mirror of
https://github.com/jlengrand/github-api.git
synced 2026-04-12 00:11:21 +00:00
Compare commits
442 Commits
github-api
...
junie-init
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
d85919658d | ||
|
|
6b30617090 | ||
|
|
3ced4fc9c8 | ||
|
|
4748db2bc3 | ||
|
|
e0ebec5d5c | ||
|
|
b1ff0a4453 | ||
|
|
6564648230 | ||
|
|
48cadbc814 | ||
|
|
fbfba70714 | ||
|
|
30a6cc504e | ||
|
|
54d8fe93a8 | ||
|
|
4abf33acdb | ||
|
|
c00d562b48 | ||
|
|
fad4753f0f | ||
|
|
c24df1d022 | ||
|
|
823465590e | ||
|
|
804db70049 | ||
|
|
1782e5a483 | ||
|
|
b6283a0493 | ||
|
|
0bb18ee7c5 | ||
|
|
1a77dd270f | ||
|
|
1c6ab19d59 | ||
|
|
ef4e64dcdd | ||
|
|
946b4e963b | ||
|
|
0d7867daf6 | ||
|
|
3044b5437b | ||
|
|
4a2886531d | ||
|
|
c5e2d8b2ae | ||
|
|
3041431468 | ||
|
|
63b9188dad | ||
|
|
2436ed0431 | ||
|
|
0295ad82fa | ||
|
|
c197dc6b7b | ||
|
|
a79971e406 | ||
|
|
1a56f9d093 | ||
|
|
35852055e8 | ||
|
|
196ee25452 | ||
|
|
7d8335423d | ||
|
|
eac4990eac | ||
|
|
0f17812732 | ||
|
|
3bafb965c5 | ||
|
|
0e02444c07 | ||
|
|
4dcc479d48 | ||
|
|
a564c97763 | ||
|
|
80e17109de | ||
|
|
c395b9d6b3 | ||
|
|
e34d33f1cd | ||
|
|
1c920dee06 | ||
|
|
955d2e0a07 | ||
|
|
d0912009dd | ||
|
|
e68950e619 | ||
|
|
93c026b7af | ||
|
|
5254839ff7 | ||
|
|
6ca0d83b70 | ||
|
|
8ed832a303 | ||
|
|
dbf6d3bf37 | ||
|
|
081a454ec8 | ||
|
|
543b643fdb | ||
|
|
d02f194668 | ||
|
|
9c8c00b77c | ||
|
|
a23de4707b | ||
|
|
301303bd90 | ||
|
|
4689b8f885 | ||
|
|
c4de682493 | ||
|
|
b23934a5a1 | ||
|
|
f2eecc3cc5 | ||
|
|
f5310965dc | ||
|
|
47ffff3407 | ||
|
|
f2a70a46ad | ||
|
|
acd5c6baa6 | ||
|
|
06d02059cb | ||
|
|
603288c361 | ||
|
|
09ee3168f9 | ||
|
|
1559d063c7 | ||
|
|
cfdcb182a4 | ||
|
|
d526b13d7d | ||
|
|
fffe31220e | ||
|
|
ce17396ea6 | ||
|
|
d18e81dc74 | ||
|
|
6ae5acba5d | ||
|
|
0a1c803f69 | ||
|
|
fa0865b208 | ||
|
|
886887913c | ||
|
|
5c64fec032 | ||
|
|
892f60ea16 | ||
|
|
f28f966040 | ||
|
|
0e9cc90d31 | ||
|
|
72dc5c5d18 | ||
|
|
02e02d39b0 | ||
|
|
e629a23bd4 | ||
|
|
f6e8a2c7c6 | ||
|
|
76bea5174f | ||
|
|
2be27d1a41 | ||
|
|
cd1454ac03 | ||
|
|
b550910f4c | ||
|
|
d13e490be2 | ||
|
|
3d451526ef | ||
|
|
bd38897d48 | ||
|
|
63ccbaf064 | ||
|
|
2beb806b8a | ||
|
|
552ba6693e | ||
|
|
2452add4d7 | ||
|
|
0dc931ceed | ||
|
|
1dfedc6a58 | ||
|
|
e33046a624 | ||
|
|
002b3f03da | ||
|
|
fd1817d111 | ||
|
|
7526b46f9d | ||
|
|
169fd18a54 | ||
|
|
0708812456 | ||
|
|
7d86070ac8 | ||
|
|
713b85f9de | ||
|
|
4fef5bb1fc | ||
|
|
f3eadcddb6 | ||
|
|
237171727d | ||
|
|
31212d33ae | ||
|
|
8af66133d2 | ||
|
|
9578e027b1 | ||
|
|
2c75b42b4e | ||
|
|
7854b30a76 | ||
|
|
cf2571858c | ||
|
|
092815747a | ||
|
|
649d7ed87f | ||
|
|
684560ef67 | ||
|
|
adf054ba5d | ||
|
|
dcdfee67cd | ||
|
|
9d7209ec62 | ||
|
|
b97e8a2c38 | ||
|
|
8bd3f391da | ||
|
|
5d0dbf6e2f | ||
|
|
38f3595552 | ||
|
|
b72e7fa2ee | ||
|
|
659b32f5ec | ||
|
|
d0c326bbf5 | ||
|
|
4a5aceb1f9 | ||
|
|
884248930e | ||
|
|
530d524366 | ||
|
|
5957da3d6d | ||
|
|
6efe428f57 | ||
|
|
25b9a2ce33 | ||
|
|
0ce78016cc | ||
|
|
696dd90b23 | ||
|
|
e66a72387e | ||
|
|
874ce23dd7 | ||
|
|
7479cac9a7 | ||
|
|
064ce1b0bc | ||
|
|
941573af49 | ||
|
|
2f9ff32176 | ||
|
|
b84d5a7c39 | ||
|
|
bd19f23b3f | ||
|
|
ee047ea9b5 | ||
|
|
601f18016a | ||
|
|
93abb0ed36 | ||
|
|
6453e585a9 | ||
|
|
3a1ed5a5b7 | ||
|
|
c5b45523d6 | ||
|
|
bf082f2a46 | ||
|
|
672febd88b | ||
|
|
927843ea83 | ||
|
|
8fac7d317e | ||
|
|
626574ae36 | ||
|
|
8c9eb3393b | ||
|
|
0c4728f46a | ||
|
|
837526ce5d | ||
|
|
afcfa906b8 | ||
|
|
8b3f50d4d3 | ||
|
|
9022455d85 | ||
|
|
8e20f4d9f5 | ||
|
|
7c8a7ff26e | ||
|
|
064d6944f3 | ||
|
|
b8b3cf9c80 | ||
|
|
18e7138812 | ||
|
|
bfb3b94478 | ||
|
|
6167d196d9 | ||
|
|
43ed7c7ac7 | ||
|
|
fc98e72569 | ||
|
|
258acf79f6 | ||
|
|
b509076d6f | ||
|
|
f57ea4c4e9 | ||
|
|
578fe085ce | ||
|
|
2553a79b02 | ||
|
|
4770316898 | ||
|
|
99f192d33c | ||
|
|
fc3bac0e77 | ||
|
|
ad2990b1b6 | ||
|
|
fab848a0d3 | ||
|
|
4a2244e661 | ||
|
|
bab5399327 | ||
|
|
52705ac695 | ||
|
|
73d2e1db5c | ||
|
|
83aa9d04ef | ||
|
|
97652c6803 | ||
|
|
f40daf8488 | ||
|
|
3e6a5bc718 | ||
|
|
78ffe5a759 | ||
|
|
9abfdc805b | ||
|
|
9e47a2b8c6 | ||
|
|
feba6ed8b6 | ||
|
|
acab40b704 | ||
|
|
435272065f | ||
|
|
c5c04672fc | ||
|
|
5eef764cba | ||
|
|
2682e0a1e2 | ||
|
|
a68d16d5de | ||
|
|
304ab10cf9 | ||
|
|
dc46341432 | ||
|
|
99aea9296e | ||
|
|
b0693037f3 | ||
|
|
c19cfd98d1 | ||
|
|
cdc0e2ad6b | ||
|
|
6606b5c7d1 | ||
|
|
551dbf2a06 | ||
|
|
d734237788 | ||
|
|
47e2a5aea1 | ||
|
|
57cdc308e8 | ||
|
|
8919c5f8c7 | ||
|
|
b8f00bc699 | ||
|
|
042038f480 | ||
|
|
fb03e749bd | ||
|
|
e522239832 | ||
|
|
ae69324196 | ||
|
|
5194c2d9bc | ||
|
|
daf5c5eb98 | ||
|
|
a7b4c97020 | ||
|
|
420d5d06f3 | ||
|
|
a7cd052b7c | ||
|
|
6e1b943823 | ||
|
|
8a3559ada5 | ||
|
|
ea3cbd4c71 | ||
|
|
34a1f9d6e4 | ||
|
|
629bd510c1 | ||
|
|
40937a5cc6 | ||
|
|
8509957102 | ||
|
|
b0aea0c575 | ||
|
|
1f7f646bec | ||
|
|
a59ee6a82d | ||
|
|
1fefc77582 | ||
|
|
199eee4e25 | ||
|
|
854df5321b | ||
|
|
bd509070ac | ||
|
|
a8c7c97d06 | ||
|
|
6d86cfb4f6 | ||
|
|
fb3e956502 | ||
|
|
9b0dbe6f34 | ||
|
|
c10c7237a7 | ||
|
|
36612fe97f | ||
|
|
18e2056a10 | ||
|
|
8c8f1451d4 | ||
|
|
be67f1d9e2 | ||
|
|
90bc250269 | ||
|
|
1bd178654f | ||
|
|
f22bf160f9 | ||
|
|
4261c42949 | ||
|
|
40cfb85a8e | ||
|
|
f08299b134 | ||
|
|
a04ab45abc | ||
|
|
0647df2d2b | ||
|
|
d4cc3af1e9 | ||
|
|
936ab499ce | ||
|
|
453f475b4e | ||
|
|
bda3855b86 | ||
|
|
772a6c112b | ||
|
|
9b4134cada | ||
|
|
ed9f54006d | ||
|
|
3b1f176544 | ||
|
|
d2732bcf54 | ||
|
|
a1461f401a | ||
|
|
f9fd30275c | ||
|
|
eeea14dab4 | ||
|
|
1df807a198 | ||
|
|
0848287069 | ||
|
|
334b37a256 | ||
|
|
8776a3b672 | ||
|
|
657550f767 | ||
|
|
45a0114f75 | ||
|
|
a8ddd3e12a | ||
|
|
b668396151 | ||
|
|
9e7c33369c | ||
|
|
8943ca6d1a | ||
|
|
b3460c1f9d | ||
|
|
5166c9265f | ||
|
|
35c8cfa01d | ||
|
|
8e6dbf3772 | ||
|
|
cb381dfa06 | ||
|
|
80124e3b85 | ||
|
|
7aae27e36f | ||
|
|
b212956fbb | ||
|
|
d033355e84 | ||
|
|
59d7a117d0 | ||
|
|
dfbb38c5f1 | ||
|
|
3f9954144a | ||
|
|
1b84efdbfa | ||
|
|
c33e78a7dc | ||
|
|
747c759bbb | ||
|
|
e0a709676e | ||
|
|
a96275c286 | ||
|
|
ca7c809feb | ||
|
|
a8a0bcb7db | ||
|
|
0e2bf23830 | ||
|
|
44a8b797fb | ||
|
|
cdede298a9 | ||
|
|
f6ac4d3559 | ||
|
|
7e1531dbca | ||
|
|
9aeb422157 | ||
|
|
fba0f8cf8e | ||
|
|
0f4a5227e1 | ||
|
|
d16a752b43 | ||
|
|
4d9aed90d6 | ||
|
|
4bec27fd49 | ||
|
|
be3bd74bb7 | ||
|
|
f1720b7bbc | ||
|
|
7a79a18d8f | ||
|
|
472034c950 | ||
|
|
0b14cee817 | ||
|
|
b50ab56f9e | ||
|
|
26d30663c4 | ||
|
|
ffecc390eb | ||
|
|
252ca04084 | ||
|
|
aae5c56a31 | ||
|
|
6670446037 | ||
|
|
bd39b07bb5 | ||
|
|
a9438b6121 | ||
|
|
f546cf4521 | ||
|
|
43efa78750 | ||
|
|
9e3de43802 | ||
|
|
dc615e432e | ||
|
|
cf9caa6af5 | ||
|
|
15f748358d | ||
|
|
b30d648623 | ||
|
|
33d70560b8 | ||
|
|
865a49d2e8 | ||
|
|
4fca68c25c | ||
|
|
f131a0c1c2 | ||
|
|
cd4368fa79 | ||
|
|
4ec4b160b0 | ||
|
|
a585b4957f | ||
|
|
e6b02b3bed | ||
|
|
1ef0ec0432 | ||
|
|
2e87bd86a1 | ||
|
|
0228a0d023 | ||
|
|
6365f3749d | ||
|
|
25c18130f9 | ||
|
|
436c19634d | ||
|
|
1a6facc685 | ||
|
|
bd0093c8ea | ||
|
|
e150280010 | ||
|
|
827fd5e472 | ||
|
|
f89fbc67b9 | ||
|
|
c567a88892 | ||
|
|
6a39d7fca5 | ||
|
|
a15e67f065 | ||
|
|
7a1bce9578 | ||
|
|
f2b4de7943 | ||
|
|
b3ff4ac6d9 | ||
|
|
1c56e7fab5 | ||
|
|
70ba4df385 | ||
|
|
8062c705e8 | ||
|
|
fafb23c1a6 | ||
|
|
4e7ac7030c | ||
|
|
4803daca5a | ||
|
|
facfc61316 | ||
|
|
e3e495bfb1 | ||
|
|
e007284d2f | ||
|
|
1da8416ebd | ||
|
|
79b49a469c | ||
|
|
5888efcaef | ||
|
|
459d1b4f56 | ||
|
|
9151102bda | ||
|
|
3819984add | ||
|
|
3b58fbc186 | ||
|
|
55e589b3d9 | ||
|
|
e64d64d8d8 | ||
|
|
37c2d9135b | ||
|
|
30c96221bd | ||
|
|
bf7305e3f8 | ||
|
|
3b12a229c3 | ||
|
|
5726ceb8dc | ||
|
|
c06c06624d | ||
|
|
ad40d7071e | ||
|
|
f55a39eb90 | ||
|
|
c3869bee31 | ||
|
|
6eac15df0f | ||
|
|
6f5d3c32c3 | ||
|
|
68ef40e4d0 | ||
|
|
4046bc4f72 | ||
|
|
1b8d131915 | ||
|
|
f5ad332d28 | ||
|
|
938603ff60 | ||
|
|
17af78f2bb | ||
|
|
7588267743 | ||
|
|
ed4f9c8176 | ||
|
|
bbb46e88b0 | ||
|
|
3db7aac0d8 | ||
|
|
fdbbd2e563 | ||
|
|
da2aaff9e5 | ||
|
|
4bba692170 | ||
|
|
59b61cd8be | ||
|
|
247b013e16 | ||
|
|
3c56f1f076 | ||
|
|
7fee1fcc74 | ||
|
|
d7931777bc | ||
|
|
bb48d55bd4 | ||
|
|
610b02968e | ||
|
|
a7112c42df | ||
|
|
8a474a3b00 | ||
|
|
59e18d155e | ||
|
|
12ca5d8063 | ||
|
|
c959e0a928 | ||
|
|
89a08b021d | ||
|
|
04b553cdec | ||
|
|
15e9ee30ee | ||
|
|
a0d650a86c | ||
|
|
1a6ad48e08 | ||
|
|
7c82eeb018 | ||
|
|
b188e74ee0 | ||
|
|
ff790eeefb | ||
|
|
97e918da03 | ||
|
|
4f30998873 | ||
|
|
a0fc478a28 | ||
|
|
bb03fd1968 | ||
|
|
0c65f74662 | ||
|
|
29ac2bd4f5 | ||
|
|
0d8b4f32e8 | ||
|
|
83db7f24eb | ||
|
|
5f9976a193 | ||
|
|
9480ef485b | ||
|
|
a9b7432584 | ||
|
|
6d7081910f | ||
|
|
aa96089ab4 | ||
|
|
58ae681417 | ||
|
|
c038e0af5e | ||
|
|
4f9976c0cb | ||
|
|
e308e5ed57 | ||
|
|
7b1b1ca994 | ||
|
|
551be49a1a | ||
|
|
a3888e6902 | ||
|
|
43bb6a0dd8 | ||
|
|
05863acbcd | ||
|
|
0e4cd06137 | ||
|
|
85d2d974e7 | ||
|
|
3f021f9552 | ||
|
|
4688870984 |
12
.devcontainer/devcontainer.json
Normal file
12
.devcontainer/devcontainer.json
Normal file
@@ -0,0 +1,12 @@
|
|||||||
|
{
|
||||||
|
"name": "Java",
|
||||||
|
"image": "mcr.microsoft.com/devcontainers/java:1-21",
|
||||||
|
"features": {
|
||||||
|
"ghcr.io/devcontainers/features/java:1": {
|
||||||
|
"version": "none",
|
||||||
|
"installMaven": "true",
|
||||||
|
"mavenVersion": "3.8.6",
|
||||||
|
"installGradle": "true"
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
1
.gitattributes
vendored
Normal file
1
.gitattributes
vendored
Normal file
@@ -0,0 +1 @@
|
|||||||
|
*.java text eol=lf
|
||||||
14
.github/PULL_REQUEST_TEMPLATE.md
vendored
14
.github/PULL_REQUEST_TEMPLATE.md
vendored
@@ -1,16 +1,16 @@
|
|||||||
# Description
|
# Description
|
||||||
** Describe your change here**
|
|
||||||
|
<!-- Describe your change here -->
|
||||||
|
|
||||||
# Before submitting a PR:
|
# Before submitting a PR:
|
||||||
We love getting PRs, but we hate asking people for the same basic changes every time.
|
We love getting PRs, but we hate asking people for the same basic changes every time.
|
||||||
|
|
||||||
- [ ] Push your changes to a branch other than `master`. Create your PR from that branch.
|
- [ ] Push your changes to a branch other than `main`. Create your PR from that branch.
|
||||||
- [ ] Add JavaDocs and other comments
|
- [ ] Add JavaDocs and other comments
|
||||||
- [ ] Write tests that run and pass in CI. See [CONTRIBUTING.md](CONTRIBUTING.md) for details on how to capture snapshot data.
|
- [ ] Write tests that run and pass in CI. See [CONTRIBUTING.md](CONTRIBUTING.md) for details on how to capture snapshot data.
|
||||||
- [ ] Run `mvn clean compile` locally. This may reformat your code, commit those changes.
|
|
||||||
- [ ] Run `mvn -D enable-ci clean install site` locally. If this command doesn't succeed, your change will not pass CI.
|
- [ ] Run `mvn -D enable-ci clean install site` locally. If this command doesn't succeed, your change will not pass CI.
|
||||||
|
|
||||||
# When creating a PR:
|
# When creating a PR:
|
||||||
|
|
||||||
- [ ] Fill in the "Description" above.
|
- [ ] Fill in the "Description" above.
|
||||||
- [ ] Enable "Allow edits from maintainers".
|
- [ ] Enable "Allow edits from maintainers".
|
||||||
|
|||||||
67
.github/workflows/codeql-analysis.yml
vendored
Normal file
67
.github/workflows/codeql-analysis.yml
vendored
Normal file
@@ -0,0 +1,67 @@
|
|||||||
|
# For most projects, this workflow file will not need changing; you simply need
|
||||||
|
# to commit it to your repository.
|
||||||
|
#
|
||||||
|
# You may wish to alter this file to override the set of languages analyzed,
|
||||||
|
# or to provide custom queries or build logic.
|
||||||
|
#
|
||||||
|
# ******** NOTE ********
|
||||||
|
# We have attempted to detect the languages in your repository. Please check
|
||||||
|
# the `language` matrix defined below to confirm you have the correct set of
|
||||||
|
# supported CodeQL languages.
|
||||||
|
#
|
||||||
|
name: "CodeQL"
|
||||||
|
|
||||||
|
on:
|
||||||
|
push:
|
||||||
|
branches: [ main, gh-pages ]
|
||||||
|
pull_request:
|
||||||
|
# The branches below must be a subset of the branches above
|
||||||
|
branches: [ main ]
|
||||||
|
schedule:
|
||||||
|
- cron: '20 0 * * 6'
|
||||||
|
|
||||||
|
jobs:
|
||||||
|
analyze:
|
||||||
|
name: Analyze
|
||||||
|
runs-on: ubuntu-latest
|
||||||
|
|
||||||
|
strategy:
|
||||||
|
fail-fast: false
|
||||||
|
matrix:
|
||||||
|
language: [ 'java' ]
|
||||||
|
# CodeQL supports [ 'cpp', 'csharp', 'go', 'java', 'javascript', 'python' ]
|
||||||
|
# Learn more:
|
||||||
|
# https://docs.github.com/en/free-pro-team@latest/github/finding-security-vulnerabilities-and-errors-in-your-code/configuring-code-scanning#changing-the-languages-that-are-analyzed
|
||||||
|
|
||||||
|
steps:
|
||||||
|
- name: Checkout repository
|
||||||
|
uses: actions/checkout@v2
|
||||||
|
|
||||||
|
# Initializes the CodeQL tools for scanning.
|
||||||
|
- name: Initialize CodeQL
|
||||||
|
uses: github/codeql-action/init@v1
|
||||||
|
with:
|
||||||
|
languages: ${{ matrix.language }}
|
||||||
|
# If you wish to specify custom queries, you can do so here or in a config file.
|
||||||
|
# By default, queries listed here will override any specified in a config file.
|
||||||
|
# Prefix the list here with "+" to use these queries and those in the config file.
|
||||||
|
# queries: ./path/to/local/query, your-org/your-repo/queries@main
|
||||||
|
|
||||||
|
# Autobuild attempts to build any compiled languages (C/C++, C#, or Java).
|
||||||
|
# If this step fails, then you should remove it and run the build manually (see below)
|
||||||
|
- name: Autobuild
|
||||||
|
uses: github/codeql-action/autobuild@v1
|
||||||
|
|
||||||
|
# ℹ️ Command-line programs to run using the OS shell.
|
||||||
|
# 📚 https://git.io/JvXDl
|
||||||
|
|
||||||
|
# ✏️ If the Autobuild fails above, remove it and uncomment the following three lines
|
||||||
|
# and modify them (or add more) to build your code if your project
|
||||||
|
# uses a compiled language
|
||||||
|
|
||||||
|
#- run: |
|
||||||
|
# make bootstrap
|
||||||
|
# make release
|
||||||
|
|
||||||
|
- name: Perform CodeQL Analysis
|
||||||
|
uses: github/codeql-action/analyze@v1
|
||||||
22
.github/workflows/junie.yml
vendored
Normal file
22
.github/workflows/junie.yml
vendored
Normal file
@@ -0,0 +1,22 @@
|
|||||||
|
name: Junie
|
||||||
|
run-name: Junie run ${{ inputs.run_id }}
|
||||||
|
|
||||||
|
permissions:
|
||||||
|
contents: write
|
||||||
|
pull-requests: write
|
||||||
|
|
||||||
|
on:
|
||||||
|
workflow_dispatch:
|
||||||
|
inputs:
|
||||||
|
run_id:
|
||||||
|
description: "id of workflow process"
|
||||||
|
required: true
|
||||||
|
workflow_params:
|
||||||
|
description: "stringified params"
|
||||||
|
required: true
|
||||||
|
|
||||||
|
jobs:
|
||||||
|
call-workflow-passing-data:
|
||||||
|
uses: jetbrains-junie/junie-workflows/.github/workflows/ej-issue.yml@main
|
||||||
|
with:
|
||||||
|
workflow_params: ${{ inputs.workflow_params }}
|
||||||
48
.github/workflows/maven-build.yml
vendored
48
.github/workflows/maven-build.yml
vendored
@@ -2,42 +2,51 @@ name: CI
|
|||||||
|
|
||||||
on: [push, pull_request]
|
on: [push, pull_request]
|
||||||
|
|
||||||
|
# this is required by spotless for JDK 16+
|
||||||
|
env:
|
||||||
|
JAVA_11_PLUS_MAVEN_OPTS: "--add-opens jdk.compiler/com.sun.tools.javac.util=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.file=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.parser=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.tree=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.api=ALL-UNNAMED"
|
||||||
|
|
||||||
jobs:
|
jobs:
|
||||||
build:
|
build:
|
||||||
name: build-only (Java ${{ matrix.java }})
|
name: build-only (Java ${{ matrix.java }})
|
||||||
runs-on: ubuntu-latest
|
runs-on: ubuntu-latest
|
||||||
strategy:
|
strategy:
|
||||||
|
fail-fast: false
|
||||||
matrix:
|
matrix:
|
||||||
java: [ 13 ]
|
java: [ 16 ]
|
||||||
steps:
|
steps:
|
||||||
- uses: actions/checkout@v2
|
- uses: actions/checkout@v2
|
||||||
- name: Set up JDK
|
- name: Set up JDK
|
||||||
uses: actions/setup-java@v1
|
uses: actions/setup-java@v2
|
||||||
with:
|
with:
|
||||||
java-version: ${{ matrix.java }}
|
java-version: ${{ matrix.java }}
|
||||||
|
distribution: 'adopt'
|
||||||
- name: Cached .m2
|
- name: Cached .m2
|
||||||
uses: actions/cache@v2
|
uses: actions/cache@v2.1.6
|
||||||
with:
|
with:
|
||||||
path: ~/.m2/repository
|
path: ~/.m2/repository
|
||||||
key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
|
key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
|
||||||
restore-keys: |
|
restore-keys: |
|
||||||
${{ runner.os }}-maven-
|
${{ runner.os }}-maven-
|
||||||
- name: Maven Install (skipTests)
|
- name: Maven Install (skipTests)
|
||||||
run: mvn -B install -DskipTests -D enable-ci --file pom.xml
|
env:
|
||||||
|
MAVEN_OPTS: ${{ env.JAVA_11_PLUS_MAVEN_OPTS }}
|
||||||
|
run: mvn -B install -DskipTests --file pom.xml
|
||||||
site:
|
site:
|
||||||
name: site (Java ${{ matrix.java }})
|
name: site (Java ${{ matrix.java }})
|
||||||
runs-on: ubuntu-latest
|
runs-on: ubuntu-latest
|
||||||
strategy:
|
strategy:
|
||||||
|
fail-fast: false
|
||||||
matrix:
|
matrix:
|
||||||
java: [ 8, 11 ]
|
java: [ 8, 11 ]
|
||||||
steps:
|
steps:
|
||||||
- uses: actions/checkout@v2
|
- uses: actions/checkout@v2
|
||||||
- name: Set up JDK
|
- name: Set up JDK
|
||||||
uses: actions/setup-java@v1
|
uses: actions/setup-java@v2
|
||||||
with:
|
with:
|
||||||
java-version: ${{ matrix.java }}
|
java-version: ${{ matrix.java }}
|
||||||
- uses: actions/cache@v2
|
distribution: 'adopt'
|
||||||
|
- uses: actions/cache@v2.1.6
|
||||||
with:
|
with:
|
||||||
path: ~/.m2/repository
|
path: ~/.m2/repository
|
||||||
key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
|
key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
|
||||||
@@ -49,24 +58,41 @@ jobs:
|
|||||||
name: test (${{ matrix.os }}, Java ${{ matrix.java }})
|
name: test (${{ matrix.os }}, Java ${{ matrix.java }})
|
||||||
runs-on: ${{ matrix.os }}-latest
|
runs-on: ${{ matrix.os }}-latest
|
||||||
strategy:
|
strategy:
|
||||||
|
fail-fast: false
|
||||||
matrix:
|
matrix:
|
||||||
os: [ ubuntu, windows ]
|
os: [ ubuntu, windows ]
|
||||||
java: [ 8, 11, 13, 15-ea ]
|
java: [ 8, 11, 16 ]
|
||||||
steps:
|
steps:
|
||||||
- uses: actions/checkout@v2
|
- uses: actions/checkout@v2
|
||||||
- name: Set up JDK
|
- name: Set up JDK
|
||||||
uses: actions/setup-java@v1
|
uses: actions/setup-java@v2
|
||||||
with:
|
with:
|
||||||
java-version: ${{ matrix.java }}
|
java-version: ${{ matrix.java }}
|
||||||
- uses: actions/cache@v2
|
distribution: 'adopt'
|
||||||
|
- uses: actions/cache@v2.1.6
|
||||||
with:
|
with:
|
||||||
path: ~/.m2/repository
|
path: ~/.m2/repository
|
||||||
key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
|
key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
|
||||||
restore-keys: |
|
restore-keys: |
|
||||||
${{ runner.os }}-maven-
|
${{ runner.os }}-maven-
|
||||||
|
# JDK 8
|
||||||
- name: Maven Install without Code Coverage
|
- name: Maven Install without Code Coverage
|
||||||
if: matrix.os == 'windows'
|
if: matrix.os == 'windows' && matrix.java == '8'
|
||||||
run: mvn -B install --file pom.xml
|
run: mvn -B install --file pom.xml
|
||||||
- name: Maven Install with Code Coverage
|
- name: Maven Install with Code Coverage
|
||||||
if: matrix.os != 'windows'
|
if: matrix.os != 'windows' && matrix.java == '8'
|
||||||
run: mvn -B install -D enable-ci --file pom.xml
|
run: mvn -B install -D enable-ci --file pom.xml
|
||||||
|
- name: Codecov Report
|
||||||
|
if: matrix.os != 'windows' && matrix.java == '8'
|
||||||
|
uses: codecov/codecov-action@v1.5.0
|
||||||
|
# JDK 11+
|
||||||
|
- name: Maven Install without Code Coverage
|
||||||
|
if: matrix.os == 'windows' && matrix.java != '8'
|
||||||
|
env:
|
||||||
|
MAVEN_OPTS: ${{ env.JAVA_11_PLUS_MAVEN_OPTS }}
|
||||||
|
run: mvn -B install --file pom.xml "-Dsurefire.argLine=--add-opens java.base/java.net=ALL-UNNAMED"
|
||||||
|
- name: Maven Install with Code Coverage
|
||||||
|
if: matrix.os != 'windows' && matrix.java != '8'
|
||||||
|
env:
|
||||||
|
MAVEN_OPTS: ${{ env.JAVA_11_PLUS_MAVEN_OPTS }}
|
||||||
|
run: mvn -B install -D enable-ci --file pom.xml "-Dsurefire.argLine=--add-opens java.base/java.net=ALL-UNNAMED"
|
||||||
|
|||||||
16
.github/workflows/release-drafter.yml
vendored
Normal file
16
.github/workflows/release-drafter.yml
vendored
Normal file
@@ -0,0 +1,16 @@
|
|||||||
|
|
||||||
|
name: Release Drafter
|
||||||
|
|
||||||
|
on:
|
||||||
|
push:
|
||||||
|
branches:
|
||||||
|
- main
|
||||||
|
|
||||||
|
jobs:
|
||||||
|
update_release_draft:
|
||||||
|
runs-on: ubuntu-latest
|
||||||
|
steps:
|
||||||
|
- name: Release Drafter
|
||||||
|
uses: release-drafter/release-drafter@v5
|
||||||
|
env:
|
||||||
|
GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }}
|
||||||
@@ -14,10 +14,14 @@ Example:
|
|||||||
|
|
||||||
This the default behavior.
|
This the default behavior.
|
||||||
|
|
||||||
|
Example for a single test case:
|
||||||
|
|
||||||
|
`mvn install -Dtest=WireMockStatusReporterTest#user_whenProxying_AuthCorrectlyConfigured`
|
||||||
|
|
||||||
|
|
||||||
### Setting up credential
|
### Setting up credential
|
||||||
|
|
||||||
1. Create an OAuth token on github.com
|
1. Create a "Personal access token" on https://github.com/ (`Settings` > `Developer settings` > `Personal access tokens`)
|
||||||
2. Set the GITHUB_OAUTH environment variable to the value of that token
|
2. Set the GITHUB_OAUTH environment variable to the value of that token
|
||||||
3. Set the system property `test.github.useProxy` (usually like "-Dtest.github.useProxy" as a Java VM option)
|
3. Set the system property `test.github.useProxy` (usually like "-Dtest.github.useProxy" as a Java VM option)
|
||||||
|
|
||||||
@@ -27,21 +31,37 @@ This the default behavior.
|
|||||||
|
|
||||||
`WireMockStatusReporterTest: GitHub proxying and user auth correctly configured for user login: <your login>`
|
`WireMockStatusReporterTest: GitHub proxying and user auth correctly configured for user login: <your login>`
|
||||||
|
|
||||||
Whenever you run tests with `-Dtest.github.useProxy`, they will try to get data from local files but will fallback to proxying to github if not found.
|
Whenever you run tests with `-Dtest.github.useProxy`, they will try to get data from local files but will fallback to proxying to GitHub if not found.
