[maven-release-plugin] prepare release github-api-1.126

This reverts commit 99aea9296e.

.gitattributes

@@ -0,0 +1 @@
+*.java text eol=lf

.github/PULL_REQUEST_TEMPLATE.md

@@ -7,4 +7,9 @@ We love getting PRs, but we hate asking people for the same basic changes every
 - [ ] Push your changes to a branch other than `master`. Create your PR from that branch.    
 - [ ] Add JavaDocs and other comments
 - [ ] Write tests that run and pass in CI. See [CONTRIBUTING.md](CONTRIBUTING.md) for details on how to capture snapshot data.
-- [ ] Run `mvn -P ci install site` locally. This may reformat your code, commit those changes. If this command doesn't succeed, your change will not pass CI.
+- [ ] Run `mvn -D enable-ci clean install site` locally. If this command doesn't succeed, your change will not pass CI. 
+
+# When creating a PR: 
+
+- [ ] Fill in the "Description" above. 
+- [ ] Enable "Allow edits from maintainers". 

.github/dependabot.yml

@@ -0,0 +1,12 @@
+version: 2
+updates:
+  - package-ecosystem: "maven"
+    directory: "/"
+    schedule:
+      interval: "monthly"
+      time: "02:00"
+  - package-ecosystem: "github-actions"
+    directory: "/"
+    schedule:
+      interval: "monthly"
+      time: "02:00"

.github/release-drafter.yml

@@ -1,5 +1,6 @@
-name-template: 'v$NEXT_PATCH_VERSION 🌈'
-tag-template: 'v$NEXT_PATCH_VERSION'
+name-template: 'v$NEXT_MINOR_VERSION 🌈'
+tag-template: 'github-api-$NEXT_MINOR_VERSION'
+version-template: '$MAJOR.$MINOR'
 categories:
   - title: '🚀 Features'
     labels:

.github/workflows/maven-build.yml

@@ -1,22 +1,92 @@
-name: Java CI Build and Test
+name: CI
 
 on: [push, pull_request]
 
+# this is required by spotless for JDK 16+
+env:
+  JAVA_11_PLUS_MAVEN_OPTS: "--add-opens jdk.compiler/com.sun.tools.javac.util=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.file=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.parser=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.tree=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.api=ALL-UNNAMED"
 
 jobs:
   build:
-
+    name: build-only (Java ${{ matrix.java }})
     runs-on: ubuntu-latest
     strategy:
+      fail-fast: false
       matrix:
-        java: [ '1.8.0', '11.0.x', '13.0.x' ]
+        java: [ 16 ]
+    steps:
+      - uses: actions/checkout@v2
+      - name: Set up JDK
+        uses: actions/setup-java@v1
+        with:
+          java-version: ${{ matrix.java }}
+      - name: Cached .m2
+        uses: actions/cache@v2.1.4
+        with:
+          path: ~/.m2/repository
+          key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
+          restore-keys: |
+            ${{ runner.os }}-maven-
+      - name: Maven Install (skipTests)
+        env:
+          MAVEN_OPTS: ${{ env.JAVA_11_PLUS_MAVEN_OPTS }}
+        run: mvn -B install -DskipTests -D enable-ci --file pom.xml
+  site:
+    name: site (Java ${{ matrix.java }})
+    runs-on: ubuntu-latest
+    strategy:
+      fail-fast: false
+      matrix:
+        java: [ 8, 11 ]
+    steps:
+      - uses: actions/checkout@v2
+      - name: Set up JDK
+        uses: actions/setup-java@v1
+        with:
+          java-version: ${{ matrix.java }}
+      - uses: actions/cache@v2.1.4
+        with:
+          path: ~/.m2/repository
+          key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
+          restore-keys: |
+            ${{ runner.os }}-maven-
+      - name: Maven Site
+        run: mvn -B site -D enable-ci --file pom.xml
+  test:
+    name: test (${{ matrix.os }}, Java ${{ matrix.java }})
+    runs-on: ${{ matrix.os }}-latest
+    strategy:
+      fail-fast: false
+      matrix:
+        os: [ ubuntu, windows ]
+        java: [ 8, 11, 16 ]
     steps:
     - uses: actions/checkout@v2
     - name: Set up JDK
       uses: actions/setup-java@v1
       with:
         java-version: ${{ matrix.java }}
-    - name: Maven Download all dependencies
-      run: mvn -B org.apache.maven.plugins:maven-dependency-plugin:3.1.1:go-offline -P ci
-    - name: Maven Build
-      run: mvn -B install site -P ci --file pom.xml
+    - uses: actions/cache@v2.1.4
+      with:
+        path: ~/.m2/repository
+        key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
+        restore-keys: |
+          ${{ runner.os }}-maven-
+    # JDK 8
+    - name: Maven Install without Code Coverage
+      if: matrix.os == 'windows' && matrix.java == '8'
+      run: mvn -B install --file pom.xml
+    - name: Maven Install with Code Coverage
+      if: matrix.os != 'windows' && matrix.java == '8'
+      run: mvn -B install -D enable-ci --file pom.xml
+    # JDK 11+
+    - name: Maven Install without Code Coverage
+      if: matrix.os == 'windows' && matrix.java != '8'
+      env:
+        MAVEN_OPTS: ${{ env.JAVA_11_PLUS_MAVEN_OPTS }}
+      run: mvn -B install --file pom.xml
+    - name: Maven Install with Code Coverage
+      if: matrix.os != 'windows' && matrix.java != '8'
+      env:
+        MAVEN_OPTS: ${{ env.JAVA_11_PLUS_MAVEN_OPTS }}
+      run: mvn -B install -D enable-ci --file pom.xml

.gitignore

@@ -9,3 +9,5 @@ target
 .DS_Store
 
 dependency-reduced-pom.xml
+.factorypath
+.vscode/settings.json

CONTRIBUTING.md

@@ -14,10 +14,14 @@ Example:
 
 This the default behavior.
 
+Example for a single test case:
+
+`mvn install -Dtest=WireMockStatusReporterTest#user_whenProxying_AuthCorrectlyConfigured`
+
 
 ### Setting up credential
 
-1. Create an OAuth token on github.com
+1. Create a "Personal access token" on https://github.com/ (`Settings` > `Developer settings` > `Personal access tokens`)
 2. Set the GITHUB_OAUTH environment variable to the value of that token
 3. Set the system property `test.github.useProxy` (usually like "-Dtest.github.useProxy" as a Java VM option)
 
@@ -27,21 +31,37 @@ This the default behavior.
 
     `WireMockStatusReporterTest: GitHub proxying and user auth correctly configured for user login: <your login>`
 
-Whenever you run tests with `-Dtest.github.useProxy`, they will try to get data from local files but will fallback to proxying to github if not found.
-
+Whenever you run tests with `-Dtest.github.useProxy`, they will try to get data from local files but will fallback to proxying to GitHub if not found.
 
 ### Writing a new test
 
 Once you have credentials setup, you add new test classes and test methods as you would normally.
-Keep `useProxy` enabled and iterate on your tests as needed. Remember, while proxying your tests are interacting with GitHub - you will need to clean up your state between runs.
 
-When you are ready to create a snapshot of your test data,
-run your test with `test.github.takeSnapshot` ("-Dtest.github.takeSnapshot" as a Java VM option).  For example:
+#### Running tests using GitHub test proxy
 
-    `mvn install -Dtest.github.takeSnapshot -Dtest=YourTestClassName`
+Keep `useProxy` enabled and iterate on your tests as needed. With `useProxy` enabled your tests will interact with 
+GitHub - you will need to clean up your server-state between runs. This can be done manually to start with.
+Once your test code is somewhat stable, use `getGitHubBeforeAfter()` to get a `GitHub` instance for test setup and cleanup.
+Interactions with that `GitHub` instance will not be recorded as part of the test, keeping the test data files to a minimum. 
 
-The above command would create snapshot WireMock data files under the path `src/test/resources/org/kohsuhke/github/YourTestClassName/wiremock`.
-Each method would get a separate director that would hold the data files for that test method.
+#### Running tests against your personal GitHub user account
+
+By default, test helper methods such as `getTempRepository()` target the `hub4j-test-org` GitHub organization.
+Please request access to this org to record your tests before submitting a PR.  This helps keep the project stable and nimble.
+Until you have access (or if you don't want access), you can set the following additional system property to target 
+your personal github account.
+
+    `mvn install -Dtest.github.org=false -Dtest=YourTestClassName`
+
+#### Taking a snapshot 
+
+When you are ready to create a snapshot of your test data, run your test with `test.github.takeSnapshot`  ("-Dtest.github.takeSnapshot" as 
+a Java VM option). For example:
+
+    `mvn install -Dtest.github.takeSnapshot -Dtest.github.org=false -Dtest=YourTestClassName`
+
+The above command will create snapshot WireMock data files under the path `src/test/resources/org/kohsuhke/github/YourTestClassName/wiremock`.
+Each method will get a separate directory that will hold the data files for that test method.
 
 Add all files including the generated data to your commit and submit a PR.
 

README.md

@@ -1,7 +1,9 @@
 # Java API for GitHub
 
 [![Sonatype Nexus (Releases)](https://img.shields.io/nexus/r/org.kohsuke/github-api?server=https%3A%2F%2Foss.sonatype.org)](https://mvnrepository.com/artifact/org.kohsuke/github-api)
-[![Join the chat at https://gitter.im/github-api/github-api](https://badges.gitter.im/Join%20Chat.svg)](https://gitter.im/github-api/github-api?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
+[![Join the chat at https://gitter.im/hub4j/github-api](https://badges.gitter.im/Join%20Chat.svg)](https://gitter.im/hub4j/github-api?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
+![CI](https://github.com/hub4j/github-api/workflows/CI/badge.svg?branch=master)
+
 
 
 See https://github-api.kohsuke.org/ for more details

pom.xml

@@ -2,16 +2,16 @@
   <modelVersion>4.0.0</modelVersion>
   <groupId>org.kohsuke</groupId>
   <artifactId>github-api</artifactId>
-  <version>1.105</version>
+  <version>1.126</version>
   <name>GitHub API for Java</name>
   <url>https://github-api.kohsuke.org/</url>
   <description>GitHub API for Java</description>
 
   <scm>
-    <connection>scm:git:git@github.com/github-api/${project.artifactId}.git</connection>
-    <developerConnection>scm:git:ssh://git@github.com/github-api/${project.artifactId}.git</developerConnection>
-    <url>https://${project.artifactId}.kohsuke.org/</url>
-    <tag>github-api-1.105</tag>
+    <connection>scm:git:git@github.com/hub4j/${project.artifactId}.git</connection>
+    <developerConnection>scm:git:ssh://git@github.com/hub4j/${project.artifactId}.git</developerConnection>
+    <url>https://github.com/hub4j/github-api/</url>
+    <tag>github-api-1.126</tag>
   </scm>
 
   <distributionManagement>
@@ -27,25 +27,26 @@
     </repository>
     <site>
       <id>github-pages</id>
-      <url>gitsite:git@github.com/github-api/${project.artifactId}.git</url>
+      <url>gitsite:git@github.com/hub4j/${project.artifactId}.git</url>
     </site>
   </distributionManagement>
 
   <properties>
     <project.build.sourceEncoding>UTF-8</project.build.sourceEncoding>
-    <spotbugs-maven-plugin.version>3.1.12.2</spotbugs-maven-plugin.version>
-    <spotbugs.version>3.1.12</spotbugs.version>
+    <spotbugs-maven-plugin.version>4.2.0</spotbugs-maven-plugin.version>
+    <spotbugs.version>4.2.1</spotbugs.version>
     <spotbugs-maven-plugin.failOnError>true</spotbugs-maven-plugin.failOnError>
     <hamcrest.version>2.2</hamcrest.version>
-    <okhttp3.version>4.3.1</okhttp3.version>
-    <okio.version>2.4.3</okio.version>
-    <formatter-maven-plugin.goal>format</formatter-maven-plugin.goal>
-    <impsort-maven-plugin.goal>sort</impsort-maven-plugin.goal>
+    <okhttp3.version>4.4.1</okhttp3.version>
+    <okio.version>2.5.0</okio.version>
     <!-- Using this as the minimum bar for code coverage.  Adding methods without covering them will fail this. -->
-    <jacoco.coverage.target.bundle.method>0.556</jacoco.coverage.target.bundle.method>
-    <jacoco.coverage.target.class.method>0.25</jacoco.coverage.target.class.method>
+    <jacoco.coverage.target.bundle.method>0.70</jacoco.coverage.target.bundle.method>
+    <jacoco.coverage.target.class.method>0.50</jacoco.coverage.target.class.method>
     <!-- For non-ci builds we'd like the build to still complete if jacoco metrics aren't met. -->
     <jacoco.haltOnFailure>false</jacoco.haltOnFailure>
+    <jjwt.suite.version>0.11.2</jjwt.suite.version>
+
+    <surefire.argLine />
   </properties>
 
   <build>
@@ -80,52 +81,12 @@
     <pluginManagement>
       <plugins>
         <plugin>
-          <groupId>org.apache.maven.plugins</groupId>
-          <artifactId>maven-shade-plugin</artifactId>
-          <version>3.2.1</version>
-          <executions>
-            <execution>
-              <id>shaded-jar</id>
-              <phase>package</phase>
-              <goals>
-                <goal>shade</goal>
-              </goals>
-              <configuration>
-                <relocations>
-                  <relocation>
-                    <pattern>com.fasterxml.jackson</pattern>
-                    <shadedPattern>hidden.com.fasterxml.jackson</shadedPattern>
-                  </relocation>
-                  <relocation>
-                    <pattern>org.apache</pattern>
-                    <shadedPattern>hidden.org.apache</shadedPattern>
-                  </relocation>
-                </relocations>
-                <artifactSet>
-                  <excludes>
-                    <exclude>com.infradna.tool:bridge-method-annotation</exclude>
-                    <exclude>org.jenkins-ci:annotation-indexer</exclude>
-                    <exclude>com.squareup.*:*</exclude>
-                    <exclude>org.jetbrains*:*</exclude>
-                    <exclude>com.github.spotbugs:*</exclude>
-                    <exclude>com.google.code.findbugs:*</exclude>
-                  </excludes>
-                </artifactSet>
-                <shadedArtifactAttached>true</shadedArtifactAttached>
-                <filters>
-                  <filter>
-                    <artifact>*:*</artifact>
-                    <excludes>
-                      <exclude>module-info.class</exclude>
-                      <exclude>META-INF/*.SF</exclude>
-                      <exclude>META-INF/*.DSA</exclude>
-                      <exclude>META-INF/*.RSA</exclude>
-                    </excludes>
-                  </filter>
-                </filters>
-              </configuration>
-            </execution>
-          </executions>
+          <artifactId>maven-surefire-plugin</artifactId>
+          <version>2.22.2</version>
+          <configuration>
+            <!-- SUREFIRE-1226 workaround -->
+            <trimStackTrace>false</trimStackTrace>
+          </configuration>
         </plugin>
         <plugin>
           <groupId>org.apache.maven.plugins</groupId>
@@ -140,7 +101,7 @@
         <plugin>
           <groupId>org.jacoco</groupId>
           <artifactId>jacoco-maven-plugin</artifactId>
-          <version>0.8.5</version>
+          <version>0.8.6</version>
           <executions>
             <execution>
               <goals>
@@ -193,64 +154,40 @@
                       <!-- Sample only -->
                       <exclude>org.kohsuke.github.example.*</exclude>
 
-                      <!-- No methods -->
-                      <exclude>org.kohsuke.github.DeleteToken</exclude>
-                      <exclude>org.kohsuke.github.Previews</exclude>
 
                       <!-- Deprecated -->
                       <exclude>org.kohsuke.github.extras.OkHttp3Connector</exclude>
                       <exclude>org.kohsuke.github.EnforcementLevel</exclude>
                       <exclude>org.kohsuke.github.GHPerson.1</exclude>
-                      <exclude>org.kohsuke.github.GHPerson.1.1</exclude>
+                      <!-- TODO: Some coverage, but more needed -->
+                      <exclude>org.kohsuke.github.GHPullRequestReviewBuilder.DraftReviewComment</exclude>
+                      <exclude>org.kohsuke.github.GHIssue.PullRequest</exclude>
+                      <exclude>org.kohsuke.github.GHCommitSearchBuilder</exclude>
+                      <exclude>org.kohsuke.github.GHRepositorySearchBuilder</exclude>
+                      <exclude>org.kohsuke.github.GHUserSearchBuilder</exclude>
 
                       <!-- TODO: These still need test coverage -->
                       <exclude>org.kohsuke.github.GHBranchProtection.RequiredSignatures</exclude>
                       <exclude>org.kohsuke.github.GHBranchProtectionBuilder.Restrictions</exclude>
                       <exclude>org.kohsuke.github.GHBranchProtection.Restrictions</exclude>
                       <exclude>org.kohsuke.github.GHCommentAuthorAssociation</exclude>
-                      <exclude>org.kohsuke.github.GHCommitBuilder.UserInfo</exclude>
-                      <exclude>org.kohsuke.github.GHCommitSearchBuilder.CommitSearchResult</exclude>
-                      <exclude>org.kohsuke.github.GHCommitSearchBuilder.Sort</exclude>
-                      <exclude>org.kohsuke.github.GHCommitSearchBuilder</exclude>
-                      <exclude>org.kohsuke.github.GHCommitState</exclude>
                       <exclude>org.kohsuke.github.GHCompare.Commit</exclude>
                       <exclude>org.kohsuke.github.GHCompare.InnerCommit</exclude>
-                      <exclude>org.kohsuke.github.GHCompare.Status</exclude>
                       <exclude>org.kohsuke.github.GHCompare.Tree</exclude>
                       <exclude>org.kohsuke.github.GHCompare.User</exclude>
                       <exclude>org.kohsuke.github.GHCompare</exclude>
                       <exclude>org.kohsuke.github.GHDeployKey</exclude>
-                      <exclude>org.kohsuke.github.GHDeploymentStatusBuilder</exclude>
-                      <exclude>org.kohsuke.github.GHDirection</exclude>
                       <exclude>org.kohsuke.github.GHEmail</exclude>
-                      <exclude>org.kohsuke.github.GHEventPayload.Ping</exclude>
-                      <exclude>org.kohsuke.github.GHEventPayload.Release</exclude>
-                      <exclude>org.kohsuke.github.GHException</exclude>
-                      <exclude>org.kohsuke.github.GHHook</exclude>
-                      <exclude>org.kohsuke.github.GHHooks.OrgContext</exclude>
                       <exclude>org.kohsuke.github.GHInvitation</exclude>
-                      <exclude>org.kohsuke.github.GHIssueSearchBuilder.IssueSearchResult</exclude>
-                      <exclude>org.kohsuke.github.GHIssueSearchBuilder.Sort</exclude>
-                      <exclude>org.kohsuke.github.GHIssueSearchBuilder</exclude>
-                      <exclude>org.kohsuke.github.GHMilestoneState</exclude>
-                      <exclude>org.kohsuke.github.GHOrgHook</exclude>
-                      <exclude>org.kohsuke.github.GHProject.ProjectStateFilter</exclude>
                       <exclude>org.kohsuke.github.GHPullRequestCommitDetail.Authorship</exclude>
                       <exclude>org.kohsuke.github.GHPullRequestCommitDetail.Commit</exclude>
                       <exclude>org.kohsuke.github.GHPullRequestCommitDetail.CommitPointer</exclude>
                       <exclude>org.kohsuke.github.GHPullRequestCommitDetail.Tree</exclude>
                       <exclude>org.kohsuke.github.GHPullRequestCommitDetail</exclude>
                       <exclude>org.kohsuke.github.GHPullRequestFileDetail</exclude>
-                      <exclude>org.kohsuke.github.GHPullRequestQueryBuilder.Sort</exclude>
                       <exclude>org.kohsuke.github.GHReleaseUpdater</exclude>
-                      <exclude>org.kohsuke.github.GHRepository.ForkSort</exclude>
                       <exclude>org.kohsuke.github.GHRequestedAction</exclude>
-                      <exclude>org.kohsuke.github.GHStargazer</exclude>
-                      <exclude>org.kohsuke.github.GHTagObject</exclude>
-                      <exclude>org.kohsuke.github.GHTeam.Role</exclude>
-                      <exclude>org.kohsuke.github.GHUserSearchBuilder.Sort</exclude>
                       <exclude>org.kohsuke.github.GHVerifiedKey</exclude>
-                      <exclude>org.kohsuke.github.GitHubBuilder.1</exclude>
                     </excludes>
                   </rule>
                 </rules>
@@ -261,7 +198,7 @@
         <plugin>
           <groupId>org.apache.maven.plugins</groupId>
           <artifactId>maven-javadoc-plugin</artifactId>
-          <version>3.1.1</version>
+          <version>3.2.0</version>
           <configuration>
             <source>8</source>
             <failOnWarnings>true</failOnWarnings>
@@ -285,7 +222,7 @@
       <plugin>
         <groupId>org.apache.maven.plugins</groupId>
         <artifactId>maven-site-plugin</artifactId>
-        <version>3.8.2</version>
+        <version>3.9.1</version>
       </plugin>
       <plugin>
         <groupId>org.apache.maven.plugins</groupId>
@@ -305,12 +242,12 @@
       <plugin>
         <groupId>org.apache.maven.plugins</groupId>
         <artifactId>maven-project-info-reports-plugin</artifactId>
-        <version>3.0.0</version>
+        <version>3.1.1</version>
         <dependencies>
           <dependency>
             <groupId>org.apache.bcel</groupId>
             <artifactId>bcel</artifactId>
-            <version>6.4.1</version>
+            <version>6.5.0</version>
           </dependency>
         </dependencies>
       </plugin>
@@ -332,12 +269,20 @@
 
       <plugin>
         <artifactId>maven-surefire-plugin</artifactId>
-        <version>2.22.2</version>
+        <executions>
+          <execution>
+            <id>default-test</id>
+            <configuration>
+              <excludesFile>src/test/resources/slow-or-flaky-tests.txt</excludesFile>
+              <argLine>${surefire.argLine}</argLine>
+            </configuration>
+          </execution>
+        </executions>
       </plugin>
       <plugin>
         <groupId>org.codehaus.mojo</groupId>
         <artifactId>animal-sniffer-maven-plugin</artifactId>
-        <version>1.18</version>
+        <version>1.20</version>
         <configuration>
           <signature>
             <groupId>org.codehaus.mojo.signature</groupId>
@@ -368,36 +313,35 @@
         </executions>
       </plugin>
       <plugin>
-        <groupId>net.revelc.code.formatter</groupId>
-        <artifactId>formatter-maven-plugin</artifactId>
-        <version>2.11.0</version>
+        <groupId>com.diffplug.spotless</groupId>
+        <artifactId>spotless-maven-plugin</artifactId>
+        <version>2.8.1</version>
         <executions>
           <execution>
+            <id>spotless-check</id>
+            <!-- runs in verify phase by default -->
             <goals>
-              <goal>${formatter-maven-plugin.goal}</goal>
+              <!-- can be disabled using -Dspotless.check.skip=true -->
+              <goal>check</goal>
             </goals>
-            <configuration>
-              <configFile>src/main/resources/eclipse/formatter.xml</configFile>
-            </configuration>
           </execution>
         </executions>
-      </plugin>
-      <plugin>
-        <groupId>net.revelc.code</groupId>
-        <artifactId>impsort-maven-plugin</artifactId>
-        <version>1.3.2</version>
         <configuration>
-          <groups>*,java.,javax.</groups>
-          <removeUnused>true</removeUnused>
-          <staticAfter>true</staticAfter>
+          <java>
+            <eclipse>
+              <file>${basedir}/src/build/eclipse/formatter.xml</file>
+            </eclipse>
+
+            <importOrder>
+              <file>${basedir}/src/build/eclipse/eclipse.importorder</file>
+            </importOrder>
+            <removeUnusedImports />
+
+            <trimTrailingWhitespace />
+            <endWithNewline />
+
+          </java>
         </configuration>
-        <executions>
-          <execution>
-            <goals>
-              <goal>${impsort-maven-plugin.goal}</goal>
-            </goals>
-          </execution>
-        </executions>
       </plugin>
       <plugin>
         <groupId>com.github.spotbugs</groupId>
@@ -434,6 +378,12 @@
       <artifactId>commons-lang3</artifactId>
       <version>3.9</version>
     </dependency>
+    <dependency>
+      <groupId>com.tngtech.archunit</groupId>
+      <artifactId>archunit</artifactId>
+      <version>0.17.0</version>
+      <scope>test</scope>
+    </dependency>
     <dependency>
       <groupId>org.hamcrest</groupId>
       <artifactId>hamcrest</artifactId>
@@ -456,18 +406,24 @@
     <dependency>
       <groupId>junit</groupId>
       <artifactId>junit</artifactId>
-      <version>4.13</version>
+      <version>4.13.2</version>
+      <scope>test</scope>
+    </dependency>
+    <dependency>
+      <groupId>org.awaitility</groupId>
+      <artifactId>awaitility</artifactId>
+      <version>4.0.3</version>
       <scope>test</scope>
     </dependency>
     <dependency>
       <groupId>com.fasterxml.jackson.core</groupId>
       <artifactId>jackson-databind</artifactId>
-      <version>2.10.2</version>
+      <version>2.12.1</version>
     </dependency>
     <dependency>
       <groupId>commons-io</groupId>
       <artifactId>commons-io</artifactId>
-      <version>2.6</version>
+      <version>2.4</version>
     </dependency>
     <dependency>
       <groupId>com.infradna.tool</groupId>
@@ -493,7 +449,7 @@
     <dependency>
       <groupId>org.kohsuke.stapler</groupId>
       <artifactId>stapler</artifactId>
-      <version>1.258</version>
+      <version>1.262</version>
       <scope>test</scope>
     </dependency>
     <dependency>
@@ -505,9 +461,27 @@
     <dependency>
       <groupId>org.eclipse.jgit</groupId>
       <artifactId>org.eclipse.jgit</artifactId>
-      <version>5.6.0.201912101111-r</version>
+      <version>5.10.0.202012080955-r</version>
       <scope>test</scope>
     </dependency>
+    <dependency>
+      <groupId>io.jsonwebtoken</groupId>
+      <artifactId>jjwt-api</artifactId>
+      <version>${jjwt.suite.version}</version>
+      <optional>true</optional>
+    </dependency>
+    <dependency>
+      <groupId>io.jsonwebtoken</groupId>
+      <artifactId>jjwt-impl</artifactId>
+      <version>${jjwt.suite.version}</version>
+      <optional>true</optional>
+    </dependency>
+    <dependency>
+      <groupId>io.jsonwebtoken</groupId>
+      <artifactId>jjwt-jackson</artifactId>
+      <version>${jjwt.suite.version}</version>
+      <optional>true</optional>
+    </dependency>
     <dependency>
       <groupId>com.squareup.okio</groupId>
       <artifactId>okio</artifactId>
@@ -543,7 +517,7 @@
     <dependency>
       <groupId>org.mockito</groupId>
       <artifactId>mockito-core</artifactId>
-      <version>3.2.4</version>
+      <version>3.7.7</version>
       <scope>test</scope>
     </dependency>
     <dependency>
@@ -555,7 +529,7 @@
     <dependency>
       <groupId>com.github.tomakehurst</groupId>
       <artifactId>wiremock-jre8-standalone</artifactId>
-      <version>2.25.1</version>
+      <version>2.27.2</version>
       <scope>test</scope>
     </dependency>
     <dependency>
@@ -564,6 +538,12 @@
       <version>2.8.6</version>
       <scope>test</scope>
     </dependency>
+    <dependency>
+      <groupId>org.slf4j</groupId>
+      <artifactId>slf4j-simple</artifactId>
+      <version>1.7.30</version>
+      <scope>test</scope>
+    </dependency>
   </dependencies>
   <repositories>
     <repository>
@@ -578,42 +558,100 @@
     </pluginRepository>
   </pluginRepositories>
   <profiles>
+    <!-- only enable slow-or-flaky-test if -Dtest= is not present -->
     <profile>
-      <id>ci</id>
+      <id>slow-or-flaky-test</id>
+      <activation>
+        <property>
+          <name>!test</name>
+        </property>
+      </activation>
+      <build>
+        <plugins>
+          <plugin>
+            <artifactId>maven-surefire-plugin</artifactId>
+            <executions>
+              <execution>
+                <id>slow-or-flaky-test</id>
+                <phase>test</phase>
+                <goals>
+                  <goal>test</goal>
+                </goals>
+                <configuration>
+                  <rerunFailingTestsCount>2</rerunFailingTestsCount>
+                  <!-- There are some tests that take longer or are a little
+                    flaky. Run them here. -->
+                  <includesFile>src/test/resources/slow-or-flaky-tests.txt</includesFile>
+                  <argLine>${surefire.argLine}</argLine>
+                </configuration>
+              </execution>
+            </executions>
+          </plugin>
+        </plugins>
+      </build>
+    </profile>
+    <profile>
+      <id>jdk11+</id>
+      <activation>
+        <jdk>[11,)</jdk>
+      </activation>
+      <properties>
+        <!-- this is required for GithubHttpUrlConnectionClient#setRequestMethod() to work with JDK 16+ -->
+        <surefire.argLine>--add-opens java.base/java.net=ALL-UNNAMED</surefire.argLine>
+      </properties>
+    </profile>
+    <profile>
+      <id>ci-non-windows</id>
+      <activation>
+        <property>
+          <name>enable-ci</name>
+        </property>
+        <os>
+          <family>!windows</family>
+        </os>
+      </activation>
+      <properties>
+        <!-- Only fail code coverage on non-windows machines -->
+        <jacoco.haltOnFailure>true</jacoco.haltOnFailure>
+      </properties>
+    </profile>
+    <profile>
+      <id>ci-all</id>
       <activation>
         <property>
           <name>enable-ci</name>
         </property>
       </activation>
-      <properties>
-        <formatter-maven-plugin.goal>validate</formatter-maven-plugin.goal>
-        <impsort-maven-plugin.goal>check</impsort-maven-plugin.goal>
-        <jacoco.haltOnFailure>true</jacoco.haltOnFailure>
-      </properties>
       <build>
         <plugins>
-          <plugin>
-            <groupId>org.apache.maven.plugins</groupId>
-            <artifactId>maven-shade-plugin</artifactId>
-          </plugin>
           <plugin>
             <groupId>org.jacoco</groupId>
             <artifactId>jacoco-maven-plugin</artifactId>
           </plugin>
+          <plugin>
+            <groupId>com.diffplug.spotless</groupId>
+            <artifactId>spotless-maven-plugin</artifactId>
+            <executions>
+              <execution>
+                <id>spotless-check</id>
+                <!-- In CI, run check early in the build -->
+                <phase>process-sources</phase>
+                <goals>
+                  <goal>check</goal>
+                </goals>
+              </execution>
+            </executions>
+          </plugin>
         </plugins>
       </build>
     </profile>
     <profile>
       <id>release</id>
-      <properties>
-        <formatter-maven-plugin.goal>validate</formatter-maven-plugin.goal>
-        <impsort-maven-plugin.goal>check</impsort-maven-plugin.goal>
-      </properties>
       <build>
         <plugins>
           <plugin>
-            <groupId>org.apache.maven.plugins</groupId>
-            <artifactId>maven-shade-plugin</artifactId>
+            <groupId>org.jacoco</groupId>
+            <artifactId>jacoco-maven-plugin</artifactId>
           </plugin>
           <plugin>
             <groupId>org.apache.maven.plugins</groupId>
@@ -664,6 +702,18 @@
   </profiles>
   <reporting>
     <plugins>
+      <plugin>
+        <groupId>org.jacoco</groupId>
+        <artifactId>jacoco-maven-plugin</artifactId>
+        <reportSets>
+          <reportSet>
+            <reports>
+              <!-- select non-aggregate reports -->
+              <report>report</report>
+            </reports>
+          </reportSet>
+        </reportSets>
+      </plugin>
       <plugin>
         <groupId>org.apache.maven.plugins</groupId>
         <artifactId>maven-javadoc-plugin</artifactId>

src/build/eclipse/eclipse.importorder

@@ -0,0 +1,6 @@
+#Organize Import Order
+# Import this file in Window -> Preferences -> Java -> Code Style -> Organize Imports -> Import...
+0=
+1=java
+2=javax
+3=\#

