67b9 | ||
|
|
c567a88892 | ||
|
|
6a39d7fca5 | ||
|
|
a15e67f065 | ||
|
|
7a1bce9578 | ||
|
|
f2b4de7943 | ||
|
|
b3ff4ac6d9 | ||
|
|
1c56e7fab5 | ||
|
|
70ba4df385 | ||
|
|
8062c705e8 | ||
|
|
fafb23c1a6 | ||
|
|
4e7ac7030c | ||
|
|
4803daca5a | ||
|
|
facfc61316 | ||
|
|
e3e495bfb1 | ||
|
|
e007284d2f | ||
|
|
1da8416ebd | ||
|
|
79b49a469c | ||
|
|
5888efcaef | ||
|
|
459d1b4f56 | ||
|
|
9151102bda | ||
|
|
3819984add | ||
|
|
3b58fbc186 | ||
|
|
55e589b3d9 | ||
|
|
e64d64d8d8 | ||
|
|
37c2d9135b | ||
|
|
30c96221bd | ||
|
|
bf7305e3f8 | ||
|
|
3b12a229c3 | ||
|
|
5726ceb8dc | ||
|
|
c06c06624d | ||
|
|
ad40d7071e | ||
|
|
f55a39eb90 | ||
|
|
c3869bee31 | ||
|
|
6eac15df0f | ||
|
|
6f5d3c32c3 | ||
|
|
68ef40e4d0 | ||
|
|
4046bc4f72 | ||
|
|
1b8d131915 | ||
|
|
f5ad332d28 | ||
|
|
938603ff60 | ||
|
|
17af78f2bb | ||
|
|
7588267743 | ||
|
|
ed4f9c8176 | ||
|
|
bbb46e88b0 | ||
|
|
3db7aac0d8 | ||
|
|
fdbbd2e563 | ||
|
|
e92f1321d4 | ||
|
|
da2aaff9e5 | ||
|
|
208904b634 | ||
|
|
a433bcda2e | ||
|
|
4bba692170 | ||
|
|
59b61cd8be | ||
|
|
247b013e16 | ||
|
|
77baafa643 | ||
|
|
3c56f1f076 | ||
|
|
224d8c7cb4 | ||
|
|
0feb520549 | ||
|
|
ca365b12f6 | ||
|
|
bde6ad9a06 | ||
|
|
4953f4500d | ||
|
|
7fee1fcc74 | ||
|
|
4415ac8fd2 | ||
|
|
8c81e48a31 | ||
|
|
9ad0329c56 | ||
|
|
78f533bbfc | ||
|
|
79c7dd9ecf | ||
|
|
5d796d1f79 | ||
|
|
68a82be6c4 | ||
|
|
2676ef2b73 | ||
|
|
04b283c539 | ||
|
|
98b067937a | ||
|
|
8ababb60bf | ||
|
|
b51d655f77 | ||
|
|
74496d32da | ||
|
|
316e278be1 | ||
|
|
d881bf6504 | ||
|
|
c74fbbe1fd | ||
|
|
929d9fb7bd | ||
|
|
5d069d0531 | ||
|
|
dd9e6dc5d3 | ||
|
|
d22c77c41d | ||
|
|
3a11b7ccbf | ||
|
|
d7931777bc | ||
|
|
9d161b28bb | ||
|
|
9b16a1caa0 | ||
|
|
9a918e3bac | ||
|
|
d4c5c6a1e0 | ||
|
|
63fda3555c | ||
|
|
6a2381c06b | ||
|
|
e9c0a16c26 | ||
|
|
2101a67ac1 | ||
|
|
ddac568aaa | ||
|
|
262ae9f635 | ||
|
|
381502fb80 | ||
|
|
92fb441eb2 | ||
|
|
29e08037a8 | ||
|
|
84cc6d9315 | ||
|
|
b8d5a1c732 | ||
|
|
0197ab9661 | ||
|
|
b7915e61a6 | ||
|
|
586db99450 | ||
|
|
5377d0dd18 | ||
|
|
bb48d55bd4 | ||
|
|
c5d3a7d573 | ||
|
|
8267050f06 | ||
|
|
610b02968e | ||
|
|
a7112c42df | ||
|
|
8a474a3b00 | ||
|
|
59e18d155e | ||
|
|
12ca5d8063 | ||
|
|
c959e0a928 | ||
|
|
89a08b021d | ||
|
|
04b553cdec | ||
|
|
15e9ee30ee | ||
|
|
a0d650a86c | ||
|
|
1a6ad48e08 | ||
|
|
7c82eeb018 | ||
|
|
b188e74ee0 | ||
|
|
c21bd5765a | ||
|
|
b78c37a695 | ||
|
|
2f151d45c3 | ||
|
|
3ebe3afdbd | ||
|
|
f4845df6c0 | ||
|
|
272b87f04d | ||
|
|
ff790eeefb | ||
|
|
97e918da03 | ||
|
|
4f30998873 | ||
|
|
a0fc478a28 | ||
|
|
bb03fd1968 | ||
|
|
0c65f74662 | ||
|
|
29ac2bd4f5 | ||
|
|
0d8b4f32e8 | ||
|
|
83db7f24eb | ||
|
|
5f9976a193 | ||
|
|
9480ef485b | ||
|
|
a9b7432584 | ||
|
|
6d7081910f | ||
|
|
aa96089ab4 | ||
|
|
58ae681417 | ||
|
|
c038e0af5e | ||
|
|
4f9976c0cb | ||
|
|
e308e5ed57 | ||
|
|
7b1b1ca994 | ||
|
|
551be49a1a | ||
|
|
a3888e6902 | ||
|
|
43bb6a0dd8 | ||
|
|
6e3f754366 | ||
|
|
6360112432 | ||
|
|
f1ca0b5417 | ||
|
|
0894c8007c | ||
|
|
05863acbcd | ||
|
|
0e4cd06137 | ||
|
|
85d2d974e7 | ||
|
|
3f021f9552 | ||
|
|
0456f10709 | ||
|
|
b7d03f7463 | ||
|
|
07a392c2a7 | ||
|
|
5b69de770f | ||
|
|
4688870984 | ||
|
|
bf67069768 | ||
|
|
91764c1c74 | ||
|
|
8b2a3e1221 | ||
|
|
def2f0b37d | ||
|
|
5d7479a3dd | ||
|
|
ceb2d35f9f | ||
|
|
fc38dba59a | ||
|
|
75b383d398 | ||
|
|
ee2d9491fb | ||
|
|
bf86a7c75a | ||
|
|
70f6d129e2 | ||
|
|
a4ac2aa99a | ||
|
|
ae3b6fbe6b | ||
|
|
e357fca963 | ||
|
|
c84cc89805 | ||
|
|
181238cd50 | ||
|
|
214c24c736 | ||
|
|
cf51ce8f26 | ||
|
|
2b7ed40d01 | ||
|
|
349ef7a54c | ||
|
|
94df5fc389 | ||
|
|
906238a297 | ||
|
|
7963fa82b5 | ||
|
|
1aba6012fb | ||
|
|
ff4324ac67 | ||
|
|
11bc669e1d | ||
|
|
dcf26d58e4 | ||
|
|
4d46872c35 | ||
|
|
4f0d62f421 | ||
|
|
f7ad1f517b | ||
|
|
345d6197f3 | ||
|
|
bb4d44138a | ||
|
|
a8ef0cde53 | ||
|
|
77dc009c95 | ||
|
|
aa298c93cc | ||
|
|
dfb0a5240e | ||
|
|
9cfc3c22b5 | ||
|
|
b177d98e29 | ||
|
|
5405fb0370 | ||
|
|
72a1c24b3b | ||
|
|
f146ae94ec | ||
|
|
a0bbba748a | ||
|
|
81bf818573 | ||
|
|
d5913dc292 | ||
|
|
e1e901b794 | ||
|
|
2f2f26767e | ||
|
|
bffa78c1b8 | ||
|
|
c55719c67a | ||
|
|
cb3b4a6642 | ||
|
|
92c141cee6 | ||
|
|
fd1a1a1c23 | ||
|
|
b835884b2e | ||
|
|
660763908d | ||
|
|
fe8bdb755a | ||
|
|
67dc6d2d23 | ||
|
|
9c8d73cbe2 | ||
|
|
5db97d92dd | ||
|
|
ac470dddb5 | ||
|
|
43063fe8ce | ||
|
|
59e0046c1e | ||
|
|
36ab05c265 | ||
|
|
2b2be05dae | ||
|
|
fb1adbd1ef | ||
|
|
ab68a59b25 | ||
|
|
9c7de767e9 | ||
|
|
8ba5cf7c2e | ||
|
|
b194a19b98 | ||
|
|
1d344b016f | ||
|
|
474f3ef4ca | ||
|
|
9830927020 | ||
|
|
727932a442 | ||
|
|
cd92b51845 | ||
|
|
fe26d16411 | ||
|
|
d68c66ce2b | ||
|
|
e7bfbfb48f | ||
|
|
f2a88ae61c | ||
|
|
e2113f6ee5 | ||
|
|
3867224024 | ||
|
|
9ee0bf43bc | ||
|
|
2844542efa | ||
|
|
e3fcae9392 | ||
|
|
c6ccfa91f3 | ||
|
|
b6fcee1cb9 | ||
|
|
9071befb04 | ||
|
|
bdd5fe98f3 | ||
|
|
a3d3e83a49 | ||
|
|
08bde72028 | ||
|
|
108a136368 | ||
|
|
57d87ad6b1 | ||
|
|
0c22815ff7 | ||
|
|
0ca792ecfd | ||
|
|
987c34c69e | ||
|
|
c1c02bc8ab | ||
|
|
4ee369f27c | ||
|
|
c9012efdcb | ||
|
|
41524fc67d | ||
|
|
04ff61e981 | ||
|
|
532468dc67 | ||
|
|
9c9a2dae47 | ||
|
|
c8a868b57f | ||
|
|
4b3f81ee34 | ||
|
|
afa170ba7c | ||
|
|
46e3b2272e | ||
|
|
52472e90ec | ||
|
|
4ef0d00846 | ||
|
|
580f2537f2 | ||
|
|
3d9fd96026 | ||
|
|
f449b92721 | ||
|
|
3b0216b023 | ||
|
|
98cf839737 | ||
|
|
0bb0846505 | ||
|
|
70969400a3 | ||
|
|
147e8d5d12 | ||
|
|
cacc3e6edd | ||
|
|
a284eca147 | ||
|
|
0d3ba9d7f0 | ||
|
|
be8064d642 | ||
|
|
e30dba742d | ||
|
|
44b72ed647 | ||
|
|
666bd77dac | ||
|
|
0a6613e60d | ||
|
|
62e186c123 | ||
|
|
50dd8f5bcc | ||
|
|
d5fcac9c45 | ||
|
|
c2bed85190 | ||
|
|
183b463ef2 | ||
|
|
92fdac44a0 | ||
|
|
12829ecc73 | ||
|
|
51319c3b26 | ||
|
|
8fd827040b | ||
|
|
5ec46eae0d | ||
|
|
32c03301be | ||
|
|
df7f29b2ab | ||
|
|
e863113c36 | ||
|
|
8e2c1d7382 | ||
|
|
ab7b9cccba | ||
|
|
81bf61a161 | ||
|
|
b40f008647 | ||
|
|
734e41702b | ||
|
|
038dd20a91 | ||
|
|
1dd62b8550 | ||
|
|
715deebe05 | ||
|
|
b3fe3d8590 | ||
|
|
f74c3ed3ea | ||
|
|
2c9aebeeed | ||
|
|
7474f1e11f | ||
|
|
dba9c55b64 | ||
|
|
b432364397 | ||
|
|
696967bdd1 | ||
|
|
b76889efc3 | ||
|
|
e6a7b64ebe | ||
|
|
9daa0df311 | ||
|
|
612800bda5 | ||
|
|
a6bbb1dec9 | ||
|
|
873c93ab64 | ||
|
|
d15242e2d2 | ||
|
|
992d2b937c | ||
|
|
1e05ddad4b | ||
|
|
4f8a64610b | ||
|
|
b82366218c | ||
|
|
acbe1f4cb3 | ||
|
|
4c5e018583 | ||
|
|
6c0380e85c | ||
|
|
fde48e604f | ||
|
|
e83a4de5fb | ||
|
|
927d2799dc | ||
|
|
1ad701fe5d | ||
|
|
086425d2da | ||
|
|
beca54416a | ||
|
|
c92f5c5713 | ||
|
|
dee4e6caff | ||
|
|
dd5a39e72e | ||
|
|
e5ed52165c | ||
|
|
9484f8e0f5 | ||
|
|
947caffe0a | ||
|
|
870090e8df | ||
|
|
73f07f13c5 | ||
|
|
d1952bf591 | ||
|
|
5a612e1332 | ||
|
|
b00a9faea6 | ||
|
|
74db42a703 | ||
|
|
ddf625ca04 | ||
|
|
eca2f017d8 | ||
|
|
3190bde343 | ||
|
|
c6ebf42a47 | ||
|
|
c116b60d12 | ||
|
|
5d09e6d9ab | ||
|
|
2613ce0ac9 | ||
|
|
a88e9b28ea | ||
|
|
f0a3c26ee6 | ||
|
|
84c87ecb32 | ||
|
|
6573f44d41 | ||
|
|
3cacbc552c | ||
|
|
343d623e02 | ||
|
|
6b80bb2b11 | ||
|
|
56fe7452eb | ||
|
|
d3a66f6605 | ||
|
|
dd7b4712f1 | ||
|
|
9df5871f6b | ||
|
|
29aab9e9f4 | ||
|
|
af67eb7f0b | ||
|
|
10482c0141 | ||
|
|
a7a792251a | ||
|
|
aec2308144 | ||
|
|
0741b8aa6a | ||
|
|
3082622394 | ||
|
|
965c9cb0af | ||
|
|
495a46e2d8 | ||
|
|
05bda1192e | ||
|
|
6058af0ca1 | ||
|
|
1eb8bf9719 | ||
|
|
afc02faeda | ||
|
|
66f22de90f | ||
|
|
2949a2e0ff | ||
|
|
ba12efea9d | ||
|
|
e1180a12fb | ||
|
|
1393706f13 | ||
|
|
6f994f31f7 | ||
|
|
38aa99a063 | ||
|
|
85c44b3529 | ||
|
|
e1a2768de5 | ||
|
|
e1c9b27203 | ||
|
|
969f6ef826 | ||
|
|
7abc4d4e76 | ||
|
|
ac97147c1f | ||
|
|
dbd20fe396 | ||
|
|
44e57c9c4b | ||
|
|
488e5e531f | ||
|
|
42a6a8d770 | ||
|
|
f8e877ea05 | ||
|
|
65d6fc7272 | ||
|
|
63ce8e461b | ||
|
|
fbf4c48461 | ||
|
|
81a55db644 | ||
|
|
4d4edfa181 | ||
|
|
6f9182f1f6 | ||
|
|
fa600c03e2 | ||
|
|
4a53301e9f | ||
|
|
676984b3d5 | ||
|
|
e6d7f7248b | ||
|
|
50903b5c4a | ||
|
|
01e399fb91 | ||
|
|
911aeb7af0 | ||
|
|
7e5cd9abbc | ||
|
|
115527a21a | ||
|
|
eff4f4f601 | ||
|
|
16e0099a0d | ||
|
|
2c8c678275 | ||
|
|
3b51e87fbf | ||
|
|
6c6eef5e2b | ||
|
|
6e5910f44c | ||
|
|
a967189bc6 | ||
|
|
7069176cf6 | ||
|
|
44dcbe773d | ||
|
|
ca76975461 | ||
|
|
83122ac99e | ||
|
|
c3e9458555 | ||
|
|
057ba38873 | ||
|
|
81d7d6236b | ||
|
|
191dd49653 | ||
|
|
21e9dd6f51 | ||
|
|
cc2d14acc6 | ||
|
|
87f37e9f1c | ||
|
|
d536a9f874 | ||
|
|
b45f353fa9 | ||
|
|
a3073ec14e | ||
|
|
f77eb33029 | ||
|
|
c1c919097a | ||
|
|
e05348463c | ||
|
|
fdcf74eaf2 | ||
|
|
6d57a3e3b9 | ||
|
|
1f449c866e | ||
|
|
e12deccd24 | ||
|
|
3184ebb5ee | ||
|
|
4a35ed2b35 | ||
|
|
5c9474d1c8 | ||
|
|
2321dc50c5 | ||
|
|
4efd2e8184 | ||
|
|
e30e153bfa | ||
|
|
2724211535 | ||
|
|
81068de0f1 | ||
|
|
7d842175f7 | ||
|
|
e0aee9f361 | ||
|
|
df576e2738 | ||
|
|
bb1356b25d | ||
|
|
1b67960da4 | ||
|
|
d76718e8b2 | ||
|
|
76c51922f1 |
1
.gitattributes
vendored
Normal file
1
.gitattributes
vendored
Normal file
@@ -0,0 +1 @@
|
||||
*.java text eol=lf
|
||||
14
.github/PULL_REQUEST_TEMPLATE.md
vendored
14
.github/PULL_REQUEST_TEMPLATE.md
vendored
@@ -1,12 +1,16 @@
|
||||
# Description
|
||||
** Describe your change here**
|
||||
# Description
|
||||
|
||||
<!-- Describe your change here -->
|
||||
|
||||
# Before submitting a PR:
|
||||
We love getting PRs, but we hate asking people for the same basic changes every time.
|
||||
We love getting PRs, but we hate asking people for the same basic changes every time.
|
||||
|
||||
- [ ] Push your changes to a branch other than `master`. Create your PR from that branch.
|
||||
- [ ] Push your changes to a branch other than `main`. Create your PR from that branch.
|
||||
- [ ] Add JavaDocs and other comments
|
||||
- [ ] Write tests that run and pass in CI. See [CONTRIBUTING.md](CONTRIBUTING.md) for details on how to capture snapshot data.
|
||||
- [ ] Run `mvn clean compile` locally. This may reformat your code, commit those changes.
|
||||
- [ ] Run `mvn -D enable-ci clean install site` locally. If this command doesn't succeed, your change will not pass CI.
|
||||
|
||||
# When creating a PR:
|
||||
|
||||
- [ ] Fill in the "Description" above.
|
||||
- [ ] Enable "Allow edits from maintainers".
|
||||
|
||||
12
.github/dependabot.yml
vendored
Normal file
12
.github/dependabot.yml
vendored
Normal file
@@ -0,0 +1,12 @@
|
||||
version: 2
|
||||
updates:
|
||||
- package-ecosystem: "maven"
|
||||
directory: "/"
|
||||
schedule:
|
||||
interval: "monthly"
|
||||
time: "02:00"
|
||||
- package-ecosystem: "github-actions"
|
||||
directory: "/"
|
||||
schedule:
|
||||
interval: "monthly"
|
||||
time: "02:00"
|
||||
5
.github/release-drafter.yml
vendored
5
.github/release-drafter.yml
vendored
@@ -1,5 +1,6 @@
|
||||
name-template: 'v$NEXT_PATCH_VERSION 🌈'
|
||||
tag-template: 'v$NEXT_PATCH_VERSION'
|
||||
name-template: 'v$NEXT_MINOR_VERSION 🌈'
|
||||
tag-template: 'github-api-$NEXT_MINOR_VERSION'
|
||||
version-template: '$MAJOR.$MINOR'
|
||||
categories:
|
||||
- title: '🚀 Features'
|
||||
labels:
|
||||
|
||||
67
.github/workflows/codeql-analysis.yml
vendored
Normal file
67
.github/workflows/codeql-analysis.yml
vendored
Normal file
@@ -0,0 +1,67 @@
|
||||
# For most projects, this workflow file will not need changing; you simply need
|
||||
# to commit it to your repository.
|
||||
#
|
||||
# You may wish to alter this file to override the set of languages analyzed,
|
||||
# or to provide custom queries or build logic.
|
||||
#
|
||||
# ******** NOTE ********
|
||||
# We have attempted to detect the languages in your repository. Please check
|
||||
# the `language` matrix defined below to confirm you have the correct set of
|
||||
# supported CodeQL languages.
|
||||
#
|
||||
name: "CodeQL"
|
||||
|
||||
on:
|
||||
push:
|
||||
branches: [ main, gh-pages ]
|
||||
pull_request:
|
||||
# The branches below must be a subset of the branches above
|
||||
branches: [ main ]
|
||||
schedule:
|
||||
- cron: '20 0 * * 6'
|
||||
|
||||
jobs:
|
||||
analyze:
|
||||
name: Analyze
|
||||
runs-on: ubuntu-latest
|
||||
|
||||
strategy:
|
||||
fail-fast: false
|
||||
matrix:
|
||||
language: [ 'java' ]
|
||||
# CodeQL supports [ 'cpp', 'csharp', 'go', 'java', 'javascript', 'python' ]
|
||||
# Learn more:
|
||||
# https://docs.github.com/en/free-pro-team@latest/github/finding-security-vulnerabilities-and-errors-in-your-code/configuring-code-scanning#changing-the-languages-that-are-analyzed
|
||||
|
||||
steps:
|
||||
- name: Checkout repository
|
||||
uses: actions/checkout@v2
|
||||
|
||||
# Initializes the CodeQL tools for scanning.
|
||||
- name: Initialize CodeQL
|
||||
uses: github/codeql-action/init@v1
|
||||
with:
|
||||
languages: ${{ matrix.language }}
|
||||
# If you wish to specify custom queries, you can do so here or in a config file.
|
||||
# By default, queries listed here will override any specified in a config file.
|
||||
# Prefix the list here with "+" to use these queries and those in the config file.
|
||||
# queries: ./path/to/local/query, your-org/your-repo/queries@main
|
||||
|
||||
# Autobuild attempts to build any compiled languages (C/C++, C#, or Java).
|
||||
# If this step fails, then you should remove it and run the build manually (see below)
|
||||
- name: Autobuild
|
||||
uses: github/codeql-action/autobuild@v1
|
||||
|
||||
# ℹ️ Command-line programs to run using the OS shell.
|
||||
# 📚 https://git.io/JvXDl
|
||||
|
||||
# ✏️ If the Autobuild fails above, remove it and uncomment the following three lines
|
||||
# and modify them (or add more) to build your code if your project
|
||||
# uses a compiled language
|
||||
|
||||
#- run: |
|
||||
# make bootstrap
|
||||
# make release
|
||||
|
||||
- name: Perform CodeQL Analysis
|
||||
uses: github/codeql-action/analyze@v1
|
||||
48
.github/workflows/maven-build.yml
vendored
48
.github/workflows/maven-build.yml
vendored
@@ -2,42 +2,51 @@ name: CI
|
||||
|
||||
on: [push, pull_request]
|
||||
|
||||
# this is required by spotless for JDK 16+
|
||||
env:
|
||||
JAVA_11_PLUS_MAVEN_OPTS: "--add-opens jdk.compiler/com.sun.tools.javac.util=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.file=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.parser=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.tree=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.api=ALL-UNNAMED"
|
||||
|
||||
jobs:
|
||||
build:
|
||||
name: build-only (Java ${{ matrix.java }})
|
||||
runs-on: ubuntu-latest
|
||||
strategy:
|
||||
fail-fast: false
|
||||
matrix:
|
||||
java: [ 11 ]
|
||||
java: [ 16 ]
|
||||
steps:
|
||||
- uses: actions/checkout@v2
|
||||
- name: Set up JDK
|
||||
uses: actions/setup-java@v1
|
||||
uses: actions/setup-java@v2
|
||||
with:
|
||||
java-version: ${{ matrix.java }}
|
||||
distribution: 'adopt'
|
||||
- name: Cached .m2
|
||||
uses: actions/cache@v1
|
||||
uses: actions/cache@v2.1.6
|
||||
with:
|
||||
path: ~/.m2/repository
|
||||
key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
|
||||
restore-keys: |
|
||||
${{ runner.os }}-maven-
|
||||
- name: Maven Install (skipTests)
|
||||
run: mvn -B install -DskipTests -D enable-ci --file pom.xml
|
||||
env:
|
||||
MAVEN_OPTS: ${{ env.JAVA_11_PLUS_MAVEN_OPTS }}
|
||||
run: mvn -B install -DskipTests --file pom.xml
|
||||
site:
|
||||
name: site (Java ${{ matrix.java }})
|
||||
runs-on: ubuntu-latest
|
||||
strategy:
|
||||
fail-fast: false
|
||||
matrix:
|
||||
java: [ 8, 11 ]
|
||||
steps:
|
||||
- uses: actions/checkout@v2
|
||||
- name: Set up JDK
|
||||
uses: actions/setup-java@v1
|
||||
uses: actions/setup-java@v2
|
||||
with:
|
||||
java-version: ${{ matrix.java }}
|
||||
- uses: actions/cache@v1
|
||||
distribution: 'adopt'
|
||||
- uses: actions/cache@v2.1.6
|
||||
with:
|
||||
path: ~/.m2/repository
|
||||
key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
|
||||
@@ -49,24 +58,41 @@ jobs:
|
||||
name: test (${{ matrix.os }}, Java ${{ matrix.java }})
|
||||
runs-on: ${{ matrix.os }}-latest
|
||||
strategy:
|
||||
fail-fast: false
|
||||
matrix:
|
||||
os: [ ubuntu, windows ]
|
||||
java: [ 8, 11, 13 ]
|
||||
java: [ 8, 11, 16 ]
|
||||
steps:
|
||||
- uses: actions/checkout@v2
|
||||
- name: Set up JDK
|
||||
uses: actions/setup-java@v1
|
||||
uses: actions/setup-java@v2
|
||||
with:
|
||||
java-version: ${{ matrix.java }}
|
||||
- uses: actions/cache@v1
|
||||
distribution: 'adopt'
|
||||
- uses: actions/cache@v2.1.6
|
||||
with:
|
||||
path: ~/.m2/repository
|
||||
key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
|
||||
restore-keys: |
|
||||
${{ runner.os }}-maven-
|
||||
# JDK 8
|
||||
- name: Maven Install without Code Coverage
|
||||
if: matrix.os == 'windows'
|
||||
if: matrix.os == 'windows' && matrix.java == '8'
|
||||
run: mvn -B install --file pom.xml
|
||||
- name: Maven Install with Code Coverage
|
||||
if: matrix.os != 'windows'
|
||||
if: matrix.os != 'windows' && matrix.java == '8'
|
||||
run: mvn -B install -D enable-ci --file pom.xml
|
||||
- name: Codecov Report
|
||||
if: matrix.os != 'windows' && matrix.java == '8'
|
||||
uses: codecov/codecov-action@v1.5.0
|
||||
# JDK 11+
|
||||
- name: Maven Install without Code Coverage
|
||||
if: matrix.os == 'windows' && matrix.java != '8'
|
||||
env:
|
||||
MAVEN_OPTS: ${{ env.JAVA_11_PLUS_MAVEN_OPTS }}
|
||||
run: mvn -B install --file pom.xml "-Dsurefire.argLine=--add-opens java.base/java.net=ALL-UNNAMED"
|
||||
- name: Maven Install with Code Coverage
|
||||
if: matrix.os != 'windows' && matrix.java != '8'
|
||||
env:
|
||||
MAVEN_OPTS: ${{ env.JAVA_11_PLUS_MAVEN_OPTS }}
|
||||
run: mvn -B install -D enable-ci --file pom.xml "-Dsurefire.argLine=--add-opens java.base/java.net=ALL-UNNAMED"
|
||||
|
||||
16
.github/workflows/release-drafter.yml
vendored
Normal file
16
.github/workflows/release-drafter.yml
vendored
Normal file
@@ -0,0 +1,16 @@
|
||||
|
||||
name: Release Drafter
|
||||
|
||||
on:
|
||||
push:
|
||||
branches:
|
||||
- main
|
||||
|
||||
jobs:
|
||||
update_release_draft:
|
||||
runs-on: ubuntu-latest
|
||||
steps:
|
||||
- name: Release Drafter
|
||||
uses: release-drafter/release-drafter@v5
|
||||
env:
|
||||
GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }}
|
||||
1326
CHANGELOG.md
1326
CHANGELOG.md
File diff suppressed because it is too large
Load Diff
@@ -14,10 +14,14 @@ Example:
|
||||
|
||||
This the default behavior.
|
||||
|
||||
Example for a single test case:
|
||||
|
||||
`mvn install -Dtest=WireMockStatusReporterTest#user_whenProxying_AuthCorrectlyConfigured`
|
||||
|
||||
|
||||
### Setting up credential
|
||||
|
||||
1. Create an OAuth token on github.com
|
||||
1. Create a "Personal access token" on https://github.com/ (`Settings` > `Developer settings` > `Personal access tokens`)
|
||||
2. Set the GITHUB_OAUTH environment variable to the value of that token
|
||||
3. Set the system property `test.github.useProxy` (usually like "-Dtest.github.useProxy" as a Java VM option)
|
||||
|
||||
@@ -27,21 +31,37 @@ This the default behavior.
|
||||
|
||||
`WireMockStatusReporterTest: GitHub proxying and user auth correctly configured for user login: <your login>`
|
||||
|
||||
Whenever you run tests with `-Dtest.github.useProxy`, they will try to get data from local files but will fallback to proxying to github if not found.
|
||||
|
||||
Whenever you run tests with `-Dtest.github.useProxy`, they will try to get data from local files but will fallback to proxying to GitHub if not found.
|
||||
|
||||
### Writing a new test
|
||||
|
||||
Once you have credentials setup, you add new test classes and test methods as you would normally.
|
||||
Keep `useProxy` enabled and iterate on your tests as needed. Remember, while proxying your tests are interacting with GitHub - you will need to clean up your state between runs.
|
||||
|
||||
When you are ready to create a snapshot of your test data,
|
||||
run your test with `test.github.takeSnapshot` ("-Dtest.github.takeSnapshot" as a Java VM option). For example:
|
||||
#### Running tests using GitHub test proxy
|
||||
|
||||
`mvn install -Dtest.github.takeSnapshot -Dtest=YourTestClassName`
|
||||
Keep `useProxy` enabled and iterate on your tests as needed. With `useProxy` enabled your tests will interact with
|
||||
GitHub - you will need to clean up your server-state between runs. This can be done manually to start with.
|
||||
Once your test code is somewhat stable, use `getNonRecordingGitHub()` to get a `GitHub` instance for test setup and cleanup.
|
||||
Interactions with that `GitHub` instance will not be recorded as part of the test, keeping the test data files to a minimum.
|
||||
|
||||
The above command would create snapshot WireMock data files under the path `src/test/resources/org/kohsuhke/github/YourTestClassName/wiremock`.
|
||||
Each method would get a separate director that would hold the data files for that test method.
|
||||
#### Running tests against your personal GitHub user account
|
||||
|
||||
By default, test helper methods such as `getTempRepository()` target the `hub4j-test-org` GitHub organization.
|
||||
Please request access to this org to record your tests before submitting a PR. This helps keep the project stable and nimble.
|
||||
Until you have access (or if you don't want access), you can set the following additional system property to target
|
||||
your personal github account.
|
||||
|
||||
`mvn install -Dtest.github.org=false -Dtest=YourTestClassName`
|
||||
|
||||
#### Taking a snapshot
|
||||
|
||||
When you are ready to create a snapshot of your test data, run your test with `test.github.takeSnapshot` ("-Dtest.github.takeSnapshot" as
|
||||
a Java VM option). For example:
|
||||
|
||||
`mvn install -Dtest.github.takeSnapshot -Dtest.github.org=false -Dtest=YourTestClassName`
|
||||
|
||||
The above command will create snapshot WireMock data files under the path `src/test/resources/org/kohsuhke/github/YourTestClassName/wiremock`.
|
||||
Each method will get a separate directory that will hold the data files for that test method.
|
||||
|
||||
Add all files including the generated data to your commit and submit a PR.