|
||||||
|
|
||||||
|
|
||||||
### Writing a new test
|
### Writing a new test
|
||||||
|
|
||||||
Once you have credentials setup, you add new test classes and test methods as you would normally.
|
Once you have credentials setup, you add new test classes and test methods as you would normally.
|
||||||
Keep `useProxy` enabled and iterate on your tests as needed. Remember, while proxying your tests are interacting with GitHub - you will need to clean up your state between runs.
|
|
||||||
|
|
||||||
When you are ready to create a snapshot of your test data,
|
#### Running tests using GitHub test proxy
|
||||||
run your test with `test.github.takeSnapshot` ("-Dtest.github.takeSnapshot" as a Java VM option). For example:
|
|
||||||
|
|
||||||
`mvn install -Dtest.github.takeSnapshot -Dtest=YourTestClassName`
|
Keep `useProxy` enabled and iterate on your tests as needed. With `useProxy` enabled your tests will interact with
|
||||||
|
GitHub - you will need to clean up your server-state between runs. This can be done manually to start with.
|
||||||
|
Once your test code is somewhat stable, use `getNonRecordingGitHub()` to get a `GitHub` instance for test setup and cleanup.
|
||||||
|
Interactions with that `GitHub` instance will not be recorded as part of the test, keeping the test data files to a minimum.
|
||||||
|
|
||||||
The above command would create snapshot WireMock data files under the path `src/test/resources/org/kohsuhke/github/YourTestClassName/wiremock`.
|
#### Running tests against your personal GitHub user account
|
||||||
Each method would get a separate director that would hold the data files for that test method.
|
|
||||||
|
By default, test helper methods such as `getTempRepository()` target the `hub4j-test-org` GitHub organization.
|
||||||
|
Please request access to this org to record your tests before submitting a PR. This helps keep the project stable and nimble.
|
||||||
|
Until you have access (or if you don't want access), you can set the following additional system property to target
|
||||||
|
your personal github account.
|
||||||
|
|
||||||
|
`mvn install -Dtest.github.org=false -Dtest=YourTestClassName`
|
||||||
|
|
||||||
|
#### Taking a snapshot
|
||||||
|
|
||||||
|
When you are ready to create a snapshot of your test data, run your test with `test.github.takeSnapshot` ("-Dtest.github.takeSnapshot" as
|
||||||
|
a Java VM option). For example:
|
||||||
|
|
||||||
|
`mvn install -Dtest.github.takeSnapshot -Dtest.github.org=false -Dtest=YourTestClassName`
|
||||||
|
|
||||||
|
The above command will create snapshot WireMock data files under the path `src/test/resources/org/kohsuhke/github/YourTestClassName/wiremock`.
|
||||||
|
Each method will get a separate directory that will hold the data files for that test method.
|
||||||
|
|
||||||
Add all files including the generated data to your commit and submit a PR.
|
Add all files including the generated data to your commit and submit a PR.
|
||||||
|
|
||||||
|
|||||||
@@ -2,8 +2,8 @@
|
|||||||
|
|
||||||
[](https://mvnrepository.com/artifact/org.kohsuke/github-api)
|
[](https://mvnrepository.com/artifact/org.kohsuke/github-api)
|
||||||
[](https://gitter.im/hub4j/github-api?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
|
[](https://gitter.im/hub4j/github-api?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
|
||||||

|

|
||||||
|
[](https://codecov.io/gh/hub4j/github-api)
|
||||||
|
|
||||||
|
|
||||||
See https://github-api.kohsuke.org/ for more details
|
See https://github-api.kohsuke.org/ for more details
|
||||||
|
|||||||
7
codecov.yml
Normal file
7
codecov.yml
Normal file
@@ -0,0 +1,7 @@
|
|||||||
|
ignore:
|
||||||
|
- "**/extras/okhttp3/ObsoleteUrlFactory**"
|
||||||
|
- "**/extras/OkHttpConnector"
|
||||||
|
- "**/extras/OkHttp3Connector"
|
||||||
|
- "**/example/**"
|
||||||
|
- "**/github/EnforcementLevel"
|
||||||
|
|
||||||
249
pom.xml
249
pom.xml
@@ -2,7 +2,7 @@
|
|||||||
<modelVersion>4.0.0</modelVersion>
|
<modelVersion>4.0.0</modelVersion>
|
||||||
<groupId>org.kohsuke</groupId>
|
<groupId>org.kohsuke</groupId>
|
||||||
<artifactId>github-api</artifactId>
|
<artifactId>github-api</artifactId>
|
||||||
<version>1.117</version>
|
<version>1.131-SNAPSHOT</version>
|
||||||
<name>GitHub API for Java</name>
|
<name>GitHub API for Java</name>
|
||||||
<url>https://github-api.kohsuke.org/</url>
|
<url>https://github-api.kohsuke.org/</url>
|
||||||
<description>GitHub API for Java</description>
|
<description>GitHub API for Java</description>
|
||||||
@@ -11,7 +11,7 @@
|
|||||||
<connection>scm:git:git@github.com/hub4j/${project.artifactId}.git</connection>
|
<connection>scm:git:git@github.com/hub4j/${project.artifactId}.git</connection>
|
||||||
<developerConnection>scm:git:ssh://git@github.com/hub4j/${project.artifactId}.git</developerConnection>
|
<developerConnection>scm:git:ssh://git@github.com/hub4j/${project.artifactId}.git</developerConnection>
|
||||||
<url>https://github.com/hub4j/github-api/</url>
|
<url>https://github.com/hub4j/github-api/</url>
|
||||||
<tag>github-api-1.117</tag>
|
<tag>HEAD</tag>
|
||||||
</scm>
|
</scm>
|
||||||
|
|
||||||
<distributionManagement>
|
<distributionManagement>
|
||||||
@@ -33,19 +33,21 @@
|
|||||||
|
|
||||||
<properties>
|
<properties>
|
||||||
<project.build.sourceEncoding>UTF-8</project.build.sourceEncoding>
|
<project.build.sourceEncoding>UTF-8</project.build.sourceEncoding>
|
||||||
<spotbugs-maven-plugin.version>4.0.4</spotbugs-maven-plugin.version>
|
<spotbugs-maven-plugin.version>4.2.3</spotbugs-maven-plugin.version>
|
||||||
<spotbugs.version>4.1.2</spotbugs.version>
|
<spotbugs.version>4.2.3</spotbugs.version>
|
||||||
<spotbugs-maven-plugin.failOnError>true</spotbugs-maven-plugin.failOnError>
|
<spotbugs-maven-plugin.failOnError>true</spotbugs-maven-plugin.failOnError>
|
||||||
<hamcrest.version>2.2</hamcrest.version>
|
<hamcrest.version>2.2</hamcrest.version>
|
||||||
<okhttp3.version>4.4.1</okhttp3.version>
|
<okhttp3.version>4.4.1</okhttp3.version>
|
||||||
<okio.version>2.5.0</okio.version>
|
<okio.version>2.5.0</okio.version>
|
||||||
<formatter-maven-plugin.goal>format</formatter-maven-plugin.goal>
|
|
||||||
<impsort-maven-plugin.goal>sort</impsort-maven-plugin.goal>
|
|
||||||
<!-- Using this as the minimum bar for code coverage. Adding methods without covering them will fail this. -->
|
<!-- Using this as the minimum bar for code coverage. Adding methods without covering them will fail this. -->
|
||||||
<jacoco.coverage.target.bundle.method>0.60</jacoco.coverage.target.bundle.method>
|
<jacoco.coverage.target.bundle.method>0.70</jacoco.coverage.target.bundle.method>
|
||||||
<jacoco.coverage.target.class.method>0.25</jacoco.coverage.target.class.method>
|
<jacoco.coverage.target.class.method>0.50</jacoco.coverage.target.class.method>
|
||||||
<!-- For non-ci builds we'd like the build to still complete if jacoco metrics aren't met. -->
|
<!-- For non-ci builds we'd like the build to still complete if jacoco metrics aren't met. -->
|
||||||
<jacoco.haltOnFailure>false</jacoco.haltOnFailure>
|
<jacoco.haltOnFailure>false</jacoco.haltOnFailure>
|
||||||
|
<jjwt.suite.version>0.11.2</jjwt.suite.version>
|
||||||
|
|
||||||
|
<jacoco.surefire.argLine />
|
||||||
|
<surefire.argLine />
|
||||||
</properties>
|
</properties>
|
||||||
|
|
||||||
<build>
|
<build>
|
||||||
@@ -100,12 +102,17 @@
|
|||||||
<plugin>
|
<plugin>
|
||||||
<groupId>org.jacoco</groupId>
|
<groupId>org.jacoco</groupId>
|
||||||
<artifactId>jacoco-maven-plugin</artifactId>
|
<artifactId>jacoco-maven-plugin</artifactId>
|
||||||
<version>0.8.6</version>
|
<version>0.8.7</version>
|
||||||
<executions>
|
<executions>
|
||||||
<execution>
|
<execution>
|
||||||
<goals>
|
<goals>
|
||||||
<goal>prepare-agent</goal>
|
<goal>prepare-agent</goal>
|
||||||
</goals>
|
</goals>
|
||||||
|
<configuration>
|
||||||
|
<propertyName>jacoco.surefire.argLine</propertyName>
|
||||||
|
<!-- no need to get data about external code. It dramatically reduces performance of JaCoCo for nothing -->
|
||||||
|
<include>org.kohsuke.*</include>
|
||||||
|
</configuration>
|
||||||
</execution>
|
</execution>
|
||||||
<!-- attached to Maven test phase -->
|
<!-- attached to Maven test phase -->
|
||||||
<execution>
|
<execution>
|
||||||
@@ -153,59 +160,41 @@
|
|||||||
<!-- Sample only -->
|
<!-- Sample only -->
|
||||||
<exclude>org.kohsuke.github.example.*</exclude>
|
<exclude>org.kohsuke.github.example.*</exclude>
|
||||||
|
|
||||||
<!-- No methods -->
|
|
||||||
<exclude>org.kohsuke.github.Previews</exclude>
|
|
||||||
|
|
||||||
<!-- Deprecated -->
|
<!-- Deprecated -->
|
||||||
|
<exclude>org.kohsuke.github.extras.OkHttpConnector</exclude>
|
||||||
<exclude>org.kohsuke.github.extras.OkHttp3Connector</exclude>
|
<exclude>org.kohsuke.github.extras.OkHttp3Connector</exclude>
|
||||||
<exclude>org.kohsuke.github.EnforcementLevel</exclude>
|
<exclude>org.kohsuke.github.EnforcementLevel</exclude>
|
||||||
<exclude>org.kohsuke.github.GHPerson.1</exclude>
|
<exclude>org.kohsuke.github.GHPerson.1</exclude>
|
||||||
|
|
||||||
<!-- These fail coverage on windows because tests are disabled -->
|
<!-- TODO: Some coverage, but more needed -->
|
||||||
<exclude>org.kohsuke.github.GHAsset</exclude>
|
<exclude>org.kohsuke.github.GHPullRequestReviewBuilder.DraftReviewComment</exclude>
|
||||||
<exclude>org.kohsuke.github.GHReleaseBuilder</exclude>
|
<exclude>org.kohsuke.github.GHIssue.PullRequest</exclude>
|
||||||
<exclude>org.kohsuke.github.GHRelease</exclude>
|
<exclude>org.kohsuke.github.GHCommitSearchBuilder</exclude>
|
||||||
|
<exclude>org.kohsuke.github.GHRepositorySearchBuilder</exclude>
|
||||||
|
<exclude>org.kohsuke.github.GHUserSearchBuilder</exclude>
|
||||||
|
|
||||||
<!-- TODO: These still need test coverage -->
|
<!-- TODO: These still need test coverage -->
|
||||||
<exclude>org.kohsuke.github.GHBranchProtection.RequiredSignatures</exclude>
|
<exclude>org.kohsuke.github.GHBranchProtection.RequiredSignatures</exclude>
|
||||||
<exclude>org.kohsuke.github.GHBranchProtectionBuilder.Restrictions</exclude>
|
<exclude>org.kohsuke.github.GHBranchProtectionBuilder.Restrictions</exclude>
|
||||||
<exclude>org.kohsuke.github.GHBranchProtection.Restrictions</exclude>
|
<exclude>org.kohsuke.github.GHBranchProtection.Restrictions</exclude>
|
||||||
<exclude>org.kohsuke.github.GHCommentAuthorAssociation</exclude>
|
<exclude>org.kohsuke.github.GHCommentAuthorAssociation</exclude>
|
||||||
<exclude>org.kohsuke.github.GHCommitBuilder.UserInfo</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHCommitState</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHCompare.Commit</exclude>
|
<exclude>org.kohsuke.github.GHCompare.Commit</exclude>
|
||||||
<exclude>org.kohsuke.github.GHCompare.InnerCommit</exclude>
|
<exclude>org.kohsuke.github.GHCompare.InnerCommit</exclude>
|
||||||
<exclude>org.kohsuke.github.GHCompare.Status</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHCompare.Tree</exclude>
|
<exclude>org.kohsuke.github.GHCompare.Tree</exclude>
|
||||||
<exclude>org.kohsuke.github.GHCompare.User</exclude>
|
<exclude>org.kohsuke.github.GHCompare.User</exclude>
|
||||||
<exclude>org.kohsuke.github.GHCompare</exclude>
|
<exclude>org.kohsuke.github.GHCompare</exclude>
|
||||||
<exclude>org.kohsuke.github.GHDeployKey</exclude>
|
<exclude>org.kohsuke.github.GHDeployKey</exclude>
|
||||||
<exclude>org.kohsuke.github.GHDeploymentStatusBuilder</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHDirection</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHEmail</exclude>
|
<exclude>org.kohsuke.github.GHEmail</exclude>
|
||||||
<exclude>org.kohsuke.github.GHEventPayload.Ping</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHEventPayload.Release</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHException</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHHook</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHHooks.OrgContext</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHInvitation</exclude>
|
<exclude>org.kohsuke.github.GHInvitation</exclude>
|
||||||
<exclude>org.kohsuke.github.GHMilestoneState</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHOrgHook</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHProject.ProjectStateFilter</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.Authorship</exclude>
|
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.Authorship</exclude>
|
||||||
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.Commit</exclude>
|
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.Commit</exclude>
|
||||||
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.CommitPointer</exclude>
|
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.CommitPointer</exclude>
|
||||||
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.Tree</exclude>
|
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.Tree</exclude>
|
||||||
<exclude>org.kohsuke.github.GHPullRequestCommitDetail</exclude>
|
<exclude>org.kohsuke.github.GHPullRequestCommitDetail</exclude>
|
||||||
<exclude>org.kohsuke.github.GHPullRequestFileDetail</exclude>
|
<exclude>org.kohsuke.github.GHPullRequestFileDetail</exclude>
|
||||||
<exclude>org.kohsuke.github.GHPullRequestQueryBuilder.Sort</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHReleaseUpdater</exclude>
|
<exclude>org.kohsuke.github.GHReleaseUpdater</exclude>
|
||||||
<exclude>org.kohsuke.github.GHRepository.ForkSort</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHRequestedAction</exclude>
|
<exclude>org.kohsuke.github.GHRequestedAction</exclude>
|
||||||
<exclude>org.kohsuke.github.GHStargazer</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHTagObject</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHTeam.Role</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHUserSearchBuilder.Sort</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHVerifiedKey</exclude>
|
<exclude>org.kohsuke.github.GHVerifiedKey</exclude>
|
||||||
</excludes>
|
</excludes>
|
||||||
</rule>
|
</rule>
|
||||||
@@ -217,7 +206,7 @@
|
|||||||
<plugin>
|
<plugin>
|
||||||
<groupId>org.apache.maven.plugins</groupId>
|
<groupId>org.apache.maven.plugins</groupId>
|
||||||
<artifactId>maven-javadoc-plugin</artifactId>
|
<artifactId>maven-javadoc-plugin</artifactId>
|
||||||
<version>3.2.0</version>
|
<version>3.3.0</version>
|
||||||
<configuration>
|
<configuration>
|
||||||
<source>8</source>
|
<source>8</source>
|
||||||
<failOnWarnings>true</failOnWarnings>
|
<failOnWarnings>true</failOnWarnings>
|
||||||
@@ -261,7 +250,7 @@
|
|||||||
<plugin>
|
<plugin>
|
||||||
<groupId>org.apache.maven.plugins</groupId>
|
<groupId>org.apache.maven.plugins</groupId>
|
||||||
<artifactId>maven-project-info-reports-plugin</artifactId>
|
<artifactId>maven-project-info-reports-plugin</artifactId>
|
||||||
<version>3.1.0</version>
|
<version>3.1.2</version>
|
||||||
<dependencies>
|
<dependencies>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>org.apache.bcel</groupId>
|
<groupId>org.apache.bcel</groupId>
|
||||||
@@ -293,18 +282,7 @@
|
|||||||
<id>default-test</id>
|
<id>default-test</id>
|
||||||
<configuration>
|
<configuration>
|
||||||
<excludesFile>src/test/resources/slow-or-flaky-tests.txt</excludesFile>
|
<excludesFile>src/test/resources/slow-or-flaky-tests.txt</excludesFile>
|
||||||
</configuration>
|
<argLine>@{jacoco.surefire.argLine} ${surefire.argLine}</argLine>
|
||||||
</execution>
|
|
||||||
<execution>
|
|
||||||
<id>slow-or-flaky-test</id>
|
|
||||||
<phase>test</phase>
|
|
||||||
<goals>
|
|
||||||
<goal>test</goal>
|
|
||||||
</goals>
|
|
||||||
<configuration>
|
|
||||||
<rerunFailingTestsCount>2</rerunFailingTestsCount>
|
|
||||||
<!-- There are some tests that take longer or are a little flaky. Run them here. -->
|
|
||||||
<includesFile>src/test/resources/slow-or-flaky-tests.txt</includesFile>
|
|
||||||
</configuration>
|
</configuration>
|
||||||
</execution>
|
</execution>
|
||||||
</executions>
|
</executions>
|
||||||
@@ -312,7 +290,7 @@
|
|||||||
<plugin>
|
<plugin>
|
||||||
<groupId>org.codehaus.mojo</groupId>
|
<groupId>org.codehaus.mojo</groupId>
|
||||||
<artifactId>animal-sniffer-maven-plugin</artifactId>
|
<artifactId>animal-sniffer-maven-plugin</artifactId>
|
||||||
<version>1.19</version>
|
<version>1.20</version>
|
||||||
<configuration>
|
<configuration>
|
||||||
<signature>
|
<signature>
|
||||||
<groupId>org.codehaus.mojo.signature</groupId>
|
<groupId>org.codehaus.mojo.signature</groupId>
|
||||||
@@ -343,37 +321,35 @@
|
|||||||
</executions>
|
</executions>
|
||||||
</plugin>
|
</plugin>
|
||||||
<plugin>
|
<plugin>
|
||||||
<groupId>net.revelc.code.formatter</groupId>
|
<groupId>com.diffplug.spotless</groupId>
|
||||||
<artifactId>formatter-maven-plugin</artifactId>
|
<artifactId>spotless-maven-plugin</artifactId>
|
||||||
<version>2.12.1</version>
|
<version>2.11.1</version>
|
||||||
<executions>
|
<executions>
|
||||||
<execution>
|
<execution>
|
||||||
|
<id>spotless-check</id>
|
||||||
|
<!-- runs in verify phase by default -->
|
||||||
<goals>
|
<goals>
|
||||||
<goal>${formatter-maven-plugin.goal}</goal>
|
<!-- can be disabled using -Dspotless.check.skip=true -->
|
||||||
|
<goal>check</goal>
|
||||||
</goals>
|
</goals>
|
||||||
<configuration>
|
|
||||||
<configFile>src/main/resources/eclipse/formatter.xml</configFile>
|
|
||||||
<cachedir>${project.build.directory}/.cache</cachedir>
|
|
||||||
</configuration>
|
|
||||||
</execution>
|
</execution>
|
||||||
</executions>
|
</executions>
|
||||||
</plugin>
|
|
||||||
<plugin>
|
|
||||||
<groupId>net.revelc.code</groupId>
|
|
||||||
<artifactId>impsort-maven-plugin</artifactId>
|
|
||||||
<version>1.4.1</version>
|
|
||||||
<configuration>
|
<configuration>
|
||||||
<groups>*,java.,javax.</groups>
|
<java>
|
||||||
<removeUnused>true</removeUnused>
|
<eclipse>
|
||||||
<staticAfter>true</staticAfter>
|
<file>${basedir}/src/build/eclipse/formatter.xml</file>
|
||||||
|
</eclipse>
|
||||||
|
|
||||||
|
<importOrder>
|
||||||
|
<file>${basedir}/src/build/eclipse/eclipse.importorder</file>
|
||||||
|
</importOrder>
|
||||||
|
<removeUnusedImports />
|
||||||
|
|
||||||
|
<trimTrailingWhitespace />
|
||||||
|
<endWithNewline />
|
||||||
|
|
||||||
|
</java>
|
||||||
</configuration>
|
</configuration>
|
||||||
<executions>
|
|
||||||
<execution>
|
|
||||||
<goals>
|
|
||||||
<goal>${impsort-maven-plugin.goal}</goal>
|
|
||||||
</goals>
|
|
||||||
</execution>
|
|
||||||
</executions>
|
|
||||||
</plugin>
|
</plugin>
|
||||||
<plugin>
|
<plugin>
|
||||||
<groupId>com.github.spotbugs</groupId>
|
<groupId>com.github.spotbugs</groupId>
|
||||||
@@ -410,6 +386,12 @@
|
|||||||
<artifactId>commons-lang3</artifactId>
|
<artifactId>commons-lang3</artifactId>
|
||||||
<version>3.9</version>
|
<version>3.9</version>
|
||||||
</dependency>
|
</dependency>
|
||||||
|
<dependency>
|
||||||
|
<groupId>com.tngtech.archunit</groupId>
|
||||||
|
<artifactId>archunit</artifactId>
|
||||||
|
<version>0.19.0</version>
|
||||||
|
<scope>test</scope>
|
||||||
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>org.hamcrest</groupId>
|
<groupId>org.hamcrest</groupId>
|
||||||
<artifactId>hamcrest</artifactId>
|
<artifactId>hamcrest</artifactId>
|
||||||
@@ -432,23 +414,29 @@
|
|||||||
<dependency>
|
<dependency>
|
||||||
<groupId>junit</groupId>
|
<groupId>junit</groupId>
|
||||||
<artifactId>junit</artifactId>
|
<artifactId>junit</artifactId>
|
||||||
<version>4.13.1</version>
|
<version>4.13.2</version>
|
||||||
|
<scope>test</scope>
|
||||||
|
</dependency>
|
||||||
|
<dependency>
|
||||||
|
<groupId>org.awaitility</groupId>
|
||||||
|
<artifactId>awaitility</artifactId>
|
||||||
|
<version>4.1.0</version>
|
||||||
<scope>test</scope>
|
<scope>test</scope>
|
||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>com.fasterxml.jackson.core</groupId>
|
<groupId>com.fasterxml.jackson.core</groupId>
|
||||||
<artifactId>jackson-databind</artifactId>
|
<artifactId>jackson-databind</artifactId>
|
||||||
<version>2.10.2</version>
|
<version>2.12.3</version>
|
||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>commons-io</groupId>
|
<groupId>commons-io</groupId>
|
||||||
<artifactId>commons-io</artifactId>
|
<artifactId>commons-io</artifactId>
|
||||||
<version>2.4</version>
|
<version>2.8.0</version>
|
||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>com.infradna.tool</groupId>
|
<groupId>com.infradna.tool</groupId>
|
||||||
<artifactId>bridge-method-annotation</artifactId>
|
<artifactId>bridge-method-annotation</artifactId>
|
||||||
<version>1.18</version>
|
<version>1.21</version>
|
||||||
<optional>true</optional>
|
<optional>true</optional>
|
||||||
</dependency>
|
</dependency>
|
||||||
<!-- for stapler-jetty -->
|
<!-- for stapler-jetty -->
|
||||||
@@ -469,7 +457,7 @@
|
|||||||
<dependency>
|
<dependency>
|
||||||
<groupId>org.kohsuke.stapler</groupId>
|
<groupId>org.kohsuke.stapler</groupId>
|
||||||
<artifactId>stapler</artifactId>
|
<artifactId>stapler</artifactId>
|
||||||
<version>1.260</version>
|
<version>1.263</version>
|
||||||
<scope>test</scope>
|
<scope>test</scope>
|
||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
@@ -481,26 +469,26 @@
|
|||||||
<dependency>
|
<dependency>
|
||||||
<groupId>org.eclipse.jgit</groupId>
|
<groupId>org.eclipse.jgit</groupId>
|
||||||
<artifactId>org.eclipse.jgit</artifactId>
|
<artifactId>org.eclipse.jgit</artifactId>
|
||||||
<version>5.9.0.202009080501-r</version>
|
<version>5.11.1.202105131744-r</version>
|
||||||
<scope>test</scope>
|
<scope>test</scope>
|
||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>io.jsonwebtoken</groupId>
|
<groupId>io.jsonwebtoken</groupId>
|
||||||
<artifactId>jjwt-api</artifactId>
|
<artifactId>jjwt-api</artifactId>
|
||||||
<version>0.11.2</version>
|
<version>${jjwt.suite.version}</version>
|
||||||
<scope>test</scope>
|
<optional>true</optional>
|
||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>io.jsonwebtoken</groupId>
|
<groupId>io.jsonwebtoken</groupId>
|
||||||
<artifactId>jjwt-impl</artifactId>
|
<artifactId>jjwt-impl</artifactId>
|
||||||
<version>0.11.2</version>
|
<version>${jjwt.suite.version}</version>
|
||||||
<scope>test</scope>
|
<optional>true</optional>
|
||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>io.jsonwebtoken</groupId>
|
<groupId>io.jsonwebtoken</groupId>
|
||||||
<artifactId>jjwt-jackson</artifactId>
|
<artifactId>jjwt-jackson</artifactId>
|
||||||
<version>0.11.2</version>
|
<version>${jjwt.suite.version}</version>
|
||||||
<scope>test</scope>
|
<optional>true</optional>
|
||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>com.squareup.okio</groupId>
|
<groupId>com.squareup.okio</groupId>
|
||||||
@@ -531,13 +519,13 @@
|
|||||||
<dependency>
|
<dependency>
|
||||||
<groupId>org.kohsuke</groupId>
|
<groupId>org.kohsuke</groupId>
|
||||||
<artifactId>wordnet-random-name</artifactId>
|
<artifactId>wordnet-random-name</artifactId>
|
||||||
<version>1.3</version>
|
<version>1.5</version>
|
||||||
<scope>test</scope>
|
<scope>test</scope>
|
||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>org.mockito</groupId>
|
<groupId>org.mockito</groupId>
|
||||||
<artifactId>mockito-core</artifactId>
|
<artifactId>mockito-core</artifactId>
|
||||||
<version>3.6.0</version>
|
<version>3.10.0</version>
|
||||||
<scope>test</scope>
|
<scope>test</scope>
|
||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
@@ -549,19 +537,19 @@
|
|||||||
<dependency>
|
<dependency>
|
||||||
<groupId>com.github.tomakehurst</groupId>
|
<groupId>com.github.tomakehurst</groupId>
|
||||||
<artifactId>wiremock-jre8-standalone</artifactId>
|
<artifactId>wiremock-jre8-standalone</artifactId>
|
||||||
<version>2.27.2</version>
|
<version>2.28.0</version>
|
||||||
<scope>test</scope>
|
<scope>test</scope>
|
||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>com.google.code.gson</groupId>
|
<groupId>com.google.code.gson</groupId>
|
||||||
<artifactId>gson</artifactId>
|
<artifactId>gson</artifactId>
|
||||||
<version>2.8.6</version>
|
<version>2.8.7</version>
|
||||||
<scope>test</scope>
|
<scope>test</scope>
|
||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>org.slf4j</groupId>
|
<groupId>org.slf4j</groupId>
|
||||||
<artifactId>slf4j-simple</artifactId>
|
<artifactId>slf4j-simple</artifactId>
|
||||||
<version>1.7.2</version>
|
<version>1.7.30</version>
|
||||||
<scope>test</scope>
|
<scope>test</scope>
|
||||||
</dependency>
|
</dependency>
|
||||||
</dependencies>
|
</dependencies>
|
||||||
@@ -578,6 +566,38 @@
|
|||||||
</pluginRepository>
|
</pluginRepository>
|
||||||
</pluginRepositories>
|
</pluginRepositories>
|
||||||
<profiles>
|
<profiles>
|
||||||
|
<!-- only enable slow-or-flaky-test if -Dtest= is not present -->
|
||||||
|
<profile>
|
||||||
|
<id>slow-or-flaky-test</id>
|
||||||
|
<activation>
|
||||||
|
<property>
|
||||||
|
<name>!test</name>
|
||||||
|
</property>
|
||||||
|
</activation>
|
||||||
|
<build>
|
||||||
|
<plugins>
|
||||||
|
<plugin>
|
||||||
|
<artifactId>maven-surefire-plugin</artifactId>
|
||||||
|
<executions>
|
||||||
|
<execution>
|
||||||
|
<id>slow-or-flaky-test</id>
|
||||||
|
<phase>test</phase>
|
||||||
|
<goals>
|
||||||
|
<goal>test</goal>
|
||||||
|
</goals>
|
||||||
|
<configuration>
|
||||||
|
<rerunFailingTestsCount>2</rerunFailingTestsCount>
|
||||||
|
<!-- There are some tests that take longer or are a little
|
||||||
|
flaky. Run them here. -->
|
||||||
|
<includesFile>src/test/resources/slow-or-flaky-tests.txt</includesFile>
|
||||||
|
<argLine>@{jacoco.surefire.argLine} ${surefire.argLine}</argLine>
|
||||||
|
</configuration>
|
||||||
|
</execution>
|
||||||
|
</executions>
|
||||||
|
</plugin>
|
||||||
|
</plugins>
|
||||||
|
</build>
|
||||||
|
</profile>
|
||||||
<profile>
|
<profile>
|
||||||
<id>ci-non-windows</id>
|
<id>ci-non-windows</id>
|
||||||
<activation>
|
<activation>
|
||||||
@@ -589,8 +609,8 @@
|
|||||||
</os>
|
</os>
|
||||||
</activation>
|
</activation>
|
||||||
<properties>
|
<properties>
|
||||||
<formatter-maven-plugin.goal>validate</formatter-maven-plugin.goal>
|
<!-- Only fail code coverage on non-windows machines -->
|
||||||
<impsort-maven-plugin.goal>check</impsort-maven-plugin.goal>
|
<jacoco.haltOnFailure>true</jacoco.haltOnFailure>
|
||||||
</properties>
|
</properties>
|
||||||
</profile>
|
</profile>
|
||||||
<profile>
|
<profile>
|
||||||
@@ -600,24 +620,55 @@
|
|||||||
<name>enable-ci</name>
|
<name>enable-ci</name>
|
||||||
</property>
|
</property>
|
||||||
</activation>
|
</activation>
|
||||||
<properties>
|
|
||||||
<jacoco.haltOnFailure>true</jacoco.haltOnFailure>
|
|
||||||
</properties>
|
|
||||||
<build>
|
<build>
|
||||||
<plugins>
|
<plugins>
|
||||||
<plugin>
|
<plugin>
|
||||||
<groupId>org.jacoco</groupId>
|
<groupId>org.jacoco</groupId>
|
||||||
<artifactId>jacoco-maven-plugin</artifactId>
|
<artifactId>jacoco-maven-plugin</artifactId>
|
||||||
</plugin>
|
</plugin>
|
||||||
|
<plugin>
|
||||||
|
<groupId>com.diffplug.spotless</groupId>
|
||||||
|
<artifactId>spotless-maven-plugin</artifactId>
|
||||||
|
<executions>
|
||||||
|
<execution>
|
||||||
|
<id>spotless-check</id>
|
||||||
|
<!-- In CI, run check early in the build -->
|
||||||
|
<phase>process-sources</phase>
|
||||||
|
<goals>
|
||||||
|
<goal>check</goal>
|
||||||
|
</goals>
|
||||||
|
</execution>
|
||||||
|
</executions>
|
||||||
|
</plugin>
|
||||||
|
<plugin>
|
||||||
|
<groupId>org.apache.maven.plugins</groupId>
|
||||||
|
<artifactId>maven-enforcer-plugin</artifactId>
|
||||||
|
<version>3.0.0-M3</version>
|
||||||
|
<executions>
|
||||||
|
<execution>
|
||||||
|
<id>enforce-jacoco-exist</id>
|
||||||
|
<phase>verify</phase>
|
||||||
|
<goals>
|
||||||
|
<goal>enforce</goal>
|
||||||
|
</goals>
|
||||||
|
<configuration>
|
||||||
|
<rules>
|
||||||
|
<requireFilesExist>
|
||||||
|
<files>
|
||||||
|
<file>${project.build.directory}/jacoco.exec</file>
|
||||||
|
</files>
|
||||||
|
</requireFilesExist>
|
||||||
|
</rules>
|
||||||
|
<fail>true</fail>
|
||||||
|
</configuration>
|
||||||
|
</execution>
|
||||||
|
</executions>
|
||||||
|
</plugin>
|
||||||
</plugins>
|
</plugins>
|
||||||
</build>
|
</build>
|
||||||
</profile>
|
</profile>
|
||||||
<profile>
|
<profile>
|
||||||
<id>release</id>
|
<id>release</id>
|
||||||
<properties>
|
|
||||||
<formatter-maven-plugin.goal>validate</formatter-maven-plugin.goal>
|
|
||||||
<impsort-maven-plugin.goal>check</impsort-maven-plugin.goal>
|
|
||||||
</properties>
|
|
||||||
<build>
|
<build>
|
||||||
<plugins>
|
<plugins>
|
||||||
<plugin>
|
<plugin>
|
||||||
|
|||||||
6
src/build/eclipse/eclipse.importorder
Normal file
6
src/build/eclipse/eclipse.importorder
Normal file
@@ -0,0 +1,6 @@
|
|||||||
|
#Organize Import Order
|
||||||
|
# Import this file in Window -> Preferences -> Java -> Code Style -> Organize Imports -> Import...
|
||||||
|
0=
|
||||||
|
1=java
|
||||||
|
2=javax
|
||||||
|
3=\#
|
||||||
@@ -12,14 +12,14 @@ import javax.annotation.Nonnull;
|
|||||||
* <p>
|
* <p>
|
||||||
* Batching looks like this:
|
* Batching looks like this:
|
||||||
* </p>
|
* </p>
|
||||||
*
|
*
|
||||||
* <pre>
|
* <pre>
|
||||||
* update().someName(value).otherName(value).done()
|
* update().someName(value).otherName(value).done()
|
||||||
* </pre>
|
* </pre>
|
||||||
* <p>
|
* <p>
|
||||||
* Single changes look like this:
|
* Single changes look like this:
|
||||||
* </p>
|
* </p>
|
||||||
*
|
*
|
||||||
* <pre>
|
* <pre>
|
||||||
* set().someName(value);
|
* set().someName(value);
|
||||||
* set().otherName(value);
|
* set().otherName(value);
|
||||||
@@ -38,7 +38,7 @@ import javax.annotation.Nonnull;
|
|||||||
* Intermediate return type for this builder returned by calls to {@link #with(String, Object)}. If {@link S}
|
* Intermediate return type for this builder returned by calls to {@link #with(String, Object)}. If {@link S}
|
||||||
* the same as {@link R}, this builder will commit changes after each call to {@link #with(String, Object)}.
