mirror of
https://github.com/jlengrand/github-api.git
synced 2026-04-02 00:11:25 +00:00
Compare commits
232 Commits
github-api
...
github-api
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
6606b5c7d1 | ||
|
|
551dbf2a06 | ||
|
|
d734237788 | ||
|
|
47e2a5aea1 | ||
|
|
57cdc308e8 | ||
|
|
8919c5f8c7 | ||
|
|
b8f00bc699 | ||
|
|
042038f480 | ||
|
|
fb03e749bd | ||
|
|
e522239832 | ||
|
|
ae69324196 | ||
|
|
5194c2d9bc | ||
|
|
daf5c5eb98 | ||
|
|
a7b4c97020 | ||
|
|
420d5d06f3 | ||
|
|
a7cd052b7c | ||
|
|
6e1b943823 | ||
|
|
8a3559ada5 | ||
|
|
ea3cbd4c71 | ||
|
|
34a1f9d6e4 | ||
|
|
629bd510c1 | ||
|
|
40937a5cc6 | ||
|
|
8509957102 | ||
|
|
b0aea0c575 | ||
|
|
1f7f646bec | ||
|
|
a59ee6a82d | ||
|
|
1fefc77582 | ||
|
|
199eee4e25 | ||
|
|
854df5321b | ||
|
|
bd509070ac | ||
|
|
a8c7c97d06 | ||
|
|
6d86cfb4f6 | ||
|
|
fb3e956502 | ||
|
|
9b0dbe6f34 | ||
|
|
c10c7237a7 | ||
|
|
36612fe97f | ||
|
|
18e2056a10 | ||
|
|
8c8f1451d4 | ||
|
|
be67f1d9e2 | ||
|
|
90bc250269 | ||
|
|
1bd178654f | ||
|
|
f22bf160f9 | ||
|
|
4261c42949 | ||
|
|
40cfb85a8e | ||
|
|
f08299b134 | ||
|
|
a04ab45abc | ||
|
|
0647df2d2b | ||
|
|
d4cc3af1e9 | ||
|
|
936ab499ce | ||
|
|
453f475b4e | ||
|
|
bda3855b86 | ||
|
|
772a6c112b | ||
|
|
9b4134cada | ||
|
|
ed9f54006d | ||
|
|
3b1f176544 | ||
|
|
d2732bcf54 | ||
|
|
a1461f401a | ||
|
|
f9fd30275c | ||
|
|
eeea14dab4 | ||
|
|
1df807a198 | ||
|
|
0848287069 | ||
|
|
334b37a256 | ||
|
|
8776a3b672 | ||
|
|
657550f767 | ||
|
|
45a0114f75 | ||
|
|
a8ddd3e12a | ||
|
|
b668396151 | ||
|
|
9e7c33369c | ||
|
|
8943ca6d1a | ||
|
|
b3460c1f9d | ||
|
|
5166c9265f | ||
|
|
35c8cfa01d | ||
|
|
8e6dbf3772 | ||
|
|
cb381dfa06 | ||
|
|
80124e3b85 | ||
|
|
7aae27e36f | ||
|
|
b212956fbb | ||
|
|
d033355e84 | ||
|
|
59d7a117d0 | ||
|
|
dfbb38c5f1 | ||
|
|
3f9954144a | ||
|
|
1b84efdbfa | ||
|
|
c33e78a7dc | ||
|
|
747c759bbb | ||
|
|
e0a709676e | ||
|
|
a96275c286 | ||
|
|
ca7c809feb | ||
|
|
a8a0bcb7db | ||
|
|
0e2bf23830 | ||
|
|
44a8b797fb | ||
|
|
cdede298a9 | ||
|
|
f6ac4d3559 | ||
|
|
7e1531dbca | ||
|
|
9aeb422157 | ||
|
|
fba0f8cf8e | ||
|
|
0f4a5227e1 | ||
|
|
d16a752b43 | ||
|
|
4d9aed90d6 | ||
|
|
4bec27fd49 | ||
|
|
be3bd74bb7 | ||
|
|
f1720b7bbc | ||
|
|
7a79a18d8f | ||
|
|
472034c950 | ||
|
|
0b14cee817 | ||
|
|
b50ab56f9e | ||
|
|
26d30663c4 | ||
|
|
ffecc390eb | ||
|
|
252ca04084 | ||
|
|
aae5c56a31 | ||
|
|
6670446037 | ||
|
|
bd39b07bb5 | ||
|
|
a9438b6121 | ||
|
|
f546cf4521 | ||
|
|
43efa78750 | ||
|
|
9e3de43802 | ||
|
|
dc615e432e | ||
|
|
cf9caa6af5 | ||
|
|
15f748358d | ||
|
|
b30d648623 | ||
|
|
33d70560b8 | ||
|
|
865a49d2e8 | ||
|
|
4fca68c25c | ||
|
|
f131a0c1c2 | ||
|
|
cd4368fa79 | ||
|
|
4ec4b160b0 | ||
|
|
a585b4957f | ||
|
|
e6b02b3bed | ||
|
|
1ef0ec0432 | ||
|
|
2e87bd86a1 | ||
|
|
0228a0d023 | ||
|
|
6365f3749d | ||
|
|
25c18130f9 | ||
|
|
436c19634d | ||
|
|
1a6facc685 | ||
|
|
bd0093c8ea | ||
|
|
e150280010 | ||
|
|
827fd5e472 | ||
|
|
f89fbc67b9 | ||
|
|
c567a88892 | ||
|
|
6a39d7fca5 | ||
|
|
a15e67f065 | ||
|
|
7a1bce9578 | ||
|
|
f2b4de7943 | ||
|
|
b3ff4ac6d9 | ||
|
|
1c56e7fab5 | ||
|
|
70ba4df385 | ||
|
|
8062c705e8 | ||
|
|
fafb23c1a6 | ||
|
|
4e7ac7030c | ||
|
|
4803daca5a | ||
|
|
facfc61316 | ||
|
|
e3e495bfb1 | ||
|
|
e007284d2f | ||
|
|
1da8416ebd | ||
|
|
79b49a469c | ||
|
|
5888efcaef | ||
|
|
459d1b4f56 | ||
|
|
9151102bda | ||
|
|
3819984add | ||
|
|
3b58fbc186 | ||
|
|
55e589b3d9 | ||
|
|
e64d64d8d8 | ||
|
|
37c2d9135b | ||
|
|
30c96221bd | ||
|
|
bf7305e3f8 | ||
|
|
3b12a229c3 | ||
|
|
5726ceb8dc | ||
|
|
c06c06624d | ||
|
|
ad40d7071e | ||
|
|
f55a39eb90 | ||
|
|
c3869bee31 | ||
|
|
6eac15df0f | ||
|
|
6f5d3c32c3 | ||
|
|
68ef40e4d0 | ||
|
|
4046bc4f72 | ||
|
|
1b8d131915 | ||
|
|
f5ad332d28 | ||
|
|
938603ff60 | ||
|
|
17af78f2bb | ||
|
|
7588267743 | ||
|
|
ed4f9c8176 | ||
|
|
bbb46e88b0 | ||
|
|
3db7aac0d8 | ||
|
|
fdbbd2e563 | ||
|
|
da2aaff9e5 | ||
|
|
4bba692170 | ||
|
|
59b61cd8be | ||
|
|
247b013e16 | ||
|
|
3c56f1f076 | ||
|
|
7fee1fcc74 | ||
|
|
d7931777bc | ||
|
|
bb48d55bd4 | ||
|
|
610b02968e | ||
|
|
a7112c42df | ||
|
|
8a474a3b00 | ||
|
|
59e18d155e | ||
|
|
12ca5d8063 | ||
|
|
c959e0a928 | ||
|
|
89a08b021d | ||
|
|
04b553cdec | ||
|
|
15e9ee30ee | ||
|
|
a0d650a86c | ||
|
|
1a6ad48e08 | ||
|
|
7c82eeb018 | ||
|
|
b188e74ee0 | ||
|
|
ff790eeefb | ||
|
|
97e918da03 | ||
|
|
4f30998873 | ||
|
|
a0fc478a28 | ||
|
|
bb03fd1968 | ||
|
|
0c65f74662 | ||
|
|
29ac2bd4f5 | ||
|
|
0d8b4f32e8 | ||
|
|
83db7f24eb | ||
|
|
5f9976a193 | ||
|
|
9480ef485b | ||
|
|
a9b7432584 | ||
|
|
6d7081910f | ||
|
|
aa96089ab4 | ||
|
|
58ae681417 | ||
|
|
c038e0af5e | ||
|
|
4f9976c0cb | ||
|
|
e308e5ed57 | ||
|
|
7b1b1ca994 | ||
|
|
551be49a1a | ||
|
|
a3888e6902 | ||
|
|
43bb6a0dd8 | ||
|
|
05863acbcd | ||
|
|
0e4cd06137 | ||
|
|
85d2d974e7 | ||
|
|
3f021f9552 | ||
|
|
4688870984 |
1
.gitattributes
vendored
Normal file
1
.gitattributes
vendored
Normal file
@@ -0,0 +1 @@
|
|||||||
|
*.java text eol=lf
|
||||||
1
.github/PULL_REQUEST_TEMPLATE.md
vendored
1
.github/PULL_REQUEST_TEMPLATE.md
vendored
@@ -7,7 +7,6 @@ We love getting PRs, but we hate asking people for the same basic changes every