|
||||
|
||||
|
||||
@@ -1,9 +1,9 @@
|
||||
# Java API for GitHub
|
||||
|
||||
[](https://mvnrepository.com/artifact/org.kohsuke/github-api)
|
||||
[](https://gitter.im/github-api/github-api?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
|
||||

|
||||
|
||||
[](https://gitter.im/hub4j/github-api?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
|
||||

|
||||
[](https://codecov.io/gh/hub4j/github-api)
|
||||
|
||||
|
||||
See https://github-api.kohsuke.org/ for more details
|
||||
|
||||
7
codecov.yml
Normal file
7
codecov.yml
Normal file
@@ -0,0 +1,7 @@
|
||||
ignore:
|
||||
- "**/extras/okhttp3/ObsoleteUrlFactory**"
|
||||
- "**/extras/OkHttpConnector"
|
||||
- "**/extras/OkHttp3Connector"
|
||||
- "**/example/**"
|
||||
- "**/github/EnforcementLevel"
|
||||
|
||||
279
pom.xml
279
pom.xml
@@ -2,16 +2,16 @@
|
||||
<modelVersion>4.0.0</modelVersion>
|
||||
<groupId>org.kohsuke</groupId>
|
||||
<artifactId>github-api</artifactId>
|
||||
<version>1.110</version>
|
||||
<version>1.131-SNAPSHOT</version>
|
||||
<name>GitHub API for Java</name>
|
||||
<url>https://github-api.kohsuke.org/</url>
|
||||
<description>GitHub API for Java</description>
|
||||
|
||||
<scm>
|
||||
<connection>scm:git:git@github.com/github-api/${project.artifactId}.git</connection>
|
||||
<developerConnection>scm:git:ssh://git@github.com/github-api/${project.artifactId}.git</developerConnection>
|
||||
<url>https://github.com/github-api/github-api/</url>
|
||||
<tag>github-api-1.110</tag>
|
||||
<connection>scm:git:git@github.com/hub4j/${project.artifactId}.git</connection>
|
||||
<developerConnection>scm:git:ssh://git@github.com/hub4j/${project.artifactId}.git</developerConnection>
|
||||
<url>https://github.com/hub4j/github-api/</url>
|
||||
<tag>HEAD</tag>
|
||||
</scm>
|
||||
|
||||
<distributionManagement>
|
||||
@@ -27,25 +27,27 @@
|
||||
</repository>
|
||||
<site>
|
||||
<id>github-pages</id>
|
||||
<url>gitsite:git@github.com/github-api/${project.artifactId}.git</url>
|
||||
<url>gitsite:git@github.com/hub4j/${project.artifactId}.git</url>
|
||||
</site>
|
||||
</distributionManagement>
|
||||
|
||||
<properties>
|
||||
<project.build.sourceEncoding>UTF-8</project.build.sourceEncoding>
|
||||
<spotbugs-maven-plugin.version>4.0.0</spotbugs-maven-plugin.version>
|
||||
<spotbugs.version>4.0.1</spotbugs.version>
|
||||
<spotbugs-maven-plugin.version>4.2.3</spotbugs-maven-plugin.version>
|
||||
<spotbugs.version>4.2.3</spotbugs.version>
|
||||
<spotbugs-maven-plugin.failOnError>true</spotbugs-maven-plugin.failOnError>
|
||||
<hamcrest.version>2.2</hamcrest.version>
|
||||
<okhttp3.version>4.4.1</okhttp3.version>
|
||||
<okio.version>2.5.0</okio.version>
|
||||
<formatter-maven-plugin.goal>format</formatter-maven-plugin.goal>
|
||||
<impsort-maven-plugin.goal>sort</impsort-maven-plugin.goal>
|
||||
<!-- Using this as the minimum bar for code coverage. Adding methods without covering them will fail this. -->
|
||||
<jacoco.coverage.target.bundle.method>0.60</jacoco.coverage.target.bundle.method>
|
||||
<jacoco.coverage.target.class.method>0.25</jacoco.coverage.target.class.method>
|
||||
<jacoco.coverage.target.bundle.method>0.70</jacoco.coverage.target.bundle.method>
|
||||
<jacoco.coverage.target.class.method>0.50</jacoco.coverage.target.class.method>
|
||||
<!-- For non-ci builds we'd like the build to still complete if jacoco metrics aren't met. -->
|
||||
<jacoco.haltOnFailure>false</jacoco.haltOnFailure>
|
||||
<jjwt.suite.version>0.11.2</jjwt.suite.version>
|
||||
|
||||
<jacoco.surefire.argLine />
|
||||
<surefire.argLine />
|
||||
</properties>
|
||||
|
||||
<build>
|
||||
@@ -79,6 +81,14 @@
|
||||
</testResources>
|
||||
<pluginManagement>
|
||||
<plugins>
|
||||
<plugin>
|
||||
<artifactId>maven-surefire-plugin</artifactId>
|
||||
<version>2.22.2</version>
|
||||
<configuration>
|
||||
<!-- SUREFIRE-1226 workaround -->
|
||||
<trimStackTrace>false</trimStackTrace>
|
||||
</configuration>
|
||||
</plugin>
|
||||
<plugin>
|
||||
<groupId>org.apache.maven.plugins</groupId>
|
||||
<artifactId>maven-source-plugin</artifactId>
|
||||
@@ -92,12 +102,17 @@
|
||||
<plugin>
|
||||
<groupId>org.jacoco</groupId>
|
||||
<artifactId>jacoco-maven-plugin</artifactId>
|
||||
<version>0.8.5</version>
|
||||
<version>0.8.7</version>
|
||||
<executions>
|
||||
<execution>
|
||||
<goals>
|
||||
<goal>prepare-agent</goal>
|
||||
</goals>
|
||||
<configuration>
|
||||
<propertyName>jacoco.surefire.argLine</propertyName>
|
||||
<!-- no need to get data about external code. It dramatically reduces performance of JaCoCo for nothing -->
|
||||
<include>org.kohsuke.*</include>
|
||||
</configuration>
|
||||
</execution>
|
||||
<!-- attached to Maven test phase -->
|
||||
<execution>
|
||||
@@ -145,59 +160,41 @@
|
||||
<!-- Sample only -->
|
||||
<exclude>org.kohsuke.github.example.*</exclude>
|
||||
|
||||
<!-- No methods -->
|
||||
<exclude>org.kohsuke.github.Previews</exclude>
|
||||
|
||||
<!-- Deprecated -->
|
||||
<exclude>org.kohsuke.github.extras.OkHttpConnector</exclude>
|
||||
<exclude>org.kohsuke.github.extras.OkHttp3Connector</exclude>
|
||||
<exclude>org.kohsuke.github.EnforcementLevel</exclude>
|
||||
<exclude>org.kohsuke.github.GHPerson.1</exclude>
|
||||
|
||||
<!-- These fail coverage on windows because tests are disabled -->
|
||||
<exclude>org.kohsuke.github.GHAsset</exclude>
|
||||
<exclude>org.kohsuke.github.GHReleaseBuilder</exclude>
|
||||
<exclude>org.kohsuke.github.GHRelease</exclude>
|
||||
|
||||
<!-- TODO: Some coverage, but more needed -->
|
||||
<exclude>org.kohsuke.github.GHPullRequestReviewBuilder.DraftReviewComment</exclude>
|
||||
<exclude>org.kohsuke.github.GHIssue.PullRequest</exclude>
|
||||
<exclude>org.kohsuke.github.GHCommitSearchBuilder</exclude>
|
||||
<exclude>org.kohsuke.github.GHRepositorySearchBuilder</exclude>
|
||||
<exclude>org.kohsuke.github.GHUserSearchBuilder</exclude>
|
||||
|
||||
<!-- TODO: These still need test coverage -->
|
||||
<exclude>org.kohsuke.github.GHBranchProtection.RequiredSignatures</exclude>
|
||||
<exclude>org.kohsuke.github.GHBranchProtectionBuilder.Restrictions</exclude>
|
||||
<exclude>org.kohsuke.github.GHBranchProtection.Restrictions</exclude>
|
||||
<exclude>org.kohsuke.github.GHCommentAuthorAssociation</exclude>
|
||||
<exclude>org.kohsuke.github.GHCommitBuilder.UserInfo</exclude>
|
||||
<exclude>org.kohsuke.github.GHCommitState</exclude>
|
||||
<exclude>org.kohsuke.github.GHCompare.Commit</exclude>
|
||||
<exclude>org.kohsuke.github.GHCompare.InnerCommit</exclude>
|
||||
<exclude>org.kohsuke.github.GHCompare.Status</exclude>
|
||||
<exclude>org.kohsuke.github.GHCompare.Tree</exclude>
|
||||
<exclude>org.kohsuke.github.GHCompare.User</exclude>
|
||||
<exclude>org.kohsuke.github.GHCompare</exclude>
|
||||
<exclude>org.kohsuke.github.GHDeployKey</exclude>
|
||||
<exclude>org.kohsuke.github.GHDeploymentStatusBuilder</exclude>
|
||||
<exclude>org.kohsuke.github.GHDirection</exclude>
|
||||
<exclude>org.kohsuke.github.GHEmail</exclude>
|
||||
<exclude>org.kohsuke.github.GHEventPayload.Ping</exclude>
|
||||
<exclude>org.kohsuke.github.GHEventPayload.Release</exclude>
|
||||
<exclude>org.kohsuke.github.GHException</exclude>
|
||||
<exclude>org.kohsuke.github.GHHook</exclude>
|
||||
<exclude>org.kohsuke.github.GHHooks.OrgContext</exclude>
|
||||
<exclude>org.kohsuke.github.GHInvitation</exclude>
|
||||
<exclude>org.kohsuke.github.GHMilestoneState</exclude>
|
||||
<exclude>org.kohsuke.github.GHOrgHook</exclude>
|
||||
<exclude>org.kohsuke.github.GHProject.ProjectStateFilter</exclude>
|
||||
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.Authorship</exclude>
|
||||
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.Commit</exclude>
|
||||
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.CommitPointer</exclude>
|
||||
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.Tree</exclude>
|
||||
<exclude>org.kohsuke.github.GHPullRequestCommitDetail</exclude>
|
||||
<exclude>org.kohsuke.github.GHPullRequestFileDetail</exclude>
|
||||
<exclude>org.kohsuke.github.GHPullRequestQueryBuilder.Sort</exclude>
|
||||
<exclude>org.kohsuke.github.GHReleaseUpdater</exclude>
|
||||
<exclude>org.kohsuke.github.GHRepository.ForkSort</exclude>
|
||||
<exclude>org.kohsuke.github.GHRequestedAction</exclude>
|
||||
<exclude>org.kohsuke.github.GHStargazer</exclude>
|
||||
<exclude>org.kohsuke.github.GHTagObject</exclude>
|
||||
<exclude>org.kohsuke.github.GHTeam.Role</exclude>
|
||||
<exclude>org.kohsuke.github.GHUserSearchBuilder.Sort</exclude>
|
||||
<exclude>org.kohsuke.github.GHVerifiedKey</exclude>
|
||||
</excludes>
|
||||
</rule>
|
||||
@@ -209,7 +206,7 @@
|
||||
<plugin>
|
||||
<groupId>org.apache.maven.plugins</groupId>
|
||||
<artifactId>maven-javadoc-plugin</artifactId>
|
||||
<version>3.2.0</version>
|
||||
<version>3.3.0</version>
|
||||
<configuration>
|
||||
<source>8</source>
|
||||
<failOnWarnings>true</failOnWarnings>
|
||||
@@ -233,7 +230,7 @@
|
||||
<plugin>
|
||||
<groupId>org.apache.maven.plugins</groupId>
|
||||
<artifactId>maven-site-plugin</artifactId>
|
||||
<version>3.9.0</version>
|
||||
<version>3.9.1</version>
|
||||
</plugin>
|
||||
<plugin>
|
||||
<groupId>org.apache.maven.plugins</groupId>
|
||||
@@ -253,12 +250,12 @@
|
||||
<plugin>
|
||||
<groupId>org.apache.maven.plugins</groupId>
|
||||
<artifactId>maven-project-info-reports-plugin</artifactId>
|
||||
<version>3.0.0</version>
|
||||
<version>3.1.2</version>
|
||||
<dependencies>
|
||||
<dependency>
|
||||
<groupId>org.apache.bcel</groupId>
|
||||
<artifactId>bcel</artifactId>
|
||||
<version>6.4.1</version>
|
||||
<version>6.5.0</version>
|
||||
</dependency>
|
||||
</dependencies>
|
||||
</plugin>
|
||||
@@ -280,16 +277,20 @@
|
||||
|
||||
<plugin>
|
||||
<artifactId>maven-surefire-plugin</artifactId>
|
||||
<version>2.22.2</version>
|
||||
<configuration>
|
||||
<!-- SUREFIRE-1226 workaround -->
|
||||
<trimStackTrace>false</trimStackTrace>
|
||||
</configuration>
|
||||
<executions>
|
||||
<execution>
|
||||
<id>default-test</id>
|
||||
<configuration>
|
||||
<excludesFile>src/test/resources/slow-or-flaky-tests.txt</excludesFile>
|
||||
<argLine>@{jacoco.surefire.argLine} ${surefire.argLine}</argLine>
|
||||
</configuration>
|
||||
</execution>
|
||||
</executions>
|
||||
</plugin>
|
||||
<plugin>
|
||||
<groupId>org.codehaus.mojo</groupId>
|
||||
<artifactId>animal-sniffer-maven-plugin</artifactId>
|
||||
<version>1.18</version>
|
||||
<version>1.20</version>
|
||||
<configuration>
|
||||
<signature>
|
||||
<groupId>org.codehaus.mojo.signature</groupId>
|
||||
@@ -320,36 +321,35 @@
|
||||
</executions>
|
||||
</plugin>
|
||||
<plugin>
|
||||
<groupId>net.revelc.code.formatter</groupId>
|
||||
<artifactId>formatter-maven-plugin</artifactId>
|
||||
<version>2.11.0</version>
|
||||
<groupId>com.diffplug.spotless</groupId>
|
||||
<artifactId>spotless-maven-plugin</artifactId>
|
||||
<version>2.11.1</version>
|
||||
<executions>
|
||||
<execution>
|
||||
<id>spotless-check</id>
|
||||
<!-- runs in verify phase by default -->
|
||||
<goals>
|
||||
<goal>${formatter-maven-plugin.goal}</goal>
|
||||
<!-- can be disabled using -Dspotless.check.skip=true -->
|
||||
<goal>check</goal>
|
||||
</goals>
|
||||
<configuration>
|
||||
<configFile>src/main/resources/eclipse/formatter.xml</configFile>
|
||||
</configuration>
|
||||
</execution>
|
||||
</executions>
|
||||
</plugin>
|
||||
<plugin>
|
||||
<groupId>net.revelc.code</groupId>
|
||||
<artifactId>impsort-maven-plugin</artifactId>
|
||||
<version>1.3.2</version>
|
||||
<configuration>
|
||||
<groups>*,java.,javax.</groups>
|
||||
<removeUnused>true</removeUnused>
|
||||
<staticAfter>true</staticAfter>
|
||||
<java>
|
||||
<eclipse>
|
||||
<file>${basedir}/src/build/eclipse/formatter.xml</file>
|
||||
</eclipse>
|
||||
|
||||
<importOrder>
|
||||
<file>${basedir}/src/build/eclipse/eclipse.importorder</file>
|
||||
</importOrder>
|
||||
<removeUnusedImports />
|
||||
|
||||
<trimTrailingWhitespace />
|
||||
<endWithNewline />
|
||||
|
||||
</java>
|
||||
</configuration>
|
||||
<executions>
|
||||
<execution>
|
||||
<goals>
|
||||
<goal>${impsort-maven-plugin.goal}</goal>
|
||||
</goals>
|
||||
</execution>
|
||||
</executions>
|
||||
</plugin>
|
||||
<plugin>
|
||||
<groupId>com.github.spotbugs</groupId>
|
||||
@@ -386,6 +386,12 @@
|
||||
<artifactId>commons-lang3</artifactId>
|
||||
<version>3.9</version>
|
||||
</dependency>
|
||||
<dependency>
|
||||
<groupId>com.tngtech.archunit</groupId>
|
||||
<artifactId>archunit</artifactId>
|
||||
<version>0.19.0</version>
|
||||
<scope>test</scope>
|
||||
</dependency>
|
||||
<dependency>
|
||||
<groupId>org.hamcrest</groupId>
|
||||
<artifactId>hamcrest</artifactId>
|
||||
@@ -408,23 +414,29 @@
|
||||
<dependency>
|
||||
<groupId>junit</groupId>
|
||||
<artifactId>junit</artifactId>
|
||||
<version>4.13</version>
|
||||
<version>4.13.2</version>
|
||||
<scope>test</scope>
|
||||
</dependency>
|
||||
<dependency>
|
||||
<groupId>org.awaitility</groupId>
|
||||
<artifactId>awaitility</artifactId>
|
||||
<version>4.1.0</version>
|
||||
<scope>test</scope>
|
||||
</dependency>
|
||||
<dependency>
|
||||
<groupId>com.fasterxml.jackson.core</groupId>
|
||||
<artifactId>jackson-databind</artifactId>
|
||||
<version>2.10.2</version>
|
||||
<version>2.12.3</version>
|
||||
</dependency>
|
||||
<dependency>
|
||||
<groupId>commons-io</groupId>
|
||||
<artifactId>commons-io</artifactId>
|
||||
<version>2.4</version>
|
||||
<version>2.8.0</version>
|
||||
</dependency>
|
||||
<dependency>
|
||||
<groupId>com.infradna.tool</groupId>
|
||||
<artifactId>bridge-method-annotation</artifactId>
|
||||
<version>1.18</version>
|
||||
<version>1.21</version>
|
||||
<optional>true</optional>
|
||||
</dependency>
|
||||
<!-- for stapler-jetty -->
|
||||
@@ -445,7 +457,7 @@
|
||||
<dependency>
|
||||
<groupId>org.kohsuke.stapler</groupId>
|
||||
<artifactId>stapler</artifactId>
|
||||
<version>1.259</version>
|
||||
<version>1.263</version>
|
||||
<scope>test</scope>
|
||||
</dependency>
|
||||
<dependency>
|
||||
@@ -457,9 +469,27 @@
|
||||
<dependency>
|
||||
<groupId>org.eclipse.jgit</groupId>
|
||||
<artifactId>org.eclipse.jgit</artifactId>
|
||||
<version>5.7.0.202003110725-r</version>
|
||||
<version>5.11.1.202105131744-r</version>
|
||||
<scope>test</scope>
|
||||
</dependency>
|
||||
<dependency>
|
||||
<groupId>io.jsonwebtoken</groupId>
|
||||
<artifactId>jjwt-api</artifactId>
|
||||
<version>${jjwt.suite.version}</version>
|
||||
<optional>true</optional>
|
||||
</dependency>
|
||||
<dependency>
|
||||
<groupId>io.jsonwebtoken</groupId>
|
||||
<artifactId>jjwt-impl</artifactId>
|
||||
<version>${jjwt.suite.version}</version>
|
||||
<optional>true</optional>
|
||||
</dependency>
|
||||
<dependency>
|
||||
<groupId>io.jsonwebtoken</groupId>
|
||||
<artifactId>jjwt-jackson</artifactId>
|
||||
<version>${jjwt.suite.version}</version>
|
||||
<optional>true</optional>
|
||||
</dependency>
|
||||
<dependency>
|
||||
<groupId>com.squareup.okio</groupId>
|
||||
<artifactId>okio</artifactId>
|
||||
@@ -489,13 +519,13 @@
|
||||
<dependency>
|
||||
<groupId>org.kohsuke</groupId>
|
||||
<artifactId>wordnet-random-name</artifactId>
|
||||
<version>1.3</version>
|
||||
<version>1.5</version>
|
||||
<scope>test</scope>
|
||||
</dependency>
|
||||
<dependency>
|
||||
<groupId>org.mockito</groupId>
|
||||
<artifactId>mockito-core</artifactId>
|
||||
<version>3.3.3</version>
|
||||
<version>3.10.0</version>
|
||||
<scope>test</scope>
|
||||
</dependency>
|
||||
<dependency>
|
||||
@@ -507,13 +537,19 @@
|
||||
<dependency>
|
||||
<groupId>com.github.tomakehurst</groupId>
|
||||
<artifactId>wiremock-jre8-standalone</artifactId>
|
||||
<version>2.26.3</version>
|
||||
<version>2.28.0</version>
|
||||
<scope>test</scope>
|
||||
</dependency>
|
||||
<dependency>
|
||||
<groupId>com.google.code.gson</groupId>
|
||||
<artifactId>gson</artifactId>
|
||||
<version>2.8.6</version>
|
||||
<version>2.8.7</version>
|
||||
<scope>test</scope>
|
||||
</dependency>
|
||||
<dependency>
|
||||
<groupId>org.slf4j</groupId>
|
||||
<artifactId>slf4j-simple</artifactId>
|
||||
<version>1.7.30</version>
|
||||
<scope>test</scope>
|
||||
</dependency>
|
||||
</dependencies>
|
||||
@@ -530,6 +566,38 @@
|
||||
</pluginRepository>
|
||||
</pluginRepositories>
|
||||
<profiles>
|
||||
<!-- only enable slow-or-flaky-test if -Dtest= is not present -->
|
||||
<profile>
|
||||
<id>slow-or-flaky-test</id>
|
||||
<activation>
|
||||
<property>
|
||||
<name>!test</name>
|
||||
</property>
|
||||
</activation>
|
||||
<build>
|
||||
<plugins>
|
||||
<plugin>
|
||||
<artifactId>maven-surefire-plugin</artifactId>
|
||||
<executions>
|
||||
<execution>
|
||||
<id>slow-or-flaky-test</id>
|
||||
<phase>test</phase>
|
||||
<goals>
|
||||
<goal>test</goal>
|
||||
</goals>
|
||||
<configuration>
|
||||
<rerunFailingTestsCount>2</rerunFailingTestsCount>
|
||||
<!-- There are some tests that take longer or are a little
|
||||
flaky. Run them here. -->
|
||||
<includesFile>src/test/resources/slow-or-flaky-tests.txt</includesFile>
|
||||
<argLine>@{jacoco.surefire.argLine} ${surefire.argLine}</argLine>
|
||||
</configuration>
|
||||
</execution>
|
||||
</executions>
|
||||
</plugin>
|
||||
</plugins>
|
||||
</build>
|
||||
</profile>
|
||||
<profile>
|
||||
<id>ci-non-windows</id>
|
||||
<activation>
|
||||
@@ -541,8 +609,8 @@
|
||||
</os>
|
||||
</activation>
|
||||
<properties>
|
||||
<formatter-maven-plugin.goal>validate</formatter-maven-plugin.goal>
|
||||
<impsort-maven-plugin.goal>check</impsort-maven-plugin.goal>
|
||||
<!-- Only fail code coverage on non-windows machines -->
|
||||
<jacoco.haltOnFailure>true</jacoco.haltOnFailure>
|
||||
</properties>
|
||||
</profile>
|
||||
<profile>
|
||||
@@ -552,24 +620,55 @@
|
||||
<name>enable-ci</name>
|
||||
</property>
|
||||
</activation>
|
||||
<properties>
|
||||
<jacoco.haltOnFailure>true</jacoco.haltOnFailure>
|
||||
</properties>
|
||||
<build>
|
||||
<plugins>
|
||||
<plugin>
|
||||
<groupId>org.jacoco</groupId>
|
||||
<artifactId>jacoco-maven-plugin</artifactId>
|
||||
</plugin>
|
||||
<plugin>
|
||||
<groupId>com.diffplug.spotless</groupId>
|
||||
<artifactId>spotless-maven-plugin</artifactId>
|
||||
<executions>
|
||||
<execution>
|
||||
<id>spotless-check</id>
|
||||
<!-- In CI, run check early in the build -->
|
||||
<phase>process-sources</phase>
|
||||
<goals>
|
||||
<goal>check</goal>
|
||||
</goals>
|
||||
</execution>
|
||||
</executions>
|
||||
</plugin>
|
||||
<plugin>
|
||||
<groupId>org.apache.maven.plugins</groupId>
|
||||
<artifactId>maven-enforcer-plugin</artifactId>
|
||||
<version>3.0.0-M3</version>
|
||||
<executions>
|
||||
<execution>
|
||||
<id>enforce-jacoco-exist</id>
|
||||
<phase>verify</phase>
|
||||
<goals>
|
||||
<goal>enforce</goal>
|
||||
</goals>
|
||||
<configuration>
|
||||
<rules>
|
||||
<requireFilesExist>
|
||||
<files>
|
||||
<file>${project.build.directory}/jacoco.exec</file>
|
||||
</files>
|
||||
</requireFilesExist>
|
||||
</rules>
|
||||
<fail>true</fail>
|
||||
</configuration>
|
||||
</execution>
|
||||
</executions>
|
||||
</plugin>
|
||||
</plugins>
|
||||
</build>
|
||||
</profile>
|
||||
<profile>
|
||||
<id>release</id>
|
||||
<properties>
|
||||
<formatter-maven-plugin.goal>validate</formatter-maven-plugin.goal>
|
||||
<impsort-maven-plugin.goal>check</impsort-maven-plugin.goal>
|
||||
</properties>
|
||||
<build>
|
||||
<plugins>
|
||||
<plugin>
|
||||
|
||||
6
src/build/eclipse/eclipse.importorder
Normal file
6
src/build/eclipse/eclipse.importorder
Normal file
@@ -0,0 +1,6 @@
|
||||
#Organize Import Order
|
||||
# Import this file in Window -> Preferences -> Java -> Code Style -> Organize Imports -> Import...
|
||||
0=
|
||||
1=java
|
||||
2=javax
|
||||
3=\#
|
||||
@@ -12,14 +12,14 @@ import javax.annotation.Nonnull;
|
||||
* <p>
|
||||
* Batching looks like this:
|
||||
* </p>
|
||||
*
|
||||
*
|
||||
* <pre>
|
||||
* update().someName(value).otherName(value).done()
|
||||
* </pre>
|
||||
* <p>
|
||||
* Single changes look like this:
|
||||
* </p>
|
||||
*
|
||||
*
|
||||
* <pre>
|
||||
* set().someName(value);
|
||||
* set().otherName(value);
|
||||
@@ -38,7 +38,7 @@ import javax.annotation.Nonnull;
|
||||
* Intermediate return type for this builder returned by calls to {@link #with(String, Object)}. If {@link S}
|
||||
* the same as {@link R}, this builder will commit changes after each call to {@link #with(String, Object)}.
|
||||
*/
|
||||
abstract class AbstractBuilder<R, S> {
|
||||
abstract class AbstractBuilder<R, S> extends GitHubInteractiveObject {
|
||||
|
||||
@Nonnull
|
||||
private final Class<R> returnType;
|
||||
@@ -75,6 +75,7 @@ abstract class AbstractBuilder<R, S> {
|
||||
@Nonnull Class<S> intermediateReturnType,
|
||||
@Nonnull GitHub root,
|
||||
@CheckForNull R baseInstance) {
|
||||
super(root);
|
||||
this.requester = root.createRequest();
|
||||
this.returnType = finalReturnType;
|
||||
this.commitChangesImmediately = returnType.equals(intermediateReturnType);
|
||||
@@ -97,7 +98,7 @@ abstract class AbstractBuilder<R, S> {
|
||||
* if there is an I/O Exception
|
||||
*/
|
||||
@Nonnull
|
||||
@Preview
|
||||
@BetaApi
|
||||
@Deprecated
|
||||
public R done() throws IOException {
|
||||
R result;
|
||||
@@ -127,7 +128,7 @@ abstract class AbstractBuilder<R, S> {
|
||||
* if an I/O error occurs
|
||||
*/
|
||||
@Nonnull
|
||||
@Preview
|
||||
@BetaApi
|
||||
@Deprecated
|
||||
protected S with(@Nonnull String name, Object value) throws IOException {
|
||||
requester.with(name, value);
|
||||
@@ -148,7 +149,7 @@ abstract class AbstractBuilder<R, S> {
|
||||
* if an I/O error occurs
|
||||
*/
|
||||
@Nonnull
|
||||
@Preview
|
||||
@BetaApi
|
||||
@Deprecated
|
||||
protected S continueOrDone() throws IOException {
|
||||
// This little bit of roughness in this base class means all inheriting builders get to create Updater and
|
||||
|
||||
18
src/main/java/org/kohsuke/github/BetaApi.java
Normal file
18
src/main/java/org/kohsuke/github/BetaApi.java
Normal file
@@ -0,0 +1,18 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import java.lang.annotation.Documented;
|
||||
import java.lang.annotation.Retention;
|
||||
import java.lang.annotation.RetentionPolicy;
|
||||
|
||||
/**
|
||||
* Indicates that the method/class/etc marked is a beta implementation of an sdk feature.
|
||||
* <p>
|
||||
* These APIs are subject to change and not a part of the backward compatibility commitment. Always used in conjunction
|
||||
* with 'deprecated' to raise awareness to clients.
|
||||
* </p>
|
||||
*
|
||||
*/
|
||||
@Retention(RetentionPolicy.RUNTIME)
|
||||
@Documented
|
||||
public @interface BetaApi {
|
||||
}
|
||||
@@ -1,11 +1,14 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import org.kohsuke.github.internal.EnumUtils;
|
||||
|
||||
import java.io.IOException;
|
||||
import java.net.URL;
|
||||
import java.util.List;
|
||||
import java.util.Map;
|
||||
import java.util.stream.Collectors;
|
||||
|
||||
import static org.kohsuke.github.Previews.MACHINE_MAN;
|
||||
import static org.kohsuke.github.internal.Previews.MACHINE_MAN;
|
||||
|
||||
/**
|
||||
* A Github App.
|
||||
@@ -15,13 +18,12 @@ import static org.kohsuke.github.Previews.MACHINE_MAN;
|
||||
*/
|
||||
public class GHApp extends GHObject {
|
||||
|
||||
private GitHub root;
|
||||
private GHUser owner;
|
||||
private String name;
|
||||
private String description;
|
||||
private String externalUrl;
|
||||
private Map<String, String> permissions;
|
||||
private List<GHEvent> events;
|
||||
private List<String> events;
|
||||
private long installationsCount;
|
||||
private String htmlUrl;
|
||||
|
||||
@@ -39,7 +41,9 @@ public class GHApp extends GHObject {
|
||||
*
|
||||
* @param owner
|
||||
* the owner
|
||||
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||
*/
|
||||
@Deprecated
|
||||
public void setOwner(GHUser owner) {
|
||||
this.owner = owner;
|
||||
}
|
||||
@@ -58,7 +62,9 @@ public class GHApp extends GHObject {
|
||||
*
|
||||
* @param name
|
||||
* the name
|
||||
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||
*/
|
||||
@Deprecated
|
||||
public void setName(String name) {
|
||||
this.name = name;
|
||||
}
|
||||
@@ -77,7 +83,9 @@ public class GHApp extends GHObject {
|
||||
*
|
||||
* @param description
|
||||
* the description
|
||||
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||
*/
|
||||
@Deprecated
|
||||
public void setDescription(String description) {
|
||||
this.description = description;
|
||||
}
|
||||
@@ -96,7 +104,9 @@ public class GHApp extends GHObject {
|
||||
*
|
||||
* @param externalUrl
|
||||
* the external url
|
||||
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||
*/
|
||||
@Deprecated
|
||||
public void setExternalUrl(String externalUrl) {
|
||||
this.externalUrl = externalUrl;
|
||||
}
|
||||
@@ -107,7 +117,9 @@ public class GHApp extends GHObject {
|
||||
* @return the events
|
||||
*/
|
||||
public List<GHEvent> getEvents() {
|
||||
return events;
|
||||
return events.stream()
|
||||
.map(e -> EnumUtils.getEnumOrDefault(GHEvent.class, e, GHEvent.UNKNOWN))
|
||||
.collect(Collectors.toList());
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -115,9 +127,11 @@ public class GHApp extends GHObject {
|
||||
*
|
||||
* @param events
|
||||
* the events
|
||||
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||
*/
|
||||
@Deprecated
|
||||
public void setEvents(List<GHEvent> events) {
|
||||
this.events = events;
|
||||
this.events = events.stream().map(GHEvent::symbol).collect(Collectors.toList());
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -134,7 +148,9 @@ public class GHApp extends GHObject {
|
||||
*
|
||||
* @param installationsCount
|
||||
* the installations count
|
||||
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||
*/
|
||||
@Deprecated
|
||||
public void setInstallationsCount(long installationsCount) {
|
||||
this.installationsCount = installationsCount;
|
||||
}
|
||||
@@ -157,7 +173,9 @@ public class GHApp extends GHObject {
|
||||
*
|
||||
* @param permissions
|
||||
* the permissions
|
||||
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||
*/
|
||||
@Deprecated
|
||||
public void setPermissions(Map<String, String> permissions) {
|
||||
this.permissions = permissions;
|
||||
}
|
||||
@@ -175,7 +193,7 @@ public class GHApp extends GHObject {
|
||||
* @return a list of App installations
|
||||
* @see <a href="https://developer.github.com/v3/apps/#list-installations">List installations</a>
|
||||
*/
|
||||
@Preview
|
||||
@Preview(MACHINE_MAN)
|
||||
@Deprecated
|
||||
public PagedIterable<GHAppInstallation> listInstallations() {
|
||||
return root.createRequest()
|
||||
@@ -196,7 +214,7 @@ public class GHApp extends GHObject {
|
||||
* on error
|
||||
* @see <a href="https://developer.github.com/v3/apps/#get-an-installation">Get an installation</a>
|
||||
*/
|
||||
@Preview
|
||||
@Preview(MACHINE_MAN)
|
||||
@Deprecated
|
||||
public GHAppInstallation getInstallationById(long id) throws IOException {
|
||||
return root.createRequest()
|
||||
@@ -219,7 +237,7 @@ public class GHApp extends GHObject {
|
||||
* @see <a href="https://developer.github.com/v3/apps/#get-an-organization-installation">Get an organization
|
||||
* installation</a>
|
||||
*/
|
||||
@Preview
|
||||
@Preview(MACHINE_MAN)
|
||||
@Deprecated
|
||||
public GHAppInstallation getInstallationByOrganization(String name) throws IOException {
|
||||
return root.createRequest()
|
||||
@@ -244,7 +262,7 @@ public class GHApp extends GHObject {
|
||||
* @see <a href="https://developer.github.com/v3/apps/#get-a-repository-installation">Get a repository
|
||||
* installation</a>
|
||||
*/
|
||||
@Preview
|
||||
@Preview(MACHINE_MAN)
|
||||
@Deprecated
|
||||
public GHAppInstallation getInstallationByRepository(String ownerName, String repositoryName) throws IOException {
|
||||
return root.createRequest()
|
||||
@@ -266,7 +284,7 @@ public class GHApp extends GHObject {
|
||||
* on error
|
||||
* @see <a href="https://developer.github.com/v3/apps/#get-a-user-installation">Get a user installation</a>
|
||||
*/
|
||||
@Preview
|
||||
@Preview(MACHINE_MAN)
|
||||
@Deprecated
|
||||
public GHAppInstallation getInstallationByUser(String name) throws IOException {
|
||||
return root.createRequest()
|
||||
|
||||
@@ -5,7 +5,7 @@ import java.util.HashMap;
|
||||
import java.util.List;
|
||||
import java.util.Map;
|
||||
|
||||
import static org.kohsuke.github.Previews.MACHINE_MAN;
|
||||
import static org.kohsuke.github.internal.Previews.MACHINE_MAN;
|
||||
|
||||
/**
|
||||
* Creates a access token for a GitHub App Installation
|
||||
@@ -14,12 +14,11 @@ import static org.kohsuke.github.Previews.MACHINE_MAN;
|
||||
* @see GHAppInstallation#createToken(Map) GHAppInstallation#createToken(Map)
|
||||
* @see GHAppInstallation#createToken() GHAppInstallation#createToken()
|
||||
*/
|
||||
public class GHAppCreateTokenBuilder {
|
||||
private final GitHub root;
|
||||
public class GHAppCreateTokenBuilder extends GitHubInteractiveObject {
|
||||
protected final Requester builder;
|
||||
private final String apiUrlTail;
|
||||
|
||||
@Preview
|
||||
@BetaApi
|
||||
@Deprecated
|
||||
GHAppCreateTokenBuilder(GitHub root, String apiUrlTail) {
|
||||
this.root = root;
|
||||
@@ -27,7 +26,7 @@ public class GHAppCreateTokenBuilder {
|
||||
this.builder = root.createRequest();
|
||||
}
|
||||
|
||||
@Preview
|
||||
@BetaApi
|
||||
@Deprecated
|
||||
GHAppCreateTokenBuilder(GitHub root, String apiUrlTail, Map<String, GHPermissionType> permissions) {
|
||||
this(root, apiUrlTail);
|
||||
@@ -43,7 +42,7 @@ public class GHAppCreateTokenBuilder {
|
||||
* Array containing the repositories Ids
|
||||
* @return a GHAppCreateTokenBuilder
|
||||
*/
|
||||
@Preview
|
||||
@BetaApi
|
||||
@Deprecated
|
||||
public GHAppCreateTokenBuilder repositoryIds(List<Long> repositoryIds) {
|
||||
this.builder.with("repository_ids", repositoryIds);
|
||||
@@ -58,7 +57,7 @@ public class GHAppCreateTokenBuilder {
|
||||
* Map containing the permission names and types.