|
* the same as {@link R}, this builder will commit changes after each call to {@link #with(String, Object)}.
|
||||||
*/
|
*/
|
||||||
abstract class AbstractBuilder<R, S> {
|
abstract class AbstractBuilder<R, S> extends GitHubInteractiveObject {
|
||||||
|
|
||||||
@Nonnull
|
@Nonnull
|
||||||
private final Class<R> returnType;
|
private final Class<R> returnType;
|
||||||
@@ -75,6 +75,7 @@ abstract class AbstractBuilder<R, S> {
|
|||||||
@Nonnull Class<S> intermediateReturnType,
|
@Nonnull Class<S> intermediateReturnType,
|
||||||
@Nonnull GitHub root,
|
@Nonnull GitHub root,
|
||||||
@CheckForNull R baseInstance) {
|
@CheckForNull R baseInstance) {
|
||||||
|
super(root);
|
||||||
this.requester = root.createRequest();
|
this.requester = root.createRequest();
|
||||||
this.returnType = finalReturnType;
|
this.returnType = finalReturnType;
|
||||||
this.commitChangesImmediately = returnType.equals(intermediateReturnType);
|
this.commitChangesImmediately = returnType.equals(intermediateReturnType);
|
||||||
@@ -97,7 +98,7 @@ abstract class AbstractBuilder<R, S> {
|
|||||||
* if there is an I/O Exception
|
* if there is an I/O Exception
|
||||||
*/
|
*/
|
||||||
@Nonnull
|
@Nonnull
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public R done() throws IOException {
|
public R done() throws IOException {
|
||||||
R result;
|
R result;
|
||||||
@@ -127,7 +128,7 @@ abstract class AbstractBuilder<R, S> {
|
|||||||
* if an I/O error occurs
|
* if an I/O error occurs
|
||||||
*/
|
*/
|
||||||
@Nonnull
|
@Nonnull
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
protected S with(@Nonnull String name, Object value) throws IOException {
|
protected S with(@Nonnull String name, Object value) throws IOException {
|
||||||
requester.with(name, value);
|
requester.with(name, value);
|
||||||
@@ -148,7 +149,7 @@ abstract class AbstractBuilder<R, S> {
|
|||||||
* if an I/O error occurs
|
* if an I/O error occurs
|
||||||
*/
|
*/
|
||||||
@Nonnull
|
@Nonnull
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
protected S continueOrDone() throws IOException {
|
protected S continueOrDone() throws IOException {
|
||||||
// This little bit of roughness in this base class means all inheriting builders get to create Updater and
|
// This little bit of roughness in this base class means all inheriting builders get to create Updater and
|
||||||
|
|||||||
18
src/main/java/org/kohsuke/github/BetaApi.java
Normal file
18
src/main/java/org/kohsuke/github/BetaApi.java
Normal file
@@ -0,0 +1,18 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import java.lang.annotation.Documented;
|
||||||
|
import java.lang.annotation.Retention;
|
||||||
|
import java.lang.annotation.RetentionPolicy;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Indicates that the method/class/etc marked is a beta implementation of an sdk feature.
|
||||||
|
* <p>
|
||||||
|
* These APIs are subject to change and not a part of the backward compatibility commitment. Always used in conjunction
|
||||||
|
* with 'deprecated' to raise awareness to clients.
|
||||||
|
* </p>
|
||||||
|
*
|
||||||
|
*/
|
||||||
|
@Retention(RetentionPolicy.RUNTIME)
|
||||||
|
@Documented
|
||||||
|
public @interface BetaApi {
|
||||||
|
}
|
||||||
@@ -1,11 +1,14 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import org.kohsuke.github.internal.EnumUtils;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
import java.util.Map;
|
import java.util.Map;
|
||||||
|
import java.util.stream.Collectors;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.MACHINE_MAN;
|
import static org.kohsuke.github.internal.Previews.MACHINE_MAN;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* A Github App.
|
* A Github App.
|
||||||
@@ -15,13 +18,12 @@ import static org.kohsuke.github.Previews.MACHINE_MAN;
|
|||||||
*/
|
*/
|
||||||
public class GHApp extends GHObject {
|
public class GHApp extends GHObject {
|
||||||
|
|
||||||
private GitHub root;
|
|
||||||
private GHUser owner;
|
private GHUser owner;
|
||||||
private String name;
|
private String name;
|
||||||
private String description;
|
private String description;
|
||||||
private String externalUrl;
|
private String externalUrl;
|
||||||
private Map<String, String> permissions;
|
private Map<String, String> permissions;
|
||||||
private List<GHEvent> events;
|
private List<String> events;
|
||||||
private long installationsCount;
|
private long installationsCount;
|
||||||
private String htmlUrl;
|
private String htmlUrl;
|
||||||
|
|
||||||
@@ -115,7 +117,9 @@ public class GHApp extends GHObject {
|
|||||||
* @return the events
|
* @return the events
|
||||||
*/
|
*/
|
||||||
public List<GHEvent> getEvents() {
|
public List<GHEvent> getEvents() {
|
||||||
return events;
|
return events.stream()
|
||||||
|
.map(e -> EnumUtils.getEnumOrDefault(GHEvent.class, e, GHEvent.UNKNOWN))
|
||||||
|
.collect(Collectors.toList());
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -127,7 +131,7 @@ public class GHApp extends GHObject {
|
|||||||
*/
|
*/
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public void setEvents(List<GHEvent> events) {
|
public void setEvents(List<GHEvent> events) {
|
||||||
this.events = events;
|
this.events = events.stream().map(GHEvent::symbol).collect(Collectors.toList());
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -189,7 +193,7 @@ public class GHApp extends GHObject {
|
|||||||
* @return a list of App installations
|
* @return a list of App installations
|
||||||
* @see <a href="https://developer.github.com/v3/apps/#list-installations">List installations</a>
|
* @see <a href="https://developer.github.com/v3/apps/#list-installations">List installations</a>
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(MACHINE_MAN)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public PagedIterable<GHAppInstallation> listInstallations() {
|
public PagedIterable<GHAppInstallation> listInstallations() {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
@@ -210,7 +214,7 @@ public class GHApp extends GHObject {
|
|||||||
* on error
|
* on error
|
||||||
* @see <a href="https://developer.github.com/v3/apps/#get-an-installation">Get an installation</a>
|
* @see <a href="https://developer.github.com/v3/apps/#get-an-installation">Get an installation</a>
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(MACHINE_MAN)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppInstallation getInstallationById(long id) throws IOException {
|
public GHAppInstallation getInstallationById(long id) throws IOException {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
@@ -233,7 +237,7 @@ public class GHApp extends GHObject {
|
|||||||
* @see <a href="https://developer.github.com/v3/apps/#get-an-organization-installation">Get an organization
|
* @see <a href="https://developer.github.com/v3/apps/#get-an-organization-installation">Get an organization
|
||||||
* installation</a>
|
* installation</a>
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(MACHINE_MAN)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppInstallation getInstallationByOrganization(String name) throws IOException {
|
public GHAppInstallation getInstallationByOrganization(String name) throws IOException {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
@@ -258,7 +262,7 @@ public class GHApp extends GHObject {
|
|||||||
* @see <a href="https://developer.github.com/v3/apps/#get-a-repository-installation">Get a repository
|
* @see <a href="https://developer.github.com/v3/apps/#get-a-repository-installation">Get a repository
|
||||||
* installation</a>
|
* installation</a>
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(MACHINE_MAN)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppInstallation getInstallationByRepository(String ownerName, String repositoryName) throws IOException {
|
public GHAppInstallation getInstallationByRepository(String ownerName, String repositoryName) throws IOException {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
@@ -280,7 +284,7 @@ public class GHApp extends GHObject {
|
|||||||
* on error
|
* on error
|
||||||
* @see <a href="https://developer.github.com/v3/apps/#get-a-user-installation">Get a user installation</a>
|
* @see <a href="https://developer.github.com/v3/apps/#get-a-user-installation">Get a user installation</a>
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(MACHINE_MAN)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppInstallation getInstallationByUser(String name) throws IOException {
|
public GHAppInstallation getInstallationByUser(String name) throws IOException {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
|
|||||||
@@ -5,7 +5,7 @@ import java.util.HashMap;
|
|||||||
import java.util.List;
|
import java.util.List;
|
||||||
import java.util.Map;
|
import java.util.Map;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.MACHINE_MAN;
|
import static org.kohsuke.github.internal.Previews.MACHINE_MAN;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a access token for a GitHub App Installation
|
* Creates a access token for a GitHub App Installation
|
||||||
@@ -14,12 +14,11 @@ import static org.kohsuke.github.Previews.MACHINE_MAN;
|
|||||||
* @see GHAppInstallation#createToken(Map) GHAppInstallation#createToken(Map)
|
* @see GHAppInstallation#createToken(Map) GHAppInstallation#createToken(Map)
|
||||||
* @see GHAppInstallation#createToken() GHAppInstallation#createToken()
|
* @see GHAppInstallation#createToken() GHAppInstallation#createToken()
|
||||||
*/
|
*/
|
||||||
public class GHAppCreateTokenBuilder {
|
public class GHAppCreateTokenBuilder extends GitHubInteractiveObject {
|
||||||
private final GitHub root;
|
|
||||||
protected final Requester builder;
|
protected final Requester builder;
|
||||||
private final String apiUrlTail;
|
private final String apiUrlTail;
|
||||||
|
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
GHAppCreateTokenBuilder(GitHub root, String apiUrlTail) {
|
GHAppCreateTokenBuilder(GitHub root, String apiUrlTail) {
|
||||||
this.root = root;
|
this.root = root;
|
||||||
@@ -27,7 +26,7 @@ public class GHAppCreateTokenBuilder {
|
|||||||
this.builder = root.createRequest();
|
this.builder = root.createRequest();
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
GHAppCreateTokenBuilder(GitHub root, String apiUrlTail, Map<String, GHPermissionType> permissions) {
|
GHAppCreateTokenBuilder(GitHub root, String apiUrlTail, Map<String, GHPermissionType> permissions) {
|
||||||
this(root, apiUrlTail);
|
this(root, apiUrlTail);
|
||||||
@@ -43,7 +42,7 @@ public class GHAppCreateTokenBuilder {
|
|||||||
* Array containing the repositories Ids
|
* Array containing the repositories Ids
|
||||||
* @return a GHAppCreateTokenBuilder
|
* @return a GHAppCreateTokenBuilder
|
||||||
*/
|
*/
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppCreateTokenBuilder repositoryIds(List<Long> repositoryIds) {
|
public GHAppCreateTokenBuilder repositoryIds(List<Long> repositoryIds) {
|
||||||
this.builder.with("repository_ids", repositoryIds);
|
this.builder.with("repository_ids", repositoryIds);
|
||||||
@@ -58,7 +57,7 @@ public class GHAppCreateTokenBuilder {
|
|||||||
* Map containing the permission names and types.
|
* Map containing the permission names and types.
|
||||||
* @return a GHAppCreateTokenBuilder
|
* @return a GHAppCreateTokenBuilder
|
||||||
*/
|
*/
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppCreateTokenBuilder permissions(Map<String, GHPermissionType> permissions) {
|
public GHAppCreateTokenBuilder permissions(Map<String, GHPermissionType> permissions) {
|
||||||
Map<String, String> retMap = new HashMap<>();
|
Map<String, String> retMap = new HashMap<>();
|
||||||
@@ -78,7 +77,7 @@ public class GHAppCreateTokenBuilder {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* on error
|
* on error
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(MACHINE_MAN)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppInstallationToken create() throws IOException {
|
public GHAppInstallationToken create() throws IOException {
|
||||||
return builder.method("POST")
|
return builder.method("POST")
|
||||||
|
|||||||
@@ -1,15 +1,17 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
import com.fasterxml.jackson.annotation.JsonProperty;
|
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||||
|
import org.kohsuke.github.internal.EnumUtils;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.MalformedURLException;
|
import java.net.MalformedURLException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
import java.util.Map;
|
import java.util.Map;
|
||||||
|
import java.util.stream.Collectors;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.GAMBIT;
|
import static org.kohsuke.github.internal.Previews.GAMBIT;
|
||||||
import static org.kohsuke.github.Previews.MACHINE_MAN;
|
import static org.kohsuke.github.internal.Previews.MACHINE_MAN;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* A Github App Installation.
|
* A Github App Installation.
|
||||||
@@ -22,7 +24,6 @@ import static org.kohsuke.github.Previews.MACHINE_MAN;
|
|||||||
* @see GHApp#getInstallationByUser(String) GHApp#getInstallationByUser(String)
|
* @see GHApp#getInstallationByUser(String) GHApp#getInstallationByUser(String)
|
||||||
*/
|
*/
|
||||||
public class GHAppInstallation extends GHObject {
|
public class GHAppInstallation extends GHObject {
|
||||||
private GitHub root;
|
|
||||||
private GHUser account;
|
private GHUser account;
|
||||||
|
|
||||||
@JsonProperty("access_tokens_url")
|
@JsonProperty("access_tokens_url")
|
||||||
@@ -36,7 +37,7 @@ public class GHAppInstallation extends GHObject {
|
|||||||
@JsonProperty("target_type")
|
@JsonProperty("target_type")
|
||||||
private GHTargetType targetType;
|
private GHTargetType targetType;
|
||||||
private Map<String, GHPermissionType> permissions;
|
private Map<String, GHPermissionType> permissions;
|
||||||
private List<GHEvent> events;
|
private List<String> events;
|
||||||
@JsonProperty("single_file_name")
|
@JsonProperty("single_file_name")
|
||||||
private String singleFileName;
|
private String singleFileName;
|
||||||
@JsonProperty("repository_selection")
|
@JsonProperty("repository_selection")
|
||||||
@@ -124,7 +125,7 @@ public class GHAppInstallation extends GHObject {
|
|||||||
*
|
*
|
||||||
* @return the paged iterable
|
* @return the paged iterable
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(MACHINE_MAN)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public PagedSearchIterable<GHRepository> listRepositories() {
|
public PagedSearchIterable<GHRepository> listRepositories() {
|
||||||
GitHubRequest request;
|
GitHubRequest request;
|
||||||
@@ -251,7 +252,9 @@ public class GHAppInstallation extends GHObject {
|
|||||||
* @return the events
|
* @return the events
|
||||||
*/
|
*/
|
||||||
public List<GHEvent> getEvents() {
|
public List<GHEvent> getEvents() {
|
||||||
return events;
|
return events.stream()
|
||||||
|
.map(e -> EnumUtils.getEnumOrDefault(GHEvent.class, e, GHEvent.UNKNOWN))
|
||||||
|
.collect(Collectors.toList());
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -263,7 +266,7 @@ public class GHAppInstallation extends GHObject {
|
|||||||
*/
|
*/
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public void setEvents(List<GHEvent> events) {
|
public void setEvents(List<GHEvent> events) {
|
||||||
this.events = events;
|
this.events = events.stream().map(GHEvent::symbol).collect(Collectors.toList());
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -322,7 +325,7 @@ public class GHAppInstallation extends GHObject {
|
|||||||
* on error
|
* on error
|
||||||
* @see <a href="https://developer.github.com/v3/apps/#delete-an-installation">Delete an installation</a>
|
* @see <a href="https://developer.github.com/v3/apps/#delete-an-installation">Delete an installation</a>
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(GAMBIT)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public void deleteInstallation() throws IOException {
|
public void deleteInstallation() throws IOException {
|
||||||
root.createRequest()
|
root.createRequest()
|
||||||
@@ -344,7 +347,7 @@ public class GHAppInstallation extends GHObject {
|
|||||||
* @return a GHAppCreateTokenBuilder instance
|
* @return a GHAppCreateTokenBuilder instance
|
||||||
* @deprecated Use {@link GHAppInstallation#createToken()} instead.
|
* @deprecated Use {@link GHAppInstallation#createToken()} instead.
|
||||||
*/
|
*/
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppCreateTokenBuilder createToken(Map<String, GHPermissionType> permissions) {
|
public GHAppCreateTokenBuilder createToken(Map<String, GHPermissionType> permissions) {
|
||||||
return new GHAppCreateTokenBuilder(root,
|
return new GHAppCreateTokenBuilder(root,
|
||||||
@@ -361,7 +364,7 @@ public class GHAppInstallation extends GHObject {
|
|||||||
*
|
*
|
||||||
* @return a GHAppCreateTokenBuilder instance
|
* @return a GHAppCreateTokenBuilder instance
|
||||||
*/
|
*/
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppCreateTokenBuilder createToken() {
|
public GHAppCreateTokenBuilder createToken() {
|
||||||
return new GHAppCreateTokenBuilder(root, String.format("/app/installations/%d/access_tokens", getId()));
|
return new GHAppCreateTokenBuilder(root, String.format("/app/installations/%d/access_tokens", getId()));
|
||||||
|
|||||||
@@ -14,9 +14,7 @@ import java.util.Map;
|
|||||||
* @author Paulo Miguel Almeida
|
* @author Paulo Miguel Almeida
|
||||||
* @see GHAppInstallation#createToken(Map) GHAppInstallation#createToken(Map)
|
* @see GHAppInstallation#createToken(Map) GHAppInstallation#createToken(Map)
|
||||||
*/
|
*/
|
||||||
public class GHAppInstallationToken {
|
public class GHAppInstallationToken extends GitHubInteractiveObject {
|
||||||
private GitHub root;
|
|
||||||
|
|
||||||
private String token;
|
private String token;
|
||||||
protected String expires_at;
|
protected String expires_at;
|
||||||
private Map<String, String> permissions;
|
private Map<String, String> permissions;
|
||||||
|
|||||||
140
src/main/java/org/kohsuke/github/GHArtifact.java
Normal file
140
src/main/java/org/kohsuke/github/GHArtifact.java
Normal file
@@ -0,0 +1,140 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import com.fasterxml.jackson.annotation.JsonIgnore;
|
||||||
|
import org.apache.commons.lang3.StringUtils;
|
||||||
|
import org.kohsuke.github.function.InputStreamFunction;
|
||||||
|
|
||||||
|
import java.io.IOException;
|
||||||
|
import java.net.URL;
|
||||||
|
import java.util.Date;
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
|
import static java.util.Objects.requireNonNull;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* An artifact from a workflow run.
|
||||||
|
*
|
||||||
|
* @author Guillaume Smet
|
||||||
|
*/
|
||||||
|
public class GHArtifact extends GHObject {
|
||||||
|
|
||||||
|
// Not provided by the API.
|
||||||
|
@JsonIgnore
|
||||||
|
private GHRepository owner;
|
||||||
|
|
||||||
|
private String name;
|
||||||
|
private long sizeInBytes;
|
||||||
|
private String archiveDownloadUrl;
|
||||||
|
private boolean expired;
|
||||||
|
private String expiresAt;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the name.
|
||||||
|
*
|
||||||
|
* @return the name
|
||||||
|
*/
|
||||||
|
public String getName() {
|
||||||
|
return name;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the size of the artifact in bytes.
|
||||||
|
*
|
||||||
|
* @return the size
|
||||||
|
*/
|
||||||
|
public long getSizeInBytes() {
|
||||||
|
return sizeInBytes;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the archive download URL.
|
||||||
|
*
|
||||||
|
* @return the archive download URL
|
||||||
|
*/
|
||||||
|
public URL getArchiveDownloadUrl() {
|
||||||
|
return GitHubClient.parseURL(archiveDownloadUrl);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* If this artifact has expired.
|
||||||
|
*
|
||||||
|
* @return if the artifact has expired
|
||||||
|
*/
|
||||||
|
public boolean isExpired() {
|
||||||
|
return expired;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the date at which this artifact will expire.
|
||||||
|
*
|
||||||
|
* @return the date of expiration
|
||||||
|
*/
|
||||||
|
public Date getExpiresAt() {
|
||||||
|
return GitHubClient.parseDate(expiresAt);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Repository to which the artifact belongs.
|
||||||
|
*
|
||||||
|
* @return the repository
|
||||||
|
*/
|
||||||
|
public GHRepository getRepository() {
|
||||||
|
return owner;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* @deprecated This object has no HTML URL.
|
||||||
|
*/
|
||||||
|
@Override
|
||||||
|
public URL getHtmlUrl() throws IOException {
|
||||||
|
return null;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Deletes the artifact.
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public void delete() throws IOException {
|
||||||
|
root.createRequest().method("DELETE").withUrlPath(getApiRoute()).fetchHttpStatusCode();
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Downloads the artifact.
|
||||||
|
*
|
||||||
|
* @param <T>
|
||||||
|
* the type of result
|
||||||
|
* @param streamFunction
|
||||||
|
* The {@link InputStreamFunction} that will process the stream
|
||||||
|
* @throws IOException
|
||||||
|
* The IO exception.
|
||||||
|
* @return the result of reading the stream.
|
||||||
|
*/
|
||||||
|
public <T> T download(InputStreamFunction<T> streamFunction) throws IOException {
|
||||||
|
requireNonNull(streamFunction, "Stream function must not be null");
|
||||||
|
|
||||||
|
return root.createRequest().method("GET").withUrlPath(getApiRoute(), "zip").fetchStream(streamFunction);
|
||||||
|
}
|
||||||
|
|
||||||
|
private String getApiRoute() {
|
||||||
|
if (owner == null) {
|
||||||
|
// Workflow runs returned from search to do not have an owner. Attempt to use url.
|
||||||
|
final URL url = Objects.requireNonNull(getUrl(), "Missing instance URL!");
|
||||||
|
return StringUtils.prependIfMissing(url.toString().replace(root.getApiUrl(), ""), "/");
|
||||||
|
}
|
||||||
|
return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/actions/artifacts/" + getId();
|
||||||
|
}
|
||||||
|
|
||||||
|
GHArtifact wrapUp(GHRepository owner) {
|
||||||
|
this.owner = owner;
|
||||||
|
return wrapUp(owner.root);
|
||||||
|
}
|
||||||
|
|
||||||
|
GHArtifact wrapUp(GitHub root) {
|
||||||
|
this.root = root;
|
||||||
|
if (owner != null)
|
||||||
|
owner.wrap(root);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
}
|
||||||
49
src/main/java/org/kohsuke/github/GHArtifactsIterable.java
Normal file
49
src/main/java/org/kohsuke/github/GHArtifactsIterable.java
Normal file
@@ -0,0 +1,49 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import java.net.MalformedURLException;
|
||||||
|
import java.util.Iterator;
|
||||||
|
|
||||||
|
import javax.annotation.Nonnull;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Iterable for artifacts listing.
|
||||||
|
*/
|
||||||
|
class GHArtifactsIterable extends PagedIterable<GHArtifact> {
|
||||||
|
private final transient GHRepository owner;
|
||||||
|
private final GitHubRequest request;
|
||||||
|
|
||||||
|
private GHArtifactsPage result;
|
||||||
|
|
||||||
|
public GHArtifactsIterable(GHRepository owner, GitHubRequest.Builder<?> requestBuilder) {
|
||||||
|
this.owner = owner;
|
||||||
|
try {
|
||||||
|
this.request = requestBuilder.build();
|
||||||
|
} catch (MalformedURLException e) {
|
||||||
|
throw new GHException("Malformed URL", e);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
@Nonnull
|
||||||
|
@Override
|
||||||
|
public PagedIterator<GHArtifact> _iterator(int pageSize) {
|
||||||
|
return new PagedIterator<>(
|
||||||
|
adapt(GitHubPageIterator.create(owner.getRoot().getClient(), GHArtifactsPage.class, request, pageSize)),
|
||||||
|
null);
|
||||||
|
}
|
||||||
|
|
||||||
|
protected Iterator<GHArtifact[]> adapt(final Iterator<GHArtifactsPage> base) {
|
||||||
|
return new Iterator<GHArtifact[]>() {
|
||||||
|
public boolean hasNext() {
|
||||||
|
return base.hasNext();
|
||||||
|
}
|
||||||
|
|
||||||
|
public GHArtifact[] next() {
|
||||||
|
GHArtifactsPage v = base.next();
|
||||||
|
if (result == null) {
|
||||||
|
result = v;
|
||||||
|
}
|
||||||
|
return v.getArtifacts(owner);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
}
|
||||||
|
}
|
||||||
20
src/main/java/org/kohsuke/github/GHArtifactsPage.java
Normal file
20
src/main/java/org/kohsuke/github/GHArtifactsPage.java
Normal file
@@ -0,0 +1,20 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Represents the one page of artifacts result when listing artifacts.
|
||||||
|
*/
|
||||||
|
class GHArtifactsPage {
|
||||||
|
private int total_count;
|
||||||
|
private GHArtifact[] artifacts;
|
||||||
|
|
||||||
|
public int getTotalCount() {
|
||||||
|
return total_count;
|
||||||
|
}
|
||||||
|
|
||||||
|
GHArtifact[] getArtifacts(GHRepository owner) {
|
||||||
|
for (GHArtifact artifact : artifacts) {
|
||||||
|
artifact.wrapUp(owner);
|
||||||
|
}
|
||||||
|
return artifacts;
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -9,7 +9,6 @@ import java.net.URL;
|
|||||||
* @see GHRelease#getAssets() GHRelease#getAssets()
|
* @see GHRelease#getAssets() GHRelease#getAssets()
|
||||||
*/
|
*/
|
||||||
public class GHAsset extends GHObject {
|
public class GHAsset extends GHObject {
|
||||||
GitHub root;
|
|
||||||
GHRepository owner;
|
GHRepository owner;
|
||||||
private String name;
|
private String name;
|
||||||
private String label;
|
private String label;
|
||||||
|
|||||||
@@ -33,7 +33,6 @@ public class GHAuthorization extends GHObject {
|
|||||||
public static final String WRITE_KEY = "write:public_key";
|
public static final String WRITE_KEY = "write:public_key";
|
||||||
public static final String ADMIN_KEY = "admin:public_key";
|
public static final String ADMIN_KEY = "admin:public_key";
|
||||||
|
|
||||||
private GitHub root;
|
|
||||||
private List<String> scopes;
|
private List<String> scopes;
|
||||||
private String token;
|
private String token;
|
||||||
private String token_last_eight;
|
private String token_last_eight;
|
||||||
|
|||||||
@@ -3,6 +3,7 @@ package org.kohsuke.github;
|
|||||||
import com.fasterxml.jackson.annotation.JsonCreator;
|
import com.fasterxml.jackson.annotation.JsonCreator;
|
||||||
import com.fasterxml.jackson.annotation.JsonProperty;
|
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
@@ -20,8 +21,7 @@ import javax.annotation.CheckForNull;
|
|||||||
value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD",
|
value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD",
|
||||||
"URF_UNREAD_FIELD" },
|
"URF_UNREAD_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public class GHBranch {
|
public class GHBranch extends GitHubInteractiveObject {
|
||||||
private GitHub root;
|
|
||||||
private GHRepository owner;
|
private GHRepository owner;
|
||||||
|
|
||||||
private String name;
|
private String name;
|
||||||
@@ -78,7 +78,7 @@ public class GHBranch {
|
|||||||
*
|
*
|
||||||
* @return true if the push to this branch is restricted via branch protection.
|
* @return true if the push to this branch is restricted via branch protection.
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(Previews.LUKE_CAGE)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public boolean isProtected() {
|
public boolean isProtected() {
|
||||||
return protection;
|
return protection;
|
||||||
@@ -89,7 +89,7 @@ public class GHBranch {
|
|||||||
*
|
*
|
||||||
* @return API URL that deals with the protection of this branch.
|
* @return API URL that deals with the protection of this branch.