|
|||||||
- [ ] Push your changes to a branch other than `master`. Create your PR from that branch.
|
- [ ] Push your changes to a branch other than `master`. Create your PR from that branch.
|
||||||
- [ ] Add JavaDocs and other comments
|
- [ ] Add JavaDocs and other comments
|
||||||
- [ ] Write tests that run and pass in CI. See [CONTRIBUTING.md](CONTRIBUTING.md) for details on how to capture snapshot data.
|
- [ ] Write tests that run and pass in CI. See [CONTRIBUTING.md](CONTRIBUTING.md) for details on how to capture snapshot data.
|
||||||
- [ ] Run `mvn clean compile` locally. This may reformat your code, commit those changes.
|
|
||||||
- [ ] Run `mvn -D enable-ci clean install site` locally. If this command doesn't succeed, your change will not pass CI.
|
- [ ] Run `mvn -D enable-ci clean install site` locally. If this command doesn't succeed, your change will not pass CI.
|
||||||
|
|
||||||
# When creating a PR:
|
# When creating a PR:
|
||||||
|
|||||||
34
.github/workflows/maven-build.yml
vendored
34
.github/workflows/maven-build.yml
vendored
@@ -2,14 +2,18 @@ name: CI
|
|||||||
|
|
||||||
on: [push, pull_request]
|
on: [push, pull_request]
|
||||||
|
|
||||||
|
# this is required by spotless for JDK 16+
|
||||||
|
env:
|
||||||
|
JAVA_11_PLUS_MAVEN_OPTS: "--add-opens jdk.compiler/com.sun.tools.javac.util=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.file=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.parser=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.tree=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.api=ALL-UNNAMED"
|
||||||
|
|
||||||
jobs:
|
jobs:
|
||||||
build:
|
build:
|
||||||
name: build-only (Java ${{ matrix.java }})
|
name: build-only (Java ${{ matrix.java }})
|
||||||
runs-on: ubuntu-latest
|
runs-on: ubuntu-latest
|
||||||
strategy:
|
strategy:
|
||||||
|
fail-fast: false
|
||||||
matrix:
|
matrix:
|
||||||
java: [ 13 ]
|
java: [ 16 ]
|
||||||
steps:
|
steps:
|
||||||
- uses: actions/checkout@v2
|
- uses: actions/checkout@v2
|
||||||
- name: Set up JDK
|
- name: Set up JDK
|
||||||
@@ -17,18 +21,21 @@ jobs:
|
|||||||
with:
|
with:
|
||||||
java-version: ${{ matrix.java }}
|
java-version: ${{ matrix.java }}
|
||||||
- name: Cached .m2
|
- name: Cached .m2
|
||||||
uses: actions/cache@v2
|
uses: actions/cache@v2.1.4
|
||||||
with:
|
with:
|
||||||
path: ~/.m2/repository
|
path: ~/.m2/repository
|
||||||
key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
|
key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
|
||||||
restore-keys: |
|
restore-keys: |
|
||||||
${{ runner.os }}-maven-
|
${{ runner.os }}-maven-
|
||||||
- name: Maven Install (skipTests)
|
- name: Maven Install (skipTests)
|
||||||
|
env:
|
||||||
|
MAVEN_OPTS: ${{ env.JAVA_11_PLUS_MAVEN_OPTS }}
|
||||||
run: mvn -B install -DskipTests -D enable-ci --file pom.xml
|
run: mvn -B install -DskipTests -D enable-ci --file pom.xml
|
||||||
site:
|
site:
|
||||||
name: site (Java ${{ matrix.java }})
|
name: site (Java ${{ matrix.java }})
|
||||||
runs-on: ubuntu-latest
|
runs-on: ubuntu-latest
|
||||||
strategy:
|
strategy:
|
||||||
|
fail-fast: false
|
||||||
matrix:
|
matrix:
|
||||||
java: [ 8, 11 ]
|
java: [ 8, 11 ]
|
||||||
steps:
|
steps:
|
||||||
@@ -37,7 +44,7 @@ jobs:
|
|||||||
uses: actions/setup-java@v1
|
uses: actions/setup-java@v1
|
||||||
with:
|
with:
|
||||||
java-version: ${{ matrix.java }}
|
java-version: ${{ matrix.java }}
|
||||||
- uses: actions/cache@v2
|
- uses: actions/cache@v2.1.4
|
||||||
with:
|
with:
|
||||||
path: ~/.m2/repository
|
path: ~/.m2/repository
|
||||||
key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
|
key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
|
||||||
@@ -49,24 +56,37 @@ jobs:
|
|||||||
name: test (${{ matrix.os }}, Java ${{ matrix.java }})
|
name: test (${{ matrix.os }}, Java ${{ matrix.java }})
|
||||||
runs-on: ${{ matrix.os }}-latest
|
runs-on: ${{ matrix.os }}-latest
|
||||||
strategy:
|
strategy:
|
||||||
|
fail-fast: false
|
||||||
matrix:
|
matrix:
|
||||||
os: [ ubuntu, windows ]
|
os: [ ubuntu, windows ]
|
||||||
java: [ 8, 11, 13, 15-ea ]
|
java: [ 8, 11, 16 ]
|
||||||
steps:
|
steps:
|
||||||
- uses: actions/checkout@v2
|
- uses: actions/checkout@v2
|
||||||
- name: Set up JDK
|
- name: Set up JDK
|
||||||
uses: actions/setup-java@v1
|
uses: actions/setup-java@v1
|
||||||
with:
|
with:
|
||||||
java-version: ${{ matrix.java }}
|
java-version: ${{ matrix.java }}
|
||||||
- uses: actions/cache@v2
|
- uses: actions/cache@v2.1.4
|
||||||
with:
|
with:
|
||||||
path: ~/.m2/repository
|
path: ~/.m2/repository
|
||||||
key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
|
key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
|
||||||
restore-keys: |
|
restore-keys: |
|
||||||
${{ runner.os }}-maven-
|
${{ runner.os }}-maven-
|
||||||
|
# JDK 8
|
||||||
- name: Maven Install without Code Coverage
|
- name: Maven Install without Code Coverage
|
||||||
if: matrix.os == 'windows'
|
if: matrix.os == 'windows' && matrix.java == '8'
|
||||||
run: mvn -B install --file pom.xml