|
||||
* @return a GHAppCreateTokenBuilder
|
||||
*/
|
||||
@Preview
|
||||
@BetaApi
|
||||
@Deprecated
|
||||
public GHAppCreateTokenBuilder permissions(Map<String, GHPermissionType> permissions) {
|
||||
Map<String, String> retMap = new HashMap<>();
|
||||
@@ -78,7 +77,7 @@ public class GHAppCreateTokenBuilder {
|
||||
* @throws IOException
|
||||
* on error
|
||||
*/
|
||||
@Preview
|
||||
@Preview(MACHINE_MAN)
|
||||
@Deprecated
|
||||
public GHAppInstallationToken create() throws IOException {
|
||||
return builder.method("POST")
|
||||
|
||||
@@ -1,13 +1,17 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||
import org.kohsuke.github.internal.EnumUtils;
|
||||
|
||||
import java.io.IOException;
|
||||
import java.net.MalformedURLException;
|
||||
import java.net.URL;
|
||||
import java.util.List;
|
||||
import java.util.Map;
|
||||
import java.util.stream.Collectors;
|
||||
|
||||
import static org.kohsuke.github.Previews.GAMBIT;
|
||||
import static org.kohsuke.github.internal.Previews.GAMBIT;
|
||||
import static org.kohsuke.github.internal.Previews.MACHINE_MAN;
|
||||
|
||||
/**
|
||||
* A Github App Installation.
|
||||
@@ -20,7 +24,6 @@ import static org.kohsuke.github.Previews.GAMBIT;
|
||||
* @see GHApp#getInstallationByUser(String) GHApp#getInstallationByUser(String)
|
||||
*/
|
||||
public class GHAppInstallation extends GHObject {
|
||||
private GitHub root;
|
||||
private GHUser account;
|
||||
|
||||
@JsonProperty("access_tokens_url")
|
||||
@@ -34,7 +37,7 @@ public class GHAppInstallation extends GHObject {
|
||||
@JsonProperty("target_type")
|
||||
private GHTargetType targetType;
|
||||
private Map<String, GHPermissionType> permissions;
|
||||
private List<GHEvent> events;
|
||||
private List<String> events;
|
||||
@JsonProperty("single_file_name")
|
||||
private String singleFileName;
|
||||
@JsonProperty("repository_selection")
|
||||
@@ -59,7 +62,9 @@ public class GHAppInstallation extends GHObject {
|
||||
*
|
||||
* @param root
|
||||
* the root
|
||||
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||
*/
|
||||
@Deprecated
|
||||
public void setRoot(GitHub root) {
|
||||
this.root = root;
|
||||
}
|
||||
@@ -78,7 +83,9 @@ public class GHAppInstallation extends GHObject {
|
||||
*
|
||||
* @param account
|
||||
* the account
|
||||
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||
*/
|
||||
@Deprecated
|
||||
public void setAccount(GHUser account) {
|
||||
this.account = account;
|
||||
}
|
||||
@@ -97,7 +104,9 @@ public class GHAppInstallation extends GHObject {
|
||||
*
|
||||
* @param accessTokenUrl
|
||||
* the access token url
|
||||
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||
*/
|
||||
@Deprecated
|
||||
public void setAccessTokenUrl(String accessTokenUrl) {
|
||||
this.accessTokenUrl = accessTokenUrl;
|
||||
}
|
||||
@@ -111,12 +120,44 @@ public class GHAppInstallation extends GHObject {
|
||||
return repositoriesUrl;
|
||||
}
|
||||
|
||||
/**
|
||||
* List repositories that this app installation can access.
|
||||
*
|
||||
* @return the paged iterable
|
||||
*/
|
||||
@Preview(MACHINE_MAN)
|
||||
@Deprecated
|
||||
public PagedSearchIterable<GHRepository> listRepositories() {
|
||||
GitHubRequest request;
|
||||
|
||||
try {
|
||||
request = root.createRequest().withPreview(MACHINE_MAN).withUrlPath("/installation/repositories").build();
|
||||
} catch (MalformedURLException e) {
|
||||
throw new GHException("", e);
|
||||
}
|
||||
|
||||
return new PagedSearchIterable<>(root, request, GHAppInstallationRepositoryResult.class);
|
||||
}
|
||||
|
||||
private static class GHAppInstallationRepositoryResult extends SearchResult<GHRepository> {
|
||||
private GHRepository[] repositories;
|
||||
|
||||
@Override
|
||||
GHRepository[] getItems(GitHub root) {
|
||||
for (GHRepository item : repositories)
|
||||
item.wrap(root);
|
||||
return repositories;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Sets repositories url.
|
||||
*
|
||||
* @param repositoriesUrl
|
||||
* the repositories url
|
||||
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||
*/
|
||||
@Deprecated
|
||||
public void setRepositoriesUrl(String repositoriesUrl) {
|
||||
this.repositoriesUrl = repositoriesUrl;
|
||||
}
|
||||
@@ -135,7 +176,9 @@ public class GHAppInstallation extends GHObject {
|
||||
*
|
||||
* @param appId
|
||||
* the app id
|
||||
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||
*/
|
||||
@Deprecated
|
||||
public void setAppId(long appId) {
|
||||
this.appId = appId;
|
||||
}
|
||||
@@ -154,7 +197,9 @@ public class GHAppInstallation extends GHObject {
|
||||
*
|
||||
* @param targetId
|
||||
* the target id
|
||||
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||
*/
|
||||
@Deprecated
|
||||
public void setTargetId(long targetId) {
|
||||
this.targetId = targetId;
|
||||
}
|
||||
@@ -173,7 +218,9 @@ public class GHAppInstallation extends GHObject {
|
||||
*
|
||||
* @param targetType
|
||||
* the target type
|
||||
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||
*/
|
||||
@Deprecated
|
||||
public void setTargetType(GHTargetType targetType) {
|
||||
this.targetType = targetType;
|
||||
}
|
||||
@@ -192,7 +239,9 @@ public class GHAppInstallation extends GHObject {
|
||||
*
|
||||
* @param permissions
|
||||
* the permissions
|
||||
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||
*/
|
||||
@Deprecated
|
||||
public void setPermissions(Map<String, GHPermissionType> permissions) {
|
||||
this.permissions = permissions;
|
||||
}
|
||||
@@ -203,7 +252,9 @@ public class GHAppInstallation extends GHObject {
|
||||
* @return the events
|
||||
*/
|
||||
public List<GHEvent> getEvents() {
|
||||
return events;
|
||||
return events.stream()
|
||||
.map(e -> EnumUtils.getEnumOrDefault(GHEvent.class, e, GHEvent.UNKNOWN))
|
||||
.collect(Collectors.toList());
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -211,9 +262,11 @@ public class GHAppInstallation extends GHObject {
|
||||
*
|
||||
* @param events
|
||||
* the events
|
||||
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||
*/
|
||||
@Deprecated
|
||||
public void setEvents(List<GHEvent> events) {
|
||||
this.events = events;
|
||||
this.events = events.stream().map(GHEvent::symbol).collect(Collectors.toList());
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -230,7 +283,9 @@ public class GHAppInstallation extends GHObject {
|
||||
*
|
||||
* @param singleFileName
|
||||
* the single file name
|
||||
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||
*/
|
||||
@Deprecated
|
||||
public void setSingleFileName(String singleFileName) {
|
||||
this.singleFileName = singleFileName;
|
||||
}
|
||||
@@ -249,7 +304,9 @@ public class GHAppInstallation extends GHObject {
|
||||
*
|
||||
* @param repositorySelection
|
||||
* the repository selection
|
||||
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||
*/
|
||||
@Deprecated
|
||||
public void setRepositorySelection(GHRepositorySelection repositorySelection) {
|
||||
this.repositorySelection = repositorySelection;
|
||||
}
|
||||
@@ -268,13 +325,13 @@ public class GHAppInstallation extends GHObject {
|
||||
* on error
|
||||
* @see <a href="https://developer.github.com/v3/apps/#delete-an-installation">Delete an installation</a>
|
||||
*/
|
||||
@Preview
|
||||
@Preview(GAMBIT)
|
||||
@Deprecated
|
||||
public void deleteInstallation() throws IOException {
|
||||
root.createRequest()
|
||||
.method("DELETE")
|
||||
.withPreview(GAMBIT)
|
||||
.withUrlPath(String.format("/app/installations/%d", id))
|
||||
.withUrlPath(String.format("/app/installations/%d", getId()))
|
||||
.send();
|
||||
}
|
||||
|
||||
@@ -290,10 +347,12 @@ public class GHAppInstallation extends GHObject {
|
||||
* @return a GHAppCreateTokenBuilder instance
|
||||
* @deprecated Use {@link GHAppInstallation#createToken()} instead.
|
||||
*/
|
||||
@Preview
|
||||
@BetaApi
|
||||
@Deprecated
|
||||
public GHAppCreateTokenBuilder createToken(Map<String, GHPermissionType> permissions) {
|
||||
return new GHAppCreateTokenBuilder(root, String.format("/app/installations/%d/access_tokens", id), permissions);
|
||||
return new GHAppCreateTokenBuilder(root,
|
||||
String.format("/app/installations/%d/access_tokens", getId()),
|
||||
permissions);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -305,9 +364,9 @@ public class GHAppInstallation extends GHObject {
|
||||
*
|
||||
* @return a GHAppCreateTokenBuilder instance
|
||||
*/
|
||||
@Preview
|
||||
@BetaApi
|
||||
@Deprecated
|
||||
public GHAppCreateTokenBuilder createToken() {
|
||||
return new GHAppCreateTokenBuilder(root, String.format("/app/installations/%d/access_tokens", id));
|
||||
return new GHAppCreateTokenBuilder(root, String.format("/app/installations/%d/access_tokens", getId()));
|
||||
}
|
||||
}
|
||||
|
||||
@@ -14,9 +14,7 @@ import java.util.Map;
|
||||
* @author Paulo Miguel Almeida
|
||||
* @see GHAppInstallation#createToken(Map) GHAppInstallation#createToken(Map)
|
||||
*/
|
||||
public class GHAppInstallationToken {
|
||||
private GitHub root;
|
||||
|
||||
public class GHAppInstallationToken extends GitHubInteractiveObject {
|
||||
private String token;
|
||||
protected String expires_at;
|
||||
private Map<String, String> permissions;
|
||||
@@ -37,7 +35,9 @@ public class GHAppInstallationToken {
|
||||
*
|
||||
* @param root
|
||||
* the root
|
||||
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||
*/
|
||||
@Deprecated
|
||||
public void setRoot(GitHub root) {
|
||||
this.root = root;
|
||||
}
|
||||
@@ -56,7 +56,9 @@ public class GHAppInstallationToken {
|
||||
*
|
||||
* @param permissions
|
||||
* the permissions
|
||||
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||
*/
|
||||
@Deprecated
|
||||
public void setPermissions(Map<String, String> permissions) {
|
||||
this.permissions = permissions;
|
||||
}
|
||||
@@ -75,7 +77,9 @@ public class GHAppInstallationToken {
|
||||
*
|
||||
* @param token
|
||||
* the token
|
||||
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||
*/
|
||||
@Deprecated
|
||||
public void setToken(String token) {
|
||||
this.token = token;
|
||||
}
|
||||
@@ -94,7 +98,9 @@ public class GHAppInstallationToken {
|
||||
*
|
||||
* @param repositories
|
||||
* the repositories
|
||||
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||
*/
|
||||
@Deprecated
|
||||
public void setRepositories(List<GHRepository> repositories) {
|
||||
this.repositories = repositories;
|
||||
}
|
||||
@@ -113,7 +119,9 @@ public class GHAppInstallationToken {
|
||||
*
|
||||
* @param repositorySelection
|
||||
* the repository selection
|
||||
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||
*/
|
||||
@Deprecated
|
||||
public void setRepositorySelection(GHRepositorySelection repositorySelection) {
|
||||
this.repositorySelection = repositorySelection;
|
||||
}
|
||||
|
||||
140
src/main/java/org/kohsuke/github/GHArtifact.java
Normal file
140
src/main/java/org/kohsuke/github/GHArtifact.java
Normal file
@@ -0,0 +1,140 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import com.fasterxml.jackson.annotation.JsonIgnore;
|
||||
import org.apache.commons.lang3.StringUtils;
|
||||
import org.kohsuke.github.function.InputStreamFunction;
|
||||
|
||||
import java.io.IOException;
|
||||
import java.net.URL;
|
||||
import java.util.Date;
|
||||
import java.util.Objects;
|
||||
|
||||
import static java.util.Objects.requireNonNull;
|
||||
|
||||
/**
|
||||
* An artifact from a workflow run.
|
||||
*
|
||||
* @author Guillaume Smet
|
||||
*/
|
||||
public class GHArtifact extends GHObject {
|
||||
|
||||
// Not provided by the API.
|
||||
@JsonIgnore
|
||||
private GHRepository owner;
|
||||
|
||||
private String name;
|
||||
private long sizeInBytes;
|
||||
private String archiveDownloadUrl;
|
||||
private boolean expired;
|
||||
private String expiresAt;
|
||||
|
||||
/**
|
||||
* Gets the name.
|
||||
*
|
||||
* @return the name
|
||||
*/
|
||||
public String getName() {
|
||||
return name;
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets the size of the artifact in bytes.
|
||||
*
|
||||
* @return the size
|
||||
*/
|
||||
public long getSizeInBytes() {
|
||||
return sizeInBytes;
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets the archive download URL.
|
||||
*
|
||||
* @return the archive download URL
|
||||
*/
|
||||
public URL getArchiveDownloadUrl() {
|
||||
return GitHubClient.parseURL(archiveDownloadUrl);
|
||||
}
|
||||
|
||||
/**
|
||||
* If this artifact has expired.
|
||||
*
|
||||
* @return if the artifact has expired
|
||||
*/
|
||||
public boolean isExpired() {
|
||||
return expired;
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets the date at which this artifact will expire.
|
||||
*
|
||||
* @return the date of expiration
|
||||
*/
|
||||
public Date getExpiresAt() {
|
||||
return GitHubClient.parseDate(expiresAt);
|
||||
}
|
||||
|
||||
/**
|
||||
* Repository to which the artifact belongs.
|
||||
*
|
||||
* @return the repository
|
||||
*/
|
||||
public GHRepository getRepository() {
|
||||
return owner;
|
||||
}
|
||||
|
||||
/**
|
||||
* @deprecated This object has no HTML URL.
|
||||
*/
|
||||
@Override
|
||||
public URL getHtmlUrl() throws IOException {
|
||||
return null;
|
||||
}
|
||||
|
||||
/**
|
||||
* Deletes the artifact.
|
||||
*
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
public void delete() throws IOException {
|
||||
root.createRequest().method("DELETE").withUrlPath(getApiRoute()).fetchHttpStatusCode();
|
||||
}
|
||||
|
||||
/**
|
||||
* Downloads the artifact.
|
||||
*
|
||||
* @param <T>
|
||||
* the type of result
|
||||
* @param streamFunction
|
||||
* The {@link InputStreamFunction} that will process the stream
|
||||
* @throws IOException
|
||||
* The IO exception.
|
||||
* @return the result of reading the stream.
|
||||
*/
|
||||
public <T> T download(InputStreamFunction<T> streamFunction) throws IOException {
|
||||
requireNonNull(streamFunction, "Stream function must not be null");
|
||||
|
||||
return root.createRequest().method("GET").withUrlPath(getApiRoute(), "zip").fetchStream(streamFunction);
|
||||
}
|
||||
|
||||
private String getApiRoute() {
|
||||
if (owner == null) {
|
||||
// Workflow runs returned from search to do not have an owner. Attempt to use url.
|
||||
final URL url = Objects.requireNonNull(getUrl(), "Missing instance URL!");
|
||||
return StringUtils.prependIfMissing(url.toString().replace(root.getApiUrl(), ""), "/");
|
||||
}
|
||||
return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/actions/artifacts/" + getId();
|
||||
}
|
||||
|
||||
GHArtifact wrapUp(GHRepository owner) {
|
||||
this.owner = owner;
|
||||
return wrapUp(owner.root);
|
||||
}
|
||||
|
||||
GHArtifact wrapUp(GitHub root) {
|
||||
this.root = root;
|
||||
if (owner != null)
|
||||
owner.wrap(root);
|
||||
return this;
|
||||
}
|
||||
}
|
||||
49
src/main/java/org/kohsuke/github/GHArtifactsIterable.java
Normal file
49
src/main/java/org/kohsuke/github/GHArtifactsIterable.java
Normal file
@@ -0,0 +1,49 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import java.net.MalformedURLException;
|
||||
import java.util.Iterator;
|
||||
|
||||
import javax.annotation.Nonnull;
|
||||
|
||||
/**
|
||||
* Iterable for artifacts listing.
|
||||
*/
|
||||
class GHArtifactsIterable extends PagedIterable<GHArtifact> {
|
||||
private final transient GHRepository owner;
|
||||
private final GitHubRequest request;
|
||||
|
||||
private GHArtifactsPage result;
|
||||
|
||||
public GHArtifactsIterable(GHRepository owner, GitHubRequest.Builder<?> requestBuilder) {
|
||||
this.owner = owner;
|
||||
try {
|
||||
this.request = requestBuilder.build();
|
||||
} catch (MalformedURLException e) {
|
||||
throw new GHException("Malformed URL", e);
|
||||
}
|
||||
}
|
||||
|
||||
@Nonnull
|
||||
@Override
|
||||
public PagedIterator<GHArtifact> _iterator(int pageSize) {
|
||||
return new PagedIterator<>(
|
||||
adapt(GitHubPageIterator.create(owner.getRoot().getClient(), GHArtifactsPage.class, request, pageSize)),
|
||||
null);
|
||||
}
|
||||
|
||||
protected Iterator<GHArtifact[]> adapt(final Iterator<GHArtifactsPage> base) {
|
||||
return new Iterator<GHArtifact[]>() {
|
||||
public boolean hasNext() {
|
||||
return base.hasNext();
|
||||
}
|
||||
|
||||
public GHArtifact[] next() {
|
||||
GHArtifactsPage v = base.next();
|
||||
if (result == null) {
|
||||
result = v;
|
||||
}
|
||||
return v.getArtifacts(owner);
|
||||
}
|
||||
};
|
||||
}
|
||||
}
|
||||
20
src/main/java/org/kohsuke/github/GHArtifactsPage.java
Normal file
20
src/main/java/org/kohsuke/github/GHArtifactsPage.java
Normal file
@@ -0,0 +1,20 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
/**
|
||||
* Represents the one page of artifacts result when listing artifacts.
|
||||
*/
|
||||
class GHArtifactsPage {
|
||||
private int total_count;
|
||||
private GHArtifact[] artifacts;
|
||||
|
||||
public int getTotalCount() {
|
||||
return total_count;
|
||||
}
|
||||
|
||||
GHArtifact[] getArtifacts(GHRepository owner) {
|
||||
for (GHArtifact artifact : artifacts) {
|
||||
artifact.wrapUp(owner);
|
||||
}
|
||||
return artifacts;
|
||||
}
|
||||
}
|
||||
@@ -9,7 +9,6 @@ import java.net.URL;
|
||||
* @see GHRelease#getAssets() GHRelease#getAssets()
|
||||
*/
|
||||
public class GHAsset extends GHObject {
|
||||
GitHub root;
|
||||
GHRepository owner;
|
||||
private String name;
|
||||
private String label;
|
||||
@@ -149,7 +148,7 @@ public class GHAsset extends GHObject {
|
||||
}
|
||||
|
||||
private String getApiRoute() {
|
||||
return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/releases/assets/" + id;
|
||||
return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/releases/assets/" + getId();
|
||||
}
|
||||
|
||||
GHAsset wrap(GHRelease release) {
|
||||
|
||||
@@ -33,7 +33,6 @@ public class GHAuthorization extends GHObject {
|
||||
public static final String WRITE_KEY = "write:public_key";
|
||||
public static final String ADMIN_KEY = "admin:public_key";
|
||||
|
||||
private GitHub root;
|
||||
private List<String> scopes;
|
||||
private String token;
|
||||
private String token_last_eight;
|
||||
@@ -112,10 +111,12 @@ public class GHAuthorization extends GHObject {
|
||||
* Gets api url.
|
||||
*
|
||||
* @return the api url
|
||||
* @deprecated use {@link #getUrl()}
|
||||
*/
|
||||
@Deprecated
|
||||
@SuppressFBWarnings(value = "NM_CONFUSING", justification = "It's a part of the library API, cannot be changed")
|
||||
public URL getApiURL() {
|
||||
return GitHubClient.parseURL(url);
|
||||
return getUrl();
|
||||
}
|
||||
|
||||
/**
|
||||
|
||||
@@ -3,12 +3,15 @@ package org.kohsuke.github;
|
||||
import com.fasterxml.jackson.annotation.JsonCreator;
|
||||
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||
import org.kohsuke.github.internal.Previews;
|
||||
|
||||
import java.io.IOException;
|
||||
import java.net.URL;
|
||||
import java.util.Collection;
|
||||
import java.util.Objects;
|
||||
|
||||
import javax.annotation.CheckForNull;
|
||||
|
||||
/**
|
||||
* A branch in a repository.
|
||||
*
|
||||
@@ -18,8 +21,7 @@ import java.util.Objects;
|
||||
value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD",
|
||||
"URF_UNREAD_FIELD" },
|
||||
justification = "JSON API")
|
||||
public class GHBranch {
|
||||
private GitHub root;
|
||||
public class GHBranch extends GitHubInteractiveObject {
|
||||
private GHRepository owner;
|
||||
|
||||
private String name;
|
||||
@@ -76,7 +78,7 @@ public class GHBranch {
|
||||
*
|
||||
* @return true if the push to this branch is restricted via branch protection.
|
||||
*/
|
||||
@Preview
|
||||
@Preview(Previews.LUKE_CAGE)
|
||||
@Deprecated
|
||||
public boolean isProtected() {
|
||||
return protection;
|
||||
@@ -87,7 +89,7 @@ public class GHBranch {
|
||||
*
|
||||
* @return API URL that deals with the protection of this branch.
|
||||
*/
|
||||
@Preview
|
||||
@Preview(Previews.LUKE_CAGE)
|
||||
@Deprecated
|
||||
public URL getProtectionUrl() {
|
||||
return GitHubClient.parseURL(protection_url);
|
||||
@@ -100,8 +102,14 @@ public class GHBranch {
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
@Preview(Previews.LUKE_CAGE)
|
||||
@Deprecated
|
||||
public GHBranchProtection getProtection() throws IOException {
|
||||
return root.createRequest().withUrlPath(protection_url).fetch(GHBranchProtection.class).wrap(this);
|
||||
return root.createRequest()
|
||||
.withPreview(Previews.LUKE_CAGE)
|
||||
.setRawUrlPath(protection_url)
|
||||
.fetch(GHBranchProtection.class)
|
||||
.wrap(this);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -120,7 +128,7 @@ public class GHBranch {
|
||||
* if disabling protection fails
|
||||
*/
|
||||
public void disableProtection() throws IOException {
|
||||
root.createRequest().method("DELETE").withUrlPath(protection_url).send();
|
||||
root.createRequest().method("DELETE").setRawUrlPath(protection_url).send();
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -129,7 +137,7 @@ public class GHBranch {
|
||||
* @return GHBranchProtectionBuilder for enabling protection
|
||||
* @see GHCommitStatus#getContext() GHCommitStatus#getContext()
|
||||
*/
|
||||
@Preview
|
||||
@Preview(Previews.LUKE_CAGE)
|
||||
@Deprecated
|
||||
public GHBranchProtectionBuilder enableProtection() {
|
||||
return new GHBranchProtectionBuilder(this);
|
||||
@@ -161,6 +169,59 @@ public class GHBranch {
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Merge a branch into this branch.
|
||||
*
|
||||
* @param headBranch
|
||||
* the branch whose head will be merged
|
||||
*
|
||||
* @param commitMessage
|
||||
* the commit message
|
||||
*
|
||||
* @return the merge {@link GHCommit} created, or {@code null} if the base already contains the head (nothing to
|
||||
* merge).
|
||||
*
|
||||
* @throws IOException
|
||||
* if merging fails
|
||||
*/
|
||||
@CheckForNull
|
||||
public GHCommit merge(GHBranch headBranch, String commitMessage) throws IOException {
|
||||
return merge(headBranch.getName(), commitMessage);
|
||||
}
|
||||
|
||||
/**
|
||||
* Merge a ref into this branch.
|
||||
*
|
||||
* @param head
|
||||
* the ref name that will be merged into this branch. Follows the usual ref naming rules, could be a
|
||||
* branch name, tag, or commit sha.
|
||||
*
|
||||
* @param commitMessage
|
||||
* the commit message
|
||||
*
|
||||
* @return the merge {@link GHCommit} created, or {@code null} if the base already contains the head (nothing to
|
||||
* merge).
|
||||
*
|
||||
* @throws IOException
|
||||
* if merging fails
|
||||
*/
|
||||
@CheckForNull
|
||||
public GHCommit merge(String head, String commitMessage) throws IOException {
|
||||
GHCommit result = root.createRequest()
|
||||
.withUrlPath(owner.getApiTailUrl("merges"))
|
||||
.method("POST")
|
||||
.with("commit_message", commitMessage)
|
||||
.with("base", this.name)
|
||||
.with("head", head)
|
||||
.fetch(GHCommit.class);
|
||||
|
||||
if (result != null) {
|
||||
result.wrapUp(owner);
|
||||
}
|
||||
|
||||
return result;
|
||||
}
|
||||
|
||||
String getApiRoute() {
|
||||
return owner.getApiTailUrl("/branches/" + name);
|
||||
}
|
||||
|
||||
@@ -6,23 +6,23 @@ import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||
import java.io.IOException;
|
||||
import java.util.Collection;
|
||||
|
||||
import static org.kohsuke.github.Previews.ZZZAX;
|
||||
import static org.kohsuke.github.internal.Previews.ZZZAX;
|
||||
|
||||
/**
|
||||
* The type GHBranchProtection.
|
||||
*
|
||||
* @see <a href="https://docs.github.com/en/rest/reference/repos#get-branch-protection">GitHub Branch Protection</a>
|
||||
*/
|
||||
@SuppressFBWarnings(
|
||||
value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD",
|
||||
"URF_UNREAD_FIELD" },
|
||||
justification = "JSON API")
|
||||
public class GHBranchProtection {
|
||||
public class GHBranchProtection extends GitHubInteractiveObject {
|
||||
private static final String REQUIRE_SIGNATURES_URI = "/required_signatures";
|
||||
|
||||
@JsonProperty
|
||||
private EnforceAdmins enforceAdmins;
|
||||
|
||||
private GitHub root;
|
||||
|
||||
@JsonProperty("required_pull_request_reviews")
|
||||
private RequiredReviews requiredReviews;
|
||||
|
||||
@@ -41,7 +41,7 @@ public class GHBranchProtection {
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
@Preview
|
||||
@Preview(ZZZAX)
|
||||
@Deprecated
|
||||
public void enabledSignedCommits() throws IOException {
|
||||
requester().method("POST").withUrlPath(url + REQUIRE_SIGNATURES_URI).fetch(RequiredSignatures.class);
|
||||
@@ -53,7 +53,7 @@ public class GHBranchProtection {
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
@Preview
|
||||
@Preview(ZZZAX)
|
||||
@Deprecated
|
||||
public void disableSignedCommits() throws IOException {
|
||||
requester().method("DELETE").withUrlPath(url + REQUIRE_SIGNATURES_URI).send();
|
||||
@@ -84,7 +84,7 @@ public class GHBranchProtection {
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
@Preview
|
||||
@Preview(ZZZAX)
|
||||
@Deprecated
|
||||
public boolean getRequiredSignatures() throws IOException {
|
||||
return requester().withUrlPath(url + REQUIRE_SIGNATURES_URI).fetch(RequiredSignatures.class).enabled;
|
||||
|
||||
@@ -12,7 +12,7 @@ import java.util.List;
|
||||
import java.util.Map;
|
||||
import java.util.Set;
|
||||
|
||||
import static org.kohsuke.github.Previews.*;
|
||||
import static org.kohsuke.github.internal.Previews.LUKE_CAGE;
|
||||
|
||||
/**
|
||||
* Builder to configure the branch protection settings.
|
||||
|
||||
@@ -1,10 +1,21 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||
import com.infradna.tool.bridge_method_injector.WithBridgeMethods;
|
||||
import edu.umd.cs.findbugs.annotations.NonNull;
|
||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||
import org.kohsuke.github.GHWorkflowRun.Conclusion;
|
||||
import org.kohsuke.github.GHWorkflowRun.Status;
|
||||
import org.kohsuke.github.internal.EnumUtils;
|
||||
import org.kohsuke.github.internal.Previews;
|
||||
|
||||
import java.io.IOException;
|
||||
import java.net.URL;
|
||||
import java.util.Arrays;
|
||||
import java.util.Collections;
|
||||
import java.util.Date;
|
||||
import java.util.List;
|
||||
import java.util.Locale;
|
||||
|
||||
/**
|
||||
* Represents a check run.
|
||||
@@ -14,8 +25,9 @@ import java.util.Date;
|
||||
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD", "URF_UNREAD_FIELD" },
|
||||
justification = "JSON API")
|
||||
public class GHCheckRun extends GHObject {
|
||||
|
||||
@JsonProperty("repository")
|
||||
GHRepository owner;
|
||||
GitHub root;
|
||||
|
||||
private String status;
|
||||
private String conclusion;
|
||||
@@ -34,7 +46,7 @@ public class GHCheckRun extends GHObject {
|
||||
|
||||
GHCheckRun wrap(GHRepository owner) {
|
||||
this.owner = owner;
|
||||
this.root = owner.root;
|
||||
wrap(owner.root);
|
||||
return this;
|
||||
}
|
||||
|
||||
@@ -42,7 +54,24 @@ public class GHCheckRun extends GHObject {
|
||||
this.root = root;
|
||||
if (owner != null) {
|
||||
owner.wrap(root);
|
||||
if (pullRequests != null && pullRequests.length != 0) {
|
||||
for (GHPullRequest singlePull : pullRequests) {
|
||||
singlePull.wrap(owner);
|
||||
}
|
||||
}
|
||||
|
||||
}
|
||||
if (checkSuite != null) {
|
||||
if (owner != null) {
|
||||
checkSuite.wrap(owner);
|
||||
} else {
|
||||
checkSuite.wrap(root);
|
||||
}
|
||||
}
|
||||
if (app != null) {
|
||||
app.wrapUp(root);
|
||||
}
|
||||
|
||||
return this;
|
||||
}
|
||||
|
||||
@@ -56,12 +85,27 @@ public class GHCheckRun extends GHObject {
|
||||
* @return Status of the check run
|
||||
* @see Status
|
||||
*/
|
||||
public String getStatus() {
|
||||
@WithBridgeMethods(value = String.class, adapterMethod = "statusAsStr")
|
||||
public Status getStatus() {
|
||||
return Status.from(status);
|
||||
}
|
||||
|
||||
@SuppressFBWarnings(value = "UPM_UNCALLED_PRIVATE_METHOD", justification = "Bridge method of getStatus")
|
||||
private Object statusAsStr(Status status, Class type) {
|
||||
return status;
|
||||
}
|
||||
|
||||
public static enum Status {
|
||||
QUEUED, IN_PROGRESS, COMPLETED
|
||||
QUEUED, IN_PROGRESS, COMPLETED, UNKNOWN;
|
||||
|
||||
public static Status from(String value) {
|
||||
return EnumUtils.getNullableEnumOrDefault(Status.class, value, Status.UNKNOWN);
|
||||
}
|
||||
|
||||
@Override
|
||||
public String toString() {
|
||||
return name().toLowerCase(Locale.ROOT);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -70,12 +114,33 @@ public class GHCheckRun extends GHObject {
|
||||
* @return Status of the check run
|
||||
* @see Conclusion
|
||||
*/
|
||||
public String getConclusion() {
|
||||
@WithBridgeMethods(value = String.class, adapterMethod = "conclusionAsStr")
|
||||
public Conclusion getConclusion() {
|
||||
return Conclusion.from(conclusion);
|
||||
}
|
||||
|
||||
@SuppressFBWarnings(value = "UPM_UNCALLED_PRIVATE_METHOD", justification = "Bridge method of getConclusion")
|
||||
private Object conclusionAsStr(Conclusion conclusion, Class type) {
|
||||
return conclusion;
|
||||
}
|
||||
|
||||
/**
|
||||
* Final conclusion of the check.
|
||||
*
|
||||
* From <a href="https://docs.github.com/en/rest/reference/checks#create-a-check-run--parameters">Check Run
|
||||
* Parameters - <code>conclusion</code></a>.
|
||||
*/
|
||||
public static enum Conclusion {
|
||||
SUCCESS, FAILURE, NEUTRAL, CANCELLED, TIMED_OUT, ACTION_REQUIRED
|
||||
ACTION_REQUIRED, CANCELLED, FAILURE, NEUTRAL, SUCCESS, SKIPPED, STALE, TIMED_OUT, UNKNOWN;
|
||||
|
||||
public static Conclusion from(String value) {
|
||||
return EnumUtils.getNullableEnumOrDefault(Conclusion.class, value, Conclusion.UNKNOWN);
|
||||
}
|
||||
|
||||
@Override
|
||||
public String toString() {
|
||||
return name().toLowerCase(Locale.ROOT);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -99,15 +164,22 @@ public class GHCheckRun extends GHObject {
|
||||
/**
|
||||
* Gets the pull requests participated in this check run.
|
||||
*
|
||||
* @return Pull requests of this check run
|
||||
* Note this field is only populated for events. When getting a {@link GHCheckRun} outside of an event, this is
|
||||
* always empty.
|
||||
*
|
||||
* @return the list of {@link GHPullRequest}s for this check run. Only populated for events.