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(Previews.LUKE_CAGE)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public URL getProtectionUrl() {
|
public URL getProtectionUrl() {
|
||||||
return GitHubClient.parseURL(protection_url);
|
return GitHubClient.parseURL(protection_url);
|
||||||
@@ -102,6 +102,8 @@ public class GHBranch {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
|
@Preview(Previews.LUKE_CAGE)
|
||||||
|
@Deprecated
|
||||||
public GHBranchProtection getProtection() throws IOException {
|
public GHBranchProtection getProtection() throws IOException {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
.withPreview(Previews.LUKE_CAGE)
|
.withPreview(Previews.LUKE_CAGE)
|
||||||
@@ -135,7 +137,7 @@ public class GHBranch {
|
|||||||
* @return GHBranchProtectionBuilder for enabling protection
|
* @return GHBranchProtectionBuilder for enabling protection
|
||||||
* @see GHCommitStatus#getContext() GHCommitStatus#getContext()
|
* @see GHCommitStatus#getContext() GHCommitStatus#getContext()
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(Previews.LUKE_CAGE)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHBranchProtectionBuilder enableProtection() {
|
public GHBranchProtectionBuilder enableProtection() {
|
||||||
return new GHBranchProtectionBuilder(this);
|
return new GHBranchProtectionBuilder(this);
|
||||||
|
|||||||
@@ -6,7 +6,7 @@ import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
|||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.util.Collection;
|
import java.util.Collection;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.ZZZAX;
|
import static org.kohsuke.github.internal.Previews.ZZZAX;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The type GHBranchProtection.
|
* The type GHBranchProtection.
|
||||||
@@ -17,14 +17,12 @@ import static org.kohsuke.github.Previews.ZZZAX;
|
|||||||
value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD",
|
value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD",
|
||||||
"URF_UNREAD_FIELD" },
|
"URF_UNREAD_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public class GHBranchProtection {
|
public class GHBranchProtection extends GitHubInteractiveObject {
|
||||||
private static final String REQUIRE_SIGNATURES_URI = "/required_signatures";
|
private static final String REQUIRE_SIGNATURES_URI = "/required_signatures";
|
||||||
|
|
||||||
@JsonProperty
|
@JsonProperty
|
||||||
private EnforceAdmins enforceAdmins;
|
private EnforceAdmins enforceAdmins;
|
||||||
|
|
||||||
private GitHub root;
|
|
||||||
|
|
||||||
@JsonProperty("required_pull_request_reviews")
|
@JsonProperty("required_pull_request_reviews")
|
||||||
private RequiredReviews requiredReviews;
|
private RequiredReviews requiredReviews;
|
||||||
|
|
||||||
@@ -43,7 +41,7 @@ public class GHBranchProtection {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(ZZZAX)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public void enabledSignedCommits() throws IOException {
|
public void enabledSignedCommits() throws IOException {
|
||||||
requester().method("POST").withUrlPath(url + REQUIRE_SIGNATURES_URI).fetch(RequiredSignatures.class);
|
requester().method("POST").withUrlPath(url + REQUIRE_SIGNATURES_URI).fetch(RequiredSignatures.class);
|
||||||
@@ -55,7 +53,7 @@ public class GHBranchProtection {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(ZZZAX)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public void disableSignedCommits() throws IOException {
|
public void disableSignedCommits() throws IOException {
|
||||||
requester().method("DELETE").withUrlPath(url + REQUIRE_SIGNATURES_URI).send();
|
requester().method("DELETE").withUrlPath(url + REQUIRE_SIGNATURES_URI).send();
|
||||||
@@ -86,7 +84,7 @@ public class GHBranchProtection {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(ZZZAX)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public boolean getRequiredSignatures() throws IOException {
|
public boolean getRequiredSignatures() throws IOException {
|
||||||
return requester().withUrlPath(url + REQUIRE_SIGNATURES_URI).fetch(RequiredSignatures.class).enabled;
|
return requester().withUrlPath(url + REQUIRE_SIGNATURES_URI).fetch(RequiredSignatures.class).enabled;
|
||||||
|
|||||||
@@ -12,7 +12,7 @@ import java.util.List;
|
|||||||
import java.util.Map;
|
import java.util.Map;
|
||||||
import java.util.Set;
|
import java.util.Set;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.*;
|
import static org.kohsuke.github.internal.Previews.LUKE_CAGE;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Builder to configure the branch protection settings.
|
* Builder to configure the branch protection settings.
|
||||||
|
|||||||
@@ -1,8 +1,13 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
import com.fasterxml.jackson.annotation.JsonProperty;
|
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||||
|
import com.infradna.tool.bridge_method_injector.WithBridgeMethods;
|
||||||
import edu.umd.cs.findbugs.annotations.NonNull;
|
import edu.umd.cs.findbugs.annotations.NonNull;
|
||||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
|
import org.kohsuke.github.GHWorkflowRun.Conclusion;
|
||||||
|
import org.kohsuke.github.GHWorkflowRun.Status;
|
||||||
|
import org.kohsuke.github.internal.EnumUtils;
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
@@ -10,6 +15,7 @@ import java.util.Arrays;
|
|||||||
import java.util.Collections;
|
import java.util.Collections;
|
||||||
import java.util.Date;
|
import java.util.Date;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
|
import java.util.Locale;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Represents a check run.
|
* Represents a check run.
|
||||||
@@ -22,7 +28,6 @@ public class GHCheckRun extends GHObject {
|
|||||||
|
|
||||||
@JsonProperty("repository")
|
@JsonProperty("repository")
|
||||||
GHRepository owner;
|
GHRepository owner;
|
||||||
GitHub root;
|
|
||||||
|
|
||||||
private String status;
|
private String status;
|
||||||
private String conclusion;
|
private String conclusion;
|
||||||
@@ -80,12 +85,27 @@ public class GHCheckRun extends GHObject {
|
|||||||
* @return Status of the check run
|
* @return Status of the check run
|
||||||
* @see Status
|
* @see Status
|
||||||
*/
|
*/
|
||||||
public String getStatus() {
|
@WithBridgeMethods(value = String.class, adapterMethod = "statusAsStr")
|
||||||
|
public Status getStatus() {
|
||||||
|
return Status.from(status);
|
||||||
|
}
|
||||||
|
|
||||||
|
@SuppressFBWarnings(value = "UPM_UNCALLED_PRIVATE_METHOD", justification = "Bridge method of getStatus")
|
||||||
|
private Object statusAsStr(Status status, Class type) {
|
||||||
return status;
|
return status;
|
||||||
}
|
}
|
||||||
|
|
||||||
public static enum Status {
|
public static enum Status {
|
||||||
QUEUED, IN_PROGRESS, COMPLETED
|
QUEUED, IN_PROGRESS, COMPLETED, UNKNOWN;
|
||||||
|
|
||||||
|
public static Status from(String value) {
|
||||||
|
return EnumUtils.getNullableEnumOrDefault(Status.class, value, Status.UNKNOWN);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String toString() {
|
||||||
|
return name().toLowerCase(Locale.ROOT);
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -94,7 +114,13 @@ public class GHCheckRun extends GHObject {
|
|||||||
* @return Status of the check run
|
* @return Status of the check run
|
||||||
* @see Conclusion
|
* @see Conclusion
|
||||||
*/
|
*/
|
||||||
public String getConclusion() {
|
@WithBridgeMethods(value = String.class, adapterMethod = "conclusionAsStr")
|
||||||
|
public Conclusion getConclusion() {
|
||||||
|
return Conclusion.from(conclusion);
|
||||||
|
}
|
||||||
|
|
||||||
|
@SuppressFBWarnings(value = "UPM_UNCALLED_PRIVATE_METHOD", justification = "Bridge method of getConclusion")
|
||||||
|
private Object conclusionAsStr(Conclusion conclusion, Class type) {
|
||||||
return conclusion;
|
return conclusion;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -105,7 +131,16 @@ public class GHCheckRun extends GHObject {
|
|||||||
* Parameters - <code>conclusion</code></a>.
|
* Parameters - <code>conclusion</code></a>.
|
||||||
*/
|
*/
|
||||||
public static enum Conclusion {
|
public static enum Conclusion {
|
||||||
SUCCESS, FAILURE, NEUTRAL, CANCELLED, TIMED_OUT, ACTION_REQUIRED, SKIPPED
|
ACTION_REQUIRED, CANCELLED, FAILURE, NEUTRAL, SUCCESS, SKIPPED, STALE, TIMED_OUT, UNKNOWN;
|
||||||
|
|
||||||
|
public static Conclusion from(String value) {
|
||||||
|
return EnumUtils.getNullableEnumOrDefault(Conclusion.class, value, Conclusion.UNKNOWN);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String toString() {
|
||||||
|
return name().toLowerCase(Locale.ROOT);
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -295,10 +330,10 @@ public class GHCheckRun extends GHObject {
|
|||||||
|
|
||||||
/**
|
/**
|
||||||
* Updates this check run.
|
* Updates this check run.
|
||||||
*
|
*
|
||||||
* @return a builder which you should customize, then call {@link GHCheckRunBuilder#create}
|
* @return a builder which you should customize, then call {@link GHCheckRunBuilder#create}
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(Previews.ANTIOPE)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public @NonNull GHCheckRunBuilder update() {
|
public @NonNull GHCheckRunBuilder update() {
|
||||||
return new GHCheckRunBuilder(owner, getId());
|
return new GHCheckRunBuilder(owner, getId());
|
||||||
|
|||||||
@@ -28,6 +28,7 @@ import com.fasterxml.jackson.annotation.JsonInclude;
|
|||||||
import edu.umd.cs.findbugs.annotations.CheckForNull;
|
import edu.umd.cs.findbugs.annotations.CheckForNull;
|
||||||
import edu.umd.cs.findbugs.annotations.NonNull;
|
import edu.umd.cs.findbugs.annotations.NonNull;
|
||||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.util.Collections;
|
import java.util.Collections;
|
||||||
@@ -46,7 +47,7 @@ import java.util.Locale;
|
|||||||
* @see <a href="https://developer.github.com/v3/checks/runs/#update-a-check-run">documentation</a>
|
* @see <a href="https://developer.github.com/v3/checks/runs/#update-a-check-run">documentation</a>
|
||||||
*/
|
*/
|
||||||
@SuppressFBWarnings(value = "URF_UNREAD_FIELD", justification = "Jackson serializes these even without a getter")
|
@SuppressFBWarnings(value = "URF_UNREAD_FIELD", justification = "Jackson serializes these even without a getter")
|
||||||
@Preview
|
@Preview(Previews.ANTIOPE)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public final class GHCheckRunBuilder {
|
public final class GHCheckRunBuilder {
|
||||||
|
|
||||||
@@ -151,7 +152,7 @@ public final class GHCheckRunBuilder {
|
|||||||
}
|
}
|
||||||
GHCheckRun run = requester.with("output", output).with("actions", actions).fetch(GHCheckRun.class).wrap(repo);
|
GHCheckRun run = requester.with("output", output).with("actions", actions).fetch(GHCheckRun.class).wrap(repo);
|
||||||
while (!extraAnnotations.isEmpty()) {
|
while (!extraAnnotations.isEmpty()) {
|
||||||
Output output2 = new Output(output.title, output.summary);
|
Output output2 = new Output(output.title, output.summary).withText(output.text);
|
||||||
int i = Math.min(extraAnnotations.size(), MAX_ANNOTATIONS);
|
int i = Math.min(extraAnnotations.size(), MAX_ANNOTATIONS);
|
||||||
output2.annotations = extraAnnotations.subList(0, i);
|
output2.annotations = extraAnnotations.subList(0, i);
|
||||||
extraAnnotations = extraAnnotations.subList(i, extraAnnotations.size());
|
extraAnnotations = extraAnnotations.subList(i, extraAnnotations.size());
|
||||||
|
|||||||
@@ -8,13 +8,13 @@ import javax.annotation.Nonnull;
|
|||||||
* Iterable for check-runs listing.
|
* Iterable for check-runs listing.
|
||||||
*/
|
*/
|
||||||
class GHCheckRunsIterable extends PagedIterable<GHCheckRun> {
|
class GHCheckRunsIterable extends PagedIterable<GHCheckRun> {
|
||||||
private GitHub root;
|
private final GHRepository owner;
|
||||||
private final GitHubRequest request;
|
private final GitHubRequest request;
|
||||||
|
|
||||||
private GHCheckRunsPage result;
|
private GHCheckRunsPage result;
|
||||||
|
|
||||||
public GHCheckRunsIterable(GitHub root, GitHubRequest request) {
|
public GHCheckRunsIterable(GHRepository owner, GitHubRequest request) {
|
||||||
this.root = root;
|
this.owner = owner;
|
||||||
this.request = request;
|
this.request = request;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -22,7 +22,7 @@ class GHCheckRunsIterable extends PagedIterable<GHCheckRun> {
|
|||||||
@Override
|
@Override
|
||||||
public PagedIterator<GHCheckRun> _iterator(int pageSize) {
|
public PagedIterator<GHCheckRun> _iterator(int pageSize) {
|
||||||
return new PagedIterator<>(
|
return new PagedIterator<>(
|
||||||
adapt(GitHubPageIterator.create(root.getClient(), GHCheckRunsPage.class, request, pageSize)),
|
adapt(GitHubPageIterator.create(owner.getRoot().getClient(), GHCheckRunsPage.class, request, pageSize)),
|
||||||
null);
|
null);
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -37,7 +37,7 @@ class GHCheckRunsIterable extends PagedIterable<GHCheckRun> {
|
|||||||
if (result == null) {
|
if (result == null) {
|
||||||
result = v;
|
result = v;
|
||||||
}
|
}
|
||||||
return v.getCheckRuns(root);
|
return v.getCheckRuns(owner);
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -11,9 +11,9 @@ class GHCheckRunsPage {
|
|||||||
return total_count;
|
return total_count;
|
||||||
}
|
}
|
||||||
|
|
||||||
GHCheckRun[] getCheckRuns(GitHub root) {
|
GHCheckRun[] getCheckRuns(GHRepository owner) {
|
||||||
for (GHCheckRun check_run : check_runs) {
|
for (GHCheckRun check_run : check_runs) {
|
||||||
check_run.wrap(root);
|
check_run.wrap(owner);
|
||||||
}
|
}
|
||||||
return check_runs;
|
return check_runs;
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -21,7 +21,6 @@ public class GHCheckSuite extends GHObject {
|
|||||||
|
|
||||||
@JsonProperty("repository")
|
@JsonProperty("repository")
|
||||||
GHRepository owner;
|
GHRepository owner;
|
||||||
GitHub root;
|
|
||||||
|
|
||||||
private String nodeId;
|
private String nodeId;
|
||||||
private String headBranch;
|
private String headBranch;
|
||||||
|
|||||||
@@ -11,7 +11,8 @@ import java.util.Collections;
|
|||||||
import java.util.Date;
|
import java.util.Date;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.GROOT;
|
import static org.kohsuke.github.internal.Previews.ANTIOPE;
|
||||||
|
import static org.kohsuke.github.internal.Previews.GROOT;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* A commit in a repository.
|
* A commit in a repository.
|
||||||
@@ -65,7 +66,7 @@ public class GHCommit {
|
|||||||
* @return the authored date
|
* @return the authored date
|
||||||
*/
|
*/
|
||||||
public Date getAuthoredDate() {
|
public Date getAuthoredDate() {
|
||||||
return GitHubClient.parseDate(author.date);
|
return author.getDate();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -84,7 +85,7 @@ public class GHCommit {
|
|||||||
* @return the commit date
|
* @return the commit date
|
||||||
*/
|
*/
|
||||||
public Date getCommitDate() {
|
public Date getCommitDate() {
|
||||||
return GitHubClient.parseDate(committer.date);
|
return committer.getDate();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -121,7 +122,6 @@ public class GHCommit {
|
|||||||
* @deprecated Use {@link GitUser} instead.
|
* @deprecated Use {@link GitUser} instead.
|
||||||
*/
|
*/
|
||||||
public static class GHAuthor extends GitUser {
|
public static class GHAuthor extends GitUser {
|
||||||
private String date;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -453,7 +453,7 @@ public class GHCommit {
|
|||||||
*
|
*
|
||||||
* @return {@link PagedIterable} with the pull requests which contain this commit
|
* @return {@link PagedIterable} with the pull requests which contain this commit
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(GROOT)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public PagedIterable<GHPullRequest> listPullRequests() {
|
public PagedIterable<GHPullRequest> listPullRequests() {
|
||||||
return owner.root.createRequest()
|
return owner.root.createRequest()
|
||||||
@@ -469,7 +469,7 @@ public class GHCommit {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(GROOT)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public PagedIterable<GHBranch> listBranchesWhereHead() throws IOException {
|
public PagedIterable<GHBranch> listBranchesWhereHead() throws IOException {
|
||||||
return owner.root.createRequest()
|
return owner.root.createRequest()
|
||||||
@@ -565,7 +565,7 @@ public class GHCommit {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* on error
|
* on error
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(ANTIOPE)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public PagedIterable<GHCheckRun> getCheckRuns() throws IOException {
|
public PagedIterable<GHCheckRun> getCheckRuns() throws IOException {
|
||||||
return owner.getCheckRuns(sha);
|
return owner.getCheckRuns(sha);
|
||||||
@@ -573,7 +573,7 @@ public class GHCommit {
|
|||||||
|
|
||||||
/**
|
/**
|
||||||
* Some of the fields are not always filled in when this object is retrieved as a part of another API call.
|
* Some of the fields are not always filled in when this object is retrieved as a part of another API call.
|
||||||
*
|
*
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* on error
|
* on error
|
||||||
*/
|
*/
|
||||||
|
|||||||
@@ -5,7 +5,7 @@ import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
|||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.*;
|
import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* A comment attached to a commit (or a specific line in a specific file of a commit.)
|
* A comment attached to a commit (or a specific line in a specific file of a commit.)
|
||||||
@@ -121,7 +121,7 @@ public class GHCommitComment extends GHObject implements Reactable {
|
|||||||
this.body = body;
|
this.body = body;
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHReaction createReaction(ReactionContent content) throws IOException {
|
public GHReaction createReaction(ReactionContent content) throws IOException {
|
||||||
return owner.root.createRequest()
|
return owner.root.createRequest()
|
||||||
@@ -133,7 +133,7 @@ public class GHCommitComment extends GHObject implements Reactable {
|
|||||||
.wrap(owner.root);
|
.wrap(owner.root);
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public PagedIterable<GHReaction> listReactions() {
|
public PagedIterable<GHReaction> listReactions() {
|
||||||
return owner.root.createRequest()
|
return owner.root.createRequest()
|
||||||
|
|||||||
@@ -1,6 +1,7 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
import org.apache.commons.lang3.StringUtils;
|
import org.apache.commons.lang3.StringUtils;
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
|
|
||||||
@@ -10,7 +11,7 @@ import java.io.IOException;
|
|||||||
* @author Marc de Verdelhan
|
* @author Marc de Verdelhan
|
||||||
* @see GitHub#searchCommits() GitHub#searchCommits()
|
* @see GitHub#searchCommits() GitHub#searchCommits()
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(Previews.CLOAK)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public class GHCommitSearchBuilder extends GHSearchBuilder<GHCommit> {
|
public class GHCommitSearchBuilder extends GHSearchBuilder<GHCommit> {
|
||||||
GHCommitSearchBuilder(GitHub root) {
|
GHCommitSearchBuilder(GitHub root) {
|
||||||
|
|||||||
@@ -18,8 +18,6 @@ public class GHCommitStatus extends GHObject {
|
|||||||
String context;
|
String context;
|
||||||
GHUser creator;
|
GHUser creator;
|
||||||
|
|
||||||
private GitHub root;
|
|
||||||
|
|
||||||
GHCommitStatus wrapUp(GitHub root) {
|
GHCommitStatus wrapUp(GitHub root) {
|
||||||
if (creator != null)
|
if (creator != null)
|
||||||
creator.wrapUp(root);
|
creator.wrapUp(root);
|
||||||
|
|||||||
@@ -15,15 +15,13 @@ import java.util.Base64;
|
|||||||
* @see GHRepository#getFileContent(String) GHRepository#getFileContent(String)
|
* @see GHRepository#getFileContent(String) GHRepository#getFileContent(String)
|
||||||
*/
|
*/
|
||||||
@SuppressWarnings({ "UnusedDeclaration" })
|
@SuppressWarnings({ "UnusedDeclaration" })
|
||||||
public class GHContent implements Refreshable {
|
public class GHContent extends GitHubInteractiveObject implements Refreshable {
|
||||||
/*
|
/*
|
||||||
* In normal use of this class, repository field is set via wrap(), but in the code search API, there's a nested
|
* In normal use of this class, repository field is set via wrap(), but in the code search API, there's a nested
|
||||||
* 'repository' field that gets populated from JSON.
|
* 'repository' field that gets populated from JSON.
|
||||||
*/
|
*/
|
||||||
private GHRepository repository;
|
private GHRepository repository;
|
||||||
|
|
||||||
private GitHub root;
|
|
||||||
|
|
||||||
private String type;
|
private String type;
|
||||||
private String encoding;
|
private String encoding;
|
||||||
private long size;
|
private long size;
|
||||||
@@ -102,7 +100,7 @@ public class GHContent implements Refreshable {
|
|||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets target of a symlink. This will only be set if {@code "symlink".equals(getType())}
|
* Gets target of a symlink. This will only be set if {@code "symlink".equals(getType())}
|
||||||
*
|
*
|
||||||
* @return the target
|
* @return the target
|
||||||
*/
|
*/
|
||||||
public String getTarget() {
|
public String getTarget() {
|
||||||
|
|||||||
@@ -118,6 +118,41 @@ public class GHContentSearchBuilder extends GHSearchBuilder<GHContent> {
|
|||||||
return q("repo:" + v);
|
return q("repo:" + v);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Order gh content search builder.
|
||||||
|
*
|
||||||
|
* @param v
|
||||||
|
* the v
|
||||||
|
* @return the gh content search builder
|
||||||
|
*/
|
||||||
|
public GHContentSearchBuilder order(GHDirection v) {
|
||||||
|
req.with("order", v);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Sort gh content search builder.
|
||||||
|
*
|
||||||
|
* @param sort
|
||||||
|
* the sort
|
||||||
|
* @return the gh content search builder
|
||||||
|
*/
|
||||||
|
public GHContentSearchBuilder sort(GHContentSearchBuilder.Sort sort) {
|
||||||
|
if (Sort.BEST_MATCH.equals(sort)) {
|
||||||
|
req.remove("sort");
|
||||||
|
} else {
|
||||||
|
req.with("sort", sort);
|
||||||
|
}
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The enum Sort.
|
||||||
|
*/
|
||||||
|
public enum Sort {
|
||||||
|
BEST_MATCH, INDEXED
|
||||||
|
}
|
||||||
|
|
||||||
private static class ContentSearchResult extends SearchResult<GHContent> {
|
private static class ContentSearchResult extends SearchResult<GHContent> {
|
||||||
private GHContent[] items;
|
private GHContent[] items;
|
||||||
|
|
||||||
|
|||||||
@@ -1,168 +1,25 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.BAPTISE;
|
import static org.kohsuke.github.internal.Previews.BAPTISTE;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a repository
|
* Creates a repository
|
||||||
*
|
*
|
||||||
* @author Kohsuke Kawaguchi
|
* @author Kohsuke Kawaguchi
|
||||||
*/
|
*/
|
||||||
public class GHCreateRepositoryBuilder {
|
public class GHCreateRepositoryBuilder extends GHRepositoryBuilder<GHCreateRepositoryBuilder> {
|
||||||
private final GitHub root;
|
|
||||||
protected final Requester builder;
|
|
||||||
private String apiUrlTail;
|
|
||||||
|
|
||||||
GHCreateRepositoryBuilder(GitHub root, String apiUrlTail, String name) {
|
public GHCreateRepositoryBuilder(String name, GitHub root, String apiTail) {
|
||||||
this.root = root;
|
super(GHCreateRepositoryBuilder.class, root, null);
|
||||||
this.apiUrlTail = apiUrlTail;
|
requester.method("POST").withUrlPath(apiTail);
|
||||||
this.builder = root.createRequest();
|
|
||||||
this.builder.with("name", name);
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
try {
|
||||||
* Description for repository
|
name(name);
|
||||||
*
|
} catch (IOException e) {
|
||||||
* @param description
|
// not going to happen here
|
||||||
* description of repository
|
}
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder description(String description) {
|
|
||||||
this.builder.with("description", description);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Homepage for repository
|
|
||||||
*
|
|
||||||
* @param homepage
|
|
||||||
* homepage of repository
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder homepage(URL homepage) {
|
|
||||||
return homepage(homepage.toExternalForm());
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Homepage for repository
|
|
||||||
*
|
|
||||||
* @param homepage
|
|
||||||
* homepage of repository
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder homepage(String homepage) {
|
|
||||||
this.builder.with("homepage", homepage);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Creates a private repository
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* private if true
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder private_(boolean enabled) {
|
|
||||||
this.builder.with("private", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Enables issue tracker
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* true if enabled
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder issues(boolean enabled) {
|
|
||||||
this.builder.with("has_issues", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Enables projects
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* true if enabled
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder projects(boolean enabled) {
|
|
||||||
this.builder.with("has_projects", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Enables wiki
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* true if enabled
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder wiki(boolean enabled) {
|
|
||||||
this.builder.with("has_wiki", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Enables downloads
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* true if enabled
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder downloads(boolean enabled) {
|
|
||||||
this.builder.with("has_downloads", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* If true, create an initial commit with empty README.
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* true if enabled
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder autoInit(boolean enabled) {
|
|
||||||
this.builder.with("auto_init", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Allow or disallow squash-merging pull requests.
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* true if enabled
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder allowSquashMerge(boolean enabled) {
|
|
||||||
this.builder.with("allow_squash_merge", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Allow or disallow merging pull requests with a merge commit.
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* true if enabled
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder allowMergeCommit(boolean enabled) {
|
|
||||||
this.builder.with("allow_merge_commit", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Allow or disallow rebase-merging pull requests.
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* true if enabled
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder allowRebaseMerge(boolean enabled) {
|
|
||||||
this.builder.with("allow_rebase_merge", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -171,10 +28,11 @@ public class GHCreateRepositoryBuilder {
|
|||||||
* @param language
|
* @param language
|
||||||
* template to base the ignore file on
|
* template to base the ignore file on
|
||||||
* @return a builder to continue with building See https://developer.github.com/v3/repos/#create
|
* @return a builder to continue with building See https://developer.github.com/v3/repos/#create
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
*/
|
*/
|
||||||
public GHCreateRepositoryBuilder gitignoreTemplate(String language) {
|
public GHCreateRepositoryBuilder gitignoreTemplate(String language) throws IOException {
|
||||||
this.builder.with("gitignore_template", language);
|
return with("gitignore_template", language);
|
||||||
return this;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -183,10 +41,24 @@ public class GHCreateRepositoryBuilder {
|
|||||||
* @param license
|
* @param license
|
||||||
* template to base the license file on
|
* template to base the license file on
|
||||||
* @return a builder to continue with building See https://developer.github.com/v3/repos/#create
|
* @return a builder to continue with building See https://developer.github.com/v3/repos/#create
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
*/
|
*/
|
||||||
public GHCreateRepositoryBuilder licenseTemplate(String license) {
|
public GHCreateRepositoryBuilder licenseTemplate(String license) throws IOException {
|
||||||
this.builder.with("license_template", license);
|
return with("license_template", license);
|
||||||
return this;
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* If true, create an initial commit with empty README.
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
* @return a builder to continue with building
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public GHCreateRepositoryBuilder autoInit(boolean enabled) throws IOException {
|
||||||
|
return with("auto_init", enabled);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -195,10 +67,12 @@ public class GHCreateRepositoryBuilder {
|
|||||||
* @param team
|
* @param team
|
||||||
* team to grant access to
|
* team to grant access to
|
||||||
* @return a builder to continue with building
|
* @return a builder to continue with building
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
*/
|
*/
|
||||||
public GHCreateRepositoryBuilder team(GHTeam team) {
|
public GHCreateRepositoryBuilder team(GHTeam team) throws IOException {
|
||||||
if (team != null)
|
if (team != null)
|
||||||
this.builder.with("team_id", team.getId());
|
return with("team_id", team.getId());
|
||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -208,13 +82,13 @@ public class GHCreateRepositoryBuilder {
|
|||||||
* @param enabled
|
* @param enabled
|
||||||
* true if enabled
|
* true if enabled
|
||||||
* @return a builder to continue with building
|
* @return a builder to continue with building
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
* @deprecated Use {@link #isTemplate(boolean)} method instead
|
||||||
*/
|
*/
|
||||||
@Preview
|
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHCreateRepositoryBuilder templateRepository(boolean enabled) {
|
public GHCreateRepositoryBuilder templateRepository(boolean enabled) throws IOException {
|
||||||
this.builder.withPreview(BAPTISE);
|
return isTemplate(enabled);
|
||||||
this.builder.with("is_template", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -223,14 +97,15 @@ public class GHCreateRepositoryBuilder {
|
|||||||
* @param owner
|
* @param owner
|
||||||
* organization or personage
|
* organization or personage
|
||||||
* @return a builder to continue with building
|
* @return a builder to continue with building
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
*/
|
*/
|
||||||
public GHCreateRepositoryBuilder owner(String owner) {
|
public GHCreateRepositoryBuilder owner(String owner) throws IOException {
|
||||||
this.builder.with("owner", owner);
|
return with("owner", owner);
|
||||||
return this;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Create repository from template repository.
|
* Create repository from template repository
|
||||||
*
|
*
|
||||||
* @param templateOwner
|
* @param templateOwner
|
||||||
* template repository owner
|
* template repository owner
|
||||||
@@ -239,11 +114,10 @@ public class GHCreateRepositoryBuilder {
|
|||||||
* @return a builder to continue with building
|
* @return a builder to continue with building
|
||||||
* @see <a href="https://developer.github.com/v3/previews/">GitHub API Previews</a>
|
* @see <a href="https://developer.github.com/v3/previews/">GitHub API Previews</a>
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(BAPTISTE)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHCreateRepositoryBuilder fromTemplateRepository(String templateOwner, String templateRepo) {
|
public GHCreateRepositoryBuilder fromTemplateRepository(String templateOwner, String templateRepo) {
|
||||||
this.builder.withPreview(BAPTISE);
|
requester.withPreview(BAPTISTE).withUrlPath("/repos/" + templateOwner + "/" + templateRepo + "/generate");
|
||||||
this.apiUrlTail = "/repos/" + templateOwner + "/" + templateRepo + "/generate";
|
|
||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -252,10 +126,9 @@ public class GHCreateRepositoryBuilder {
|
|||||||
*
|
*
|
||||||
* @return the gh repository
|
* @return the gh repository
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* if repsitory cannot be created
|
* if repository cannot be created
|
||||||
*/
|
*/
|
||||||
public GHRepository create() throws IOException {
|
public GHRepository create() throws IOException {
|
||||||
return builder.method("POST").withUrlPath(apiUrlTail).fetch(GHRepository.class).wrap(root);
|
return done();
|
||||||
}
|
}
|
||||||
|
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -1,5 +1,7 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
import java.util.Map;
|
import java.util.Map;
|
||||||
@@ -14,7 +16,6 @@ import java.util.Map;
|
|||||||
*/
|
*/
|
||||||
public class GHDeployment extends GHObject {
|
public class GHDeployment extends GHObject {
|
||||||
private GHRepository owner;
|
private GHRepository owner;
|
||||||
private GitHub root;
|
|
||||||
protected String sha;
|
protected String sha;
|
||||||
protected String ref;
|
protected String ref;
|
||||||
protected String task;
|
protected String task;
|
||||||
@@ -24,6 +25,9 @@ public class GHDeployment extends GHObject {
|
|||||||
protected String statuses_url;
|
protected String statuses_url;
|
||||||
protected String repository_url;
|
protected String repository_url;
|
||||||
protected GHUser creator;
|
protected GHUser creator;
|
||||||
|
protected String original_environment;
|
||||||
|
protected boolean transient_environment;
|
||||||
|
protected boolean production_environment;
|
||||||
|
|
||||||
GHDeployment wrap(GHRepository owner) {
|
GHDeployment wrap(GHRepository owner) {
|
||||||
this.owner = owner;
|
this.owner = owner;
|
||||||
@@ -82,13 +86,26 @@ public class GHDeployment extends GHObject {
|
|||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets payload without assuming its type. It could be a String or a Map.
|
* Gets payload without assuming its type. It could be a String or a Map.
|
||||||
*
|
*
|
||||||
* @return the payload
|
* @return the payload
|
||||||
*/
|
*/
|
||||||
public Object getPayloadObject() {
|
public Object getPayloadObject() {
|
||||||
return payload;
|
return payload;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The environment defined when the deployment was first created.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @return the original deployment environment
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.FLASH)
|
||||||
|
public String getOriginalEnvironment() {
|
||||||
|
return original_environment;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets environment.
|
* Gets environment.
|
||||||
*
|
*
|
||||||
@@ -98,6 +115,33 @@ public class GHDeployment extends GHObject {
|
|||||||
return environment;
|
return environment;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Specifies if the given environment is specific to the deployment and will no longer exist at some point in the
|
||||||
|
* future.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @return the environment is transient
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
public boolean isTransientEnvironment() {
|
||||||
|
return transient_environment;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Specifies if the given environment is one that end-users directly interact with.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @return the environment is used by end-users directly
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
public boolean isProductionEnvironment() {
|
||||||
|
return production_environment;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets creator.
|
* Gets creator.
|
||||||
*
|
*
|
||||||
@@ -154,6 +198,8 @@ public class GHDeployment extends GHObject {
|
|||||||
public PagedIterable<GHDeploymentStatus> listStatuses() {
|
public PagedIterable<GHDeploymentStatus> listStatuses() {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
.withUrlPath(statuses_url)
|
.withUrlPath(statuses_url)
|
||||||
|
.withPreview(Previews.ANT_MAN)
|
||||||
|
.withPreview(Previews.FLASH)
|
||||||
.toIterable(GHDeploymentStatus[].class, item -> item.wrap(owner));
|
.toIterable(GHDeploymentStatus[].class, item -> item.wrap(owner));
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
@@ -1,5 +1,7 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
|
|
||||||
@@ -19,7 +21,10 @@ public class GHDeploymentBuilder {
|
|||||||
*/
|
*/
|
||||||
public GHDeploymentBuilder(GHRepository repo) {
|
public GHDeploymentBuilder(GHRepository repo) {
|
||||||
this.repo = repo;
|
this.repo = repo;
|
||||||
this.builder = repo.root.createRequest().method("POST");
|
this.builder = repo.root.createRequest()
|
||||||
|
.withPreview(Previews.ANT_MAN)
|
||||||
|
.withPreview(Previews.FLASH)
|
||||||
|
.method("POST");
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -40,6 +45,7 @@ public class GHDeploymentBuilder {
|
|||||||
*
|
*
|
||||||
* @param branch
|
* @param branch
|
||||||
* the branch
|
* the branch
|
||||||
|
*
|
||||||
* @return the gh deployment builder
|
* @return the gh deployment builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentBuilder ref(String branch) {
|
public GHDeploymentBuilder ref(String branch) {
|
||||||
@@ -52,6 +58,7 @@ public class GHDeploymentBuilder {
|
|||||||
*
|
*
|
||||||
* @param task
|
* @param task
|
||||||
* the task
|
* the task
|
||||||
|
*
|
||||||
* @return the gh deployment builder
|
* @return the gh deployment builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentBuilder task(String task) {
|
public GHDeploymentBuilder task(String task) {
|
||||||
@@ -64,6 +71,7 @@ public class GHDeploymentBuilder {
|
|||||||
*
|
*
|
||||||
* @param autoMerge
|
* @param autoMerge
|
||||||
* the auto merge
|
* the auto merge
|
||||||
|
*
|
||||||
* @return the gh deployment builder
|
* @return the gh deployment builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentBuilder autoMerge(boolean autoMerge) {
|
public GHDeploymentBuilder autoMerge(boolean autoMerge) {
|
||||||
@@ -76,6 +84,7 @@ public class GHDeploymentBuilder {
|
|||||||
*
|
*
|
||||||
* @param requiredContexts
|
* @param requiredContexts
|
||||||
* the required contexts
|
* the required contexts
|
||||||
|
*
|
||||||
* @return the gh deployment builder
|
* @return the gh deployment builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentBuilder requiredContexts(List<String> requiredContexts) {
|
public GHDeploymentBuilder requiredContexts(List<String> requiredContexts) {
|
||||||
@@ -88,6 +97,7 @@ public class GHDeploymentBuilder {
|
|||||||
*
|
*
|
||||||
* @param payload
|
* @param payload
|
||||||
* the payload
|
* the payload
|
||||||
|
*
|
||||||
* @return the gh deployment builder
|
* @return the gh deployment builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentBuilder payload(String payload) {
|
public GHDeploymentBuilder payload(String payload) {
|
||||||
@@ -100,6 +110,7 @@ public class GHDeploymentBuilder {
|
|||||||
*
|
*
|
||||||
* @param environment
|
* @param environment
|
||||||
* the environment
|
* the environment
|
||||||
|
*
|
||||||
* @return the gh deployment builder
|
* @return the gh deployment builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentBuilder environment(String environment) {
|
public GHDeploymentBuilder environment(String environment) {
|
||||||
@@ -107,11 +118,47 @@ public class GHDeploymentBuilder {
|
|||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Specifies if the given environment is specific to the deployment and will no longer exist at some point in the
|
||||||
|
* future.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @param transientEnvironment
|
||||||
|
* the environment is transient
|
||||||
|
*
|
||||||
|
* @return the gh deployment builder
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
public GHDeploymentBuilder transientEnvironment(boolean transientEnvironment) {
|
||||||
|
builder.with("transient_environment", transientEnvironment);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Specifies if the given environment is one that end-users directly interact with.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @param productionEnvironment
|
||||||
|
* the environment is used by end-users directly
|
||||||
|
*
|
||||||
|
* @return the gh deployment builder
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
public GHDeploymentBuilder productionEnvironment(boolean productionEnvironment) {
|
||||||
|
builder.with("production_environment", productionEnvironment);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Description gh deployment builder.