src/main/java/org/kohsuke/github/AbstractBuilder.java

@@ -0,0 +1,166 @@
+package org.kohsuke.github;
+
+import java.io.IOException;
+
+import javax.annotation.CheckForNull;
+import javax.annotation.Nonnull;
+
+/**
+ * An abstract data object builder/updater.
+ *
+ * This class can be use to make a Builder that supports both batch and single property changes.
+ * <p>
+ * Batching looks like this:
+ * </p>
+ *
+ * <pre>
+ * update().someName(value).otherName(value).done()
+ * </pre>
+ * <p>
+ * Single changes look like this:
+ * </p>
+ *
+ * <pre>
+ * set().someName(value);
+ * set().otherName(value);
+ * </pre>
+ * <p>
+ * If {@link S} is the same as {@link R}, {@link #with(String, Object)} will commit changes after the first value change
+ * and return a {@link R} from {@link #done()}.
+ * </p>
+ * <p>
+ * If {@link S} is not the same as {@link R}, {@link #with(String, Object)} will batch together multiple changes and let
+ * the user call {@link #done()} when they are ready.
+ *
+ * @param <R>
+ *            Final return type built by this builder returned when {@link #done()}} is called.
+ * @param <S>
+ *            Intermediate return type for this builder returned by calls to {@link #with(String, Object)}. If {@link S}
+ *            the same as {@link R}, this builder will commit changes after each call to {@link #with(String, Object)}.
+ */
+abstract class AbstractBuilder<R, S> extends GitHubInteractiveObject {
+
+    @Nonnull
+    private final Class<R> returnType;
+
+    private final boolean commitChangesImmediately;
+
+    @CheckForNull
+    private final R baseInstance;
+
+    @Nonnull
+    protected final Requester requester;
+
+    // TODO: Not sure how update-in-place behavior should be controlled
+    // However, it certainly can be controlled dynamically down to the instance level or inherited for all children of
+    // some
+    // connection.
+    protected boolean updateInPlace;
+
+    /**
+     * Creates a builder.
+     *
+     * @param root
+     *            the GitHub instance to connect to.
+     * @param intermediateReturnType
+     *            the intermediate return type of type {@link S} returned by calls to {@link #with(String, Object)}.
+     *            Must either be equal to {@code builtReturnType} or this instance must be castable to this class. If
+     *            not, the constructor will throw {@link IllegalArgumentException}.
+     * @param finalReturnType
+     *            the final return type for built by this builder returned when {@link #done()}} is called.
+     * @param baseInstance
+     *            optional instance on which to base this builder.
+     */
+    protected AbstractBuilder(@Nonnull Class<R> finalReturnType,
+            @Nonnull Class<S> intermediateReturnType,
+            @Nonnull GitHub root,
+            @CheckForNull R baseInstance) {
+        super(root);
+        this.requester = root.createRequest();
+        this.returnType = finalReturnType;
+        this.commitChangesImmediately = returnType.equals(intermediateReturnType);
+        if (!commitChangesImmediately && !intermediateReturnType.isInstance(this)) {
+            throw new IllegalArgumentException(
+                    "Argument \"intermediateReturnType\": This instance must be castable to intermediateReturnType or finalReturnType must be equal to intermediateReturnType.");
+        }
+
+        this.baseInstance = baseInstance;
+        this.updateInPlace = false;
+    }
+
+    /**
+     * Finishes an update, committing changes.
+     *
+     * This method may update-in-place or not. Either way it returns the resulting instance.
+     *
+     * @return an instance with updated current data
+     * @throws IOException
+     *             if there is an I/O Exception
+     */
+    @Nonnull
+    @BetaApi
+    @Deprecated
+    public R done() throws IOException {
+        R result;
+        if (updateInPlace && baseInstance != null) {
+            result = requester.fetchInto(baseInstance);
+        } else {
+            result = requester.fetch(returnType);
+        }
+        return result;
+    }
+
+    /**
+     * Applies a value to a name for this builder.
+     *
+     * If {@link S} is the same as {@link R}, this method will commit changes after the first value change and return a
+     * {@link R} from {@link #done()}.
+     *
+     * If {@link S} is not the same as {@link R}, this method will return an {@link S} and letting the caller batch
+     * together multiple changes and call {@link #done()} when they are ready.
+     *
+     * @param name
+     *            the name of the field
+     * @param value
+     *            the value of the field
+     * @return either a continuing builder or an updated data record
+     * @throws IOException
+     *             if an I/O error occurs
+     */
+    @Nonnull
+    @BetaApi
+    @Deprecated
+    protected S with(@Nonnull String name, Object value) throws IOException {
+        requester.with(name, value);
+        return continueOrDone();
+    }
+
+    /**
+     * Chooses whether to return a continuing builder or an updated data record
+     *
+     * If {@link S} is the same as {@link R}, this method will commit changes after the first value change and return a
+     * {@link R} from {@link #done()}.
+     *
+     * If {@link S} is not the same as {@link R}, this method will return an {@link S} and letting the caller batch
+     * together multiple changes and call {@link #done()} when they are ready.
+     *
+     * @return either a continuing builder or an updated data record
+     * @throws IOException
+     *             if an I/O error occurs
+     */
+    @Nonnull
+    @BetaApi
+    @Deprecated
+    protected S continueOrDone() throws IOException {
+        // This little bit of roughness in this base class means all inheriting builders get to create Updater and
+        // Setter classes from almost identical code. Creator can often be implemented with significant code reuse as
+        // well.
+        if (commitChangesImmediately) {
+            // These casts look strange and risky, but they they're actually guaranteed safe due to the return path
+            // being based on the previous comparison of class instances passed to the constructor.
+            return (S) done();
+        } else {
+            return (S) this;
+        }
+    }
+}

src/main/java/org/kohsuke/github/AbuseLimitHandler.java

@@ -29,6 +29,10 @@ public abstract class AbuseLimitHandler {
      * @throws IOException
      *             on failure
      * @see <a href="https://developer.github.com/v3/#abuse-rate-limits">API documentation from GitHub</a>
+     * @see <a href=
+     *      "https://developer.github.com/v3/guides/best-practices-for-integrators/#dealing-with-abuse-rate-limits">Dealing
+     *      with abuse rate limits</a>
+     *
      */
     public abstract void onError(IOException e, HttpURLConnection uc) throws IOException;
 

src/main/java/org/kohsuke/github/BetaApi.java

@@ -0,0 +1,18 @@
+package org.kohsuke.github;
+
+import java.lang.annotation.Documented;
+import java.lang.annotation.Retention;
+import java.lang.annotation.RetentionPolicy;
+
+/**
+ * Indicates that the method/class/etc marked is a beta implementation of an sdk feature.
+ * <p>
+ * These APIs are subject to change and not a part of the backward compatibility commitment. Always used in conjunction
+ * with 'deprecated' to raise awareness to clients.
+ * </p>
+ *
+ */
+@Retention(RetentionPolicy.RUNTIME)
+@Documented
+public @interface BetaApi {
+}

src/main/java/org/kohsuke/github/DeleteToken.java

@@ -1,35 +0,0 @@
-/*
- * The MIT License
- *
- * Copyright (c) 2010, Kohsuke Kawaguchi
- *
- * Permission is hereby granted, free of charge, to any person obtaining a copy
- * of this software and associated documentation files (the "Software"), to deal
- * in the Software without restriction, including without limitation the rights
- * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
- * copies of the Software, and to permit persons to whom the Software is
- * furnished to do so, subject to the following conditions:
- *
- * The above copyright notice and this permission notice shall be included in
- * all copies or substantial portions of the Software.
- *
- * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
- * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
- * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
- * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
- * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
- * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
- * THE SOFTWARE.
- */
-package org.kohsuke.github;
-
-import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
-
-/**
- * @author Kohsuke Kawaguchi
- */
-@SuppressFBWarnings(value = "UUF_UNUSED_PUBLIC_OR_PROTECTED_FIELD",
-        justification = "Being constructed by JSON deserialization")
-class DeleteToken {
-    public String delete_token;
-}

src/main/java/org/kohsuke/github/GHApp.java

@@ -5,7 +5,7 @@ import java.net.URL;
 import java.util.List;
 import java.util.Map;
 
-import static org.kohsuke.github.Previews.MACHINE_MAN;
+import static org.kohsuke.github.internal.Previews.MACHINE_MAN;
 
 /**
  * A Github App.
@@ -15,7 +15,6 @@ import static org.kohsuke.github.Previews.MACHINE_MAN;
  */
 public class GHApp extends GHObject {
 
-    private GitHub root;
     private GHUser owner;
     private String name;
     private String description;
@@ -39,7 +38,9 @@ public class GHApp extends GHObject {
      *
      * @param owner
      *            the owner
+     * @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
      */
+    @Deprecated
     public void setOwner(GHUser owner) {
         this.owner = owner;
     }
@@ -58,7 +59,9 @@ public class GHApp extends GHObject {
      *
      * @param name
      *            the name
+     * @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
      */
+    @Deprecated
     public void setName(String name) {
         this.name = name;
     }
@@ -77,7 +80,9 @@ public class GHApp extends GHObject {
      *
      * @param description
      *            the description
+     * @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
      */
+    @Deprecated
     public void setDescription(String description) {
         this.description = description;
     }
@@ -96,7 +101,9 @@ public class GHApp extends GHObject {
      *
      * @param externalUrl
      *            the external url
+     * @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
      */
+    @Deprecated
     public void setExternalUrl(String externalUrl) {
         this.externalUrl = externalUrl;
     }
@@ -115,7 +122,9 @@ public class GHApp extends GHObject {
      *
      * @param events
      *            the events
+     * @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
      */
+    @Deprecated
     public void setEvents(List<GHEvent> events) {
         this.events = events;
     }
@@ -134,13 +143,15 @@ public class GHApp extends GHObject {
      *
      * @param installationsCount
      *            the installations count
+     * @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
      */
+    @Deprecated
     public void setInstallationsCount(long installationsCount) {
         this.installationsCount = installationsCount;
     }
 
     public URL getHtmlUrl() {
-        return GitHub.parseURL(htmlUrl);
+        return GitHubClient.parseURL(htmlUrl);
     }
 
     /**
@@ -157,7 +168,9 @@ public class GHApp extends GHObject {
      *
      * @param permissions
      *            the permissions
+     * @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
      */
+    @Deprecated
     public void setPermissions(Map<String, String> permissions) {
         this.permissions = permissions;
     }
@@ -175,7 +188,7 @@ public class GHApp extends GHObject {
      * @return a list of App installations
      * @see <a href="https://developer.github.com/v3/apps/#list-installations">List installations</a>
      */
-    @Preview
+    @Preview(MACHINE_MAN)
     @Deprecated
     public PagedIterable<GHAppInstallation> listInstallations() {
         return root.createRequest()
@@ -196,7 +209,7 @@ public class GHApp extends GHObject {
      *             on error
      * @see <a href="https://developer.github.com/v3/apps/#get-an-installation">Get an installation</a>
      */
-    @Preview
+    @Preview(MACHINE_MAN)
     @Deprecated
     public GHAppInstallation getInstallationById(long id) throws IOException {
         return root.createRequest()
@@ -219,7 +232,7 @@ public class GHApp extends GHObject {
      * @see <a href="https://developer.github.com/v3/apps/#get-an-organization-installation">Get an organization
      *      installation</a>
      */
-    @Preview
+    @Preview(MACHINE_MAN)
     @Deprecated
     public GHAppInstallation getInstallationByOrganization(String name) throws IOException {
         return root.createRequest()
@@ -244,7 +257,7 @@ public class GHApp extends GHObject {
      * @see <a href="https://developer.github.com/v3/apps/#get-a-repository-installation">Get a repository
      *      installation</a>
      */
-    @Preview
+    @Preview(MACHINE_MAN)
     @Deprecated
     public GHAppInstallation getInstallationByRepository(String ownerName, String repositoryName) throws IOException {
         return root.createRequest()
@@ -266,7 +279,7 @@ public class GHApp extends GHObject {
      *             on error
      * @see <a href="https://developer.github.com/v3/apps/#get-a-user-installation">Get a user installation</a>
      */
-    @Preview
+    @Preview(MACHINE_MAN)
     @Deprecated
     public GHAppInstallation getInstallationByUser(String name) throws IOException {
         return root.createRequest()

src/main/java/org/kohsuke/github/GHAppCreateTokenBuilder.java

@@ -5,7 +5,7 @@ import java.util.HashMap;
 import java.util.List;
 import java.util.Map;
 
-import static org.kohsuke.github.Previews.MACHINE_MAN;
+import static org.kohsuke.github.internal.Previews.MACHINE_MAN;
 
 /**
  * Creates a access token for a GitHub App Installation
@@ -14,12 +14,11 @@ import static org.kohsuke.github.Previews.MACHINE_MAN;
  * @see GHAppInstallation#createToken(Map) GHAppInstallation#createToken(Map)
  * @see GHAppInstallation#createToken() GHAppInstallation#createToken()
  */
-public class GHAppCreateTokenBuilder {
-    private final GitHub root;
+public class GHAppCreateTokenBuilder extends GitHubInteractiveObject {
     protected final Requester builder;
     private final String apiUrlTail;
 
-    @Preview
+    @BetaApi
     @Deprecated
     GHAppCreateTokenBuilder(GitHub root, String apiUrlTail) {
         this.root = root;
@@ -27,7 +26,7 @@ public class GHAppCreateTokenBuilder {
         this.builder = root.createRequest();
     }
 
-    @Preview
+    @BetaApi
     @Deprecated
     GHAppCreateTokenBuilder(GitHub root, String apiUrlTail, Map<String, GHPermissionType> permissions) {
         this(root, apiUrlTail);
@@ -43,7 +42,7 @@ public class GHAppCreateTokenBuilder {
      *            Array containing the repositories Ids
      * @return a GHAppCreateTokenBuilder
      */
-    @Preview
+    @BetaApi
     @Deprecated
     public GHAppCreateTokenBuilder repositoryIds(List<Long> repositoryIds) {
         this.builder.with("repository_ids", repositoryIds);
@@ -58,12 +57,12 @@ public class GHAppCreateTokenBuilder {
      *            Map containing the permission names and types.
      * @return a GHAppCreateTokenBuilder
      */
-    @Preview
+    @BetaApi
     @Deprecated
     public GHAppCreateTokenBuilder permissions(Map<String, GHPermissionType> permissions) {
         Map<String, String> retMap = new HashMap<>();
         for (Map.Entry<String, GHPermissionType> entry : permissions.entrySet()) {
-            retMap.put(entry.getKey(), Requester.transformEnum(entry.getValue()));
+            retMap.put(entry.getKey(), GitHubRequest.transformEnum(entry.getValue()));
         }
         builder.with("permissions", retMap);
         return this;
@@ -78,7 +77,7 @@ public class GHAppCreateTokenBuilder {
      * @throws IOException
      *             on error
      */
-    @Preview
+    @Preview(MACHINE_MAN)
     @Deprecated
     public GHAppInstallationToken create() throws IOException {
         return builder.method("POST")

src/main/java/org/kohsuke/github/GHAppInstallation.java

@@ -3,11 +3,13 @@ package org.kohsuke.github;
 import com.fasterxml.jackson.annotation.JsonProperty;
 
 import java.io.IOException;
+import java.net.MalformedURLException;
 import java.net.URL;
 import java.util.List;
 import java.util.Map;
 
-import static org.kohsuke.github.Previews.GAMBIT;
+import static org.kohsuke.github.internal.Previews.GAMBIT;
+import static org.kohsuke.github.internal.Previews.MACHINE_MAN;
 
 /**
  * A Github App Installation.
@@ -20,7 +22,6 @@ import static org.kohsuke.github.Previews.GAMBIT;
  * @see GHApp#getInstallationByUser(String) GHApp#getInstallationByUser(String)
  */
 public class GHAppInstallation extends GHObject {
-    private GitHub root;
     private GHUser account;
 
     @JsonProperty("access_tokens_url")
@@ -42,7 +43,7 @@ public class GHAppInstallation extends GHObject {
     private String htmlUrl;
 
     public URL getHtmlUrl() {
-        return GitHub.parseURL(htmlUrl);
+        return GitHubClient.parseURL(htmlUrl);
     }
 
     /**
@@ -59,7 +60,9 @@ public class GHAppInstallation extends GHObject {
      *
      * @param root
      *            the root
+     * @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
      */
+    @Deprecated
     public void setRoot(GitHub root) {
         this.root = root;
     }
@@ -78,7 +81,9 @@ public class GHAppInstallation extends GHObject {
      *
      * @param account
      *            the account
+     * @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
      */
+    @Deprecated
     public void setAccount(GHUser account) {
         this.account = account;
     }
@@ -97,7 +102,9 @@ public class GHAppInstallation extends GHObject {
      *
      * @param accessTokenUrl
      *            the access token url
+     * @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
      */
+    @Deprecated
     public void setAccessTokenUrl(String accessTokenUrl) {
         this.accessTokenUrl = accessTokenUrl;
     }
@@ -111,12 +118,44 @@ public class GHAppInstallation extends GHObject {
         return repositoriesUrl;
     }
 
+    /**
+     * List repositories that this app installation can access.
+     *
+     * @return the paged iterable
+     */
+    @Preview(MACHINE_MAN)
+    @Deprecated
+    public PagedSearchIterable<GHRepository> listRepositories() {
+        GitHubRequest request;
+
+        try {
+            request = root.createRequest().withPreview(MACHINE_MAN).withUrlPath("/installation/repositories").build();
+        } catch (MalformedURLException e) {
+            throw new GHException("", e);
+        }
+
+        return new PagedSearchIterable<>(root, request, GHAppInstallationRepositoryResult.class);
+    }
+
+    private static class GHAppInstallationRepositoryResult extends SearchResult<GHRepository> {
+        private GHRepository[] repositories;
+
+        @Override
+        GHRepository[] getItems(GitHub root) {
+            for (GHRepository item : repositories)
+                item.wrap(root);
+            return repositories;
+        }
+    }
+
     /**
      * Sets repositories url.
      *
      * @param repositoriesUrl
      *            the repositories url
+     * @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
      */
+    @Deprecated
     public void setRepositoriesUrl(String repositoriesUrl) {
         this.repositoriesUrl = repositoriesUrl;
     }
@@ -135,7 +174,9 @@ public class GHAppInstallation extends GHObject {
      *
      * @param appId
      *            the app id
+     * @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
      */
+    @Deprecated
     public void setAppId(long appId) {
         this.appId = appId;
     }
@@ -154,7 +195,9 @@ public class GHAppInstallation extends GHObject {
      *
      * @param targetId
      *            the target id
+     * @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
      */
+    @Deprecated
     public void setTargetId(long targetId) {
         this.targetId = targetId;
     }
@@ -173,7 +216,9 @@ public class GHAppInstallation extends GHObject {
      *
      * @param targetType
      *            the target type
+     * @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
      */
+    @Deprecated
     public void setTargetType(GHTargetType targetType) {
         this.targetType = targetType;
     }
@@ -192,7 +237,9 @@ public class GHAppInstallation extends GHObject {
      *
      * @param permissions
      *            the permissions
+     * @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
      */
+    @Deprecated
     public void setPermissions(Map<String, GHPermissionType> permissions) {
         this.permissions = permissions;
     }
@@ -211,7 +258,9 @@ public class GHAppInstallation extends GHObject {
      *
      * @param events
      *            the events
+     * @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
      */
+    @Deprecated
     public void setEvents(List<GHEvent> events) {
         this.events = events;
     }
@@ -230,7 +279,9 @@ public class GHAppInstallation extends GHObject {
      *
      * @param singleFileName
      *            the single file name
+     * @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
      */
+    @Deprecated
     public void setSingleFileName(String singleFileName) {
         this.singleFileName = singleFileName;
     }
@@ -249,7 +300,9 @@ public class GHAppInstallation extends GHObject {
      *
      * @param repositorySelection
      *            the repository selection
+     * @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
      */
+    @Deprecated
     public void setRepositorySelection(GHRepositorySelection repositorySelection) {
         this.repositorySelection = repositorySelection;
     }
@@ -268,13 +321,13 @@ public class GHAppInstallation extends GHObject {
      *             on error
      * @see <a href="https://developer.github.com/v3/apps/#delete-an-installation">Delete an installation</a>
      */
-    @Preview
+    @Preview(GAMBIT)
     @Deprecated
     public void deleteInstallation() throws IOException {
         root.createRequest()
                 .method("DELETE")
                 .withPreview(GAMBIT)
-                .withUrlPath(String.format("/app/installations/%d", id))
+                .withUrlPath(String.format("/app/installations/%d", getId()))
                 .send();
     }
 
@@ -290,10 +343,12 @@ public class GHAppInstallation extends GHObject {
      * @return a GHAppCreateTokenBuilder instance
      * @deprecated Use {@link GHAppInstallation#createToken()} instead.
      */
-    @Preview
+    @BetaApi
     @Deprecated
     public GHAppCreateTokenBuilder createToken(Map<String, GHPermissionType> permissions) {
-        return new GHAppCreateTokenBuilder(root, String.format("/app/installations/%d/access_tokens", id), permissions);
+        return new GHAppCreateTokenBuilder(root,
+                String.format("/app/installations/%d/access_tokens", getId()),
+                permissions);
     }
 
     /**
@@ -305,9 +360,9 @@ public class GHAppInstallation extends GHObject {
      *
      * @return a GHAppCreateTokenBuilder instance
      */
-    @Preview
+    @BetaApi
     @Deprecated
     public GHAppCreateTokenBuilder createToken() {
-        return new GHAppCreateTokenBuilder(root, String.format("/app/installations/%d/access_tokens", id));
+        return new GHAppCreateTokenBuilder(root, String.format("/app/installations/%d/access_tokens", getId()));
     }
 }

src/main/java/org/kohsuke/github/GHAppInstallationToken.java

@@ -14,9 +14,7 @@ import java.util.Map;
  * @author Paulo Miguel Almeida
  * @see GHAppInstallation#createToken(Map) GHAppInstallation#createToken(Map)
  */
-public class GHAppInstallationToken {
-    private GitHub root;
-
+public class GHAppInstallationToken extends GitHubInteractiveObject {
     private String token;
     protected String expires_at;
     private Map<String, String> permissions;
@@ -37,7 +35,9 @@ public class GHAppInstallationToken {
      *
      * @param root
      *            the root
+     * @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
      */
+    @Deprecated
     public void setRoot(GitHub root) {
         this.root = root;
     }
@@ -56,7 +56,9 @@ public class GHAppInstallationToken {
      *
      * @param permissions
      *            the permissions
+     * @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
      */
+    @Deprecated
     public void setPermissions(Map<String, String> permissions) {
         this.permissions = permissions;
     }
@@ -75,7 +77,9 @@ public class GHAppInstallationToken {
      *
      * @param token
      *            the token
+     * @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
      */
+    @Deprecated
     public void setToken(String token) {
         this.token = token;
     }
@@ -94,7 +98,9 @@ public class GHAppInstallationToken {
      *
      * @param repositories
      *            the repositories
+     * @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
      */
+    @Deprecated
     public void setRepositories(List<GHRepository> repositories) {
         this.repositories = repositories;
     }
@@ -113,7 +119,9 @@ public class GHAppInstallationToken {
      *
      * @param repositorySelection
      *            the repository selection
+     * @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
      */
+    @Deprecated
     public void setRepositorySelection(GHRepositorySelection repositorySelection) {
         this.repositorySelection = repositorySelection;
     }
@@ -127,7 +135,7 @@ public class GHAppInstallationToken {
      */
     @WithBridgeMethods(value = String.class, adapterMethod = "expiresAtStr")
     public Date getExpiresAt() throws IOException {
-        return GitHub.parseDate(expires_at);
+        return GitHubClient.parseDate(expires_at);
     }
 
     @SuppressFBWarnings(value = "UPM_UNCALLED_PRIVATE_METHOD", justification = "Bridge method of getExpiresAt")

src/main/java/org/kohsuke/github/GHAsset.java

@@ -9,7 +9,6 @@ import java.net.URL;
  * @see GHRelease#getAssets() GHRelease#getAssets()
  */
 public class GHAsset extends GHObject {
-    GitHub root;
     GHRepository owner;
     private String name;
     private String label;
@@ -149,7 +148,7 @@ public class GHAsset extends GHObject {
     }
 
     private String getApiRoute() {
-        return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/releases/assets/" + id;
+        return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/releases/assets/" + getId();
     }
 
     GHAsset wrap(GHRelease release) {

src/main/java/org/kohsuke/github/GHAuthorization.java

@@ -33,7 +33,6 @@ public class GHAuthorization extends GHObject {
     public static final String WRITE_KEY = "write:public_key";
     public static final String ADMIN_KEY = "admin:public_key";
 
-    private GitHub root;
     private List<String> scopes;
     private String token;
     private String token_last_eight;
@@ -96,7 +95,7 @@ public class GHAuthorization extends GHObject {
      * @return the app url
      */
     public URL getAppUrl() {
-        return GitHub.parseURL(app.url);
+        return GitHubClient.parseURL(app.url);
     }
 
     /**
@@ -112,10 +111,12 @@ public class GHAuthorization extends GHObject {
      * Gets api url.
      *
      * @return the api url
+     * @deprecated use {@link #getUrl()}
      */
+    @Deprecated
     @SuppressFBWarnings(value = "NM_CONFUSING", justification = "It's a part of the library API, cannot be changed")
     public URL getApiURL() {
-        return GitHub.parseURL(url);
+        return getUrl();
     }
 
     /**
@@ -141,7 +142,7 @@ public class GHAuthorization extends GHObject {
      * @return the note url
      */
     public URL getNoteUrl() {
-        return GitHub.parseURL(note_url);
+        return GitHubClient.parseURL(note_url);
     }
 
     /**

src/main/java/org/kohsuke/github/GHBlob.java

@@ -24,7 +24,7 @@ public class GHBlob {
      * @return API URL of this blob.
      */
     public URL getUrl() {
-        return GitHub.parseURL(url);
+        return GitHubClient.parseURL(url);
     }
 
     /**

src/main/java/org/kohsuke/github/GHBranch.java

@@ -3,12 +3,15 @@ package org.kohsuke.github;
 import com.fasterxml.jackson.annotation.JsonCreator;
 import com.fasterxml.jackson.annotation.JsonProperty;
 import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
+import org.kohsuke.github.internal.Previews;
 
 import java.io.IOException;
 import java.net.URL;
 import java.util.Collection;
 import java.util.Objects;
 
+import javax.annotation.CheckForNull;
+
 /**
  * A branch in a repository.
  *
@@ -18,8 +21,7 @@ import java.util.Objects;
         value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD",
                 "URF_UNREAD_FIELD" },
         justification = "JSON API")
-public class GHBranch {
-    private GitHub root;
+public class GHBranch extends GitHubInteractiveObject {
     private GHRepository owner;
 
     private String name;
@@ -76,7 +78,7 @@ public class GHBranch {
      *
      * @return true if the push to this branch is restricted via branch protection.
      */
-    @Preview
+    @Preview(Previews.LUKE_CAGE)
     @Deprecated
     public boolean isProtected() {
         return protection;
@@ -87,10 +89,10 @@ public class GHBranch {
      *
      * @return API URL that deals with the protection of this branch.
      */
-    @Preview
+    @Preview(Previews.LUKE_CAGE)
     @Deprecated
     public URL getProtectionUrl() {
-        return GitHub.parseURL(protection_url);
+        return GitHubClient.parseURL(protection_url);
     }
 
     /**
@@ -100,8 +102,14 @@ public class GHBranch {
      * @throws IOException
      *             the io exception
      */
+    @Preview(Previews.LUKE_CAGE)
+    @Deprecated
     public GHBranchProtection getProtection() throws IOException {
-        return root.createRequest().withUrlPath(protection_url).fetch(GHBranchProtection.class).wrap(this);
+        return root.createRequest()
+                .withPreview(Previews.LUKE_CAGE)
+                .setRawUrlPath(protection_url)
+                .fetch(GHBranchProtection.class)
+                .wrap(this);
     }
 
     /**
@@ -120,7 +128,7 @@ public class GHBranch {
      *             if disabling protection fails
      */
     public void disableProtection() throws IOException {
-        root.createRequest().method("DELETE").withUrlPath(protection_url).send();
+        root.createRequest().method("DELETE").setRawUrlPath(protection_url).send();
     }
 
     /**
@@ -129,7 +137,7 @@ public class GHBranch {
      * @return GHBranchProtectionBuilder for enabling protection
      * @see GHCommitStatus#getContext() GHCommitStatus#getContext()
      */
-    @Preview
+    @Preview(Previews.LUKE_CAGE)
     @Deprecated
     public GHBranchProtectionBuilder enableProtection() {
         return new GHBranchProtectionBuilder(this);
@@ -161,6 +169,59 @@ public class GHBranch {
         }
     }
 
+    /**
+     * Merge a branch into this branch.
+     *
+     * @param headBranch
+     *            the branch whose head will be merged
+     *
+     * @param commitMessage
+     *            the commit message
+     *
+     * @return the merge {@link GHCommit} created, or {@code null} if the base already contains the head (nothing to
+     *         merge).
+     *
+     * @throws IOException
+     *             if merging fails
+     */
+    @CheckForNull
+    public GHCommit merge(GHBranch headBranch, String commitMessage) throws IOException {
+        return merge(headBranch.getName(), commitMessage);
+    }
+
+    /**
+     * Merge a ref into this branch.
+     *
+     * @param head
+     *            the ref name that will be merged into this branch. Follows the usual ref naming rules, could be a
+     *            branch name, tag, or commit sha.
+     *
+     * @param commitMessage
+     *            the commit message
+     *
+     * @return the merge {@link GHCommit} created, or {@code null} if the base already contains the head (nothing to
+     *         merge).
+     *
+     * @throws IOException
+     *             if merging fails
+     */
+    @CheckForNull
+    public GHCommit merge(String head, String commitMessage) throws IOException {
+        GHCommit result = root.createRequest()
+                .withUrlPath(owner.getApiTailUrl("merges"))
+                .method("POST")
+                .with("commit_message", commitMessage)
+                .with("base", this.name)
+                .with("head", head)
+                .fetch(GHCommit.class);
+
+        if (result != null) {
+            result.wrapUp(owner);
+        }
+
+        return result;
+    }
+
     String getApiRoute() {
         return owner.getApiTailUrl("/branches/" + name);
     }

src/main/java/org/kohsuke/github/GHBranchProtection.java

@@ -6,23 +6,23 @@ import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
 import java.io.IOException;
 import java.util.Collection;
 
-import static org.kohsuke.github.Previews.ZZZAX;
+import static org.kohsuke.github.internal.Previews.ZZZAX;
 
 /**
  * The type GHBranchProtection.
+ *
+ * @see <a href="https://docs.github.com/en/rest/reference/repos#get-branch-protection">GitHub Branch Protection</a>
  */
 @SuppressFBWarnings(
         value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD",
                 "URF_UNREAD_FIELD" },
         justification = "JSON API")
-public class GHBranchProtection {
+public class GHBranchProtection extends GitHubInteractiveObject {
     private static final String REQUIRE_SIGNATURES_URI = "/required_signatures";
 
     @JsonProperty
     private EnforceAdmins enforceAdmins;
 
-    private GitHub root;
-
     @JsonProperty("required_pull_request_reviews")
     private RequiredReviews requiredReviews;
 
@@ -41,7 +41,7 @@ public class GHBranchProtection {
      * @throws IOException
      *             the io exception
      */
-    @Preview
+    @Preview(ZZZAX)
     @Deprecated
     public void enabledSignedCommits() throws IOException {
         requester().method("POST").withUrlPath(url + REQUIRE_SIGNATURES_URI).fetch(RequiredSignatures.class);
@@ -53,7 +53,7 @@ public class GHBranchProtection {
      * @throws IOException
      *             the io exception
      */
-    @Preview
+    @Preview(ZZZAX)
     @Deprecated
     public void disableSignedCommits() throws IOException {
         requester().method("DELETE").withUrlPath(url + REQUIRE_SIGNATURES_URI).send();
@@ -84,7 +84,7 @@ public class GHBranchProtection {
      * @throws IOException
      *             the io exception
      */
-    @Preview
+    @Preview(ZZZAX)
     @Deprecated
     public boolean getRequiredSignatures() throws IOException {
         return requester().withUrlPath(url + REQUIRE_SIGNATURES_URI).fetch(RequiredSignatures.class).enabled;

src/main/java/org/kohsuke/github/GHBranchProtectionBuilder.java

@@ -12,7 +12,7 @@ import java.util.List;
 import java.util.Map;
 import java.util.Set;
 
-import static org.kohsuke.github.Previews.*;
+import static org.kohsuke.github.internal.Previews.LUKE_CAGE;
 
 /**
  * Builder to configure the branch protection settings.

src/main/java/org/kohsuke/github/GHCheckRun.java

@@ -1,30 +1,52 @@
 package org.kohsuke.github;
 
+import com.fasterxml.jackson.annotation.JsonProperty;
+import com.infradna.tool.bridge_method_injector.WithBridgeMethods;
+import edu.umd.cs.findbugs.annotations.NonNull;
 import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
+import org.kohsuke.github.GHWorkflowRun.Conclusion;
+import org.kohsuke.github.GHWorkflowRun.Status;
+import org.kohsuke.github.internal.EnumUtils;
+import org.kohsuke.github.internal.Previews;
 
 import java.io.IOException;
 import java.net.URL;
+import java.util.Arrays;
+import java.util.Collections;
+import java.util.Date;
+import java.util.List;
+import java.util.Locale;
 