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
GHPullRequest[] getPullRequests() throws IOException {
|
||||
public List<GHPullRequest> getPullRequests() throws IOException {
|
||||
if (pullRequests != null && pullRequests.length != 0) {
|
||||
for (GHPullRequest singlePull : pullRequests) {
|
||||
singlePull.refresh();
|
||||
// Only refresh if we haven't do so before
|
||||
singlePull.refresh(singlePull.getTitle());
|
||||
}
|
||||
return Collections.unmodifiableList(Arrays.asList(pullRequests));
|
||||
}
|
||||
return pullRequests;
|
||||
return Collections.emptyList();
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -256,4 +328,15 @@ public class GHCheckRun extends GHObject {
|
||||
NOTICE, WARNING, FAILURE
|
||||
}
|
||||
|
||||
/**
|
||||
* Updates this check run.
|
||||
*
|
||||
* @return a builder which you should customize, then call {@link GHCheckRunBuilder#create}
|
||||
*/
|
||||
@Preview(Previews.ANTIOPE)
|
||||
@Deprecated
|
||||
public @NonNull GHCheckRunBuilder update() {
|
||||
return new GHCheckRunBuilder(owner, getId());
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
@@ -28,6 +28,7 @@ import com.fasterxml.jackson.annotation.JsonInclude;
|
||||
import edu.umd.cs.findbugs.annotations.CheckForNull;
|
||||
import edu.umd.cs.findbugs.annotations.NonNull;
|
||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||
import org.kohsuke.github.internal.Previews;
|
||||
|
||||
import java.io.IOException;
|
||||
import java.util.Collections;
|
||||
@@ -37,30 +38,45 @@ import java.util.List;
|
||||
import java.util.Locale;
|
||||
|
||||
/**
|
||||
* Drafts a check run.
|
||||
* Drafts or updates a check run.
|
||||
*
|
||||
* @see GHCheckRun
|
||||
* @see GHRepository#createCheckRun
|
||||
* @see <a href="https://developer.github.com/v3/checks/runs/#create-a-check-run">documentation</a>
|
||||
* @see GHCheckRun#update()
|
||||
* @see <a href="https://developer.github.com/v3/checks/runs/#update-a-check-run">documentation</a>
|
||||
*/
|
||||
@SuppressFBWarnings(value = "URF_UNREAD_FIELD", justification = "Jackson serializes these even without a getter")
|
||||
@Preview
|
||||
@Preview(Previews.ANTIOPE)
|
||||
@Deprecated
|
||||
public final class GHCheckRunBuilder {
|
||||
|
||||
private final GHRepository repo;
|
||||
private final Requester requester;
|
||||
protected final GHRepository repo;
|
||||
protected final Requester requester;
|
||||
private Output output;
|
||||
private List<Action> actions;
|
||||
|
||||
GHCheckRunBuilder(GHRepository repo, String name, String headSHA) {
|
||||
private GHCheckRunBuilder(GHRepository repo, Requester requester) {
|
||||
this.repo = repo;
|
||||
requester = repo.root.createRequest()
|
||||
.withPreview(Previews.ANTIOPE)
|
||||
.method("POST")
|
||||
.with("name", name)
|
||||
.with("head_sha", headSHA)
|
||||
.withUrlPath(repo.getApiTailUrl("check-runs"));
|
||||
this.requester = requester;
|
||||
}
|
||||
|
||||
GHCheckRunBuilder(GHRepository repo, String name, String headSHA) {
|
||||
this(repo,
|
||||
repo.root.createRequest()
|
||||
.withPreview(Previews.ANTIOPE)
|
||||
.method("POST")
|
||||
.with("name", name)
|
||||
.with("head_sha", headSHA)
|
||||
.withUrlPath(repo.getApiTailUrl("check-runs")));
|
||||
}
|
||||
|
||||
GHCheckRunBuilder(GHRepository repo, long checkId) {
|
||||
this(repo,
|
||||
repo.root.createRequest()
|
||||
.withPreview(Previews.ANTIOPE)
|
||||
.method("PATCH")
|
||||
.withUrlPath(repo.getApiTailUrl("check-runs/" + checkId)));
|
||||
}
|
||||
|
||||
public @NonNull GHCheckRunBuilder withDetailsURL(@CheckForNull String detailsURL) {
|
||||
@@ -136,7 +152,7 @@ public final class GHCheckRunBuilder {
|
||||
}
|
||||
GHCheckRun run = requester.with("output", output).with("actions", actions).fetch(GHCheckRun.class).wrap(repo);
|
||||
while (!extraAnnotations.isEmpty()) {
|
||||
Output output2 = new Output(output.title, output.summary);
|
||||
Output output2 = new Output(output.title, output.summary).withText(output.text);
|
||||
int i = Math.min(extraAnnotations.size(), MAX_ANNOTATIONS);
|
||||
output2.annotations = extraAnnotations.subList(0, i);
|
||||
extraAnnotations = extraAnnotations.subList(i, extraAnnotations.size());
|
||||
@@ -144,7 +160,7 @@ public final class GHCheckRunBuilder {
|
||||
.withPreview(Previews.ANTIOPE)
|
||||
.method("PATCH")
|
||||
.with("output", output2)
|
||||
.withUrlPath(repo.getApiTailUrl("check-runs/" + run.id))
|
||||
.withUrlPath(repo.getApiTailUrl("check-runs/" + run.getId()))
|
||||
.fetch(GHCheckRun.class)
|
||||
.wrap(repo);
|
||||
}
|
||||
|
||||
@@ -8,13 +8,13 @@ import javax.annotation.Nonnull;
|
||||
* Iterable for check-runs listing.
|
||||
*/
|
||||
class GHCheckRunsIterable extends PagedIterable<GHCheckRun> {
|
||||
private GitHub root;
|
||||
private final GHRepository owner;
|
||||
private final GitHubRequest request;
|
||||
|
||||
private GHCheckRunsPage result;
|
||||
|
||||
public GHCheckRunsIterable(GitHub root, GitHubRequest request) {
|
||||
this.root = root;
|
||||
public GHCheckRunsIterable(GHRepository owner, GitHubRequest request) {
|
||||
this.owner = owner;
|
||||
this.request = request;
|
||||
}
|
||||
|
||||
@@ -22,7 +22,7 @@ class GHCheckRunsIterable extends PagedIterable<GHCheckRun> {
|
||||
@Override
|
||||
public PagedIterator<GHCheckRun> _iterator(int pageSize) {
|
||||
return new PagedIterator<>(
|
||||
adapt(GitHubPageIterator.create(root.getClient(), GHCheckRunsPage.class, request, pageSize)),
|
||||
adapt(GitHubPageIterator.create(owner.getRoot().getClient(), GHCheckRunsPage.class, request, pageSize)),
|
||||
null);
|
||||
}
|
||||
|
||||
@@ -37,7 +37,7 @@ class GHCheckRunsIterable extends PagedIterable<GHCheckRun> {
|
||||
if (result == null) {
|
||||
result = v;
|
||||
}
|
||||
return v.getCheckRuns(root);
|
||||
return v.getCheckRuns(owner);
|
||||
}
|
||||
};
|
||||
}
|
||||
|
||||
@@ -11,9 +11,9 @@ class GHCheckRunsPage {
|
||||
return total_count;
|
||||
}
|
||||
|
||||
GHCheckRun[] getCheckRuns(GitHub root) {
|
||||
GHCheckRun[] getCheckRuns(GHRepository owner) {
|
||||
for (GHCheckRun check_run : check_runs) {
|
||||
check_run.wrap(root);
|
||||
check_run.wrap(owner);
|
||||
}
|
||||
return check_runs;
|
||||
}
|
||||
|
||||
@@ -1,10 +1,14 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||
|
||||
import java.io.IOException;
|
||||
import java.net.URL;
|
||||
import java.util.Arrays;
|
||||
import java.util.Collections;
|
||||
import java.util.Date;
|
||||
import java.util.List;
|
||||
|
||||
/**
|
||||
* Represents a check suite.
|
||||
@@ -14,8 +18,9 @@ import java.util.Date;
|
||||
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD", "URF_UNREAD_FIELD" },
|
||||
justification = "JSON API")
|
||||
public class GHCheckSuite extends GHObject {
|
||||
|
||||
@JsonProperty("repository")
|
||||
GHRepository owner;
|
||||
GitHub root;
|
||||
|
||||
private String nodeId;
|
||||
private String headBranch;
|
||||
@@ -32,7 +37,7 @@ public class GHCheckSuite extends GHObject {
|
||||
|
||||
GHCheckSuite wrap(GHRepository owner) {
|
||||
this.owner = owner;
|
||||
this.root = owner.root;
|
||||
this.wrap(owner.root);
|
||||
return this;
|
||||
}
|
||||
|
||||
@@ -40,6 +45,14 @@ public class GHCheckSuite extends GHObject {
|
||||
this.root = root;
|
||||
if (owner != null) {
|
||||
owner.wrap(root);
|
||||
if (pullRequests != null && pullRequests.length != 0) {
|
||||
for (GHPullRequest singlePull : pullRequests) {
|
||||
singlePull.wrap(owner);
|
||||
}
|
||||
}
|
||||
}
|
||||
if (app != null) {
|
||||
app.wrapUp(root);
|
||||
}
|
||||
return this;
|
||||
}
|
||||
@@ -153,15 +166,22 @@ public class GHCheckSuite extends GHObject {
|
||||
/**
|
||||
* Gets the pull requests participated in this check suite.
|
||||
*
|
||||
* @return Pull requests
|
||||
* Note this field is only populated for events. When getting a {@link GHCheckSuite} outside of an event, this is
|
||||
* always empty.
|
||||
*
|
||||
* @return the list of {@link GHPullRequest}s for this check suite. Only populated for events.
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
GHPullRequest[] getPullRequests() throws IOException {
|
||||
public List<GHPullRequest> getPullRequests() throws IOException {
|
||||
if (pullRequests != null && pullRequests.length != 0) {
|
||||
for (GHPullRequest singlePull : pullRequests) {
|
||||
singlePull.refresh();
|
||||
// Only refresh if we haven't do so before
|
||||
singlePull.refresh(singlePull.getTitle());
|
||||
}
|
||||
return Collections.unmodifiableList(Arrays.asList(pullRequests));
|
||||
}
|
||||
return pullRequests;
|
||||
return Collections.emptyList();
|
||||
}
|
||||
|
||||
/**
|
||||
|
||||
@@ -11,6 +11,9 @@ import java.util.Collections;
|
||||
import java.util.Date;
|
||||
import java.util.List;
|
||||
|
||||
import static org.kohsuke.github.internal.Previews.ANTIOPE;
|
||||
import static org.kohsuke.github.internal.Previews.GROOT;
|
||||
|
||||
/**
|
||||
* A commit in a repository.
|
||||
*
|
||||
@@ -63,7 +66,7 @@ public class GHCommit {
|
||||
* @return the authored date
|
||||
*/
|
||||
public Date getAuthoredDate() {
|
||||
return GitHubClient.parseDate(author.date);
|
||||
return author.getDate();
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -82,7 +85,7 @@ public class GHCommit {
|
||||
* @return the commit date
|
||||
*/
|
||||
public Date getCommitDate() {
|
||||
return GitHubClient.parseDate(committer.date);
|
||||
return committer.getDate();
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -119,7 +122,6 @@ public class GHCommit {
|
||||
* @deprecated Use {@link GitUser} instead.
|
||||
*/
|
||||
public static class GHAuthor extends GitUser {
|
||||
private String date;
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -446,6 +448,39 @@ public class GHCommit {
|
||||
return owner.root.getUser(author.login);
|
||||
}
|
||||
|
||||
/**
|
||||
* Retrieves a list of pull requests which contain this commit.
|
||||
*
|
||||
* @return {@link PagedIterable} with the pull requests which contain this commit
|
||||
*/
|
||||
@Preview(GROOT)
|
||||
@Deprecated
|
||||
public PagedIterable<GHPullRequest> listPullRequests() {
|
||||
return owner.root.createRequest()
|
||||
.withPreview(GROOT)
|
||||
.withUrlPath(String.format("/repos/%s/%s/commits/%s/pulls", owner.getOwnerName(), owner.getName(), sha))
|
||||
.toIterable(GHPullRequest[].class, item -> item.wrapUp(owner));
|
||||
}
|
||||
|
||||
/**
|
||||
* Retrieves a list of branches where this commit is the head commit.
|
||||
*
|
||||
* @return {@link PagedIterable} with the branches where the commit is the head commit
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
@Preview(GROOT)
|
||||
@Deprecated
|
||||
public PagedIterable<GHBranch> listBranchesWhereHead() throws IOException {
|
||||
return owner.root.createRequest()
|
||||
.withPreview(GROOT)
|
||||
.withUrlPath(String.format("/repos/%s/%s/commits/%s/branches-where-head",
|
||||
owner.getOwnerName(),
|
||||
owner.getName(),
|
||||
sha))
|
||||
.toIterable(GHBranch[].class, item -> item.wrap(owner));
|
||||
}
|
||||
|
||||
/**
|
||||
* List comments paged iterable.
|
||||
*
|
||||
@@ -530,7 +565,7 @@ public class GHCommit {
|
||||
* @throws IOException
|
||||
* on error
|
||||
*/
|
||||
@Preview
|
||||
@Preview(ANTIOPE)
|
||||
@Deprecated
|
||||
public PagedIterable<GHCheckRun> getCheckRuns() throws IOException {
|
||||
return owner.getCheckRuns(sha);
|
||||
@@ -538,7 +573,7 @@ public class GHCommit {
|
||||
|
||||
/**
|
||||
* Some of the fields are not always filled in when this object is retrieved as a part of another API call.
|
||||
*
|
||||
*
|
||||
* @throws IOException
|
||||
* on error
|
||||
*/
|
||||
|
||||
@@ -89,6 +89,19 @@ public class GHCommitBuilder {
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Configures the PGP signature of this commit.
|
||||
*
|
||||
* @param signature
|
||||
* the signature calculated from the commit
|
||||
*
|
||||
* @return the gh commit builder
|
||||
*/
|
||||
public GHCommitBuilder withSignature(String signature) {
|
||||
req.with("signature", signature);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Configures the committer of this commit.
|
||||
*
|
||||
|
||||
@@ -5,7 +5,7 @@ import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||
import java.io.IOException;
|
||||
import java.net.URL;
|
||||
|
||||
import static org.kohsuke.github.Previews.*;
|
||||
import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
|
||||
|
||||
/**
|
||||
* A comment attached to a commit (or a specific line in a specific file of a commit.)
|
||||
@@ -121,7 +121,7 @@ public class GHCommitComment extends GHObject implements Reactable {
|
||||
this.body = body;
|
||||
}
|
||||
|
||||
@Preview
|
||||
@Preview(SQUIRREL_GIRL)
|
||||
@Deprecated
|
||||
public GHReaction createReaction(ReactionContent content) throws IOException {
|
||||
return owner.root.createRequest()
|
||||
@@ -133,7 +133,7 @@ public class GHCommitComment extends GHObject implements Reactable {
|
||||
.wrap(owner.root);
|
||||
}
|
||||
|
||||
@Preview
|
||||
@Preview(SQUIRREL_GIRL)
|
||||
@Deprecated
|
||||
public PagedIterable<GHReaction> listReactions() {
|
||||
return owner.root.createRequest()
|
||||
@@ -153,7 +153,7 @@ public class GHCommitComment extends GHObject implements Reactable {
|
||||
}
|
||||
|
||||
private String getApiTail() {
|
||||
return String.format("/repos/%s/%s/comments/%s", owner.getOwnerName(), owner.getName(), id);
|
||||
return String.format("/repos/%s/%s/comments/%s", owner.getOwnerName(), owner.getName(), getId());
|
||||
}
|
||||
|
||||
GHCommitComment wrap(GHRepository owner) {
|
||||
|
||||
@@ -1,6 +1,7 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import org.apache.commons.lang3.StringUtils;
|
||||
import org.kohsuke.github.internal.Previews;
|
||||
|
||||
import java.io.IOException;
|
||||
|
||||
@@ -10,7 +11,7 @@ import java.io.IOException;
|
||||
* @author Marc de Verdelhan
|
||||
* @see GitHub#searchCommits() GitHub#searchCommits()
|
||||
*/
|
||||
@Preview
|
||||
@Preview(Previews.CLOAK)
|
||||
@Deprecated
|
||||
public class GHCommitSearchBuilder extends GHSearchBuilder<GHCommit> {
|
||||
GHCommitSearchBuilder(GitHub root) {
|
||||
|
||||
@@ -18,8 +18,6 @@ public class GHCommitStatus extends GHObject {
|
||||
String context;
|
||||
GHUser creator;
|
||||
|
||||
private GitHub root;
|
||||
|
||||
GHCommitStatus wrapUp(GitHub root) {
|
||||
if (creator != null)
|
||||
creator.wrapUp(root);
|
||||
|
||||
@@ -15,21 +15,20 @@ import java.util.Base64;
|
||||
* @see GHRepository#getFileContent(String) GHRepository#getFileContent(String)
|
||||
*/
|
||||
@SuppressWarnings({ "UnusedDeclaration" })
|
||||
public class GHContent implements Refreshable {
|
||||
public class GHContent extends GitHubInteractiveObject implements Refreshable {
|
||||
/*
|
||||
* In normal use of this class, repository field is set via wrap(), but in the code search API, there's a nested
|
||||
* 'repository' field that gets populated from JSON.
|
||||
*/
|
||||
private GHRepository repository;
|
||||
|
||||
private GitHub root;
|
||||
|
||||
private String type;
|
||||
private String encoding;
|
||||
private long size;
|
||||
private String sha;
|
||||
private String name;
|
||||
private String path;
|
||||
private String target;
|
||||
private String content;
|
||||
private String url; // this is the API url
|
||||
private String git_url; // this is the Blob url
|
||||
@@ -99,6 +98,15 @@ public class GHContent implements Refreshable {
|
||||
return path;
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets target of a symlink. This will only be set if {@code "symlink".equals(getType())}
|
||||
*
|
||||
* @return the target
|
||||
*/
|
||||
public String getTarget() {
|
||||
return target;
|
||||
}
|
||||
|
||||
/**
|
||||
* Retrieve the decoded content that is stored at this location.
|
||||
*
|
||||
|
||||
@@ -118,6 +118,41 @@ public class GHContentSearchBuilder extends GHSearchBuilder<GHContent> {
|
||||
return q("repo:" + v);
|
||||
}
|
||||
|
||||
/**
|
||||
* Order gh content search builder.
|
||||
*
|
||||
* @param v
|
||||
* the v
|
||||
* @return the gh content search builder
|
||||
*/
|
||||
public GHContentSearchBuilder order(GHDirection v) {
|
||||
req.with("order", v);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Sort gh content search builder.
|
||||
*
|
||||
* @param sort
|
||||
* the sort
|
||||
* @return the gh content search builder
|
||||
*/
|
||||
public GHContentSearchBuilder sort(GHContentSearchBuilder.Sort sort) {
|
||||
if (Sort.BEST_MATCH.equals(sort)) {
|
||||
req.remove("sort");
|
||||
} else {
|
||||
req.with("sort", sort);
|
||||
}
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* The enum Sort.
|
||||
*/
|
||||
public enum Sort {
|
||||
BEST_MATCH, INDEXED
|
||||
}
|
||||
|
||||
private static class ContentSearchResult extends SearchResult<GHContent> {
|
||||
private GHContent[] items;
|
||||
|
||||
|
||||
@@ -1,166 +1,25 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import java.io.IOException;
|
||||
import java.net.URL;
|
||||
|
||||
import static org.kohsuke.github.internal.Previews.BAPTISTE;
|
||||
|
||||
/**
|
||||
* Creates a repository
|
||||
*
|
||||
* @author Kohsuke Kawaguchi
|
||||
*/
|
||||
public class GHCreateRepositoryBuilder {
|
||||
private final GitHub root;
|
||||
protected final Requester builder;
|
||||
private final String apiUrlTail;
|
||||
public class GHCreateRepositoryBuilder extends GHRepositoryBuilder<GHCreateRepositoryBuilder> {
|
||||
|
||||
GHCreateRepositoryBuilder(GitHub root, String apiUrlTail, String name) {
|
||||
this.root = root;
|
||||
this.apiUrlTail = apiUrlTail;
|
||||
this.builder = root.createRequest();
|
||||
this.builder.with("name", name);
|
||||
}
|
||||
public GHCreateRepositoryBuilder(String name, GitHub root, String apiTail) {
|
||||
super(GHCreateRepositoryBuilder.class, root, null);
|
||||
requester.method("POST").withUrlPath(apiTail);
|
||||
|
||||
/**
|
||||
* Description for repository
|
||||
*
|
||||
* @param description
|
||||
* description of repository
|
||||
* @return a builder to continue with building
|
||||
*/
|
||||
public GHCreateRepositoryBuilder description(String description) {
|
||||
this.builder.with("description", description);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Homepage for repository
|
||||
*
|
||||
* @param homepage
|
||||
* homepage of repository
|
||||
* @return a builder to continue with building
|
||||
*/
|
||||
public GHCreateRepositoryBuilder homepage(URL homepage) {
|
||||
return homepage(homepage.toExternalForm());
|
||||
}
|
||||
|
||||
/**
|
||||
* Homepage for repository
|
||||
*
|
||||
* @param homepage
|
||||
* homepage of repository
|
||||
* @return a builder to continue with building
|
||||
*/
|
||||
public GHCreateRepositoryBuilder homepage(String homepage) {
|
||||
this.builder.with("homepage", homepage);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Creates a private repository
|
||||
*
|
||||
* @param enabled
|
||||
* private if true
|
||||
* @return a builder to continue with building
|
||||
*/
|
||||
public GHCreateRepositoryBuilder private_(boolean enabled) {
|
||||
this.builder.with("private", enabled);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Enables issue tracker
|
||||
*
|
||||
* @param enabled
|
||||
* true if enabled
|
||||
* @return a builder to continue with building
|
||||
*/
|
||||
public GHCreateRepositoryBuilder issues(boolean enabled) {
|
||||
this.builder.with("has_issues", enabled);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Enables projects
|
||||
*
|
||||
* @param enabled
|
||||
* true if enabled
|
||||
* @return a builder to continue with building
|
||||
*/
|
||||
public GHCreateRepositoryBuilder projects(boolean enabled) {
|
||||
this.builder.with("has_projects", enabled);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Enables wiki
|
||||
*
|
||||
* @param enabled
|
||||
* true if enabled
|
||||
* @return a builder to continue with building
|
||||
*/
|
||||
public GHCreateRepositoryBuilder wiki(boolean enabled) {
|
||||
this.builder.with("has_wiki", enabled);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Enables downloads
|
||||
*
|
||||
* @param enabled
|
||||
* true if enabled
|
||||
* @return a builder to continue with building
|
||||
*/
|
||||
public GHCreateRepositoryBuilder downloads(boolean enabled) {
|
||||
this.builder.with("has_downloads", enabled);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* If true, create an initial commit with empty README.
|
||||
*
|
||||
* @param enabled
|
||||
* true if enabled
|
||||
* @return a builder to continue with building
|
||||
*/
|
||||
public GHCreateRepositoryBuilder autoInit(boolean enabled) {
|
||||
this.builder.with("auto_init", enabled);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Allow or disallow squash-merging pull requests.
|
||||
*
|
||||
* @param enabled
|
||||
* true if enabled
|
||||
* @return a builder to continue with building
|
||||
*/
|
||||
public GHCreateRepositoryBuilder allowSquashMerge(boolean enabled) {
|
||||
this.builder.with("allow_squash_merge", enabled);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Allow or disallow merging pull requests with a merge commit.
|
||||
*
|
||||
* @param enabled
|
||||
* true if enabled
|
||||
* @return a builder to continue with building
|
||||
*/
|
||||
public GHCreateRepositoryBuilder allowMergeCommit(boolean enabled) {
|
||||
this.builder.with("allow_merge_commit", enabled);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Allow or disallow rebase-merging pull requests.
|
||||
*
|
||||
* @param enabled
|
||||
* true if enabled
|
||||
* @return a builder to continue with building
|
||||
*/
|
||||
public GHCreateRepositoryBuilder allowRebaseMerge(boolean enabled) {
|
||||
this.builder.with("allow_rebase_merge", enabled);
|
||||
return this;
|
||||
try {
|
||||
name(name);
|
||||
} catch (IOException e) {
|
||||
// not going to happen here
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -169,10 +28,11 @@ public class GHCreateRepositoryBuilder {
|
||||
* @param language
|
||||
* template to base the ignore file on
|
||||
* @return a builder to continue with building See https://developer.github.com/v3/repos/#create
|
||||
* @throws IOException
|
||||
* In case of any networking error or error from the server.
|
||||
*/
|
||||
public GHCreateRepositoryBuilder gitignoreTemplate(String language) {
|
||||
this.builder.with("gitignore_template", language);
|
||||
return this;
|
||||
public GHCreateRepositoryBuilder gitignoreTemplate(String language) throws IOException {
|
||||
return with("gitignore_template", language);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -181,10 +41,24 @@ public class GHCreateRepositoryBuilder {
|
||||
* @param license
|
||||
* template to base the license file on
|
||||
* @return a builder to continue with building See https://developer.github.com/v3/repos/#create
|
||||
* @throws IOException
|
||||
* In case of any networking error or error from the server.
|
||||
*/
|
||||
public GHCreateRepositoryBuilder licenseTemplate(String license) {
|
||||
this.builder.with("license_template", license);
|
||||
return this;
|
||||
public GHCreateRepositoryBuilder licenseTemplate(String license) throws IOException {
|
||||
return with("license_template", license);
|
||||
}
|
||||
|
||||
/**
|
||||
* If true, create an initial commit with empty README.
|
||||
*
|
||||
* @param enabled
|
||||
* true if enabled
|
||||
* @return a builder to continue with building
|
||||
* @throws IOException
|
||||
* In case of any networking error or error from the server.
|
||||
*/
|
||||
public GHCreateRepositoryBuilder autoInit(boolean enabled) throws IOException {
|
||||
return with("auto_init", enabled);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -193,10 +67,57 @@ public class GHCreateRepositoryBuilder {
|
||||
* @param team
|
||||
* team to grant access to
|
||||
* @return a builder to continue with building
|
||||
* @throws IOException
|
||||
* In case of any networking error or error from the server.
|
||||
*/
|
||||
public GHCreateRepositoryBuilder team(GHTeam team) {
|
||||
public GHCreateRepositoryBuilder team(GHTeam team) throws IOException {
|
||||
if (team != null)
|
||||
this.builder.with("team_id", team.getId());
|
||||
return with("team_id", team.getId());
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Specifies whether the repository is a template.
|
||||
*
|
||||
* @param enabled
|
||||
* true if enabled
|
||||
* @return a builder to continue with building
|
||||
* @throws IOException
|
||||
* In case of any networking error or error from the server.
|
||||
* @deprecated Use {@link #isTemplate(boolean)} method instead
|
||||
*/
|
||||
@Deprecated
|
||||
public GHCreateRepositoryBuilder templateRepository(boolean enabled) throws IOException {
|
||||
return isTemplate(enabled);
|
||||
}
|
||||
|
||||
/**
|
||||
* Specifies the ownership of the repository.
|
||||
*
|
||||
* @param owner
|
||||
* organization or personage
|
||||
* @return a builder to continue with building
|
||||
* @throws IOException
|
||||
* In case of any networking error or error from the server.
|
||||
*/
|
||||
public GHCreateRepositoryBuilder owner(String owner) throws IOException {
|
||||
return with("owner", owner);
|
||||
}
|
||||
|
||||
/**
|
||||
* Create repository from template repository
|
||||
*
|
||||
* @param templateOwner
|
||||
* template repository owner
|
||||
* @param templateRepo
|
||||
* template repository
|
||||
* @return a builder to continue with building
|
||||
* @see <a href="https://developer.github.com/v3/previews/">GitHub API Previews</a>
|
||||
*/
|
||||
@Preview(BAPTISTE)
|
||||
@Deprecated
|
||||
public GHCreateRepositoryBuilder fromTemplateRepository(String templateOwner, String templateRepo) {
|
||||
requester.withPreview(BAPTISTE).withUrlPath("/repos/" + templateOwner + "/" + templateRepo + "/generate");
|
||||
return this;
|
||||
}
|
||||
|
||||
@@ -205,10 +126,9 @@ public class GHCreateRepositoryBuilder {
|
||||
*
|
||||
* @return the gh repository
|
||||
* @throws IOException
|
||||
* if repsitory cannot be created
|
||||
* if repository cannot be created
|
||||
*/
|
||||
public GHRepository create() throws IOException {
|
||||
return builder.method("POST").withUrlPath(apiUrlTail).fetch(GHRepository.class).wrap(root);
|
||||
return done();
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
@@ -1,7 +1,10 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import org.kohsuke.github.internal.Previews;
|
||||
|
||||
import java.io.IOException;
|
||||
import java.net.URL;
|
||||
import java.util.Map;
|
||||
|
||||
/**
|
||||
* Represents a deployment
|
||||
@@ -13,7 +16,6 @@ import java.net.URL;
|
||||
*/
|
||||
public class GHDeployment extends GHObject {
|
||||
private GHRepository owner;
|
||||
private GitHub root;
|
||||
protected String sha;
|
||||
protected String ref;
|
||||
protected String task;
|
||||
@@ -23,6 +25,9 @@ public class GHDeployment extends GHObject {
|
||||
protected String statuses_url;
|
||||
protected String repository_url;
|
||||
protected GHUser creator;
|
||||
protected String original_environment;
|
||||
protected boolean transient_environment;
|
||||
protected boolean production_environment;
|
||||
|
||||
GHDeployment wrap(GHRepository owner) {
|
||||
this.owner = owner;
|
||||
@@ -60,7 +65,8 @@ public class GHDeployment extends GHObject {
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets payload.