|
* Description gh deployment builder.
|
||||||
*
|
*
|
||||||
* @param description
|
* @param description
|
||||||
* the description
|
* the description
|
||||||
|
*
|
||||||
* @return the gh deployment builder
|
* @return the gh deployment builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentBuilder description(String description) {
|
public GHDeploymentBuilder description(String description) {
|
||||||
@@ -123,6 +170,7 @@ public class GHDeploymentBuilder {
|
|||||||
* Create gh deployment.
|
* Create gh deployment.
|
||||||
*
|
*
|
||||||
* @return the gh deployment
|
* @return the gh deployment
|
||||||
|
*
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
|
|||||||
@@ -1,8 +1,40 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Represents the state of deployment
|
* Represents the state of deployment
|
||||||
*/
|
*/
|
||||||
public enum GHDeploymentState {
|
public enum GHDeploymentState {
|
||||||
PENDING, SUCCESS, ERROR, FAILURE
|
PENDING,
|
||||||
|
SUCCESS,
|
||||||
|
ERROR,
|
||||||
|
FAILURE,
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The state of the deployment currently reflects it's in progress.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.FLASH)
|
||||||
|
IN_PROGRESS,
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The state of the deployment currently reflects it's queued up for processing.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.FLASH)
|
||||||
|
QUEUED,
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The state of the deployment currently reflects it's no longer active.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
INACTIVE
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -1,5 +1,7 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
import java.util.Locale;
|
import java.util.Locale;
|
||||||
|
|
||||||
@@ -8,19 +10,21 @@ import java.util.Locale;
|
|||||||
*/
|
*/
|
||||||
public class GHDeploymentStatus extends GHObject {
|
public class GHDeploymentStatus extends GHObject {
|
||||||
private GHRepository owner;
|
private GHRepository owner;
|
||||||
private GitHub root;
|
|
||||||
protected GHUser creator;
|
protected GHUser creator;
|
||||||
protected String state;
|
protected String state;
|
||||||
protected String description;
|
protected String description;
|
||||||
protected String target_url;
|
protected String target_url;
|
||||||
|
protected String log_url;
|
||||||
protected String deployment_url;
|
protected String deployment_url;
|
||||||
protected String repository_url;
|
protected String repository_url;
|
||||||
|
protected String environment_url;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Wrap gh deployment status.
|
* Wrap gh deployment status.
|
||||||
*
|
*
|
||||||
* @param owner
|
* @param owner
|
||||||
* the owner
|
* the owner
|
||||||
|
*
|
||||||
* @return the gh deployment status
|
* @return the gh deployment status
|
||||||
*/
|
*/
|
||||||
public GHDeploymentStatus wrap(GHRepository owner) {
|
public GHDeploymentStatus wrap(GHRepository owner) {
|
||||||
@@ -34,12 +38,30 @@ public class GHDeploymentStatus extends GHObject {
|
|||||||
/**
|
/**
|
||||||
* Gets target url.
|
* Gets target url.
|
||||||
*
|
*
|
||||||
|
* @deprecated Target url is deprecated in favor of {@link #getLogUrl() getLogUrl}
|
||||||
|
*
|
||||||
* @return the target url
|
* @return the target url
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public URL getTargetUrl() {
|
public URL getTargetUrl() {
|
||||||
return GitHubClient.parseURL(target_url);
|
return GitHubClient.parseURL(target_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets target url.
|
||||||
|
* <p>
|
||||||
|
* This method replaces {@link #getTargetUrl() getTargetUrl}}.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @return the target url
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
public URL getLogUrl() {
|
||||||
|
return GitHubClient.parseURL(log_url);
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets deployment url.
|
* Gets deployment url.
|
||||||
*
|
*
|
||||||
@@ -49,6 +71,19 @@ public class GHDeploymentStatus extends GHObject {
|
|||||||
return GitHubClient.parseURL(deployment_url);
|
return GitHubClient.parseURL(deployment_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets deployment environment url.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @return the deployment environment url
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
public URL getEnvironmentUrl() {
|
||||||
|
return GitHubClient.parseURL(environment_url);
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets repository url.
|
* Gets repository url.
|
||||||
*
|
*
|
||||||
|
|||||||
@@ -1,5 +1,7 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -21,6 +23,7 @@ public class GHDeploymentStatusBuilder {
|
|||||||
* the deployment id
|
* the deployment id
|
||||||
* @param state
|
* @param state
|
||||||
* the state
|
* the state
|
||||||
|
*
|
||||||
* @deprecated Use {@link GHDeployment#createStatus(GHDeploymentState)}
|
* @deprecated Use {@link GHDeployment#createStatus(GHDeploymentState)}
|
||||||
*/
|
*/
|
||||||
@Deprecated
|
@Deprecated
|
||||||
@@ -31,15 +34,38 @@ public class GHDeploymentStatusBuilder {
|
|||||||
GHDeploymentStatusBuilder(GHRepository repo, long deploymentId, GHDeploymentState state) {
|
GHDeploymentStatusBuilder(GHRepository repo, long deploymentId, GHDeploymentState state) {
|
||||||
this.repo = repo;
|
this.repo = repo;
|
||||||
this.deploymentId = deploymentId;
|
this.deploymentId = deploymentId;
|
||||||
this.builder = repo.root.createRequest().method("POST");
|
this.builder = repo.root.createRequest()
|
||||||
|
.withPreview(Previews.ANT_MAN)
|
||||||
|
.withPreview(Previews.FLASH)
|
||||||
|
.method("POST");
|
||||||
|
|
||||||
this.builder.with("state", state);
|
this.builder.with("state", state);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Add an inactive status to all prior non-transient, non-production environment deployments with the same
|
||||||
|
* repository and environment name as the created status's deployment.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @param autoInactive
|
||||||
|
* Add inactive status flag
|
||||||
|
*
|
||||||
|
* @return the gh deployment status builder
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview({ Previews.ANT_MAN, Previews.FLASH })
|
||||||
|
public GHDeploymentStatusBuilder autoInactive(boolean autoInactive) {
|
||||||
|
this.builder.with("auto_inactive", autoInactive);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Description gh deployment status builder.
|
* Description gh deployment status builder.
|
||||||
*
|
*
|
||||||
* @param description
|
* @param description
|
||||||
* the description
|
* the description
|
||||||
|
*
|
||||||
* @return the gh deployment status builder
|
* @return the gh deployment status builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentStatusBuilder description(String description) {
|
public GHDeploymentStatusBuilder description(String description) {
|
||||||
@@ -47,13 +73,70 @@ public class GHDeploymentStatusBuilder {
|
|||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Name for the target deployment environment, which can be changed when setting a deploy status.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @param environment
|
||||||
|
* the environment name
|
||||||
|
*
|
||||||
|
* @return the gh deployment status builder
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.FLASH)
|
||||||
|
public GHDeploymentStatusBuilder environment(String environment) {
|
||||||
|
this.builder.with("environment", environment);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The URL for accessing the environment
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @param environmentUrl
|
||||||
|
* the environment url
|
||||||
|
*
|
||||||
|
* @return the gh deployment status builder
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
public GHDeploymentStatusBuilder environmentUrl(String environmentUrl) {
|
||||||
|
this.builder.with("environment_url", environmentUrl);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The full URL of the deployment's output.
|
||||||
|
* <p>
|
||||||
|
* This method replaces {@link #targetUrl(String) targetUrl}.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @param logUrl
|
||||||
|
* the deployment output url
|
||||||
|
*
|
||||||
|
* @return the gh deployment status builder
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
public GHDeploymentStatusBuilder logUrl(String logUrl) {
|
||||||
|
this.builder.with("log_url", logUrl);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Target url gh deployment status builder.
|
* Target url gh deployment status builder.
|
||||||
*
|
*
|
||||||
|
* @deprecated Target url is deprecated in favor of {@link #logUrl(String) logUrl}
|
||||||
|
*
|
||||||
* @param targetUrl
|
* @param targetUrl
|
||||||
* the target url
|
* the target url
|
||||||
|
*
|
||||||
* @return the gh deployment status builder
|
* @return the gh deployment status builder
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public GHDeploymentStatusBuilder targetUrl(String targetUrl) {
|
public GHDeploymentStatusBuilder targetUrl(String targetUrl) {
|
||||||
this.builder.with("target_url", targetUrl);
|
this.builder.with("target_url", targetUrl);
|
||||||
return this;
|
return this;
|
||||||
@@ -63,6 +146,7 @@ public class GHDeploymentStatusBuilder {
|
|||||||
* Create gh deployment status.
|
* Create gh deployment status.
|
||||||
*
|
*
|
||||||
* @return the gh deployment status
|
* @return the gh deployment status
|
||||||
|
*
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
|
|||||||
@@ -1,7 +1,7 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
import com.fasterxml.jackson.annotation.JacksonInject;
|
|
||||||
import com.fasterxml.jackson.annotation.JsonProperty;
|
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
@@ -18,8 +18,6 @@ import javax.annotation.Nonnull;
|
|||||||
*/
|
*/
|
||||||
public class GHDiscussion extends GHObject {
|
public class GHDiscussion extends GHObject {
|
||||||
|
|
||||||
@JacksonInject
|
|
||||||
private GitHub root;
|
|
||||||
private GHTeam team;
|
private GHTeam team;
|
||||||
private long number;
|
private long number;
|
||||||
private String body, title, htmlUrl;
|
private String body, title, htmlUrl;
|
||||||
@@ -130,7 +128,7 @@ public class GHDiscussion extends GHObject {
|
|||||||
*
|
*
|
||||||
* @return a {@link GHDiscussion.Updater}
|
* @return a {@link GHDiscussion.Updater}
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(Previews.SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHDiscussion.Updater update() {
|
public GHDiscussion.Updater update() {
|
||||||
return new GHDiscussion.Updater(this);
|
return new GHDiscussion.Updater(this);
|
||||||
@@ -141,7 +139,7 @@ public class GHDiscussion extends GHObject {
|
|||||||
*
|
*
|
||||||
* @return a {@link GHDiscussion.Setter}
|
* @return a {@link GHDiscussion.Setter}
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(Previews.SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHDiscussion.Setter set() {
|
public GHDiscussion.Setter set() {
|
||||||
return new GHDiscussion.Setter(this);
|
return new GHDiscussion.Setter(this);
|
||||||
|
|||||||
@@ -12,6 +12,7 @@ import java.util.Locale;
|
|||||||
public enum GHEvent {
|
public enum GHEvent {
|
||||||
CHECK_RUN,
|
CHECK_RUN,
|
||||||
CHECK_SUITE,
|
CHECK_SUITE,
|
||||||
|
CODE_SCANNING_ALERT,
|
||||||
COMMIT_COMMENT,
|
COMMIT_COMMENT,
|
||||||
CONTENT_REFERENCE,
|
CONTENT_REFERENCE,
|
||||||
CREATE,
|
CREATE,
|
||||||
@@ -19,6 +20,8 @@ public enum GHEvent {
|
|||||||
DEPLOY_KEY,
|
DEPLOY_KEY,
|
||||||
DEPLOYMENT,
|
DEPLOYMENT,
|
||||||
DEPLOYMENT_STATUS,
|
DEPLOYMENT_STATUS,
|
||||||
|
DISCUSSION,
|
||||||
|
DISCUSSION_COMMENT,
|
||||||
DOWNLOAD,
|
DOWNLOAD,
|
||||||
FOLLOW,
|
FOLLOW,
|
||||||
FORK,
|
FORK,
|
||||||
@@ -56,6 +59,7 @@ public enum GHEvent {
|
|||||||
REPOSITORY,
|
REPOSITORY,
|
||||||
REPOSITORY_IMPORT,
|
REPOSITORY_IMPORT,
|
||||||
REPOSITORY_VULNERABILITY_ALERT,
|
REPOSITORY_VULNERABILITY_ALERT,
|
||||||
|
SCHEDULE,
|
||||||
SECURITY_ADVISORY,
|
SECURITY_ADVISORY,
|
||||||
STAR,
|
STAR,
|
||||||
STATUS,
|
STATUS,
|
||||||
@@ -65,6 +69,11 @@ public enum GHEvent {
|
|||||||
WORKFLOW_DISPATCH,
|
WORKFLOW_DISPATCH,
|
||||||
WORKFLOW_RUN,
|
WORKFLOW_RUN,
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Special event type that means we haven't found an enum value corresponding to the event.
|
||||||
|
*/
|
||||||
|
UNKNOWN,
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Special event type that means "every possible event"
|
* Special event type that means "every possible event"
|
||||||
*/
|
*/
|
||||||
|
|||||||
@@ -4,7 +4,7 @@ import com.fasterxml.jackson.databind.node.ObjectNode;
|
|||||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.util.Date;
|
import java.util.*;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Represents an event.
|
* Represents an event.
|
||||||
@@ -12,14 +12,22 @@ import java.util.Date;
|
|||||||
* @author Kohsuke Kawaguchi
|
* @author Kohsuke Kawaguchi
|
||||||
*/
|
*/
|
||||||
@SuppressFBWarnings(value = "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", justification = "JSON API")
|
@SuppressFBWarnings(value = "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", justification = "JSON API")
|
||||||
public class GHEventInfo {
|
public class GHEventInfo extends GitHubInteractiveObject {
|
||||||
private GitHub root;
|
|
||||||
|
|
||||||
// we don't want to expose Jackson dependency to the user. This needs databinding
|
// we don't want to expose Jackson dependency to the user. This needs databinding
|
||||||
private ObjectNode payload;
|
private ObjectNode payload;
|
||||||
|
|
||||||
private long id;
|
private long id;
|
||||||
private String created_at;
|
private String created_at;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Representation of GitHub Event API Event Type.
|
||||||
|
*
|
||||||
|
* This is not the same as the values used for hook methods such as
|
||||||
|
* {@link GHRepository#createHook(String, Map, Collection, boolean)}.
|
||||||
|
*
|
||||||
|
* @see <a href="https://docs.github.com/en/developers/webhooks-and-events/github-event-types">GitHub event
|
||||||
|
* types</a>
|
||||||
|
*/
|
||||||
private String type;
|
private String type;
|
||||||
|
|
||||||
// these are all shallow objects
|
// these are all shallow objects
|
||||||
@@ -42,20 +50,45 @@ public class GHEventInfo {
|
|||||||
private String name; // owner/repo
|
private String name; // owner/repo
|
||||||
}
|
}
|
||||||
|
|
||||||
|
static final Map<String, GHEvent> mapTypeStringToEvent = createEventMap();
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Map for GitHub Event API Event Type to GHEvent.
|
||||||
|
*
|
||||||
|
* @see <a href="https://docs.github.com/en/developers/webhooks-and-events/github-event-types">GitHub event
|
||||||
|
* types</a>
|
||||||
|
*/
|
||||||
|
private static Map<String, GHEvent> createEventMap() {
|
||||||
|
HashMap<String, GHEvent> map = new HashMap<>();
|
||||||
|
map.put("CommitCommentEvent", GHEvent.COMMIT_COMMENT);
|
||||||
|
map.put("CreateEvent", GHEvent.CREATE);
|
||||||
|
map.put("DeleteEvent", GHEvent.DELETE);
|
||||||
|
map.put("ForkEvent", GHEvent.FORK);
|
||||||
|
map.put("GollumEvent", GHEvent.GOLLUM);
|
||||||
|
map.put("IssueCommentEvent", GHEvent.ISSUE_COMMENT);
|
||||||
|
map.put("IssuesEvent", GHEvent.ISSUES);
|
||||||
|
map.put("MemberEvent", GHEvent.MEMBER);
|
||||||
|
map.put("PublicEvent", GHEvent.PUBLIC);
|
||||||
|
map.put("PullRequestEvent", GHEvent.PULL_REQUEST);
|
||||||
|
map.put("PullRequestReviewEvent", GHEvent.PULL_REQUEST_REVIEW);
|
||||||
|
map.put("PullRequestReviewCommentEvent", GHEvent.PULL_REQUEST_REVIEW_COMMENT);
|
||||||
|
map.put("PushEvent", GHEvent.PUSH);
|
||||||
|
map.put("ReleaseEvent", GHEvent.RELEASE);
|
||||||
|
map.put("WatchEvent", GHEvent.WATCH);
|
||||||
|
return Collections.unmodifiableMap(map);
|
||||||
|
}
|
||||||
|
|
||||||
|
static GHEvent transformTypeToGHEvent(String type) {
|
||||||
|
return mapTypeStringToEvent.getOrDefault(type, GHEvent.UNKNOWN);
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets type.
|
* Gets type.
|
||||||
*
|
*
|
||||||
* @return the type
|
* @return the type
|
||||||
*/
|
*/
|
||||||
public GHEvent getType() {
|
public GHEvent getType() {
|
||||||
String t = type;
|
return transformTypeToGHEvent(type);
|
||||||
if (t.endsWith("Event"))
|
|
||||||
t = t.substring(0, t.length() - 5);
|
|
||||||
for (GHEvent e : GHEvent.values()) {
|
|
||||||
if (e.name().replace("_", "").equalsIgnoreCase(t))
|
|
||||||
return e;
|
|
||||||
}
|
|
||||||
return null; // unknown event type
|
|
||||||
}
|
}
|
||||||
|
|
||||||
GHEventInfo wrapUp(GitHub root) {
|
GHEventInfo wrapUp(GitHub root) {
|
||||||
|
|||||||
@@ -5,7 +5,9 @@ import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
|||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.io.Reader;
|
import java.io.Reader;
|
||||||
|
import java.util.Date;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
|
import java.util.Map;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Base type for types used in databinding of the event payload.
|
* Base type for types used in databinding of the event payload.
|
||||||
@@ -17,9 +19,7 @@ import java.util.List;
|
|||||||
*/
|
*/
|
||||||
@SuppressWarnings("UnusedDeclaration")
|
@SuppressWarnings("UnusedDeclaration")
|
||||||
@SuppressFBWarnings("UWF_UNWRITTEN_FIELD")
|
@SuppressFBWarnings("UWF_UNWRITTEN_FIELD")
|
||||||
public class GHEventPayload {
|
public class GHEventPayload extends GitHubInteractiveObject {
|
||||||
protected GitHub root;
|
|
||||||
|
|
||||||
// https://docs.github.com/en/free-pro-team@latest/developers/webhooks-and-events/webhook-events-and-payloads#webhook-payload-object-common-properties
|
// https://docs.github.com/en/free-pro-team@latest/developers/webhooks-and-events/webhook-events-and-payloads#webhook-payload-object-common-properties
|
||||||
// Webhook payload object common properties: action, sender, repository, organization, installation
|
// Webhook payload object common properties: action, sender, repository, organization, installation
|
||||||
private String action;
|
private String action;
|
||||||
@@ -382,9 +382,9 @@ public class GHEventPayload {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets label.
|
* Gets the added or removed label for labeled/unlabeled events.
|
||||||
*
|
*
|
||||||
* @return the label
|
* @return label the added or removed label
|
||||||
*/
|
*/
|
||||||
public GHLabel getLabel() {
|
public GHLabel getLabel() {
|
||||||
return label;
|
return label;
|
||||||
@@ -521,6 +521,10 @@ public class GHEventPayload {
|
|||||||
public static class Issue extends GHEventPayload {
|
public static class Issue extends GHEventPayload {
|
||||||
private GHIssue issue;
|
private GHIssue issue;
|
||||||
|
|
||||||
|
private GHLabel label;
|
||||||
|
|
||||||
|
private GHIssueChanges changes;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets issue.
|
* Gets issue.
|
||||||
*
|
*
|
||||||
@@ -540,6 +544,24 @@ public class GHEventPayload {
|
|||||||
this.issue = issue;
|
this.issue = issue;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the added or removed label for labeled/unlabeled events.
|
||||||
|
*
|
||||||
|
* @return label the added or removed label
|
||||||
|
*/
|
||||||
|
public GHLabel getLabel() {
|
||||||
|
return label;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get changes (for action="edited")
|
||||||
|
*
|
||||||
|
* @return changes
|
||||||
|
*/
|
||||||
|
public GHIssueChanges getChanges() {
|
||||||
|
return changes;
|
||||||
|
}
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
void wrapUp(GitHub root) {
|
void wrapUp(GitHub root) {
|
||||||
super.wrapUp(root);
|
super.wrapUp(root);
|
||||||
@@ -689,9 +711,11 @@ public class GHEventPayload {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets master branch.
|
* Gets default branch.
|
||||||
*
|
*
|
||||||
* @return the master branch
|
* Name is an artifact of when "master" was the most common default.
|
||||||
|
*
|
||||||
|
* @return the default branch
|
||||||
*/
|
*/
|
||||||
@SuppressFBWarnings(value = "UWF_UNWRITTEN_FIELD", justification = "Comes from JSON deserialization")
|
@SuppressFBWarnings(value = "UWF_UNWRITTEN_FIELD", justification = "Comes from JSON deserialization")
|
||||||
public String getMasterBranch() {
|
public String getMasterBranch() {
|
||||||
@@ -937,7 +961,7 @@ public class GHEventPayload {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The full Git ref that was pushed. Example: “refs/heads/master”
|
* The full Git ref that was pushed. Example: “refs/heads/main”
|
||||||
*
|
*
|
||||||
* @return the ref
|
* @return the ref
|
||||||
*/
|
*/
|
||||||
@@ -1069,7 +1093,7 @@ public class GHEventPayload {
|
|||||||
public static class PushCommit {
|
public static class PushCommit {
|
||||||
private GitUser author;
|
private GitUser author;
|
||||||
private GitUser committer;
|
private GitUser committer;
|
||||||
private String url, sha, message;
|
private String url, sha, message, timestamp;
|
||||||
private boolean distinct;
|
private boolean distinct;
|
||||||
private List<String> added, removed, modified;
|
private List<String> added, removed, modified;
|
||||||
|
|
||||||
@@ -1158,6 +1182,15 @@ public class GHEventPayload {
|
|||||||
public List<String> getModified() {
|
public List<String> getModified() {
|
||||||
return modified;
|
return modified;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Obtains the timestamp of the commit
|
||||||
|
*
|
||||||
|
* @return the timestamp
|
||||||
|
*/
|
||||||
|
public Date getTimestamp() {
|
||||||
|
return GitHubClient.parseDate(timestamp);
|
||||||
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -1216,19 +1249,29 @@ public class GHEventPayload {
|
|||||||
private String description;
|
private String description;
|
||||||
private GHCommitState state;
|
private GHCommitState state;
|
||||||
private GHCommit commit;
|
private GHCommit commit;
|
||||||
|
private String targetUrl;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets the status content.
|
* Gets the status content.
|
||||||
*
|
*
|
||||||
* @return status content
|
* @return status content
|
||||||
*/
|
*/
|
||||||
public String getContext() {
|
public String getContext() {
|
||||||
return context;
|
return context;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The optional link added to the status.
|
||||||
|
*
|
||||||
|
* @return a url
|
||||||
|
*/
|
||||||
|
public String getTargetUrl() {
|
||||||
|
return targetUrl;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets the status description.
|
* Gets the status description.
|
||||||
*
|
*
|
||||||
* @return status description
|
* @return status description
|
||||||
*/
|
*/
|
||||||
public String getDescription() {
|
public String getDescription() {
|
||||||
@@ -1237,7 +1280,7 @@ public class GHEventPayload {
|
|||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets the status state.
|
* Gets the status state.
|
||||||
*
|
*
|
||||||
* @return status state
|
* @return status state
|
||||||
*/
|
*/
|
||||||
public GHCommitState getState() {
|
public GHCommitState getState() {
|
||||||
@@ -1246,7 +1289,7 @@ public class GHEventPayload {
|
|||||||
|
|
||||||
/**
|
/**
|
||||||
* Sets the status stage.
|
* Sets the status stage.
|
||||||
*
|
*
|
||||||
* @param state
|
* @param state
|
||||||
* status state
|
* status state
|
||||||
*/
|
*/
|
||||||
@@ -1256,7 +1299,7 @@ public class GHEventPayload {
|
|||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets the commit associated with the status event.
|
* Gets the commit associated with the status event.
|
||||||
*
|
*
|
||||||
* @return commit
|
* @return commit
|
||||||
*/
|
*/
|
||||||
public GHCommit getCommit() {
|
public GHCommit getCommit() {
|
||||||
@@ -1265,7 +1308,7 @@ public class GHEventPayload {
|
|||||||
|
|
||||||
/**
|
/**
|
||||||
* Sets the commit associated with the status event.
|
* Sets the commit associated with the status event.
|
||||||
*
|
*
|
||||||
* @param commit
|
* @param commit
|
||||||
* commit
|
* commit
|
||||||
*/
|
*/
|
||||||
@@ -1286,4 +1329,125 @@ public class GHEventPayload {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Occurs when someone triggered a workflow run or sends a POST request to the "Create a workflow dispatch event"
|
||||||
|
* endpoint.
|
||||||
|
*
|
||||||
|
* @see <a href=
|
||||||
|
* "https://docs.github.com/en/developers/webhooks-and-events/webhook-events-and-payloads#workflow_dispatch">
|
||||||
|
* workflow dispatch event</a>
|
||||||
|
* @see <a href=
|
||||||
|
* "https://docs.github.com/en/actions/reference/events-that-trigger-workflows#workflow_dispatch">Events that
|
||||||
|
* trigger workflows</a>
|
||||||
|
*/
|
||||||
|
public static class WorkflowDispatch extends GHEventPayload {
|
||||||
|
private Map<String, Object> inputs;
|
||||||
|
private String ref;
|
||||||
|
private String workflow;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the map of input parameters passed to the workflow.
|
||||||
|
*
|
||||||
|
* @return the map of input parameters
|
||||||
|
*/
|
||||||
|
public Map<String, Object> getInputs() {
|
||||||
|
return inputs;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the ref of the branch (e.g. refs/heads/main)
|
||||||
|
*
|
||||||
|
* @return the ref of the branch
|
||||||
|
*/
|
||||||
|
public String getRef() {
|
||||||
|
return ref;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the path of the workflow file (e.g. .github/workflows/hello-world-workflow.yml).
|
||||||
|
*
|
||||||
|
* @return the path of the workflow file
|
||||||
|
*/
|
||||||
|
public String getWorkflow() {
|
||||||
|
return workflow;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A workflow run was requested or completed.
|
||||||
|
*
|
||||||
|
* @see <a href=
|
||||||
|
* "https://docs.github.com/en/developers/webhooks-and-events/webhook-events-and-payloads#workflow_run">
|
||||||
|
* workflow run event</a>
|
||||||
|
* @see <a href="https://docs.github.com/en/rest/reference/actions#workflow-runs">Actions Workflow Runs</a>
|
||||||
|
*/
|
||||||
|
public static class WorkflowRun extends GHEventPayload {
|
||||||
|
private GHWorkflowRun workflowRun;
|
||||||
|
private GHWorkflow workflow;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the workflow run.
|
||||||
|
*
|
||||||
|
* @return the workflow run
|
||||||
|
*/
|
||||||
|
public GHWorkflowRun getWorkflowRun() {
|
||||||
|
return workflowRun;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the associated workflow.
|
||||||
|
*
|
||||||
|
* @return the associated workflow
|
||||||
|
*/
|
||||||
|
public GHWorkflow getWorkflow() {
|
||||||
|
return workflow;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
void wrapUp(GitHub root) {
|
||||||
|
super.wrapUp(root);
|
||||||
|
if (workflowRun == null || workflow == null) {
|
||||||
|
throw new IllegalStateException(
|
||||||
|
"Expected workflow and workflow_run payload, but got something else. Maybe we've got another type of event?");
|
||||||
|
}
|
||||||
|
GHRepository repository = getRepository();
|
||||||
|
if (repository == null) {
|
||||||
|
throw new IllegalStateException("Repository must not be null");
|
||||||
|
}
|
||||||
|
workflowRun.wrapUp(repository);
|
||||||
|
workflow.wrapUp(repository);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A label was created, edited or deleted.
|
||||||
|
*
|
||||||
|
* @see <a href= "https://docs.github.com/en/developers/webhooks-and-events/webhook-events-and-payloads#label">
|
||||||
|
* label event</a>
|
||||||
|
*/
|
||||||
|
public static class Label extends GHEventPayload {
|
||||||
|
|
||||||
|
private GHLabel label;
|
||||||
|
|
||||||
|
private GHLabelChanges changes;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the label.
|
||||||
|
*
|
||||||
|
* @return the label
|
||||||
|
*/
|
||||||
|
public GHLabel getLabel() {
|
||||||
|
return label;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets changes (for action="edited")
|
||||||
|
*
|
||||||
|
* @return changes
|
||||||
|
*/
|
||||||
|
public GHLabelChanges getChanges() {
|
||||||
|
return changes;
|
||||||
|
}
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -23,7 +23,6 @@ import java.util.Map.Entry;
|
|||||||
public class GHGist extends GHObject {
|
public class GHGist extends GHObject {
|
||||||
|
|
||||||
final GHUser owner;
|
final GHUser owner;
|
||||||
final GitHub root;
|
|
||||||
|
|
||||||
private String forks_url, commits_url, id, git_pull_url, git_push_url, html_url;
|
private String forks_url, commits_url, id, git_pull_url, git_push_url, html_url;
|
||||||
|
|
||||||
@@ -123,7 +122,7 @@ public class GHGist extends GHObject {
|
|||||||
|
|
||||||
/**
|
/**
|
||||||
* Get the html url.
|
* Get the html url.