 /**
- * Represents a deployment
+ * Represents a check run.
  *
  * @see <a href="https://developer.github.com/v3/checks/runs/">documentation</a>
  */
-
 @SuppressFBWarnings(value = { "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD", "URF_UNREAD_FIELD" },
         justification = "JSON API")
 public class GHCheckRun extends GHObject {
+
+    @JsonProperty("repository")
     GHRepository owner;
-    GitHub root;
 
     private String status;
     private String conclusion;
     private String name;
+    private String headSha;
+    private String nodeId;
+    private String externalId;
+    private String startedAt;
+    private String completedAt;
+    private URL htmlUrl;
+    private URL detailsUrl;
+    private Output output;
+    private GHApp app;
     private GHPullRequest[] pullRequests;
+    private GHCheckSuite checkSuite;
 
     GHCheckRun wrap(GHRepository owner) {
         this.owner = owner;
-        this.root = owner.root;
+        wrap(owner.root);
         return this;
     }
 
@@ -32,7 +54,24 @@ public class GHCheckRun extends GHObject {
         this.root = root;
         if (owner != null) {
             owner.wrap(root);
+            if (pullRequests != null && pullRequests.length != 0) {
+                for (GHPullRequest singlePull : pullRequests) {
+                    singlePull.wrap(owner);
+                }
+            }
+
         }
+        if (checkSuite != null) {
+            if (owner != null) {
+                checkSuite.wrap(owner);
+            } else {
+                checkSuite.wrap(root);
+            }
+        }
+        if (app != null) {
+            app.wrapUp(root);
+        }
+
         return this;
     }
 
@@ -40,33 +79,264 @@ public class GHCheckRun extends GHObject {
         return pullRequests;
     }
 
-    public String getStatus() {
+    /**
+     * Gets status of the check run.
+     *
+     * @return Status of the check run
+     * @see Status
+     */
+    @WithBridgeMethods(value = String.class, adapterMethod = "statusAsStr")
+    public Status getStatus() {
+        return Status.from(status);
+    }
+
+    @SuppressFBWarnings(value = "UPM_UNCALLED_PRIVATE_METHOD", justification = "Bridge method of getStatus")
+    private Object statusAsStr(Status status, Class type) {
         return status;
     }
 
-    public String getConclusion() {
+    public static enum Status {
+        QUEUED, IN_PROGRESS, COMPLETED, UNKNOWN;
+
+        public static Status from(String value) {
+            return EnumUtils.getNullableEnumOrDefault(Status.class, value, Status.UNKNOWN);
+        }
+
+        @Override
+        public String toString() {
+            return name().toLowerCase(Locale.ROOT);
+        }
+    }
+
+    /**
+     * Gets conclusion of a completed check run.
+     *
+     * @return Status of the check run
+     * @see Conclusion
+     */
+    @WithBridgeMethods(value = String.class, adapterMethod = "conclusionAsStr")
+    public Conclusion getConclusion() {
+        return Conclusion.from(conclusion);
+    }
+
+    @SuppressFBWarnings(value = "UPM_UNCALLED_PRIVATE_METHOD", justification = "Bridge method of getConclusion")
+    private Object conclusionAsStr(Conclusion conclusion, Class type) {
         return conclusion;
     }
 
+    /**
+     * Final conclusion of the check.
+     *
+     * From <a href="https://docs.github.com/en/rest/reference/checks#create-a-check-run--parameters">Check Run
+     * Parameters - <code>conclusion</code></a>.
+     */
+    public static enum Conclusion {
+        ACTION_REQUIRED, CANCELLED, FAILURE, NEUTRAL, SUCCESS, SKIPPED, STALE, TIMED_OUT, UNKNOWN;
+
+        public static Conclusion from(String value) {
+            return EnumUtils.getNullableEnumOrDefault(Conclusion.class, value, Conclusion.UNKNOWN);
+        }
+
+        @Override
+        public String toString() {
+            return name().toLowerCase(Locale.ROOT);
+        }
+    }
+
+    /**
+     * Gets the custom name of this check run.
+     *
+     * @return Name of the check run
+     */
     public String getName() {
         return name;
     }
 
-    GHPullRequest[] getPullRequests() throws IOException {
-        if (pullRequests != null && pullRequests.length != 0) {
-            for (GHPullRequest singlePull : pullRequests) {
-                singlePull.refresh();
-            }
-        }
-        return pullRequests;
+    /**
+     * Gets the HEAD SHA.
+     *
+     * @return sha for the HEAD commit
+     */
+    public String getHeadSha() {
+        return headSha;
     }
 
     /**
-     * @deprecated This object has no HTML URL.
+     * Gets the pull requests participated in this check run.
+     *
+     * Note this field is only populated for events. When getting a {@link GHCheckRun} outside of an event, this is
+     * always empty.
+     *
+     * @return the list of {@link GHPullRequest}s for this check run. Only populated for events.
+     * @throws IOException
+     *             the io exception
+     */
+    public List<GHPullRequest> getPullRequests() throws IOException {
+        if (pullRequests != null && pullRequests.length != 0) {
+            for (GHPullRequest singlePull : pullRequests) {
+                // Only refresh if we haven't do so before
+                singlePull.refresh(singlePull.getTitle());
+            }
+            return Collections.unmodifiableList(Arrays.asList(pullRequests));
+        }
+        return Collections.emptyList();
+    }
+
+    /**
+     * Gets the HTML URL: https://github.com/[owner]/[repo-name]/runs/[check-run-id], usually an GitHub Action page of
+     * the check run.
+     *
+     * @return HTML URL
      */
     @Override
     public URL getHtmlUrl() {
-        return null;
+        return htmlUrl;
+    }
+
+    /**
+     * Gets the global node id to access most objects in GitHub.
+     *
+     * @see <a href="https://developer.github.com/v4/guides/using-global-node-ids/">documentation</a>
+     * @return Global node id
+     */
+    public String getNodeId() {
+        return nodeId;
+    }
+
+    /**
+     * Gets a reference for the check run on the integrator's system.
+     *
+     * @return Reference id
+     */
+    public String getExternalId() {
+        return externalId;
+    }
+
+    /**
+     * Gets the details URL from which to find full details of the check run on the integrator's site.
+     *
+     * @return Details URL
+     */
+    public URL getDetailsUrl() {
+        return detailsUrl;
+    }
+
+    /**
+     * Gets the start time of the check run in ISO 8601 format: YYYY-MM-DDTHH:MM:SSZ.
+     *
+     * @return Timestamp of the start time
+     */
+    public Date getStartedAt() {
+        return GitHubClient.parseDate(startedAt);
+    }
+
+    /**
+     * Gets the completed time of the check run in ISO 8601 format: YYYY-MM-DDTHH:MM:SSZ.
+     *
+     * @return Timestamp of the completed time
+     */
+    public Date getCompletedAt() {
+        return GitHubClient.parseDate(completedAt);
+    }
+
+    /**
+     * Gets the GitHub app this check run belongs to, included in response.
+     *
+     * @return GitHub App
+     */
+    public GHApp getApp() {
+        return app;
+    }
+
+    /**
+     * Gets the check suite this check run belongs to
+     *
+     * @return Check suite
+     */
+    public GHCheckSuite getCheckSuite() {
+        return checkSuite;
+    }
+
+    /**
+     * Gets an output for a check run.
+     *
+     * @return Output of a check run
+     */
+    public Output getOutput() {
+        return output;
+    }
+
+    /**
+     * Represents an output in a check run to include summary and other results.
+     *
+     * @see <a href="https://developer.github.com/v3/checks/runs/#output-object">documentation</a>
+     */
+    public static class Output {
+        private String title;
+        private String summary;
+        private String text;
+        private int annotationsCount;
+        private URL annotationsUrl;
+
+        /**
+         * Gets the title of check run.
+         *
+         * @return title of check run
+         */
+        public String getTitle() {
+            return title;
+        }
+
+        /**
+         * Gets the summary of the check run, note that it supports Markdown.
+         *
+         * @return summary of check run
+         */
+        public String getSummary() {
+            return summary;
+        }
+
+        /**
+         * Gets the details of the check run, note that it supports Markdown.
+         *
+         * @return Details of the check run
+         */
+        public String getText() {
+            return text;
+        }
+
+        /**
+         * Gets the annotation count of a check run.
+         *
+         * @return annotation count of a check run
+         */
+        public int getAnnotationsCount() {
+            return annotationsCount;
+        }
+
+        /**
+         * Gets the URL of annotations.
+         *
+         * @return URL of annotations
+         */
+        public URL getAnnotationsUrl() {
+            return annotationsUrl;
+        }
+    }
+
+    public static enum AnnotationLevel {
+        NOTICE, WARNING, FAILURE
+    }
+
+    /**
+     * Updates this check run.
+     *
+     * @return a builder which you should customize, then call {@link GHCheckRunBuilder#create}
+     */
+    @Preview(Previews.ANTIOPE)
+    @Deprecated
+    public @NonNull GHCheckRunBuilder update() {
+        return new GHCheckRunBuilder(owner, getId());
     }
 
 }

src/main/java/org/kohsuke/github/GHCheckRunBuilder.java

@@ -0,0 +1,307 @@
+/*
+ * The MIT License
+ *
+ * Copyright 2020 CloudBees, Inc.
+ *
+ * Permission is hereby granted, free of charge, to any person obtaining a copy
+ * of this software and associated documentation files (the "Software"), to deal
+ * in the Software without restriction, including without limitation the rights
+ * to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
+ * copies of the Software, and to permit persons to whom the Software is
+ * furnished to do so, subject to the following conditions:
+ *
+ * The above copyright notice and this permission notice shall be included in
+ * all copies or substantial portions of the Software.
+ *
+ * THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
+ * IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
+ * FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
+ * AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
+ * LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
+ * OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
+ * THE SOFTWARE.
+ */
+
+package org.kohsuke.github;
+
+import com.fasterxml.jackson.annotation.JsonInclude;
+import edu.umd.cs.findbugs.annotations.CheckForNull;
+import edu.umd.cs.findbugs.annotations.NonNull;
+import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
+import org.kohsuke.github.internal.Previews;
+
+import java.io.IOException;
+import java.util.Collections;
+import java.util.Date;
+import java.util.LinkedList;
+import java.util.List;
+import java.util.Locale;
+
+/**
+ * Drafts or updates a check run.
+ *
+ * @see GHCheckRun
+ * @see GHRepository#createCheckRun
+ * @see <a href="https://developer.github.com/v3/checks/runs/#create-a-check-run">documentation</a>
+ * @see GHCheckRun#update()
+ * @see <a href="https://developer.github.com/v3/checks/runs/#update-a-check-run">documentation</a>
+ */
+@SuppressFBWarnings(value = "URF_UNREAD_FIELD", justification = "Jackson serializes these even without a getter")
+@Preview(Previews.ANTIOPE)
+@Deprecated
+public final class GHCheckRunBuilder {
+
+    protected final GHRepository repo;
+    protected final Requester requester;
+    private Output output;
+    private List<Action> actions;
+
+    private GHCheckRunBuilder(GHRepository repo, Requester requester) {
+        this.repo = repo;
+        this.requester = requester;
+    }
+
+    GHCheckRunBuilder(GHRepository repo, String name, String headSHA) {
+        this(repo,
+                repo.root.createRequest()
+                        .withPreview(Previews.ANTIOPE)
+                        .method("POST")
+                        .with("name", name)
+                        .with("head_sha", headSHA)
+                        .withUrlPath(repo.getApiTailUrl("check-runs")));
+    }
+
+    GHCheckRunBuilder(GHRepository repo, long checkId) {
+        this(repo,
+                repo.root.createRequest()
+                        .withPreview(Previews.ANTIOPE)
+                        .method("PATCH")
+                        .withUrlPath(repo.getApiTailUrl("check-runs/" + checkId)));
+    }
+
+    public @NonNull GHCheckRunBuilder withDetailsURL(@CheckForNull String detailsURL) {
+        requester.with("details_url", detailsURL);
+        return this;
+    }
+
+    public @NonNull GHCheckRunBuilder withExternalID(@CheckForNull String externalID) {
+        requester.with("external_id", externalID);
+        return this;
+    }
+
+    public @NonNull GHCheckRunBuilder withStatus(@CheckForNull GHCheckRun.Status status) {
+        if (status != null) {
+            // Do *not* use the overload taking Enum, as that s/_/-/g which would be wrong here.
+            requester.with("status", status.toString().toLowerCase(Locale.ROOT));
+        }
+        return this;
+    }
+
+    public @NonNull GHCheckRunBuilder withConclusion(@CheckForNull GHCheckRun.Conclusion conclusion) {
+        if (conclusion != null) {
+            requester.with("conclusion", conclusion.toString().toLowerCase(Locale.ROOT));
+        }
+        return this;
+    }
+
+    public @NonNull GHCheckRunBuilder withStartedAt(@CheckForNull Date startedAt) {
+        if (startedAt != null) {
+            requester.with("started_at", GitHubClient.printDate(startedAt));
+        }
+        return this;
+    }
+
+    public @NonNull GHCheckRunBuilder withCompletedAt(@CheckForNull Date completedAt) {
+        if (completedAt != null) {
+            requester.with("completed_at", GitHubClient.printDate(completedAt));
+        }
+        return this;
+    }
+
+    public @NonNull GHCheckRunBuilder add(@NonNull Output output) {
+        if (this.output != null) {
+            throw new IllegalStateException("cannot add Output twice");
+        }
+        this.output = output;
+        return this;
+    }
+
+    public @NonNull GHCheckRunBuilder add(@NonNull Action action) {
+        if (actions == null) {
+            actions = new LinkedList<>();
+        }
+        actions.add(action);
+        return this;
+    }
+
+    private static final int MAX_ANNOTATIONS = 50;
+    /**
+     * Actually creates the check run. (If more than fifty annotations were requested, this is done in batches.)
+     *
+     * @return the resulting run
+     * @throws IOException
+     *             for the usual reasons
+     */
+    public @NonNull GHCheckRun create() throws IOException {
+        List<Annotation> extraAnnotations;
+        if (output != null && output.annotations != null && output.annotations.size() > MAX_ANNOTATIONS) {
+            extraAnnotations = output.annotations.subList(MAX_ANNOTATIONS, output.annotations.size());
+            output.annotations = output.annotations.subList(0, MAX_ANNOTATIONS);
+        } else {
+            extraAnnotations = Collections.emptyList();
+        }
+        GHCheckRun run = requester.with("output", output).with("actions", actions).fetch(GHCheckRun.class).wrap(repo);
+        while (!extraAnnotations.isEmpty()) {
+            Output output2 = new Output(output.title, output.summary).withText(output.text);
+            int i = Math.min(extraAnnotations.size(), MAX_ANNOTATIONS);
+            output2.annotations = extraAnnotations.subList(0, i);
+            extraAnnotations = extraAnnotations.subList(i, extraAnnotations.size());
+            run = repo.root.createRequest()
+                    .withPreview(Previews.ANTIOPE)
+                    .method("PATCH")
+                    .with("output", output2)
+                    .withUrlPath(repo.getApiTailUrl("check-runs/" + run.getId()))
+                    .fetch(GHCheckRun.class)
+                    .wrap(repo);
+        }
+        return run;
+    }
+
+    /**
+     * @see <a href="https://developer.github.com/v3/checks/runs/#output-object">documentation</a>
+     */
+    @JsonInclude(JsonInclude.Include.NON_NULL)
+    public static final class Output {
+
+        private final String title;
+        private final String summary;
+        private String text;
+        private List<Annotation> annotations;
+        private List<Image> images;
+
+        public Output(@NonNull String title, @NonNull String summary) {
+            this.title = title;
+            this.summary = summary;
+        }
+
+        public @NonNull Output withText(@CheckForNull String text) {
+            this.text = text;
+            return this;
+        }
+
+        public @NonNull Output add(@NonNull Annotation annotation) {
+            if (annotations == null) {
+                annotations = new LinkedList<>();
+            }
+            annotations.add(annotation);
+            return this;
+        }
+
+        public @NonNull Output add(@NonNull Image image) {
+            if (images == null) {
+                images = new LinkedList<>();
+            }
+            images.add(image);
+            return this;
+        }
+
+    }
+
+    /**
+     * @see <a href="https://developer.github.com/v3/checks/runs/#annotations-object">documentation</a>
+     */
+    @JsonInclude(JsonInclude.Include.NON_NULL)
+    public static final class Annotation {
+
+        private final String path;
+        private final int start_line;
+        private final int end_line;
+        private final String annotation_level;
+        private final String message;
+        private Integer start_column;
+        private Integer end_column;
+        private String title;
+        private String raw_details;
+
+        public Annotation(@NonNull String path,
+                int line,
+                @NonNull GHCheckRun.AnnotationLevel annotationLevel,
+                @NonNull String message) {
+            this(path, line, line, annotationLevel, message);
+        }
+
+        public Annotation(@NonNull String path,
+                int startLine,
+                int endLine,
+                @NonNull GHCheckRun.AnnotationLevel annotationLevel,
+                @NonNull String message) {
+            this.path = path;
+            start_line = startLine;
+            end_line = endLine;
+            annotation_level = annotationLevel.toString().toLowerCase(Locale.ROOT);
+            this.message = message;
+        }
+
+        public @NonNull Annotation withStartColumn(@CheckForNull Integer startColumn) {
+            start_column = startColumn;
+            return this;
+        }
+
+        public @NonNull Annotation withEndColumn(@CheckForNull Integer endColumn) {
+            end_column = endColumn;
+            return this;
+        }
+
+        public @NonNull Annotation withTitle(@CheckForNull String title) {
+            this.title = title;
+            return this;
+        }
+
+        public @NonNull Annotation withRawDetails(@CheckForNull String rawDetails) {
+            raw_details = rawDetails;
+            return this;
+        }
+
+    }
+
+    /**
+     * @see <a href="https://developer.github.com/v3/checks/runs/#images-object">documentation</a>
+     */
+    @JsonInclude(JsonInclude.Include.NON_NULL)
+    public static final class Image {
+
+        private final String alt;
+        private final String image_url;
+        private String caption;
+
+        public Image(@NonNull String alt, @NonNull String imageURL) {
+            this.alt = alt;
+            image_url = imageURL;
+        }
+
+        public @NonNull Image withCaption(@CheckForNull String caption) {
+            this.caption = caption;
+            return this;
+        }
+
+    }
+
+    /**
+     * @see <a href="https://developer.github.com/v3/checks/runs/#actions-object">documentation</a>
+     */
+    @JsonInclude(JsonInclude.Include.NON_NULL)
+    public static final class Action {
+
+        private final String label;
+        private final String description;
+        private final String identifier;
+
+        public Action(@NonNull String label, @NonNull String description, @NonNull String identifier) {
+            this.label = label;
+            this.description = description;
+            this.identifier = identifier;
+        }
+
+    }
+
+}

src/main/java/org/kohsuke/github/GHCheckRunsIterable.java

@@ -0,0 +1,44 @@
+package org.kohsuke.github;
+
+import java.util.Iterator;
+
+import javax.annotation.Nonnull;
+
+/**
+ * Iterable for check-runs listing.
+ */
+class GHCheckRunsIterable extends PagedIterable<GHCheckRun> {
+    private final transient GitHub root;
+    private final GitHubRequest request;
+
+    private GHCheckRunsPage result;
+
+    public GHCheckRunsIterable(GitHub root, GitHubRequest request) {
+        this.root = root;
+        this.request = request;
+    }
+
+    @Nonnull
+    @Override
+    public PagedIterator<GHCheckRun> _iterator(int pageSize) {
+        return new PagedIterator<>(
+                adapt(GitHubPageIterator.create(root.getClient(), GHCheckRunsPage.class, request, pageSize)),
+                null);
+    }
+
+    protected Iterator<GHCheckRun[]> adapt(final Iterator<GHCheckRunsPage> base) {
+        return new Iterator<GHCheckRun[]>() {
+            public boolean hasNext() {
+                return base.hasNext();
+            }
+
+            public GHCheckRun[] next() {
+                GHCheckRunsPage v = base.next();
+                if (result == null) {
+                    result = v;
+                }
+                return v.getCheckRuns(root);
+            }
+        };
+    }
+}

src/main/java/org/kohsuke/github/GHCheckRunsPage.java

@@ -0,0 +1,20 @@
+package org.kohsuke.github;
+
+/**
+ * Represents the one page of check-runs result when listing check-runs.
+ */
+class GHCheckRunsPage {
+    private int total_count;
+    private GHCheckRun[] check_runs;
+
+    public int getTotalCount() {
+        return total_count;
+    }
+
+    GHCheckRun[] getCheckRuns(GitHub root) {
+        for (GHCheckRun check_run : check_runs) {
+            check_run.wrap(root);
+        }
+        return check_runs;
+    }
+}

src/main/java/org/kohsuke/github/GHCheckSuite.java

@@ -0,0 +1,259 @@
+package org.kohsuke.github;
+
+import com.fasterxml.jackson.annotation.JsonProperty;
+import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
+
+import java.io.IOException;
+import java.net.URL;
+import java.util.Arrays;
+import java.util.Collections;
+import java.util.Date;
+import java.util.List;
+
+/**
+ * Represents a check suite.
+ *
+ * @see <a href="https://developer.github.com/v3/checks/suites/">documentation</a>
+ */
+@SuppressFBWarnings(value = { "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD", "URF_UNREAD_FIELD" },
+        justification = "JSON API")
+public class GHCheckSuite extends GHObject {
+
+    @JsonProperty("repository")
+    GHRepository owner;
+
+    private String nodeId;
+    private String headBranch;
+    private String headSha;
+    private String status;
+    private String conclusion;
+    private String before;
+    private String after;
+    private int latestCheckRunsCount;
+    private URL checkRunsUrl;
+    private HeadCommit headCommit;
+    private GHApp app;
+    private GHPullRequest[] pullRequests;
+
+    GHCheckSuite wrap(GHRepository owner) {
+        this.owner = owner;
+        this.wrap(owner.root);
+        return this;
+    }
+
+    GHCheckSuite wrap(GitHub root) {
+        this.root = root;
+        if (owner != null) {
+            owner.wrap(root);
+            if (pullRequests != null && pullRequests.length != 0) {
+                for (GHPullRequest singlePull : pullRequests) {
+                    singlePull.wrap(owner);
+                }
+            }
+        }
+        if (app != null) {
+            app.wrapUp(root);
+        }
+        return this;
+    }
+
+    GHPullRequest[] wrap() {
+        return pullRequests;
+    }
+
+    /**
+     * Gets the global node id to access most objects in GitHub.
+     *
+     * @see <a href="https://developer.github.com/v4/guides/using-global-node-ids/">documentation</a>
+     * @return global node id
+     */
+    public String getNodeId() {
+        return nodeId;
+    }
+
+    /**
+     * The head branch name the changes are on.
+     *
+     * @return head branch name
+     */
+    public String getHeadBranch() {
+        return headBranch;
+    }
+
+    /**
+     * Gets the HEAD SHA.
+     *
+     * @return sha for the HEAD commit
+     */
+    public String getHeadSha() {
+        return headSha;
+    }
+
+    /**
+     * Gets status of the check suite. It can be one of request, in_progress, or completed.
+     *
+     * @return status of the check suite
+     */
+    public String getStatus() {
+        return status;
+    }
+
+    /**
+     * Gets conclusion of a completed check suite. It can be one of success, failure, neutral, cancelled, time_out,
+     * action_required, or stale. The check suite will report the highest priority check run conclusion in the check
+     * suite's conclusion.
+     *
+     * @return conclusion of the check suite
+     */
+    public String getConclusion() {
+        return conclusion;
+    }
+
+    /**
+     * The SHA of the most recent commit on ref before the push.
+     *
+     * @return sha of a commit
+     */
+    public String getBefore() {
+        return before;
+    }
+
+    /**
+     * The SHA of the most recent commit on ref after the push.
+     *
+     * @return sha of a commit
+     */
+    public String getAfter() {
+        return after;
+    }
+
+    /**
+     * The quantity of check runs that had run as part of the latest push.
+     *
+     * @return sha of the most recent commit
+     */
+    public int getLatestCheckRunsCount() {
+        return latestCheckRunsCount;
+    }
+
+    /**
+     * The url used to list all the check runs belonged to this suite.
+     *
+     * @return url containing all check runs
+     */
+    public URL getCheckRunsUrl() {
+        return checkRunsUrl;
+    }
+
+    /**
+     * The commit of current head.
+     *
+     * @return head commit
+     */
+    public HeadCommit getHeadCommit() {
+        return headCommit;
+    }
+
+    /**
+     * Gets the GitHub app this check suite belongs to, included in response.
+     *
+     * @return GitHub App
+     */
+    public GHApp getApp() {
+        return app;
+    }
+
+    /**
+     * Gets the pull requests participated in this check suite.
+     *
+     * Note this field is only populated for events. When getting a {@link GHCheckSuite} outside of an event, this is
+     * always empty.
+     *
+     * @return the list of {@link GHPullRequest}s for this check suite. Only populated for events.
+     * @throws IOException
+     *             the io exception
+     */
+    public List<GHPullRequest> getPullRequests() throws IOException {
+        if (pullRequests != null && pullRequests.length != 0) {
+            for (GHPullRequest singlePull : pullRequests) {
+                // Only refresh if we haven't do so before
+                singlePull.refresh(singlePull.getTitle());
+            }
+            return Collections.unmodifiableList(Arrays.asList(pullRequests));
+        }
+        return Collections.emptyList();
+    }
+
+    /**
+     * Check suite doesn't have a HTML URL.
+     *
+     * @return null
+     */
+    @Override
+    public URL getHtmlUrl() {
+        return null;
+    }
+
+    public static class HeadCommit {
+        private String id;
+        private String treeId;
+        private String message;
+        private String timestamp;
+        private GitUser author;
+        private GitUser committer;
+
+        /**
+         * Gets id of the commit, used by {@link GHCheckSuite} when a {@link GHEvent#CHECK_SUITE} comes
+         *
+         * @return id of the commit
+         */
+        public String getId() {
+            return id;
+        }
+
+        /**
+         * Gets id of the tree.
+         *
+         * @return id of the tree
+         */
+        public String getTreeId() {
+            return treeId;
+        }
+
+        /**
+         * Gets message.
+         *
+         * @return commit message.
+         */
+        public String getMessage() {
+            return message;
+        }
+
+        /**
+         * Gets timestamp of the commit.
+         *
+         * @return timestamp of the commit
+         */
+        public Date getTimestamp() {
+            return GitHubClient.parseDate(timestamp);
+        }
+
+        /**
+         * Gets author.
+         *
+         * @return the author
+         */
+        public GitUser getAuthor() {
+            return author;
+        }
+
+        /**
+         * Gets committer.
+         *
+         * @return the committer
+         */
+        public GitUser getCommitter() {
+            return committer;
+        }
+    }
+}

src/main/java/org/kohsuke/github/GHCommit.java

@@ -11,6 +11,9 @@ import java.util.Collections;
 import java.util.Date;
 import java.util.List;
 
+import static org.kohsuke.github.internal.Previews.ANTIOPE;
+import static org.kohsuke.github.internal.Previews.GROOT;
+
 /**
  * A commit in a repository.
  *
@@ -39,6 +42,8 @@ public class GHCommit {
 
         private int comment_count;
 
+        private GHVerification verification;
+
         static class Tree {
             String sha;
         }
@@ -61,7 +66,7 @@ public class GHCommit {
          * @return the authored date
          */
         public Date getAuthoredDate() {
-            return GitHub.parseDate(author.date);
+            return author.getDate();
         }
 
         /**
@@ -80,7 +85,7 @@ public class GHCommit {
          * @return the commit date
          */
         public Date getCommitDate() {
-            return GitHub.parseDate(committer.date);
+            return committer.getDate();
         }
 
         /**
@@ -100,6 +105,15 @@ public class GHCommit {
         public int getCommentCount() {
             return comment_count;
         }
+
+        /**
+         * Gets Verification Status.
+         *
+         * @return the Verification status
+         */
+        public GHVerification getVerification() {
+            return verification;
+        }
     }
 
     /**
@@ -108,7 +122,6 @@ public class GHCommit {
      * @deprecated Use {@link GitUser} instead.
      */
     public static class GHAuthor extends GitUser {
-        private String date;
     }
 
     /**
@@ -201,7 +214,7 @@ public class GHCommit {
          *         resolves to the actual content of the file.
          */
         public URL getRawUrl() {
-            return GitHub.parseURL(raw_url);
+            return GitHubClient.parseURL(raw_url);
         }
 
         /**
@@ -212,7 +225,7 @@ public class GHCommit {
          *         that resolves to the HTML page that describes this file.
          */
         public URL getBlobUrl() {
-            return GitHub.parseURL(blob_url);
+            return GitHubClient.parseURL(blob_url);
         }
 
         /**
@@ -326,7 +339,7 @@ public class GHCommit {
      *         "https://github.com/kohsuke/sandbox-ant/commit/8ae38db0ea5837313ab5f39d43a6f73de3bd9000"
      */
     public URL getHtmlUrl() {
-        return GitHub.parseURL(html_url);
+        return GitHubClient.parseURL(html_url);
     }
 
     /**
@@ -435,6 +448,39 @@ public class GHCommit {
         return owner.root.getUser(author.login);
     }
 
+    /**
+     * Retrieves a list of pull requests which contain this commit.
+     *
+     * @return {@link PagedIterable} with the pull requests which contain this commit
+     */
+    @Preview(GROOT)
+    @Deprecated
+    public PagedIterable<GHPullRequest> listPullRequests() {
+        return owner.root.createRequest()
+                .withPreview(GROOT)
+                .withUrlPath(String.format("/repos/%s/%s/commits/%s/pulls", owner.getOwnerName(), owner.getName(), sha))
+                .toIterable(GHPullRequest[].class, item -> item.wrapUp(owner));
+    }
+
+    /**
+     * Retrieves a list of branches where this commit is the head commit.
+     *
+     * @return {@link PagedIterable} with the branches where the commit is the head commit
+     * @throws IOException
+     *             the io exception
+     */
+    @Preview(GROOT)
+    @Deprecated
+    public PagedIterable<GHBranch> listBranchesWhereHead() throws IOException {
+        return owner.root.createRequest()
+                .withPreview(GROOT)
+                .withUrlPath(String.format("/repos/%s/%s/commits/%s/branches-where-head",
+                        owner.getOwnerName(),
+                        owner.getName(),
+                        sha))
+                .toIterable(GHBranch[].class, item -> item.wrap(owner));
+    }
+
     /**
      * List comments paged iterable.
      *
@@ -512,9 +558,22 @@ public class GHCommit {
         return owner.getLastCommitStatus(sha);
     }
 
+    /**
+     * Gets check-runs for given sha.
+     *
+     * @return check runs for given sha.
+     * @throws IOException
+     *             on error
+     */
+    @Preview(ANTIOPE)
+    @Deprecated
+    public PagedIterable<GHCheckRun> getCheckRuns() throws IOException {
+        return owner.getCheckRuns(sha);
+    }
+
     /**
      * Some of the fields are not always filled in when this object is retrieved as a part of another API call.
-     * 
+     *
      * @throws IOException
      *             on error
      */

src/main/java/org/kohsuke/github/GHCommitBuilder.java

@@ -89,6 +89,19 @@ public class GHCommitBuilder {
         return this;
     }
 
+    /**
+     * Configures the PGP signature of this commit.
+     *
+     * @param signature
+     *            the signature calculated from the commit
+     *
+     * @return the gh commit builder
+     */
+    public GHCommitBuilder withSignature(String signature) {
+        req.with("signature", signature);
+        return this;
+    }
+
     /**
      * Configures the committer of this commit.
      *

src/main/java/org/kohsuke/github/GHCommitComment.java

@@ -5,7 +5,7 @@ import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
 import java.io.IOException;
 import java.net.URL;
 
-import static org.kohsuke.github.Previews.*;
+import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
 
 /**
  * A comment attached to a commit (or a specific line in a specific file of a commit.)
@@ -41,7 +41,7 @@ public class GHCommitComment extends GHObject implements Reactable {
      * show this commit comment in a browser.
      */
     public URL getHtmlUrl() {
-        return GitHub.parseURL(html_url);
+        return GitHubClient.parseURL(html_url);
     }
 
     /**
@@ -121,7 +121,7 @@ public class GHCommitComment extends GHObject implements Reactable {
         this.body = body;
     }
 
-    @Preview
+    @Preview(SQUIRREL_GIRL)
     @Deprecated
     public GHReaction createReaction(ReactionContent content) throws IOException {
         return owner.root.createRequest()
@@ -133,7 +133,7 @@ public class GHCommitComment extends GHObject implements Reactable {
                 .wrap(owner.root);
     }
 