|
||||
* Gets payload. <b>NOTE:</b> only use this method if you can guarantee the payload will be a simple string,
|
||||
* otherwise use {@link #getPayloadObject()}.
|
||||
*
|
||||
* @return the payload
|
||||
*/
|
||||
@@ -68,6 +74,38 @@ public class GHDeployment extends GHObject {
|
||||
return (String) payload;
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets payload. <b>NOTE:</b> only use this method if you can guarantee the payload will be a JSON object (Map),
|
||||
* otherwise use {@link #getPayloadObject()}.
|
||||
*
|
||||
* @return the payload
|
||||
*/
|
||||
public Map<String, Object> getPayloadMap() {
|
||||
return (Map<String, Object>) payload;
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets payload without assuming its type. It could be a String or a Map.
|
||||
*
|
||||
* @return the payload
|
||||
*/
|
||||
public Object getPayloadObject() {
|
||||
return payload;
|
||||
}
|
||||
|
||||
/**
|
||||
* The environment defined when the deployment was first created.
|
||||
*
|
||||
* @deprecated until preview feature has graduated to stable
|
||||
*
|
||||
* @return the original deployment environment
|
||||
*/
|
||||
@Deprecated
|
||||
@Preview(Previews.FLASH)
|
||||
public String getOriginalEnvironment() {
|
||||
return original_environment;
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets environment.
|
||||
*
|
||||
@@ -77,6 +115,33 @@ public class GHDeployment extends GHObject {
|
||||
return environment;
|
||||
}
|
||||
|
||||
/**
|
||||
* Specifies if the given environment is specific to the deployment and will no longer exist at some point in the
|
||||
* future.
|
||||
*
|
||||
* @deprecated until preview feature has graduated to stable
|
||||
*
|
||||
* @return the environment is transient
|
||||
*/
|
||||
@Deprecated
|
||||
@Preview(Previews.ANT_MAN)
|
||||
public boolean isTransientEnvironment() {
|
||||
return transient_environment;
|
||||
}
|
||||
|
||||
/**
|
||||
* Specifies if the given environment is one that end-users directly interact with.
|
||||
*
|
||||
* @deprecated until preview feature has graduated to stable
|
||||
*
|
||||
* @return the environment is used by end-users directly
|
||||
*/
|
||||
@Deprecated
|
||||
@Preview(Previews.ANT_MAN)
|
||||
public boolean isProductionEnvironment() {
|
||||
return production_environment;
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets creator.
|
||||
*
|
||||
@@ -122,7 +187,7 @@ public class GHDeployment extends GHObject {
|
||||
* @return the gh deployment status builder
|
||||
*/
|
||||
public GHDeploymentStatusBuilder createStatus(GHDeploymentState state) {
|
||||
return new GHDeploymentStatusBuilder(owner, id, state);
|
||||
return new GHDeploymentStatusBuilder(owner, getId(), state);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -133,6 +198,8 @@ public class GHDeployment extends GHObject {
|
||||
public PagedIterable<GHDeploymentStatus> listStatuses() {
|
||||
return root.createRequest()
|
||||
.withUrlPath(statuses_url)
|
||||
.withPreview(Previews.ANT_MAN)
|
||||
.withPreview(Previews.FLASH)
|
||||
.toIterable(GHDeploymentStatus[].class, item -> item.wrap(owner));
|
||||
}
|
||||
|
||||
|
||||
@@ -1,5 +1,7 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import org.kohsuke.github.internal.Previews;
|
||||
|
||||
import java.io.IOException;
|
||||
import java.util.List;
|
||||
|
||||
@@ -19,7 +21,10 @@ public class GHDeploymentBuilder {
|
||||
*/
|
||||
public GHDeploymentBuilder(GHRepository repo) {
|
||||
this.repo = repo;
|
||||
this.builder = repo.root.createRequest().method("POST");
|
||||
this.builder = repo.root.createRequest()
|
||||
.withPreview(Previews.ANT_MAN)
|
||||
.withPreview(Previews.FLASH)
|
||||
.method("POST");
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -40,6 +45,7 @@ public class GHDeploymentBuilder {
|
||||
*
|
||||
* @param branch
|
||||
* the branch
|
||||
*
|
||||
* @return the gh deployment builder
|
||||
*/
|
||||
public GHDeploymentBuilder ref(String branch) {
|
||||
@@ -52,6 +58,7 @@ public class GHDeploymentBuilder {
|
||||
*
|
||||
* @param task
|
||||
* the task
|
||||
*
|
||||
* @return the gh deployment builder
|
||||
*/
|
||||
public GHDeploymentBuilder task(String task) {
|
||||
@@ -64,6 +71,7 @@ public class GHDeploymentBuilder {
|
||||
*
|
||||
* @param autoMerge
|
||||
* the auto merge
|
||||
*
|
||||
* @return the gh deployment builder
|
||||
*/
|
||||
public GHDeploymentBuilder autoMerge(boolean autoMerge) {
|
||||
@@ -76,6 +84,7 @@ public class GHDeploymentBuilder {
|
||||
*
|
||||
* @param requiredContexts
|
||||
* the required contexts
|
||||
*
|
||||
* @return the gh deployment builder
|
||||
*/
|
||||
public GHDeploymentBuilder requiredContexts(List<String> requiredContexts) {
|
||||
@@ -88,6 +97,7 @@ public class GHDeploymentBuilder {
|
||||
*
|
||||
* @param payload
|
||||
* the payload
|
||||
*
|
||||
* @return the gh deployment builder
|
||||
*/
|
||||
public GHDeploymentBuilder payload(String payload) {
|
||||
@@ -100,6 +110,7 @@ public class GHDeploymentBuilder {
|
||||
*
|
||||
* @param environment
|
||||
* the environment
|
||||
*
|
||||
* @return the gh deployment builder
|
||||
*/
|
||||
public GHDeploymentBuilder environment(String environment) {
|
||||
@@ -107,11 +118,47 @@ public class GHDeploymentBuilder {
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Specifies if the given environment is specific to the deployment and will no longer exist at some point in the
|
||||
* future.
|
||||
*
|
||||
* @deprecated until preview feature has graduated to stable
|
||||
*
|
||||
* @param transientEnvironment
|
||||
* the environment is transient
|
||||
*
|
||||
* @return the gh deployment builder
|
||||
*/
|
||||
@Deprecated
|
||||
@Preview(Previews.ANT_MAN)
|
||||
public GHDeploymentBuilder transientEnvironment(boolean transientEnvironment) {
|
||||
builder.with("transient_environment", transientEnvironment);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Specifies if the given environment is one that end-users directly interact with.
|
||||
*
|
||||
* @deprecated until preview feature has graduated to stable
|
||||
*
|
||||
* @param productionEnvironment
|
||||
* the environment is used by end-users directly
|
||||
*
|
||||
* @return the gh deployment builder
|
||||
*/
|
||||
@Deprecated
|
||||
@Preview(Previews.ANT_MAN)
|
||||
public GHDeploymentBuilder productionEnvironment(boolean productionEnvironment) {
|
||||
builder.with("production_environment", productionEnvironment);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Description gh deployment builder.
|
||||
*
|
||||
* @param description
|
||||
* the description
|
||||
*
|
||||
* @return the gh deployment builder
|
||||
*/
|
||||
public GHDeploymentBuilder description(String description) {
|
||||
@@ -123,6 +170,7 @@ public class GHDeploymentBuilder {
|
||||
* Create gh deployment.
|
||||
*
|
||||
* @return the gh deployment
|
||||
*
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
|
||||
@@ -1,8 +1,40 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import org.kohsuke.github.internal.Previews;
|
||||
|
||||
/**
|
||||
* Represents the state of deployment
|
||||
*/
|
||||
public enum GHDeploymentState {
|
||||
PENDING, SUCCESS, ERROR, FAILURE
|
||||
PENDING,
|
||||
SUCCESS,
|
||||
ERROR,
|
||||
FAILURE,
|
||||
|
||||
/**
|
||||
* The state of the deployment currently reflects it's in progress.
|
||||
*
|
||||
* @deprecated until preview feature has graduated to stable
|
||||
*/
|
||||
@Deprecated
|
||||
@Preview(Previews.FLASH)
|
||||
IN_PROGRESS,
|
||||
|
||||
/**
|
||||
* The state of the deployment currently reflects it's queued up for processing.
|
||||
*
|
||||
* @deprecated until preview feature has graduated to stable
|
||||
*/
|
||||
@Deprecated
|
||||
@Preview(Previews.FLASH)
|
||||
QUEUED,
|
||||
|
||||
/**
|
||||
* The state of the deployment currently reflects it's no longer active.
|
||||
*
|
||||
* @deprecated until preview feature has graduated to stable
|
||||
*/
|
||||
@Deprecated
|
||||
@Preview(Previews.ANT_MAN)
|
||||
INACTIVE
|
||||
}
|
||||
|
||||
@@ -1,5 +1,7 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import org.kohsuke.github.internal.Previews;
|
||||
|
||||
import java.net.URL;
|
||||
import java.util.Locale;
|
||||
|
||||
@@ -8,19 +10,21 @@ import java.util.Locale;
|
||||
*/
|
||||
public class GHDeploymentStatus extends GHObject {
|
||||
private GHRepository owner;
|
||||
private GitHub root;
|
||||
protected GHUser creator;
|
||||
protected String state;
|
||||
protected String description;
|
||||
protected String target_url;
|
||||
protected String log_url;
|
||||
protected String deployment_url;
|
||||
protected String repository_url;
|
||||
protected String environment_url;
|
||||
|
||||
/**
|
||||
* Wrap gh deployment status.
|
||||
*
|
||||
* @param owner
|
||||
* the owner
|
||||
*
|
||||
* @return the gh deployment status
|
||||
*/
|
||||
public GHDeploymentStatus wrap(GHRepository owner) {
|
||||
@@ -34,12 +38,30 @@ public class GHDeploymentStatus extends GHObject {
|
||||
/**
|
||||
* Gets target url.
|
||||
*
|
||||
* @deprecated Target url is deprecated in favor of {@link #getLogUrl() getLogUrl}
|
||||
*
|
||||
* @return the target url
|
||||
*/
|
||||
@Deprecated
|
||||
public URL getTargetUrl() {
|
||||
return GitHubClient.parseURL(target_url);
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets target url.
|
||||
* <p>
|
||||
* This method replaces {@link #getTargetUrl() getTargetUrl}}.
|
||||
*
|
||||
* @deprecated until preview feature has graduated to stable
|
||||
*
|
||||
* @return the target url
|
||||
*/
|
||||
@Deprecated
|
||||
@Preview(Previews.ANT_MAN)
|
||||
public URL getLogUrl() {
|
||||
return GitHubClient.parseURL(log_url);
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets deployment url.
|
||||
*
|
||||
@@ -49,6 +71,19 @@ public class GHDeploymentStatus extends GHObject {
|
||||
return GitHubClient.parseURL(deployment_url);
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets deployment environment url.
|
||||
*
|
||||
* @deprecated until preview feature has graduated to stable
|
||||
*
|
||||
* @return the deployment environment url
|
||||
*/
|
||||
@Deprecated
|
||||
@Preview(Previews.ANT_MAN)
|
||||
public URL getEnvironmentUrl() {
|
||||
return GitHubClient.parseURL(environment_url);
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets repository url.
|
||||
*
|
||||
|
||||
@@ -1,5 +1,7 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import org.kohsuke.github.internal.Previews;
|
||||
|
||||
import java.io.IOException;
|
||||
|
||||
/**
|
||||
@@ -21,6 +23,7 @@ public class GHDeploymentStatusBuilder {
|
||||
* the deployment id
|
||||
* @param state
|
||||
* the state
|
||||
*
|
||||
* @deprecated Use {@link GHDeployment#createStatus(GHDeploymentState)}
|
||||
*/
|
||||
@Deprecated
|
||||
@@ -31,15 +34,38 @@ public class GHDeploymentStatusBuilder {
|
||||
GHDeploymentStatusBuilder(GHRepository repo, long deploymentId, GHDeploymentState state) {
|
||||
this.repo = repo;
|
||||
this.deploymentId = deploymentId;
|
||||
this.builder = repo.root.createRequest().method("POST");
|
||||
this.builder = repo.root.createRequest()
|
||||
.withPreview(Previews.ANT_MAN)
|
||||
.withPreview(Previews.FLASH)
|
||||
.method("POST");
|
||||
|
||||
this.builder.with("state", state);
|
||||
}
|
||||
|
||||
/**
|
||||
* Add an inactive status to all prior non-transient, non-production environment deployments with the same
|
||||
* repository and environment name as the created status's deployment.
|
||||
*
|
||||
* @deprecated until preview feature has graduated to stable
|
||||
*
|
||||
* @param autoInactive
|
||||
* Add inactive status flag
|
||||
*
|
||||
* @return the gh deployment status builder
|
||||
*/
|
||||
@Deprecated
|
||||
@Preview({ Previews.ANT_MAN, Previews.FLASH })
|
||||
public GHDeploymentStatusBuilder autoInactive(boolean autoInactive) {
|
||||
this.builder.with("auto_inactive", autoInactive);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Description gh deployment status builder.
|
||||
*
|
||||
* @param description
|
||||
* the description
|
||||
*
|
||||
* @return the gh deployment status builder
|
||||
*/
|
||||
public GHDeploymentStatusBuilder description(String description) {
|
||||
@@ -47,13 +73,70 @@ public class GHDeploymentStatusBuilder {
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Name for the target deployment environment, which can be changed when setting a deploy status.
|
||||
*
|
||||
* @deprecated until preview feature has graduated to stable
|
||||
*
|
||||
* @param environment
|
||||
* the environment name
|
||||
*
|
||||
* @return the gh deployment status builder
|
||||
*/
|
||||
@Deprecated
|
||||
@Preview(Previews.FLASH)
|
||||
public GHDeploymentStatusBuilder environment(String environment) {
|
||||
this.builder.with("environment", environment);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* The URL for accessing the environment
|
||||
*
|
||||
* @deprecated until preview feature has graduated to stable
|
||||
*
|
||||
* @param environmentUrl
|
||||
* the environment url
|
||||
*
|
||||
* @return the gh deployment status builder
|
||||
*/
|
||||
@Deprecated
|
||||
@Preview(Previews.ANT_MAN)
|
||||
public GHDeploymentStatusBuilder environmentUrl(String environmentUrl) {
|
||||
this.builder.with("environment_url", environmentUrl);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* The full URL of the deployment's output.
|
||||
* <p>
|
||||
* This method replaces {@link #targetUrl(String) targetUrl}.
|
||||
*
|
||||
* @deprecated until preview feature has graduated to stable
|
||||
*
|
||||
* @param logUrl
|
||||
* the deployment output url
|
||||
*
|
||||
* @return the gh deployment status builder
|
||||
*/
|
||||
@Deprecated
|
||||
@Preview(Previews.ANT_MAN)
|
||||
public GHDeploymentStatusBuilder logUrl(String logUrl) {
|
||||
this.builder.with("log_url", logUrl);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Target url gh deployment status builder.
|
||||
*
|
||||
* @deprecated Target url is deprecated in favor of {@link #logUrl(String) logUrl}
|
||||
*
|
||||
* @param targetUrl
|
||||
* the target url
|
||||
*
|
||||
* @return the gh deployment status builder
|
||||
*/
|
||||
@Deprecated
|
||||
public GHDeploymentStatusBuilder targetUrl(String targetUrl) {
|
||||
this.builder.with("target_url", targetUrl);
|
||||
return this;
|
||||
@@ -63,6 +146,7 @@ public class GHDeploymentStatusBuilder {
|
||||
* Create gh deployment status.
|
||||
*
|
||||
* @return the gh deployment status
|
||||
*
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
|
||||
230
src/main/java/org/kohsuke/github/GHDiscussion.java
Normal file
230
src/main/java/org/kohsuke/github/GHDiscussion.java
Normal file
@@ -0,0 +1,230 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||
import org.kohsuke.github.internal.Previews;
|
||||
|
||||
import java.io.IOException;
|
||||
import java.net.URL;
|
||||
import java.util.Objects;
|
||||
|
||||
import javax.annotation.CheckForNull;
|
||||
import javax.annotation.Nonnull;
|
||||
|
||||
/**
|
||||
* A discussion in GitHub Team.
|
||||
*
|
||||
* @author Charles Moulliard
|
||||
* @see <a href="https://developer.github.com/v3/teams/discussions">GitHub Team Discussions</a>
|
||||
*/
|
||||
public class GHDiscussion extends GHObject {
|
||||
|
||||
private GHTeam team;
|
||||
private long number;
|
||||
private String body, title, htmlUrl;
|
||||
|
||||
@JsonProperty(value = "private")
|
||||
private boolean isPrivate;
|
||||
|
||||
@Override
|
||||
public URL getHtmlUrl() throws IOException {
|
||||
return GitHubClient.parseURL(htmlUrl);
|
||||
}
|
||||
|
||||
GHDiscussion wrapUp(GHTeam team) {
|
||||
this.team = team;
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Get the team to which this discussion belongs.
|
||||
*
|
||||
* @return the team for this discussion
|
||||
*/
|
||||
@Nonnull
|
||||
public GHTeam getTeam() {
|
||||
return team;
|
||||
}
|
||||
|
||||
/**
|
||||
* Get the title of the discussion.
|
||||
*
|
||||
* @return the title
|
||||
*/
|
||||
public String getTitle() {
|
||||
return title;
|
||||
}
|
||||
|
||||
/**
|
||||
* The description of this discussion.
|
||||
*
|
||||
* @return the body
|
||||
*/
|
||||
public String getBody() {
|
||||
return body;
|
||||
}
|
||||
|
||||
/**
|
||||
* The number of this discussion.
|
||||
*
|
||||
* @return the number
|
||||
*/
|
||||
public long getNumber() {
|
||||
return number;
|
||||
}
|
||||
|
||||
/**
|
||||
* The id number of this discussion. GitHub discussions have "number" instead of "id". This is provided for
|
||||
* convenience.
|
||||
*
|
||||
* @return the id number for this discussion
|
||||
* @see #getNumber()
|
||||
*/
|
||||
@Override
|
||||
public long getId() {
|
||||
return getNumber();
|
||||
}
|
||||
|
||||
/**
|
||||
* Whether the discussion is private to the team.
|
||||
*
|
||||
* @return {@code true} if discussion is private.
|
||||
*/
|
||||
public boolean isPrivate() {
|
||||
return isPrivate;
|
||||
}
|
||||
|
||||
/**
|
||||
* Begins the creation of a new instance.
|
||||
*
|
||||
* Consumer must call {@link GHDiscussion.Creator#done()} to commit changes.
|
||||
*
|
||||
* @param team
|
||||
* the team in which the discussion will be created.
|
||||
* @return a {@link GHLabel.Creator}
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
static GHDiscussion.Creator create(GHTeam team) throws IOException {
|
||||
return new GHDiscussion.Creator(team);
|
||||
}
|
||||
|
||||
static GHDiscussion read(GHTeam team, long discussionNumber) throws IOException {
|
||||
return team.root.createRequest()
|
||||
.setRawUrlPath(getRawUrlPath(team, discussionNumber))
|
||||
.fetch(GHDiscussion.class)
|
||||
.wrapUp(team);
|
||||
}
|
||||
|
||||
static PagedIterable<GHDiscussion> readAll(GHTeam team) throws IOException {
|
||||
return team.root.createRequest()
|
||||
.setRawUrlPath(getRawUrlPath(team, null))
|
||||
.toIterable(GHDiscussion[].class, item -> item.wrapUp(team));
|
||||
}
|
||||
|
||||
/**
|
||||
* Begins a batch update
|
||||
*
|
||||
* Consumer must call {@link GHDiscussion.Updater#done()} to commit changes.
|
||||
*
|
||||
* @return a {@link GHDiscussion.Updater}
|
||||
*/
|
||||
@Preview(Previews.SQUIRREL_GIRL)
|
||||
@Deprecated
|
||||
public GHDiscussion.Updater update() {
|
||||
return new GHDiscussion.Updater(this);
|
||||
}
|
||||
|
||||
/**
|
||||
* Begins a single property update.
|
||||
*
|
||||
* @return a {@link GHDiscussion.Setter}
|
||||
*/
|
||||
@Preview(Previews.SQUIRREL_GIRL)
|
||||
@Deprecated
|
||||
public GHDiscussion.Setter set() {
|
||||
return new GHDiscussion.Setter(this);
|
||||
}
|
||||
|
||||
/**
|
||||
* Delete the discussion
|
||||
*
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
public void delete() throws IOException {
|
||||
team.root.createRequest().method("DELETE").setRawUrlPath(getRawUrlPath(team, number)).send();
|
||||
}
|
||||
|
||||
private static String getRawUrlPath(@Nonnull GHTeam team, @CheckForNull Long discussionNumber) {
|
||||
return team.getUrl().toString() + "/discussions" + (discussionNumber == null ? "" : "/" + discussionNumber);
|
||||
}
|
||||
|
||||
/**
|
||||
* A {@link GHLabelBuilder} that updates a single property per request
|
||||
*
|
||||
* {@link #done()} is called automatically after the property is set.
|
||||
*/
|
||||
public static class Setter extends GHDiscussionBuilder<GHDiscussion> {
|
||||
private Setter(@Nonnull GHDiscussion base) {
|
||||
super(GHDiscussion.class, base.team, base);
|
||||
requester.method("PATCH").setRawUrlPath(base.getUrl().toString());
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* A {@link GHLabelBuilder} that allows multiple properties to be updated per request.
|
||||
*
|
||||
* Consumer must call {@link #done()} to commit changes.
|
||||
*/
|
||||
public static class Updater extends GHDiscussionBuilder<Updater> {
|
||||
private Updater(@Nonnull GHDiscussion base) {
|
||||
super(GHDiscussion.Updater.class, base.team, base);
|
||||
requester.method("PATCH").setRawUrlPath(base.getUrl().toString());
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* A {@link GHLabelBuilder} that creates a new {@link GHLabel}
|
||||
*
|
||||
* Consumer must call {@link #done()} to create the new instance.
|
||||
*/
|
||||
public static class Creator extends GHDiscussionBuilder<Creator> {
|
||||
|
||||
private Creator(@Nonnull GHTeam team) {
|
||||
super(GHDiscussion.Creator.class, team, null);
|
||||
requester.method("POST").setRawUrlPath(getRawUrlPath(team, null));
|
||||
}
|
||||
|
||||
/**
|
||||
* Sets whether this discussion is private to this team.
|
||||
*
|
||||
* @param value
|
||||
* privacy of this discussion
|
||||
* @return either a continuing builder or an updated {@link GHDiscussion}
|
||||
* @throws IOException
|
||||
* if there is an I/O Exception
|
||||
*/
|
||||
@Nonnull
|
||||
public Creator private_(boolean value) throws IOException {
|
||||
return with("private", value);
|
||||
}
|
||||
}
|
||||
|
||||
@Override
|
||||
public boolean equals(Object o) {
|
||||
if (this == o) {
|
||||
return true;
|
||||
}
|
||||
if (o == null || getClass() != o.getClass()) {
|
||||
return false;
|
||||
}
|
||||
GHDiscussion that = (GHDiscussion) o;
|
||||
return number == that.number && Objects.equals(getUrl(), that.getUrl()) && Objects.equals(team, that.team)
|
||||
&& Objects.equals(body, that.body) && Objects.equals(title, that.title);
|
||||
}
|
||||
|
||||
@Override
|
||||
public int hashCode() {
|
||||
return Objects.hash(team, number, body, title);
|
||||
}
|
||||
}
|
||||
80
src/main/java/org/kohsuke/github/GHDiscussionBuilder.java
Normal file
80
src/main/java/org/kohsuke/github/GHDiscussionBuilder.java
Normal file
@@ -0,0 +1,80 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import java.io.IOException;
|
||||
|
||||
import javax.annotation.CheckForNull;
|
||||
import javax.annotation.Nonnull;
|
||||
|
||||
/**
|
||||
* Base class for creating or updating a discussion.
|
||||
*
|
||||
* @param <S>
|
||||
* Intermediate return type for this builder returned by calls to {@link #with(String, Object)}. If {@link S}
|
||||
* the same as {@link GHLabel}, this builder will commit changes after each call to
|
||||
* {@link #with(String, Object)}.
|
||||
*/
|
||||
class GHDiscussionBuilder<S> extends AbstractBuilder<GHDiscussion, S> {
|
||||
|
||||
private final GHTeam team;
|
||||
|
||||
/**
|
||||
*
|
||||
* @param intermediateReturnType
|
||||
* Intermediate return type for this builder returned by calls to {@link #with(String, Object)}. If
|
||||
* {@link S} the same as {@link GHDiscussion}, this builder will commit changes after each call to
|
||||
* {@link #with(String, Object)}.
|
||||
* @param team
|
||||
* the GitHub team. Updates will be sent to the root of this team.
|
||||
* @param baseInstance
|
||||
* instance on which to base this builder. If {@code null} a new instance will be created.
|
||||
*/
|
||||
protected GHDiscussionBuilder(@Nonnull Class<S> intermediateReturnType,
|
||||
@Nonnull GHTeam team,
|
||||
@CheckForNull GHDiscussion baseInstance) {
|
||||
super(GHDiscussion.class, intermediateReturnType, team.root, baseInstance);
|
||||
|
||||
this.team = team;
|
||||
|
||||
if (baseInstance != null) {
|
||||
requester.with("title", baseInstance.getTitle());
|
||||
requester.with("body", baseInstance.getBody());
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Title for this discussion.
|
||||
*
|
||||
* @param value
|
||||
* title of discussion
|
||||
* @return either a continuing builder or an updated {@link GHDiscussion}
|
||||
* @throws IOException
|
||||
* if there is an I/O Exception
|
||||
*/
|
||||
@Nonnull
|
||||
public S title(String value) throws IOException {
|
||||
return with("title", value);
|
||||
}
|
||||
|
||||
/**
|
||||
* Body content for this discussion.
|
||||
*
|
||||
* @param value
|
||||
* body of discussion*
|
||||
* @return either a continuing builder or an updated {@link GHDiscussion}
|
||||
* @throws IOException
|
||||
* if there is an I/O Exception
|
||||
*/
|
||||
@Nonnull
|
||||
public S body(String value) throws IOException {
|
||||
return with("body", value);
|
||||
}
|
||||
|
||||
/**
|
||||
* {@inheritDoc}
|
||||
*/
|
||||
@Nonnull
|
||||
@Override
|
||||
public GHDiscussion done() throws IOException {
|
||||
return super.done().wrapUp(team);
|
||||
}
|
||||
}
|
||||
@@ -12,6 +12,7 @@ import java.util.Locale;
|
||||
public enum GHEvent {
|
||||
CHECK_RUN,
|
||||
CHECK_SUITE,
|
||||
CODE_SCANNING_ALERT,
|
||||
COMMIT_COMMENT,
|
||||
CONTENT_REFERENCE,
|
||||
CREATE,
|
||||
@@ -19,6 +20,8 @@ public enum GHEvent {
|
||||
DEPLOY_KEY,
|
||||
DEPLOYMENT,
|
||||
DEPLOYMENT_STATUS,
|
||||
DISCUSSION,
|
||||
DISCUSSION_COMMENT,
|
||||
DOWNLOAD,
|
||||
FOLLOW,
|
||||
FORK,
|
||||
@@ -56,12 +59,20 @@ public enum GHEvent {
|
||||
REPOSITORY,
|
||||
REPOSITORY_IMPORT,
|
||||
REPOSITORY_VULNERABILITY_ALERT,
|
||||
SCHEDULE,
|
||||
SECURITY_ADVISORY,
|
||||
STAR,
|
||||
STATUS,
|
||||
TEAM,
|
||||
TEAM_ADD,
|
||||
WATCH,
|
||||
WORKFLOW_DISPATCH,
|
||||
WORKFLOW_RUN,
|
||||
|
||||
/**
|
||||
* Special event type that means we haven't found an enum value corresponding to the event.
|
||||
*/
|
||||
UNKNOWN,
|
||||
|
||||
/**
|
||||
* Special event type that means "every possible event"
|
||||
|
||||
@@ -4,7 +4,7 @@ import com.fasterxml.jackson.databind.node.ObjectNode;
|
||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||
|
||||
import java.io.IOException;
|
||||
import java.util.Date;
|
||||
import java.util.*;
|
||||
|
||||
/**
|
||||
* Represents an event.
|
||||
@@ -12,14 +12,22 @@ import java.util.Date;
|
||||
* @author Kohsuke Kawaguchi
|
||||
*/
|
||||
@SuppressFBWarnings(value = "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", justification = "JSON API")
|
||||
public class GHEventInfo {
|
||||
private GitHub root;
|
||||
|
||||
public class GHEventInfo extends GitHubInteractiveObject {
|
||||
// we don't want to expose Jackson dependency to the user. This needs databinding
|
||||
private ObjectNode payload;
|
||||
|
||||
private long id;
|
||||
private String created_at;
|
||||
|
||||
/**
|
||||
* Representation of GitHub Event API Event Type.
|
||||
*
|
||||
* This is not the same as the values used for hook methods such as
|
||||
* {@link GHRepository#createHook(String, Map, Collection, boolean)}.
|
||||
*
|
||||
* @see <a href="https://docs.github.com/en/developers/webhooks-and-events/github-event-types">GitHub event
|
||||
* types</a>
|
||||
*/
|
||||
private String type;
|
||||
|
||||
// these are all shallow objects
|
||||
@@ -42,20 +50,45 @@ public class GHEventInfo {
|
||||
private String name; // owner/repo
|
||||
}
|
||||
|
||||
static final Map<String, GHEvent> mapTypeStringToEvent = createEventMap();
|
||||
|
||||
/**
|
||||
* Map for GitHub Event API Event Type to GHEvent.
|
||||
*
|
||||
* @see <a href="https://docs.github.com/en/developers/webhooks-and-events/github-event-types">GitHub event
|
||||
* types</a>
|
||||
*/
|
||||
private static Map<String, GHEvent> createEventMap() {
|
||||
HashMap<String, GHEvent> map = new HashMap<>();
|
||||
map.put("CommitCommentEvent", GHEvent.COMMIT_COMMENT);
|
||||
map.put("CreateEvent", GHEvent.CREATE);
|
||||
map.put("DeleteEvent", GHEvent.DELETE);
|
||||
map.put("ForkEvent", GHEvent.FORK);
|
||||
map.put("GollumEvent", GHEvent.GOLLUM);
|
||||
map.put("IssueCommentEvent", GHEvent.ISSUE_COMMENT);
|
||||
map.put("IssuesEvent", GHEvent.ISSUES);
|
||||
map.put("MemberEvent", GHEvent.MEMBER);
|
||||
map.put("PublicEvent", GHEvent.PUBLIC);
|
||||
map.put("PullRequestEvent", GHEvent.PULL_REQUEST);
|
||||
map.put("PullRequestReviewEvent", GHEvent.PULL_REQUEST_REVIEW);
|
||||
map.put("PullRequestReviewCommentEvent", GHEvent.PULL_REQUEST_REVIEW_COMMENT);
|
||||
map.put("PushEvent", GHEvent.PUSH);
|
||||
map.put("ReleaseEvent", GHEvent.RELEASE);
|
||||
map.put("WatchEvent", GHEvent.WATCH);
|
||||
return Collections.unmodifiableMap(map);
|
||||
}
|
||||
|
||||
static GHEvent transformTypeToGHEvent(String type) {
|
||||
return mapTypeStringToEvent.getOrDefault(type, GHEvent.UNKNOWN);
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets type.
|
||||
*
|
||||
* @return the type
|
||||
*/
|
||||
public GHEvent getType() {
|
||||
String t = type;
|
||||
if (t.endsWith("Event"))
|
||||
t = t.substring(0, t.length() - 5);
|
||||
for (GHEvent e : GHEvent.values()) {
|
||||
if (e.name().replace("_", "").equalsIgnoreCase(t))
|
||||
return e;
|
||||
}
|
||||
return null; // unknown event type
|
||||
return transformTypeToGHEvent(type);
|
||||
}
|
||||
|
||||
GHEventInfo wrapUp(GitHub root) {
|
||||
|
||||
File diff suppressed because it is too large
Load Diff
@@ -23,7 +23,6 @@ import java.util.Map.Entry;
|
||||
public class GHGist extends GHObject {
|
||||
|
||||
final GHUser owner;
|
||||
final GitHub root;
|
||||
|
||||
private String forks_url, commits_url, id, git_pull_url, git_push_url, html_url;
|
||||
|
||||
@@ -50,6 +49,30 @@ public class GHGist extends GHObject {
|
||||
this.owner = root.getUser(owner);
|
||||
}
|
||||
|
||||
/**
|
||||
* Unlike most other GitHub objects, the id for Gists can be non-numeric, such as "aa5a315d61ae9438b18d". If the id
|
||||
* is numeric, this method will get it. If id is not numeric, this will throw a runtime
|
||||
* {@link NumberFormatException}.