|
||||||
*
|
*
|
||||||
* @return the github html url
|
* @return the github html url
|
||||||
*/
|
*/
|
||||||
public URL getHtmlUrl() {
|
public URL getHtmlUrl() {
|
||||||
|
|||||||
@@ -13,7 +13,6 @@ import javax.annotation.Nonnull;
|
|||||||
* @see GitHub#createGist() GitHub#createGist()
|
* @see GitHub#createGist() GitHub#createGist()
|
||||||
*/
|
*/
|
||||||
public class GHGistBuilder {
|
public class GHGistBuilder {
|
||||||
private final GitHub root;
|
|
||||||
private final Requester req;
|
private final Requester req;
|
||||||
private final LinkedHashMap<String, Object> files = new LinkedHashMap<String, Object>();
|
private final LinkedHashMap<String, Object> files = new LinkedHashMap<String, Object>();
|
||||||
|
|
||||||
@@ -24,7 +23,6 @@ public class GHGistBuilder {
|
|||||||
* the root
|
* the root
|
||||||
*/
|
*/
|
||||||
public GHGistBuilder(GitHub root) {
|
public GHGistBuilder(GitHub root) {
|
||||||
this.root = root;
|
|
||||||
req = root.createRequest().method("POST");
|
req = root.createRequest().method("POST");
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
@@ -1,13 +1,13 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
|
import org.kohsuke.github.internal.EnumUtils;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
import java.util.Collections;
|
import java.util.Collections;
|
||||||
import java.util.EnumSet;
|
import java.util.EnumSet;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
import java.util.Locale;
|
|
||||||
import java.util.Map;
|
import java.util.Map;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -40,10 +40,7 @@ public abstract class GHHook extends GHObject {
|
|||||||
public EnumSet<GHEvent> getEvents() {
|
public EnumSet<GHEvent> getEvents() {
|
||||||
EnumSet<GHEvent> s = EnumSet.noneOf(GHEvent.class);
|
EnumSet<GHEvent> s = EnumSet.noneOf(GHEvent.class);
|
||||||
for (String e : events) {
|
for (String e : events) {
|
||||||
if (e.equals("*"))
|
s.add(e.equals("*") ? GHEvent.ALL : EnumUtils.getEnumOrDefault(GHEvent.class, e, GHEvent.UNKNOWN));
|
||||||
s.add(GHEvent.ALL);
|
|
||||||
else
|
|
||||||
s.add(Enum.valueOf(GHEvent.class, e.toUpperCase(Locale.ENGLISH)));
|
|
||||||
}
|
}
|
||||||
return s;
|
return s;
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -12,8 +12,7 @@ import java.util.Map;
|
|||||||
* functionality
|
* functionality
|
||||||
*/
|
*/
|
||||||
class GHHooks {
|
class GHHooks {
|
||||||
static abstract class Context {
|
static abstract class Context extends GitHubInteractiveObject {
|
||||||
private final GitHub root;
|
|
||||||
|
|
||||||
private Context(GitHub root) {
|
private Context(GitHub root) {
|
||||||
this.root = root;
|
this.root = root;
|
||||||
|
|||||||
@@ -16,7 +16,6 @@ import java.net.URL;
|
|||||||
"UUF_UNUSED_FIELD" },
|
"UUF_UNUSED_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public class GHInvitation extends GHObject {
|
public class GHInvitation extends GHObject {
|
||||||
/* package almost final */ GitHub root;
|
|
||||||
|
|
||||||
private int id;
|
private int id;
|
||||||
private GHRepository repository;
|
private GHRepository repository;
|
||||||
|
|||||||
@@ -39,7 +39,7 @@ import java.util.List;
|
|||||||
import java.util.Locale;
|
import java.util.Locale;
|
||||||
import java.util.Objects;
|
import java.util.Objects;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.SQUIRREL_GIRL;
|
import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Represents an issue on GitHub.
|
* Represents an issue on GitHub.
|
||||||
@@ -53,7 +53,6 @@ import static org.kohsuke.github.Previews.SQUIRREL_GIRL;
|
|||||||
public class GHIssue extends GHObject implements Reactable {
|
public class GHIssue extends GHObject implements Reactable {
|
||||||
private static final String ASSIGNEES = "assignees";
|
private static final String ASSIGNEES = "assignees";
|
||||||
|
|
||||||
GitHub root;
|
|
||||||
GHRepository owner;
|
GHRepository owner;
|
||||||
|
|
||||||
// API v3
|
// API v3
|
||||||
@@ -313,7 +312,7 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Sets labels.
|
* Sets labels on the target to a specific list.
|
||||||
*
|
*
|
||||||
* @param labels
|
* @param labels
|
||||||
* the labels
|
* the labels
|
||||||
@@ -327,100 +326,137 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
/**
|
/**
|
||||||
* Adds labels to the issue.
|
* Adds labels to the issue.
|
||||||
*
|
*
|
||||||
|
* Labels that are already present on the target are ignored.
|
||||||
|
*
|
||||||
|
* @return the complete list of labels including the new additions
|
||||||
* @param names
|
* @param names
|
||||||
* Names of the label
|
* Names of the label
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void addLabels(String... names) throws IOException {
|
@WithBridgeMethods(void.class)
|
||||||
_addLabels(Arrays.asList(names));
|
public List<GHLabel> addLabels(String... names) throws IOException {
|
||||||
|
return _addLabels(Arrays.asList(names));
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Add labels.
|
* Add labels.
|
||||||
*
|
*
|
||||||
|
* Labels that are already present on the target are ignored.
|
||||||
|
*
|
||||||
|
* @return the complete list of labels including the new additions
|
||||||
* @param labels
|
* @param labels
|
||||||
* the labels
|
* the labels
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void addLabels(GHLabel... labels) throws IOException {
|
@WithBridgeMethods(void.class)
|
||||||
addLabels(Arrays.asList(labels));
|
public List<GHLabel> addLabels(GHLabel... labels) throws IOException {
|
||||||
|
return addLabels(Arrays.asList(labels));
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Add labels.
|
* Add labels.
|
||||||
*
|
*
|
||||||
|
* Labels that are already present on the target are ignored.
|
||||||
|
*
|
||||||
|
* @return the complete list of labels including the new additions
|
||||||
* @param labels
|
* @param labels
|
||||||
* the labels
|
* the labels
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void addLabels(Collection<GHLabel> labels) throws IOException {
|
@WithBridgeMethods(void.class)
|
||||||
_addLabels(GHLabel.toNames(labels));
|
public List<GHLabel> addLabels(Collection<GHLabel> labels) throws IOException {
|
||||||
|
return _addLabels(GHLabel.toNames(labels));
|
||||||
}
|
}
|
||||||
|
|
||||||
private void _addLabels(Collection<String> names) throws IOException {
|
private List<GHLabel> _addLabels(Collection<String> names) throws IOException {
|
||||||
List<String> newLabels = new ArrayList<String>();
|
return Arrays.asList(root.createRequest()
|
||||||
|
.with("labels", names)
|
||||||
for (GHLabel label : getLabels()) {
|
.method("POST")
|
||||||
newLabels.add(label.getName());
|
.withUrlPath(getIssuesApiRoute() + "/labels")
|
||||||
}
|
.fetch(GHLabel[].class));
|
||||||
for (String name : names) {
|
|
||||||
if (!newLabels.contains(name)) {
|
|
||||||
newLabels.add(name);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
setLabels(newLabels.toArray(new String[0]));
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Remove a given label by name from this issue.
|
* Remove a single label.
|
||||||
*
|
*
|
||||||
|
* Attempting to remove a label that is not present throws {@link GHFileNotFoundException}.
|
||||||
|
*
|
||||||
|
* @return the remaining list of labels
|
||||||
|
* @param name
|
||||||
|
* the name
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception, throws {@link GHFileNotFoundException} if label was not present.
|
||||||
|
*/
|
||||||
|
@WithBridgeMethods(void.class)
|
||||||
|
public List<GHLabel> removeLabel(String name) throws IOException {
|
||||||
|
return Arrays.asList(root.createRequest()
|
||||||
|
.method("DELETE")
|
||||||
|
.withUrlPath(getIssuesApiRoute() + "/labels", name)
|
||||||
|
.fetch(GHLabel[].class));
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Remove a collection of labels.
|
||||||
|
*
|
||||||
|
* Attempting to remove labels that are not present on the target are ignored.
|
||||||
|
*
|
||||||
|
* @return the remaining list of labels
|
||||||
* @param names
|
* @param names
|
||||||
* the names
|
* the names
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void removeLabels(String... names) throws IOException {
|
@WithBridgeMethods(void.class)
|
||||||
_removeLabels(Arrays.asList(names));
|
public List<GHLabel> removeLabels(String... names) throws IOException {
|
||||||
|
return _removeLabels(Arrays.asList(names));
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Remove labels.
|
* Remove a collection of labels.
|
||||||
*
|
*
|
||||||
|
* Attempting to remove labels that are not present on the target are ignored.
|
||||||
|
*
|
||||||
|
* @return the remaining list of labels
|
||||||
* @param labels
|
* @param labels
|
||||||
* the labels
|
* the labels
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
* @see #removeLabels(String...) #removeLabels(String...)
|
* @see #removeLabels(String...) #removeLabels(String...)
|
||||||
*/
|
*/
|
||||||
public void removeLabels(GHLabel... labels) throws IOException {
|
@WithBridgeMethods(void.class)
|
||||||
removeLabels(Arrays.asList(labels));
|
public List<GHLabel> removeLabels(GHLabel... labels) throws IOException {
|
||||||
|
return removeLabels(Arrays.asList(labels));
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Remove labels.
|
* Remove a collection of labels.
|
||||||
*
|
*
|
||||||
|
* Attempting to remove labels that are not present on the target are ignored.
|
||||||
|
*
|
||||||
|
* @return the remaining list of labels
|
||||||
* @param labels
|
* @param labels
|
||||||
* the labels
|
* the labels
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void removeLabels(Collection<GHLabel> labels) throws IOException {
|
@WithBridgeMethods(void.class)
|
||||||
_removeLabels(GHLabel.toNames(labels));
|
public List<GHLabel> removeLabels(Collection<GHLabel> labels) throws IOException {
|
||||||
|
return _removeLabels(GHLabel.toNames(labels));
|
||||||
}
|
}
|
||||||
|
|
||||||
private void _removeLabels(Collection<String> names) throws IOException {
|
private List<GHLabel> _removeLabels(Collection<String> names) throws IOException {
|
||||||
List<String> newLabels = new ArrayList<String>();
|
List<GHLabel> remainingLabels = Collections.emptyList();
|
||||||
|
for (String name : names) {
|
||||||
for (GHLabel l : getLabels()) {
|
try {
|
||||||
if (!names.contains(l.getName())) {
|
remainingLabels = removeLabel(name);
|
||||||
newLabels.add(l.getName());
|
} catch (GHFileNotFoundException e) {
|
||||||
|
// when trying to remove multiple labels, we ignore already removed
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
return remainingLabels;
|
||||||
setLabels(newLabels.toArray(new String[0]));
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -448,7 +484,7 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
.toIterable(GHIssueComment[].class, item -> item.wrapUp(this));
|
.toIterable(GHIssueComment[].class, item -> item.wrapUp(this));
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHReaction createReaction(ReactionContent content) throws IOException {
|
public GHReaction createReaction(ReactionContent content) throws IOException {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
@@ -460,7 +496,7 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
.wrap(root);
|
.wrap(root);
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public PagedIterable<GHReaction> listReactions() {
|
public PagedIterable<GHReaction> listReactions() {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
|
|||||||
49
src/main/java/org/kohsuke/github/GHIssueChanges.java
Normal file
49
src/main/java/org/kohsuke/github/GHIssueChanges.java
Normal file
@@ -0,0 +1,49 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Wrapper to define changed fields on issues action="edited"
|
||||||
|
*
|
||||||
|
* @see GHEventPayload.Issue
|
||||||
|
*/
|
||||||
|
@SuppressFBWarnings("UWF_UNWRITTEN_FIELD")
|
||||||
|
public class GHIssueChanges {
|
||||||
|
|
||||||
|
private GHFrom title;
|
||||||
|
private GHFrom body;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Old issue title.
|
||||||
|
*
|
||||||
|
* @return old issue title (or null if not changed)
|
||||||
|
*/
|
||||||
|
public GHFrom getTitle() {
|
||||||
|
return title;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Old issue body.
|
||||||
|
*
|
||||||
|
* @return old issue body (or null if not changed)
|
||||||
|
*/
|
||||||
|
public GHFrom getBody() {
|
||||||
|
return body;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Wrapper for changed values.
|
||||||
|
*/
|
||||||
|
public static class GHFrom {
|
||||||
|
private String from;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Previous value that was changed.
|
||||||
|
*
|
||||||
|
* @return previous value
|
||||||
|
*/
|
||||||
|
public String getFrom() {
|
||||||
|
return from;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -26,7 +26,7 @@ package org.kohsuke.github;
|
|||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.*;
|
import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Comment to the issue
|
* Comment to the issue
|
||||||
@@ -126,7 +126,7 @@ public class GHIssueComment extends GHObject implements Reactable {
|
|||||||
owner.root.createRequest().method("DELETE").withUrlPath(getApiRoute()).send();
|
owner.root.createRequest().method("DELETE").withUrlPath(getApiRoute()).send();
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHReaction createReaction(ReactionContent content) throws IOException {
|
public GHReaction createReaction(ReactionContent content) throws IOException {
|
||||||
return owner.root.createRequest()
|
return owner.root.createRequest()
|
||||||
@@ -138,7 +138,7 @@ public class GHIssueComment extends GHObject implements Reactable {
|
|||||||
.wrap(owner.root);
|
.wrap(owner.root);
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public PagedIterable<GHReaction> listReactions() {
|
public PagedIterable<GHReaction> listReactions() {
|
||||||
return owner.root.createRequest()
|
return owner.root.createRequest()
|
||||||
|
|||||||
@@ -9,9 +9,7 @@ import java.util.Date;
|
|||||||
*
|
*
|
||||||
* @author Martin van Zijl
|
* @author Martin van Zijl
|
||||||
*/
|
*/
|
||||||
public class GHIssueEvent {
|
public class GHIssueEvent extends GitHubInteractiveObject {
|
||||||
private GitHub root;
|
|
||||||
|
|
||||||
private long id;
|
private long id;
|
||||||
private String node_id;
|
private String node_id;
|
||||||
private String url;
|
private String url;
|
||||||
|
|||||||
@@ -31,4 +31,4 @@ package org.kohsuke.github;
|
|||||||
*/
|
*/
|
||||||
public enum GHIssueState {
|
public enum GHIssueState {
|
||||||
OPEN, CLOSED, ALL
|
OPEN, CLOSED, ALL
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -9,9 +9,7 @@ import org.apache.commons.lang3.builder.ToStringBuilder;
|
|||||||
* @author Kohsuke Kawaguchi
|
* @author Kohsuke Kawaguchi
|
||||||
*/
|
*/
|
||||||
@SuppressFBWarnings(value = "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", justification = "JSON API")
|
@SuppressFBWarnings(value = "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", justification = "JSON API")
|
||||||
public class GHKey {
|
public class GHKey extends GitHubInteractiveObject {
|
||||||
/* package almost final */ GitHub root;
|
|
||||||
|
|
||||||
protected String url, key, title;
|
protected String url, key, title;
|
||||||
protected boolean verified;
|
protected boolean verified;
|
||||||
protected int id;
|
protected int id;
|
||||||
|
|||||||
@@ -2,6 +2,7 @@ package org.kohsuke.github;
|
|||||||
|
|
||||||
import com.fasterxml.jackson.annotation.JacksonInject;
|
import com.fasterxml.jackson.annotation.JacksonInject;
|
||||||
import com.fasterxml.jackson.annotation.JsonCreator;
|
import com.fasterxml.jackson.annotation.JsonCreator;
|
||||||
|
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.util.ArrayList;
|
import java.util.ArrayList;
|
||||||
@@ -20,7 +21,12 @@ import javax.annotation.Nonnull;
|
|||||||
* @see GHIssue#getLabels() GHIssue#getLabels()
|
* @see GHIssue#getLabels() GHIssue#getLabels()
|
||||||
* @see GHRepository#listLabels() GHRepository#listLabels()
|
* @see GHRepository#listLabels() GHRepository#listLabels()
|
||||||
*/
|
*/
|
||||||
public class GHLabel {
|
public class GHLabel extends GitHubInteractiveObject {
|
||||||
|
|
||||||
|
private long id;
|
||||||
|
private String nodeId;
|
||||||
|
@JsonProperty("default")
|
||||||
|
private boolean default_;
|
||||||
|
|
||||||
@Nonnull
|
@Nonnull
|
||||||
private String url, name, color;
|
private String url, name, color;
|
||||||
@@ -28,9 +34,6 @@ public class GHLabel {
|
|||||||
@CheckForNull
|
@CheckForNull
|
||||||
private String description;
|
private String description;
|
||||||
|
|
||||||
@Nonnull
|
|
||||||
private final GitHub root;
|
|
||||||
|
|
||||||
@JsonCreator
|
@JsonCreator
|
||||||
private GHLabel(@JacksonInject @Nonnull GitHub root) {
|
private GHLabel(@JacksonInject @Nonnull GitHub root) {
|
||||||
this.root = root;
|
this.root = root;
|
||||||
@@ -45,6 +48,24 @@ public class GHLabel {
|
|||||||
return Objects.requireNonNull(root);
|
return Objects.requireNonNull(root);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets id.
|
||||||
|
*
|
||||||
|
* @return the id
|
||||||
|
*/
|
||||||
|
public long getId() {
|
||||||
|
return id;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets node id.
|
||||||
|
*
|
||||||
|
* @return the node id.
|
||||||
|
*/
|
||||||
|
public String getNodeId() {
|
||||||
|
return nodeId;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets url.
|
* Gets url.
|
||||||
*
|
*
|
||||||
@@ -85,6 +106,15 @@ public class GHLabel {
|
|||||||
return description;
|
return description;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* If the label is one of the default labels created by GitHub automatically.
|
||||||
|
*
|
||||||
|
* @return true if the label is a default one
|
||||||
|
*/
|
||||||
|
public boolean isDefault() {
|
||||||
|
return default_;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Sets color.
|
* Sets color.
|
||||||
*
|
*
|
||||||
@@ -132,7 +162,7 @@ public class GHLabel {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
static Creator create(GHRepository repository) throws IOException {
|
static Creator create(GHRepository repository) throws IOException {
|
||||||
return new Creator(repository);
|
return new Creator(repository);
|
||||||
@@ -179,7 +209,7 @@ public class GHLabel {
|
|||||||
*
|
*
|
||||||
* @return a {@link Updater}
|
* @return a {@link Updater}
|
||||||
*/
|
*/
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public Updater update() {
|
public Updater update() {
|
||||||
return new Updater(this);
|
return new Updater(this);
|
||||||
@@ -187,10 +217,10 @@ public class GHLabel {
|
|||||||
|
|
||||||
/**
|
/**
|
||||||
* Begins a single property update.
|
* Begins a single property update.
|
||||||
*
|
*
|
||||||
* @return a {@link Setter}
|
* @return a {@link Setter}
|
||||||
*/
|
*/
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public Setter set() {
|
public Setter set() {
|
||||||
return new Setter(this);
|
return new Setter(this);
|
||||||
@@ -227,7 +257,7 @@ public class GHLabel {
|
|||||||
*
|
*
|
||||||
* {@link #done()} is called automatically after the property is set.
|
* {@link #done()} is called automatically after the property is set.
|
||||||
*/
|
*/
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public static class Setter extends GHLabelBuilder<GHLabel> {
|
public static class Setter extends GHLabelBuilder<GHLabel> {
|
||||||
private Setter(@Nonnull GHLabel base) {
|
private Setter(@Nonnull GHLabel base) {
|
||||||
@@ -241,7 +271,7 @@ public class GHLabel {
|
|||||||
*
|
*
|
||||||
* Consumer must call {@link #done()} to commit changes.
|
* Consumer must call {@link #done()} to commit changes.
|
||||||
*/
|
*/
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public static class Updater extends GHLabelBuilder<Updater> {
|
public static class Updater extends GHLabelBuilder<Updater> {
|
||||||
private Updater(@Nonnull GHLabel base) {
|
private Updater(@Nonnull GHLabel base) {
|
||||||
@@ -255,7 +285,7 @@ public class GHLabel {
|
|||||||
*
|
*
|
||||||
* Consumer must call {@link #done()} to create the new instance.
|
* Consumer must call {@link #done()} to create the new instance.
|
||||||
*/
|
*/
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public static class Creator extends GHLabelBuilder<Creator> {
|
public static class Creator extends GHLabelBuilder<Creator> {
|
||||||
private Creator(@Nonnull GHRepository repository) {
|
private Creator(@Nonnull GHRepository repository) {
|
||||||
|
|||||||
@@ -38,21 +38,21 @@ class GHLabelBuilder<S> extends AbstractBuilder<GHLabel, S> {
|
|||||||
}
|
}
|
||||||
|
|
||||||
@Nonnull
|
@Nonnull
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public S name(String value) throws IOException {
|
public S name(String value) throws IOException {
|
||||||
return with("name", value);
|
return with("name", value);
|
||||||
}
|
}
|
||||||
|
|
||||||
@Nonnull
|
@Nonnull
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public S color(String value) throws IOException {
|
public S color(String value) throws IOException {
|
||||||
return with("color", value);
|
return with("color", value);
|
||||||
}
|
}
|
||||||
|
|
||||||
@Nonnull
|
@Nonnull
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public S description(String value) throws IOException {
|
public S description(String value) throws IOException {
|
||||||
return with("description", value);
|
return with("description", value);
|
||||||
|
|||||||
49
src/main/java/org/kohsuke/github/GHLabelChanges.java
Normal file
49
src/main/java/org/kohsuke/github/GHLabelChanges.java
Normal file
@@ -0,0 +1,49 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Wrapper to define changed fields on label action="edited"
|
||||||
|
*
|
||||||
|
* @see GHEventPayload.Label
|
||||||
|
*/
|
||||||
|
@SuppressFBWarnings("UWF_UNWRITTEN_FIELD")
|
||||||
|
public class GHLabelChanges {
|
||||||
|
|
||||||
|
private GHFrom name;
|
||||||
|
private GHFrom color;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Old label name.
|
||||||
|
*
|
||||||
|
* @return old label name (or null if not changed)
|
||||||
|
*/
|
||||||
|
public GHFrom getName() {
|
||||||
|
return name;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Old label color.
|
||||||
|
*
|
||||||
|
* @return old label color (or null if not changed)
|
||||||
|
*/
|
||||||
|
public GHFrom getColor() {
|
||||||
|
return color;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Wrapper for changed values.
|
||||||
|
*/
|
||||||
|
public static class GHFrom {
|
||||||
|
private String from;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Previous value that was changed.
|
||||||
|
*
|
||||||
|
* @return previous value
|
||||||
|
*/
|
||||||
|
public String getFrom() {
|
||||||
|
return from;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -44,9 +44,6 @@ import java.util.Objects;
|
|||||||
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public class GHLicense extends GHObject {
|
public class GHLicense extends GHObject {
|
||||||
@SuppressFBWarnings("IS2_INCONSISTENT_SYNC")
|
|
||||||
// root is set before the object is returned to the app
|
|
||||||
/* package almost final */ GitHub root;
|
|
||||||
|
|
||||||
// these fields are always present, even in the short form
|
// these fields are always present, even in the short form
|
||||||
protected String key, name;
|
protected String key, name;
|
||||||
|
|||||||
@@ -9,9 +9,7 @@ import java.net.URL;
|
|||||||
* @see GitHub#getMyMarketplacePurchases()
|
* @see GitHub#getMyMarketplacePurchases()
|
||||||
* @see GHMarketplaceListAccountBuilder#createRequest()
|
* @see GHMarketplaceListAccountBuilder#createRequest()
|
||||||
*/
|
*/
|
||||||
public class GHMarketplaceAccount {
|
public class GHMarketplaceAccount extends GitHubInteractiveObject {
|
||||||
|
|
||||||
protected GitHub root;
|
|
||||||
private String url;
|
private String url;
|
||||||
private long id;
|
private long id;
|
||||||
private String login;
|
private String login;
|
||||||
|
|||||||
@@ -8,8 +8,7 @@ import java.io.IOException;
|
|||||||
* @author Paulo Miguel Almeida
|
* @author Paulo Miguel Almeida
|
||||||
* @see GHMarketplacePlan#listAccounts()
|
* @see GHMarketplacePlan#listAccounts()
|
||||||
*/
|
*/
|
||||||
public class GHMarketplaceListAccountBuilder {
|
public class GHMarketplaceListAccountBuilder extends GitHubInteractiveObject {
|
||||||
private final GitHub root;
|
|
||||||
private final Requester builder;
|
private final Requester builder;
|
||||||
private final long planId;
|
private final long planId;
|
||||||
|
|
||||||
|
|||||||
@@ -10,8 +10,7 @@ import java.util.Date;
|
|||||||
* @author Paulo Miguel Almeida
|
* @author Paulo Miguel Almeida
|
||||||
* @see GHMarketplaceListAccountBuilder#createRequest()
|
* @see GHMarketplaceListAccountBuilder#createRequest()
|
||||||
*/
|
*/
|
||||||
public class GHMarketplacePendingChange {
|
public class GHMarketplacePendingChange extends GitHubInteractiveObject {
|
||||||
private GitHub root;
|
|
||||||
private long id;
|
private long id;
|
||||||
@SuppressFBWarnings(value = "UWF_UNWRITTEN_FIELD", justification = "Field comes from JSON deserialization")
|
@SuppressFBWarnings(value = "UWF_UNWRITTEN_FIELD", justification = "Field comes from JSON deserialization")
|
||||||
private Long unitCount;
|
private Long unitCount;
|
||||||
|
|||||||
@@ -11,9 +11,7 @@ import java.util.List;
|
|||||||
* @author Paulo Miguel Almeida
|
* @author Paulo Miguel Almeida
|
||||||
* @see GitHub#listMarketplacePlans()
|
* @see GitHub#listMarketplacePlans()
|
||||||
*/
|
*/
|
||||||
public class GHMarketplacePlan {
|
public class GHMarketplacePlan extends GitHubInteractiveObject {
|
||||||
|
|
||||||
private GitHub root;
|
|
||||||
private String url;
|
private String url;
|
||||||
private String accountsUrl;
|
private String accountsUrl;
|
||||||
private long id;
|
private long id;
|
||||||
|
|||||||
@@ -10,9 +10,8 @@ import java.util.Date;
|
|||||||
* @author Paulo Miguel Almeida
|
* @author Paulo Miguel Almeida
|
||||||
* @see GHMarketplaceListAccountBuilder#createRequest() GHMarketplaceListAccountBuilder#createRequest()
|
* @see GHMarketplaceListAccountBuilder#createRequest() GHMarketplaceListAccountBuilder#createRequest()
|
||||||
*/
|
*/
|
||||||
public class GHMarketplacePurchase {
|
public class GHMarketplacePurchase extends GitHubInteractiveObject {
|
||||||
|
|
||||||
private GitHub root;
|
|
||||||
private String billingCycle;
|
private String billingCycle;
|
||||||
private String nextBillingDate;
|
private String nextBillingDate;
|
||||||
private boolean onFreeTrial;
|
private boolean onFreeTrial;
|
||||||
|
|||||||
@@ -10,8 +10,7 @@ import java.util.Date;
|
|||||||
* @author Paulo Miguel Almeida
|
* @author Paulo Miguel Almeida
|
||||||
* @see GitHub#getMyMarketplacePurchases()
|
* @see GitHub#getMyMarketplacePurchases()
|
||||||
*/
|
*/
|
||||||
public class GHMarketplaceUserPurchase {
|
public class GHMarketplaceUserPurchase extends GitHubInteractiveObject {
|
||||||
protected GitHub root;
|
|
||||||
private String billingCycle;
|
private String billingCycle;
|
||||||
private String nextBillingDate;
|
private String nextBillingDate;
|
||||||
private boolean onFreeTrial;
|
private boolean onFreeTrial;
|
||||||
|
|||||||
@@ -10,9 +10,7 @@ import java.util.Locale;
|
|||||||
* @author Kohsuke Kawaguchi
|
* @author Kohsuke Kawaguchi
|
||||||
* @see GHMyself#listOrgMemberships() GHMyself#listOrgMemberships()
|
* @see GHMyself#listOrgMemberships() GHMyself#listOrgMemberships()
|
||||||
*/
|
*/
|
||||||
public class GHMembership /* extends GHObject --- but it doesn't have id, created_at, etc. */ {
|
public class GHMembership extends GitHubInteractiveObject {
|
||||||
GitHub root;
|
|
||||||
|
|
||||||
String url;
|
String url;
|
||||||
String state;
|
String state;
|
||||||
String role;
|
String role;
|
||||||
|
|||||||
@@ -23,6 +23,9 @@ public class GHMeta {
|
|||||||
private List<String> api;
|
private List<String> api;
|
||||||
private List<String> pages;
|
private List<String> pages;
|
||||||
private List<String> importer = new ArrayList<>();
|
private List<String> importer = new ArrayList<>();
|
||||||
|
private List<String> packages;
|
||||||
|
private List<String> actions;
|
||||||
|
private List<String> dependabot;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Is verifiable password authentication boolean.
|
* Is verifiable password authentication boolean.
|
||||||
@@ -86,4 +89,31 @@ public class GHMeta {
|
|||||||
public List<String> getImporter() {
|
public List<String> getImporter() {
|
||||||
return Collections.unmodifiableList(importer);
|
return Collections.unmodifiableList(importer);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets package.
|
||||||
|
*
|
||||||
|
* @return the package
|
||||||
|
*/
|
||||||
|
public List<String> getPackages() {
|
||||||
|
return Collections.unmodifiableList(packages);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets actions.
|
||||||
|
*
|
||||||
|
* @return the actions
|
||||||
|
*/
|
||||||
|
public List<String> getActions() {
|
||||||
|
return Collections.unmodifiableList(actions);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets dependabot.
|
||||||
|
*
|
||||||
|
* @return the dependabot
|
||||||
|
*/
|
||||||
|
public List<String> getDependabot() {
|
||||||
|
return Collections.unmodifiableList(dependabot);
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -11,7 +11,6 @@ import java.util.Locale;
|
|||||||
* @author Yusuke Kokubo
|
* @author Yusuke Kokubo
|
||||||
*/
|
*/
|
||||||
public class GHMilestone extends GHObject {
|
public class GHMilestone extends GHObject {
|
||||||
GitHub root;
|
|
||||||
GHRepository owner;
|
GHRepository owner;
|
||||||
|
|
||||||
GHUser creator;
|
GHUser creator;
|
||||||
|
|||||||
@@ -7,4 +7,4 @@ package org.kohsuke.github;
|
|||||||
*/
|
*/
|
||||||
public enum GHMilestoneState {
|
public enum GHMilestoneState {
|
||||||
OPEN, CLOSED
|
OPEN, CLOSED
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -23,9 +23,7 @@ import java.util.NoSuchElementException;
|
|||||||
* @see GitHub#listNotifications() GitHub#listNotifications()
|
* @see GitHub#listNotifications() GitHub#listNotifications()
|
||||||
* @see GHRepository#listNotifications() GHRepository#listNotifications()
|
* @see GHRepository#listNotifications() GHRepository#listNotifications()
|
||||||
*/
|
*/
|
||||||
public class GHNotificationStream implements Iterable<GHThread> {
|
public class GHNotificationStream extends GitHubInteractiveObject implements Iterable<GHThread> {
|
||||||
private final GitHub root;
|
|
||||||
|
|
||||||
private Boolean all, participating;
|
private Boolean all, participating;
|
||||||
private String since;
|
private String since;
|
||||||
private String apiUrl;
|
private String apiUrl;
|
||||||
|
|||||||
@@ -20,7 +20,7 @@ import javax.annotation.CheckForNull;
|
|||||||
*/
|
*/
|
||||||
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public abstract class GHObject {
|
public abstract class GHObject extends GitHubInteractiveObject {
|
||||||
/**
|
/**
|
||||||
* Capture response HTTP headers on the state object.
|
* Capture response HTTP headers on the state object.
|
||||||
*/
|
*/
|
||||||
@@ -38,7 +38,7 @@ public abstract class GHObject {
|
|||||||
|
|
||||||
/**
|
/**
|
||||||
* Called by Jackson
|
* Called by Jackson
|
||||||
*
|
*
|
||||||
* @param responseInfo
|
* @param responseInfo
|
||||||
* the {@link GitHubResponse.ResponseInfo} to get headers from.
|
* the {@link GitHubResponse.ResponseInfo} to get headers from.
|
||||||
*/
|
*/
|
||||||
|
|||||||
@@ -10,7 +10,7 @@ import java.util.List;
|
|||||||
import java.util.Map;
|
import java.util.Map;
|
||||||
import java.util.TreeMap;
|
import java.util.TreeMap;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.INERTIA;
|
import static org.kohsuke.github.internal.Previews.INERTIA;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The type GHOrganization.
|
* The type GHOrganization.
|
||||||
@@ -18,6 +18,9 @@ import static org.kohsuke.github.Previews.INERTIA;
|
|||||||
* @author Kohsuke Kawaguchi
|
* @author Kohsuke Kawaguchi
|
||||||
*/
|
*/
|
||||||
public class GHOrganization extends GHPerson {
|
public class GHOrganization extends GHPerson {
|
||||||
|
|
||||||
|
private boolean has_organization_projects;
|
||||||
|
|
||||||
GHOrganization wrapUp(GitHub root) {
|
GHOrganization wrapUp(GitHub root) {
|
||||||
return (GHOrganization) super.wrapUp(root);
|
return (GHOrganization) super.wrapUp(root);
|
||||||
}
|
}
|
||||||
@@ -97,7 +100,7 @@ public class GHOrganization extends GHPerson {
|
|||||||
* @return the gh create repository builder
|
* @return the gh create repository builder
|
||||||
*/
|
*/
|
||||||
public GHCreateRepositoryBuilder createRepository(String name) {
|
public GHCreateRepositoryBuilder createRepository(String name) {
|
||||||
return new GHCreateRepositoryBuilder(root, "/orgs/" + login + "/repos", name);
|
return new GHCreateRepositoryBuilder(name, root, "/orgs/" + login + "/repos");
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -181,7 +184,7 @@ public class GHOrganization extends GHPerson {
|
|||||||
|
|
||||||
/**
|
/**
|
||||||
* Finds a team that has the given slug in its {@link GHTeam#getSlug()}
|
* Finds a team that has the given slug in its {@link GHTeam#getSlug()}
|
||||||
*
|
*
|
||||||
* @param slug
|
* @param slug
|
||||||
* the slug
|
* the slug
|
||||||
* @return the team by slug
|
* @return the team by slug
|
||||||
@@ -367,6 +370,35 @@ public class GHOrganization extends GHPerson {
|
|||||||
root.createRequest().method("DELETE").withUrlPath("/orgs/" + login + "/public_members/" + u.getLogin()).send();
|
root.createRequest().method("DELETE").withUrlPath("/orgs/" + login + "/public_members/" + u.getLogin()).send();
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Are projects enabled for organization boolean.