-    @Preview
+    @Preview(SQUIRREL_GIRL)
     @Deprecated
     public PagedIterable<GHReaction> listReactions() {
         return owner.root.createRequest()
@@ -153,7 +153,7 @@ public class GHCommitComment extends GHObject implements Reactable {
     }
 
     private String getApiTail() {
-        return String.format("/repos/%s/%s/comments/%s", owner.getOwnerName(), owner.getName(), id);
+        return String.format("/repos/%s/%s/comments/%s", owner.getOwnerName(), owner.getName(), getId());
     }
 
     GHCommitComment wrap(GHRepository owner) {

src/main/java/org/kohsuke/github/GHCommitQueryBuilder.java

@@ -83,7 +83,7 @@ public class GHCommitQueryBuilder {
      * @return the gh commit query builder
      */
     public GHCommitQueryBuilder since(Date dt) {
-        req.with("since", GitHub.printDate(dt));
+        req.with("since", GitHubClient.printDate(dt));
         return this;
     }
 
@@ -106,7 +106,7 @@ public class GHCommitQueryBuilder {
      * @return the gh commit query builder
      */
     public GHCommitQueryBuilder until(Date dt) {
-        req.with("until", GitHub.printDate(dt));
+        req.with("until", GitHubClient.printDate(dt));
         return this;
     }
 

src/main/java/org/kohsuke/github/GHCommitSearchBuilder.java

@@ -1,6 +1,7 @@
 package org.kohsuke.github;
 
 import org.apache.commons.lang3.StringUtils;
+import org.kohsuke.github.internal.Previews;
 
 import java.io.IOException;
 
@@ -10,7 +11,7 @@ import java.io.IOException;
  * @author Marc de Verdelhan
  * @see GitHub#searchCommits() GitHub#searchCommits()
  */
-@Preview
+@Preview(Previews.CLOAK)
 @Deprecated
 public class GHCommitSearchBuilder extends GHSearchBuilder<GHCommit> {
     GHCommitSearchBuilder(GitHub root) {
@@ -259,7 +260,7 @@ public class GHCommitSearchBuilder extends GHSearchBuilder<GHCommit> {
         if (StringUtils.isBlank(commitUrl)) {
             return null;
         }
-        int indexOfUsername = (GitHub.GITHUB_URL + "/repos/").length();
+        int indexOfUsername = (GitHubClient.GITHUB_URL + "/repos/").length();
         String[] tokens = commitUrl.substring(indexOfUsername).split("/", 3);
         return tokens[0] + '/' + tokens[1];
     }

src/main/java/org/kohsuke/github/GHCommitStatus.java

@@ -18,8 +18,6 @@ public class GHCommitStatus extends GHObject {
     String context;
     GHUser creator;
 
-    private GitHub root;
-
     GHCommitStatus wrapUp(GitHub root) {
         if (creator != null)
             creator.wrapUp(root);

src/main/java/org/kohsuke/github/GHCompare.java

@@ -27,7 +27,7 @@ public class GHCompare {
      * @return the url
      */
     public URL getUrl() {
-        return GitHub.parseURL(url);
+        return GitHubClient.parseURL(url);
     }
 
     /**
@@ -36,7 +36,7 @@ public class GHCompare {
      * @return the html url
      */
     public URL getHtmlUrl() {
-        return GitHub.parseURL(html_url);
+        return GitHubClient.parseURL(html_url);
     }
 
     /**
@@ -45,7 +45,7 @@ public class GHCompare {
      * @return the permalink url
      */
     public URL getPermalinkUrl() {
-        return GitHub.parseURL(permalink_url);
+        return GitHubClient.parseURL(permalink_url);
     }
 
     /**
@@ -54,7 +54,7 @@ public class GHCompare {
      * @return the diff url
      */
     public URL getDiffUrl() {
-        return GitHub.parseURL(diff_url);
+        return GitHubClient.parseURL(diff_url);
     }
 
     /**
@@ -63,7 +63,7 @@ public class GHCompare {
      * @return the patch url
      */
     public URL getPatchUrl() {
-        return GitHub.parseURL(patch_url);
+        return GitHubClient.parseURL(patch_url);
     }
 
     /**

src/main/java/org/kohsuke/github/GHContent.java

@@ -15,21 +15,20 @@ import java.util.Base64;
  * @see GHRepository#getFileContent(String) GHRepository#getFileContent(String)
  */
 @SuppressWarnings({ "UnusedDeclaration" })
-public class GHContent implements Refreshable {
+public class GHContent extends GitHubInteractiveObject implements Refreshable {
     /*
      * In normal use of this class, repository field is set via wrap(), but in the code search API, there's a nested
      * 'repository' field that gets populated from JSON.
      */
     private GHRepository repository;
 
-    private GitHub root;
-
     private String type;
     private String encoding;
     private long size;
     private String sha;
     private String name;
     private String path;
+    private String target;
     private String content;
     private String url; // this is the API url
     private String git_url; // this is the Blob url
@@ -99,6 +98,15 @@ public class GHContent implements Refreshable {
         return path;
     }
 
+    /**
+     * Gets target of a symlink. This will only be set if {@code "symlink".equals(getType())}
+     *
+     * @return the target
+     */
+    public String getTarget() {
+        return target;
+    }
+
     /**
      * Retrieve the decoded content that is stored at this location.
      *
@@ -388,22 +396,6 @@ public class GHContent implements Refreshable {
         return this;
     }
 
-    /**
-     * Wrap gh content [ ].
-     *
-     * @param contents
-     *            the contents
-     * @param repository
-     *            the repository
-     * @return the gh content [ ]
-     */
-    public static GHContent[] wrap(GHContent[] contents, GHRepository repository) {
-        for (GHContent unwrappedContent : contents) {
-            unwrappedContent.wrap(repository);
-        }
-        return contents;
-    }
-
     /**
      * Fully populate the data by retrieving missing data.
      *

src/main/java/org/kohsuke/github/GHCreateRepositoryBuilder.java

@@ -1,154 +1,25 @@
 package org.kohsuke.github;
 
 import java.io.IOException;
-import java.net.URL;
+
+import static org.kohsuke.github.internal.Previews.BAPTISTE;
 
 /**
  * Creates a repository
  *
  * @author Kohsuke Kawaguchi
  */
-public class GHCreateRepositoryBuilder {
-    private final GitHub root;
-    protected final Requester builder;
-    private final String apiUrlTail;
+public class GHCreateRepositoryBuilder extends GHRepositoryBuilder<GHCreateRepositoryBuilder> {
 
-    GHCreateRepositoryBuilder(GitHub root, String apiUrlTail, String name) {
-        this.root = root;
-        this.apiUrlTail = apiUrlTail;
-        this.builder = root.createRequest();
-        this.builder.with("name", name);
-    }
+    public GHCreateRepositoryBuilder(String name, GitHub root, String apiTail) {
+        super(GHCreateRepositoryBuilder.class, root, null);
+        requester.method("POST").withUrlPath(apiTail);
 
-    /**
-     * Description for repository
-     *
-     * @param description
-     *            description of repository
-     * @return a builder to continue with building
-     */
-    public GHCreateRepositoryBuilder description(String description) {
-        this.builder.with("description", description);
-        return this;
-    }
-
-    /**
-     * Homepage for repository
-     *
-     * @param homepage
-     *            homepage of repository
-     * @return a builder to continue with building
-     */
-    public GHCreateRepositoryBuilder homepage(URL homepage) {
-        return homepage(homepage.toExternalForm());
-    }
-
-    /**
-     * Homepage for repository
-     *
-     * @param homepage
-     *            homepage of repository
-     * @return a builder to continue with building
-     */
-    public GHCreateRepositoryBuilder homepage(String homepage) {
-        this.builder.with("homepage", homepage);
-        return this;
-    }
-
-    /**
-     * Creates a private repository
-     *
-     * @param enabled
-     *            private if true
-     * @return a builder to continue with building
-     */
-    public GHCreateRepositoryBuilder private_(boolean enabled) {
-        this.builder.with("private", enabled);
-        return this;
-    }
-
-    /**
-     * Enables issue tracker
-     *
-     * @param enabled
-     *            true if enabled
-     * @return a builder to continue with building
-     */
-    public GHCreateRepositoryBuilder issues(boolean enabled) {
-        this.builder.with("has_issues", enabled);
-        return this;
-    }
-
-    /**
-     * Enables wiki
-     *
-     * @param enabled
-     *            true if enabled
-     * @return a builder to continue with building
-     */
-    public GHCreateRepositoryBuilder wiki(boolean enabled) {
-        this.builder.with("has_wiki", enabled);
-        return this;
-    }
-
-    /**
-     * Enables downloads
-     *
-     * @param enabled
-     *            true if enabled
-     * @return a builder to continue with building
-     */
-    public GHCreateRepositoryBuilder downloads(boolean enabled) {
-        this.builder.with("has_downloads", enabled);
-        return this;
-    }
-
-    /**
-     * If true, create an initial commit with empty README.
-     *
-     * @param enabled
-     *            true if enabled
-     * @return a builder to continue with building
-     */
-    public GHCreateRepositoryBuilder autoInit(boolean enabled) {
-        this.builder.with("auto_init", enabled);
-        return this;
-    }
-
-    /**
-     * Allow or disallow squash-merging pull requests.
-     *
-     * @param enabled
-     *            true if enabled
-     * @return a builder to continue with building
-     */
-    public GHCreateRepositoryBuilder allowSquashMerge(boolean enabled) {
-        this.builder.with("allow_squash_merge", enabled);
-        return this;
-    }
-
-    /**
-     * Allow or disallow merging pull requests with a merge commit.
-     *
-     * @param enabled
-     *            true if enabled
-     * @return a builder to continue with building
-     */
-    public GHCreateRepositoryBuilder allowMergeCommit(boolean enabled) {
-        this.builder.with("allow_merge_commit", enabled);
-        return this;
-    }
-
-    /**
-     * Allow or disallow rebase-merging pull requests.
-     *
-     * @param enabled
-     *            true if enabled
-     * @return a builder to continue with building
-     */
-    public GHCreateRepositoryBuilder allowRebaseMerge(boolean enabled) {
-        this.builder.with("allow_rebase_merge", enabled);
-        return this;
+        try {
+            name(name);
+        } catch (IOException e) {
+            // not going to happen here
+        }
     }
 
     /**
@@ -157,10 +28,11 @@ public class GHCreateRepositoryBuilder {
      * @param language
      *            template to base the ignore file on
      * @return a builder to continue with building See https://developer.github.com/v3/repos/#create
+     * @throws IOException
+     *             In case of any networking error or error from the server.
      */
-    public GHCreateRepositoryBuilder gitignoreTemplate(String language) {
-        this.builder.with("gitignore_template", language);
-        return this;
+    public GHCreateRepositoryBuilder gitignoreTemplate(String language) throws IOException {
+        return with("gitignore_template", language);
     }
 
     /**
@@ -169,10 +41,24 @@ public class GHCreateRepositoryBuilder {
      * @param license
      *            template to base the license file on
      * @return a builder to continue with building See https://developer.github.com/v3/repos/#create
+     * @throws IOException
+     *             In case of any networking error or error from the server.
      */
-    public GHCreateRepositoryBuilder licenseTemplate(String license) {
-        this.builder.with("license_template", license);
-        return this;
+    public GHCreateRepositoryBuilder licenseTemplate(String license) throws IOException {
+        return with("license_template", license);
+    }
+
+    /**
+     * If true, create an initial commit with empty README.
+     *
+     * @param enabled
+     *            true if enabled
+     * @return a builder to continue with building
+     * @throws IOException
+     *             In case of any networking error or error from the server.
+     */
+    public GHCreateRepositoryBuilder autoInit(boolean enabled) throws IOException {
+        return with("auto_init", enabled);
     }
 
     /**
@@ -181,10 +67,57 @@ public class GHCreateRepositoryBuilder {
      * @param team
      *            team to grant access to
      * @return a builder to continue with building
+     * @throws IOException
+     *             In case of any networking error or error from the server.
      */
-    public GHCreateRepositoryBuilder team(GHTeam team) {
+    public GHCreateRepositoryBuilder team(GHTeam team) throws IOException {
         if (team != null)
-            this.builder.with("team_id", team.getId());
+            return with("team_id", team.getId());
+        return this;
+    }
+
+    /**
+     * Specifies whether the repository is a template.
+     *
+     * @param enabled
+     *            true if enabled
+     * @return a builder to continue with building
+     * @throws IOException
+     *             In case of any networking error or error from the server.
+     * @deprecated Use {@link #isTemplate(boolean)} method instead
+     */
+    @Deprecated
+    public GHCreateRepositoryBuilder templateRepository(boolean enabled) throws IOException {
+        return isTemplate(enabled);
+    }
+
+    /**
+     * Specifies the ownership of the repository.
+     *
+     * @param owner
+     *            organization or personage
+     * @return a builder to continue with building
+     * @throws IOException
+     *             In case of any networking error or error from the server.
+     */
+    public GHCreateRepositoryBuilder owner(String owner) throws IOException {
+        return with("owner", owner);
+    }
+
+    /**
+     * Create repository from template repository
+     *
+     * @param templateOwner
+     *            template repository owner
+     * @param templateRepo
+     *            template repository
+     * @return a builder to continue with building
+     * @see <a href="https://developer.github.com/v3/previews/">GitHub API Previews</a>
+     */
+    @Preview(BAPTISTE)
+    @Deprecated
+    public GHCreateRepositoryBuilder fromTemplateRepository(String templateOwner, String templateRepo) {
+        requester.withPreview(BAPTISTE).withUrlPath("/repos/" + templateOwner + "/" + templateRepo + "/generate");
         return this;
     }
 
@@ -193,10 +126,9 @@ public class GHCreateRepositoryBuilder {
      *
      * @return the gh repository
      * @throws IOException
-     *             if repsitory cannot be created
+     *             if repository cannot be created
      */
     public GHRepository create() throws IOException {
-        return builder.method("POST").withUrlPath(apiUrlTail).fetch(GHRepository.class).wrap(root);
+        return done();
     }
-
 }

src/main/java/org/kohsuke/github/GHDeployment.java

@@ -1,7 +1,10 @@
 package org.kohsuke.github;
 
+import org.kohsuke.github.internal.Previews;
+
 import java.io.IOException;
 import java.net.URL;
+import java.util.Map;
 
 /**
  * Represents a deployment
@@ -13,7 +16,6 @@ import java.net.URL;
  */
 public class GHDeployment extends GHObject {
     private GHRepository owner;
-    private GitHub root;
     protected String sha;
     protected String ref;
     protected String task;
@@ -23,6 +25,9 @@ public class GHDeployment extends GHObject {
     protected String statuses_url;
     protected String repository_url;
     protected GHUser creator;
+    protected String original_environment;
+    protected boolean transient_environment;
+    protected boolean production_environment;
 
     GHDeployment wrap(GHRepository owner) {
         this.owner = owner;
@@ -38,7 +43,7 @@ public class GHDeployment extends GHObject {
      * @return the statuses url
      */
     public URL getStatusesUrl() {
-        return GitHub.parseURL(statuses_url);
+        return GitHubClient.parseURL(statuses_url);
     }
 
     /**
@@ -47,7 +52,7 @@ public class GHDeployment extends GHObject {
      * @return the repository url
      */
     public URL getRepositoryUrl() {
-        return GitHub.parseURL(repository_url);
+        return GitHubClient.parseURL(repository_url);
     }
 
     /**
@@ -60,7 +65,8 @@ public class GHDeployment extends GHObject {
     }
 
     /**
-     * Gets payload.
+     * Gets payload. <b>NOTE:</b> only use this method if you can guarantee the payload will be a simple string,
+     * otherwise use {@link #getPayloadObject()}.
      *
      * @return the payload
      */
@@ -68,6 +74,38 @@ public class GHDeployment extends GHObject {
         return (String) payload;
     }
 
+    /**
+     * Gets payload. <b>NOTE:</b> only use this method if you can guarantee the payload will be a JSON object (Map),
+     * otherwise use {@link #getPayloadObject()}.
+     *
+     * @return the payload
+     */
+    public Map<String, Object> getPayloadMap() {
+        return (Map<String, Object>) payload;
+    }
+
+    /**
+     * Gets payload without assuming its type. It could be a String or a Map.
+     *
+     * @return the payload
+     */
+    public Object getPayloadObject() {
+        return payload;
+    }
+
+    /**
+     * The environment defined when the deployment was first created.
+     *
+     * @deprecated until preview feature has graduated to stable
+     *
+     * @return the original deployment environment
+     */
+    @Deprecated
+    @Preview(Previews.FLASH)
+    public String getOriginalEnvironment() {
+        return original_environment;
+    }
+
     /**
      * Gets environment.
      *
@@ -77,6 +115,33 @@ public class GHDeployment extends GHObject {
         return environment;
     }
 
+    /**
+     * Specifies if the given environment is specific to the deployment and will no longer exist at some point in the
+     * future.
+     *
+     * @deprecated until preview feature has graduated to stable
+     *
+     * @return the environment is transient
+     */
+    @Deprecated
+    @Preview(Previews.ANT_MAN)
+    public boolean isTransientEnvironment() {
+        return transient_environment;
+    }
+
+    /**
+     * Specifies if the given environment is one that end-users directly interact with.
+     *
+     * @deprecated until preview feature has graduated to stable
+     *
+     * @return the environment is used by end-users directly
+     */
+    @Deprecated
+    @Preview(Previews.ANT_MAN)
+    public boolean isProductionEnvironment() {
+        return production_environment;
+    }
+
     /**
      * Gets creator.
      *
@@ -122,7 +187,7 @@ public class GHDeployment extends GHObject {
      * @return the gh deployment status builder
      */
     public GHDeploymentStatusBuilder createStatus(GHDeploymentState state) {
-        return new GHDeploymentStatusBuilder(owner, id, state);
+        return new GHDeploymentStatusBuilder(owner, getId(), state);
     }
 
     /**
@@ -133,6 +198,8 @@ public class GHDeployment extends GHObject {
     public PagedIterable<GHDeploymentStatus> listStatuses() {
         return root.createRequest()
                 .withUrlPath(statuses_url)
+                .withPreview(Previews.ANT_MAN)
+                .withPreview(Previews.FLASH)
                 .toIterable(GHDeploymentStatus[].class, item -> item.wrap(owner));
     }
 

src/main/java/org/kohsuke/github/GHDeploymentBuilder.java

@@ -1,5 +1,7 @@
 package org.kohsuke.github;
 
+import org.kohsuke.github.internal.Previews;
+
 import java.io.IOException;
 import java.util.List;
 
@@ -19,7 +21,10 @@ public class GHDeploymentBuilder {
      */
     public GHDeploymentBuilder(GHRepository repo) {
         this.repo = repo;
-        this.builder = repo.root.createRequest().method("POST");
+        this.builder = repo.root.createRequest()
+                .withPreview(Previews.ANT_MAN)
+                .withPreview(Previews.FLASH)
+                .method("POST");
     }
 
     /**
@@ -40,6 +45,7 @@ public class GHDeploymentBuilder {
      *
      * @param branch
      *            the branch
+     *
      * @return the gh deployment builder
      */
     public GHDeploymentBuilder ref(String branch) {
@@ -52,6 +58,7 @@ public class GHDeploymentBuilder {
      *
      * @param task
      *            the task
+     *
      * @return the gh deployment builder
      */
     public GHDeploymentBuilder task(String task) {
@@ -64,6 +71,7 @@ public class GHDeploymentBuilder {
      *
      * @param autoMerge
      *            the auto merge
+     *
      * @return the gh deployment builder
      */
     public GHDeploymentBuilder autoMerge(boolean autoMerge) {
@@ -76,6 +84,7 @@ public class GHDeploymentBuilder {
      *
      * @param requiredContexts
      *            the required contexts
+     *
      * @return the gh deployment builder
      */
     public GHDeploymentBuilder requiredContexts(List<String> requiredContexts) {
@@ -88,6 +97,7 @@ public class GHDeploymentBuilder {
      *
      * @param payload
      *            the payload
+     *
      * @return the gh deployment builder
      */
     public GHDeploymentBuilder payload(String payload) {
@@ -100,6 +110,7 @@ public class GHDeploymentBuilder {
      *
      * @param environment
      *            the environment
+     *
      * @return the gh deployment builder
      */
     public GHDeploymentBuilder environment(String environment) {
@@ -107,11 +118,47 @@ public class GHDeploymentBuilder {
         return this;
     }
 
+    /**
+     * Specifies if the given environment is specific to the deployment and will no longer exist at some point in the
+     * future.
+     *
+     * @deprecated until preview feature has graduated to stable
+     *
+     * @param transientEnvironment
+     *            the environment is transient
+     *
+     * @return the gh deployment builder
+     */
+    @Deprecated
+    @Preview(Previews.ANT_MAN)
+    public GHDeploymentBuilder transientEnvironment(boolean transientEnvironment) {
+        builder.with("transient_environment", transientEnvironment);
+        return this;
+    }
+
+    /**
+     * Specifies if the given environment is one that end-users directly interact with.
+     *
+     * @deprecated until preview feature has graduated to stable
+     *
+     * @param productionEnvironment
+     *            the environment is used by end-users directly
+     *
+     * @return the gh deployment builder
+     */
+    @Deprecated
+    @Preview(Previews.ANT_MAN)
+    public GHDeploymentBuilder productionEnvironment(boolean productionEnvironment) {
+        builder.with("production_environment", productionEnvironment);
+        return this;
+    }
+
     /**
      * Description gh deployment builder.
      *
      * @param description
      *            the description
+     *
      * @return the gh deployment builder
      */
     public GHDeploymentBuilder description(String description) {
@@ -123,6 +170,7 @@ public class GHDeploymentBuilder {
      * Create gh deployment.
      *
      * @return the gh deployment
+     *
      * @throws IOException
      *             the io exception
      */

src/main/java/org/kohsuke/github/GHDeploymentState.java

@@ -1,8 +1,40 @@
 package org.kohsuke.github;
 
+import org.kohsuke.github.internal.Previews;
+
 /**
  * Represents the state of deployment
  */
 public enum GHDeploymentState {
-    PENDING, SUCCESS, ERROR, FAILURE
+    PENDING,
+    SUCCESS,
+    ERROR,
+    FAILURE,
+
+    /**
+     * The state of the deployment currently reflects it's in progress.
+     *
+     * @deprecated until preview feature has graduated to stable
+     */
+    @Deprecated
+    @Preview(Previews.FLASH)
+    IN_PROGRESS,
+
+    /**
+     * The state of the deployment currently reflects it's queued up for processing.
+     *
+     * @deprecated until preview feature has graduated to stable
+     */
+    @Deprecated
+    @Preview(Previews.FLASH)
+    QUEUED,
+
+    /**
+     * The state of the deployment currently reflects it's no longer active.
+     *
+     * @deprecated until preview feature has graduated to stable
+     */
+    @Deprecated
+    @Preview(Previews.ANT_MAN)
+    INACTIVE
 }

src/main/java/org/kohsuke/github/GHDeploymentStatus.java

@@ -1,5 +1,7 @@
 package org.kohsuke.github;
 
+import org.kohsuke.github.internal.Previews;
+
 import java.net.URL;
 import java.util.Locale;
 
@@ -8,19 +10,21 @@ import java.util.Locale;
  */
 public class GHDeploymentStatus extends GHObject {
     private GHRepository owner;
-    private GitHub root;
     protected GHUser creator;
     protected String state;
     protected String description;
     protected String target_url;
+    protected String log_url;
     protected String deployment_url;
     protected String repository_url;
+    protected String environment_url;
 
     /**
      * Wrap gh deployment status.
      *
      * @param owner
      *            the owner
+     *
      * @return the gh deployment status
      */
     public GHDeploymentStatus wrap(GHRepository owner) {
@@ -34,10 +38,28 @@ public class GHDeploymentStatus extends GHObject {
     /**
      * Gets target url.
      *
+     * @deprecated Target url is deprecated in favor of {@link #getLogUrl() getLogUrl}
+     *
      * @return the target url
      */
+    @Deprecated
     public URL getTargetUrl() {
-        return GitHub.parseURL(target_url);
+        return GitHubClient.parseURL(target_url);
+    }
+
+    /**
+     * Gets target url.
+     * <p>
+     * This method replaces {@link #getTargetUrl() getTargetUrl}}.
+     *
+     * @deprecated until preview feature has graduated to stable
+     *
+     * @return the target url
+     */
+    @Deprecated
+    @Preview(Previews.ANT_MAN)
+    public URL getLogUrl() {
+        return GitHubClient.parseURL(log_url);
     }
 
     /**
@@ -46,7 +68,20 @@ public class GHDeploymentStatus extends GHObject {
      * @return the deployment url
      */
     public URL getDeploymentUrl() {
-        return GitHub.parseURL(deployment_url);
+        return GitHubClient.parseURL(deployment_url);
+    }
+
+    /**
+     * Gets deployment environment url.
+     *
+     * @deprecated until preview feature has graduated to stable
+     *
+     * @return the deployment environment url
+     */
+    @Deprecated
+    @Preview(Previews.ANT_MAN)
+    public URL getEnvironmentUrl() {
+        return GitHubClient.parseURL(environment_url);
     }
 
     /**
@@ -55,7 +90,7 @@ public class GHDeploymentStatus extends GHObject {
      * @return the repository url
      */
     public URL getRepositoryUrl() {
-        return GitHub.parseURL(repository_url);
+        return GitHubClient.parseURL(repository_url);
     }
 
     /**

src/main/java/org/kohsuke/github/GHDeploymentStatusBuilder.java

@@ -1,5 +1,7 @@
 package org.kohsuke.github;
 
+import org.kohsuke.github.internal.Previews;
+
 import java.io.IOException;
 
 /**
@@ -21,8 +23,10 @@ public class GHDeploymentStatusBuilder {
      *            the deployment id
      * @param state
      *            the state
+     *
      * @deprecated Use {@link GHDeployment#createStatus(GHDeploymentState)}
      */
+    @Deprecated
     public GHDeploymentStatusBuilder(GHRepository repo, int deploymentId, GHDeploymentState state) {
         this(repo, (long) deploymentId, state);
     }
@@ -30,15 +34,38 @@ public class GHDeploymentStatusBuilder {
     GHDeploymentStatusBuilder(GHRepository repo, long deploymentId, GHDeploymentState state) {
         this.repo = repo;
         this.deploymentId = deploymentId;
-        this.builder = repo.root.createRequest().method("POST");
+        this.builder = repo.root.createRequest()
+                .withPreview(Previews.ANT_MAN)
+                .withPreview(Previews.FLASH)
+                .method("POST");
+
         this.builder.with("state", state);
     }
 
+    /**
+     * Add an inactive status to all prior non-transient, non-production environment deployments with the same
+     * repository and environment name as the created status's deployment.
+     *
+     * @deprecated until preview feature has graduated to stable
+     *
+     * @param autoInactive
+     *            Add inactive status flag
+     *
+     * @return the gh deployment status builder
+     */
+    @Deprecated
+    @Preview({ Previews.ANT_MAN, Previews.FLASH })
+    public GHDeploymentStatusBuilder autoInactive(boolean autoInactive) {
+        this.builder.with("auto_inactive", autoInactive);
+        return this;
+    }
+
     /**
      * Description gh deployment status builder.
      *
      * @param description
      *            the description
+     *
      * @return the gh deployment status builder
      */
     public GHDeploymentStatusBuilder description(String description) {
@@ -46,13 +73,70 @@ public class GHDeploymentStatusBuilder {
         return this;
     }
 
+    /**
+     * Name for the target deployment environment, which can be changed when setting a deploy status.
+     *
+     * @deprecated until preview feature has graduated to stable
+     *
+     * @param environment
+     *            the environment name
+     *
+     * @return the gh deployment status builder
+     */
+    @Deprecated
+    @Preview(Previews.FLASH)
+    public GHDeploymentStatusBuilder environment(String environment) {
+        this.builder.with("environment", environment);
+        return this;
+    }
+
+    /**
+     * The URL for accessing the environment
+     *
+     * @deprecated until preview feature has graduated to stable
+     *
+     * @param environmentUrl
+     *            the environment url
+     *
+     * @return the gh deployment status builder
+     */
+    @Deprecated
+    @Preview(Previews.ANT_MAN)
+    public GHDeploymentStatusBuilder environmentUrl(String environmentUrl) {
+        this.builder.with("environment_url", environmentUrl);
+        return this;
+    }
+
+    /**
+     * The full URL of the deployment's output.
+     * <p>
+     * This method replaces {@link #targetUrl(String) targetUrl}.
+     *
+     * @deprecated until preview feature has graduated to stable
+     *
+     * @param logUrl
+     *            the deployment output url
+     *
+     * @return the gh deployment status builder
+     */
+    @Deprecated
+    @Preview(Previews.ANT_MAN)
+    public GHDeploymentStatusBuilder logUrl(String logUrl) {
+        this.builder.with("log_url", logUrl);
+        return this;
+    }
+
     /**
      * Target url gh deployment status builder.
      *
+     * @deprecated Target url is deprecated in favor of {@link #logUrl(String) logUrl}
+     *
      * @param targetUrl
      *            the target url
+     *
      * @return the gh deployment status builder
      */
+    @Deprecated
     public GHDeploymentStatusBuilder targetUrl(String targetUrl) {
         this.builder.with("target_url", targetUrl);
         return this;
@@ -62,6 +146,7 @@ public class GHDeploymentStatusBuilder {
      * Create gh deployment status.
      *
      * @return the gh deployment status
+     *
      * @throws IOException
      *             the io exception
      */

src/main/java/org/kohsuke/github/GHDiscussion.java

@@ -0,0 +1,230 @@
+package org.kohsuke.github;
+
+import com.fasterxml.jackson.annotation.JsonProperty;
+import org.kohsuke.github.internal.Previews;
+
+import java.io.IOException;
+import java.net.URL;
+import java.util.Objects;
+
+import javax.annotation.CheckForNull;
+import javax.annotation.Nonnull;
+
+/**
+ * A discussion in GitHub Team.
+ *
+ * @author Charles Moulliard
+ * @see <a href="https://developer.github.com/v3/teams/discussions">GitHub Team Discussions</a>
+ */
+public class GHDiscussion extends GHObject {
+
+    private GHTeam team;
+    private long number;
+    private String body, title, htmlUrl;
+
+    @JsonProperty(value = "private")
+    private boolean isPrivate;
+
+    @Override
+    public URL getHtmlUrl() throws IOException {
+        return GitHubClient.parseURL(htmlUrl);
+    }
+
+    GHDiscussion wrapUp(GHTeam team) {
+        this.team = team;
+        return this;
+    }
+
+    /**
+     * Get the team to which this discussion belongs.
+     *
+     * @return the team for this discussion
+     */
+    @Nonnull
+    public GHTeam getTeam() {
+        return team;
+    }
+
+    /**
+     * Get the title of the discussion.
+     *
+     * @return the title
+     */
+    public String getTitle() {
+        return title;
+    }
+
+    /**
+     * The description of this discussion.
+     *
+     * @return the body
+     */
+    public String getBody() {
+        return body;
+    }
+
+    /**
+     * The number of this discussion.
+     *
+     * @return the number
+     */
+    public long getNumber() {
+        return number;
+    }
+
+    /**
+     * The id number of this discussion. GitHub discussions have "number" instead of "id". This is provided for
+     * convenience.
+     *
+     * @return the id number for this discussion
+     * @see #getNumber()
+     */
+    @Override
+    public long getId() {
+        return getNumber();
+    }
+
+    /**
+     * Whether the discussion is private to the team.
+     *
+     * @return {@code true} if discussion is private.
+     */
+    public boolean isPrivate() {
+        return isPrivate;
+    }
+
+    /**
+     * Begins the creation of a new instance.
+     *
+     * Consumer must call {@link GHDiscussion.Creator#done()} to commit changes.
+     *
+     * @param team
+     *            the team in which the discussion will be created.
+     * @return a {@link GHLabel.Creator}
+     * @throws IOException
+     *             the io exception
+     */
+    static GHDiscussion.Creator create(GHTeam team) throws IOException {
+        return new GHDiscussion.Creator(team);
+    }
+
+    static GHDiscussion read(GHTeam team, long discussionNumber) throws IOException {
+        return team.root.createRequest()
+                .setRawUrlPath(getRawUrlPath(team, discussionNumber))
+                .fetch(GHDiscussion.class)
+                .wrapUp(team);
+    }
+
+    static PagedIterable<GHDiscussion> readAll(GHTeam team) throws IOException {
+        return team.root.createRequest()
+                .setRawUrlPath(getRawUrlPath(team, null))
+                .toIterable(GHDiscussion[].class, item -> item.wrapUp(team));
+    }
+
+    /**
+     * Begins a batch update
+     *
+     * Consumer must call {@link GHDiscussion.Updater#done()} to commit changes.
+     *
+     * @return a {@link GHDiscussion.Updater}
+     */
+    @Preview(Previews.SQUIRREL_GIRL)
+    @Deprecated
+    public GHDiscussion.Updater update() {
+        return new GHDiscussion.Updater(this);
+    }
+
+    /**
+     * Begins a single property update.
+     *
+     * @return a {@link GHDiscussion.Setter}
+     */
+    @Preview(Previews.SQUIRREL_GIRL)
+    @Deprecated
+    public GHDiscussion.Setter set() {
+        return new GHDiscussion.Setter(this);
+    }
+
+    /**
+     * Delete the discussion
+     *
+     * @throws IOException
+     *             the io exception
+     */
+    public void delete() throws IOException {
+        team.root.createRequest().method("DELETE").setRawUrlPath(getRawUrlPath(team, number)).send();
+    }
+
+    private static String getRawUrlPath(@Nonnull GHTeam team, @CheckForNull Long discussionNumber) {
+        return team.getUrl().toString() + "/discussions" + (discussionNumber == null ? "" : "/" + discussionNumber);
+    }
+
+    /**
+     * A {@link GHLabelBuilder} that updates a single property per request
+     *
+     * {@link #done()} is called automatically after the property is set.
+     */
+    public static class Setter extends GHDiscussionBuilder<GHDiscussion> {
+        private Setter(@Nonnull GHDiscussion base) {
+            super(GHDiscussion.class, base.team, base);
+            requester.method("PATCH").setRawUrlPath(base.getUrl().toString());
+        }
+    }
+
+    /**
+     * A {@link GHLabelBuilder} that allows multiple properties to be updated per request.
+     *
+     * Consumer must call {@link #done()} to commit changes.
+     */
+    public static class Updater extends GHDiscussionBuilder<Updater> {
+        private Updater(@Nonnull GHDiscussion base) {
+            super(GHDiscussion.Updater.class, base.team, base);
+            requester.method("PATCH").setRawUrlPath(base.getUrl().toString());
+        }
+    }
+
+    /**
+     * A {@link GHLabelBuilder} that creates a new {@link GHLabel}
+     *
+     * Consumer must call {@link #done()} to create the new instance.
+     */
+    public static class Creator extends GHDiscussionBuilder<Creator> {
+
+        private Creator(@Nonnull GHTeam team) {
+            super(GHDiscussion.Creator.class, team, null);
+            requester.method("POST").setRawUrlPath(getRawUrlPath(team, null));
+        }
+
+        /**
+         * Sets whether this discussion is private to this team.
+         *
+         * @param value
+         *            privacy of this discussion
+         * @return either a continuing builder or an updated {@link GHDiscussion}
+         * @throws IOException
+         *             if there is an I/O Exception
+         */
+        @Nonnull
+        public Creator private_(boolean value) throws IOException {
+            return with("private", value);
+        }
+    }
+
+    @Override
+    public boolean equals(Object o) {
+        if (this == o) {
+            return true;
+        }
+        if (o == null || getClass() != o.getClass()) {
+            return false;
+        }
+        GHDiscussion that = (GHDiscussion) o;
+        return number == that.number && Objects.equals(getUrl(), that.getUrl()) && Objects.equals(team, that.team)
+                && Objects.equals(body, that.body) && Objects.equals(title, that.title);
+    }
+
+    @Override
+    public int hashCode() {
+        return Objects.hash(team, number, body, title);
+    }
+}