|
||||
*
|
||||
* @return id of the Gist.
|
||||
* @deprecated Use {@link #getGistId()} instead.
|
||||
*/
|
||||
@Deprecated
|
||||
@Override
|
||||
public long getId() {
|
||||
return Long.parseLong(getGistId());
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets the id for this Gist. Unlike most other GitHub objects, the id for Gists can be non-numeric, such as
|
||||
* "aa5a315d61ae9438b18d". This should be used instead of {@link #getId()}.
|
||||
*
|
||||
* @return id of this Gist
|
||||
*/
|
||||
public String getGistId() {
|
||||
return this.id;
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets owner.
|
||||
*
|
||||
@@ -97,6 +120,11 @@ public class GHGist extends GHObject {
|
||||
return git_push_url;
|
||||
}
|
||||
|
||||
/**
|
||||
* Get the html url.
|
||||
*
|
||||
* @return the github html url
|
||||
*/
|
||||
public URL getHtmlUrl() {
|
||||
return GitHubClient.parseURL(html_url);
|
||||
}
|
||||
|
||||
@@ -4,6 +4,8 @@ import java.io.IOException;
|
||||
import java.util.Collections;
|
||||
import java.util.LinkedHashMap;
|
||||
|
||||
import javax.annotation.Nonnull;
|
||||
|
||||
/**
|
||||
* Builder pattern for creating a new Gist.
|
||||
*
|
||||
@@ -11,7 +13,6 @@ import java.util.LinkedHashMap;
|
||||
* @see GitHub#createGist() GitHub#createGist()
|
||||
*/
|
||||
public class GHGistBuilder {
|
||||
private final GitHub root;
|
||||
private final Requester req;
|
||||
private final LinkedHashMap<String, Object> files = new LinkedHashMap<String, Object>();
|
||||
|
||||
@@ -22,7 +23,6 @@ public class GHGistBuilder {
|
||||
* the root
|
||||
*/
|
||||
public GHGistBuilder(GitHub root) {
|
||||
this.root = root;
|
||||
req = root.createRequest().method("POST");
|
||||
}
|
||||
|
||||
@@ -59,7 +59,7 @@ public class GHGistBuilder {
|
||||
* the content
|
||||
* @return Adds a new file.
|
||||
*/
|
||||
public GHGistBuilder file(String fileName, String content) {
|
||||
public GHGistBuilder file(@Nonnull String fileName, @Nonnull String content) {
|
||||
files.put(fileName, Collections.singletonMap("content", content));
|
||||
return this;
|
||||
}
|
||||
|
||||
@@ -1,8 +1,11 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import java.io.IOException;
|
||||
import java.util.Collections;
|
||||
import java.util.HashMap;
|
||||
import java.util.LinkedHashMap;
|
||||
import java.util.Map;
|
||||
|
||||
import javax.annotation.Nonnull;
|
||||
|
||||
/**
|
||||
* Builder pattern for updating a Gist.
|
||||
@@ -12,7 +15,7 @@ import java.util.LinkedHashMap;
|
||||
public class GHGistUpdater {
|
||||
private final GHGist base;
|
||||
private final Requester builder;
|
||||
LinkedHashMap<String, Object> files;
|
||||
LinkedHashMap<String, Map<String, String>> files;
|
||||
|
||||
GHGistUpdater(GHGist base) {
|
||||
this.base = base;
|
||||
@@ -32,16 +35,15 @@ public class GHGistUpdater {
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
public GHGistUpdater addFile(String fileName, String content) throws IOException {
|
||||
public GHGistUpdater addFile(@Nonnull String fileName, @Nonnull String content) throws IOException {
|
||||
updateFile(fileName, content);
|
||||
return this;
|
||||
}
|
||||
|
||||
// // This method does not work.
|
||||
// public GHGistUpdater deleteFile(String fileName) throws IOException {
|
||||
// files.put(fileName, Collections.singletonMap("filename", null));
|
||||
// return this;
|
||||
// }
|
||||
public GHGistUpdater deleteFile(@Nonnull String fileName) throws IOException {
|
||||
files.put(fileName, null);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Rename file gh gist updater.
|
||||
@@ -54,8 +56,9 @@ public class GHGistUpdater {
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
public GHGistUpdater renameFile(String fileName, String newFileName) throws IOException {
|
||||
files.put(fileName, Collections.singletonMap("filename", newFileName));
|
||||
public GHGistUpdater renameFile(@Nonnull String fileName, @Nonnull String newFileName) throws IOException {
|
||||
Map<String, String> file = files.computeIfAbsent(fileName, d -> new HashMap<>());
|
||||
file.put("filename", newFileName);
|
||||
return this;
|
||||
}
|
||||
|
||||
@@ -70,8 +73,31 @@ public class GHGistUpdater {
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
public GHGistUpdater updateFile(String fileName, String content) throws IOException {
|
||||
files.put(fileName, Collections.singletonMap("content", content));
|
||||
public GHGistUpdater updateFile(@Nonnull String fileName, @Nonnull String content) throws IOException {
|
||||
Map<String, String> file = files.computeIfAbsent(fileName, d -> new HashMap<>());
|
||||
file.put("content", content);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Update file name and content
|
||||
*
|
||||
* @param fileName
|
||||
* the file name
|
||||
* @param newFileName
|
||||
* the new file name
|
||||
* @param content
|
||||
* the content
|
||||
* @return the gh gist updater
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
public GHGistUpdater updateFile(@Nonnull String fileName, @Nonnull String newFileName, @Nonnull String content)
|
||||
throws IOException {
|
||||
Map<String, String> file = files.computeIfAbsent(fileName, d -> new HashMap<>());
|
||||
file.put("content", content);
|
||||
file.put("filename", newFileName);
|
||||
files.put(fileName, file);
|
||||
return this;
|
||||
}
|
||||
|
||||
|
||||
@@ -1,13 +1,13 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||
import org.kohsuke.github.internal.EnumUtils;
|
||||
|
||||
import java.io.IOException;
|
||||
import java.net.URL;
|
||||
import java.util.Collections;
|
||||
import java.util.EnumSet;
|
||||
import java.util.List;
|
||||
import java.util.Locale;
|
||||
import java.util.Map;
|
||||
|
||||
/**
|
||||
@@ -40,10 +40,7 @@ public abstract class GHHook extends GHObject {
|
||||
public EnumSet<GHEvent> getEvents() {
|
||||
EnumSet<GHEvent> s = EnumSet.noneOf(GHEvent.class);
|
||||
for (String e : events) {
|
||||
if (e.equals("*"))
|
||||
s.add(GHEvent.ALL);
|
||||
else
|
||||
s.add(Enum.valueOf(GHEvent.class, e.toUpperCase(Locale.ENGLISH)));
|
||||
s.add(e.equals("*") ? GHEvent.ALL : EnumUtils.getEnumOrDefault(GHEvent.class, e, GHEvent.UNKNOWN));
|
||||
}
|
||||
return s;
|
||||
}
|
||||
|
||||
@@ -12,8 +12,7 @@ import java.util.Map;
|
||||
* functionality
|
||||
*/
|
||||
class GHHooks {
|
||||
static abstract class Context {
|
||||
private final GitHub root;
|
||||
static abstract class Context extends GitHubInteractiveObject {
|
||||
|
||||
private Context(GitHub root) {
|
||||
this.root = root;
|
||||
|
||||
@@ -16,7 +16,6 @@ import java.net.URL;
|
||||
"UUF_UNUSED_FIELD" },
|
||||
justification = "JSON API")
|
||||
public class GHInvitation extends GHObject {
|
||||
/* package almost final */ GitHub root;
|
||||
|
||||
private int id;
|
||||
private GHRepository repository;
|
||||
|
||||
@@ -37,8 +37,9 @@ import java.util.Collections;
|
||||
import java.util.Date;
|
||||
import java.util.List;
|
||||
import java.util.Locale;
|
||||
import java.util.Objects;
|
||||
|
||||
import static org.kohsuke.github.Previews.SQUIRREL_GIRL;
|
||||
import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
|
||||
|
||||
/**
|
||||
* Represents an issue on GitHub.
|
||||
@@ -52,7 +53,6 @@ import static org.kohsuke.github.Previews.SQUIRREL_GIRL;
|
||||
public class GHIssue extends GHObject implements Reactable {
|
||||
private static final String ASSIGNEES = "assignees";
|
||||
|
||||
GitHub root;
|
||||
GHRepository owner;
|
||||
|
||||
// API v3
|
||||
@@ -157,10 +157,8 @@ public class GHIssue extends GHObject implements Reactable {
|
||||
* Gets labels.
|
||||
*
|
||||
* @return the labels
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
public Collection<GHLabel> getLabels() throws IOException {
|
||||
public Collection<GHLabel> getLabels() {
|
||||
if (labels == null) {
|
||||
return Collections.emptyList();
|
||||
}
|
||||
@@ -179,10 +177,12 @@ public class GHIssue extends GHObject implements Reactable {
|
||||
/**
|
||||
* Gets api url.
|
||||
*
|
||||
* @return the api url
|
||||
* @return API URL of this object.
|
||||
* @deprecated use {@link #getUrl()}
|
||||
*/
|
||||
@Deprecated
|
||||
public URL getApiURL() {
|
||||
return GitHubClient.parseURL(url);
|
||||
return getUrl();
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -236,7 +236,7 @@ public class GHIssue extends GHObject implements Reactable {
|
||||
}
|
||||
|
||||
private void editIssue(String key, Object value) throws IOException {
|
||||
root.createRequest().with(key, value).method("PATCH").withUrlPath(getIssuesApiRoute()).send();
|
||||
root.createRequest().withNullable(key, value).method("PATCH").withUrlPath(getIssuesApiRoute()).send();
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -293,9 +293,9 @@ public class GHIssue extends GHObject implements Reactable {
|
||||
*/
|
||||
public void setMilestone(GHMilestone milestone) throws IOException {
|
||||
if (milestone == null) {
|
||||
editNullable("milestone", null);
|
||||
editIssue("milestone", null);
|
||||
} else {
|
||||
edit("milestone", milestone.getNumber());
|
||||
editIssue("milestone", milestone.getNumber());
|
||||
}
|
||||
}
|
||||
|
||||
@@ -312,7 +312,7 @@ public class GHIssue extends GHObject implements Reactable {
|
||||
}
|
||||
|
||||
/**
|
||||
* Sets labels.
|
||||
* Sets labels on the target to a specific list.
|
||||
*
|
||||
* @param labels
|
||||
* the labels
|
||||
@@ -326,100 +326,137 @@ public class GHIssue extends GHObject implements Reactable {
|
||||
/**
|
||||
* Adds labels to the issue.
|
||||
*
|
||||
* Labels that are already present on the target are ignored.
|
||||
*
|
||||
* @return the complete list of labels including the new additions
|
||||
* @param names
|
||||
* Names of the label
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
public void addLabels(String... names) throws IOException {
|
||||
_addLabels(Arrays.asList(names));
|
||||
@WithBridgeMethods(void.class)
|
||||
public List<GHLabel> addLabels(String... names) throws IOException {
|
||||
return _addLabels(Arrays.asList(names));
|
||||
}
|
||||
|
||||
/**
|
||||
* Add labels.
|
||||
*
|
||||
* Labels that are already present on the target are ignored.
|
||||
*
|
||||
* @return the complete list of labels including the new additions
|
||||
* @param labels
|
||||
* the labels
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
public void addLabels(GHLabel... labels) throws IOException {
|
||||
addLabels(Arrays.asList(labels));
|
||||
@WithBridgeMethods(void.class)
|
||||
public List<GHLabel> addLabels(GHLabel... labels) throws IOException {
|
||||
return addLabels(Arrays.asList(labels));
|
||||
}
|
||||
|
||||
/**
|
||||
* Add labels.
|
||||
*
|
||||
* Labels that are already present on the target are ignored.
|
||||
*
|
||||
* @return the complete list of labels including the new additions
|
||||
* @param labels
|
||||
* the labels
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
public void addLabels(Collection<GHLabel> labels) throws IOException {
|
||||
_addLabels(GHLabel.toNames(labels));
|
||||
@WithBridgeMethods(void.class)
|
||||
public List<GHLabel> addLabels(Collection<GHLabel> labels) throws IOException {
|
||||
return _addLabels(GHLabel.toNames(labels));
|
||||
}
|
||||
|
||||
private void _addLabels(Collection<String> names) throws IOException {
|
||||
List<String> newLabels = new ArrayList<String>();
|
||||
|
||||
for (GHLabel label : getLabels()) {
|
||||
newLabels.add(label.getName());
|
||||
}
|
||||
for (String name : names) {
|
||||
if (!newLabels.contains(name)) {
|
||||
newLabels.add(name);
|
||||
}
|
||||
}
|
||||
setLabels(newLabels.toArray(new String[0]));
|
||||
private List<GHLabel> _addLabels(Collection<String> names) throws IOException {
|
||||
return Arrays.asList(root.createRequest()
|
||||
.with("labels", names)
|
||||
.method("POST")
|
||||
.withUrlPath(getIssuesApiRoute() + "/labels")
|
||||
.fetch(GHLabel[].class));
|
||||
}
|
||||
|
||||
/**
|
||||
* Remove a given label by name from this issue.
|
||||
* Remove a single label.
|
||||
*
|
||||
* Attempting to remove a label that is not present throws {@link GHFileNotFoundException}.
|
||||
*
|
||||
* @return the remaining list of labels
|
||||
* @param name
|
||||
* the name
|
||||
* @throws IOException
|
||||
* the io exception, throws {@link GHFileNotFoundException} if label was not present.
|
||||
*/
|
||||
@WithBridgeMethods(void.class)
|
||||
public List<GHLabel> removeLabel(String name) throws IOException {
|
||||
return Arrays.asList(root.createRequest()
|
||||
.method("DELETE")
|
||||
.withUrlPath(getIssuesApiRoute() + "/labels", name)
|
||||
.fetch(GHLabel[].class));
|
||||
}
|
||||
|
||||
/**
|
||||
* Remove a collection of labels.
|
||||
*
|
||||
* Attempting to remove labels that are not present on the target are ignored.
|
||||
*
|
||||
* @return the remaining list of labels
|
||||
* @param names
|
||||
* the names
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
public void removeLabels(String... names) throws IOException {
|
||||
_removeLabels(Arrays.asList(names));
|
||||
@WithBridgeMethods(void.class)
|
||||
public List<GHLabel> removeLabels(String... names) throws IOException {
|
||||
return _removeLabels(Arrays.asList(names));
|
||||
}
|
||||
|
||||
/**
|
||||
* Remove labels.
|
||||
* Remove a collection of labels.
|
||||
*
|
||||
* Attempting to remove labels that are not present on the target are ignored.
|
||||
*
|
||||
* @return the remaining list of labels
|
||||
* @param labels
|
||||
* the labels
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
* @see #removeLabels(String...) #removeLabels(String...)
|
||||
*/
|
||||
public void removeLabels(GHLabel... labels) throws IOException {
|
||||
removeLabels(Arrays.asList(labels));
|
||||
@WithBridgeMethods(void.class)
|
||||
public List<GHLabel> removeLabels(GHLabel... labels) throws IOException {
|
||||
return removeLabels(Arrays.asList(labels));
|
||||
}
|
||||
|
||||
/**
|
||||
* Remove labels.
|
||||
* Remove a collection of labels.
|
||||
*
|
||||
* Attempting to remove labels that are not present on the target are ignored.
|
||||
*
|
||||
* @return the remaining list of labels
|
||||
* @param labels
|
||||
* the labels
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
public void removeLabels(Collection<GHLabel> labels) throws IOException {
|
||||
_removeLabels(GHLabel.toNames(labels));
|
||||
@WithBridgeMethods(void.class)
|
||||
public List<GHLabel> removeLabels(Collection<GHLabel> labels) throws IOException {
|
||||
return _removeLabels(GHLabel.toNames(labels));
|
||||
}
|
||||
|
||||
private void _removeLabels(Collection<String> names) throws IOException {
|
||||
List<String> newLabels = new ArrayList<String>();
|
||||
|
||||
for (GHLabel l : getLabels()) {
|
||||
if (!names.contains(l.getName())) {
|
||||
newLabels.add(l.getName());
|
||||
private List<GHLabel> _removeLabels(Collection<String> names) throws IOException {
|
||||
List<GHLabel> remainingLabels = Collections.emptyList();
|
||||
for (String name : names) {
|
||||
try {
|
||||
remainingLabels = removeLabel(name);
|
||||
} catch (GHFileNotFoundException e) {
|
||||
// when trying to remove multiple labels, we ignore already removed
|
||||
}
|
||||
}
|
||||
|
||||
setLabels(newLabels.toArray(new String[0]));
|
||||
return remainingLabels;
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -447,7 +484,7 @@ public class GHIssue extends GHObject implements Reactable {
|
||||
.toIterable(GHIssueComment[].class, item -> item.wrapUp(this));
|
||||
}
|
||||
|
||||
@Preview
|
||||
@Preview(SQUIRREL_GIRL)
|
||||
@Deprecated
|
||||
public GHReaction createReaction(ReactionContent content) throws IOException {
|
||||
return root.createRequest()
|
||||
@@ -459,7 +496,7 @@ public class GHIssue extends GHObject implements Reactable {
|
||||
.wrap(root);
|
||||
}
|
||||
|
||||
@Preview
|
||||
@Preview(SQUIRREL_GIRL)
|
||||
@Deprecated
|
||||
public PagedIterable<GHReaction> listReactions() {
|
||||
return root.createRequest()
|
||||
@@ -570,7 +607,8 @@ public class GHIssue extends GHObject implements Reactable {
|
||||
protected String getIssuesApiRoute() {
|
||||
if (owner == null) {
|
||||
// Issues returned from search to do not have an owner. Attempt to use url.
|
||||
return StringUtils.prependIfMissing(getUrl().toString().replace(root.getApiUrl(), ""), "/");
|
||||
final URL url = Objects.requireNonNull(getUrl(), "Missing instance URL!");
|
||||
return StringUtils.prependIfMissing(url.toString().replace(root.getApiUrl(), ""), "/");
|
||||
}
|
||||
return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/issues/" + number;
|
||||
}
|
||||
|
||||
49
src/main/java/org/kohsuke/github/GHIssueChanges.java
Normal file
49
src/main/java/org/kohsuke/github/GHIssueChanges.java
Normal file
@@ -0,0 +1,49 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||
|
||||
/**
|
||||
* Wrapper to define changed fields on issues action="edited"
|
||||
*
|
||||
* @see GHEventPayload.Issue
|
||||
*/
|
||||
@SuppressFBWarnings("UWF_UNWRITTEN_FIELD")
|
||||
public class GHIssueChanges {
|
||||
|
||||
private GHFrom title;
|
||||
private GHFrom body;
|
||||
|
||||
/**
|
||||
* Old issue title.
|
||||
*
|
||||
* @return old issue title (or null if not changed)
|
||||
*/
|
||||
public GHFrom getTitle() {
|
||||
return title;
|
||||
}
|
||||
|
||||
/**
|
||||
* Old issue body.
|
||||
*
|
||||
* @return old issue body (or null if not changed)
|
||||
*/
|
||||
public GHFrom getBody() {
|
||||
return body;
|
||||
}
|
||||
|
||||
/**
|
||||
* Wrapper for changed values.
|
||||
*/
|
||||
public static class GHFrom {
|
||||
private String from;
|
||||
|
||||
/**
|
||||
* Previous value that was changed.
|
||||
*
|
||||
* @return previous value
|
||||
*/
|
||||
public String getFrom() {
|
||||
return from;
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -26,7 +26,7 @@ package org.kohsuke.github;
|
||||
import java.io.IOException;
|
||||
import java.net.URL;
|
||||
|
||||
import static org.kohsuke.github.Previews.*;
|
||||
import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
|
||||
|
||||
/**
|
||||
* Comment to the issue
|
||||
@@ -126,7 +126,7 @@ public class GHIssueComment extends GHObject implements Reactable {
|
||||
owner.root.createRequest().method("DELETE").withUrlPath(getApiRoute()).send();
|
||||
}
|
||||
|
||||
@Preview
|
||||
@Preview(SQUIRREL_GIRL)
|
||||
@Deprecated
|
||||
public GHReaction createReaction(ReactionContent content) throws IOException {
|
||||
return owner.root.createRequest()
|
||||
@@ -138,7 +138,7 @@ public class GHIssueComment extends GHObject implements Reactable {
|
||||
.wrap(owner.root);
|
||||
}
|
||||
|
||||
@Preview
|
||||
@Preview(SQUIRREL_GIRL)
|
||||
@Deprecated
|
||||
public PagedIterable<GHReaction> listReactions() {
|
||||
return owner.root.createRequest()
|
||||
@@ -149,6 +149,6 @@ public class GHIssueComment extends GHObject implements Reactable {
|
||||
|
||||
private String getApiRoute() {
|
||||
return "/repos/" + owner.getRepository().getOwnerName() + "/" + owner.getRepository().getName()
|
||||
+ "/issues/comments/" + id;
|
||||
+ "/issues/comments/" + getId();
|
||||
}
|
||||
}
|
||||
|
||||
@@ -5,11 +5,11 @@ import java.util.Date;
|
||||
/**
|
||||
* The type GHIssueEvent.
|
||||
*
|
||||
* @see <a href="https://developer.github.com/v3/issues/events/">Github documentation for issue events</a>
|
||||
*
|
||||
* @author Martin van Zijl
|
||||
*/
|
||||
public class GHIssueEvent {
|
||||
private GitHub root;
|
||||
|
||||
public class GHIssueEvent extends GitHubInteractiveObject {
|
||||
private long id;
|
||||
private String node_id;
|
||||
private String url;
|
||||
@@ -18,6 +18,9 @@ public class GHIssueEvent {
|
||||
private String commit_id;
|
||||
private String commit_url;
|
||||
private String created_at;
|
||||
private GHMilestone milestone;
|
||||
private GHLabel label;
|
||||
private GHUser assignee;
|
||||
|
||||
private GHIssue issue;
|
||||
|
||||
@@ -111,6 +114,36 @@ public class GHIssueEvent {
|
||||
return issue;
|
||||
}
|
||||
|
||||
/**
|
||||
* Get the {@link GHMilestone} that this issue was added to or removed from. Only present for events "milestoned"
|
||||
* and "demilestoned", <code>null</code> otherwise.
|
||||
*
|
||||
* @return the milestone
|
||||
*/
|
||||
public GHMilestone getMilestone() {
|
||||
return milestone;
|
||||
}
|
||||
|
||||
/**
|
||||
* Get the {@link GHLabel} that was added to or removed from the issue. Only present for events "labeled" and
|
||||
* "unlabeled", <code>null</code> otherwise.
|
||||
*
|
||||
* @return the label
|
||||
*/
|
||||
public GHLabel getLabel() {
|
||||
return label;
|
||||
}
|
||||
|
||||
/**
|
||||
* Get the {@link GHUser} that was assigned or unassigned from the issue. Only present for events "assigned" and
|
||||
* "unassigned", <code>null</code> otherwise.
|
||||
*
|
||||
* @return the user
|
||||
*/
|
||||
public GHUser getAssignee() {
|
||||
return assignee;
|
||||
}
|
||||
|
||||
GHIssueEvent wrapUp(GitHub root) {
|
||||
this.root = root;
|
||||
return this;
|
||||
|
||||
@@ -31,4 +31,4 @@ package org.kohsuke.github;
|
||||
*/
|
||||
public enum GHIssueState {
|
||||
OPEN, CLOSED, ALL
|
||||
}
|
||||
}
|
||||
|
||||
@@ -9,9 +9,7 @@ import org.apache.commons.lang3.builder.ToStringBuilder;
|
||||
* @author Kohsuke Kawaguchi
|
||||
*/
|
||||
@SuppressFBWarnings(value = "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", justification = "JSON API")
|
||||
public class GHKey {
|
||||
/* package almost final */ GitHub root;
|
||||
|
||||
public class GHKey extends GitHubInteractiveObject {
|
||||
protected String url, key, title;
|
||||
protected boolean verified;
|
||||
protected int id;
|
||||
|
||||
@@ -2,6 +2,7 @@ package org.kohsuke.github;
|
||||
|
||||
import com.fasterxml.jackson.annotation.JacksonInject;
|
||||
import com.fasterxml.jackson.annotation.JsonCreator;
|
||||
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||
|
||||
import java.io.IOException;
|
||||
import java.util.ArrayList;
|
||||
@@ -20,7 +21,12 @@ import javax.annotation.Nonnull;
|
||||
* @see GHIssue#getLabels() GHIssue#getLabels()
|
||||
* @see GHRepository#listLabels() GHRepository#listLabels()
|
||||
*/
|
||||
public class GHLabel {
|
||||
public class GHLabel extends GitHubInteractiveObject {
|
||||
|
||||
private long id;
|
||||
private String nodeId;
|
||||
@JsonProperty("default")
|
||||
private boolean default_;
|
||||
|
||||
@Nonnull
|
||||
private String url, name, color;
|
||||
@@ -28,9 +34,6 @@ public class GHLabel {
|
||||
@CheckForNull
|
||||
private String description;
|
||||
|
||||
@Nonnull
|
||||
private final GitHub root;
|
||||
|
||||
@JsonCreator
|
||||
private GHLabel(@JacksonInject @Nonnull GitHub root) {
|
||||
this.root = root;
|
||||
@@ -45,6 +48,24 @@ public class GHLabel {
|
||||
return Objects.requireNonNull(root);
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets id.
|
||||
*
|
||||
* @return the id
|
||||
*/
|
||||
public long getId() {
|
||||
return id;
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets node id.
|
||||
*
|
||||
* @return the node id.
|
||||
*/
|
||||
public String getNodeId() {
|
||||
return nodeId;
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets url.
|
||||
*
|
||||
@@ -85,6 +106,15 @@ public class GHLabel {
|
||||
return description;
|
||||
}
|
||||
|
||||
/**
|
||||
* If the label is one of the default labels created by GitHub automatically.
|
||||
*
|
||||
* @return true if the label is a default one
|
||||
*/
|
||||
public boolean isDefault() {
|
||||
return default_;
|
||||
}
|
||||
|
||||
/**
|
||||
* Sets color.
|
||||
*
|
||||
@@ -132,7 +162,7 @@ public class GHLabel {
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
@Preview
|
||||
@BetaApi
|
||||
@Deprecated
|
||||
static Creator create(GHRepository repository) throws IOException {
|
||||
return new Creator(repository);
|
||||
@@ -179,7 +209,7 @@ public class GHLabel {
|
||||
*
|
||||
* @return a {@link Updater}
|
||||
*/
|
||||
@Preview
|
||||
@BetaApi
|
||||
@Deprecated
|
||||
public Updater update() {
|
||||
return new Updater(this);
|
||||
@@ -187,10 +217,10 @@ public class GHLabel {
|
||||
|
||||
/**
|
||||
* Begins a single property update.
|
||||
*
|
||||
*
|
||||
* @return a {@link Setter}
|
||||
*/
|
||||
@Preview
|
||||
@BetaApi
|
||||
@Deprecated
|
||||
public Setter set() {
|
||||
return new Setter(this);
|
||||
@@ -227,7 +257,7 @@ public class GHLabel {
|
||||
*
|
||||
* {@link #done()} is called automatically after the property is set.
|
||||
*/
|
||||
@Preview
|
||||
@BetaApi
|
||||
@Deprecated
|
||||
public static class Setter extends GHLabelBuilder<GHLabel> {
|
||||
private Setter(@Nonnull GHLabel base) {
|
||||
@@ -241,7 +271,7 @@ public class GHLabel {
|
||||
*
|
||||
* Consumer must call {@link #done()} to commit changes.
|
||||
*/
|
||||
@Preview
|
||||
@BetaApi
|
||||
@Deprecated
|
||||
public static class Updater extends GHLabelBuilder<Updater> {
|
||||
private Updater(@Nonnull GHLabel base) {
|
||||
@@ -255,7 +285,7 @@ public class GHLabel {
|
||||
*
|
||||
* Consumer must call {@link #done()} to create the new instance.
|
||||
*/
|
||||
@Preview
|
||||
@BetaApi
|
||||
@Deprecated
|
||||
public static class Creator extends GHLabelBuilder<Creator> {
|
||||
private Creator(@Nonnull GHRepository repository) {
|
||||
|
||||
@@ -38,21 +38,21 @@ class GHLabelBuilder<S> extends AbstractBuilder<GHLabel, S> {
|
||||
}
|
||||
|
||||
@Nonnull
|
||||
@Preview
|
||||
@BetaApi
|
||||
@Deprecated
|
||||
public S name(String value) throws IOException {
|
||||
return with("name", value);
|
||||
}
|
||||
|
||||
@Nonnull
|
||||
@Preview
|
||||
@BetaApi
|
||||
@Deprecated
|
||||
public S color(String value) throws IOException {
|
||||
return with("color", value);
|
||||
}
|
||||
|
||||
@Nonnull
|
||||
@Preview
|
||||
@BetaApi
|
||||
@Deprecated
|
||||
public S description(String value) throws IOException {
|
||||
return with("description", value);
|
||||
|
||||
49
src/main/java/org/kohsuke/github/GHLabelChanges.java
Normal file
49
src/main/java/org/kohsuke/github/GHLabelChanges.java
Normal file
@@ -0,0 +1,49 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||
|
||||
/**
|
||||
* Wrapper to define changed fields on label action="edited"
|
||||
*
|
||||
* @see GHEventPayload.Label
|
||||
*/
|
||||
@SuppressFBWarnings("UWF_UNWRITTEN_FIELD")
|
||||
public class GHLabelChanges {
|
||||
|
||||
private GHFrom name;
|
||||
private GHFrom color;
|
||||
|
||||
/**
|
||||
* Old label name.
|
||||
*
|
||||
* @return old label name (or null if not changed)
|
||||
*/
|
||||
public GHFrom getName() {
|
||||
return name;
|
||||
}
|
||||
|
||||
/**
|
||||
* Old label color.
|
||||
*
|
||||
* @return old label color (or null if not changed)
|
||||
*/
|
||||
public GHFrom getColor() {
|
||||
return color;
|
||||
}
|
||||
|
||||
/**
|
||||
* Wrapper for changed values.
|
||||
*/
|
||||
public static class GHFrom {
|
||||
private String from;
|
||||
|
||||
/**
|
||||
* Previous value that was changed.
|
||||
*
|
||||
* @return previous value
|
||||
*/
|
||||
public String getFrom() {
|
||||
return from;
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -24,13 +24,13 @@
|
||||
|
||||
package org.kohsuke.github;
|
||||
|
||||
import com.infradna.tool.bridge_method_injector.WithBridgeMethods;
|
||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||
|
||||
import java.io.IOException;
|
||||
import java.net.URL;
|
||||
import java.util.ArrayList;
|
||||
import java.util.List;
|
||||
import java.util.Objects;
|
||||
|
||||
/**
|
||||
* The GitHub Preview API's license information
|
||||
@@ -44,9 +44,6 @@ import java.util.List;
|
||||
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
||||
justification = "JSON API")
|
||||
public class GHLicense extends GHObject {
|
||||
@SuppressFBWarnings("IS2_INCONSISTENT_SYNC")
|
||||
// root is set before the object is returned to the app
|
||||
/* package almost final */ GitHub root;
|
||||
|
||||
// these fields are always present, even in the short form
|
||||
protected String key, name;
|
||||
@@ -78,14 +75,6 @@ public class GHLicense extends GHObject {
|
||||
return name;
|
||||
}
|
||||
|
||||
/**
|
||||
* @return API URL of this object.