|
run: mvn -B install --file pom.xml
|
||||||
- name: Maven Install with Code Coverage
|
- name: Maven Install with Code Coverage
|
||||||
if: matrix.os != 'windows'
|
if: matrix.os != 'windows' && matrix.java == '8'
|
||||||
|
run: mvn -B install -D enable-ci --file pom.xml
|
||||||
|
# JDK 11+
|
||||||
|
- name: Maven Install without Code Coverage
|
||||||
|
if: matrix.os == 'windows' && matrix.java != '8'
|
||||||
|
env:
|
||||||
|
MAVEN_OPTS: ${{ env.JAVA_11_PLUS_MAVEN_OPTS }}
|
||||||
|
run: mvn -B install --file pom.xml
|
||||||
|
- name: Maven Install with Code Coverage
|
||||||
|
if: matrix.os != 'windows' && matrix.java != '8'
|
||||||
|
env:
|
||||||
|
MAVEN_OPTS: ${{ env.JAVA_11_PLUS_MAVEN_OPTS }}
|
||||||
run: mvn -B install -D enable-ci --file pom.xml
|
run: mvn -B install -D enable-ci --file pom.xml
|
||||||
|
|||||||
@@ -14,10 +14,14 @@ Example:
|
|||||||
|
|
||||||
This the default behavior.
|
This the default behavior.
|
||||||
|
|
||||||
|
Example for a single test case:
|
||||||
|
|
||||||
|
`mvn install -Dtest=WireMockStatusReporterTest#user_whenProxying_AuthCorrectlyConfigured`
|
||||||
|
|
||||||
|
|
||||||
### Setting up credential
|
### Setting up credential
|
||||||
|
|
||||||
1. Create an OAuth token on github.com
|
1. Create a "Personal access token" on https://github.com/ (`Settings` > `Developer settings` > `Personal access tokens`)
|
||||||
2. Set the GITHUB_OAUTH environment variable to the value of that token
|
2. Set the GITHUB_OAUTH environment variable to the value of that token
|
||||||
3. Set the system property `test.github.useProxy` (usually like "-Dtest.github.useProxy" as a Java VM option)
|
3. Set the system property `test.github.useProxy` (usually like "-Dtest.github.useProxy" as a Java VM option)
|
||||||
|
|
||||||
@@ -27,21 +31,37 @@ This the default behavior.
|
|||||||
|
|
||||||
`WireMockStatusReporterTest: GitHub proxying and user auth correctly configured for user login: <your login>`
|
`WireMockStatusReporterTest: GitHub proxying and user auth correctly configured for user login: <your login>`
|
||||||
|
|
||||||
Whenever you run tests with `-Dtest.github.useProxy`, they will try to get data from local files but will fallback to proxying to github if not found.
|
Whenever you run tests with `-Dtest.github.useProxy`, they will try to get data from local files but will fallback to proxying to GitHub if not found.
|
||||||
|
|
||||||
|
|
||||||
### Writing a new test
|
### Writing a new test
|
||||||
|
|
||||||
Once you have credentials setup, you add new test classes and test methods as you would normally.
|
Once you have credentials setup, you add new test classes and test methods as you would normally.
|
||||||
Keep `useProxy` enabled and iterate on your tests as needed. Remember, while proxying your tests are interacting with GitHub - you will need to clean up your state between runs.
|
|
||||||
|
|
||||||
When you are ready to create a snapshot of your test data,
|
#### Running tests using GitHub test proxy
|
||||||
run your test with `test.github.takeSnapshot` ("-Dtest.github.takeSnapshot" as a Java VM option). For example:
|
|
||||||
|
|
||||||
`mvn install -Dtest.github.takeSnapshot -Dtest=YourTestClassName`
|
Keep `useProxy` enabled and iterate on your tests as needed. With `useProxy` enabled your tests will interact with
|
||||||
|
GitHub - you will need to clean up your server-state between runs. This can be done manually to start with.
|
||||||
|
Once your test code is somewhat stable, use `getGitHubBeforeAfter()` to get a `GitHub` instance for test setup and cleanup.
|
||||||
|
Interactions with that `GitHub` instance will not be recorded as part of the test, keeping the test data files to a minimum.
|
||||||
|
|
||||||
The above command would create snapshot WireMock data files under the path `src/test/resources/org/kohsuhke/github/YourTestClassName/wiremock`.
|
#### Running tests against your personal GitHub user account
|
||||||
Each method would get a separate director that would hold the data files for that test method.
|
|
||||||
|
By default, test helper methods such as `getTempRepository()` target the `hub4j-test-org` GitHub organization.
|
||||||
|
Please request access to this org to record your tests before submitting a PR. This helps keep the project stable and nimble.
|
||||||
|
Until you have access (or if you don't want access), you can set the following additional system property to target
|
||||||
|
your personal github account.
|
||||||
|
|
||||||
|
`mvn install -Dtest.github.org=false -Dtest=YourTestClassName`
|
||||||
|
|
||||||
|
#### Taking a snapshot
|
||||||
|
|
||||||
|
When you are ready to create a snapshot of your test data, run your test with `test.github.takeSnapshot` ("-Dtest.github.takeSnapshot" as
|
||||||
|
a Java VM option). For example:
|
||||||
|
|
||||||
|
`mvn install -Dtest.github.takeSnapshot -Dtest.github.org=false -Dtest=YourTestClassName`
|
||||||
|
|
||||||
|
The above command will create snapshot WireMock data files under the path `src/test/resources/org/kohsuhke/github/YourTestClassName/wiremock`.