src/main/java/org/kohsuke/github/GHDiscussionBuilder.java

@@ -0,0 +1,80 @@
+package org.kohsuke.github;
+
+import java.io.IOException;
+
+import javax.annotation.CheckForNull;
+import javax.annotation.Nonnull;
+
+/**
+ * Base class for creating or updating a discussion.
+ *
+ * @param <S>
+ *            Intermediate return type for this builder returned by calls to {@link #with(String, Object)}. If {@link S}
+ *            the same as {@link GHLabel}, this builder will commit changes after each call to
+ *            {@link #with(String, Object)}.
+ */
+class GHDiscussionBuilder<S> extends AbstractBuilder<GHDiscussion, S> {
+
+    private final GHTeam team;
+
+    /**
+     *
+     * @param intermediateReturnType
+     *            Intermediate return type for this builder returned by calls to {@link #with(String, Object)}. If
+     *            {@link S} the same as {@link GHDiscussion}, this builder will commit changes after each call to
+     *            {@link #with(String, Object)}.
+     * @param team
+     *            the GitHub team. Updates will be sent to the root of this team.
+     * @param baseInstance
+     *            instance on which to base this builder. If {@code null} a new instance will be created.
+     */
+    protected GHDiscussionBuilder(@Nonnull Class<S> intermediateReturnType,
+            @Nonnull GHTeam team,
+            @CheckForNull GHDiscussion baseInstance) {
+        super(GHDiscussion.class, intermediateReturnType, team.root, baseInstance);
+
+        this.team = team;
+
+        if (baseInstance != null) {
+            requester.with("title", baseInstance.getTitle());
+            requester.with("body", baseInstance.getBody());
+        }
+    }
+
+    /**
+     * Title for this discussion.
+     *
+     * @param value
+     *            title of discussion
+     * @return either a continuing builder or an updated {@link GHDiscussion}
+     * @throws IOException
+     *             if there is an I/O Exception
+     */
+    @Nonnull
+    public S title(String value) throws IOException {
+        return with("title", value);
+    }
+
+    /**
+     * Body content for this discussion.
+     *
+     * @param value
+     *            body of discussion*
+     * @return either a continuing builder or an updated {@link GHDiscussion}
+     * @throws IOException
+     *             if there is an I/O Exception
+     */
+    @Nonnull
+    public S body(String value) throws IOException {
+        return with("body", value);
+    }
+
+    /**
+     * {@inheritDoc}
+     */
+    @Nonnull
+    @Override
+    public GHDiscussion done() throws IOException {
+        return super.done().wrapUp(team);
+    }
+}

src/main/java/org/kohsuke/github/GHEvent.java

@@ -12,6 +12,7 @@ import java.util.Locale;
 public enum GHEvent {
     CHECK_RUN,
     CHECK_SUITE,
+    CODE_SCANNING_ALERT,
     COMMIT_COMMENT,
     CONTENT_REFERENCE,
     CREATE,
@@ -50,6 +51,7 @@ public enum GHEvent {
     PULL_REQUEST_REVIEW,
     PULL_REQUEST_REVIEW_COMMENT,
     PUSH,
+    REGISTRY_PACKAGE,
     RELEASE,
     REPOSITORY_DISPATCH, // only valid for org hooks
     REPOSITORY,
@@ -61,6 +63,8 @@ public enum GHEvent {
     TEAM,
     TEAM_ADD,
     WATCH,
+    WORKFLOW_DISPATCH,
+    WORKFLOW_RUN,
 
     /**
      * Special event type that means "every possible event"

src/main/java/org/kohsuke/github/GHEventInfo.java

@@ -12,9 +12,7 @@ import java.util.Date;
  * @author Kohsuke Kawaguchi
  */
 @SuppressFBWarnings(value = "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", justification = "JSON API")
-public class GHEventInfo {
-    private GitHub root;
-
+public class GHEventInfo extends GitHubInteractiveObject {
     // we don't want to expose Jackson dependency to the user. This needs databinding
     private ObjectNode payload;
 
@@ -78,7 +76,7 @@ public class GHEventInfo {
      * @return the created at
      */
     public Date getCreatedAt() {
-        return GitHub.parseDate(created_at);
+        return GitHubClient.parseDate(created_at);
     }
 
     /**
@@ -144,7 +142,7 @@ public class GHEventInfo {
      *             if payload cannot be parsed
      */
     public <T extends GHEventPayload> T getPayload(Class<T> type) throws IOException {
-        T v = GitHub.MAPPER.readValue(payload.traverse(), type);
+        T v = GitHubClient.getMappingObjectReader(root).readValue(payload.traverse(), type);
         v.wrapUp(root);
         return v;
     }

src/main/java/org/kohsuke/github/GHFileNotFoundException.java

@@ -1,11 +1,11 @@
 package org.kohsuke.github;
 
 import java.io.FileNotFoundException;
-import java.net.HttpURLConnection;
 import java.util.List;
 import java.util.Map;
 
 import javax.annotation.CheckForNull;
+import javax.annotation.Nonnull;
 
 /**
  * Request/responce contains useful metadata. Custom exception allows store info for next diagnostics.
@@ -24,11 +24,24 @@ public class GHFileNotFoundException extends FileNotFoundException {
     /**
      * Instantiates a new Gh file not found exception.
      *
-     * @param s
-     *            the s
+     * @param message
+     *            the message
      */
-    public GHFileNotFoundException(String s) {
-        super(s);
+    public GHFileNotFoundException(String message) {
+        super(message);
+    }
+
+    /**
+     * Instantiates a new Gh file not found exception.
+     *
+     * @param message
+     *            the message
+     * @param cause
+     *            the cause
+     */
+    public GHFileNotFoundException(String message, Throwable cause) {
+        super(message);
+        this.initCause(cause);
     }
 
     /**
@@ -41,8 +54,8 @@ public class GHFileNotFoundException extends FileNotFoundException {
         return responseHeaderFields;
     }
 
-    GHFileNotFoundException withResponseHeaderFields(HttpURLConnection urlConnection) {
-        this.responseHeaderFields = urlConnection.getHeaderFields();
+    GHFileNotFoundException withResponseHeaderFields(@Nonnull Map<String, List<String>> headerFields) {
+        this.responseHeaderFields = headerFields;
         return this;
     }
 }

src/main/java/org/kohsuke/github/GHGist.java

@@ -1,12 +1,13 @@
 package org.kohsuke.github;
 
+import com.fasterxml.jackson.annotation.JacksonInject;
+import com.fasterxml.jackson.annotation.JsonCreator;
 import com.fasterxml.jackson.annotation.JsonProperty;
 import org.apache.commons.lang3.StringUtils;
 
 import java.io.IOException;
 import java.net.URL;
 import java.util.Collections;
-import java.util.HashMap;
 import java.util.Map;
 import java.util.Map.Entry;
 
@@ -20,8 +21,8 @@ import java.util.Map.Entry;
  * @see <a href="https://developer.github.com/v3/gists/">documentation</a>
  */
 public class GHGist extends GHObject {
-    /* package almost final */ GHUser owner;
-    /* package almost final */ GitHub root;
+
+    final GHUser owner;
 
     private String forks_url, commits_url, id, git_pull_url, git_push_url, html_url;
 
@@ -34,7 +35,43 @@ public class GHGist extends GHObject {
 
     private String comments_url;
 
-    private Map<String, GHGistFile> files = new HashMap<String, GHGistFile>();
+    private final Map<String, GHGistFile> files;
+
+    @JsonCreator
+    private GHGist(@JacksonInject GitHub root,
+            @JsonProperty("owner") GHUser owner,
+            @JsonProperty("files") Map<String, GHGistFile> files) {
+        this.root = root;
+        for (Entry<String, GHGistFile> e : files.entrySet()) {
+            e.getValue().fileName = e.getKey();
+        }
+        this.files = Collections.unmodifiableMap(files);
+        this.owner = root.getUser(owner);
+    }
+
+    /**
+     * Unlike most other GitHub objects, the id for Gists can be non-numeric, such as "aa5a315d61ae9438b18d". If the id
+     * is numeric, this method will get it. If id is not numeric, this will throw a runtime
+     * {@link NumberFormatException}.
+     *
+     * @return id of the Gist.
+     * @deprecated Use {@link #getGistId()} instead.
+     */
+    @Deprecated
+    @Override
+    public long getId() {
+        return Long.parseLong(getGistId());
+    }
+
+    /**
+     * Gets the id for this Gist. Unlike most other GitHub objects, the id for Gists can be non-numeric, such as
+     * "aa5a315d61ae9438b18d". This should be used instead of {@link #getId()}.
+     *
+     * @return id of this Gist
+     */
+    public String getGistId() {
+        return this.id;
+    }
 
     /**
      * Gets owner.
@@ -44,7 +81,7 @@ public class GHGist extends GHObject {
      *             the io exception
      */
     public GHUser getOwner() throws IOException {
-        return root.intern(owner);
+        return owner;
     }
 
     /**
@@ -83,8 +120,13 @@ public class GHGist extends GHObject {
         return git_push_url;
     }
 
+    /**
+     * Get the html url.
+     *
+     * @return the github html url
+     */
     public URL getHtmlUrl() {
-        return GitHub.parseURL(html_url);
+        return GitHubClient.parseURL(html_url);
     }
 
     /**
@@ -140,31 +182,7 @@ public class GHGist extends GHObject {
      * @return the files
      */
     public Map<String, GHGistFile> getFiles() {
-        return Collections.unmodifiableMap(files);
-    }
-
-    GHGist wrapUp(GHUser owner) {
-        this.owner = owner;
-        this.root = owner.root;
-        wrapUp();
-        return this;
-    }
-
-    /**
-     * Used when caller obtains {@link GHGist} without knowing its owner. A partially constructed owner object is
-     * interned.
-     */
-    GHGist wrapUp(GitHub root) {
-        this.owner = root.getUser(owner);
-        this.root = root;
-        wrapUp();
-        return this;
-    }
-
-    private void wrapUp() {
-        for (Entry<String, GHGistFile> e : files.entrySet()) {
-            e.getValue().fileName = e.getKey();
-        }
+        return files;
     }
 
     String getApiTailUrl(String tail) {
@@ -214,7 +232,7 @@ public class GHGist extends GHObject {
      *             the io exception
      */
     public GHGist fork() throws IOException {
-        return root.createRequest().method("POST").withUrlPath(getApiTailUrl("forks")).fetch(GHGist.class).wrapUp(root);
+        return root.createRequest().method("POST").withUrlPath(getApiTailUrl("forks")).fetch(GHGist.class);
     }
 
     /**
@@ -223,9 +241,7 @@ public class GHGist extends GHObject {
      * @return the paged iterable
      */
     public PagedIterable<GHGist> listForks() {
-        return root.createRequest()
-                .withUrlPath(getApiTailUrl("forks"))
-                .toIterable(GHGist[].class, item -> item.wrapUp(root));
+        return root.createRequest().withUrlPath(getApiTailUrl("forks")).toIterable(GHGist[].class, null);
     }
 
     /**
@@ -264,10 +280,4 @@ public class GHGist extends GHObject {
     public int hashCode() {
         return id.hashCode();
     }
-
-    GHGist wrap(GHUser owner) {
-        this.owner = owner;
-        this.root = owner.root;
-        return this;
-    }
 }

src/main/java/org/kohsuke/github/GHGistBuilder.java

@@ -4,6 +4,8 @@ import java.io.IOException;
 import java.util.Collections;
 import java.util.LinkedHashMap;
 
+import javax.annotation.Nonnull;
+
 /**
  * Builder pattern for creating a new Gist.
  *
@@ -11,7 +13,6 @@ import java.util.LinkedHashMap;
  * @see GitHub#createGist() GitHub#createGist()
  */
 public class GHGistBuilder {
-    private final GitHub root;
     private final Requester req;
     private final LinkedHashMap<String, Object> files = new LinkedHashMap<String, Object>();
 
@@ -22,7 +23,6 @@ public class GHGistBuilder {
      *            the root
      */
     public GHGistBuilder(GitHub root) {
-        this.root = root;
         req = root.createRequest().method("POST");
     }
 
@@ -59,7 +59,7 @@ public class GHGistBuilder {
      *            the content
      * @return Adds a new file.
      */
-    public GHGistBuilder file(String fileName, String content) {
+    public GHGistBuilder file(@Nonnull String fileName, @Nonnull String content) {
         files.put(fileName, Collections.singletonMap("content", content));
         return this;
     }
@@ -73,6 +73,6 @@ public class GHGistBuilder {
      */
     public GHGist create() throws IOException {
         req.with("files", files);
-        return req.withUrlPath("/gists").fetch(GHGist.class).wrapUp(root);
+        return req.withUrlPath("/gists").fetch(GHGist.class);
     }
 }

src/main/java/org/kohsuke/github/GHGistUpdater.java

@@ -1,8 +1,11 @@
 package org.kohsuke.github;
 
 import java.io.IOException;
-import java.util.Collections;
+import java.util.HashMap;
 import java.util.LinkedHashMap;
+import java.util.Map;
+
+import javax.annotation.Nonnull;
 
 /**
  * Builder pattern for updating a Gist.
@@ -12,7 +15,7 @@ import java.util.LinkedHashMap;
 public class GHGistUpdater {
     private final GHGist base;
     private final Requester builder;
-    LinkedHashMap<String, Object> files;
+    LinkedHashMap<String, Map<String, String>> files;
 
     GHGistUpdater(GHGist base) {
         this.base = base;
@@ -32,16 +35,15 @@ public class GHGistUpdater {
      * @throws IOException
      *             the io exception
      */
-    public GHGistUpdater addFile(String fileName, String content) throws IOException {
+    public GHGistUpdater addFile(@Nonnull String fileName, @Nonnull String content) throws IOException {
         updateFile(fileName, content);
         return this;
     }
 
-    // // This method does not work.
-    // public GHGistUpdater deleteFile(String fileName) throws IOException {
-    // files.put(fileName, Collections.singletonMap("filename", null));
-    // return this;
-    // }
+    public GHGistUpdater deleteFile(@Nonnull String fileName) throws IOException {
+        files.put(fileName, null);
+        return this;
+    }
 
     /**
      * Rename file gh gist updater.
@@ -54,8 +56,9 @@ public class GHGistUpdater {
      * @throws IOException
      *             the io exception
      */
-    public GHGistUpdater renameFile(String fileName, String newFileName) throws IOException {
-        files.put(fileName, Collections.singletonMap("filename", newFileName));
+    public GHGistUpdater renameFile(@Nonnull String fileName, @Nonnull String newFileName) throws IOException {
+        Map<String, String> file = files.computeIfAbsent(fileName, d -> new HashMap<>());
+        file.put("filename", newFileName);
         return this;
     }
 
@@ -70,8 +73,31 @@ public class GHGistUpdater {
      * @throws IOException
      *             the io exception
      */
-    public GHGistUpdater updateFile(String fileName, String content) throws IOException {
-        files.put(fileName, Collections.singletonMap("content", content));
+    public GHGistUpdater updateFile(@Nonnull String fileName, @Nonnull String content) throws IOException {
+        Map<String, String> file = files.computeIfAbsent(fileName, d -> new HashMap<>());
+        file.put("content", content);
+        return this;
+    }
+
+    /**
+     * Update file name and content
+     *
+     * @param fileName
+     *            the file name
+     * @param newFileName
+     *            the new file name
+     * @param content
+     *            the content
+     * @return the gh gist updater
+     * @throws IOException
+     *             the io exception
+     */
+    public GHGistUpdater updateFile(@Nonnull String fileName, @Nonnull String newFileName, @Nonnull String content)
+            throws IOException {
+        Map<String, String> file = files.computeIfAbsent(fileName, d -> new HashMap<>());
+        file.put("content", content);
+        file.put("filename", newFileName);
+        files.put(fileName, file);
         return this;
     }
 
@@ -96,6 +122,6 @@ public class GHGistUpdater {
      */
     public GHGist update() throws IOException {
         builder.with("files", files);
-        return builder.method("PATCH").withUrlPath(base.getApiTailUrl("")).fetch(GHGist.class).wrap(base.owner);
+        return builder.method("PATCH").withUrlPath(base.getApiTailUrl("")).fetch(GHGist.class);
     }
 }

src/main/java/org/kohsuke/github/GHHooks.java

@@ -12,8 +12,7 @@ import java.util.Map;
  * functionality
  */
 class GHHooks {
-    static abstract class Context {
-        private final GitHub root;
+    static abstract class Context extends GitHubInteractiveObject {
 
         private Context(GitHub root) {
             this.root = root;

src/main/java/org/kohsuke/github/GHIOException.java

@@ -1,11 +1,11 @@
 package org.kohsuke.github;
 
 import java.io.IOException;
-import java.net.HttpURLConnection;
 import java.util.List;
 import java.util.Map;
 
 import javax.annotation.CheckForNull;
+import javax.annotation.Nonnull;
 
 /**
  * Request/responce contains useful metadata. Custom exception allows store info for next diagnostics.
@@ -31,6 +31,20 @@ public class GHIOException extends IOException {
         super(message);
     }
 
+    /**
+     * Constructs a {@code GHIOException} with the specified detail message and cause.
+     *
+     * @param message
+     *            The detail message (which is saved for later retrieval by the {@link #getMessage()} method)
+     *
+     * @param cause
+     *            The cause (which is saved for later retrieval by the {@link #getCause()} method). (A null value is
+     *            permitted, and indicates that the cause is nonexistent or unknown.)
+     */
+    public GHIOException(String message, Throwable cause) {
+        super(message, cause);
+    }
+
     /**
      * Gets response header fields.
      *
@@ -41,8 +55,8 @@ public class GHIOException extends IOException {
         return responseHeaderFields;
     }
 
-    GHIOException withResponseHeaderFields(HttpURLConnection urlConnection) {
-        this.responseHeaderFields = urlConnection.getHeaderFields();
+    GHIOException withResponseHeaderFields(@Nonnull Map<String, List<String>> headerFields) {
+        this.responseHeaderFields = headerFields;
         return this;
     }
 }

src/main/java/org/kohsuke/github/GHInvitation.java

@@ -16,7 +16,6 @@ import java.net.URL;
                 "UUF_UNUSED_FIELD" },
         justification = "JSON API")
 public class GHInvitation extends GHObject {
-    /* package almost final */ GitHub root;
 
     private int id;
     private GHRepository repository;
@@ -51,6 +50,6 @@ public class GHInvitation extends GHObject {
 
     @Override
     public URL getHtmlUrl() {
-        return GitHub.parseURL(html_url);
+        return GitHubClient.parseURL(html_url);
     }
 }

src/main/java/org/kohsuke/github/GHIssue.java

@@ -26,6 +26,7 @@ package org.kohsuke.github;
 
 import com.infradna.tool.bridge_method_injector.WithBridgeMethods;
 import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
+import org.apache.commons.lang3.StringUtils;
 
 import java.io.IOException;
 import java.net.URL;
@@ -36,8 +37,9 @@ import java.util.Collections;
 import java.util.Date;
 import java.util.List;
 import java.util.Locale;
+import java.util.Objects;
 
-import static org.kohsuke.github.Previews.SQUIRREL_GIRL;
+import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
 
 /**
  * Represents an issue on GitHub.
@@ -51,7 +53,6 @@ import static org.kohsuke.github.Previews.SQUIRREL_GIRL;
 public class GHIssue extends GHObject implements Reactable {
     private static final String ASSIGNEES = "assignees";
 
-    GitHub root;
     GHRepository owner;
 
     // API v3
@@ -63,8 +64,7 @@ public class GHIssue extends GHObject implements Reactable {
     protected int comments;
     @SkipFromToString
     protected String body;
-    // for backward compatibility with < 1.63, this collection needs to hold instances of Label, not GHLabel
-    protected List<Label> labels;
+    protected List<GHLabel> labels;
     protected GHUser user;
     protected String title, html_url;
     protected GHIssue.PullRequest pull_request;
@@ -72,14 +72,6 @@ public class GHIssue extends GHObject implements Reactable {
     protected GHUser closed_by;
     protected boolean locked;
 
-    /**
-     * The type Label.
-     *
-     * @deprecated use {@link GHLabel}
-     */
-    public static class Label extends GHLabel {
-    }
-
     GHIssue wrap(GHRepository owner) {
         this.owner = owner;
         if (milestone != null)
@@ -100,12 +92,6 @@ public class GHIssue extends GHObject implements Reactable {
         return this;
     }
 
-    static GHIssue[] wrap(GHIssue[] issues, GHRepository owner) {
-        for (GHIssue i : issues)
-            i.wrap(owner);
-        return issues;
-    }
-
     /**
      * Repository to which the issue belongs.
      *
@@ -137,7 +123,7 @@ public class GHIssue extends GHObject implements Reactable {
      * The HTML page of this issue, like https://github.com/jenkinsci/jenkins/issues/100
      */
     public URL getHtmlUrl() {
-        return GitHub.parseURL(html_url);
+        return GitHubClient.parseURL(html_url);
     }
 
     /**
@@ -171,14 +157,12 @@ public class GHIssue extends GHObject implements Reactable {
      * Gets labels.
      *
      * @return the labels
-     * @throws IOException
-     *             the io exception
      */
-    public Collection<GHLabel> getLabels() throws IOException {
+    public Collection<GHLabel> getLabels() {
         if (labels == null) {
             return Collections.emptyList();
         }
-        return Collections.<GHLabel>unmodifiableList(labels);
+        return Collections.unmodifiableList(labels);
     }
 
     /**
@@ -187,16 +171,18 @@ public class GHIssue extends GHObject implements Reactable {
      * @return the closed at
      */
     public Date getClosedAt() {
-        return GitHub.parseDate(closed_at);
+        return GitHubClient.parseDate(closed_at);
     }
 
     /**
      * Gets api url.
      *
-     * @return the api url
+     * @return API URL of this object.
+     * @deprecated use {@link #getUrl()}
      */
+    @Deprecated
     public URL getApiURL() {
-        return GitHub.parseURL(url);
+        return getUrl();
     }
 
     /**
@@ -242,8 +228,15 @@ public class GHIssue extends GHObject implements Reactable {
         root.createRequest().with(key, value).method("PATCH").withUrlPath(getApiRoute()).send();
     }
 
+    /**
+     * Identical to edit(), but allows null for the value.
+     */
+    private void editNullable(String key, Object value) throws IOException {
+        root.createRequest().withNullable(key, value).method("PATCH").withUrlPath(getApiRoute()).send();
+    }
+
     private void editIssue(String key, Object value) throws IOException {
-        root.createRequest().with(key, value).method("PATCH").withUrlPath(getIssuesApiRoute()).send();
+        root.createRequest().withNullable(key, value).method("PATCH").withUrlPath(getIssuesApiRoute()).send();
     }
 
     /**
@@ -291,15 +284,19 @@ public class GHIssue extends GHObject implements Reactable {
     }
 
     /**
-     * Sets milestone.
+     * Sets the milestone for this issue.
      *
      * @param milestone
-     *            the milestone
+     *            The milestone to assign this issue to. Use null to remove the milestone for this issue.
      * @throws IOException
-     *             the io exception
+     *             The io exception
      */
     public void setMilestone(GHMilestone milestone) throws IOException {
-        edit("milestone", milestone.getNumber());
+        if (milestone == null) {
+            editIssue("milestone", null);
+        } else {
+            editIssue("milestone", milestone.getNumber());
+        }
     }
 
     /**
@@ -315,7 +312,7 @@ public class GHIssue extends GHObject implements Reactable {
     }
 
     /**
-     * Sets labels.
+     * Sets labels on the target to a specific list.
      *
      * @param labels
      *            the labels
@@ -329,6 +326,8 @@ public class GHIssue extends GHObject implements Reactable {
     /**
      * Adds labels to the issue.
      *
+     * Labels that are already present on the target are ignored.
+     *
      * @param names
      *            Names of the label
      * @throws IOException
@@ -341,6 +340,8 @@ public class GHIssue extends GHObject implements Reactable {
     /**
      * Add labels.
      *
+     * Labels that are already present on the target are ignored.
+     *
      * @param labels
      *            the labels
      * @throws IOException
@@ -353,6 +354,8 @@ public class GHIssue extends GHObject implements Reactable {
     /**
      * Add labels.
      *
+     * Labels that are already present on the target are ignored.
+     *
      * @param labels
      *            the labels
      * @throws IOException
@@ -363,21 +366,27 @@ public class GHIssue extends GHObject implements Reactable {
     }
 
     private void _addLabels(Collection<String> names) throws IOException {
-        List<String> newLabels = new ArrayList<String>();
-
-        for (GHLabel label : getLabels()) {
-            newLabels.add(label.getName());
-        }
-        for (String name : names) {
-            if (!newLabels.contains(name)) {
-                newLabels.add(name);
-            }
-        }
-        setLabels(newLabels.toArray(new String[0]));
+        root.createRequest().with("labels", names).method("POST").withUrlPath(getIssuesApiRoute() + "/labels").send();
     }
 
     /**
-     * Remove a given label by name from this issue.
+     * Remove a single label.
+     *
+     * Attempting to remove a label that is not present throws {@link GHFileNotFoundException}.
+     *
+     * @param name
+     *            the name
+     * @throws IOException
+     *             the io exception, throws {@link GHFileNotFoundException} if label was not present.
+     */
+    public void removeLabel(String name) throws IOException {
+        root.createRequest().method("DELETE").withUrlPath(getIssuesApiRoute() + "/labels", name).send();
+    }
+
+    /**
+     * Remove a collection of labels.
+     *
+     * Attempting to remove labels that are not present on the target are ignored.
      *
      * @param names
      *            the names
@@ -389,7 +398,9 @@ public class GHIssue extends GHObject implements Reactable {
     }
 
     /**
-     * Remove labels.
+     * Remove a collection of labels.
+     *
+     * Attempting to remove labels that are not present on the target are ignored.
      *
      * @param labels
      *            the labels
@@ -402,7 +413,9 @@ public class GHIssue extends GHObject implements Reactable {
     }
 
     /**
-     * Remove labels.
+     * Remove a collection of labels.
+     *
+     * Attempting to remove labels that are not present on the target are ignored.
      *
      * @param labels
      *            the labels
@@ -414,15 +427,13 @@ public class GHIssue extends GHObject implements Reactable {
     }
 
     private void _removeLabels(Collection<String> names) throws IOException {
-        List<String> newLabels = new ArrayList<String>();
-
-        for (GHLabel l : getLabels()) {
-            if (!names.contains(l.getName())) {
-                newLabels.add(l.getName());
+        for (String name : names) {
+            try {
+                removeLabel(name);
+            } catch (GHFileNotFoundException e) {
+                // when trying to remove multiple labels, we ignore already removed
             }
         }
-
-        setLabels(newLabels.toArray(new String[0]));
     }
 
     /**
@@ -434,7 +445,7 @@ public class GHIssue extends GHObject implements Reactable {
      * @see #listComments() #listComments()
      */
     public List<GHIssueComment> getComments() throws IOException {
-        return listComments().asList();
+        return listComments().toList();
     }
 
     /**
@@ -450,10 +461,10 @@ public class GHIssue extends GHObject implements Reactable {
                 .toIterable(GHIssueComment[].class, item -> item.wrapUp(this));
     }
 
-    @Preview
+    @Preview(SQUIRREL_GIRL)
     @Deprecated
     public GHReaction createReaction(ReactionContent content) throws IOException {
-        return owner.root.createRequest()
+        return root.createRequest()
                 .method("POST")
                 .withPreview(SQUIRREL_GIRL)
                 .with("content", content.getContent())
@@ -462,13 +473,13 @@ public class GHIssue extends GHObject implements Reactable {
                 .wrap(root);
     }
 
-    @Preview
+    @Preview(SQUIRREL_GIRL)
     @Deprecated
     public PagedIterable<GHReaction> listReactions() {
-        return owner.root.createRequest()
+        return root.createRequest()
                 .withPreview(SQUIRREL_GIRL)
                 .withUrlPath(getApiRoute() + "/reactions")
-                .toIterable(GHReaction[].class, item -> item.wrap(owner.root));
+                .toIterable(GHReaction[].class, item -> item.wrap(root));
     }
 
     /**
@@ -571,6 +582,11 @@ public class GHIssue extends GHObject implements Reactable {
      * @return the issues api route
      */
     protected String getIssuesApiRoute() {
+        if (owner == null) {
+            // Issues returned from search to do not have an owner. Attempt to use url.
+            final URL url = Objects.requireNonNull(getUrl(), "Missing instance URL!");
+            return StringUtils.prependIfMissing(url.toString().replace(root.getApiUrl(), ""), "/");
+        }
         return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/issues/" + number;
     }
 
@@ -677,7 +693,7 @@ public class GHIssue extends GHObject implements Reactable {
          * @return the diff url
          */
         public URL getDiffUrl() {
-            return GitHub.parseURL(diff_url);
+            return GitHubClient.parseURL(diff_url);
         }
 
         /**
@@ -686,7 +702,7 @@ public class GHIssue extends GHObject implements Reactable {
          * @return the patch url
          */
         public URL getPatchUrl() {
-            return GitHub.parseURL(patch_url);
+            return GitHubClient.parseURL(patch_url);
         }
 