|
||||
*/
|
||||
@WithBridgeMethods(value = String.class, adapterMethod = "urlToString")
|
||||
public URL getUrl() {
|
||||
return GitHubClient.parseURL(url);
|
||||
}
|
||||
|
||||
/**
|
||||
* Featured licenses are bold in the new repository drop-down
|
||||
*
|
||||
@@ -199,7 +188,14 @@ public class GHLicense extends GHObject {
|
||||
if (description != null)
|
||||
return; // already populated
|
||||
|
||||
root.createRequest().withUrlPath(url).fetchInto(this);
|
||||
if (root == null || root.isOffline()) {
|
||||
return; // cannot populate, will have to live with what we have
|
||||
}
|
||||
|
||||
URL url = getUrl();
|
||||
if (url != null) {
|
||||
root.createRequest().setRawUrlPath(url.toString()).fetchInto(this);
|
||||
}
|
||||
}
|
||||
|
||||
@Override
|
||||
@@ -210,12 +206,12 @@ public class GHLicense extends GHObject {
|
||||
return false;
|
||||
|
||||
GHLicense that = (GHLicense) o;
|
||||
return this.url.equals(that.url);
|
||||
return Objects.equals(getUrl(), that.getUrl());
|
||||
}
|
||||
|
||||
@Override
|
||||
public int hashCode() {
|
||||
return url.hashCode();
|
||||
return Objects.hashCode(getUrl());
|
||||
}
|
||||
|
||||
GHLicense wrap(GitHub root) {
|
||||
|
||||
@@ -9,9 +9,7 @@ import java.net.URL;
|
||||
* @see GitHub#getMyMarketplacePurchases()
|
||||
* @see GHMarketplaceListAccountBuilder#createRequest()
|
||||
*/
|
||||
public class GHMarketplaceAccount {
|
||||
|
||||
protected GitHub root;
|
||||
public class GHMarketplaceAccount extends GitHubInteractiveObject {
|
||||
private String url;
|
||||
private long id;
|
||||
private String login;
|
||||
|
||||
@@ -8,8 +8,7 @@ import java.io.IOException;
|
||||
* @author Paulo Miguel Almeida
|
||||
* @see GHMarketplacePlan#listAccounts()
|
||||
*/
|
||||
public class GHMarketplaceListAccountBuilder {
|
||||
private final GitHub root;
|
||||
public class GHMarketplaceListAccountBuilder extends GitHubInteractiveObject {
|
||||
private final Requester builder;
|
||||
private final long planId;
|
||||
|
||||
|
||||
@@ -10,8 +10,7 @@ import java.util.Date;
|
||||
* @author Paulo Miguel Almeida
|
||||
* @see GHMarketplaceListAccountBuilder#createRequest()
|
||||
*/
|
||||
public class GHMarketplacePendingChange {
|
||||
private GitHub root;
|
||||
public class GHMarketplacePendingChange extends GitHubInteractiveObject {
|
||||
private long id;
|
||||
@SuppressFBWarnings(value = "UWF_UNWRITTEN_FIELD", justification = "Field comes from JSON deserialization")
|
||||
private Long unitCount;
|
||||
|
||||
@@ -11,9 +11,7 @@ import java.util.List;
|
||||
* @author Paulo Miguel Almeida
|
||||
* @see GitHub#listMarketplacePlans()
|
||||
*/
|
||||
public class GHMarketplacePlan {
|
||||
|
||||
private GitHub root;
|
||||
public class GHMarketplacePlan extends GitHubInteractiveObject {
|
||||
private String url;
|
||||
private String accountsUrl;
|
||||
private long id;
|
||||
|
||||
@@ -10,9 +10,8 @@ import java.util.Date;
|
||||
* @author Paulo Miguel Almeida
|
||||
* @see GHMarketplaceListAccountBuilder#createRequest() GHMarketplaceListAccountBuilder#createRequest()
|
||||
*/
|
||||
public class GHMarketplacePurchase {
|
||||
public class GHMarketplacePurchase extends GitHubInteractiveObject {
|
||||
|
||||
private GitHub root;
|
||||
private String billingCycle;
|
||||
private String nextBillingDate;
|
||||
private boolean onFreeTrial;
|
||||
|
||||
@@ -10,8 +10,7 @@ import java.util.Date;
|
||||
* @author Paulo Miguel Almeida
|
||||
* @see GitHub#getMyMarketplacePurchases()
|
||||
*/
|
||||
public class GHMarketplaceUserPurchase {
|
||||
protected GitHub root;
|
||||
public class GHMarketplaceUserPurchase extends GitHubInteractiveObject {
|
||||
private String billingCycle;
|
||||
private String nextBillingDate;
|
||||
private boolean onFreeTrial;
|
||||
|
||||
@@ -10,9 +10,7 @@ import java.util.Locale;
|
||||
* @author Kohsuke Kawaguchi
|
||||
* @see GHMyself#listOrgMemberships() GHMyself#listOrgMemberships()
|
||||
*/
|
||||
public class GHMembership /* extends GHObject --- but it doesn't have id, created_at, etc. */ {
|
||||
GitHub root;
|
||||
|
||||
public class GHMembership extends GitHubInteractiveObject {
|
||||
String url;
|
||||
String state;
|
||||
String role;
|
||||
|
||||
@@ -23,6 +23,9 @@ public class GHMeta {
|
||||
private List<String> api;
|
||||
private List<String> pages;
|
||||
private List<String> importer = new ArrayList<>();
|
||||
private List<String> packages;
|
||||
private List<String> actions;
|
||||
private List<String> dependabot;
|
||||
|
||||
/**
|
||||
* Is verifiable password authentication boolean.
|
||||
@@ -86,4 +89,31 @@ public class GHMeta {
|
||||
public List<String> getImporter() {
|
||||
return Collections.unmodifiableList(importer);
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets package.
|
||||
*
|
||||
* @return the package
|
||||
*/
|
||||
public List<String> getPackages() {
|
||||
return Collections.unmodifiableList(packages);
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets actions.
|
||||
*
|
||||
* @return the actions
|
||||
*/
|
||||
public List<String> getActions() {
|
||||
return Collections.unmodifiableList(actions);
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets dependabot.
|
||||
*
|
||||
* @return the dependabot
|
||||
*/
|
||||
public List<String> getDependabot() {
|
||||
return Collections.unmodifiableList(dependabot);
|
||||
}
|
||||
}
|
||||
|
||||
@@ -11,7 +11,6 @@ import java.util.Locale;
|
||||
* @author Yusuke Kokubo
|
||||
*/
|
||||
public class GHMilestone extends GHObject {
|
||||
GitHub root;
|
||||
GHRepository owner;
|
||||
|
||||
GHUser creator;
|
||||
|
||||
@@ -7,4 +7,4 @@ package org.kohsuke.github;
|
||||
*/
|
||||
public enum GHMilestoneState {
|
||||
OPEN, CLOSED
|
||||
}
|
||||
}
|
||||
|
||||
@@ -23,9 +23,7 @@ import java.util.NoSuchElementException;
|
||||
* @see GitHub#listNotifications() GitHub#listNotifications()
|
||||
* @see GHRepository#listNotifications() GHRepository#listNotifications()
|
||||
*/
|
||||
public class GHNotificationStream implements Iterable<GHThread> {
|
||||
private final GitHub root;
|
||||
|
||||
public class GHNotificationStream extends GitHubInteractiveObject implements Iterable<GHThread> {
|
||||
private Boolean all, participating;
|
||||
private String since;
|
||||
private String apiUrl;
|
||||
|
||||
@@ -20,23 +20,25 @@ import javax.annotation.CheckForNull;
|
||||
*/
|
||||
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
||||
justification = "JSON API")
|
||||
public abstract class GHObject {
|
||||
public abstract class GHObject extends GitHubInteractiveObject {
|
||||
/**
|
||||
* Capture response HTTP headers on the state object.
|
||||
*/
|
||||
protected Map<String, List<String>> responseHeaderFields;
|
||||
protected transient Map<String, List<String>> responseHeaderFields;
|
||||
|
||||
protected String url;
|
||||
protected long id;
|
||||
protected String created_at;
|
||||
protected String updated_at;
|
||||
private String url;
|
||||
|
||||
private long id;
|
||||
private String nodeId;
|
||||
private String createdAt;
|
||||
private String updatedAt;
|
||||
|
||||
GHObject() {
|
||||
}
|
||||
|
||||
/**
|
||||
* Called by Jackson
|
||||
*
|
||||
*
|
||||
* @param responseInfo
|
||||
* the {@link GitHubResponse.ResponseInfo} to get headers from.
|
||||
*/
|
||||
@@ -74,12 +76,12 @@ public abstract class GHObject {
|
||||
*/
|
||||
@WithBridgeMethods(value = String.class, adapterMethod = "createdAtStr")
|
||||
public Date getCreatedAt() throws IOException {
|
||||
return GitHubClient.parseDate(created_at);
|
||||
return GitHubClient.parseDate(createdAt);
|
||||
}
|
||||
|
||||
@SuppressFBWarnings(value = "UPM_UNCALLED_PRIVATE_METHOD", justification = "Bridge method of getCreatedAt")
|
||||
private Object createdAtStr(Date id, Class type) {
|
||||
return created_at;
|
||||
return createdAt;
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -110,7 +112,18 @@ public abstract class GHObject {
|
||||
* on error
|
||||
*/
|
||||
public Date getUpdatedAt() throws IOException {
|
||||
return GitHubClient.parseDate(updated_at);
|
||||
return GitHubClient.parseDate(updatedAt);
|
||||
}
|
||||
|
||||
/**
|
||||
* Get Global node_id from Github object.
|
||||
*
|
||||
* @see <a href="https://developer.github.com/v4/guides/using-global-node-ids/">Using Global Node IDs</a>
|
||||
*
|
||||
* @return Global Node ID.
|
||||
*/
|
||||
public String getNodeId() {
|
||||
return nodeId;
|
||||
}
|
||||
|
||||
/**
|
||||
|
||||
@@ -22,6 +22,6 @@ class GHOrgHook extends GHHook {
|
||||
|
||||
@Override
|
||||
String getApiRoute() {
|
||||
return String.format("/orgs/%s/hooks/%d", organization.getLogin(), id);
|
||||
return String.format("/orgs/%s/hooks/%d", organization.getLogin(), getId());
|
||||
}
|
||||
}
|
||||
|
||||
@@ -10,7 +10,7 @@ import java.util.List;
|
||||
import java.util.Map;
|
||||
import java.util.TreeMap;
|
||||
|
||||
import static org.kohsuke.github.Previews.INERTIA;
|
||||
import static org.kohsuke.github.internal.Previews.INERTIA;
|
||||
|
||||
/**
|
||||
* The type GHOrganization.
|
||||
@@ -18,6 +18,9 @@ import static org.kohsuke.github.Previews.INERTIA;
|
||||
* @author Kohsuke Kawaguchi
|
||||
*/
|
||||
public class GHOrganization extends GHPerson {
|
||||
|
||||
private boolean has_organization_projects;
|
||||
|
||||
GHOrganization wrapUp(GitHub root) {
|
||||
return (GHOrganization) super.wrapUp(root);
|
||||
}
|
||||
@@ -97,7 +100,7 @@ public class GHOrganization extends GHPerson {
|
||||
* @return the gh create repository builder
|
||||
*/
|
||||
public GHCreateRepositoryBuilder createRepository(String name) {
|
||||
return new GHCreateRepositoryBuilder(root, "/orgs/" + login + "/repos", name);
|
||||
return new GHCreateRepositoryBuilder(name, root, "/orgs/" + login + "/repos");
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -128,6 +131,22 @@ public class GHOrganization extends GHPerson {
|
||||
.toIterable(GHTeam[].class, item -> item.wrapUp(this));
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets a single team by ID.
|
||||
*
|
||||
* @param teamId
|
||||
* id of the team that we want to query for
|
||||
* @return the team
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*
|
||||
* @deprecated Use {@link GHOrganization#getTeam(long)}
|
||||
*/
|
||||
@Deprecated
|
||||
public GHTeam getTeam(int teamId) throws IOException {
|
||||
return getTeam((long) teamId);
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets a single team by ID.
|
||||
*
|
||||
@@ -139,9 +158,9 @@ public class GHOrganization extends GHPerson {
|
||||
*
|
||||
* @see <a href= "https://developer.github.com/v3/teams/#get-team-by-name">documentation</a>
|
||||
*/
|
||||
public GHTeam getTeam(int teamId) throws IOException {
|
||||
public GHTeam getTeam(long teamId) throws IOException {
|
||||
return root.createRequest()
|
||||
.withUrlPath(String.format("/organizations/%d/team/%d", id, teamId))
|
||||
.withUrlPath(String.format("/organizations/%d/team/%d", getId(), teamId))
|
||||
.fetch(GHTeam.class)
|
||||
.wrapUp(this);
|
||||
}
|
||||
@@ -165,7 +184,7 @@ public class GHOrganization extends GHPerson {
|
||||
|
||||
/**
|
||||
* Finds a team that has the given slug in its {@link GHTeam#getSlug()}
|
||||
*
|
||||
*
|
||||
* @param slug
|
||||
* the slug
|
||||
* @return the team by slug
|
||||
@@ -351,6 +370,35 @@ public class GHOrganization extends GHPerson {
|
||||
root.createRequest().method("DELETE").withUrlPath("/orgs/" + login + "/public_members/" + u.getLogin()).send();
|
||||
}
|
||||
|
||||
/**
|
||||
* Are projects enabled for organization boolean.
|
||||
*
|
||||
* @return the boolean
|
||||
*/
|
||||
public boolean areOrganizationProjectsEnabled() {
|
||||
return has_organization_projects;
|
||||
}
|
||||
|
||||
/**
|
||||
* Sets organization projects enabled status boolean
|
||||
*
|
||||
* @param newStatus
|
||||
* enable status
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
public void enableOrganizationProjects(boolean newStatus) throws IOException {
|
||||
edit("has_organization_projects", newStatus);
|
||||
}
|
||||
|
||||
private void edit(String key, Object value) throws IOException {
|
||||
root.createRequest()
|
||||
.withUrlPath(String.format("/orgs/%s", login))
|
||||
.method("PATCH")
|
||||
.with(key, value)
|
||||
.fetchInto(this);
|
||||
}
|
||||
|
||||
/**
|
||||
* Returns the projects for this organization.
|
||||
*
|
||||
@@ -405,7 +453,7 @@ public class GHOrganization extends GHPerson {
|
||||
* The enum Permission.
|
||||
*/
|
||||
public enum Permission {
|
||||
ADMIN, PUSH, PULL
|
||||
ADMIN, MAINTAIN, PUSH, TRIAGE, PULL
|
||||
}
|
||||
|
||||
/**
|
||||
|
||||
@@ -28,7 +28,7 @@ import java.util.Locale;
|
||||
|
||||
/**
|
||||
* Permission for a user in a repository.
|
||||
*
|
||||
*
|
||||
* @see <a href="https://developer.github.com/v3/repos/collaborators/#review-a-users-permission-level">API</a>
|
||||
*/
|
||||
class GHPermission {
|
||||
|
||||
@@ -18,16 +18,15 @@ import java.util.TreeMap;
|
||||
* @author Kohsuke Kawaguchi
|
||||
*/
|
||||
public abstract class GHPerson extends GHObject {
|
||||
/* package almost final */ GitHub root;
|
||||
|
||||
// core data fields that exist even for "small" user data (such as the user info in pull request)
|
||||
protected String login, avatar_url;
|
||||
|
||||
// other fields (that only show up in full data)
|
||||
protected String location, blog, email, name, company, type;
|
||||
protected String location, blog, email, bio, name, company, type, twitter_username;
|
||||
protected String html_url;
|
||||
protected int followers, following, public_repos, public_gists;
|
||||
protected boolean site_admin;
|
||||
protected boolean site_admin, hireable;
|
||||
|
||||
// other fields (that only show up in full data) that require privileged scope
|
||||
protected Integer total_private_repos;
|
||||
@@ -46,13 +45,16 @@ public abstract class GHPerson extends GHObject {
|
||||
* the io exception
|
||||
*/
|
||||
protected synchronized void populate() throws IOException {
|
||||
if (created_at != null) {
|
||||
if (super.getCreatedAt() != null) {
|
||||
return; // already populated
|
||||
}
|
||||
if (root == null || root.isOffline()) {
|
||||
return; // cannot populate, will have to live with what we have
|
||||
}
|
||||
root.createRequest().withUrlPath(url).fetchInto(this);
|
||||
URL url = getUrl();
|
||||
if (url != null) {
|
||||
root.createRequest().setRawUrlPath(url.toString()).fetchInto(this);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -151,10 +153,7 @@ public abstract class GHPerson extends GHObject {
|
||||
*/
|
||||
public GHRepository getRepository(String name) throws IOException {
|
||||
try {
|
||||
return root.createRequest()
|
||||
.withUrlPath("/repos/" + login + '/' + name)
|
||||
.fetch(GHRepository.class)
|
||||
.wrap(root);
|
||||
return GHRepository.read(root, login, name);
|
||||
} catch (FileNotFoundException e) {
|
||||
return null;
|
||||
}
|
||||
@@ -234,6 +233,18 @@ public abstract class GHPerson extends GHObject {
|
||||
return location;
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets the Twitter Username of this user, like "GitHub"
|
||||
*
|
||||
* @return the Twitter username
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
public String getTwitterUsername() throws IOException {
|
||||
populate();
|
||||
return twitter_username;
|
||||
}
|
||||
|
||||
public Date getCreatedAt() throws IOException {
|
||||
populate();
|
||||
return super.getCreatedAt();
|
||||
|
||||
@@ -28,7 +28,7 @@ import java.io.IOException;
|
||||
import java.net.URL;
|
||||
import java.util.Locale;
|
||||
|
||||
import static org.kohsuke.github.Previews.INERTIA;
|
||||
import static org.kohsuke.github.internal.Previews.INERTIA;
|
||||
|
||||
/**
|
||||
* A GitHub project.
|
||||
@@ -37,12 +37,10 @@ import static org.kohsuke.github.Previews.INERTIA;
|
||||
* @see <a href="https://developer.github.com/v3/projects/">Projects</a>
|
||||
*/
|
||||
public class GHProject extends GHObject {
|
||||
protected GitHub root;
|
||||
protected GHObject owner;
|
||||
|
||||
private String owner_url;
|
||||
private String html_url;
|
||||
private String node_id;
|
||||
private String name;
|
||||
private String body;
|
||||
private int number;
|
||||
@@ -81,10 +79,8 @@ public class GHProject extends GHObject {
|
||||
} else if (owner_url.contains("/users/")) {
|
||||
owner = root.createRequest().withUrlPath(getOwnerUrl().getPath()).fetch(GHUser.class).wrapUp(root);
|
||||
} else if (owner_url.contains("/repos/")) {
|
||||
owner = root.createRequest()
|
||||
.withUrlPath(getOwnerUrl().getPath())
|
||||
.fetch(GHRepository.class)
|
||||
.wrap(root);
|
||||
String[] pathElements = getOwnerUrl().getPath().split("/");
|
||||
owner = GHRepository.read(root, pathElements[1], pathElements[2]);
|
||||
}
|
||||
} catch (FileNotFoundException e) {
|
||||
return null;
|
||||
@@ -105,10 +101,12 @@ public class GHProject extends GHObject {
|
||||
/**
|
||||
* Gets node id.
|
||||
*
|
||||
* @deprecated Use {@link GHObject#getNodeId()}
|
||||
* @return the node id
|
||||
*/
|
||||
@Deprecated
|
||||
public String getNode_id() {
|
||||
return node_id;
|
||||
return getNodeId();
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -191,7 +189,7 @@ public class GHProject extends GHObject {
|
||||
* @return the api route
|
||||
*/
|
||||
protected String getApiRoute() {
|
||||
return "/projects/" + id;
|
||||
return "/projects/" + getId();
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -290,7 +288,7 @@ public class GHProject extends GHObject {
|
||||
final GHProject project = this;
|
||||
return root.createRequest()
|
||||
.withPreview(INERTIA)
|
||||
.withUrlPath(String.format("/projects/%d/columns", id))
|
||||
.withUrlPath(String.format("/projects/%d/columns", getId()))
|
||||
.toIterable(GHProjectColumn[].class, item -> item.wrap(project));
|
||||
}
|
||||
|
||||
@@ -308,8 +306,8 @@ public class GHProject extends GHObject {
|
||||
.method("POST")
|
||||
.withPreview(INERTIA)
|
||||
.with("name", name)
|
||||
.withUrlPath(String.format("/projects/%d/columns", id))
|
||||
.withUrlPath(String.format("/projects/%d/columns", getId()))
|
||||
.fetch(GHProjectColumn.class)
|
||||
.wrap(this);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
@@ -6,7 +6,7 @@ import java.io.FileNotFoundException;
|
||||
import java.io.IOException;
|
||||
import java.net.URL;
|
||||
|
||||
import static org.kohsuke.github.Previews.INERTIA;
|
||||
import static org.kohsuke.github.internal.Previews.INERTIA;
|
||||
|
||||
/**
|
||||
* The type GHProjectCard.
|
||||
@@ -14,7 +14,6 @@ import static org.kohsuke.github.Previews.INERTIA;
|
||||
* @author Gunnar Skjold
|
||||
*/
|
||||
public class GHProjectCard extends GHObject {
|
||||
private GitHub root;
|
||||
private GHProject project;
|
||||
private GHProjectColumn column;
|
||||
|
||||
@@ -213,7 +212,7 @@ public class GHProjectCard extends GHObject {
|
||||
* @return the api route
|
||||
*/
|
||||
protected String getApiRoute() {
|
||||
return String.format("/projects/columns/cards/%d", id);
|
||||
return String.format("/projects/columns/cards/%d", getId());
|
||||
}
|
||||
|
||||
/**
|
||||
|
||||
@@ -4,7 +4,7 @@ import java.io.FileNotFoundException;
|
||||
import java.io.IOException;
|
||||
import java.net.URL;
|
||||
|
||||
import static org.kohsuke.github.Previews.INERTIA;
|
||||
import static org.kohsuke.github.internal.Previews.INERTIA;
|
||||
|
||||
/**
|
||||
* The type GHProjectColumn.
|
||||
@@ -12,7 +12,6 @@ import static org.kohsuke.github.Previews.INERTIA;
|
||||
* @author Gunnar Skjold
|
||||
*/
|
||||
public class GHProjectColumn extends GHObject {
|
||||
protected GitHub root;
|
||||
protected GHProject project;
|
||||
|
||||
private String name;
|
||||
@@ -115,7 +114,7 @@ public class GHProjectColumn extends GHObject {
|
||||
* @return the api route
|
||||
*/
|
||||
protected String getApiRoute() {
|
||||
return String.format("/projects/columns/%d", id);
|
||||
return String.format("/projects/columns/%d", getId());
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -139,7 +138,7 @@ public class GHProjectColumn extends GHObject {
|
||||
final GHProjectColumn column = this;
|
||||
return root.createRequest()
|
||||
.withPreview(INERTIA)
|
||||
.withUrlPath(String.format("/projects/columns/%d/cards", id))
|
||||
.withUrlPath(String.format("/projects/columns/%d/cards", getId()))
|
||||
.toIterable(GHProjectCard[].class, item -> item.wrap(column));
|
||||
}
|
||||
|
||||
@@ -157,7 +156,7 @@ public class GHProjectColumn extends GHObject {
|
||||
.method("POST")
|
||||
.withPreview(INERTIA)
|
||||
.with("note", note)
|
||||
.withUrlPath(String.format("/projects/columns/%d/cards", id))
|
||||
.withUrlPath(String.format("/projects/columns/%d/cards", getId()))
|
||||
.fetch(GHProjectCard.class)
|
||||
.wrap(this);
|
||||
}
|
||||
@@ -177,7 +176,7 @@ public class GHProjectColumn extends GHObject {
|
||||
.withPreview(INERTIA)
|
||||
.with("content_type", issue instanceof GHPullRequest ? "PullRequest" : "Issue")
|
||||
.with("content_id", issue.getId())
|
||||
.withUrlPath(String.format("/projects/columns/%d/cards", id))
|
||||
.withUrlPath(String.format("/projects/columns/%d/cards", getId()))
|
||||
.fetch(GHProjectCard.class)
|
||||
.wrap(this);
|
||||
}
|
||||
|
||||
@@ -29,14 +29,15 @@ import java.io.IOException;
|
||||
import java.net.URL;
|
||||
import java.util.ArrayList;
|
||||
import java.util.Arrays;
|
||||
import java.util.Collection;
|
||||
import java.util.Collections;
|
||||
import java.util.Date;
|
||||
import java.util.List;
|
||||
import java.util.Objects;
|
||||
|
||||
import javax.annotation.CheckForNull;
|
||||
|
||||
import static org.kohsuke.github.Previews.SHADOW_CAT;
|
||||
import static org.kohsuke.github.internal.Previews.LYDIAN;
|
||||
import static org.kohsuke.github.internal.Previews.SHADOW_CAT;
|
||||
|
||||
/**
|
||||
* A pull request.
|
||||
@@ -71,13 +72,6 @@ public class GHPullRequest extends GHIssue implements Refreshable {
|
||||
private GHUser[] requested_reviewers;
|
||||
private GHTeam[] requested_teams;
|
||||
|
||||
/**
|
||||
* GitHub doesn't return some properties of {@link GHIssue} when requesting the GET on the 'pulls' API route as
|
||||
* opposed to 'issues' API route. This flag remembers whether we made the GET call on the 'issues' route on this
|
||||
* object to fill in those missing details
|
||||
*/
|
||||
private transient boolean fetchedIssueDetails;
|
||||
|
||||
GHPullRequest wrapUp(GHRepository owner) {
|
||||
this.wrap(owner);
|
||||
return wrapUp(owner.root);
|
||||
@@ -103,7 +97,9 @@ public class GHPullRequest extends GHIssue implements Refreshable {
|
||||
protected String getApiRoute() {
|
||||
if (owner == null) {
|
||||
// Issues returned from search to do not have an owner. Attempt to use url.
|
||||
return StringUtils.prependIfMissing(getUrl().toString().replace(root.getApiUrl(), ""), "/");
|
||||
final URL url = Objects.requireNonNull(getUrl(), "Missing instance URL!");
|
||||
return StringUtils.prependIfMissing(url.toString().replace(root.getApiUrl(), ""), "/");
|
||||
|
||||
}
|
||||
return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/pulls/" + number;
|
||||
}
|
||||
@@ -174,12 +170,6 @@ public class GHPullRequest extends GHIssue implements Refreshable {
|
||||
return GitHubClient.parseDate(merged_at);
|
||||
}
|
||||
|
||||
@Override
|
||||
public Collection<GHLabel> getLabels() throws IOException {
|
||||
fetchIssue();
|
||||
return super.getLabels();
|
||||
}
|
||||
|
||||
@Override
|
||||
public GHUser getClosedBy() {
|
||||
return null;
|
||||
@@ -387,10 +377,14 @@ public class GHPullRequest extends GHIssue implements Refreshable {
|
||||
* Repopulates this object.
|
||||
*/
|
||||
public void refresh() throws IOException {
|
||||
if (root.isOffline()) {
|
||||
if (root == null || root.isOffline()) {
|
||||
return; // cannot populate, will have to live with what we have
|
||||
}
|
||||
root.createRequest().withPreview(SHADOW_CAT).withUrlPath(url).fetchInto(this).wrapUp(owner);
|
||||
|
||||
URL url = getUrl();
|
||||
if (url != null) {
|
||||
root.createRequest().withPreview(SHADOW_CAT).setRawUrlPath(url.toString()).fetchInto(this).wrapUp(owner);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -558,6 +552,41 @@ public class GHPullRequest extends GHIssue implements Refreshable {
|
||||
.send();
|
||||
}
|
||||
|
||||
/**
|
||||
* Set the base branch on the pull request
|
||||
*
|
||||
* @param newBaseBranch
|
||||
* the name of the new base branch
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
* @return the updated pull request
|
||||
*/
|
||||
public GHPullRequest setBaseBranch(String newBaseBranch) throws IOException {
|
||||
return root.createRequest()
|
||||
.method("PATCH")
|
||||
.with("base", newBaseBranch)
|
||||
.withUrlPath(getApiRoute())
|
||||
.fetch(GHPullRequest.class)
|
||||
.wrapUp(root);
|
||||
}
|
||||
|
||||
/**
|
||||
* Updates the branch. The same as pressing the button in the web GUI.
|
||||
*
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
@Preview(LYDIAN)
|
||||
@Deprecated
|
||||
public void updateBranch() throws IOException {
|
||||
root.createRequest()
|
||||
.withPreview(LYDIAN)
|
||||
.method("PUT")
|
||||
.with("expected_head_sha", head.getSha())
|
||||
.withUrlPath(getApiRoute() + "/update-branch")
|
||||
.send();
|
||||
}
|
||||
|
||||
/**
|
||||
* Merge this pull request.
|
||||
* <p>
|
||||
@@ -619,10 +648,4 @@ public class GHPullRequest extends GHIssue implements Refreshable {
|
||||
MERGE, SQUASH, REBASE
|
||||
}
|
||||
|
||||
private void fetchIssue() throws IOException {
|
||||
if (!fetchedIssueDetails) {
|
||||
root.createRequest().withUrlPath(getIssuesApiRoute()).fetchInto(this);
|
||||
fetchedIssueDetails = true;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
86
src/main/java/org/kohsuke/github/GHPullRequestChanges.java
Normal file
86
src/main/java/org/kohsuke/github/GHPullRequestChanges.java
Normal file
@@ -0,0 +1,86 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||
|
||||
/**
|
||||
* Wrapper to define changed fields on pull_request action="edited"
|
||||
*
|
||||
* @see GHEventPayload.PullRequest
|
||||
*/
|
||||
@SuppressFBWarnings("UWF_UNWRITTEN_FIELD")
|
||||
public class GHPullRequestChanges {
|
||||
|
||||
private GHCommitPointer base;
|
||||
private GHFrom title;
|
||||
private GHFrom body;
|
||||
|
||||
/**
|
||||
* Old target branch for pull request.
|
||||
*
|
||||
* @return old target branch info (or null if not changed)
|
||||
*/
|
||||
public GHCommitPointer getBase() {
|
||||
return base;
|
||||
}
|
||||
|
||||
/**
|
||||
* Old pull request title.
|
||||
*
|
||||
* @return old pull request title (or null if not changed)
|
||||
*/
|
||||
public GHFrom getTitle() {
|
||||
return title;
|
||||
}
|
||||
|
||||
/**
|
||||
* Old pull request body.
|
||||
*
|
||||
* @return old pull request body (or null if not changed)
|
||||
*/
|
||||
public GHFrom getBody() {
|
||||
return body;
|
||||
}
|
||||
|
||||
/**
|
||||
* @see org.kohsuke.github.GHCommitPointer
|
||||
*/
|
||||
public static class GHCommitPointer {
|
||||
private GHFrom ref;
|
||||
private GHFrom sha;
|
||||
|
||||
/**
|
||||
* Named ref to the commit. This (from value) appears to be a "short ref" that doesn't include "refs/heads/"
|
||||
* portion.
|
||||
*
|
||||
* @return the ref
|
||||
*/
|
||||
public GHFrom getRef() {
|
||||
return ref;
|
||||
}
|
||||
|
||||
/**
|
||||
* SHA1 of the commit.
|
||||
*
|
||||
* @return sha
|
||||
*/
|
||||
public GHFrom getSha() {
|
||||
return sha;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Wrapper for changed values.
|
||||
*/
|
||||
public static class GHFrom {
|
||||
private String from;
|
||||
|
||||
/**
|
||||
* Previous value that was changed.
|
||||
*
|
||||
* @return previous value
|
||||
*/
|
||||
public String getFrom() {
|
||||
return from;
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1,6 +1,6 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import static org.kohsuke.github.Previews.SHADOW_CAT;
|
||||
import static org.kohsuke.github.internal.Previews.SHADOW_CAT;
|
||||
|
||||
/**
|
||||
* Lists up pull requests with some filtering and sorting.
|
||||
|
||||
@@ -46,6 +46,7 @@ public class GHPullRequestReview extends GHObject {
|
||||
private String commit_id;
|
||||
private GHPullRequestReviewState state;
|
||||
private String submitted_at;
|
||||
private String html_url;
|
||||
|
||||
GHPullRequestReview wrapUp(GHPullRequest owner) {
|
||||
this.owner = owner;
|
||||
@@ -102,7 +103,7 @@ public class GHPullRequestReview extends GHObject {
|
||||
|
||||
@Override
|
||||
public URL getHtmlUrl() {
|
||||
return null;
|
||||
return GitHubClient.parseURL(html_url);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -111,7 +112,7 @@ public class GHPullRequestReview extends GHObject {
|
||||
* @return the api route
|
||||
*/
|
||||
protected String getApiRoute() {
|
||||
return owner.getApiRoute() + "/reviews/" + id;
|
||||
return owner.getApiRoute() + "/reviews/" + getId();
|
||||
}
|
||||
|
||||
/**
|
||||
|
||||
@@ -28,7 +28,7 @@ import java.net.URL;
|
||||
|
||||
import javax.annotation.CheckForNull;
|
||||
|
||||
import static org.kohsuke.github.Previews.*;
|
||||
import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
|
||||
|
||||
/**
|
||||
* Review comment to the pull request
|
||||
@@ -153,7 +153,20 @@ public class GHPullRequestReviewComment extends GHObject implements Reactable {
|
||||
* @return the api route
|
||||
*/
|
||||
protected String getApiRoute() {
|
||||
return "/repos/" + owner.getRepository().getFullName() + "/pulls/comments/" + id;
|
||||
return getApiRoute(false);
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets api route.
|
||||
*
|
||||
* @param includePullNumber
|
||||
* if true, includes the owning pull request's number in the route.