|
||||||
|
Each method will get a separate directory that will hold the data files for that test method.
|
||||||
|
|
||||||
Add all files including the generated data to your commit and submit a PR.
|
Add all files including the generated data to your commit and submit a PR.
|
||||||
|
|
||||||
|
|||||||
217
pom.xml
217
pom.xml
@@ -2,7 +2,7 @@
|
|||||||
<modelVersion>4.0.0</modelVersion>
|
<modelVersion>4.0.0</modelVersion>
|
||||||
<groupId>org.kohsuke</groupId>
|
<groupId>org.kohsuke</groupId>
|
||||||
<artifactId>github-api</artifactId>
|
<artifactId>github-api</artifactId>
|
||||||
<version>1.117</version>
|
<version>1.125</version>
|
||||||
<name>GitHub API for Java</name>
|
<name>GitHub API for Java</name>
|
||||||
<url>https://github-api.kohsuke.org/</url>
|
<url>https://github-api.kohsuke.org/</url>
|
||||||
<description>GitHub API for Java</description>
|
<description>GitHub API for Java</description>
|
||||||
@@ -11,7 +11,7 @@
|
|||||||
<connection>scm:git:git@github.com/hub4j/${project.artifactId}.git</connection>
|
<connection>scm:git:git@github.com/hub4j/${project.artifactId}.git</connection>
|
||||||
<developerConnection>scm:git:ssh://git@github.com/hub4j/${project.artifactId}.git</developerConnection>
|
<developerConnection>scm:git:ssh://git@github.com/hub4j/${project.artifactId}.git</developerConnection>
|
||||||
<url>https://github.com/hub4j/github-api/</url>
|
<url>https://github.com/hub4j/github-api/</url>
|
||||||
<tag>github-api-1.117</tag>
|
<tag>github-api-1.125</tag>
|
||||||
</scm>
|
</scm>
|
||||||
|
|
||||||
<distributionManagement>
|
<distributionManagement>
|
||||||
@@ -33,19 +33,20 @@
|
|||||||
|
|
||||||
<properties>
|
<properties>
|
||||||
<project.build.sourceEncoding>UTF-8</project.build.sourceEncoding>
|
<project.build.sourceEncoding>UTF-8</project.build.sourceEncoding>
|
||||||
<spotbugs-maven-plugin.version>4.0.4</spotbugs-maven-plugin.version>
|
<spotbugs-maven-plugin.version>4.2.0</spotbugs-maven-plugin.version>
|
||||||
<spotbugs.version>4.1.2</spotbugs.version>
|
<spotbugs.version>4.2.1</spotbugs.version>
|
||||||
<spotbugs-maven-plugin.failOnError>true</spotbugs-maven-plugin.failOnError>
|
<spotbugs-maven-plugin.failOnError>true</spotbugs-maven-plugin.failOnError>
|
||||||
<hamcrest.version>2.2</hamcrest.version>
|
<hamcrest.version>2.2</hamcrest.version>
|
||||||
<okhttp3.version>4.4.1</okhttp3.version>
|
<okhttp3.version>4.4.1</okhttp3.version>
|
||||||
<okio.version>2.5.0</okio.version>
|
<okio.version>2.5.0</okio.version>
|
||||||
<formatter-maven-plugin.goal>format</formatter-maven-plugin.goal>
|
|
||||||
<impsort-maven-plugin.goal>sort</impsort-maven-plugin.goal>
|
|
||||||
<!-- Using this as the minimum bar for code coverage. Adding methods without covering them will fail this. -->
|
<!-- Using this as the minimum bar for code coverage. Adding methods without covering them will fail this. -->
|
||||||
<jacoco.coverage.target.bundle.method>0.60</jacoco.coverage.target.bundle.method>
|
<jacoco.coverage.target.bundle.method>0.70</jacoco.coverage.target.bundle.method>
|
||||||
<jacoco.coverage.target.class.method>0.25</jacoco.coverage.target.class.method>
|
<jacoco.coverage.target.class.method>0.50</jacoco.coverage.target.class.method>
|
||||||
<!-- For non-ci builds we'd like the build to still complete if jacoco metrics aren't met. -->
|
<!-- For non-ci builds we'd like the build to still complete if jacoco metrics aren't met. -->
|
||||||
<jacoco.haltOnFailure>false</jacoco.haltOnFailure>
|
<jacoco.haltOnFailure>false</jacoco.haltOnFailure>
|
||||||
|
<jjwt.suite.version>0.11.2</jjwt.suite.version>
|
||||||
|
|
||||||
|
<surefire.argLine />
|
||||||
</properties>
|
</properties>
|
||||||
|
|
||||||
<build>
|
<build>
|
||||||
@@ -153,59 +154,39 @@
|
|||||||
<!-- Sample only -->
|
<!-- Sample only -->
|
||||||
<exclude>org.kohsuke.github.example.*</exclude>
|
<exclude>org.kohsuke.github.example.*</exclude>
|
||||||
|
|
||||||
<!-- No methods -->
|
|
||||||
<exclude>org.kohsuke.github.Previews</exclude>
|
|
||||||
|
|
||||||
<!-- Deprecated -->
|
<!-- Deprecated -->
|
||||||
<exclude>org.kohsuke.github.extras.OkHttp3Connector</exclude>
|
<exclude>org.kohsuke.github.extras.OkHttp3Connector</exclude>
|
||||||
<exclude>org.kohsuke.github.EnforcementLevel</exclude>
|
<exclude>org.kohsuke.github.EnforcementLevel</exclude>
|
||||||
<exclude>org.kohsuke.github.GHPerson.1</exclude>
|
<exclude>org.kohsuke.github.GHPerson.1</exclude>
|
||||||
|
<!-- TODO: Some coverage, but more needed -->
|
||||||
<!-- These fail coverage on windows because tests are disabled -->
|
<exclude>org.kohsuke.github.GHPullRequestReviewBuilder.DraftReviewComment</exclude>
|
||||||
<exclude>org.kohsuke.github.GHAsset</exclude>
|
<exclude>org.kohsuke.github.GHIssue.PullRequest</exclude>
|
||||||
<exclude>org.kohsuke.github.GHReleaseBuilder</exclude>
|
<exclude>org.kohsuke.github.GHCommitSearchBuilder</exclude>
|
||||||
<exclude>org.kohsuke.github.GHRelease</exclude>
|
<exclude>org.kohsuke.github.GHRepositorySearchBuilder</exclude>
|
||||||
|
<exclude>org.kohsuke.github.GHUserSearchBuilder</exclude>
|
||||||
|
|
||||||
<!-- TODO: These still need test coverage -->
|
<!-- TODO: These still need test coverage -->
|
||||||
<exclude>org.kohsuke.github.GHBranchProtection.RequiredSignatures</exclude>
|
<exclude>org.kohsuke.github.GHBranchProtection.RequiredSignatures</exclude>
|
||||||
<exclude>org.kohsuke.github.GHBranchProtectionBuilder.Restrictions</exclude>
|
<exclude>org.kohsuke.github.GHBranchProtectionBuilder.Restrictions</exclude>
|
||||||
<exclude>org.kohsuke.github.GHBranchProtection.Restrictions</exclude>