         /**
@@ -695,7 +711,7 @@ public class GHIssue extends GHObject implements Reactable {
          * @return the url
          */
         public URL getUrl() {
-            return GitHub.parseURL(html_url);
+            return GitHubClient.parseURL(html_url);
         }
     }
 

src/main/java/org/kohsuke/github/GHIssueChanges.java

@@ -0,0 +1,49 @@
+package org.kohsuke.github;
+
+import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
+
+/**
+ * Wrapper to define changed fields on issues action="edited"
+ *
+ * @see GHEventPayload.Issue
+ */
+@SuppressFBWarnings("UWF_UNWRITTEN_FIELD")
+public class GHIssueChanges {
+
+    private GHFrom title;
+    private GHFrom body;
+
+    /**
+     * Old issue title.
+     *
+     * @return old issue title (or null if not changed)
+     */
+    public GHFrom getTitle() {
+        return title;
+    }
+
+    /**
+     * Old issue body.
+     *
+     * @return old issue body (or null if not changed)
+     */
+    public GHFrom getBody() {
+        return body;
+    }
+
+    /**
+     * Wrapper for changed values.
+     */
+    public static class GHFrom {
+        private String from;
+
+        /**
+         * Previous value that was changed.
+         *
+         * @return previous value
+         */
+        public String getFrom() {
+            return from;
+        }
+    }
+}

src/main/java/org/kohsuke/github/GHIssueComment.java

@@ -26,7 +26,7 @@ package org.kohsuke.github;
 import java.io.IOException;
 import java.net.URL;
 
-import static org.kohsuke.github.Previews.*;
+import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
 
 /**
  * Comment to the issue
@@ -87,7 +87,7 @@ public class GHIssueComment extends GHObject implements Reactable {
 
     @Override
     public URL getHtmlUrl() {
-        return GitHub.parseURL(html_url);
+        return GitHubClient.parseURL(html_url);
     }
 
     /**
@@ -126,7 +126,7 @@ public class GHIssueComment extends GHObject implements Reactable {
         owner.root.createRequest().method("DELETE").withUrlPath(getApiRoute()).send();
     }
 
-    @Preview
+    @Preview(SQUIRREL_GIRL)
     @Deprecated
     public GHReaction createReaction(ReactionContent content) throws IOException {
         return owner.root.createRequest()
@@ -138,7 +138,7 @@ public class GHIssueComment extends GHObject implements Reactable {
                 .wrap(owner.root);
     }
 
-    @Preview
+    @Preview(SQUIRREL_GIRL)
     @Deprecated
     public PagedIterable<GHReaction> listReactions() {
         return owner.root.createRequest()
@@ -149,6 +149,6 @@ public class GHIssueComment extends GHObject implements Reactable {
 
     private String getApiRoute() {
         return "/repos/" + owner.getRepository().getOwnerName() + "/" + owner.getRepository().getName()
-                + "/issues/comments/" + id;
+                + "/issues/comments/" + getId();
     }
 }

src/main/java/org/kohsuke/github/GHIssueEvent.java

@@ -5,11 +5,11 @@ import java.util.Date;
 /**
  * The type GHIssueEvent.
  *
+ * @see <a href="https://developer.github.com/v3/issues/events/">Github documentation for issue events</a>
+ *
  * @author Martin van Zijl
  */
-public class GHIssueEvent {
-    private GitHub root;
-
+public class GHIssueEvent extends GitHubInteractiveObject {
     private long id;
     private String node_id;
     private String url;
@@ -18,6 +18,9 @@ public class GHIssueEvent {
     private String commit_id;
     private String commit_url;
     private String created_at;
+    private GHMilestone milestone;
+    private GHLabel label;
+    private GHUser assignee;
 
     private GHIssue issue;
 
@@ -90,7 +93,7 @@ public class GHIssueEvent {
      * @return the created at
      */
     public Date getCreatedAt() {
-        return GitHub.parseDate(created_at);
+        return GitHubClient.parseDate(created_at);
     }
 
     /**
@@ -111,6 +114,36 @@ public class GHIssueEvent {
         return issue;
     }
 
+    /**
+     * Get the {@link GHMilestone} that this issue was added to or removed from. Only present for events "milestoned"
+     * and "demilestoned", <code>null</code> otherwise.
+     *
+     * @return the milestone
+     */
+    public GHMilestone getMilestone() {
+        return milestone;
+    }
+
+    /**
+     * Get the {@link GHLabel} that was added to or removed from the issue. Only present for events "labeled" and
+     * "unlabeled", <code>null</code> otherwise.
+     *
+     * @return the label
+     */
+    public GHLabel getLabel() {
+        return label;
+    }
+
+    /**
+     * Get the {@link GHUser} that was assigned or unassigned from the issue. Only present for events "assigned" and
+     * "unassigned", <code>null</code> otherwise.
+     *
+     * @return the user
+     */
+    public GHUser getAssignee() {
+        return assignee;
+    }
+
     GHIssueEvent wrapUp(GitHub root) {
         this.root = root;
         return this;

src/main/java/org/kohsuke/github/GHIssueState.java

@@ -31,4 +31,4 @@ package org.kohsuke.github;
  */
 public enum GHIssueState {
     OPEN, CLOSED, ALL
-}
+}

src/main/java/org/kohsuke/github/GHKey.java

@@ -9,9 +9,7 @@ import org.apache.commons.lang3.builder.ToStringBuilder;
  * @author Kohsuke Kawaguchi
  */
 @SuppressFBWarnings(value = "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", justification = "JSON API")
-public class GHKey {
-    /* package almost final */ GitHub root;
-
+public class GHKey extends GitHubInteractiveObject {
     protected String url, key, title;
     protected boolean verified;
     protected int id;

src/main/java/org/kohsuke/github/GHLabel.java

@@ -1,27 +1,77 @@
 package org.kohsuke.github;
 
+import com.fasterxml.jackson.annotation.JacksonInject;
+import com.fasterxml.jackson.annotation.JsonCreator;
+import com.fasterxml.jackson.annotation.JsonProperty;
+
 import java.io.IOException;
 import java.util.ArrayList;
 import java.util.Collection;
 import java.util.List;
 import java.util.Objects;
 
+import javax.annotation.CheckForNull;
+import javax.annotation.Nonnull;
+
 /**
  * The type GHLabel.
  *
  * @author Kohsuke Kawaguchi
+ * @see <a href="https://developer.github.com/v3/issues/labels/">Labels</a>
  * @see GHIssue#getLabels() GHIssue#getLabels()
  * @see GHRepository#listLabels() GHRepository#listLabels()
  */
-public class GHLabel {
-    private String url, name, color, description;
-    private GHRepository repo;
+public class GHLabel extends GitHubInteractiveObject {
+
+    private long id;
+    private String nodeId;
+    @JsonProperty("default")
+    private boolean default_;
+
+    @Nonnull
+    private String url, name, color;
+
+    @CheckForNull
+    private String description;
+
+    @JsonCreator
+    private GHLabel(@JacksonInject @Nonnull GitHub root) {
+        this.root = root;
+        url = "";
+        name = "";
+        color = "";
+        description = null;
+    }
+
+    @Nonnull
+    GitHub getApiRoot() {
+        return Objects.requireNonNull(root);
+    }
+
+    /**
+     * Gets id.
+     *
+     * @return the id
+     */
+    public long getId() {
+        return id;
+    }
+
+    /**
+     * Gets node id.
+     *
+     * @return the node id.
+     */
+    public String getNodeId() {
+        return nodeId;
+    }
 
     /**
      * Gets url.
      *
      * @return the url
      */
+    @Nonnull
     public String getUrl() {
         return url;
     }
@@ -31,6 +81,7 @@ public class GHLabel {
      *
      * @return the name
      */
+    @Nonnull
     public String getName() {
         return name;
     }
@@ -40,6 +91,7 @@ public class GHLabel {
      *
      * @return the color
      */
+    @Nonnull
     public String getColor() {
         return color;
     }
@@ -49,23 +101,18 @@ public class GHLabel {
      *
      * @return the description
      */
+    @CheckForNull
     public String getDescription() {
         return description;
     }
 
-    GHLabel wrapUp(GHRepository repo) {
-        this.repo = repo;
-        return this;
-    }
-
     /**
-     * Delete.
+     * If the label is one of the default labels created by GitHub automatically.
      *
-     * @throws IOException
-     *             the io exception
+     * @return true if the label is a default one
      */
-    public void delete() throws IOException {
-        repo.root.createRequest().method("DELETE").setRawUrlPath(url).send();
+    public boolean isDefault() {
+        return default_;
     }
 
     /**
@@ -75,15 +122,11 @@ public class GHLabel {
      *            6-letter hex color code, like "f29513"
      * @throws IOException
      *             the io exception
+     * @deprecated use {@link #set()} or {@link #update()} instead
      */
+    @Deprecated
     public void setColor(String newColor) throws IOException {
-        repo.root.createRequest()
-                .method("PATCH")
-                .with("name", name)
-                .with("color", newColor)
-                .with("description", description)
-                .setRawUrlPath(url)
-                .send();
+        set().color(newColor);
     }
 
     /**
@@ -93,25 +136,106 @@ public class GHLabel {
      *            Description of label
      * @throws IOException
      *             the io exception
+     * @deprecated use {@link #set()} or {@link #update()} instead
      */
+    @Deprecated
     public void setDescription(String newDescription) throws IOException {
-        repo.root.createRequest()
-                .method("PATCH")
-                .with("name", name)
-                .with("color", color)
-                .with("description", newDescription)
-                .setRawUrlPath(url)
-                .send();
+        set().description(newDescription);
     }
 
     static Collection<String> toNames(Collection<GHLabel> labels) {
-        List<String> r = new ArrayList<String>();
+        List<String> r = new ArrayList<>();
         for (GHLabel l : labels) {
             r.add(l.getName());
         }
         return r;
     }
 
+    /**
+     * Begins the creation of a new instance.
+     *
+     * Consumer must call {@link Creator#done()} to commit changes.
+     *
+     * @param repository
+     *            the repository in which the label will be created.
+     * @return a {@link Creator}
+     * @throws IOException
+     *             the io exception
+     */
+    @BetaApi
+    @Deprecated
+    static Creator create(GHRepository repository) throws IOException {
+        return new Creator(repository);
+    }
+
+    /**
+     * Reads a label from a repository.
+     *
+     * @param repository
+     *            the repository to read from
+     * @param name
+     *            the name of the label
+     * @return a label
+     * @throws IOException
+     *             the io exception
+     */
+    static GHLabel read(@Nonnull GHRepository repository, @Nonnull String name) throws IOException {
+        return repository.root.createRequest()
+                .withUrlPath(repository.getApiTailUrl("labels"), name)
+                .fetch(GHLabel.class);
+
+    }
+
+    /**
+     * Reads all labels from a repository.
+     *
+     * @param repository
+     *            the repository to read from
+     * @return iterable of all labels
+     * @throws IOException
+     *             the io exception
+     */
+    static PagedIterable<GHLabel> readAll(@Nonnull final GHRepository repository) throws IOException {
+        return repository.root.createRequest()
+                .withUrlPath(repository.getApiTailUrl("labels"))
+                .toIterable(GHLabel[].class, null);
+
+    }
+
+    /**
+     * Begins a batch update
+     *
+     * Consumer must call {@link Updater#done()} to commit changes.
+     *
+     * @return a {@link Updater}
+     */
+    @BetaApi
+    @Deprecated
+    public Updater update() {
+        return new Updater(this);
+    }
+
+    /**
+     * Begins a single property update.
+     *
+     * @return a {@link Setter}
+     */
+    @BetaApi
+    @Deprecated
+    public Setter set() {
+        return new Setter(this);
+    }
+
+    /**
+     * Delete this label from the repository.
+     *
+     * @throws IOException
+     *             the io exception
+     */
+    public void delete() throws IOException {
+        root.createRequest().method("DELETE").setRawUrlPath(getUrl()).send();
+    }
+
     @Override
     public boolean equals(final Object o) {
         if (this == o)
@@ -120,11 +244,54 @@ public class GHLabel {
             return false;
         final GHLabel ghLabel = (GHLabel) o;
         return Objects.equals(url, ghLabel.url) && Objects.equals(name, ghLabel.name)
-                && Objects.equals(color, ghLabel.color) && Objects.equals(repo, ghLabel.repo);
+                && Objects.equals(color, ghLabel.color) && Objects.equals(description, ghLabel.description);
     }
 
     @Override
     public int hashCode() {
-        return Objects.hash(url, name, color, repo);
+        return Objects.hash(url, name, color, description);
     }
+
+    /**
+     * A {@link GHLabelBuilder} that updates a single property per request
+     *
+     * {@link #done()} is called automatically after the property is set.
+     */
+    @BetaApi
+    @Deprecated
+    public static class Setter extends GHLabelBuilder<GHLabel> {
+        private Setter(@Nonnull GHLabel base) {
+            super(GHLabel.class, base.getApiRoot(), base);
+            requester.method("PATCH").setRawUrlPath(base.getUrl());
+        }
+    }
+
+    /**
+     * A {@link GHLabelBuilder} that allows multiple properties to be updated per request.
+     *
+     * Consumer must call {@link #done()} to commit changes.
+     */
+    @BetaApi
+    @Deprecated
+    public static class Updater extends GHLabelBuilder<Updater> {
+        private Updater(@Nonnull GHLabel base) {
+            super(Updater.class, base.getApiRoot(), base);
+            requester.method("PATCH").setRawUrlPath(base.getUrl());
+        }
+    }
+
+    /**
+     * A {@link GHLabelBuilder} that creates a new {@link GHLabel}
+     *
+     * Consumer must call {@link #done()} to create the new instance.
+     */
+    @BetaApi
+    @Deprecated
+    public static class Creator extends GHLabelBuilder<Creator> {
+        private Creator(@Nonnull GHRepository repository) {
+            super(Creator.class, repository.root, null);
+            requester.method("POST").withUrlPath(repository.getApiTailUrl("labels"));
+        }
+    }
+
 }

src/main/java/org/kohsuke/github/GHLabelBuilder.java

@@ -0,0 +1,60 @@
+package org.kohsuke.github;
+
+import java.io.IOException;
+
+import javax.annotation.CheckForNull;
+import javax.annotation.Nonnull;
+
+/**
+ *
+ * @param <S>
+ *            Intermediate return type for this builder returned by calls to {@link #with(String, Object)}. If {@link S}
+ *            the same as {@link GHLabel}, this builder will commit changes after each call to
+ *            {@link #with(String, Object)}.
+ */
+class GHLabelBuilder<S> extends AbstractBuilder<GHLabel, S> {
+
+    /**
+     *
+     * @param intermediateReturnType
+     *            Intermediate return type for this builder returned by calls to {@link #with(String, Object)}. If
+     *            {@link S} the same as {@link GHLabel}, this builder will commit changes after each call to
+     *            {@link #with(String, Object)}.
+     * @param root
+     *            the GitHub instance to which updates will be sent
+     * @param baseInstance
+     *            instance on which to base this builder. If {@code null} a new instance will be created.
+     */
+    protected GHLabelBuilder(@Nonnull Class<S> intermediateReturnType,
+            @Nonnull GitHub root,
+            @CheckForNull GHLabel baseInstance) {
+        super(GHLabel.class, intermediateReturnType, root, baseInstance);
+
+        if (baseInstance != null) {
+            requester.with("name", baseInstance.getName());
+            requester.with("color", baseInstance.getColor());
+            requester.with("description", baseInstance.getDescription());
+        }
+    }
+
+    @Nonnull
+    @BetaApi
+    @Deprecated
+    public S name(String value) throws IOException {
+        return with("name", value);
+    }
+
+    @Nonnull
+    @BetaApi
+    @Deprecated
+    public S color(String value) throws IOException {
+        return with("color", value);
+    }
+
+    @Nonnull
+    @BetaApi
+    @Deprecated
+    public S description(String value) throws IOException {
+        return with("description", value);
+    }
+}

src/main/java/org/kohsuke/github/GHLicense.java

@@ -24,13 +24,13 @@
 
 package org.kohsuke.github;
 
-import com.infradna.tool.bridge_method_injector.WithBridgeMethods;
 import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
 
 import java.io.IOException;
 import java.net.URL;
 import java.util.ArrayList;
 import java.util.List;
+import java.util.Objects;
 
 /**
  * The GitHub Preview API's license information
@@ -44,9 +44,6 @@ import java.util.List;
 @SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
         justification = "JSON API")
 public class GHLicense extends GHObject {
-    @SuppressFBWarnings("IS2_INCONSISTENT_SYNC")
-    // root is set before the object is returned to the app
-    /* package almost final */ GitHub root;
 
     // these fields are always present, even in the short form
     protected String key, name;
@@ -78,14 +75,6 @@ public class GHLicense extends GHObject {
         return name;
     }
 
-    /**
-     * @return API URL of this object.
-     */
-    @WithBridgeMethods(value = String.class, adapterMethod = "urlToString")
-    public URL getUrl() {
-        return GitHub.parseURL(url);
-    }
-
     /**
      * Featured licenses are bold in the new repository drop-down
      *
@@ -100,7 +89,7 @@ public class GHLicense extends GHObject {
 
     public URL getHtmlUrl() throws IOException {
         populate();
-        return GitHub.parseURL(html_url);
+        return GitHubClient.parseURL(html_url);
     }
 
     /**
@@ -199,7 +188,14 @@ public class GHLicense extends GHObject {
         if (description != null)
             return; // already populated
 
-        root.createRequest().withUrlPath(url).fetchInto(this);
+        if (root == null || root.isOffline()) {
+            return; // cannot populate, will have to live with what we have
+        }
+
+        URL url = getUrl();
+        if (url != null) {
+            root.createRequest().setRawUrlPath(url.toString()).fetchInto(this);
+        }
     }
 
     @Override
@@ -210,12 +206,12 @@ public class GHLicense extends GHObject {
             return false;
 
         GHLicense that = (GHLicense) o;
-        return this.url.equals(that.url);
+        return Objects.equals(getUrl(), that.getUrl());
     }
 
     @Override
     public int hashCode() {
-        return url.hashCode();
+        return Objects.hashCode(getUrl());
     }
 
     GHLicense wrap(GitHub root) {

src/main/java/org/kohsuke/github/GHMarketplaceAccount.java

@@ -9,9 +9,7 @@ import java.net.URL;
  * @see GitHub#getMyMarketplacePurchases()
  * @see GHMarketplaceListAccountBuilder#createRequest()
  */
-public class GHMarketplaceAccount {
-
-    protected GitHub root;
+public class GHMarketplaceAccount extends GitHubInteractiveObject {
     private String url;
     private long id;
     private String login;
@@ -37,7 +35,7 @@ public class GHMarketplaceAccount {
      * @return the url
      */
     public URL getUrl() {
-        return GitHub.parseURL(url);
+        return GitHubClient.parseURL(url);
     }
 
     /**

src/main/java/org/kohsuke/github/GHMarketplaceListAccountBuilder.java

@@ -8,8 +8,7 @@ import java.io.IOException;
  * @author Paulo Miguel Almeida
  * @see GHMarketplacePlan#listAccounts()
  */
-public class GHMarketplaceListAccountBuilder {
-    private final GitHub root;
+public class GHMarketplaceListAccountBuilder extends GitHubInteractiveObject {
     private final Requester builder;
     private final long planId;
 

src/main/java/org/kohsuke/github/GHMarketplacePendingChange.java

@@ -10,8 +10,7 @@ import java.util.Date;
  * @author Paulo Miguel Almeida
  * @see GHMarketplaceListAccountBuilder#createRequest()
  */
-public class GHMarketplacePendingChange {
-    private GitHub root;
+public class GHMarketplacePendingChange extends GitHubInteractiveObject {
     private long id;
     @SuppressFBWarnings(value = "UWF_UNWRITTEN_FIELD", justification = "Field comes from JSON deserialization")
     private Long unitCount;
@@ -68,7 +67,7 @@ public class GHMarketplacePendingChange {
      * @return the effective date
      */
     public Date getEffectiveDate() {
-        return GitHub.parseDate(effectiveDate);
+        return GitHubClient.parseDate(effectiveDate);
     }
 
 }

src/main/java/org/kohsuke/github/GHMarketplacePlan.java

@@ -11,9 +11,7 @@ import java.util.List;
  * @author Paulo Miguel Almeida
  * @see GitHub#listMarketplacePlans()
  */
-public class GHMarketplacePlan {
-
-    private GitHub root;
+public class GHMarketplacePlan extends GitHubInteractiveObject {
     private String url;
     private String accountsUrl;
     private long id;
@@ -47,7 +45,7 @@ public class GHMarketplacePlan {
      * @return the url
      */
     public URL getUrl() {
-        return GitHub.parseURL(url);
+        return GitHubClient.parseURL(url);
     }
 
     /**

src/main/java/org/kohsuke/github/GHMarketplacePurchase.java

@@ -10,9 +10,8 @@ import java.util.Date;
  * @author Paulo Miguel Almeida
  * @see GHMarketplaceListAccountBuilder#createRequest() GHMarketplaceListAccountBuilder#createRequest()
  */
-public class GHMarketplacePurchase {
+public class GHMarketplacePurchase extends GitHubInteractiveObject {
 
-    private GitHub root;
     private String billingCycle;
     private String nextBillingDate;
     private boolean onFreeTrial;
@@ -52,7 +51,7 @@ public class GHMarketplacePurchase {
      * @return the next billing date
      */
     public Date getNextBillingDate() {
-        return GitHub.parseDate(nextBillingDate);
+        return GitHubClient.parseDate(nextBillingDate);
     }
 
     /**
@@ -70,7 +69,7 @@ public class GHMarketplacePurchase {
      * @return the free trial ends on
      */
     public Date getFreeTrialEndsOn() {
-        return GitHub.parseDate(freeTrialEndsOn);
+        return GitHubClient.parseDate(freeTrialEndsOn);
     }
 
     /**
@@ -88,7 +87,7 @@ public class GHMarketplacePurchase {
      * @return the updated at
      */
     public Date getUpdatedAt() {
-        return GitHub.parseDate(updatedAt);
+        return GitHubClient.parseDate(updatedAt);
     }
 
     /**

src/main/java/org/kohsuke/github/GHMarketplaceUserPurchase.java

@@ -10,8 +10,7 @@ import java.util.Date;
  * @author Paulo Miguel Almeida
  * @see GitHub#getMyMarketplacePurchases()
  */
-public class GHMarketplaceUserPurchase {
-    protected GitHub root;
+public class GHMarketplaceUserPurchase extends GitHubInteractiveObject {
     private String billingCycle;
     private String nextBillingDate;
     private boolean onFreeTrial;
@@ -54,7 +53,7 @@ public class GHMarketplaceUserPurchase {
      * @return the next billing date
      */
     public Date getNextBillingDate() {
-        return GitHub.parseDate(nextBillingDate);
+        return GitHubClient.parseDate(nextBillingDate);
     }
 
     /**
@@ -72,7 +71,7 @@ public class GHMarketplaceUserPurchase {
      * @return the free trial ends on
      */
     public Date getFreeTrialEndsOn() {
-        return GitHub.parseDate(freeTrialEndsOn);
+        return GitHubClient.parseDate(freeTrialEndsOn);
     }
 
     /**
@@ -90,7 +89,7 @@ public class GHMarketplaceUserPurchase {
      * @return the updated at
      */
     public Date getUpdatedAt() {
-        return GitHub.parseDate(updatedAt);
+        return GitHubClient.parseDate(updatedAt);
     }
 
     /**

src/main/java/org/kohsuke/github/GHMembership.java

@@ -10,9 +10,7 @@ import java.util.Locale;
  * @author Kohsuke Kawaguchi
  * @see GHMyself#listOrgMemberships() GHMyself#listOrgMemberships()
  */
-public class GHMembership /* extends GHObject --- but it doesn't have id, created_at, etc. */ {
-    GitHub root;
-
+public class GHMembership extends GitHubInteractiveObject {
     String url;
     String state;
     String role;
@@ -25,7 +23,7 @@ public class GHMembership /* extends GHObject --- but it doesn't have id, create
      * @return the url
      */
     public URL getUrl() {
-        return GitHub.parseURL(url);
+        return GitHubClient.parseURL(url);
     }
 
     /**
@@ -84,11 +82,6 @@ public class GHMembership /* extends GHObject --- but it doesn't have id, create
         return this;
     }
 
-    static void wrap(GHMembership[] page, GitHub root) {
-        for (GHMembership m : page)
-            m.wrap(root);
-    }
-
     /**
      * Role of a user in an organization.
      */

src/main/java/org/kohsuke/github/GHMilestone.java

@@ -11,7 +11,6 @@ import java.util.Locale;
  * @author Yusuke Kokubo
  */
 public class GHMilestone extends GHObject {
-    GitHub root;
     GHRepository owner;
 
     GHUser creator;
@@ -56,7 +55,7 @@ public class GHMilestone extends GHObject {
     public Date getDueOn() {
         if (due_on == null)
             return null;
-        return GitHub.parseDate(due_on);
+        return GitHubClient.parseDate(due_on);
     }
 
     /**
@@ -67,7 +66,7 @@ public class GHMilestone extends GHObject {
      *             the io exception
      */
     public Date getClosedAt() throws IOException {
-        return GitHub.parseDate(closed_at);
+        return GitHubClient.parseDate(closed_at);
     }
 
     /**
@@ -116,7 +115,7 @@ public class GHMilestone extends GHObject {
     }
 
     public URL getHtmlUrl() {
-        return GitHub.parseURL(html_url);
+        return GitHubClient.parseURL(html_url);
     }
 
     /**
@@ -195,7 +194,7 @@ public class GHMilestone extends GHObject {
      *             the io exception
      */
     public void setDueOn(Date dueOn) throws IOException {
-        edit("due_on", GitHub.printDate(dueOn));
+        edit("due_on", GitHubClient.printDate(dueOn));
     }
 
     /**

src/main/java/org/kohsuke/github/GHMilestoneState.java

@@ -7,4 +7,4 @@ package org.kohsuke.github;
  */
 public enum GHMilestoneState {
     OPEN, CLOSED
-}
+}

src/main/java/org/kohsuke/github/GHMyself.java

@@ -2,7 +2,6 @@ package org.kohsuke.github;
 
 import java.io.IOException;
 import java.util.ArrayList;
-import java.util.Arrays;
 import java.util.Collections;
 import java.util.HashSet;
 import java.util.List;
@@ -71,8 +70,7 @@ public class GHMyself extends GHUser {
      *             the io exception
      */
     public List<GHEmail> getEmails2() throws IOException {
-        GHEmail[] addresses = root.createRequest().withUrlPath("/user/emails").fetchArray(GHEmail[].class);
-        return Collections.unmodifiableList(Arrays.asList(addresses));
+        return root.createRequest().withUrlPath("/user/emails").toIterable(GHEmail[].class, null).toList();
     }
 
     /**
@@ -86,8 +84,7 @@ public class GHMyself extends GHUser {
      *             the io exception
      */
     public List<GHKey> getPublicKeys() throws IOException {
-        return Collections.unmodifiableList(
-                Arrays.asList(root.createRequest().withUrlPath("/user/keys").fetchArray(GHKey[].class)));
+        return root.createRequest().withUrlPath("/user/keys").toIterable(GHKey[].class, null).toList();
     }
 
     /**
@@ -101,8 +98,10 @@ public class GHMyself extends GHUser {
      *             the io exception
      */
     public List<GHVerifiedKey> getPublicVerifiedKeys() throws IOException {
-        return Collections.unmodifiableList(Arrays.asList(
-                root.createRequest().withUrlPath("/users/" + getLogin() + "/keys").fetchArray(GHVerifiedKey[].class)));
+        return root.createRequest()
+                .withUrlPath("/users/" + getLogin() + "/keys")
+                .toIterable(GHVerifiedKey[].class, null)
+                .toList();
     }
 
     /**
@@ -115,7 +114,10 @@ public class GHMyself extends GHUser {
     public GHPersonSet<GHOrganization> getAllOrganizations() throws IOException {
         GHPersonSet<GHOrganization> orgs = new GHPersonSet<GHOrganization>();
         Set<String> names = new HashSet<String>();
-        for (GHOrganization o : root.createRequest().withUrlPath("/user/orgs").fetchArray(GHOrganization[].class)) {
+        for (GHOrganization o : root.createRequest()
+                .withUrlPath("/user/orgs")
+                .toIterable(GHOrganization[].class, null)
+                .toArray()) {
             if (names.add(o.getLogin())) // in case of rumoured duplicates in the data
                 orgs.add(root.getOrganization(o.getLogin()));
         }
@@ -189,6 +191,7 @@ public class GHMyself extends GHUser {
      * @return the paged iterable
      * @deprecated Use {@link #listRepositories()}
      */
+    @Deprecated
     public PagedIterable<GHRepository> listAllRepositories() {
         return listRepositories();
     }

src/main/java/org/kohsuke/github/GHNotificationStream.java

@@ -23,9 +23,7 @@ import java.util.NoSuchElementException;
  * @see GitHub#listNotifications() GitHub#listNotifications()
  * @see GHRepository#listNotifications() GHRepository#listNotifications()
  */
-public class GHNotificationStream implements Iterable<GHThread> {
-    private final GitHub root;
-
+public class GHNotificationStream extends GitHubInteractiveObject implements Iterable<GHThread> {
     private Boolean all, participating;
     private String since;
     private String apiUrl;
@@ -79,7 +77,7 @@ public class GHNotificationStream implements Iterable<GHThread> {
      * @return the gh notification stream
      */
     public GHNotificationStream since(Date dt) {
-        since = GitHub.printDate(dt);
+        since = GitHubClient.printDate(dt);
         return this;
     }
 
@@ -180,7 +178,11 @@ public class GHNotificationStream implements Iterable<GHThread> {
 
                         req.setHeader("If-Modified-Since", lastModified);
 
-                        threads = req.withUrlPath(apiUrl).fetchArray(GHThread[].class);
+                        Requester requester = req.withUrlPath(apiUrl);
+                        GitHubResponse<GHThread[]> response = ((GitHubPageContentsIterable<GHThread>) requester
+                                .toIterable(GHThread[].class, null)).toResponse();
+                        threads = response.body();
+
                         if (threads == null) {
                             threads = EMPTY_ARRAY; // if unmodified, we get empty array
                         } else {
@@ -189,27 +191,21 @@ public class GHNotificationStream implements Iterable<GHThread> {
                         }
                         idx = threads.length - 1;
 
-                        nextCheckTime = calcNextCheckTime();
-                        lastModified = req.getResponseHeader("Last-Modified");
+                        nextCheckTime = calcNextCheckTime(response);
+                        lastModified = response.headerField("Last-Modified");
                     }
-                } catch (IOException e) {
-                    throw new RuntimeException(e);
-                } catch (InterruptedException e) {
+                } catch (IOException | InterruptedException e) {
                     throw new RuntimeException(e);
                 }
             }
 
-            private long calcNextCheckTime() {
-                String v = req.getResponseHeader("X-Poll-Interval");
+            private long calcNextCheckTime(GitHubResponse<GHThread[]> response) {
+                String v = response.headerField("X-Poll-Interval");
                 if (v == null)
                     v = "60";
                 long seconds = Integer.parseInt(v);
                 return System.currentTimeMillis() + seconds * 1000;
             }
-
-            public void remove() {
-                throw new UnsupportedOperationException();
-            }
         };
     }
 
@@ -234,7 +230,7 @@ public class GHNotificationStream implements Iterable<GHThread> {
     public void markAsRead(long timestamp) throws IOException {
         final Requester req = root.createRequest();
         if (timestamp >= 0)
-            req.with("last_read_at", GitHub.printDate(new Date(timestamp)));
+            req.with("last_read_at", GitHubClient.printDate(new Date(timestamp)));
         req.withUrlPath(apiUrl).fetchHttpStatusCode();
     }
 

src/main/java/org/kohsuke/github/GHObject.java

@@ -1,5 +1,6 @@
 package org.kohsuke.github;
 
+import com.fasterxml.jackson.annotation.JacksonInject;
 import com.infradna.tool.bridge_method_injector.WithBridgeMethods;
 import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
 import org.apache.commons.lang3.builder.ReflectionToStringBuilder;
@@ -19,20 +20,35 @@ import javax.annotation.CheckForNull;
  */
 @SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
         justification = "JSON API")
-public abstract class GHObject {
+public abstract class GHObject extends GitHubInteractiveObject {
     /**
      * Capture response HTTP headers on the state object.
      */
-    protected Map<String, List<String>> responseHeaderFields;
+    protected transient Map<String, List<String>> responseHeaderFields;
 
-    protected String url;
-    protected long id;
-    protected String created_at;
-    protected String updated_at;
+    private String url;
+
+    private long id;
+    private String nodeId;
+    private String createdAt;
+    private String updatedAt;
 
     GHObject() {
     }
 
+    /**
+     * Called by Jackson
+     *
+     * @param responseInfo
+     *            the {@link GitHubResponse.ResponseInfo} to get headers from.
+     */
+    @JacksonInject
+    protected void setResponseHeaderFields(@CheckForNull GitHubResponse.ResponseInfo responseInfo) {
+        if (responseInfo != null) {
+            responseHeaderFields = responseInfo.headers();
+        }
+    }
+
     /**
      * Returns the HTTP response headers given along with the state of this object.
      *
@@ -60,12 +76,12 @@ public abstract class GHObject {
      */
     @WithBridgeMethods(value = String.class, adapterMethod = "createdAtStr")
     public Date getCreatedAt() throws IOException {
-        return GitHub.parseDate(created_at);
+        return GitHubClient.parseDate(createdAt);
     }
 