|
||||||
|
*
|
||||||
|
* @return the boolean
|
||||||
|
*/
|
||||||
|
public boolean areOrganizationProjectsEnabled() {
|
||||||
|
return has_organization_projects;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Sets organization projects enabled status boolean
|
||||||
|
*
|
||||||
|
* @param newStatus
|
||||||
|
* enable status
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public void enableOrganizationProjects(boolean newStatus) throws IOException {
|
||||||
|
edit("has_organization_projects", newStatus);
|
||||||
|
}
|
||||||
|
|
||||||
|
private void edit(String key, Object value) throws IOException {
|
||||||
|
root.createRequest()
|
||||||
|
.withUrlPath(String.format("/orgs/%s", login))
|
||||||
|
.method("PATCH")
|
||||||
|
.with(key, value)
|
||||||
|
.fetchInto(this);
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Returns the projects for this organization.
|
* Returns the projects for this organization.
|
||||||
*
|
*
|
||||||
|
|||||||
@@ -28,7 +28,7 @@ import java.util.Locale;
|
|||||||
|
|
||||||
/**
|
/**
|
||||||
* Permission for a user in a repository.
|
* Permission for a user in a repository.
|
||||||
*
|
*
|
||||||
* @see <a href="https://developer.github.com/v3/repos/collaborators/#review-a-users-permission-level">API</a>
|
* @see <a href="https://developer.github.com/v3/repos/collaborators/#review-a-users-permission-level">API</a>
|
||||||
*/
|
*/
|
||||||
class GHPermission {
|
class GHPermission {
|
||||||
|
|||||||
@@ -18,7 +18,6 @@ import java.util.TreeMap;
|
|||||||
* @author Kohsuke Kawaguchi
|
* @author Kohsuke Kawaguchi
|
||||||
*/
|
*/
|
||||||
public abstract class GHPerson extends GHObject {
|
public abstract class GHPerson extends GHObject {
|
||||||
/* package almost final */ GitHub root;
|
|
||||||
|
|
||||||
// core data fields that exist even for "small" user data (such as the user info in pull request)
|
// core data fields that exist even for "small" user data (such as the user info in pull request)
|
||||||
protected String login, avatar_url;
|
protected String login, avatar_url;
|
||||||
@@ -236,7 +235,7 @@ public abstract class GHPerson extends GHObject {
|
|||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets the Twitter Username of this user, like "GitHub"
|
* Gets the Twitter Username of this user, like "GitHub"
|
||||||
*
|
*
|
||||||
* @return the Twitter username
|
* @return the Twitter username
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
|
|||||||
@@ -28,7 +28,7 @@ import java.io.IOException;
|
|||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
import java.util.Locale;
|
import java.util.Locale;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.INERTIA;
|
import static org.kohsuke.github.internal.Previews.INERTIA;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* A GitHub project.
|
* A GitHub project.
|
||||||
@@ -37,7 +37,6 @@ import static org.kohsuke.github.Previews.INERTIA;
|
|||||||
* @see <a href="https://developer.github.com/v3/projects/">Projects</a>
|
* @see <a href="https://developer.github.com/v3/projects/">Projects</a>
|
||||||
*/
|
*/
|
||||||
public class GHProject extends GHObject {
|
public class GHProject extends GHObject {
|
||||||
protected GitHub root;
|
|
||||||
protected GHObject owner;
|
protected GHObject owner;
|
||||||
|
|
||||||
private String owner_url;
|
private String owner_url;
|
||||||
@@ -311,4 +310,4 @@ public class GHProject extends GHObject {
|
|||||||
.fetch(GHProjectColumn.class)
|
.fetch(GHProjectColumn.class)
|
||||||
.wrap(this);
|
.wrap(this);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -6,7 +6,7 @@ import java.io.FileNotFoundException;
|
|||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.INERTIA;
|
import static org.kohsuke.github.internal.Previews.INERTIA;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The type GHProjectCard.
|
* The type GHProjectCard.
|
||||||
@@ -14,7 +14,6 @@ import static org.kohsuke.github.Previews.INERTIA;
|
|||||||
* @author Gunnar Skjold
|
* @author Gunnar Skjold
|
||||||
*/
|
*/
|
||||||
public class GHProjectCard extends GHObject {
|
public class GHProjectCard extends GHObject {
|
||||||
private GitHub root;
|
|
||||||
private GHProject project;
|
private GHProject project;
|
||||||
private GHProjectColumn column;
|
private GHProjectColumn column;
|
||||||
|
|
||||||
|
|||||||
@@ -4,7 +4,7 @@ import java.io.FileNotFoundException;
|
|||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.INERTIA;
|
import static org.kohsuke.github.internal.Previews.INERTIA;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The type GHProjectColumn.
|
* The type GHProjectColumn.
|
||||||
@@ -12,7 +12,6 @@ import static org.kohsuke.github.Previews.INERTIA;
|
|||||||
* @author Gunnar Skjold
|
* @author Gunnar Skjold
|
||||||
*/
|
*/
|
||||||
public class GHProjectColumn extends GHObject {
|
public class GHProjectColumn extends GHObject {
|
||||||
protected GitHub root;
|
|
||||||
protected GHProject project;
|
protected GHProject project;
|
||||||
|
|
||||||
private String name;
|
private String name;
|
||||||
|
|||||||
@@ -36,8 +36,8 @@ import java.util.Objects;
|
|||||||
|
|
||||||
import javax.annotation.CheckForNull;
|
import javax.annotation.CheckForNull;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.LYDIAN;
|
import static org.kohsuke.github.internal.Previews.LYDIAN;
|
||||||
import static org.kohsuke.github.Previews.SHADOW_CAT;
|
import static org.kohsuke.github.internal.Previews.SHADOW_CAT;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* A pull request.
|
* A pull request.
|
||||||
@@ -576,7 +576,7 @@ public class GHPullRequest extends GHIssue implements Refreshable {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(LYDIAN)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public void updateBranch() throws IOException {
|
public void updateBranch() throws IOException {
|
||||||
root.createRequest()
|
root.createRequest()
|
||||||
|
|||||||
@@ -1,6 +1,6 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.SHADOW_CAT;
|
import static org.kohsuke.github.internal.Previews.SHADOW_CAT;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Lists up pull requests with some filtering and sorting.
|
* Lists up pull requests with some filtering and sorting.
|
||||||
|
|||||||
@@ -28,7 +28,7 @@ import java.net.URL;
|
|||||||
|
|
||||||
import javax.annotation.CheckForNull;
|
import javax.annotation.CheckForNull;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.*;
|
import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Review comment to the pull request
|
* Review comment to the pull request
|
||||||
@@ -153,7 +153,20 @@ public class GHPullRequestReviewComment extends GHObject implements Reactable {
|
|||||||
* @return the api route
|
* @return the api route
|
||||||
*/
|
*/
|
||||||
protected String getApiRoute() {
|
protected String getApiRoute() {
|
||||||
return "/repos/" + owner.getRepository().getFullName() + "/pulls/comments/" + getId();
|
return getApiRoute(false);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets api route.
|
||||||
|
*
|
||||||
|
* @param includePullNumber
|
||||||
|
* if true, includes the owning pull request's number in the route.
|
||||||
|
*
|
||||||
|
* @return the api route
|
||||||
|
*/
|
||||||
|
protected String getApiRoute(boolean includePullNumber) {
|
||||||
|
return "/repos/" + owner.getRepository().getFullName() + "/pulls"
|
||||||
|
+ (includePullNumber ? "/" + owner.getNumber() : "") + "/comments/" + getId();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -192,13 +205,12 @@ public class GHPullRequestReviewComment extends GHObject implements Reactable {
|
|||||||
return owner.root.createRequest()
|
return owner.root.createRequest()
|
||||||
.method("POST")
|
.method("POST")
|
||||||
.with("body", body)
|
.with("body", body)
|
||||||
.with("in_reply_to", getId())
|
.withUrlPath(getApiRoute(true) + "/replies")
|
||||||
.withUrlPath(getApiRoute() + "/comments")
|
|
||||||
.fetch(GHPullRequestReviewComment.class)
|
.fetch(GHPullRequestReviewComment.class)
|
||||||
.wrapUp(owner);
|
.wrapUp(owner);
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHReaction createReaction(ReactionContent content) throws IOException {
|
public GHReaction createReaction(ReactionContent content) throws IOException {
|
||||||
return owner.root.createRequest()
|
return owner.root.createRequest()
|
||||||
@@ -210,7 +222,7 @@ public class GHPullRequestReviewComment extends GHObject implements Reactable {
|
|||||||
.wrap(owner.root);
|
.wrap(owner.root);
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public PagedIterable<GHReaction> listReactions() {
|
public PagedIterable<GHReaction> listReactions() {
|
||||||
return owner.root.createRequest()
|
return owner.root.createRequest()
|
||||||
|
|||||||
@@ -7,8 +7,7 @@ package org.kohsuke.github;
|
|||||||
* the type parameter
|
* the type parameter
|
||||||
* @author Kohsuke Kawaguchi
|
* @author Kohsuke Kawaguchi
|
||||||
*/
|
*/
|
||||||
public abstract class GHQueryBuilder<T> {
|
public abstract class GHQueryBuilder<T> extends GitHubInteractiveObject {
|
||||||
protected final GitHub root;
|
|
||||||
protected final Requester req;
|
protected final Requester req;
|
||||||
|
|
||||||
GHQueryBuilder(GitHub root) {
|
GHQueryBuilder(GitHub root) {
|
||||||
|
|||||||
@@ -12,6 +12,7 @@ import java.time.format.DateTimeFormatter;
|
|||||||
import java.time.format.DateTimeParseException;
|
import java.time.format.DateTimeParseException;
|
||||||
import java.util.Date;
|
import java.util.Date;
|
||||||
import java.util.Objects;
|
import java.util.Objects;
|
||||||
|
import java.util.concurrent.atomic.AtomicReference;
|
||||||
import java.util.logging.Logger;
|
import java.util.logging.Logger;
|
||||||
|
|
||||||
import javax.annotation.CheckForNull;
|
import javax.annotation.CheckForNull;
|
||||||
@@ -266,7 +267,7 @@ public class GHRateLimit {
|
|||||||
/**
|
/**
|
||||||
* Merge a {@link GHRateLimit} with another one to create a new {@link GHRateLimit} keeping the latest
|
* Merge a {@link GHRateLimit} with another one to create a new {@link GHRateLimit} keeping the latest
|
||||||
* {@link Record}s from each.
|
* {@link Record}s from each.
|
||||||
*
|
*
|
||||||
* @param newLimit
|
* @param newLimit
|
||||||
* {@link GHRateLimit} with potentially updated {@link Record}s.
|
* {@link GHRateLimit} with potentially updated {@link Record}s.
|
||||||
* @return a merged {@link GHRateLimit} with the latest {@link Record}s from these two instances. If the merged
|
* @return a merged {@link GHRateLimit} with the latest {@link Record}s from these two instances. If the merged
|
||||||
@@ -344,7 +345,7 @@ public class GHRateLimit {
|
|||||||
private static final UnknownLimitRecord DEFAULT = new UnknownLimitRecord(Long.MIN_VALUE);
|
private static final UnknownLimitRecord DEFAULT = new UnknownLimitRecord(Long.MIN_VALUE);
|
||||||
|
|
||||||
// The starting current UnknownLimitRecord is an expired record.
|
// The starting current UnknownLimitRecord is an expired record.
|
||||||
private static UnknownLimitRecord current = DEFAULT;
|
private static final AtomicReference<UnknownLimitRecord> current = new AtomicReference<>(DEFAULT);
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Create a new unknown record that resets at the specified time.
|
* Create a new unknown record that resets at the specified time.
|
||||||
@@ -356,18 +357,20 @@ public class GHRateLimit {
|
|||||||
super(unknownLimit, unknownRemaining, resetEpochSeconds);
|
super(unknownLimit, unknownRemaining, resetEpochSeconds);
|
||||||
}
|
}
|
||||||
|
|
||||||
static synchronized Record current() {
|
static Record current() {
|
||||||
if (current.isExpired()) {
|
Record result = current.get();
|
||||||
current = new UnknownLimitRecord(System.currentTimeMillis() / 1000L + unknownLimitResetSeconds);
|
if (result.isExpired()) {
|
||||||
|
current.set(new UnknownLimitRecord(System.currentTimeMillis() / 1000L + unknownLimitResetSeconds));
|
||||||
|
result = current.get();
|
||||||
}
|
}
|
||||||
return current;
|
return result;
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Reset the current UnknownLimitRecord. For use during testing only.
|
* Reset the current UnknownLimitRecord. For use during testing only.
|
||||||
*/
|
*/
|
||||||
static synchronized void reset() {
|
static void reset() {
|
||||||
current = DEFAULT;
|
current.set(DEFAULT);
|
||||||
unknownLimitResetSeconds = defaultUnknownLimitResetSeconds;
|
unknownLimitResetSeconds = defaultUnknownLimitResetSeconds;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -458,7 +461,7 @@ public class GHRateLimit {
|
|||||||
* {@link Record}s with earlier {@link #getResetEpochSeconds()} are replaced by those with later.
|
* {@link Record}s with earlier {@link #getResetEpochSeconds()} are replaced by those with later.
|
||||||
* {@link Record}s with the same {@link #getResetEpochSeconds()} are replaced by those with less remaining
|
* {@link Record}s with the same {@link #getResetEpochSeconds()} are replaced by those with less remaining
|
||||||
* count.
|
* count.
|
||||||
*
|
*
|
||||||
* {@link UnknownLimitRecord}s compare with each other like regular {@link Record}s.
|
* {@link UnknownLimitRecord}s compare with each other like regular {@link Record}s.
|
||||||
*
|
*
|
||||||
* {@link Record}s are replaced by {@link UnknownLimitRecord}s only when the current {@link Record} is expired
|
* {@link Record}s are replaced by {@link UnknownLimitRecord}s only when the current {@link Record} is expired
|
||||||
|
|||||||
@@ -3,7 +3,7 @@ package org.kohsuke.github;
|
|||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.*;
|
import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Reaction to issue, comment, PR, and so on.
|
* Reaction to issue, comment, PR, and so on.
|
||||||
@@ -11,10 +11,9 @@ import static org.kohsuke.github.Previews.*;
|
|||||||
* @author Kohsuke Kawaguchi
|
* @author Kohsuke Kawaguchi
|
||||||
* @see Reactable
|
* @see Reactable
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public class GHReaction extends GHObject {
|
public class GHReaction extends GHObject {
|
||||||
private GitHub root;
|
|
||||||
|
|
||||||
private GHUser user;
|
private GHUser user;
|
||||||
private ReactionContent content;
|
private ReactionContent content;
|
||||||
|
|||||||
@@ -11,9 +11,7 @@ import java.net.URL;
|
|||||||
*
|
*
|
||||||
* @author Michael Clarke
|
* @author Michael Clarke
|
||||||
*/
|
*/
|
||||||
public class GHRef {
|
public class GHRef extends GitHubInteractiveObject {
|
||||||
/* package almost final */ GitHub root;
|
|
||||||
|
|
||||||
private String ref, url;
|
private String ref, url;
|
||||||
private GHObject object;
|
private GHObject object;
|
||||||
|
|
||||||
|
|||||||
@@ -19,7 +19,6 @@ import static java.lang.String.*;
|
|||||||
* @see GHRepository#createRelease(String) GHRepository#createRelease(String)
|
* @see GHRepository#createRelease(String) GHRepository#createRelease(String)
|
||||||
*/
|
*/
|
||||||
public class GHRelease extends GHObject {
|
public class GHRelease extends GHObject {
|
||||||
GitHub root;
|
|
||||||
GHRepository owner;
|
GHRepository owner;
|
||||||
|
|
||||||
private String html_url;
|
private String html_url;
|
||||||
@@ -260,7 +259,6 @@ public class GHRelease extends GHObject {
|
|||||||
* existing logic in place for backwards compatibility.
|
* existing logic in place for backwards compatibility.
|
||||||
*/
|
*/
|
||||||
@Deprecated
|
@Deprecated
|
||||||
@Preview
|
|
||||||
public List<GHAsset> assets() {
|
public List<GHAsset> assets() {
|
||||||
return assets;
|
return assets;
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -41,7 +41,7 @@ public class GHReleaseBuilder {
|
|||||||
* Specifies the commitish value that determines where the Git tag is created from. Can be any branch or commit SHA.
|
* Specifies the commitish value that determines where the Git tag is created from. Can be any branch or commit SHA.
|
||||||
*
|
*
|
||||||
* @param commitish
|
* @param commitish
|
||||||
* Defaults to the repository’s default branch (usually "master"). Unused if the Git tag already exists.
|
* Defaults to the repository’s default branch (usually "main"). Unused if the Git tag already exists.
|
||||||
* @return the gh release builder
|
* @return the gh release builder
|
||||||
*/
|
*/
|
||||||
public GHReleaseBuilder commitish(String commitish) {
|
public GHReleaseBuilder commitish(String commitish) {
|
||||||
|
|||||||
@@ -45,7 +45,7 @@ public class GHReleaseUpdater {
|
|||||||
* Specifies the commitish value that determines where the Git tag is created from. Can be any branch or commit SHA.
|
* Specifies the commitish value that determines where the Git tag is created from. Can be any branch or commit SHA.
|
||||||
*
|
*
|
||||||
* @param commitish
|
* @param commitish
|
||||||
* Defaults to the repository’s default branch (usually "master"). Unused if the Git tag already exists.
|
* Defaults to the repository’s default branch (usually "main"). Unused if the Git tag already exists.
|
||||||
* @return the gh release updater
|
* @return the gh release updater
|
||||||
*/
|
*/
|
||||||
public GHReleaseUpdater commitish(String commitish) {
|
public GHReleaseUpdater commitish(String commitish) {
|
||||||
|
|||||||
@@ -30,6 +30,8 @@ import edu.umd.cs.findbugs.annotations.CheckForNull;
|
|||||||
import edu.umd.cs.findbugs.annotations.NonNull;
|
import edu.umd.cs.findbugs.annotations.NonNull;
|
||||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
import org.apache.commons.lang3.StringUtils;
|
import org.apache.commons.lang3.StringUtils;
|
||||||
|
import org.kohsuke.github.function.InputStreamFunction;
|
||||||
|
import org.kohsuke.github.internal.EnumUtils;
|
||||||
|
|
||||||
import java.io.FileNotFoundException;
|
import java.io.FileNotFoundException;
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
@@ -48,14 +50,24 @@ import java.util.HashSet;
|
|||||||
import java.util.Iterator;
|
import java.util.Iterator;
|
||||||
import java.util.LinkedHashSet;
|
import java.util.LinkedHashSet;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
|
import java.util.Locale;
|
||||||
import java.util.Map;
|
import java.util.Map;
|
||||||
import java.util.Objects;
|
|
||||||
import java.util.Set;
|
import java.util.Set;
|
||||||
import java.util.TreeMap;
|
import java.util.TreeMap;
|
||||||
import java.util.WeakHashMap;
|
import java.util.WeakHashMap;
|
||||||
|
|
||||||
import static java.util.Arrays.*;
|
import javax.annotation.Nonnull;
|
||||||
import static org.kohsuke.github.Previews.*;
|
|
||||||
|
import static java.util.Arrays.asList;
|
||||||
|
import static java.util.Objects.requireNonNull;
|
||||||
|
import static org.kohsuke.github.internal.Previews.ANTIOPE;
|
||||||
|
import static org.kohsuke.github.internal.Previews.ANT_MAN;
|
||||||
|
import static org.kohsuke.github.internal.Previews.BAPTISTE;
|
||||||
|
import static org.kohsuke.github.internal.Previews.FLASH;
|
||||||
|
import static org.kohsuke.github.internal.Previews.INERTIA;
|
||||||
|
import static org.kohsuke.github.internal.Previews.MERCY;
|
||||||
|
import static org.kohsuke.github.internal.Previews.NEBULA;
|
||||||
|
import static org.kohsuke.github.internal.Previews.SHADOW_CAT;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* A repository on GitHub.
|
* A repository on GitHub.
|
||||||
@@ -66,7 +78,6 @@ import static org.kohsuke.github.Previews.*;
|
|||||||
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public class GHRepository extends GHObject {
|
public class GHRepository extends GHObject {
|
||||||
/* package almost final */ transient GitHub root;
|
|
||||||
|
|
||||||
private String nodeId, description, homepage, name, full_name;
|
private String nodeId, description, homepage, name, full_name;
|
||||||
|
|
||||||
@@ -96,6 +107,8 @@ public class GHRepository extends GHObject {
|
|||||||
@JsonProperty("private")
|
@JsonProperty("private")
|
||||||
private boolean _private;
|
private boolean _private;
|
||||||
|
|
||||||
|
private String visibility;
|
||||||
|
|
||||||
private int forks_count, stargazers_count, watchers_count, size, open_issues_count, subscribers_count;
|
private int forks_count, stargazers_count, watchers_count, size, open_issues_count, subscribers_count;
|
||||||
|
|
||||||
private String pushed_at;
|
private String pushed_at;
|
||||||
@@ -163,6 +176,8 @@ public class GHRepository extends GHObject {
|
|||||||
.with("task", task)
|
.with("task", task)
|
||||||
.with("environment", environment)
|
.with("environment", environment)
|
||||||
.withUrlPath(getApiTailUrl("deployments"))
|
.withUrlPath(getApiTailUrl("deployments"))
|
||||||
|
.withPreview(ANT_MAN)
|
||||||
|
.withPreview(FLASH)
|
||||||
.toIterable(GHDeployment[].class, item -> item.wrap(this));
|
.toIterable(GHDeployment[].class, item -> item.wrap(this));
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -178,6 +193,8 @@ public class GHRepository extends GHObject {
|
|||||||
public GHDeployment getDeployment(long id) throws IOException {
|
public GHDeployment getDeployment(long id) throws IOException {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
.withUrlPath(getApiTailUrl("deployments/" + id))
|
.withUrlPath(getApiTailUrl("deployments/" + id))
|
||||||
|
.withPreview(ANT_MAN)
|
||||||
|
.withPreview(FLASH)
|
||||||
.fetch(GHDeployment.class)
|
.fetch(GHDeployment.class)
|
||||||
.wrap(this);
|
.wrap(this);
|
||||||
}
|
}
|
||||||
@@ -444,7 +461,7 @@ public class GHRepository extends GHObject {
|
|||||||
* Creates a named ref, such as tag, branch, etc.
|
* Creates a named ref, such as tag, branch, etc.
|
||||||
*
|
*
|
||||||
* @param name
|
* @param name
|
||||||
* The name of the fully qualified reference (ie: refs/heads/master). If it doesn't start with 'refs' and
|
* The name of the fully qualified reference (ie: refs/heads/main). If it doesn't start with 'refs' and
|
||||||
* have at least two slashes, it will be rejected.
|
* have at least two slashes, it will be rejected.
|
||||||
* @param sha
|
* @param sha
|
||||||
* The SHA1 value to set this reference to
|
* The SHA1 value to set this reference to
|
||||||
@@ -561,7 +578,15 @@ public class GHRepository extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public Map<String, Long> listLanguages() throws IOException {
|
public Map<String, Long> listLanguages() throws IOException {
|
||||||
return root.createRequest().withUrlPath(getApiTailUrl("languages")).fetch(HashMap.class);
|
HashMap<String, Long> result = new HashMap<>();
|
||||||
|
root.createRequest().withUrlPath(getApiTailUrl("languages")).fetch(HashMap.class).forEach((key, value) -> {
|
||||||
|
Long addValue = -1L;
|
||||||
|
if (value instanceof Integer) {
|
||||||
|
addValue = Long.valueOf((Integer) value);
|
||||||
|
}
|
||||||
|
result.put(key.toString(), addValue);
|
||||||
|
});
|
||||||
|
return result;
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -698,13 +723,48 @@ public class GHRepository extends GHObject {
|
|||||||
return _private;
|
return _private;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Visibility of a repository.
|
||||||
|
*/
|
||||||
|
public enum Visibility {
|
||||||
|
PUBLIC, INTERNAL, PRIVATE, UNKNOWN;
|
||||||
|
|
||||||
|
public static Visibility from(String value) {
|
||||||
|
return EnumUtils.getNullableEnumOrDefault(Visibility.class, value, Visibility.UNKNOWN);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String toString() {
|
||||||
|
return name().toLowerCase(Locale.ROOT);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the visibility of the repository.
|
||||||
|
*
|
||||||
|
* @return the visibility
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(NEBULA)
|
||||||
|
public Visibility getVisibility() {
|
||||||
|
if (visibility == null) {
|
||||||
|
try {
|
||||||
|
populate();
|
||||||
|
} catch (final IOException e) {
|
||||||
|
// Convert this to a runtime exception to avoid messy method signature
|
||||||
|
throw new GHException("Could not populate the visibility of the repository", e);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return Visibility.from(visibility);
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Is template boolean.
|
* Is template boolean.
|
||||||
*
|
*
|
||||||
* @return the boolean
|
* @return the boolean
|
||||||
*/
|
*/
|
||||||
@Deprecated
|
@Deprecated
|
||||||
@Preview
|
@Preview(BAPTISTE)
|
||||||
public boolean isTemplate() {
|
public boolean isTemplate() {
|
||||||
// isTemplate is still in preview, we do not want to retrieve it unless needed.
|
// isTemplate is still in preview, we do not want to retrieve it unless needed.
|
||||||
if (isTemplate == null) {
|
if (isTemplate == null) {
|
||||||
@@ -788,16 +848,18 @@ public class GHRepository extends GHObject {
|
|||||||
/**
|
/**
|
||||||
* Returns the primary branch you'll configure in the "Admin > Options" config page.
|
* Returns the primary branch you'll configure in the "Admin > Options" config page.
|
||||||
*
|
*
|
||||||
* @return This field is null until the user explicitly configures the master branch.
|
* @return This field is null until the user explicitly configures the default branch.
|
||||||
*/
|
*/
|
||||||
public String getDefaultBranch() {
|
public String getDefaultBranch() {
|
||||||
return default_branch;
|
return default_branch;
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets master branch.
|
* Gets default branch.
|
||||||
*
|
*
|
||||||
* @return the master branch
|
* Name is an artifact of when "master" was the most common default.
|
||||||
|
*
|
||||||
|
* @return the default branch
|
||||||
* @deprecated Renamed to {@link #getDefaultBranch()}
|
* @deprecated Renamed to {@link #getDefaultBranch()}
|
||||||
*/
|
*/
|
||||||
@Deprecated
|
@Deprecated
|
||||||
@@ -814,6 +876,13 @@ public class GHRepository extends GHObject {
|
|||||||
return size;
|
return size;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Affiliation of a repository collaborator
|
||||||
|
*/
|
||||||
|
public enum CollaboratorAffiliation {
|
||||||
|
ALL, DIRECT, OUTSIDE
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets the collaborators on this repository. This set always appear to include the owner.
|
* Gets the collaborators on this repository. This set always appear to include the owner.
|
||||||
*
|
*
|
||||||
@@ -837,6 +906,19 @@ public class GHRepository extends GHObject {
|
|||||||
return listUsers("collaborators");
|
return listUsers("collaborators");
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Lists up the collaborators on this repository.
|
||||||
|
*
|
||||||
|
* @param affiliation
|
||||||
|
* Filter users by affiliation
|
||||||
|
* @return Users paged iterable
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public PagedIterable<GHUser> listCollaborators(CollaboratorAffiliation affiliation) throws IOException {
|
||||||
|
return listUsers(root.createRequest().with("affiliation", affiliation), "collaborators");
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Lists all
|
* Lists all
|
||||||
* <a href="https://help.github.com/articles/assigning-issues-and-pull-requests-to-other-github-users/">the
|
* <a href="https://help.github.com/articles/assigning-issues-and-pull-requests-to-other-github-users/">the
|
||||||
@@ -884,6 +966,29 @@ public class GHRepository extends GHObject {
|
|||||||
return r;
|
return r;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the names of the collaborators on this repository. This method deviates from the principle of this library
|
||||||
|
* but it works a lot faster than {@link #getCollaborators()}.
|
||||||
|
*
|
||||||
|
* @param affiliation
|
||||||
|
* Filter users by affiliation
|
||||||
|
* @return the collaborator names
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public Set<String> getCollaboratorNames(CollaboratorAffiliation affiliation) throws IOException {
|
||||||
|
Set<String> r = new HashSet<>();
|
||||||
|
// no initializer - we just want to the logins
|
||||||
|
PagedIterable<GHUser> users = root.createRequest()
|
||||||
|
.withUrlPath(getApiTailUrl("collaborators"))
|
||||||
|
.with("affiliation", affiliation)
|
||||||
|
.toIterable(GHUser[].class, null);
|
||||||
|
for (GHUser u : users.toArray()) {
|
||||||
|
r.add(u.login);
|
||||||
|
}
|
||||||
|
return r;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Obtain permission for a given user in this repository.
|
* Obtain permission for a given user in this repository.
|
||||||
*
|
*
|
||||||
@@ -1039,14 +1144,6 @@ public class GHRepository extends GHObject {
|
|||||||
.send();
|
.send();
|
||||||
}
|
}
|
||||||
|
|
||||||
private void edit(String key, String value) throws IOException {
|
|
||||||
Requester requester = root.createRequest();
|
|
||||||
if (!key.equals("name")) {
|
|
||||||
requester.with("name", name); // even when we don't change the name, we need to send it in
|
|
||||||
}
|
|
||||||
requester.with(key, value).method("PATCH").withUrlPath(getApiTailUrl("")).send();
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Enables or disables the issue tracker for this repository.
|
* Enables or disables the issue tracker for this repository.
|
||||||
*
|
*
|
||||||
@@ -1056,7 +1153,7 @@ public class GHRepository extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void enableIssueTracker(boolean v) throws IOException {
|
public void enableIssueTracker(boolean v) throws IOException {
|
||||||
edit("has_issues", String.valueOf(v));
|
set().issues(v);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1068,7 +1165,7 @@ public class GHRepository extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void enableProjects(boolean v) throws IOException {
|
public void enableProjects(boolean v) throws IOException {
|
||||||
edit("has_projects", String.valueOf(v));
|
set().projects(v);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1080,7 +1177,7 @@ public class GHRepository extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void enableWiki(boolean v) throws IOException {
|
public void enableWiki(boolean v) throws IOException {
|
||||||
edit("has_wiki", String.valueOf(v));
|
set().wiki(v);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1092,7 +1189,7 @@ public class GHRepository extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void enableDownloads(boolean v) throws IOException {
|
public void enableDownloads(boolean v) throws IOException {
|
||||||
edit("has_downloads", String.valueOf(v));
|
set().downloads(v);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1104,7 +1201,7 @@ public class GHRepository extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void renameTo(String name) throws IOException {
|
public void renameTo(String name) throws IOException {
|
||||||
edit("name", name);
|
set().name(name);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1116,7 +1213,7 @@ public class GHRepository extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void setDescription(String value) throws IOException {
|
public void setDescription(String value) throws IOException {
|
||||||
edit("description", value);
|
set().description(value);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1128,7 +1225,7 @@ public class GHRepository extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void setHomepage(String value) throws IOException {
|
public void setHomepage(String value) throws IOException {
|
||||||
edit("homepage", value);
|
set().homepage(value);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1140,7 +1237,7 @@ public class GHRepository extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void setDefaultBranch(String value) throws IOException {
|
public void setDefaultBranch(String value) throws IOException {
|
||||||
edit("default_branch", value);
|
set().defaultBranch(value);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1152,7 +1249,27 @@ public class GHRepository extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void setPrivate(boolean value) throws IOException {
|
public void setPrivate(boolean value) throws IOException {
|
||||||
edit("private", Boolean.toString(value));
|
set().private_(value);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Sets visibility.