|
<exclude>org.kohsuke.github.GHBranchProtection.Restrictions</exclude>
|
||||||
<exclude>org.kohsuke.github.GHCommentAuthorAssociation</exclude>
|
<exclude>org.kohsuke.github.GHCommentAuthorAssociation</exclude>
|
||||||
<exclude>org.kohsuke.github.GHCommitBuilder.UserInfo</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHCommitState</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHCompare.Commit</exclude>
|
<exclude>org.kohsuke.github.GHCompare.Commit</exclude>
|
||||||
<exclude>org.kohsuke.github.GHCompare.InnerCommit</exclude>
|
<exclude>org.kohsuke.github.GHCompare.InnerCommit</exclude>
|
||||||
<exclude>org.kohsuke.github.GHCompare.Status</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHCompare.Tree</exclude>
|
<exclude>org.kohsuke.github.GHCompare.Tree</exclude>
|
||||||
<exclude>org.kohsuke.github.GHCompare.User</exclude>
|
<exclude>org.kohsuke.github.GHCompare.User</exclude>
|
||||||
<exclude>org.kohsuke.github.GHCompare</exclude>
|
<exclude>org.kohsuke.github.GHCompare</exclude>
|
||||||
<exclude>org.kohsuke.github.GHDeployKey</exclude>
|
<exclude>org.kohsuke.github.GHDeployKey</exclude>
|
||||||
<exclude>org.kohsuke.github.GHDeploymentStatusBuilder</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHDirection</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHEmail</exclude>
|
<exclude>org.kohsuke.github.GHEmail</exclude>
|
||||||
<exclude>org.kohsuke.github.GHEventPayload.Ping</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHEventPayload.Release</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHException</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHHook</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHHooks.OrgContext</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHInvitation</exclude>
|
<exclude>org.kohsuke.github.GHInvitation</exclude>
|
||||||
<exclude>org.kohsuke.github.GHMilestoneState</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHOrgHook</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHProject.ProjectStateFilter</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.Authorship</exclude>
|
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.Authorship</exclude>
|
||||||
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.Commit</exclude>
|
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.Commit</exclude>
|
||||||
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.CommitPointer</exclude>
|
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.CommitPointer</exclude>
|
||||||
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.Tree</exclude>
|
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.Tree</exclude>
|
||||||
<exclude>org.kohsuke.github.GHPullRequestCommitDetail</exclude>
|
<exclude>org.kohsuke.github.GHPullRequestCommitDetail</exclude>
|
||||||
<exclude>org.kohsuke.github.GHPullRequestFileDetail</exclude>
|
<exclude>org.kohsuke.github.GHPullRequestFileDetail</exclude>
|
||||||
<exclude>org.kohsuke.github.GHPullRequestQueryBuilder.Sort</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHReleaseUpdater</exclude>
|
<exclude>org.kohsuke.github.GHReleaseUpdater</exclude>
|
||||||
<exclude>org.kohsuke.github.GHRepository.ForkSort</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHRequestedAction</exclude>
|
<exclude>org.kohsuke.github.GHRequestedAction</exclude>
|
||||||
<exclude>org.kohsuke.github.GHStargazer</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHTagObject</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHTeam.Role</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHUserSearchBuilder.Sort</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHVerifiedKey</exclude>
|
<exclude>org.kohsuke.github.GHVerifiedKey</exclude>
|
||||||
</excludes>
|
</excludes>
|
||||||
</rule>
|
</rule>
|
||||||
@@ -261,7 +242,7 @@
|
|||||||
<plugin>
|
<plugin>
|
||||||
<groupId>org.apache.maven.plugins</groupId>
|
<groupId>org.apache.maven.plugins</groupId>
|
||||||
<artifactId>maven-project-info-reports-plugin</artifactId>
|
<artifactId>maven-project-info-reports-plugin</artifactId>
|
||||||
<version>3.1.0</version>
|
<version>3.1.1</version>
|
||||||
<dependencies>
|
<dependencies>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>org.apache.bcel</groupId>
|
<groupId>org.apache.bcel</groupId>
|
||||||
@@ -293,18 +274,7 @@
|
|||||||
<id>default-test</id>
|
<id>default-test</id>
|
||||||
<configuration>
|
<configuration>
|
||||||
<excludesFile>src/test/resources/slow-or-flaky-tests.txt</excludesFile>
|
<excludesFile>src/test/resources/slow-or-flaky-tests.txt</excludesFile>
|
||||||
</configuration>
|
<argLine>${surefire.argLine}</argLine>
|
||||||
</execution>
|
|
||||||
<execution>
|
|
||||||
<id>slow-or-flaky-test</id>
|
|
||||||
<phase>test</phase>
|
|
||||||
<goals>
|
|
||||||
<goal>test</goal>
|
|
||||||
</goals>
|
|
||||||
<configuration>
|
|
||||||
<rerunFailingTestsCount>2</rerunFailingTestsCount>
|
|
||||||
<!-- There are some tests that take longer or are a little flaky. Run them here. -->
|
|
||||||
<includesFile>src/test/resources/slow-or-flaky-tests.txt</includesFile>
|
|
||||||
</configuration>
|
</configuration>
|
||||||
</execution>
|
</execution>
|
||||||
</executions>
|
</executions>
|
||||||
@@ -312,7 +282,7 @@
|
|||||||
<plugin>
|
<plugin>
|
||||||
<groupId>org.codehaus.mojo</groupId>
|
<groupId>org.codehaus.mojo</groupId>
|
||||||
<artifactId>animal-sniffer-maven-plugin</artifactId>
|
<artifactId>animal-sniffer-maven-plugin</artifactId>
|
||||||
<version>1.19</version>
|
<version>1.20</version>
|
||||||
<configuration>