     @SuppressFBWarnings(value = "UPM_UNCALLED_PRIVATE_METHOD", justification = "Bridge method of getCreatedAt")
     private Object createdAtStr(Date id, Class type) {
-        return created_at;
+        return createdAt;
     }
 
     /**
@@ -75,7 +91,7 @@ public abstract class GHObject {
      */
     @WithBridgeMethods(value = String.class, adapterMethod = "urlToString")
     public URL getUrl() {
-        return GitHub.parseURL(url);
+        return GitHubClient.parseURL(url);
     }
 
     /**
@@ -96,7 +112,18 @@ public abstract class GHObject {
      *             on error
      */
     public Date getUpdatedAt() throws IOException {
-        return GitHub.parseDate(updated_at);
+        return GitHubClient.parseDate(updatedAt);
+    }
+
+    /**
+     * Get Global node_id from Github object.
+     *
+     * @see <a href="https://developer.github.com/v4/guides/using-global-node-ids/">Using Global Node IDs</a>
+     *
+     * @return Global Node ID.
+     */
+    public String getNodeId() {
+        return nodeId;
     }
 
     /**

src/main/java/org/kohsuke/github/GHOrgHook.java

@@ -22,6 +22,6 @@ class GHOrgHook extends GHHook {
 
     @Override
     String getApiRoute() {
-        return String.format("/orgs/%s/hooks/%d", organization.getLogin(), id);
+        return String.format("/orgs/%s/hooks/%d", organization.getLogin(), getId());
     }
 }

src/main/java/org/kohsuke/github/GHOrganization.java

@@ -10,7 +10,7 @@ import java.util.List;
 import java.util.Map;
 import java.util.TreeMap;
 
-import static org.kohsuke.github.Previews.INERTIA;
+import static org.kohsuke.github.internal.Previews.INERTIA;
 
 /**
  * The type GHOrganization.
@@ -40,6 +40,7 @@ public class GHOrganization extends GHPerson {
      *             the io exception
      * @deprecated Use {@link #createRepository(String)} that uses a builder pattern to let you control every aspect.
      */
+    @Deprecated
     public GHRepository createRepository(String name,
             String description,
             String homepage,
@@ -69,6 +70,7 @@ public class GHOrganization extends GHPerson {
      *             the io exception
      * @deprecated Use {@link #createRepository(String)} that uses a builder pattern to let you control every aspect.
      */
+    @Deprecated
     public GHRepository createRepository(String name,
             String description,
             String homepage,
@@ -95,7 +97,7 @@ public class GHOrganization extends GHPerson {
      * @return the gh create repository builder
      */
     public GHCreateRepositoryBuilder createRepository(String name) {
-        return new GHCreateRepositoryBuilder(root, "/orgs/" + login + "/repos", name);
+        return new GHCreateRepositoryBuilder(name, root, "/orgs/" + login + "/repos");
     }
 
     /**
@@ -126,6 +128,40 @@ public class GHOrganization extends GHPerson {
                 .toIterable(GHTeam[].class, item -> item.wrapUp(this));
     }
 
+    /**
+     * Gets a single team by ID.
+     *
+     * @param teamId
+     *            id of the team that we want to query for
+     * @return the team
+     * @throws IOException
+     *             the io exception
+     *
+     * @deprecated Use {@link GHOrganization#getTeam(long)}
+     */
+    @Deprecated
+    public GHTeam getTeam(int teamId) throws IOException {
+        return getTeam((long) teamId);
+    }
+
+    /**
+     * Gets a single team by ID.
+     *
+     * @param teamId
+     *            id of the team that we want to query for
+     * @return the team
+     * @throws IOException
+     *             the io exception
+     *
+     * @see <a href= "https://developer.github.com/v3/teams/#get-team-by-name">documentation</a>
+     */
+    public GHTeam getTeam(long teamId) throws IOException {
+        return root.createRequest()
+                .withUrlPath(String.format("/organizations/%d/team/%d", getId(), teamId))
+                .fetch(GHTeam.class)
+                .wrapUp(this);
+    }
+
     /**
      * Finds a team that has the given name in its {@link GHTeam#getName()}
      *
@@ -151,13 +187,13 @@ public class GHOrganization extends GHPerson {
      * @return the team by slug
      * @throws IOException
      *             the io exception
+     * @see <a href= "https://developer.github.com/v3/teams/#get-team-by-name">documentation</a>
      */
     public GHTeam getTeamBySlug(String slug) throws IOException {
-        for (GHTeam t : listTeams()) {
-            if (t.getSlug().equals(slug))
-                return t;
-        }
-        return null;
+        return root.createRequest()
+                .withUrlPath(String.format("/orgs/%s/teams/%s", login, slug))
+                .fetch(GHTeam.class)
+                .wrapUp(this);
     }
 
     /**
@@ -255,7 +291,7 @@ public class GHOrganization extends GHPerson {
      * @deprecated use {@link #listMembers()}
      */
     public List<GHUser> getMembers() throws IOException {
-        return listMembers().asList();
+        return listMembers().toList();
     }
 
     /**
@@ -281,7 +317,7 @@ public class GHOrganization extends GHPerson {
     }
 
     private PagedIterable<GHUser> listMembers(String suffix) throws IOException {
-        return listMembers(suffix, null);
+        return listMembers(suffix, null, null);
     }
 
     /**
@@ -294,13 +330,28 @@ public class GHOrganization extends GHPerson {
      *             the io exception
      */
     public PagedIterable<GHUser> listMembersWithFilter(String filter) throws IOException {
-        return listMembers("members", filter);
+        return listMembers("members", filter, null);
     }
 
-    private PagedIterable<GHUser> listMembers(final String suffix, final String filter) throws IOException {
-        String filterParams = (filter == null) ? "" : ("?filter=" + filter);
+    /**
+     * List members with specified role paged iterable.
+     *
+     * @param role
+     *            the role
+     * @return the paged iterable
+     * @throws IOException
+     *             the io exception
+     */
+    public PagedIterable<GHUser> listMembersWithRole(String role) throws IOException {
+        return listMembers("members", null, role);
+    }
+
+    private PagedIterable<GHUser> listMembers(final String suffix, final String filter, String role)
+            throws IOException {
         return root.createRequest()
-                .withUrlPath(String.format("/orgs/%s/%s%s", login, suffix, filterParams))
+                .withUrlPath(String.format("/orgs/%s/%s", login, suffix))
+                .with("filter", filter)
+                .with("role", role)
                 .toIterable(GHUser[].class, item -> item.wrapUp(root));
     }
 
@@ -370,7 +421,7 @@ public class GHOrganization extends GHPerson {
      * The enum Permission.
      */
     public enum Permission {
-        ADMIN, PUSH, PULL
+        ADMIN, MAINTAIN, PUSH, TRIAGE, PULL
     }
 
     /**

src/main/java/org/kohsuke/github/GHPermission.java

@@ -28,7 +28,7 @@ import java.util.Locale;
 
 /**
  * Permission for a user in a repository.
- * 
+ *
  * @see <a href="https://developer.github.com/v3/repos/collaborators/#review-a-users-permission-level">API</a>
  */
 class GHPermission {

src/main/java/org/kohsuke/github/GHPerson.java

@@ -2,13 +2,14 @@ package org.kohsuke.github;
 
 import java.io.FileNotFoundException;
 import java.io.IOException;
+import java.net.MalformedURLException;
 import java.net.URL;
-import java.util.Arrays;
 import java.util.Collections;
 import java.util.Date;
 import java.util.Iterator;
 import java.util.List;
 import java.util.Map;
+import java.util.Optional;
 import java.util.TreeMap;
 
 /**
@@ -17,16 +18,18 @@ import java.util.TreeMap;
  * @author Kohsuke Kawaguchi
  */
 public abstract class GHPerson extends GHObject {
-    /* package almost final */ GitHub root;
 
     // core data fields that exist even for "small" user data (such as the user info in pull request)
-    protected String login, avatar_url, gravatar_id;
+    protected String login, avatar_url;
 
     // other fields (that only show up in full data)
-    protected String location, blog, email, name, company, type;
+    protected String location, blog, email, bio, name, company, type, twitter_username;
     protected String html_url;
     protected int followers, following, public_repos, public_gists;
-    protected boolean site_admin;
+    protected boolean site_admin, hireable;
+
+    // other fields (that only show up in full data) that require privileged scope
+    protected Integer total_private_repos;
 
     GHPerson wrapUp(GitHub root) {
         this.root = root;
@@ -42,13 +45,16 @@ public abstract class GHPerson extends GHObject {
      *             the io exception
      */
     protected synchronized void populate() throws IOException {
-        if (created_at != null) {
+        if (super.getCreatedAt() != null) {
             return; // already populated
         }
         if (root == null || root.isOffline()) {
             return; // cannot populate, will have to live with what we have
         }
-        root.createRequest().withUrlPath(url).fetchInto(this);
+        URL url = getUrl();
+        if (url != null) {
+            root.createRequest().setRawUrlPath(url.toString()).fetchInto(this);
+        }
     }
 
     /**
@@ -112,29 +118,27 @@ public abstract class GHPerson extends GHObject {
      */
     @Deprecated
     public synchronized Iterable<List<GHRepository>> iterateRepositories(final int pageSize) {
-        return new Iterable<List<GHRepository>>() {
-            public Iterator<List<GHRepository>> iterator() {
-                final Iterator<GHRepository[]> pager = root.createRequest()
-                        .withUrlPath("users", login, "repos")
-                        .asIterator(GHRepository[].class, pageSize);
-
-                return new Iterator<List<GHRepository>>() {
-                    public boolean hasNext() {
-                        return pager.hasNext();
-                    }
-
-                    public List<GHRepository> next() {
-                        GHRepository[] batch = pager.next();
-                        for (GHRepository r : batch)
-                            r.root = root;
-                        return Arrays.asList(batch);
-                    }
-
-                    public void remove() {
-                        throw new UnsupportedOperationException();
-                    }
-                };
+        return () -> {
+            final PagedIterator<GHRepository> pager;
+            try {
+                GitHubPageIterator<GHRepository[]> iterator = GitHubPageIterator.create(root.getClient(),
+                        GHRepository[].class,
+                        root.createRequest().withUrlPath("users", login, "repos").build(),
+                        pageSize);
+                pager = new PagedIterator<>(iterator, item -> item.wrap(root));
+            } catch (MalformedURLException e) {
+                throw new GHException("Unable to build GitHub API URL", e);
             }
+
+            return new Iterator<List<GHRepository>>() {
+                public boolean hasNext() {
+                    return pager.hasNext();
+                }
+
+                public List<GHRepository> next() {
+                    return pager.nextPage();
+                }
+            };
         };
     }
 
@@ -149,10 +153,7 @@ public abstract class GHPerson extends GHObject {
      */
     public GHRepository getRepository(String name) throws IOException {
         try {
-            return root.createRequest()
-                    .withUrlPath("/repos/" + login + '/' + name)
-                    .fetch(GHRepository.class)
-                    .wrap(root);
+            return GHRepository.read(root, login, name);
         } catch (FileNotFoundException e) {
             return null;
         }
@@ -173,22 +174,18 @@ public abstract class GHPerson extends GHObject {
      * @return the gravatar id
      * @deprecated No longer available in the v3 API.
      */
+    @Deprecated
     public String getGravatarId() {
-        return gravatar_id;
+        return "";
     }
 
     /**
-     * Returns a string like 'https://secure.gravatar.com/avatar/0cb9832a01c22c083390f3c5dcb64105' that indicates the
-     * avatar image URL.
+     * Returns a string of the avatar image URL.
      *
      * @return the avatar url
      */
     public String getAvatarUrl() {
-        if (avatar_url != null)
-            return avatar_url;
-        if (gravatar_id != null)
-            return "https://secure.gravatar.com/avatar/" + gravatar_id;
-        return null;
+        return avatar_url;
     }
 
     /**
@@ -236,6 +233,18 @@ public abstract class GHPerson extends GHObject {
         return location;
     }
 
+    /**
+     * Gets the Twitter Username of this user, like "GitHub"
+     *
+     * @return the Twitter username
+     * @throws IOException
+     *             the io exception
+     */
+    public String getTwitterUsername() throws IOException {
+        populate();
+        return twitter_username;
+    }
+
     public Date getCreatedAt() throws IOException {
         populate();
         return super.getCreatedAt();
@@ -260,7 +269,7 @@ public abstract class GHPerson extends GHObject {
 
     @Override
     public URL getHtmlUrl() {
-        return GitHub.parseURL(html_url);
+        return GitHubClient.parseURL(html_url);
     }
 
     /**
@@ -346,4 +355,16 @@ public abstract class GHPerson extends GHObject {
         populate();
         return site_admin;
     }
+
+    /**
+     * Gets total private repo count.
+     *
+     * @return the total private repo count
+     * @throws IOException
+     *             the io exception
+     */
+    public Optional<Integer> getTotalPrivateRepoCount() throws IOException {
+        populate();
+        return Optional.ofNullable(total_private_repos);
+    }
 }

src/main/java/org/kohsuke/github/GHProject.java

@@ -28,7 +28,7 @@ import java.io.IOException;
 import java.net.URL;
 import java.util.Locale;
 
-import static org.kohsuke.github.Previews.INERTIA;
+import static org.kohsuke.github.internal.Previews.INERTIA;
 
 /**
  * A GitHub project.
@@ -37,12 +37,10 @@ import static org.kohsuke.github.Previews.INERTIA;
  * @see <a href="https://developer.github.com/v3/projects/">Projects</a>
  */
 public class GHProject extends GHObject {
-    protected GitHub root;
     protected GHObject owner;
 
     private String owner_url;
     private String html_url;
-    private String node_id;
     private String name;
     private String body;
     private int number;
@@ -51,7 +49,7 @@ public class GHProject extends GHObject {
 
     @Override
     public URL getHtmlUrl() throws IOException {
-        return GitHub.parseURL(html_url);
+        return GitHubClient.parseURL(html_url);
     }
 
     /**
@@ -81,10 +79,8 @@ public class GHProject extends GHObject {
                 } else if (owner_url.contains("/users/")) {
                     owner = root.createRequest().withUrlPath(getOwnerUrl().getPath()).fetch(GHUser.class).wrapUp(root);
                 } else if (owner_url.contains("/repos/")) {
-                    owner = root.createRequest()
-                            .withUrlPath(getOwnerUrl().getPath())
-                            .fetch(GHRepository.class)
-                            .wrap(root);
+                    String[] pathElements = getOwnerUrl().getPath().split("/");
+                    owner = GHRepository.read(root, pathElements[1], pathElements[2]);
                 }
             } catch (FileNotFoundException e) {
                 return null;
@@ -99,16 +95,18 @@ public class GHProject extends GHObject {
      * @return the owner url
      */
     public URL getOwnerUrl() {
-        return GitHub.parseURL(owner_url);
+        return GitHubClient.parseURL(owner_url);
     }
 
     /**
      * Gets node id.
      *
+     * @deprecated Use {@link GHObject#getNodeId()}
      * @return the node id
      */
+    @Deprecated
     public String getNode_id() {
-        return node_id;
+        return getNodeId();
     }
 
     /**
@@ -191,7 +189,7 @@ public class GHProject extends GHObject {
      * @return the api route
      */
     protected String getApiRoute() {
-        return "/projects/" + id;
+        return "/projects/" + getId();
     }
 
     /**
@@ -290,7 +288,7 @@ public class GHProject extends GHObject {
         final GHProject project = this;
         return root.createRequest()
                 .withPreview(INERTIA)
-                .withUrlPath(String.format("/projects/%d/columns", id))
+                .withUrlPath(String.format("/projects/%d/columns", getId()))
                 .toIterable(GHProjectColumn[].class, item -> item.wrap(project));
     }
 
@@ -308,8 +306,8 @@ public class GHProject extends GHObject {
                 .method("POST")
                 .withPreview(INERTIA)
                 .with("name", name)
-                .withUrlPath(String.format("/projects/%d/columns", id))
+                .withUrlPath(String.format("/projects/%d/columns", getId()))
                 .fetch(GHProjectColumn.class)
                 .wrap(this);
     }
-}
+}

src/main/java/org/kohsuke/github/GHProjectCard.java

@@ -6,7 +6,7 @@ import java.io.FileNotFoundException;
 import java.io.IOException;
 import java.net.URL;
 
-import static org.kohsuke.github.Previews.INERTIA;
+import static org.kohsuke.github.internal.Previews.INERTIA;
 
 /**
  * The type GHProjectCard.
@@ -14,7 +14,6 @@ import static org.kohsuke.github.Previews.INERTIA;
  * @author Gunnar Skjold
  */
 public class GHProjectCard extends GHObject {
-    private GitHub root;
     private GHProject project;
     private GHProjectColumn column;
 
@@ -149,7 +148,7 @@ public class GHProjectCard extends GHObject {
      * @return the content url
      */
     public URL getContentUrl() {
-        return GitHub.parseURL(content_url);
+        return GitHubClient.parseURL(content_url);
     }
 
     /**
@@ -158,7 +157,7 @@ public class GHProjectCard extends GHObject {
      * @return the project url
      */
     public URL getProjectUrl() {
-        return GitHub.parseURL(project_url);
+        return GitHubClient.parseURL(project_url);
     }
 
     /**
@@ -167,7 +166,7 @@ public class GHProjectCard extends GHObject {
      * @return the column url
      */
     public URL getColumnUrl() {
-        return GitHub.parseURL(column_url);
+        return GitHubClient.parseURL(column_url);
     }
 
     /**
@@ -213,7 +212,7 @@ public class GHProjectCard extends GHObject {
      * @return the api route
      */
     protected String getApiRoute() {
-        return String.format("/projects/columns/cards/%d", id);
+        return String.format("/projects/columns/cards/%d", getId());
     }
 
     /**

src/main/java/org/kohsuke/github/GHProjectColumn.java

@@ -4,7 +4,7 @@ import java.io.FileNotFoundException;
 import java.io.IOException;
 import java.net.URL;
 
-import static org.kohsuke.github.Previews.INERTIA;
+import static org.kohsuke.github.internal.Previews.INERTIA;
 
 /**
  * The type GHProjectColumn.
@@ -12,7 +12,6 @@ import static org.kohsuke.github.Previews.INERTIA;
  * @author Gunnar Skjold
  */
 public class GHProjectColumn extends GHObject {
-    protected GitHub root;
     protected GHProject project;
 
     private String name;
@@ -90,7 +89,7 @@ public class GHProjectColumn extends GHObject {
      * @return the project url
      */
     public URL getProjectUrl() {
-        return GitHub.parseURL(project_url);
+        return GitHubClient.parseURL(project_url);
     }
 
     /**
@@ -115,7 +114,7 @@ public class GHProjectColumn extends GHObject {
      * @return the api route
      */
     protected String getApiRoute() {
-        return String.format("/projects/columns/%d", id);
+        return String.format("/projects/columns/%d", getId());
     }
 
     /**
@@ -139,7 +138,7 @@ public class GHProjectColumn extends GHObject {
         final GHProjectColumn column = this;
         return root.createRequest()
                 .withPreview(INERTIA)
-                .withUrlPath(String.format("/projects/columns/%d/cards", id))
+                .withUrlPath(String.format("/projects/columns/%d/cards", getId()))
                 .toIterable(GHProjectCard[].class, item -> item.wrap(column));
     }
 
@@ -157,7 +156,7 @@ public class GHProjectColumn extends GHObject {
                 .method("POST")
                 .withPreview(INERTIA)
                 .with("note", note)
-                .withUrlPath(String.format("/projects/columns/%d/cards", id))
+                .withUrlPath(String.format("/projects/columns/%d/cards", getId()))
                 .fetch(GHProjectCard.class)
                 .wrap(this);
     }
@@ -177,7 +176,7 @@ public class GHProjectColumn extends GHObject {
                 .withPreview(INERTIA)
                 .with("content_type", issue instanceof GHPullRequest ? "PullRequest" : "Issue")
                 .with("content_id", issue.getId())
-                .withUrlPath(String.format("/projects/columns/%d/cards", id))
+                .withUrlPath(String.format("/projects/columns/%d/cards", getId()))
                 .fetch(GHProjectCard.class)
                 .wrap(this);
     }

src/main/java/org/kohsuke/github/GHPullRequest.java

@@ -23,18 +23,21 @@
  */
 package org.kohsuke.github;
 
+import org.apache.commons.lang3.StringUtils;
+
 import java.io.IOException;
 import java.net.URL;
 import java.util.ArrayList;
 import java.util.Arrays;
-import java.util.Collection;
 import java.util.Collections;
 import java.util.Date;
 import java.util.List;
+import java.util.Objects;
 
 import javax.annotation.CheckForNull;
 
-import static org.kohsuke.github.Previews.SHADOW_CAT;
+import static org.kohsuke.github.internal.Previews.LYDIAN;
+import static org.kohsuke.github.internal.Previews.SHADOW_CAT;
 
 /**
  * A pull request.
@@ -69,13 +72,6 @@ public class GHPullRequest extends GHIssue implements Refreshable {
     private GHUser[] requested_reviewers;
     private GHTeam[] requested_teams;
 
-    /**
-     * GitHub doesn't return some properties of {@link GHIssue} when requesting the GET on the 'pulls' API route as
-     * opposed to 'issues' API route. This flag remembers whether we made the GET call on the 'issues' route on this
-     * object to fill in those missing details
-     */
-    private transient boolean fetchedIssueDetails;
-
     GHPullRequest wrapUp(GHRepository owner) {
         this.wrap(owner);
         return wrapUp(owner.root);
@@ -99,6 +95,12 @@ public class GHPullRequest extends GHIssue implements Refreshable {
 
     @Override
     protected String getApiRoute() {
+        if (owner == null) {
+            // Issues returned from search to do not have an owner. Attempt to use url.
+            final URL url = Objects.requireNonNull(getUrl(), "Missing instance URL!");
+            return StringUtils.prependIfMissing(url.toString().replace(root.getApiUrl(), ""), "/");
+
+        }
         return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/pulls/" + number;
     }
 
@@ -108,7 +110,7 @@ public class GHPullRequest extends GHIssue implements Refreshable {
      * @return the patch url
      */
     public URL getPatchUrl() {
-        return GitHub.parseURL(patch_url);
+        return GitHubClient.parseURL(patch_url);
     }
 
     /**
@@ -117,7 +119,7 @@ public class GHPullRequest extends GHIssue implements Refreshable {
      * @return the issue url
      */
     public URL getIssueUrl() {
-        return GitHub.parseURL(issue_url);
+        return GitHubClient.parseURL(issue_url);
     }
 
     /**
@@ -156,7 +158,7 @@ public class GHPullRequest extends GHIssue implements Refreshable {
      * @return the diff url
      */
     public URL getDiffUrl() {
-        return GitHub.parseURL(diff_url);
+        return GitHubClient.parseURL(diff_url);
     }
 
     /**
@@ -165,13 +167,7 @@ public class GHPullRequest extends GHIssue implements Refreshable {
      * @return the merged at
      */
     public Date getMergedAt() {
-        return GitHub.parseDate(merged_at);
-    }
-
-    @Override
-    public Collection<GHLabel> getLabels() throws IOException {
-        fetchIssue();
-        return super.getLabels();
+        return GitHubClient.parseDate(merged_at);
     }
 
     @Override
@@ -381,10 +377,14 @@ public class GHPullRequest extends GHIssue implements Refreshable {
      * Repopulates this object.
      */
     public void refresh() throws IOException {
-        if (root.isOffline()) {
+        if (root == null || root.isOffline()) {
             return; // cannot populate, will have to live with what we have
         }
-        root.createRequest().withPreview(SHADOW_CAT).withUrlPath(url).fetchInto(this).wrapUp(owner);
+
+        URL url = getUrl();
+        if (url != null) {
+            root.createRequest().withPreview(SHADOW_CAT).setRawUrlPath(url.toString()).fetchInto(this).wrapUp(owner);
+        }
     }
 
     /**
@@ -447,6 +447,7 @@ public class GHPullRequest extends GHIssue implements Refreshable {
      *             the io exception
      * @deprecated Use {@link #createReview()}
      */
+    @Deprecated
     public GHPullRequestReview createReview(String body,
             @CheckForNull GHPullRequestReviewState event,
             GHPullRequestReviewComment... comments) throws IOException {
@@ -467,6 +468,7 @@ public class GHPullRequest extends GHIssue implements Refreshable {
      *             the io exception
      * @deprecated Use {@link #createReview()}
      */
+    @Deprecated
     public GHPullRequestReview createReview(String body,
             @CheckForNull GHPullRequestReviewState event,
             List<GHPullRequestReviewComment> comments) throws IOException {
@@ -550,6 +552,41 @@ public class GHPullRequest extends GHIssue implements Refreshable {
                 .send();
     }
 
+    /**
+     * Set the base branch on the pull request
+     *
+     * @param newBaseBranch
+     *            the name of the new base branch
+     * @throws IOException
+     *             the io exception
+     * @return the updated pull request
+     */
+    public GHPullRequest setBaseBranch(String newBaseBranch) throws IOException {
+        return root.createRequest()
+                .method("PATCH")
+                .with("base", newBaseBranch)
+                .withUrlPath(getApiRoute())
+                .fetch(GHPullRequest.class)
+                .wrapUp(root);
+    }
+
+    /**
+     * Updates the branch. The same as pressing the button in the web GUI.
+     *
+     * @throws IOException
+     *             the io exception
+     */
+    @Preview(LYDIAN)
+    @Deprecated
+    public void updateBranch() throws IOException {
+        root.createRequest()
+                .withPreview(LYDIAN)
+                .method("PUT")
+                .with("expected_head_sha", head.getSha())
+                .withUrlPath(getApiRoute() + "/update-branch")
+                .send();
+    }
+
     /**
      * Merge this pull request.
      * <p>
@@ -611,10 +648,4 @@ public class GHPullRequest extends GHIssue implements Refreshable {
         MERGE, SQUASH, REBASE
     }
 
-    private void fetchIssue() throws IOException {
-        if (!fetchedIssueDetails) {
-            root.createRequest().withUrlPath(getIssuesApiRoute()).fetchInto(this);
-            fetchedIssueDetails = true;
-        }
-    }
 }

src/main/java/org/kohsuke/github/GHPullRequestChanges.java

@@ -0,0 +1,86 @@
+package org.kohsuke.github;
+
+import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
+
+/**
+ * Wrapper to define changed fields on pull_request action="edited"
+ *
+ * @see GHEventPayload.PullRequest
+ */
+@SuppressFBWarnings("UWF_UNWRITTEN_FIELD")
+public class GHPullRequestChanges {
+
+    private GHCommitPointer base;
+    private GHFrom title;
+    private GHFrom body;
+
+    /**
+     * Old target branch for pull request.
+     *
+     * @return old target branch info (or null if not changed)
+     */
+    public GHCommitPointer getBase() {
+        return base;
+    }
+
+    /**
+     * Old pull request title.
+     *
+     * @return old pull request title (or null if not changed)
+     */
+    public GHFrom getTitle() {
+        return title;
+    }
+
+    /**
+     * Old pull request body.
+     *
+     * @return old pull request body (or null if not changed)
+     */
+    public GHFrom getBody() {
+        return body;
+    }
+
+    /**
+     * @see org.kohsuke.github.GHCommitPointer
+     */
+    public static class GHCommitPointer {
+        private GHFrom ref;
+        private GHFrom sha;
+
+        /**
+         * Named ref to the commit. This (from value) appears to be a "short ref" that doesn't include "refs/heads/"
+         * portion.
+         *
+         * @return the ref
+         */
+        public GHFrom getRef() {
+            return ref;
+        }
+
+        /**
+         * SHA1 of the commit.
+         *
+         * @return sha
+         */
+        public GHFrom getSha() {
+            return sha;
+        }
+    }
+
+    /**
+     * Wrapper for changed values.
+     */
+    public static class GHFrom {
+        private String from;
+
+        /**
+         * Previous value that was changed.
+         *
+         * @return previous value
+         */
+        public String getFrom() {
+            return from;
+        }
+    }
+}

src/main/java/org/kohsuke/github/GHPullRequestCommitDetail.java

@@ -75,7 +75,7 @@ public class GHPullRequestCommitDetail {
          * @return the url
          */
         public URL getUrl() {
-            return GitHub.parseURL(url);
+            return GitHubClient.parseURL(url);
         }
     }
 
@@ -125,7 +125,7 @@ public class GHPullRequestCommitDetail {
          * @return the url
          */
         public URL getUrl() {
-            return GitHub.parseURL(url);
+            return GitHubClient.parseURL(url);
         }
 
         /**
@@ -161,7 +161,7 @@ public class GHPullRequestCommitDetail {
          * @return the url
          */
         public URL getUrl() {
-            return GitHub.parseURL(url);
+            return GitHubClient.parseURL(url);
         }
 
         /**
@@ -170,7 +170,7 @@ public class GHPullRequestCommitDetail {
          * @return the html url
          */
         public URL getHtml_url() {
-            return GitHub.parseURL(html_url);
+            return GitHubClient.parseURL(html_url);
         }
 
         /**
@@ -214,7 +214,7 @@ public class GHPullRequestCommitDetail {
      * @return the api url
      */
     public URL getApiUrl() {
-        return GitHub.parseURL(url);
+        return GitHubClient.parseURL(url);
     }
 
     /**
@@ -223,7 +223,7 @@ public class GHPullRequestCommitDetail {
      * @return the url
      */
     public URL getUrl() {
-        return GitHub.parseURL(html_url);
+        return GitHubClient.parseURL(html_url);
     }
 
     /**
@@ -232,7 +232,7 @@ public class GHPullRequestCommitDetail {
      * @return the comments url
      */
     public URL getCommentsUrl() {
-        return GitHub.parseURL(comments_url);
+        return GitHubClient.parseURL(comments_url);
     }
 
     /**

src/main/java/org/kohsuke/github/GHPullRequestFileDetail.java

@@ -105,7 +105,7 @@ public class GHPullRequestFileDetail {
      * @return the blob url
      */
     public URL getBlobUrl() {
-        return GitHub.parseURL(blob_url);
+        return GitHubClient.parseURL(blob_url);
     }
 
     /**
@@ -114,7 +114,7 @@ public class GHPullRequestFileDetail {
      * @return the raw url
      */
     public URL getRawUrl() {
-        return GitHub.parseURL(raw_url);
+        return GitHubClient.parseURL(raw_url);
     }
 
     /**
@@ -123,7 +123,7 @@ public class GHPullRequestFileDetail {
      * @return the contents url
      */
     public URL getContentsUrl() {
-        return GitHub.parseURL(contents_url);
+        return GitHubClient.parseURL(contents_url);
     }
 
     /**

src/main/java/org/kohsuke/github/GHPullRequestQueryBuilder.java

@@ -1,6 +1,6 @@
 package org.kohsuke.github;
 
-import static org.kohsuke.github.Previews.SHADOW_CAT;
+import static org.kohsuke.github.internal.Previews.SHADOW_CAT;
 
 /**
  * Lists up pull requests with some filtering and sorting.

src/main/java/org/kohsuke/github/GHPullRequestReview.java

@@ -46,6 +46,7 @@ public class GHPullRequestReview extends GHObject {
     private String commit_id;
     private GHPullRequestReviewState state;
     private String submitted_at;
+    private String html_url;
 
     GHPullRequestReview wrapUp(GHPullRequest owner) {
         this.owner = owner;
@@ -102,7 +103,7 @@ public class GHPullRequestReview extends GHObject {
 
     @Override
     public URL getHtmlUrl() {
-        return null;
+        return GitHubClient.parseURL(html_url);
     }
 
     /**
@@ -111,7 +112,7 @@ public class GHPullRequestReview extends GHObject {
      * @return the api route
      */
     protected String getApiRoute() {
-        return owner.getApiRoute() + "/reviews/" + id;
+        return owner.getApiRoute() + "/reviews/" + getId();
     }
 
     /**
@@ -122,7 +123,7 @@ public class GHPullRequestReview extends GHObject {
      *             the io exception
      */
     public Date getSubmittedAt() throws IOException {
-        return GitHub.parseDate(submitted_at);
+        return GitHubClient.parseDate(submitted_at);
     }
 
     /**
@@ -145,6 +146,7 @@ public class GHPullRequestReview extends GHObject {
      * @deprecated Former preview method that changed when it got public. Left here for backward compatibility. Use
      *             {@link #submit(String, GHPullRequestReviewEvent)}
      */
+    @Deprecated
     public void submit(String body, GHPullRequestReviewState state) throws IOException {
         submit(body, state.toEvent());
     }

src/main/java/org/kohsuke/github/GHPullRequestReviewComment.java

@@ -28,7 +28,7 @@ import java.net.URL;
 
 import javax.annotation.CheckForNull;
 