|
||||
*
|
||||
* @return the api route
|
||||
*/
|
||||
protected String getApiRoute(boolean includePullNumber) {
|
||||
return "/repos/" + owner.getRepository().getFullName() + "/pulls"
|
||||
+ (includePullNumber ? "/" + owner.getNumber() : "") + "/comments/" + getId();
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -192,13 +205,12 @@ public class GHPullRequestReviewComment extends GHObject implements Reactable {
|
||||
return owner.root.createRequest()
|
||||
.method("POST")
|
||||
.with("body", body)
|
||||
.with("in_reply_to", getId())
|
||||
.withUrlPath(getApiRoute() + "/comments")
|
||||
.withUrlPath(getApiRoute(true) + "/replies")
|
||||
.fetch(GHPullRequestReviewComment.class)
|
||||
.wrapUp(owner);
|
||||
}
|
||||
|
||||
@Preview
|
||||
@Preview(SQUIRREL_GIRL)
|
||||
@Deprecated
|
||||
public GHReaction createReaction(ReactionContent content) throws IOException {
|
||||
return owner.root.createRequest()
|
||||
@@ -210,7 +222,7 @@ public class GHPullRequestReviewComment extends GHObject implements Reactable {
|
||||
.wrap(owner.root);
|
||||
}
|
||||
|
||||
@Preview
|
||||
@Preview(SQUIRREL_GIRL)
|
||||
@Deprecated
|
||||
public PagedIterable<GHReaction> listReactions() {
|
||||
return owner.root.createRequest()
|
||||
|
||||
@@ -7,8 +7,7 @@ package org.kohsuke.github;
|
||||
* the type parameter
|
||||
* @author Kohsuke Kawaguchi
|
||||
*/
|
||||
public abstract class GHQueryBuilder<T> {
|
||||
protected final GitHub root;
|
||||
public abstract class GHQueryBuilder<T> extends GitHubInteractiveObject {
|
||||
protected final Requester req;
|
||||
|
||||
GHQueryBuilder(GitHub root) {
|
||||
|
||||
@@ -6,11 +6,13 @@ import com.fasterxml.jackson.annotation.JsonProperty;
|
||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||
import org.apache.commons.lang3.StringUtils;
|
||||
|
||||
import java.time.Duration;
|
||||
import java.time.ZonedDateTime;
|
||||
import java.time.format.DateTimeFormatter;
|
||||
import java.time.format.DateTimeParseException;
|
||||
import java.util.Date;
|
||||
import java.util.Objects;
|
||||
import java.util.concurrent.atomic.AtomicReference;
|
||||
import java.util.logging.Logger;
|
||||
|
||||
import javax.annotation.CheckForNull;
|
||||
@@ -29,7 +31,7 @@ public class GHRateLimit {
|
||||
/**
|
||||
* Remaining calls that can be made.
|
||||
*
|
||||
* @deprecated This value should never have been made public. Use {@link #getRemaining()}
|
||||
* @deprecated This field should never have been made public. Use {@link #getRemaining()}
|
||||
*/
|
||||
@Deprecated
|
||||
public int remaining;
|
||||
@@ -37,7 +39,7 @@ public class GHRateLimit {
|
||||
/**
|
||||
* Allotted API call per hour.
|
||||
*
|
||||
* @deprecated This value should never have been made public. Use {@link #getLimit()}
|
||||
* @deprecated This field should never have been made public. Use {@link #getLimit()}
|
||||
*/
|
||||
@Deprecated
|
||||
public int limit;
|
||||
@@ -48,7 +50,7 @@ public class GHRateLimit {
|
||||
* date. To use this field in any meaningful way, it must be converted to a long using {@link Date#getTime()}
|
||||
* multiplied by 1000.
|
||||
*
|
||||
* @deprecated This value should never have been made public. Use {@link #getResetDate()}
|
||||
* @deprecated This field should never have been made public. Use {@link #getResetDate()}
|
||||
*/
|
||||
@Deprecated
|
||||
public Date reset;
|
||||
@@ -65,17 +67,58 @@ public class GHRateLimit {
|
||||
@Nonnull
|
||||
private final Record integrationManifest;
|
||||
|
||||
/**
|
||||
* The default GHRateLimit provided to new {@link GitHubClient}s.
|
||||
*
|
||||
* Contains all expired records that will cause {@link GitHubClient#rateLimit(RateLimitTarget)} to refresh with new
|
||||
* data when called.
|
||||
*
|
||||
* Private, but made internal for testing.
|
||||
*/
|
||||
@Nonnull
|
||||
static GHRateLimit Unknown() {
|
||||
return new GHRateLimit(new UnknownLimitRecord(),
|
||||
new UnknownLimitRecord(),
|
||||
new UnknownLimitRecord(),
|
||||
new UnknownLimitRecord());
|
||||
}
|
||||
static final GHRateLimit DEFAULT = new GHRateLimit(UnknownLimitRecord.DEFAULT,
|
||||
UnknownLimitRecord.DEFAULT,
|
||||
UnknownLimitRecord.DEFAULT,
|
||||
UnknownLimitRecord.DEFAULT);
|
||||
|
||||
/**
|
||||
* Creates a new {@link GHRateLimit} from a single record for the specified endpoint with place holders for other
|
||||
* records.
|
||||
*
|
||||
* This is used to create {@link GHRateLimit} instances that can merged with other instances.
|
||||
*
|
||||
* @param record
|
||||
* the rate limit record. Can be a regular {@link Record} constructed from header information or an
|
||||
* {@link UnknownLimitRecord} placeholder.
|
||||
* @param rateLimitTarget
|
||||
* which rate limit record to fill
|
||||
* @return a new {@link GHRateLimit} instance containing the supplied record
|
||||
*/
|
||||
@Nonnull
|
||||
static GHRateLimit fromHeaderRecord(Record header) {
|
||||
return new GHRateLimit(header, new UnknownLimitRecord(), new UnknownLimitRecord(), new UnknownLimitRecord());
|
||||
static GHRateLimit fromRecord(@Nonnull Record record, @Nonnull RateLimitTarget rateLimitTarget) {
|
||||
if (rateLimitTarget == RateLimitTarget.CORE || rateLimitTarget == RateLimitTarget.NONE) {
|
||||
return new GHRateLimit(record,
|
||||
UnknownLimitRecord.DEFAULT,
|
||||
UnknownLimitRecord.DEFAULT,
|
||||
UnknownLimitRecord.DEFAULT);
|
||||
} else if (rateLimitTarget == RateLimitTarget.SEARCH) {
|
||||
return new GHRateLimit(UnknownLimitRecord.DEFAULT,
|
||||
record,
|
||||
UnknownLimitRecord.DEFAULT,
|
||||
UnknownLimitRecord.DEFAULT);
|
||||
} else if (rateLimitTarget == RateLimitTarget.GRAPHQL) {
|
||||
return new GHRateLimit(UnknownLimitRecord.DEFAULT,
|
||||
UnknownLimitRecord.DEFAULT,
|
||||
record,
|
||||
UnknownLimitRecord.DEFAULT);
|
||||
} else if (rateLimitTarget == RateLimitTarget.INTEGRATION_MANIFEST) {
|
||||
return new GHRateLimit(UnknownLimitRecord.DEFAULT,
|
||||
UnknownLimitRecord.DEFAULT,
|
||||
UnknownLimitRecord.DEFAULT,
|
||||
record);
|
||||
} else {
|
||||
throw new IllegalArgumentException("Unknown rate limit target: " + rateLimitTarget.toString());
|
||||
}
|
||||
}
|
||||
|
||||
@JsonCreator
|
||||
@@ -142,7 +185,7 @@ public class GHRateLimit {
|
||||
}
|
||||
|
||||
/**
|
||||
* Whether the rate limit reset date for this instance has passed.
|
||||
* Whether the reset date for the Core API rate limit has passed.
|
||||
*
|
||||
* @return true if the rate limit reset date has passed. Otherwise false.
|
||||
* @since 1.100
|
||||
@@ -152,7 +195,7 @@ public class GHRateLimit {
|
||||
}
|
||||
|
||||
/**
|
||||
* The core object provides your rate limit status for all non-search-related resources in the REST API.
|
||||
* The core object provides the rate limit status for all non-search-related resources in the REST API.
|
||||
*
|
||||
* @return a rate limit record
|
||||
* @since 1.100
|
||||
@@ -163,42 +206,43 @@ public class GHRateLimit {
|
||||
}
|
||||
|
||||
/**
|
||||
* The search object provides your rate limit status for the Search API. TODO: integrate with header limit updating.
|
||||
* Issue #605.
|
||||
* The search record provides the rate limit status for the Search API.
|
||||
*
|
||||
* @return a rate limit record
|
||||
* @since 1.115
|
||||
*/
|
||||
@Nonnull
|
||||
Record getSearch() {
|
||||
public Record getSearch() {
|
||||
return search;
|
||||
}
|
||||
|
||||
/**
|
||||
* The graphql object provides your rate limit status for the GraphQL API. TODO: integrate with header limit
|
||||
* updating. Issue #605.
|
||||
* The graphql record provides the rate limit status for the GraphQL API.
|
||||
*
|
||||
* @return a rate limit record
|
||||
* @since 1.115
|
||||
*/
|
||||
@Nonnull
|
||||
Record getGraphQL() {
|
||||
public Record getGraphQL() {
|
||||
return graphql;
|
||||
}
|
||||
|
||||
/**
|
||||
* The integration_manifest object provides your rate limit status for the GitHub App Manifest code conversion
|
||||
* endpoint. TODO: integrate with header limit updating. Issue #605.
|
||||
* The integration manifest record provides the rate limit status for the GitHub App Manifest code conversion
|
||||
* endpoint.
|
||||
*
|
||||
* @return a rate limit record
|
||||
* @since 1.115
|
||||
*/
|
||||
@Nonnull
|
||||
Record getIntegrationManifest() {
|
||||
public Record getIntegrationManifest() {
|
||||
return integrationManifest;
|
||||
}
|
||||
|
||||
@Override
|
||||
public String toString() {
|
||||
return "GHRateLimit {" + "core " + getCore().toString() + "search " + getSearch().toString() + "graphql "
|
||||
+ getGraphQL().toString() + "integrationManifest " + getIntegrationManifest().toString() + '}';
|
||||
return "GHRateLimit {" + "core " + getCore().toString() + ", search " + getSearch().toString() + ", graphql "
|
||||
+ getGraphQL().toString() + ", integrationManifest " + getIntegrationManifest().toString() + "}";
|
||||
}
|
||||
|
||||
@Override
|
||||
@@ -221,44 +265,113 @@ public class GHRateLimit {
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets the appropriate {@link Record} for a particular url path.
|
||||
* Merge a {@link GHRateLimit} with another one to create a new {@link GHRateLimit} keeping the latest
|
||||
* {@link Record}s from each.
|
||||
*
|
||||
* @param urlPath
|
||||
* the url path of the request
|
||||
* @return the {@link Record} for a url path.
|
||||
* @param newLimit
|
||||
* {@link GHRateLimit} with potentially updated {@link Record}s.
|
||||
* @return a merged {@link GHRateLimit} with the latest {@link Record}s from these two instances. If the merged
|
||||
* instance is equal to the current instance, the current instance is returned.
|
||||
*/
|
||||
@Nonnull
|
||||
Record getRecordForUrlPath(@Nonnull String urlPath) {
|
||||
if (urlPath.equals("/rate_limit")) {
|
||||
return new UnknownLimitRecord();
|
||||
} else if (urlPath.startsWith("/search")) {
|
||||
return getSearch();
|
||||
} else if (urlPath.startsWith("/graphql")) {
|
||||
return getGraphQL();
|
||||
} else if (urlPath.startsWith("/app-manifests")) {
|
||||
return getIntegrationManifest();
|
||||
} else {
|
||||
GHRateLimit getMergedRateLimit(@Nonnull GHRateLimit newLimit) {
|
||||
|
||||
GHRateLimit merged = new GHRateLimit(getCore().currentOrUpdated(newLimit.getCore()),
|
||||
getSearch().currentOrUpdated(newLimit.getSearch()),
|
||||
getGraphQL().currentOrUpdated(newLimit.getGraphQL()),
|
||||
getIntegrationManifest().currentOrUpdated(newLimit.getIntegrationManifest()));
|
||||
|
||||
if (merged.equals(this)) {
|
||||
merged = this;
|
||||
}
|
||||
|
||||
return merged;
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets the specified {@link Record}.
|
||||
*
|
||||
* {@link RateLimitTarget#NONE} will return {@link UnknownLimitRecord#DEFAULT} to prevent any clients from
|
||||
* accidentally waiting on that record to reset before continuing.
|
||||
*
|
||||
* @param rateLimitTarget
|
||||
* the target rate limit record
|
||||
* @return the target {@link Record} from this instance.
|
||||
*/
|
||||
@Nonnull
|
||||
Record getRecord(@Nonnull RateLimitTarget rateLimitTarget) {
|
||||
if (rateLimitTarget == RateLimitTarget.CORE) {
|
||||
return getCore();
|
||||
} else if (rateLimitTarget == RateLimitTarget.SEARCH) {
|
||||
return getSearch();
|
||||
} else if (rateLimitTarget == RateLimitTarget.GRAPHQL) {
|
||||
return getGraphQL();
|
||||
} else if (rateLimitTarget == RateLimitTarget.INTEGRATION_MANIFEST) {
|
||||
return getIntegrationManifest();
|
||||
} else if (rateLimitTarget == RateLimitTarget.NONE) {
|
||||
return UnknownLimitRecord.DEFAULT;
|
||||
} else {
|
||||
throw new IllegalArgumentException("Unknown rate limit target: " + rateLimitTarget.toString());
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* A limit record used as a placeholder when the the actual limit is not known.
|
||||
* <p>
|
||||
* Has a large limit and long duration so that it will doesn't expire too often.
|
||||
*
|
||||
* @since 1.100
|
||||
*/
|
||||
public static class UnknownLimitRecord extends Record {
|
||||
|
||||
// One hour
|
||||
private static final long unknownLimitResetSeconds = 60L * 60L;
|
||||
private static final long defaultUnknownLimitResetSeconds = Duration.ofSeconds(30).getSeconds();
|
||||
|
||||
/**
|
||||
* The number of seconds until a {@link UnknownLimitRecord} will expire.
|
||||
*
|
||||
* This is set to a somewhat short duration, rather than a long one. This avoids
|
||||
* {@link {@link GitHubClient#rateLimit(RateLimitTarget)}} requesting rate limit updates continuously, but also
|
||||
* avoids holding on to stale unknown records indefinitely.
|
||||
*
|
||||
* When merging {@link GHRateLimit} instances, {@link UnknownLimitRecord}s will be superseded by incoming
|
||||
* regular {@link Record}s.
|
||||
*
|
||||
* @see GHRateLimit#getMergedRateLimit(GHRateLimit)
|
||||
*/
|
||||
static long unknownLimitResetSeconds = defaultUnknownLimitResetSeconds;
|
||||
|
||||
static final int unknownLimit = 1000000;
|
||||
static final int unknownRemaining = 999999;
|
||||
|
||||
private UnknownLimitRecord() {
|
||||
super(unknownLimit, unknownRemaining, System.currentTimeMillis() / 1000L + unknownLimitResetSeconds);
|
||||
// The default UnknownLimitRecord is an expired record.
|
||||
private static final UnknownLimitRecord DEFAULT = new UnknownLimitRecord(Long.MIN_VALUE);
|
||||
|
||||
// The starting current UnknownLimitRecord is an expired record.
|
||||
private static final AtomicReference<UnknownLimitRecord> current = new AtomicReference<>(DEFAULT);
|
||||
|
||||
/**
|
||||
* Create a new unknown record that resets at the specified time.
|
||||
*
|
||||
* @param resetEpochSeconds
|
||||
* the epoch second time when this record will expire.
|
||||
*/
|
||||
private UnknownLimitRecord(long resetEpochSeconds) {
|
||||
super(unknownLimit, unknownRemaining, resetEpochSeconds);
|
||||
}
|
||||
|
||||
static Record current() {
|
||||
Record result = current.get();
|
||||
if (result.isExpired()) {
|
||||
current.set(new UnknownLimitRecord(System.currentTimeMillis() / 1000L + unknownLimitResetSeconds));
|
||||
result = current.get();
|
||||
}
|
||||
return result;
|
||||
}
|
||||
|
||||
/**
|
||||
* Reset the current UnknownLimitRecord. For use during testing only.
|
||||
*/
|
||||
static void reset() {
|
||||
current.set(DEFAULT);
|
||||
unknownLimitResetSeconds = defaultUnknownLimitResetSeconds;
|
||||
}
|
||||
}
|
||||
|
||||
@@ -274,14 +387,12 @@ public class GHRateLimit {
|
||||
private final int remaining;
|
||||
|
||||
/**
|
||||
* Allotted API call per hour.
|
||||
* Allotted API call per time period.
|
||||
*/
|
||||
private final int limit;
|
||||
|
||||
/**
|
||||
* The time at which the current rate limit window resets in UTC epoch seconds.
|
||||
*
|
||||
* This is the raw value returned by the server.
|
||||
*/
|
||||
private final long resetEpochSeconds;
|
||||
|
||||
@@ -291,9 +402,11 @@ public class GHRateLimit {
|
||||
private final long createdAtEpochSeconds = System.currentTimeMillis() / 1000;
|
||||
|
||||
/**
|
||||
* The time at which the rate limit will reset. This value is calculated based on
|
||||
* {@link #getResetEpochSeconds()} by calling {@link #calculateResetDate}. If the clock on the local machine not
|
||||
* synchronized with the server clock, this time value will be adjusted to match the local machine's clock.
|
||||
* The date at which the rate limit will reset, adjusted to local machine time if the local machine's clock not
|
||||
* synchronized with to the same clock as the GitHub server.
|
||||
*
|
||||
* @see #calculateResetDate(String)
|
||||
* @see #getResetDate()
|
||||
*/
|
||||
@Nonnull
|
||||
private final Date resetDate;
|
||||
@@ -341,12 +454,58 @@ public class GHRateLimit {
|
||||
this.resetDate = calculateResetDate(updatedAt);
|
||||
}
|
||||
|
||||
/**
|
||||
* Determine if the current {@link Record} is outdated compared to another. Rate Limit dates are only accurate
|
||||
* to the second, so we look at other information in the record as well.
|
||||
*
|
||||
* {@link Record}s with earlier {@link #getResetEpochSeconds()} are replaced by those with later.
|
||||
* {@link Record}s with the same {@link #getResetEpochSeconds()} are replaced by those with less remaining
|
||||
* count.
|
||||
*
|
||||
* {@link UnknownLimitRecord}s compare with each other like regular {@link Record}s.
|
||||
*
|
||||
* {@link Record}s are replaced by {@link UnknownLimitRecord}s only when the current {@link Record} is expired
|
||||
* and the {@link UnknownLimitRecord} is not. Otherwise Regular {@link Record}s are not replaced by
|
||||
* {@link UnknownLimitRecord}s.
|
||||
*
|
||||
* Expiration is only considered after other checks, meaning expired records may sometimes be replaced by other
|
||||
* expired records.
|
||||
*
|
||||
* @param other
|
||||
* the other {@link Record}
|
||||
* @return the {@link Record} that is most current
|
||||
*/
|
||||
Record currentOrUpdated(@Nonnull Record other) {
|
||||
// This set of checks avoids most calls to isExpired()
|
||||
// Depends on UnknownLimitRecord.current() to prevent continuous updating of GHRateLimit rateLimit()
|
||||
if (getResetEpochSeconds() > other.getResetEpochSeconds()
|
||||
|| (getResetEpochSeconds() == other.getResetEpochSeconds()
|
||||
&& getRemaining() <= other.getRemaining())) {
|
||||
// If the current record has a later reset
|
||||
// or the current record has the same reset and fewer or same requests remaining
|
||||
// Then it is most recent
|
||||
return this;
|
||||
} else if (!(other instanceof UnknownLimitRecord)) {
|
||||
// If the above is not the case that means other has a later reset
|
||||
// or the same resent and fewer requests remaining.
|
||||
// If the other record is not an unknown record, the the other is more recent
|
||||
return other;
|
||||
} else if (this.isExpired() && !other.isExpired()) {
|
||||
// The other is an unknown record.
|
||||
// If the current record has expired and the other hasn't, return the other.
|
||||
return other;
|
||||
}
|
||||
|
||||
// If none of the above, the current record is most valid.
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Recalculates the {@link #resetDate} relative to the local machine clock.
|
||||
* <p>
|
||||
* {@link RateLimitChecker}s and {@link RateLimitHandler}s use {@link #getResetDate()} to make decisions about
|
||||
* how long to wait for until for the rate limit to reset. That means that {@link #getResetDate()} needs to be
|
||||
* accurate to the local machine.
|
||||
* calculated based on the local machine clock.
|
||||
* </p>
|
||||
* <p>
|
||||
* When we say that the clock on two machines is "synchronized", we mean that the UTC time returned from
|
||||
@@ -415,7 +574,7 @@ public class GHRateLimit {
|
||||
* {@link #getResetDate()} or implement a {@link RateLimitChecker} instead.
|
||||
*
|
||||
* @return a long representing the time in epoch seconds when the rate limit will reset
|
||||
* @see #getResetDate() #getResetDate()
|
||||
* @see #getResetDate()
|
||||
*/
|
||||
public long getResetEpochSeconds() {
|
||||
return resetEpochSeconds;
|
||||
@@ -424,6 +583,8 @@ public class GHRateLimit {
|
||||
/**
|
||||
* Whether the rate limit reset date indicated by this instance is expired
|
||||
*
|
||||
* If attempting to wait for the rate limit to reset, consider implementing a {@link RateLimitChecker} instead.
|
||||
*
|
||||
* @return true if the rate limit reset date has passed. Otherwise false.
|
||||
*/
|
||||
public boolean isExpired() {
|
||||
@@ -431,8 +592,8 @@ public class GHRateLimit {
|
||||
}
|
||||
|
||||
/**
|
||||
* Returns the date at which the rate limit will reset, adjusted to local machine time if the local machine's
|
||||
* clock not synchronized with to the same clock as the GitHub server.
|
||||
* The date at which the rate limit will reset, adjusted to local machine time if the local machine's clock not
|
||||
* synchronized with to the same clock as the GitHub server.
|
||||
*
|
||||
* If attempting to wait for the rate limit to reset, consider implementing a {@link RateLimitChecker} instead.
|
||||
*
|
||||
|
||||
@@ -3,7 +3,7 @@ package org.kohsuke.github;
|
||||
import java.io.IOException;
|
||||
import java.net.URL;
|
||||
|
||||
import static org.kohsuke.github.Previews.*;
|
||||
import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
|
||||
|
||||
/**
|
||||
* Reaction to issue, comment, PR, and so on.
|
||||
@@ -11,10 +11,9 @@ import static org.kohsuke.github.Previews.*;
|
||||
* @author Kohsuke Kawaguchi
|
||||
* @see Reactable
|
||||
*/
|
||||
@Preview
|
||||
@Preview(SQUIRREL_GIRL)
|
||||
@Deprecated
|
||||
public class GHReaction extends GHObject {
|
||||
private GitHub root;
|
||||
|
||||
private GHUser user;
|
||||
private ReactionContent content;
|
||||
@@ -58,6 +57,6 @@ public class GHReaction extends GHObject {
|
||||
* the io exception
|
||||
*/
|
||||
public void delete() throws IOException {
|
||||
root.createRequest().method("DELETE").withPreview(SQUIRREL_GIRL).withUrlPath("/reactions/" + id).send();
|
||||
root.createRequest().method("DELETE").withPreview(SQUIRREL_GIRL).withUrlPath("/reactions/" + getId()).send();
|
||||
}
|
||||
}
|
||||
|
||||
@@ -1,5 +1,6 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import com.fasterxml.jackson.databind.JsonMappingException;
|
||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||
|
||||
import java.io.IOException;
|
||||
@@ -10,9 +11,7 @@ import java.net.URL;
|
||||
*
|
||||
* @author Michael Clarke
|
||||
*/
|
||||
public class GHRef {
|
||||
/* package almost final */ GitHub root;
|
||||
|
||||
public class GHRef extends GitHubInteractiveObject {
|
||||
private String ref, url;
|
||||
private GHObject object;
|
||||
|
||||
@@ -90,6 +89,78 @@ public class GHRef {
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Retrive a ref of the given type for the current GitHub repository.
|
||||
*
|
||||
* @param repository
|
||||
* the repository to read from
|
||||
* @param refName
|
||||
* eg: heads/branch
|
||||
* @return refs matching the request type
|
||||
* @throws IOException
|
||||
* on failure communicating with GitHub, potentially due to an invalid ref type being requested
|
||||
*/
|
||||
static GHRef read(GHRepository repository, String refName) throws IOException {
|
||||
// Also accept e.g. "refs/heads/branch" for consistency with createRef().
|
||||
if (refName.startsWith("refs/")) {
|
||||
refName = refName.replaceFirst("refs/", "");
|
||||
}
|
||||
|
||||
// We would expect this to use `git/ref/%s` but some versions of GHE seem to not support it
|
||||
// Instead use `git/refs/%s` and check the result actually matches the ref
|
||||
GHRef result = null;
|
||||
try {
|
||||
result = repository.root.createRequest()
|
||||
.withUrlPath(repository.getApiTailUrl(String.format("git/refs/%s", refName)))
|
||||
.fetch(GHRef.class)
|
||||
.wrap(repository.root);
|
||||
} catch (IOException e) {
|
||||
// If the parse exception is due to the above returning an array instead of a single ref
|
||||
// that means the individual ref did not exist. Handled by result check below.
|
||||
// Otherwise, rethrow.
|
||||
if (!(e.getCause() instanceof JsonMappingException)) {
|
||||
throw e;
|
||||
}
|
||||
}
|
||||
|
||||
// Verify that the ref returned is the one requested
|
||||
// Used .endsWith(refName) instead of .equals("refs/" + refName) to workaround a GitBucket
|
||||
// issue where the "ref" field omits the "refs/" prefix. "endsWith()" is functionally
|
||||
// the same for this scenario - the server refs matching is prefix-based, so
|
||||
// a ref that ends with the correct string will always be the correct one.
|
||||
if (result == null || !result.getRef().endsWith(refName)) {
|
||||
throw new GHFileNotFoundException(String.format("git/refs/%s", refName)
|
||||
+ " {\"message\":\"Not Found\",\"documentation_url\":\"https://developer.github.com/v3/git/refs/#get-a-reference\"}");
|
||||
}
|
||||
return result;
|
||||
}
|
||||
|
||||
/**
|
||||
* Retrieves all refs of the given type for the current GitHub repository.
|
||||
*
|
||||
* @param repository
|
||||
* the repository to read from
|
||||
* @param refType
|
||||
* the type of reg to search for e.g. <code>tags</code> or <code>commits</code>
|
||||
* @return paged iterable of all refs of the specified type
|
||||
* @throws IOException
|
||||
* on failure communicating with GitHub, potentially due to an invalid ref type being requested
|
||||
*/
|
||||
static PagedIterable<GHRef> readMatching(GHRepository repository, String refType) throws IOException {
|
||||
if (refType.startsWith("refs/")) {
|
||||
refType = refType.replaceFirst("refs/", "");
|
||||
}
|
||||
|
||||
String url = repository.getApiTailUrl(String.format("git/refs/%s", refType));
|
||||
// if no types, do not end with slash just to be safe.
|
||||
if (refType.equals("")) {
|
||||
url = url.substring(0, url.length() - 1);
|
||||
}
|
||||
return repository.root.createRequest()
|
||||
.withUrlPath(url)
|
||||
.toIterable(GHRef[].class, item -> item.wrap(repository.root));
|
||||
}
|
||||
|
||||
/**
|
||||
* The type GHObject.
|
||||
*/
|
||||
|
||||
@@ -15,14 +15,15 @@ import static java.lang.String.*;
|
||||
* Release in a github repository.
|
||||
*
|
||||
* @see GHRepository#getReleases() GHRepository#getReleases()
|
||||
* @see GHRepository#listReleases() () GHRepository#listReleases()
|
||||
* @see GHRepository#createRelease(String) GHRepository#createRelease(String)
|
||||
*/
|
||||
public class GHRelease extends GHObject {
|
||||
GitHub root;
|
||||
GHRepository owner;
|
||||
|
||||
private String html_url;
|
||||
private String assets_url;
|
||||
private List<GHAsset> assets;
|
||||
private String upload_url;
|
||||
private String tag_name;
|
||||
private String target_commitish;
|
||||
@@ -249,18 +250,44 @@ public class GHRelease extends GHObject {
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets assets.
|
||||
* Get the cached assets.
|
||||
*
|
||||
* @return the assets
|
||||
*
|
||||
* @deprecated This should be the default behavior of {@link #getAssets()} in a future release. This method is
|
||||
* introduced in addition to enable a transition to using cached asset information while keeping the
|
||||
* existing logic in place for backwards compatibility.
|
||||
*/
|
||||
@Deprecated
|
||||
public List<GHAsset> assets() {
|
||||
return assets;
|
||||
}
|
||||
|
||||
/**
|
||||
* Re-fetch the assets of this release.
|
||||
*
|
||||
* @return the assets
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
* @deprecated The behavior of this method will change in a future release. It will then provide cached assets as
|
||||
* provided by {@link #assets()}. Use {@link #listAssets()} instead to fetch up-to-date information of
|
||||
* assets.
|
||||
*/
|
||||
@Deprecated
|
||||
public List<GHAsset> getAssets() throws IOException {
|
||||
return listAssets().toList();
|
||||
}
|
||||
|
||||
/**
|
||||
* Re-fetch the assets of this release.
|
||||
*
|
||||
* @return the assets
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
public List<GHAsset> getAssets() throws IOException {
|
||||
public PagedIterable<GHAsset> listAssets() throws IOException {
|
||||
Requester builder = owner.root.createRequest();
|
||||
|
||||
return builder.withUrlPath(getApiTailUrl("assets"))
|
||||
.toIterable(GHAsset[].class, item -> item.wrap(this))
|
||||
.toList();
|
||||
return builder.withUrlPath(getApiTailUrl("assets")).toIterable(GHAsset[].class, item -> item.wrap(this));
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -270,7 +297,7 @@ public class GHRelease extends GHObject {
|
||||
* the io exception
|
||||
*/
|
||||
public void delete() throws IOException {
|
||||
root.createRequest().method("DELETE").withUrlPath(owner.getApiTailUrl("releases/" + id)).send();
|
||||
root.createRequest().method("DELETE").withUrlPath(owner.getApiTailUrl("releases/" + getId())).send();
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -283,6 +310,6 @@ public class GHRelease extends GHObject {
|
||||
}
|
||||
|
||||
private String getApiTailUrl(String end) {
|
||||
return owner.getApiTailUrl(format("releases/%s/%s", id, end));
|
||||
return owner.getApiTailUrl(format("releases/%s/%s", getId(), end));
|
||||
}
|
||||
}
|
||||
|
||||
@@ -41,7 +41,7 @@ public class GHReleaseBuilder {
|
||||
* Specifies the commitish value that determines where the Git tag is created from. Can be any branch or commit SHA.
|
||||
*
|
||||
* @param commitish
|
||||
* Defaults to the repository’s default branch (usually "master"). Unused if the Git tag already exists.
|
||||
* Defaults to the repository’s default branch (usually "main"). Unused if the Git tag already exists.
|
||||
* @return the gh release builder
|
||||
*/
|
||||
public GHReleaseBuilder commitish(String commitish) {
|
||||
|
||||
@@ -45,7 +45,7 @@ public class GHReleaseUpdater {
|
||||
* Specifies the commitish value that determines where the Git tag is created from. Can be any branch or commit SHA.
|
||||
*
|
||||
* @param commitish
|
||||
* Defaults to the repository’s default branch (usually "master"). Unused if the Git tag already exists.
|
||||
* Defaults to the repository’s default branch (usually "main"). Unused if the Git tag already exists.
|
||||
* @return the gh release updater
|
||||
*/
|
||||
public GHReleaseUpdater commitish(String commitish) {
|
||||
@@ -100,7 +100,7 @@ public class GHReleaseUpdater {
|
||||
*/
|
||||
public GHRelease update() throws IOException {
|
||||
return builder.method("PATCH")
|
||||
.withUrlPath(base.owner.getApiTailUrl("releases/" + base.id))
|
||||
.withUrlPath(base.owner.getApiTailUrl("releases/" + base.getId()))
|
||||
.fetch(GHRelease.class)
|
||||
.wrap(base.owner);
|
||||
}
|
||||
|
||||
@@ -18,6 +18,6 @@ class GHRepoHook extends GHHook {
|
||||
|
||||
@Override
|
||||
String getApiRoute() {
|
||||
return String.format("/repos/%s/%s/hooks/%d", repository.getOwnerName(), repository.getName(), id);
|
||||
return String.format("/repos/%s/%s/hooks/%d", repository.getOwnerName(), repository.getName(), getId());
|
||||
}
|
||||
}
|
||||
|
||||
File diff suppressed because it is too large
Load Diff
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user