|
<configuration>
|
||||||
<signature>
|
<signature>
|
||||||
<groupId>org.codehaus.mojo.signature</groupId>
|
<groupId>org.codehaus.mojo.signature</groupId>
|
||||||
@@ -343,37 +313,35 @@
|
|||||||
</executions>
|
</executions>
|
||||||
</plugin>
|
</plugin>
|
||||||
<plugin>
|
<plugin>
|
||||||
<groupId>net.revelc.code.formatter</groupId>
|
<groupId>com.diffplug.spotless</groupId>
|
||||||
<artifactId>formatter-maven-plugin</artifactId>
|
<artifactId>spotless-maven-plugin</artifactId>
|
||||||
<version>2.12.1</version>
|
<version>2.8.1</version>
|
||||||
<executions>
|
<executions>
|
||||||
<execution>
|
<execution>
|
||||||
|
<id>spotless-check</id>
|
||||||
|
<!-- runs in verify phase by default -->
|
||||||
<goals>
|
<goals>
|
||||||
<goal>${formatter-maven-plugin.goal}</goal>
|
<!-- can be disabled using -Dspotless.check.skip=true -->
|
||||||
</goals>
|
<goal>check</goal>
|
||||||
<configuration>
|
|
||||||
<configFile>src/main/resources/eclipse/formatter.xml</configFile>
|
|
||||||
<cachedir>${project.build.directory}/.cache</cachedir>
|
|
||||||
</configuration>
|
|
||||||
</execution>
|
|
||||||
</executions>
|
|
||||||
</plugin>
|
|
||||||
<plugin>
|
|
||||||
<groupId>net.revelc.code</groupId>
|
|
||||||
<artifactId>impsort-maven-plugin</artifactId>
|
|
||||||
<version>1.4.1</version>
|
|
||||||
<configuration>
|
|
||||||
<groups>*,java.,javax.</groups>
|
|
||||||
<removeUnused>true</removeUnused>
|
|
||||||
<staticAfter>true</staticAfter>
|
|
||||||
</configuration>
|
|
||||||
<executions>
|
|
||||||
<execution>
|
|
||||||
<goals>
|
|
||||||
<goal>${impsort-maven-plugin.goal}</goal>
|
|
||||||
</goals>
|
</goals>
|
||||||
</execution>
|
</execution>
|
||||||
</executions>
|
</executions>
|
||||||
|
<configuration>
|
||||||
|
<java>
|
||||||
|
<eclipse>
|
||||||
|
<file>${basedir}/src/build/eclipse/formatter.xml</file>
|
||||||
|
</eclipse>
|
||||||
|
|
||||||
|
<importOrder>
|
||||||
|
<file>${basedir}/src/build/eclipse/eclipse.importorder</file>
|
||||||
|
</importOrder>
|
||||||
|
<removeUnusedImports />
|
||||||
|
|
||||||
|
<trimTrailingWhitespace />
|
||||||
|
<endWithNewline />
|
||||||
|
|
||||||
|
</java>
|
||||||
|
</configuration>
|
||||||
</plugin>
|
</plugin>
|
||||||
<plugin>
|
<plugin>
|
||||||
<groupId>com.github.spotbugs</groupId>
|
<groupId>com.github.spotbugs</groupId>
|
||||||
@@ -410,6 +378,12 @@
|
|||||||
<artifactId>commons-lang3</artifactId>
|
<artifactId>commons-lang3</artifactId>
|
||||||
<version>3.9</version>
|
<version>3.9</version>
|
||||||
</dependency>
|
</dependency>
|
||||||
|
<dependency>
|
||||||
|
<groupId>com.tngtech.archunit</groupId>
|
||||||
|
<artifactId>archunit</artifactId>
|
||||||
|
<version>0.17.0</version>
|
||||||
|
<scope>test</scope>
|
||||||
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>org.hamcrest</groupId>
|
<groupId>org.hamcrest</groupId>
|
||||||
<artifactId>hamcrest</artifactId>
|
<artifactId>hamcrest</artifactId>
|
||||||
@@ -432,13 +406,19 @@
|
|||||||
<dependency>
|
<dependency>
|
||||||
<groupId>junit</groupId>
|
<groupId>junit</groupId>
|
||||||
<artifactId>junit</artifactId>
|
<artifactId>junit</artifactId>
|
||||||
<version>4.13.1</version>
|
<version>4.13.2</version>
|
||||||
|
<scope>test</scope>
|
||||||
|
</dependency>
|
||||||
|
<dependency>
|
||||||
|
<groupId>org.awaitility</groupId>
|
||||||
|
<artifactId>awaitility</artifactId>
|
||||||
|
<version>4.0.3</version>
|
||||||
<scope>test</scope>
|
<scope>test</scope>
|
||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>com.fasterxml.jackson.core</groupId>
|
<groupId>com.fasterxml.jackson.core</groupId>
|
||||||
<artifactId>jackson-databind</artifactId>
|
<artifactId>jackson-databind</artifactId>
|
||||||
<version>2.10.2</version>
|
<version>2.12.1</version>
|
||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>commons-io</groupId>
|
<groupId>commons-io</groupId>
|
||||||
@@ -469,7 +449,7 @@
|
|||||||
<dependency>
|
<dependency>
|
||||||
<groupId>org.kohsuke.stapler</groupId>
|
<groupId>org.kohsuke.stapler</groupId>
|
||||||
<artifactId>stapler</artifactId>
|
<artifactId>stapler</artifactId>
|
||||||
<version>1.260</version>
|
<version>1.262</version>
|
||||||
<scope>test</scope>
|
<scope>test</scope>
|
||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
@@ -481,26 +461,26 @@
|
|||||||
<dependency>
|
<dependency>
|
||||||
<groupId>org.eclipse.jgit</groupId>
|
<groupId>org.eclipse.jgit</groupId>
|
||||||
<artifactId>org.eclipse.jgit</artifactId>
|
<artifactId>org.eclipse.jgit</artifactId>
|
||||||
<version>5.9.0.202009080501-r</version>
|
<version>5.10.0.202012080955-r</version>
|
||||||
<scope>test</scope>
|
<scope>test</scope>
|
||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>io.jsonwebtoken</groupId>
|
<groupId>io.jsonwebtoken</groupId>
|
||||||
<artifactId>jjwt-api</artifactId>
|
<artifactId>jjwt-api</artifactId>
|
||||||
<version>0.11.2</version>
|
<version>${jjwt.suite.version}</version>
|
||||||
<scope>test</scope>
|
<optional>true</optional>
|
||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>io.jsonwebtoken</groupId>
|
<groupId>io.jsonwebtoken</groupId>
|
||||||
<artifactId>jjwt-impl</artifactId>
|
<artifactId>jjwt-impl</artifactId>
|
||||||
<version>0.11.2</version>
|
<version>${jjwt.suite.version}</version>
|
||||||
<scope>test</scope>
|
<optional>true</optional>
|
||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>io.jsonwebtoken</groupId>
|
<groupId>io.jsonwebtoken</groupId>
|
||||||
<artifactId>jjwt-jackson</artifactId>
|
<artifactId>jjwt-jackson</artifactId>
|
||||||
<version>0.11.2</version>
|