-import static org.kohsuke.github.Previews.*;
+import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
 
 /**
  * Review comment to the pull request
@@ -44,6 +44,7 @@ public class GHPullRequestReviewComment extends GHObject implements Reactable {
     private String body;
     private GHUser user;
     private String path;
+    private String html_url;
     private int position = -1;
     private int original_position = -1;
     private long in_reply_to_id = -1L;
@@ -60,6 +61,7 @@ public class GHPullRequestReviewComment extends GHObject implements Reactable {
      * @return the gh pull request review comment
      * @deprecated You should be using {@link GHPullRequestReviewBuilder#comment(String, String, int)}
      */
+    @Deprecated
     public static GHPullRequestReviewComment draft(String body, String path, int position) {
         GHPullRequestReviewComment result = new GHPullRequestReviewComment();
         result.body = body;
@@ -142,7 +144,7 @@ public class GHPullRequestReviewComment extends GHObject implements Reactable {
 
     @Override
     public URL getHtmlUrl() {
-        return null;
+        return GitHubClient.parseURL(html_url);
     }
 
     /**
@@ -151,7 +153,20 @@ public class GHPullRequestReviewComment extends GHObject implements Reactable {
      * @return the api route
      */
     protected String getApiRoute() {
-        return "/repos/" + owner.getRepository().getFullName() + "/pulls/comments/" + id;
+        return getApiRoute(false);
+    }
+
+    /**
+     * Gets api route.
+     *
+     * @param includePullNumber
+     *            if true, includes the owning pull request's number in the route.
+     *
+     * @return the api route
+     */
+    protected String getApiRoute(boolean includePullNumber) {
+        return "/repos/" + owner.getRepository().getFullName() + "/pulls"
+                + (includePullNumber ? "/" + owner.getNumber() : "") + "/comments/" + getId();
     }
 
     /**
@@ -190,13 +205,12 @@ public class GHPullRequestReviewComment extends GHObject implements Reactable {
         return owner.root.createRequest()
                 .method("POST")
                 .with("body", body)
-                .with("in_reply_to", getId())
-                .withUrlPath(getApiRoute() + "/comments")
+                .withUrlPath(getApiRoute(true) + "/replies")
                 .fetch(GHPullRequestReviewComment.class)
                 .wrapUp(owner);
     }
 
-    @Preview
+    @Preview(SQUIRREL_GIRL)
     @Deprecated
     public GHReaction createReaction(ReactionContent content) throws IOException {
         return owner.root.createRequest()
@@ -208,7 +222,7 @@ public class GHPullRequestReviewComment extends GHObject implements Reactable {
                 .wrap(owner.root);
     }
 
-    @Preview
+    @Preview(SQUIRREL_GIRL)
     @Deprecated
     public PagedIterable<GHReaction> listReactions() {
         return owner.root.createRequest()

src/main/java/org/kohsuke/github/GHQueryBuilder.java

@@ -7,8 +7,7 @@ package org.kohsuke.github;
  *            the type parameter
  * @author Kohsuke Kawaguchi
  */
-public abstract class GHQueryBuilder<T> {
-    protected final GitHub root;
+public abstract class GHQueryBuilder<T> extends GitHubInteractiveObject {
     protected final Requester req;
 
     GHQueryBuilder(GitHub root) {

src/main/java/org/kohsuke/github/GHRateLimit.java

@@ -1,10 +1,12 @@
 package org.kohsuke.github;
 
+import com.fasterxml.jackson.annotation.JacksonInject;
 import com.fasterxml.jackson.annotation.JsonCreator;
 import com.fasterxml.jackson.annotation.JsonProperty;
 import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
 import org.apache.commons.lang3.StringUtils;
 
+import java.time.Duration;
 import java.time.ZonedDateTime;
 import java.time.format.DateTimeFormatter;
 import java.time.format.DateTimeParseException;
@@ -28,7 +30,7 @@ public class GHRateLimit {
     /**
      * Remaining calls that can be made.
      *
-     * @deprecated This value should never have been made public. Use {@link #getRemaining()}
+     * @deprecated This field should never have been made public. Use {@link #getRemaining()}
      */
     @Deprecated
     public int remaining;
@@ -36,7 +38,7 @@ public class GHRateLimit {
     /**
      * Allotted API call per hour.
      *
-     * @deprecated This value should never have been made public. Use {@link #getLimit()}
+     * @deprecated This field should never have been made public. Use {@link #getLimit()}
      */
     @Deprecated
     public int limit;
@@ -47,7 +49,7 @@ public class GHRateLimit {
      * date. To use this field in any meaningful way, it must be converted to a long using {@link Date#getTime()}
      * multiplied by 1000.
      *
-     * @deprecated This value should never have been made public. Use {@link #getResetDate()}
+     * @deprecated This field should never have been made public. Use {@link #getResetDate()}
      */
     @Deprecated
     public Date reset;
@@ -64,17 +66,58 @@ public class GHRateLimit {
     @Nonnull
     private final Record integrationManifest;
 
+    /**
+     * The default GHRateLimit provided to new {@link GitHubClient}s.
+     *
+     * Contains all expired records that will cause {@link GitHubClient#rateLimit(RateLimitTarget)} to refresh with new
+     * data when called.
+     *
+     * Private, but made internal for testing.
+     */
     @Nonnull
-    static GHRateLimit Unknown() {
-        return new GHRateLimit(new UnknownLimitRecord(),
-                new UnknownLimitRecord(),
-                new UnknownLimitRecord(),
-                new UnknownLimitRecord());
-    }
+    static final GHRateLimit DEFAULT = new GHRateLimit(UnknownLimitRecord.DEFAULT,
+            UnknownLimitRecord.DEFAULT,
+            UnknownLimitRecord.DEFAULT,
+            UnknownLimitRecord.DEFAULT);
 
+    /**
+     * Creates a new {@link GHRateLimit} from a single record for the specified endpoint with place holders for other
+     * records.
+     *
+     * This is used to create {@link GHRateLimit} instances that can merged with other instances.
+     *
+     * @param record
+     *            the rate limit record. Can be a regular {@link Record} constructed from header information or an
+     *            {@link UnknownLimitRecord} placeholder.
+     * @param rateLimitTarget
+     *            which rate limit record to fill
+     * @return a new {@link GHRateLimit} instance containing the supplied record
+     */
     @Nonnull
-    static GHRateLimit fromHeaderRecord(Record header) {
-        return new GHRateLimit(header, new UnknownLimitRecord(), new UnknownLimitRecord(), new UnknownLimitRecord());
+    static GHRateLimit fromRecord(@Nonnull Record record, @Nonnull RateLimitTarget rateLimitTarget) {
+        if (rateLimitTarget == RateLimitTarget.CORE || rateLimitTarget == RateLimitTarget.NONE) {
+            return new GHRateLimit(record,
+                    UnknownLimitRecord.DEFAULT,
+                    UnknownLimitRecord.DEFAULT,
+                    UnknownLimitRecord.DEFAULT);
+        } else if (rateLimitTarget == RateLimitTarget.SEARCH) {
+            return new GHRateLimit(UnknownLimitRecord.DEFAULT,
+                    record,
+                    UnknownLimitRecord.DEFAULT,
+                    UnknownLimitRecord.DEFAULT);
+        } else if (rateLimitTarget == RateLimitTarget.GRAPHQL) {
+            return new GHRateLimit(UnknownLimitRecord.DEFAULT,
+                    UnknownLimitRecord.DEFAULT,
+                    record,
+                    UnknownLimitRecord.DEFAULT);
+        } else if (rateLimitTarget == RateLimitTarget.INTEGRATION_MANIFEST) {
+            return new GHRateLimit(UnknownLimitRecord.DEFAULT,
+                    UnknownLimitRecord.DEFAULT,
+                    UnknownLimitRecord.DEFAULT,
+                    record);
+        } else {
+            throw new IllegalArgumentException("Unknown rate limit target: " + rateLimitTarget.toString());
+        }
     }
 
     @JsonCreator
@@ -141,7 +184,7 @@ public class GHRateLimit {
     }
 
     /**
-     * Whether the rate limit reset date for this instance has passed.
+     * Whether the reset date for the Core API rate limit has passed.
      *
      * @return true if the rate limit reset date has passed. Otherwise false.
      * @since 1.100
@@ -151,7 +194,7 @@ public class GHRateLimit {
     }
 
     /**
-     * The core object provides your rate limit status for all non-search-related resources in the REST API.
+     * The core object provides the rate limit status for all non-search-related resources in the REST API.
      *
      * @return a rate limit record
      * @since 1.100
@@ -162,42 +205,43 @@ public class GHRateLimit {
     }
 
     /**
-     * The search object provides your rate limit status for the Search API. TODO: integrate with header limit updating.
-     * Issue #605.
+     * The search record provides the rate limit status for the Search API.
      *
      * @return a rate limit record
+     * @since 1.115
      */
     @Nonnull
-    Record getSearch() {
+    public Record getSearch() {
         return search;
     }
 
     /**
-     * The graphql object provides your rate limit status for the GraphQL API. TODO: integrate with header limit
-     * updating. Issue #605.
+     * The graphql record provides the rate limit status for the GraphQL API.
      *
      * @return a rate limit record
+     * @since 1.115
      */
     @Nonnull
-    Record getGraphQL() {
+    public Record getGraphQL() {
         return graphql;
     }
 
     /**
-     * The integration_manifest object provides your rate limit status for the GitHub App Manifest code conversion
-     * endpoint. TODO: integrate with header limit updating. Issue #605.
+     * The integration manifest record provides the rate limit status for the GitHub App Manifest code conversion
+     * endpoint.
      *
      * @return a rate limit record
+     * @since 1.115
      */
     @Nonnull
-    Record getIntegrationManifest() {
+    public Record getIntegrationManifest() {
         return integrationManifest;
     }
 
     @Override
     public String toString() {
-        return "GHRateLimit {" + "core " + getCore().toString() + "search " + getSearch().toString() + "graphql "
-                + getGraphQL().toString() + "integrationManifest " + getIntegrationManifest().toString() + '}';
+        return "GHRateLimit {" + "core " + getCore().toString() + ", search " + getSearch().toString() + ", graphql "
+                + getGraphQL().toString() + ", integrationManifest " + getIntegrationManifest().toString() + "}";
     }
 
     @Override
@@ -219,23 +263,112 @@ public class GHRateLimit {
         return Objects.hash(getCore(), getSearch(), getGraphQL(), getIntegrationManifest());
     }
 
+    /**
+     * Merge a {@link GHRateLimit} with another one to create a new {@link GHRateLimit} keeping the latest
+     * {@link Record}s from each.
+     *
+     * @param newLimit
+     *            {@link GHRateLimit} with potentially updated {@link Record}s.
+     * @return a merged {@link GHRateLimit} with the latest {@link Record}s from these two instances. If the merged
+     *         instance is equal to the current instance, the current instance is returned.
+     */
+    @Nonnull
+    GHRateLimit getMergedRateLimit(@Nonnull GHRateLimit newLimit) {
+
+        GHRateLimit merged = new GHRateLimit(getCore().currentOrUpdated(newLimit.getCore()),
+                getSearch().currentOrUpdated(newLimit.getSearch()),
+                getGraphQL().currentOrUpdated(newLimit.getGraphQL()),
+                getIntegrationManifest().currentOrUpdated(newLimit.getIntegrationManifest()));
+
+        if (merged.equals(this)) {
+            merged = this;
+        }
+
+        return merged;
+    }
+
+    /**
+     * Gets the specified {@link Record}.
+     *
+     * {@link RateLimitTarget#NONE} will return {@link UnknownLimitRecord#DEFAULT} to prevent any clients from
+     * accidentally waiting on that record to reset before continuing.
+     *
+     * @param rateLimitTarget
+     *            the target rate limit record
+     * @return the target {@link Record} from this instance.
+     */
+    @Nonnull
+    Record getRecord(@Nonnull RateLimitTarget rateLimitTarget) {
+        if (rateLimitTarget == RateLimitTarget.CORE) {
+            return getCore();
+        } else if (rateLimitTarget == RateLimitTarget.SEARCH) {
+            return getSearch();
+        } else if (rateLimitTarget == RateLimitTarget.GRAPHQL) {
+            return getGraphQL();
+        } else if (rateLimitTarget == RateLimitTarget.INTEGRATION_MANIFEST) {
+            return getIntegrationManifest();
+        } else if (rateLimitTarget == RateLimitTarget.NONE) {
+            return UnknownLimitRecord.DEFAULT;
+        } else {
+            throw new IllegalArgumentException("Unknown rate limit target: " + rateLimitTarget.toString());
+        }
+    }
+
     /**
      * A limit record used as a placeholder when the the actual limit is not known.
-     * <p>
-     * Has a large limit and long duration so that it will doesn't expire too often.
      *
      * @since 1.100
      */
     public static class UnknownLimitRecord extends Record {
 
-        // One hour
-        private static final long unknownLimitResetSeconds = 60L * 60L;
+        private static final long defaultUnknownLimitResetSeconds = Duration.ofSeconds(30).getSeconds();
+
+        /**
+         * The number of seconds until a {@link UnknownLimitRecord} will expire.
+         *
+         * This is set to a somewhat short duration, rather than a long one. This avoids
+         * {@link {@link GitHubClient#rateLimit(RateLimitTarget)}} requesting rate limit updates continuously, but also
+         * avoids holding on to stale unknown records indefinitely.
+         *
+         * When merging {@link GHRateLimit} instances, {@link UnknownLimitRecord}s will be superseded by incoming
+         * regular {@link Record}s.
+         *
+         * @see GHRateLimit#getMergedRateLimit(GHRateLimit)
+         */
+        static long unknownLimitResetSeconds = defaultUnknownLimitResetSeconds;
 
         static final int unknownLimit = 1000000;
         static final int unknownRemaining = 999999;
 
-        private UnknownLimitRecord() {
-            super(unknownLimit, unknownRemaining, System.currentTimeMillis() / 1000L + unknownLimitResetSeconds);
+        // The default UnknownLimitRecord is an expired record.
+        private static final UnknownLimitRecord DEFAULT = new UnknownLimitRecord(Long.MIN_VALUE);
+
+        // The starting current UnknownLimitRecord is an expired record.
+        private static UnknownLimitRecord current = DEFAULT;
+
+        /**
+         * Create a new unknown record that resets at the specified time.
+         *
+         * @param resetEpochSeconds
+         *            the epoch second time when this record will expire.
+         */
+        private UnknownLimitRecord(long resetEpochSeconds) {
+            super(unknownLimit, unknownRemaining, resetEpochSeconds);
+        }
+
+        static synchronized Record current() {
+            if (current.isExpired()) {
+                current = new UnknownLimitRecord(System.currentTimeMillis() / 1000L + unknownLimitResetSeconds);
+            }
+            return current;
+        }
+
+        /**
+         * Reset the current UnknownLimitRecord. For use during testing only.
+         */
+        static synchronized void reset() {
+            current = DEFAULT;
+            unknownLimitResetSeconds = defaultUnknownLimitResetSeconds;
         }
     }
 
@@ -251,7 +384,7 @@ public class GHRateLimit {
         private final int remaining;
 
         /**
-         * Allotted API call per hour.
+         * Allotted API call per time period.
          */
         private final int limit;
 
@@ -266,11 +399,14 @@ public class GHRateLimit {
         private final long createdAtEpochSeconds = System.currentTimeMillis() / 1000;
 
         /**
-         * The calculated time at which the rate limit will reset. Recalculated if {@link #recalculateResetDate} is
-         * called.
+         * The date at which the rate limit will reset, adjusted to local machine time if the local machine's clock not
+         * synchronized with to the same clock as the GitHub server.
+         *
+         * @see #calculateResetDate(String)
+         * @see #getResetDate()
          */
         @Nonnull
-        private Date resetDate;
+        private final Date resetDate;
 
         /**
          * Instantiates a new Record.
@@ -282,7 +418,6 @@ public class GHRateLimit {
          * @param resetEpochSeconds
          *            the reset epoch seconds
          */
-        @JsonCreator
         public Record(@JsonProperty(value = "limit", required = true) int limit,
                 @JsonProperty(value = "remaining", required = true) int remaining,
                 @JsonProperty(value = "reset", required = true) long resetEpochSeconds) {
@@ -290,7 +425,7 @@ public class GHRateLimit {
         }
 
         /**
-         * Instantiates a new Record.
+         * Instantiates a new Record. Called by Jackson data binding or during header parsing.
          *
          * @param limit
          *            the limit
@@ -298,26 +433,99 @@ public class GHRateLimit {
          *            the remaining
          * @param resetEpochSeconds
          *            the reset epoch seconds
-         * @param updatedAt
-         *            the updated at
+         * @param responseInfo
+         *            the response info
          */
-        @SuppressFBWarnings(value = "URF_UNREAD_PUBLIC_OR_PROTECTED_FIELD", justification = "Deprecated")
-        public Record(int limit, int remaining, long resetEpochSeconds, @CheckForNull String updatedAt) {
+        @JsonCreator
+        Record(@JsonProperty(value = "limit", required = true) int limit,
+                @JsonProperty(value = "remaining", required = true) int remaining,
+                @JsonProperty(value = "reset", required = true) long resetEpochSeconds,
+                @JacksonInject @CheckForNull GitHubResponse.ResponseInfo responseInfo) {
             this.limit = limit;
             this.remaining = remaining;
             this.resetEpochSeconds = resetEpochSeconds;
-            this.resetDate = recalculateResetDate(updatedAt);
+            String updatedAt = null;
+            if (responseInfo != null) {
+                updatedAt = responseInfo.headerField("Date");
+            }
+            this.resetDate = calculateResetDate(updatedAt);
         }
 
         /**
-         * Recalculates the reset date using the server response date to calculate a time duration and then add that to
-         * the local created time for this record.
+         * Determine if the current {@link Record} is outdated compared to another. Rate Limit dates are only accurate
+         * to the second, so we look at other information in the record as well.
+         *
+         * {@link Record}s with earlier {@link #getResetEpochSeconds()} are replaced by those with later.
+         * {@link Record}s with the same {@link #getResetEpochSeconds()} are replaced by those with less remaining
+         * count.
+         *
+         * {@link UnknownLimitRecord}s compare with each other like regular {@link Record}s.
+         *
+         * {@link Record}s are replaced by {@link UnknownLimitRecord}s only when the current {@link Record} is expired
+         * and the {@link UnknownLimitRecord} is not. Otherwise Regular {@link Record}s are not replaced by
+         * {@link UnknownLimitRecord}s.
+         *
+         * Expiration is only considered after other checks, meaning expired records may sometimes be replaced by other
+         * expired records.
+         *
+         * @param other
+         *            the other {@link Record}
+         * @return the {@link Record} that is most current
+         */
+        Record currentOrUpdated(@Nonnull Record other) {
+            // This set of checks avoids most calls to isExpired()
+            // Depends on UnknownLimitRecord.current() to prevent continuous updating of GHRateLimit rateLimit()
+            if (getResetEpochSeconds() > other.getResetEpochSeconds()
+                    || (getResetEpochSeconds() == other.getResetEpochSeconds()
+                            && getRemaining() <= other.getRemaining())) {
+                // If the current record has a later reset
+                // or the current record has the same reset and fewer or same requests remaining
+                // Then it is most recent
+                return this;
+            } else if (!(other instanceof UnknownLimitRecord)) {
+                // If the above is not the case that means other has a later reset
+                // or the same resent and fewer requests remaining.
+                // If the other record is not an unknown record, the the other is more recent
+                return other;
+            } else if (this.isExpired() && !other.isExpired()) {
+                // The other is an unknown record.
+                // If the current record has expired and the other hasn't, return the other.
+                return other;
+            }
+
+            // If none of the above, the current record is most valid.
+            return this;
+        }
+
+        /**
+         * Recalculates the {@link #resetDate} relative to the local machine clock.
+         * <p>
+         * {@link RateLimitChecker}s and {@link RateLimitHandler}s use {@link #getResetDate()} to make decisions about
+         * how long to wait for until for the rate limit to reset. That means that {@link #getResetDate()} needs to be
+         * calculated based on the local machine clock.
+         * </p>
+         * <p>
+         * When we say that the clock on two machines is "synchronized", we mean that the UTC time returned from
+         * {@link System#currentTimeMillis()} on each machine is basically the same. For the purposes of rate limits an
+         * differences of up to a second can be ignored.
+         * </p>
+         * <p>
+         * When the clock on the local machine is synchronized to the same time as the clock on the GitHub server (via a
+         * time service for example), the {@link #resetDate} generated directly from {@link #resetEpochSeconds} will be
+         * accurate for the local machine as well.
+         * </p>
+         * <p>
+         * When the clock on the local machine is not synchronized with the server, the {@link #resetDate} must be
+         * recalculated relative to the local machine clock. This is done by taking the number of seconds between the
+         * response "Date" header and {@link #resetEpochSeconds} and then adding that to this record's
+         * {@link #createdAtEpochSeconds}.
          *
          * @param updatedAt
          *            a string date in RFC 1123
          * @return reset date based on the passed date
          */
-        Date recalculateResetDate(@CheckForNull String updatedAt) {
+        @Nonnull
+        private Date calculateResetDate(@CheckForNull String updatedAt) {
             long updatedAtEpochSeconds = createdAtEpochSeconds;
             if (!StringUtils.isBlank(updatedAt)) {
                 try {
@@ -334,7 +542,7 @@ public class GHRateLimit {
             // This may seem odd but it results in an accurate or slightly pessimistic reset date
             // based on system time rather than assuming the system time synchronized with the server
             long calculatedSecondsUntilReset = resetEpochSeconds - updatedAtEpochSeconds;
-            return resetDate = new Date((createdAtEpochSeconds + calculatedSecondsUntilReset) * 1000);
+            return new Date((createdAtEpochSeconds + calculatedSecondsUntilReset) * 1000);
         }
 
         /**
@@ -358,7 +566,12 @@ public class GHRateLimit {
         /**
          * Gets the time in epoch seconds when the rate limit will reset.
          *
-         * @return a long
+         * This is the raw value returned by the server. This value is not adjusted if local machine time is not
+         * synchronized with server time. If attempting to check when the rate limit will reset, use
+         * {@link #getResetDate()} or implement a {@link RateLimitChecker} instead.
+         *
+         * @return a long representing the time in epoch seconds when the rate limit will reset
+         * @see #getResetDate()
          */
         public long getResetEpochSeconds() {
             return resetEpochSeconds;
@@ -367,6 +580,8 @@ public class GHRateLimit {
         /**
          * Whether the rate limit reset date indicated by this instance is expired
          *
+         * If attempting to wait for the rate limit to reset, consider implementing a {@link RateLimitChecker} instead.
+         *
          * @return true if the rate limit reset date has passed. Otherwise false.
          */
         public boolean isExpired() {
@@ -374,7 +589,10 @@ public class GHRateLimit {
         }
 
         /**
-         * Returns the date at which the rate limit will reset.
+         * The date at which the rate limit will reset, adjusted to local machine time if the local machine's clock not
+         * synchronized with to the same clock as the GitHub server.
+         *
+         * If attempting to wait for the rate limit to reset, consider implementing a {@link RateLimitChecker} instead.
          *
          * @return the calculated date at which the rate limit has or will reset.
          */

src/main/java/org/kohsuke/github/GHReaction.java

@@ -3,7 +3,7 @@ package org.kohsuke.github;
 import java.io.IOException;
 import java.net.URL;
 
-import static org.kohsuke.github.Previews.*;
+import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
 
 /**
  * Reaction to issue, comment, PR, and so on.
@@ -11,10 +11,9 @@ import static org.kohsuke.github.Previews.*;
  * @author Kohsuke Kawaguchi
  * @see Reactable
  */
-@Preview
+@Preview(SQUIRREL_GIRL)
 @Deprecated
 public class GHReaction extends GHObject {
-    private GitHub root;
 
     private GHUser user;
     private ReactionContent content;
@@ -58,6 +57,6 @@ public class GHReaction extends GHObject {
      *             the io exception
      */
     public void delete() throws IOException {
-        root.createRequest().method("DELETE").withPreview(SQUIRREL_GIRL).withUrlPath("/reactions/" + id).send();
+        root.createRequest().method("DELETE").withPreview(SQUIRREL_GIRL).withUrlPath("/reactions/" + getId()).send();
     }
 }

src/main/java/org/kohsuke/github/GHRef.java

@@ -1,5 +1,6 @@
 package org.kohsuke.github;
 
+import com.fasterxml.jackson.databind.JsonMappingException;
 import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
 
 import java.io.IOException;
@@ -10,9 +11,7 @@ import java.net.URL;
  *
  * @author Michael Clarke
  */
-public class GHRef {
-    /* package almost final */ GitHub root;
-
+public class GHRef extends GitHubInteractiveObject {
     private String ref, url;
     private GHObject object;
 
@@ -31,7 +30,7 @@ public class GHRef {
      * @return the url
      */
     public URL getUrl() {
-        return GitHub.parseURL(url);
+        return GitHubClient.parseURL(url);
     }
 
     /**
@@ -90,11 +89,76 @@ public class GHRef {
         return this;
     }
 
-    static GHRef[] wrap(GHRef[] in, GitHub root) {
-        for (GHRef r : in) {
-            r.wrap(root);
+    /**
+     * Retrive a ref of the given type for the current GitHub repository.
+     *
+     * @param repository
+     *            the repository to read from
+     * @param refName
+     *            eg: heads/branch
+     * @return refs matching the request type
+     * @throws IOException
+     *             on failure communicating with GitHub, potentially due to an invalid ref type being requested
+     */
+    static GHRef read(GHRepository repository, String refName) throws IOException {
+        // Also accept e.g. "refs/heads/branch" for consistency with createRef().
+        if (refName.startsWith("refs/")) {
+            refName = refName.replaceFirst("refs/", "");
         }
-        return in;
+
+        // We would expect this to use `git/ref/%s` but some versions of GHE seem to not support it
+        // Instead use `git/refs/%s` and check the result actually matches the ref
+        GHRef result = null;
+        try {
+            result = repository.root.createRequest()
+                    .withUrlPath(repository.getApiTailUrl(String.format("git/refs/%s", refName)))
+                    .fetch(GHRef.class)
+                    .wrap(repository.root);
+        } catch (IOException e) {
+            // If the parse exception is due to the above returning an array instead of a single ref
+            // that means the individual ref did not exist. Handled by result check below.
+            // Otherwise, rethrow.
+            if (!(e.getCause() instanceof JsonMappingException)) {
+                throw e;
+            }
+        }
+
+        // Verify that the ref returned is the one requested
+        // Used .endsWith(refName) instead of .equals("refs/" + refName) to workaround a GitBucket
+        // issue where the "ref" field omits the "refs/" prefix. "endsWith()" is functionally
+        // the same for this scenario - the server refs matching is prefix-based, so
+        // a ref that ends with the correct string will always be the correct one.
+        if (result == null || !result.getRef().endsWith(refName)) {
+            throw new GHFileNotFoundException(String.format("git/refs/%s", refName)
+                    + " {\"message\":\"Not Found\",\"documentation_url\":\"https://developer.github.com/v3/git/refs/#get-a-reference\"}");
+        }
+        return result;
+    }
+
+    /**
+     * Retrieves all refs of the given type for the current GitHub repository.
+     *
+     * @param repository
+     *            the repository to read from
+     * @param refType
+     *            the type of reg to search for e.g. <code>tags</code> or <code>commits</code>
+     * @return paged iterable of all refs of the specified type
+     * @throws IOException
+     *             on failure communicating with GitHub, potentially due to an invalid ref type being requested
+     */
+    static PagedIterable<GHRef> readMatching(GHRepository repository, String refType) throws IOException {
+        if (refType.startsWith("refs/")) {
+            refType = refType.replaceFirst("refs/", "");
+        }
+
+        String url = repository.getApiTailUrl(String.format("git/refs/%s", refType));
+        // if no types, do not end with slash just to be safe.
+        if (refType.equals("")) {
+            url = url.substring(0, url.length() - 1);
+        }
+        return repository.root.createRequest()
+                .withUrlPath(url)
+                .toIterable(GHRef[].class, item -> item.wrap(repository.root));
     }
 
     /**
@@ -131,7 +195,7 @@ public class GHRef {
          * @return the url
          */
         public URL getUrl() {
-            return GitHub.parseURL(url);
+            return GitHubClient.parseURL(url);
         }
     }
 }

src/main/java/org/kohsuke/github/GHRelease.java

@@ -6,7 +6,6 @@ import java.io.IOException;
 import java.io.InputStream;
 import java.net.URL;
 import java.net.URLEncoder;
-import java.util.Arrays;
 import java.util.Date;
 import java.util.List;
 
@@ -16,14 +15,15 @@ import static java.lang.String.*;
  * Release in a github repository.
  *
  * @see GHRepository#getReleases() GHRepository#getReleases()
+ * @see GHRepository#listReleases() () GHRepository#listReleases()
  * @see GHRepository#createRelease(String) GHRepository#createRelease(String)
  */
 public class GHRelease extends GHObject {
-    GitHub root;
     GHRepository owner;
 
     private String html_url;
     private String assets_url;
+    private List<GHAsset> assets;
     private String upload_url;
     private String tag_name;
     private String target_commitish;
@@ -72,12 +72,13 @@ public class GHRelease extends GHObject {
      *             the io exception
      * @deprecated Use {@link #update()}
      */
+    @Deprecated
     public GHRelease setDraft(boolean draft) throws IOException {
         return update().draft(draft).update();
     }
 
     public URL getHtmlUrl() {
-        return GitHub.parseURL(html_url);
+        return GitHubClient.parseURL(html_url);
     }
 
     /**
@@ -249,17 +250,44 @@ public class GHRelease extends GHObject {
     }
 
     /**
-     * Gets assets.
+     * Get the cached assets.
+     *
+     * @return the assets
+     *
+     * @deprecated This should be the default behavior of {@link #getAssets()} in a future release. This method is
+     *             introduced in addition to enable a transition to using cached asset information while keeping the
+     *             existing logic in place for backwards compatibility.
+     */
+    @Deprecated
+    public List<GHAsset> assets() {
+        return assets;
+    }
+
+    /**
+     * Re-fetch the assets of this release.
+     *
+     * @return the assets
+     * @throws IOException
+     *             the io exception
+     * @deprecated The behavior of this method will change in a future release. It will then provide cached assets as
+     *             provided by {@link #assets()}. Use {@link #listAssets()} instead to fetch up-to-date information of
+     *             assets.
+     */
+    @Deprecated
+    public List<GHAsset> getAssets() throws IOException {
+        return listAssets().toList();
+    }
+
+    /**
+     * Re-fetch the assets of this release.
      *
      * @return the assets
      * @throws IOException
      *             the io exception
      */
-    public List<GHAsset> getAssets() throws IOException {
+    public PagedIterable<GHAsset> listAssets() throws IOException {
         Requester builder = owner.root.createRequest();
-
-        GHAsset[] assets = builder.withUrlPath(getApiTailUrl("assets")).fetchArray(GHAsset[].class);
-        return Arrays.asList(GHAsset.wrap(assets, this));
+        return builder.withUrlPath(getApiTailUrl("assets")).toIterable(GHAsset[].class, item -> item.wrap(this));
     }
 
     /**
@@ -269,7 +297,7 @@ public class GHRelease extends GHObject {
      *             the io exception
      */
     public void delete() throws IOException {
-        root.createRequest().method("DELETE").withUrlPath(owner.getApiTailUrl("releases/" + id)).send();
+        root.createRequest().method("DELETE").withUrlPath(owner.getApiTailUrl("releases/" + getId())).send();
     }
 
     /**
@@ -282,6 +310,6 @@ public class GHRelease extends GHObject {
     }
 
     private String getApiTailUrl(String end) {
-        return owner.getApiTailUrl(format("releases/%s/%s", id, end));
+        return owner.getApiTailUrl(format("releases/%s/%s", getId(), end));
     }
 }

src/main/java/org/kohsuke/github/GHReleaseUpdater.java

@@ -100,7 +100,7 @@ public class GHReleaseUpdater {
      */
     public GHRelease update() throws IOException {
         return builder.method("PATCH")
-                .withUrlPath(base.owner.getApiTailUrl("releases/" + base.id))
+                .withUrlPath(base.owner.getApiTailUrl("releases/" + base.getId()))
                 .fetch(GHRelease.class)
                 .wrap(base.owner);
     }

src/main/java/org/kohsuke/github/GHRepoHook.java

@@ -18,6 +18,6 @@ class GHRepoHook extends GHHook {
 
     @Override
     String getApiRoute() {
-        return String.format("/repos/%s/%s/hooks/%d", repository.getOwnerName(), repository.getName(), id);
+        return String.format("/repos/%s/%s/hooks/%d", repository.getOwnerName(), repository.getName(), getId());
     }
 }