|
||||||
|
*
|
||||||
|
* @param value
|
||||||
|
* the value
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(NEBULA)
|
||||||
|
public void setVisibility(final Visibility value) throws IOException {
|
||||||
|
root.createRequest()
|
||||||
|
.method("PATCH")
|
||||||
|
.withPreview(NEBULA)
|
||||||
|
.with("name", name)
|
||||||
|
.with("visibility", value)
|
||||||
|
.withUrlPath(getApiTailUrl(""))
|
||||||
|
.send();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1164,7 +1281,7 @@ public class GHRepository extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void allowSquashMerge(boolean value) throws IOException {
|
public void allowSquashMerge(boolean value) throws IOException {
|
||||||
edit("allow_squash_merge", Boolean.toString(value));
|
set().allowSquashMerge(value);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1176,7 +1293,7 @@ public class GHRepository extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void allowMergeCommit(boolean value) throws IOException {
|
public void allowMergeCommit(boolean value) throws IOException {
|
||||||
edit("allow_merge_commit", Boolean.toString(value));
|
set().allowMergeCommit(value);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1188,7 +1305,7 @@ public class GHRepository extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void allowRebaseMerge(boolean value) throws IOException {
|
public void allowRebaseMerge(boolean value) throws IOException {
|
||||||
edit("allow_rebase_merge", Boolean.toString(value));
|
set().allowRebaseMerge(value);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1200,7 +1317,7 @@ public class GHRepository extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void deleteBranchOnMerge(boolean value) throws IOException {
|
public void deleteBranchOnMerge(boolean value) throws IOException {
|
||||||
edit("delete_branch_on_merge", Boolean.toString(value));
|
set().deleteBranchOnMerge(value);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1237,12 +1354,30 @@ public class GHRepository extends GHObject {
|
|||||||
* In case of any networking error or error from the server.
|
* In case of any networking error or error from the server.
|
||||||
*/
|
*/
|
||||||
public void archive() throws IOException {
|
public void archive() throws IOException {
|
||||||
edit("archived", "true");
|
set().archive();
|
||||||
// Generall would not update this record,
|
// Generally would not update this record,
|
||||||
// but do so here since this will result in any other update actions failing
|
// but doing so here since this will result in any other update actions failing
|
||||||
archived = true;
|
archived = true;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Creates a builder that can be used to bulk update repository settings.
|
||||||
|
*
|
||||||
|
* @return the repository updater
|
||||||
|
*/
|
||||||
|
public Updater update() {
|
||||||
|
return new Updater(this);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Creates a builder that can be used to bulk update repository settings.
|
||||||
|
*
|
||||||
|
* @return the repository updater
|
||||||
|
*/
|
||||||
|
public Setter set() {
|
||||||
|
return new Setter(this);
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Sort orders for listing forks
|
* Sort orders for listing forks
|
||||||
*/
|
*/
|
||||||
@@ -1642,7 +1777,7 @@ public class GHRepository extends GHObject {
|
|||||||
* Retrive a tree of the given type for the current GitHub repository.
|
* Retrive a tree of the given type for the current GitHub repository.
|
||||||
*
|
*
|
||||||
* @param sha
|
* @param sha
|
||||||
* sha number or branch name ex: "master"
|
* sha number or branch name ex: "main"
|
||||||
* @return refs matching the request type
|
* @return refs matching the request type
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* on failure communicating with GitHub, potentially due to an invalid tree type being requested
|
* on failure communicating with GitHub, potentially due to an invalid tree type being requested
|
||||||
@@ -1666,7 +1801,7 @@ public class GHRepository extends GHObject {
|
|||||||
* https://developer.github.com/v3/git/trees/#get-a-tree-recursively
|
* https://developer.github.com/v3/git/trees/#get-a-tree-recursively
|
||||||
*
|
*
|
||||||
* @param sha
|
* @param sha
|
||||||
* sha number or branch name ex: "master"
|
* sha number or branch name ex: "main"
|
||||||
* @param recursive
|
* @param recursive
|
||||||
* use 1
|
* use 1
|
||||||
* @return the tree recursive
|
* @return the tree recursive
|
||||||
@@ -1724,7 +1859,7 @@ public class GHRepository extends GHObject {
|
|||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
.withHeader("Accept", "application/vnd.github.v3.raw")
|
.withHeader("Accept", "application/vnd.github.v3.raw")
|
||||||
.withUrlPath(target)
|
.withUrlPath(target)
|
||||||
.fetchStream();
|
.fetchStream(Requester::copyInputStream);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1878,14 +2013,14 @@ public class GHRepository extends GHObject {
|
|||||||
* @see <a href="https://developer.github.com/v3/checks/runs/#list-check-runs-for-a-specific-ref">List check runs
|
* @see <a href="https://developer.github.com/v3/checks/runs/#list-check-runs-for-a-specific-ref">List check runs
|
||||||
* for a specific ref</a>
|
* for a specific ref</a>
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(ANTIOPE)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public PagedIterable<GHCheckRun> getCheckRuns(String ref) throws IOException {
|
public PagedIterable<GHCheckRun> getCheckRuns(String ref) throws IOException {
|
||||||
GitHubRequest request = root.createRequest()
|
GitHubRequest request = root.createRequest()
|
||||||
.withUrlPath(String.format("/repos/%s/%s/commits/%s/check-runs", getOwnerName(), name, ref))
|
.withUrlPath(String.format("/repos/%s/%s/commits/%s/check-runs", getOwnerName(), name, ref))
|
||||||
.withPreview(ANTIOPE)
|
.withPreview(ANTIOPE)
|
||||||
.build();
|
.build();
|
||||||
return new GHCheckRunsIterable(root, request);
|
return new GHCheckRunsIterable(this, request);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1952,7 +2087,7 @@ public class GHRepository extends GHObject {
|
|||||||
* the commit hash
|
* the commit hash
|
||||||
* @return a builder which you should customize, then call {@link GHCheckRunBuilder#create}
|
* @return a builder which you should customize, then call {@link GHCheckRunBuilder#create}
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(ANTIOPE)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public @NonNull GHCheckRunBuilder createCheckRun(@NonNull String name, @NonNull String headSHA) {
|
public @NonNull GHCheckRunBuilder createCheckRun(@NonNull String name, @NonNull String headSHA) {
|
||||||
return new GHCheckRunBuilder(this, name, headSHA);
|
return new GHCheckRunBuilder(this, name, headSHA);
|
||||||
@@ -1965,7 +2100,7 @@ public class GHRepository extends GHObject {
|
|||||||
* the existing checkId
|
* the existing checkId
|
||||||
* @return a builder which you should customize, then call {@link GHCheckRunBuilder#create}
|
* @return a builder which you should customize, then call {@link GHCheckRunBuilder#create}
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(BAPTISTE)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public @NonNull GHCheckRunBuilder updateCheckRun(long checkId) {
|
public @NonNull GHCheckRunBuilder updateCheckRun(long checkId) {
|
||||||
return new GHCheckRunBuilder(this, checkId);
|
return new GHCheckRunBuilder(this, checkId);
|
||||||
@@ -2088,9 +2223,11 @@ public class GHRepository extends GHObject {
|
|||||||
}
|
}
|
||||||
|
|
||||||
private PagedIterable<GHUser> listUsers(final String suffix) {
|
private PagedIterable<GHUser> listUsers(final String suffix) {
|
||||||
return root.createRequest()
|
return listUsers(root.createRequest(), suffix);
|
||||||
.withUrlPath(getApiTailUrl(suffix))
|
}
|
||||||
.toIterable(GHUser[].class, item -> item.wrapUp(root));
|
|
||||||
|
private PagedIterable<GHUser> listUsers(Requester requester, final String suffix) {
|
||||||
|
return requester.withUrlPath(getApiTailUrl(suffix)).toIterable(GHUser[].class, item -> item.wrapUp(root));
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -2153,7 +2290,12 @@ public class GHRepository extends GHObject {
|
|||||||
justification = "It causes a performance degradation, but we have already exposed it to the API")
|
justification = "It causes a performance degradation, but we have already exposed it to the API")
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public Set<URL> getPostCommitHooks() {
|
public Set<URL> getPostCommitHooks() {
|
||||||
return postCommitHooks;
|
synchronized (this) {
|
||||||
|
if (postCommitHooks == null) {
|
||||||
|
postCommitHooks = setupPostCommitHooks();
|
||||||
|
}
|
||||||
|
return postCommitHooks;
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -2162,57 +2304,63 @@ public class GHRepository extends GHObject {
|
|||||||
@SuppressFBWarnings(value = "DMI_COLLECTION_OF_URLS",
|
@SuppressFBWarnings(value = "DMI_COLLECTION_OF_URLS",
|
||||||
justification = "It causes a performance degradation, but we have already exposed it to the API")
|
justification = "It causes a performance degradation, but we have already exposed it to the API")
|
||||||
@SkipFromToString
|
@SkipFromToString
|
||||||
private final Set<URL> postCommitHooks = new AbstractSet<URL>() {
|
private /* final */ transient Set<URL> postCommitHooks;
|
||||||
private List<URL> getPostCommitHooks() {
|
|
||||||
try {
|
@SuppressFBWarnings(value = "DMI_COLLECTION_OF_URLS",
|
||||||
List<URL> r = new ArrayList<>();
|
justification = "It causes a performance degradation, but we have already exposed it to the API")
|
||||||
for (GHHook h : getHooks()) {
|
private Set<URL> setupPostCommitHooks() {
|
||||||
if (h.getName().equals("web")) {
|
return new AbstractSet<URL>() {
|
||||||
r.add(new URL(h.getConfig().get("url")));
|
private List<URL> getPostCommitHooks() {
|
||||||
|
try {
|
||||||
|
List<URL> r = new ArrayList<>();
|
||||||
|
for (GHHook h : getHooks()) {
|
||||||
|
if (h.getName().equals("web")) {
|
||||||
|
r.add(new URL(h.getConfig().get("url")));
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
return r;
|
||||||
|
} catch (IOException e) {
|
||||||
|
throw new GHException("Failed to retrieve post-commit hooks", e);
|
||||||
}
|
}
|
||||||
return r;
|
|
||||||
} catch (IOException e) {
|
|
||||||
throw new GHException("Failed to retrieve post-commit hooks", e);
|
|
||||||
}
|
}
|
||||||
}
|
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
public Iterator<URL> iterator() {
|
public Iterator<URL> iterator() {
|
||||||
return getPostCommitHooks().iterator();
|
return getPostCommitHooks().iterator();
|
||||||
}
|
|
||||||
|
|
||||||
@Override
|
|
||||||
public int size() {
|
|
||||||
return getPostCommitHooks().size();
|
|
||||||
}
|
|
||||||
|
|
||||||
@Override
|
|
||||||
public boolean add(URL url) {
|
|
||||||
try {
|
|
||||||
createWebHook(url);
|
|
||||||
return true;
|
|
||||||
} catch (IOException e) {
|
|
||||||
throw new GHException("Failed to update post-commit hooks", e);
|
|
||||||
}
|
}
|
||||||
}
|
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
public boolean remove(Object url) {
|
public int size() {
|
||||||
try {
|
return getPostCommitHooks().size();
|
||||||
String _url = ((URL) url).toExternalForm();
|
}
|
||||||
for (GHHook h : getHooks()) {
|
|
||||||
if (h.getName().equals("web") && h.getConfig().get("url").equals(_url)) {
|
@Override
|
||||||
h.delete();
|
public boolean add(URL url) {
|
||||||
return true;
|
try {
|
||||||
|
createWebHook(url);
|
||||||
|
return true;
|
||||||
|
} catch (IOException e) {
|
||||||
|
throw new GHException("Failed to update post-commit hooks", e);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean remove(Object url) {
|
||||||
|
try {
|
||||||
|
String _url = ((URL) url).toExternalForm();
|
||||||
|
for (GHHook h : getHooks()) {
|
||||||
|
if (h.getName().equals("web") && h.getConfig().get("url").equals(_url)) {
|
||||||
|
h.delete();
|
||||||
|
return true;
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
return false;
|
||||||
|
} catch (IOException e) {
|
||||||
|
throw new GHException("Failed to update post-commit hooks", e);
|
||||||
}
|
}
|
||||||
return false;
|
|
||||||
} catch (IOException e) {
|
|
||||||
throw new GHException("Failed to update post-commit hooks", e);
|
|
||||||
}
|
}
|
||||||
}
|
};
|
||||||
};
|
}
|
||||||
|
|
||||||
GHRepository wrap(GitHub root) {
|
GHRepository wrap(GitHub root) {
|
||||||
this.root = root;
|
this.root = root;
|
||||||
@@ -2738,7 +2886,7 @@ public class GHRepository extends GHObject {
|
|||||||
.with("mode", mode == null ? null : mode.toString())
|
.with("mode", mode == null ? null : mode.toString())
|
||||||
.with("context", getFullName())
|
.with("context", getFullName())
|
||||||
.withUrlPath("/markdown")
|
.withUrlPath("/markdown")
|
||||||
.fetchStream(),
|
.fetchStream(Requester::copyInputStream),
|
||||||
"UTF-8");
|
"UTF-8");
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -2826,6 +2974,110 @@ public class GHRepository extends GHObject {
|
|||||||
.wrapUp(root);
|
.wrapUp(root);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Lists all the workflows of this repository.
|
||||||
|
*
|
||||||
|
* @return the paged iterable
|
||||||
|
*/
|
||||||
|
public PagedIterable<GHWorkflow> listWorkflows() {
|
||||||
|
return new GHWorkflowsIterable(this);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets a workflow by id.
|
||||||
|
*
|
||||||
|
* @param id
|
||||||
|
* the id of the workflow run
|
||||||
|
* @return the workflow run
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public GHWorkflow getWorkflow(long id) throws IOException {
|
||||||
|
return getWorkflow(String.valueOf(id));
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets a workflow by name of the file.
|
||||||
|
*
|
||||||
|
* @param nameOrId
|
||||||
|
* either the name of the file (e.g. my-workflow.yml) or the id as a string
|
||||||
|
* @return the workflow run
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public GHWorkflow getWorkflow(String nameOrId) throws IOException {
|
||||||
|
return root.createRequest()
|
||||||
|
.withUrlPath(getApiTailUrl("actions/workflows"), nameOrId)
|
||||||
|
.fetch(GHWorkflow.class)
|
||||||
|
.wrapUp(this);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Retrieves workflow runs.
|
||||||
|
*
|
||||||
|
* @return the workflow run query builder
|
||||||
|
*/
|
||||||
|
public GHWorkflowRunQueryBuilder queryWorkflowRuns() {
|
||||||
|
return new GHWorkflowRunQueryBuilder(this);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets a workflow run.
|
||||||
|
*
|
||||||
|
* @param id
|
||||||
|
* the id of the workflow run
|
||||||
|
* @return the workflow run
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public GHWorkflowRun getWorkflowRun(long id) throws IOException {
|
||||||
|
return root.createRequest()
|
||||||
|
.withUrlPath(getApiTailUrl("actions/runs"), String.valueOf(id))
|
||||||
|
.fetch(GHWorkflowRun.class)
|
||||||
|
.wrapUp(this);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Lists all the artifacts of this repository.
|
||||||
|
*
|
||||||
|
* @return the paged iterable
|
||||||
|
*/
|
||||||
|
public PagedIterable<GHArtifact> listArtifacts() {
|
||||||
|
return new GHArtifactsIterable(this, root.createRequest().withUrlPath(getApiTailUrl("actions/artifacts")));
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets an artifact by id.
|
||||||
|
*
|
||||||
|
* @param id
|
||||||
|
* the id of the artifact
|
||||||
|
* @return the artifact
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public GHArtifact getArtifact(long id) throws IOException {
|
||||||
|
return root.createRequest()
|
||||||
|
.withUrlPath(getApiTailUrl("actions/artifacts"), String.valueOf(id))
|
||||||
|
.fetch(GHArtifact.class)
|
||||||
|
.wrapUp(this);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets a job from a workflow run by id.
|
||||||
|
*
|
||||||
|
* @param id
|
||||||
|
* the id of the job
|
||||||
|
* @return the job
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public GHWorkflowJob getWorkflowJob(long id) throws IOException {
|
||||||
|
return root.createRequest()
|
||||||
|
.withUrlPath(getApiTailUrl("/actions/jobs"), String.valueOf(id))
|
||||||
|
.fetch(GHWorkflowJob.class)
|
||||||
|
.wrapUp(this);
|
||||||
|
}
|
||||||
|
|
||||||
// Only used within listTopics().
|
// Only used within listTopics().
|
||||||
private static class Topics {
|
private static class Topics {
|
||||||
public List<String> names;
|
public List<String> names;
|
||||||
@@ -2892,6 +3144,52 @@ public class GHRepository extends GHObject {
|
|||||||
.wrap(this);
|
.wrap(this);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Streams a zip archive of the repository, optionally at a given <code>ref</code>.
|
||||||
|
*
|
||||||
|
* @param <T>
|
||||||
|
* the type of result
|
||||||
|
* @param streamFunction
|
||||||
|
* The {@link InputStreamFunction} that will process the stream
|
||||||
|
* @param ref
|
||||||
|
* if <code>null</code> the repository's default branch, usually <code>main</code>,
|
||||||
|
* @throws IOException
|
||||||
|
* The IO exception.
|
||||||
|
* @return the result of reading the stream.
|
||||||
|
*/
|
||||||
|
public <T> T readZip(InputStreamFunction<T> streamFunction, String ref) throws IOException {
|
||||||
|
return downloadArchive("zip", ref, streamFunction);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Streams a tar archive of the repository, optionally at a given <code>ref</code>.
|
||||||
|
*
|
||||||
|
* @param <T>
|
||||||
|
* the type of result
|
||||||
|
* @param streamFunction
|
||||||
|
* The {@link InputStreamFunction} that will process the stream
|
||||||
|
* @param ref
|
||||||
|
* if <code>null</code> the repository's default branch, usually <code>main</code>,
|
||||||
|
* @throws IOException
|
||||||
|
* The IO exception.
|
||||||
|
* @return the result of reading the stream.
|
||||||
|
*/
|
||||||
|
public <T> T readTar(InputStreamFunction<T> streamFunction, String ref) throws IOException {
|
||||||
|
return downloadArchive("tar", ref, streamFunction);
|
||||||
|
}
|
||||||
|
|
||||||
|
private <T> T downloadArchive(@Nonnull String type,
|
||||||
|
@CheckForNull String ref,
|
||||||
|
@Nonnull InputStreamFunction<T> streamFunction) throws IOException {
|
||||||
|
requireNonNull(streamFunction, "Sink must not be null");
|
||||||
|
String tailUrl = getApiTailUrl(type + "ball");
|
||||||
|
if (ref != null) {
|
||||||
|
tailUrl += "/" + ref;
|
||||||
|
}
|
||||||
|
final Requester builder = root.createRequest().method("GET").withUrlPath(tailUrl);
|
||||||
|
return builder.fetchStream(streamFunction);
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Populate this object.
|
* Populate this object.
|
||||||
*
|
*
|
||||||
@@ -2903,20 +3201,66 @@ public class GHRepository extends GHObject {
|
|||||||
return; // can't populate if the root is offline
|
return; // can't populate if the root is offline
|
||||||
}
|
}
|
||||||
|
|
||||||
final URL url = Objects.requireNonNull(getUrl(), "Missing instance URL!");
|
final URL url = requireNonNull(getUrl(), "Missing instance URL!");
|
||||||
|
|
||||||
try {
|
try {
|
||||||
// IMPORTANT: the url for repository records is does not reliably point to the API url.
|
// IMPORTANT: the url for repository records does not reliably point to the API url.
|
||||||
// There is bug in Push event payloads that returns the wrong url.
|
// There is bug in Push event payloads that returns the wrong url.
|
||||||
// All other occurrences of "url" take the form "https://api.github.com/...".
|
// All other occurrences of "url" take the form "https://api.github.com/...".
|
||||||
// For Push event repository records, they take the form "https://github.com/{fullName}".
|
// For Push event repository records, they take the form "https://github.com/{fullName}".
|
||||||
root.createRequest().withPreview(BAPTISE).setRawUrlPath(url.toString()).fetchInto(this).wrap(root);
|
root.createRequest()
|
||||||
|
.withPreview(BAPTISTE)
|
||||||
|
.withPreview(NEBULA)
|
||||||
|
.setRawUrlPath(url.toString())
|
||||||
|
.fetchInto(this)
|
||||||
|
.wrap(root);
|
||||||
} catch (HttpException e) {
|
} catch (HttpException e) {
|
||||||
if (e.getCause() instanceof JsonParseException) {
|
if (e.getCause() instanceof JsonParseException) {
|
||||||
root.createRequest().withPreview(BAPTISE).withUrlPath("/repos/" + full_name).fetchInto(this).wrap(root);
|
root.createRequest()
|
||||||
|
.withPreview(BAPTISTE)
|
||||||
|
.withPreview(NEBULA)
|
||||||
|
.withUrlPath("/repos/" + full_name)
|
||||||
|
.fetchInto(this)
|
||||||
|
.wrap(root);
|
||||||
} else {
|
} else {
|
||||||
throw e;
|
throw e;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A {@link GHRepositoryBuilder} that allows multiple properties to be updated per request.
|
||||||
|
*
|
||||||
|
* Consumer must call {@link #done()} to commit changes.
|
||||||
|
*/
|
||||||
|
@BetaApi
|
||||||
|
@Deprecated
|
||||||
|
public static class Updater extends GHRepositoryBuilder<Updater> {
|
||||||
|
protected Updater(@Nonnull GHRepository repository) {
|
||||||
|
super(Updater.class, repository.root, null);
|
||||||
|
// even when we don't change the name, we need to send it in
|
||||||
|
// this requirement may be out-of-date, but we do not want to break it
|
||||||
|
requester.with("name", repository.name);
|
||||||
|
|
||||||
|
requester.method("PATCH").withUrlPath(repository.getApiTailUrl(""));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A {@link GHRepositoryBuilder} that allows multiple properties to be updated per request.
|
||||||
|
*
|
||||||
|
* Consumer must call {@link #done()} to commit changes.
|
||||||
|
*/
|
||||||
|
@BetaApi
|
||||||
|
@Deprecated
|
||||||
|
public static class Setter extends GHRepositoryBuilder<GHRepository> {
|
||||||
|
protected Setter(@Nonnull GHRepository repository) {
|
||||||
|
super(GHRepository.class, repository.root, null);
|
||||||
|
// even when we don't change the name, we need to send it in
|
||||||
|
// this requirement may be out-of-date, but we do not want to break it
|
||||||
|
requester.with("name", repository.name);
|
||||||
|
|
||||||
|
requester.method("PATCH").withUrlPath(repository.getApiTailUrl(""));
|
||||||
|
}
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
252
src/main/java/org/kohsuke/github/GHRepositoryBuilder.java
Normal file
252
src/main/java/org/kohsuke/github/GHRepositoryBuilder.java
Normal file
@@ -0,0 +1,252 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import org.kohsuke.github.GHRepository.Visibility;
|
||||||
|
|
||||||
|
import java.io.IOException;
|
||||||
|
import java.net.URL;
|
||||||
|
|
||||||
|
import static org.kohsuke.github.internal.Previews.BAPTISTE;
|
||||||
|
import static org.kohsuke.github.internal.Previews.NEBULA;
|
||||||
|
|
||||||
|
abstract class GHRepositoryBuilder<S> extends AbstractBuilder<GHRepository, S> {
|
||||||
|
|
||||||
|
protected GHRepositoryBuilder(Class<S> intermediateReturnType, GitHub root, GHRepository baseInstance) {
|
||||||
|
super(GHRepository.class, intermediateReturnType, root, baseInstance);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Allow or disallow squash-merging pull requests.
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S allowSquashMerge(boolean enabled) throws IOException {
|
||||||
|
return with("allow_squash_merge", enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Allow or disallow merging pull requests with a merge commit.
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S allowMergeCommit(boolean enabled) throws IOException {
|
||||||
|
return with("allow_merge_commit", enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Allow or disallow rebase-merging pull requests.
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S allowRebaseMerge(boolean enabled) throws IOException {
|
||||||
|
return with("allow_rebase_merge", enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* After pull requests are merged, you can have head branches deleted automatically.
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S deleteBranchOnMerge(boolean enabled) throws IOException {
|
||||||
|
return with("delete_branch_on_merge", enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Default repository branch
|
||||||
|
*
|
||||||
|
* @param branch
|
||||||
|
* branch name
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S defaultBranch(String branch) throws IOException {
|
||||||
|
return with("default_branch", branch);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Description for repository
|
||||||
|
*
|
||||||
|
* @param description
|
||||||
|
* description of repository
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S description(String description) throws IOException {
|
||||||
|
return with("description", description);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Homepage for repository
|
||||||
|
*
|
||||||
|
* @param homepage
|
||||||
|
* homepage of repository
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S homepage(URL homepage) throws IOException {
|
||||||
|
return homepage(homepage.toExternalForm());
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Homepage for repository
|
||||||
|
*
|
||||||
|
* @param homepage
|
||||||
|
* homepage of repository
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S homepage(String homepage) throws IOException {
|
||||||
|
return with("homepage", homepage);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Sets the repository to private
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* private if true
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S private_(boolean enabled) throws IOException {
|
||||||
|
return with("private", enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Sets the repository visibility
|
||||||
|
*
|
||||||
|
* @param visibility
|
||||||
|
* visibility of repository
|
||||||
|
* @return a builder to continue with building
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S visibility(final Visibility visibility) throws IOException {
|
||||||
|
requester.withPreview(NEBULA);
|
||||||
|
return with("visibility", visibility);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Enables issue tracker
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S issues(boolean enabled) throws IOException {
|
||||||
|
return with("has_issues", enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Enables projects
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S projects(boolean enabled) throws IOException {
|
||||||
|
return with("has_projects", enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Enables wiki
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
* @return a builder to continue with building
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S wiki(boolean enabled) throws IOException {
|
||||||
|
return with("has_wiki", enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Enables downloads
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S downloads(boolean enabled) throws IOException {
|
||||||
|
return with("has_downloads", enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Specifies whether the repository is a template.
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
* @return a builder to continue with building
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
@Preview(BAPTISTE)
|
||||||
|
@Deprecated
|
||||||
|
public S isTemplate(boolean enabled) throws IOException {
|
||||||
|
requester.withPreview(BAPTISTE);
|
||||||
|
return with("is_template", enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public GHRepository done() throws IOException {
|
||||||
|
return super.done().wrap(this.root);
|
||||||
|
}
|
||||||
|
|
||||||
|
S archive() throws IOException {
|
||||||
|
return with("archived", true);
|
||||||
|
}
|
||||||
|
|
||||||
|
S name(String name) throws IOException {
|
||||||
|
return with("name", name);
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -16,10 +16,9 @@ import java.util.NoSuchElementException;
|
|||||||
*
|
*
|
||||||
* @author Martin van Zijl
|
* @author Martin van Zijl
|
||||||
*/
|
*/
|
||||||
public class GHRepositoryStatistics {
|
public class GHRepositoryStatistics extends GitHubInteractiveObject {
|
||||||
|
|
||||||
private final GHRepository repo;
|
private final GHRepository repo;
|
||||||
private final GitHub root;
|
|
||||||
|
|
||||||
private static final int MAX_WAIT_ITERATIONS = 3;
|
private static final int MAX_WAIT_ITERATIONS = 3;
|
||||||
private static final int WAIT_SLEEP_INTERVAL = 5000;
|
private static final int WAIT_SLEEP_INTERVAL = 5000;
|
||||||
@@ -60,7 +59,7 @@ public class GHRepositoryStatistics {
|
|||||||
* @throws InterruptedException
|
* @throws InterruptedException
|
||||||
* the interrupted exception
|
* the interrupted exception
|
||||||
*/
|
*/
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
@SuppressWarnings("SleepWhileInLoop")
|
@SuppressWarnings("SleepWhileInLoop")
|
||||||
@SuppressFBWarnings(value = { "RCN_REDUNDANT_NULLCHECK_OF_NONNULL_VALUE" }, justification = "JSON API")
|
@SuppressFBWarnings(value = { "RCN_REDUNDANT_NULLCHECK_OF_NONNULL_VALUE" }, justification = "JSON API")
|
||||||
@@ -99,7 +98,6 @@ public class GHRepositoryStatistics {
|
|||||||
"URF_UNREAD_FIELD" },
|
"URF_UNREAD_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public static class ContributorStats extends GHObject {
|
public static class ContributorStats extends GHObject {
|
||||||
/* package almost final */ private GitHub root;
|
|
||||||
private GHUser author;
|
private GHUser author;
|
||||||
private int total;
|
private int total;
|
||||||
private List<Week> weeks;
|
private List<Week> weeks;
|
||||||
@@ -255,7 +253,6 @@ public class GHRepositoryStatistics {
|
|||||||
value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public static class CommitActivity extends GHObject {
|
public static class CommitActivity extends GHObject {
|
||||||
/* package almost final */ private GitHub root;
|
|
||||||
private List<Integer> days;
|
private List<Integer> days;
|
||||||
private int total;
|
private int total;
|
||||||
private long week;
|
private long week;
|
||||||
@@ -398,7 +395,6 @@ public class GHRepositoryStatistics {
|
|||||||
* The type Participation.
|
* The type Participation.
|
||||||
*/
|
*/
|
||||||
public static class Participation extends GHObject {
|
public static class Participation extends GHObject {
|
||||||
/* package almost final */ private GitHub root;
|
|
||||||
private List<Integer> all;
|
private List<Integer> all;
|
||||||
private List<Integer> owner;
|
private List<Integer> owner;
|
||||||
|
|
||||||
|
|||||||
@@ -8,7 +8,6 @@ import java.net.URL;
|
|||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public class GHRequestedAction extends GHObject {
|
public class GHRequestedAction extends GHObject {
|
||||||
private GHRepository owner;
|
private GHRepository owner;
|
||||||
private GitHub root;
|
|
||||||
private String identifier;
|
private String identifier;
|
||||||
private String label;
|
private String label;
|
||||||
private String description;
|
private String description;
|
||||||
@@ -46,4 +45,4 @@ public class GHRequestedAction extends GHObject {
|
|||||||
return null;
|
return null;
|
||||||
}
|
}
|
||||||
|
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -10,11 +10,10 @@ import java.util.Date;
|
|||||||
* @see GHRepository#getSubscription() GHRepository#getSubscription()
|
* @see GHRepository#getSubscription() GHRepository#getSubscription()
|
||||||
* @see GHThread#getSubscription() GHThread#getSubscription()
|
* @see GHThread#getSubscription() GHThread#getSubscription()
|
||||||
*/
|
*/
|
||||||
public class GHSubscription {
|
public class GHSubscription extends GitHubInteractiveObject {
|
||||||
private String created_at, url, repository_url, reason;
|
private String created_at, url, repository_url, reason;
|
||||||
private boolean subscribed, ignored;
|
private boolean subscribed, ignored;
|
||||||
|
|
||||||
private GitHub root;
|
|
||||||
private GHRepository repo;
|
private GHRepository repo;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|||||||
@@ -9,9 +9,8 @@ import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
|||||||
*/
|
*/
|
||||||
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public class GHTag {
|
public class GHTag extends GitHubInteractiveObject {
|
||||||
private GHRepository owner;
|
private GHRepository owner;
|
||||||
private GitHub root;
|
|
||||||
|
|
||||||
private String name;
|
private String name;
|
||||||
private GHCommit commit;
|
private GHCommit commit;
|
||||||
|
|||||||
@@ -9,9 +9,8 @@ import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
|||||||
*/
|
*/
|
||||||
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public class GHTagObject {
|
public class GHTagObject extends GitHubInteractiveObject {
|
||||||
private GHRepository owner;
|
private GHRepository owner;
|
||||||
private GitHub root;
|
|
||||||
|
|
||||||
private String tag;
|
private String tag;
|
||||||
private String sha;
|
private String sha;
|
||||||
|
|||||||
@@ -24,8 +24,6 @@ public class GHTeam extends GHObject implements Refreshable {
|
|||||||
|
|
||||||
private GHOrganization organization; // populated by GET /user/teams where Teams+Orgs are returned together
|
private GHOrganization organization; // populated by GET /user/teams where Teams+Orgs are returned together
|
||||||
|
|
||||||
protected /* final */ GitHub root;
|
|
||||||
|
|
||||||
public enum Privacy {
|
public enum Privacy {
|
||||||
SECRET, // only visible to organization owners and members of this team.
|
SECRET, // only visible to organization owners and members of this team.
|
||||||
CLOSED // visible to all members of this organization.
|
CLOSED // visible to all members of this organization.
|
||||||
|
|||||||
@@ -7,9 +7,7 @@ import java.io.IOException;
|
|||||||
*
|
*
|
||||||
* https://developer.github.com/v3/teams/#create-team
|
* https://developer.github.com/v3/teams/#create-team
|
||||||
*/
|
*/
|
||||||
public class GHTeamBuilder {
|
public class GHTeamBuilder extends GitHubInteractiveObject {
|
||||||
|
|
||||||
private final GitHub root;
|
|
||||||
protected final Requester builder;
|
protected final Requester builder;
|
||||||
private final String orgName;
|
private final String orgName;
|
||||||
|
|
||||||
|
|||||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user