<version>${jjwt.suite.version}</version>
|
||||||
<scope>test</scope>
|
<optional>true</optional>
|
||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>com.squareup.okio</groupId>
|
<groupId>com.squareup.okio</groupId>
|
||||||
@@ -537,7 +517,7 @@
|
|||||||
<dependency>
|
<dependency>
|
||||||
<groupId>org.mockito</groupId>
|
<groupId>org.mockito</groupId>
|
||||||
<artifactId>mockito-core</artifactId>
|
<artifactId>mockito-core</artifactId>
|
||||||
<version>3.6.0</version>
|
<version>3.7.7</version>
|
||||||
<scope>test</scope>
|
<scope>test</scope>
|
||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
@@ -561,7 +541,7 @@
|
|||||||
<dependency>
|
<dependency>
|
||||||
<groupId>org.slf4j</groupId>
|
<groupId>org.slf4j</groupId>
|
||||||
<artifactId>slf4j-simple</artifactId>
|
<artifactId>slf4j-simple</artifactId>
|
||||||
<version>1.7.2</version>
|
<version>1.7.30</version>
|
||||||
<scope>test</scope>
|
<scope>test</scope>
|
||||||
</dependency>
|
</dependency>
|
||||||
</dependencies>
|
</dependencies>
|
||||||
@@ -578,6 +558,48 @@
|
|||||||
</pluginRepository>
|
</pluginRepository>
|
||||||
</pluginRepositories>
|
</pluginRepositories>
|
||||||
<profiles>
|
<profiles>
|
||||||
|
<!-- only enable slow-or-flaky-test if -Dtest= is not present -->
|
||||||
|
<profile>
|
||||||
|
<id>slow-or-flaky-test</id>
|
||||||
|
<activation>
|
||||||
|
<property>
|
||||||
|
<name>!test</name>
|
||||||
|
</property>
|
||||||
|
</activation>
|
||||||
|
<build>
|
||||||
|
<plugins>
|
||||||
|
<plugin>
|
||||||
|
<artifactId>maven-surefire-plugin</artifactId>
|
||||||
|
<executions>
|
||||||
|
<execution>
|
||||||
|
<id>slow-or-flaky-test</id>
|
||||||
|
<phase>test</phase>
|
||||||
|
<goals>
|
||||||
|
<goal>test</goal>
|
||||||
|
</goals>
|
||||||
|
<configuration>
|
||||||
|
<rerunFailingTestsCount>2</rerunFailingTestsCount>
|
||||||
|
<!-- There are some tests that take longer or are a little
|
||||||
|
flaky. Run them here. -->
|
||||||
|
<includesFile>src/test/resources/slow-or-flaky-tests.txt</includesFile>
|
||||||
|
<argLine>${surefire.argLine}</argLine>
|
||||||
|
</configuration>
|
||||||
|
</execution>
|
||||||
|
</executions>
|
||||||
|
</plugin>
|
||||||
|
</plugins>
|
||||||
|
</build>
|
||||||
|
</profile>
|
||||||
|
<profile>
|
||||||
|
<id>jdk11+</id>
|
||||||
|
<activation>
|
||||||
|
<jdk>[11,)</jdk>
|
||||||
|
</activation>
|
||||||
|
<properties>
|
||||||
|
<!-- this is required for GithubHttpUrlConnectionClient#setRequestMethod() to work with JDK 16+ -->
|
||||||
|
<surefire.argLine>--add-opens java.base/java.net=ALL-UNNAMED</surefire.argLine>
|
||||||
|
</properties>
|
||||||
|
</profile>
|
||||||
<profile>
|
<profile>
|
||||||
<id>ci-non-windows</id>
|
<id>ci-non-windows</id>
|
||||||
<activation>
|
<activation>
|
||||||
@@ -589,8 +611,8 @@
|
|||||||
</os>
|
</os>
|
||||||
</activation>
|
</activation>
|
||||||
<properties>
|
<properties>
|
||||||
<formatter-maven-plugin.goal>validate</formatter-maven-plugin.goal>
|
<!-- Only fail code coverage on non-windows machines -->
|
||||||
<impsort-maven-plugin.goal>check</impsort-maven-plugin.goal>
|
<jacoco.haltOnFailure>true</jacoco.haltOnFailure>
|
||||||
</properties>
|
</properties>
|
||||||
</profile>
|
</profile>
|
||||||
<profile>
|
<profile>
|
||||||
@@ -600,24 +622,31 @@
|
|||||||
<name>enable-ci</name>
|
<name>enable-ci</name>
|
||||||
</property>
|
</property>
|
||||||
</activation>
|
</activation>
|
||||||
<properties>
|
|
||||||
<jacoco.haltOnFailure>true</jacoco.haltOnFailure>
|
|
||||||
</properties>
|
|
||||||
<build>
|
<build>
|
||||||
<plugins>
|
<plugins>
|
||||||
<plugin>
|
<plugin>
|
||||||
<groupId>org.jacoco</groupId>
|
<groupId>org.jacoco</groupId>
|
||||||
<artifactId>jacoco-maven-plugin</artifactId>
|
<artifactId>jacoco-maven-plugin</artifactId>
|
||||||
</plugin>
|
</plugin>
|
||||||
|
<plugin>
|
||||||
|
<groupId>com.diffplug.spotless</groupId>
|
||||||
|
<artifactId>spotless-maven-plugin</artifactId>
|
||||||
|
<executions>
|
||||||
|
<execution>
|
||||||
|
<id>spotless-check</id>
|
||||||
|
<!-- In CI, run check early in the build -->
|
||||||
|
<phase>process-sources</phase>
|
||||||
|
<goals>
|
||||||
|
<goal>check</goal>
|
||||||
|
</goals>
|
||||||
|
</execution>
|
||||||
|
</executions>
|
||||||
|
</plugin>
|
||||||
</plugins>
|
</plugins>
|
||||||
</build>
|
</build>
|
||||||
</profile>
|
</profile>
|
||||||
<profile>
|
<profile>
|
||||||
<id>release</id>
|
<id>release</id>
|
||||||
<properties>
|
|
||||||
<formatter-maven-plugin.goal>validate</formatter-maven-plugin.goal>
|
|
||||||
<impsort-maven-plugin.goal>check</impsort-maven-plugin.goal>
|
|
||||||
</properties>
|
|
||||||
<build>
|
<build>
|
||||||
<plugins>
|
<plugins>
|
||||||
<plugin>
|
<plugin>
|
||||||
|
|||||||
6
src/build/eclipse/eclipse.importorder
Normal file
6
src/build/eclipse/eclipse.importorder
Normal file
@@ -0,0 +1,6 @@
|
|||||||
|
#Organize Import Order
|
||||||
|
# Import this file in Window -> Preferences -> Java -> Code Style -> Organize Imports -> Import...
|
||||||
|
0=
|
||||||
|
1=java
|
||||||
|
2=javax
|
||||||
|
3=\#
|
||||||
@@ -38,7 +38,7 @@ import javax.annotation.Nonnull;
|
|||||||
* Intermediate return type for this builder returned by calls to {@link #with(String, Object)}. If {@link S}
|
* Intermediate return type for this builder returned by calls to {@link #with(String, Object)}. If {@link S}
|
||||||
* the same as {@link R}, this builder will commit changes after each call to {@link #with(String, Object)}.
|
* the same as {@link R}, this builder will commit changes after each call to {@link #with(String, Object)}.
|
||||||
*/
|
*/
|
||||||
abstract class AbstractBuilder<R, S> {
|
abstract class AbstractBuilder<R, S> extends GitHubInteractiveObject {
|
||||||
|
|
||||||
@Nonnull
|
@Nonnull
|
||||||
private final Class<R> returnType;
|
private final Class<R> returnType;
|
||||||
@@ -75,6 +75,7 @@ abstract class AbstractBuilder<R, S> {
|
|||||||
@Nonnull Class<S> intermediateReturnType,
|
@Nonnull Class<S> intermediateReturnType,
|
||||||
@Nonnull GitHub root,
|
@Nonnull GitHub root,
|
||||||
@CheckForNull R baseInstance) {
|
@CheckForNull R baseInstance) {
|
||||||
|
super(root);
|
||||||
this.requester = root.createRequest();
|
this.requester = root.createRequest();
|
||||||
this.returnType = finalReturnType;
|
this.returnType = finalReturnType;
|
||||||
this.commitChangesImmediately = returnType.equals(intermediateReturnType);
|
this.commitChangesImmediately = returnType.equals(intermediateReturnType);
|
||||||
@@ -97,7 +98,7 @@ abstract class AbstractBuilder<R, S> {
|
|||||||
* if there is an I/O Exception
|
* if there is an I/O Exception
|
||||||
*/
|
*/
|
||||||
@Nonnull
|
@Nonnull
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public R done() throws IOException {
|
public R done() throws IOException {
|
||||||
R result;
|
R result;
|
||||||
@@ -127,7 +128,7 @@ abstract class AbstractBuilder<R, S> {
|
|||||||
* if an I/O error occurs
|
* if an I/O error occurs
|
||||||
*/
|
*/
|
||||||
@Nonnull
|
@Nonnull
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
protected S with(@Nonnull String name, Object value) throws IOException {
|
protected S with(@Nonnull String name, Object value) throws IOException {
|
||||||
requester.with(name, value);
|
requester.with(name, value);
|
||||||
@@ -148,7 +149,7 @@ abstract class AbstractBuilder<R, S> {
|
|||||||
* if an I/O error occurs
|
* if an I/O error occurs
|
||||||
*/
|
*/
|
||||||
@Nonnull
|
@Nonnull
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
protected S continueOrDone() throws IOException {
|
protected S continueOrDone() throws IOException {
|
||||||
// This little bit of roughness in this base class means all inheriting builders get to create Updater and
|
// This little bit of roughness in this base class means all inheriting builders get to create Updater and
|
||||||
|
|||||||
18
src/main/java/org/kohsuke/github/BetaApi.java
Normal file
18
src/main/java/org/kohsuke/github/BetaApi.java
Normal file
@@ -0,0 +1,18 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import java.lang.annotation.Documented;
|
||||||
|
import java.lang.annotation.Retention;
|
||||||
|
import java.lang.annotation.RetentionPolicy;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Indicates that the method/class/etc marked is a beta implementation of an sdk feature.
|
||||||
|
* <p>
|
||||||
|
* These APIs are subject to change and not a part of the backward compatibility commitment. Always used in conjunction
|
||||||
|
* with 'deprecated' to raise awareness to clients.
|
||||||
|
* </p>
|
||||||
|
*
|
||||||
|
*/
|
||||||
|
@Retention(RetentionPolicy.RUNTIME)
|
||||||
|
@Documented
|
||||||
|
public @interface BetaApi {
|
||||||
|
}
|
||||||
@@ -5,7 +5,7 @@ import java.net.URL;
|
|||||||
import java.util.List;
|
import java.util.List;
|
||||||
import java.util.Map;
|
import java.util.Map;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.MACHINE_MAN;
|
import static org.kohsuke.github.internal.Previews.MACHINE_MAN;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* A Github App.
|
* A Github App.
|
||||||
@@ -15,7 +15,6 @@ import static org.kohsuke.github.Previews.MACHINE_MAN;
|
|||||||
*/
|
*/
|
||||||
public class GHApp extends GHObject {
|
public class GHApp extends GHObject {
|
||||||
|
|
||||||
private GitHub root;
|
|
||||||
private GHUser owner;
|
private GHUser owner;
|
||||||
private String name;
|
private String name;
|
||||||
private String description;
|
private String description;
|
||||||
@@ -189,7 +188,7 @@ public class GHApp extends GHObject {
|
|||||||
* @return a list of App installations
|
* @return a list of App installations
|
||||||
* @see <a href="https://developer.github.com/v3/apps/#list-installations">List installations</a>
|
* @see <a href="https://developer.github.com/v3/apps/#list-installations">List installations</a>
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(MACHINE_MAN)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public PagedIterable<GHAppInstallation> listInstallations() {
|
public PagedIterable<GHAppInstallation> listInstallations() {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
@@ -210,7 +209,7 @@ public class GHApp extends GHObject {
|
|||||||
* on error
|
* on error
|
||||||
* @see <a href="https://developer.github.com/v3/apps/#get-an-installation">Get an installation</a>
|
* @see <a href="https://developer.github.com/v3/apps/#get-an-installation">Get an installation</a>
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(MACHINE_MAN)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppInstallation getInstallationById(long id) throws IOException {
|
public GHAppInstallation getInstallationById(long id) throws IOException {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
@@ -233,7 +232,7 @@ public class GHApp extends GHObject {
|
|||||||
* @see <a href="https://developer.github.com/v3/apps/#get-an-organization-installation">Get an organization
|
* @see <a href="https://developer.github.com/v3/apps/#get-an-organization-installation">Get an organization
|
||||||
* installation</a>
|
* installation</a>
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(MACHINE_MAN)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppInstallation getInstallationByOrganization(String name) throws IOException {
|
public GHAppInstallation getInstallationByOrganization(String name) throws IOException {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
@@ -258,7 +257,7 @@ public class GHApp extends GHObject {
|
|||||||
* @see <a href="https://developer.github.com/v3/apps/#get-a-repository-installation">Get a repository
|
* @see <a href="https://developer.github.com/v3/apps/#get-a-repository-installation">Get a repository
|
||||||
* installation</a>
|
* installation</a>
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(MACHINE_MAN)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppInstallation getInstallationByRepository(String ownerName, String repositoryName) throws IOException {
|
public GHAppInstallation getInstallationByRepository(String ownerName, String repositoryName) throws IOException {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
@@ -280,7 +279,7 @@ public class GHApp extends GHObject {
|
|||||||
* on error
|
* on error
|
||||||
* @see <a href="https://developer.github.com/v3/apps/#get-a-user-installation">Get a user installation</a>
|
* @see <a href="https://developer.github.com/v3/apps/#get-a-user-installation">Get a user installation</a>
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(MACHINE_MAN)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppInstallation getInstallationByUser(String name) throws IOException {
|
public GHAppInstallation getInstallationByUser(String name) throws IOException {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
|
|||||||
@@ -5,7 +5,7 @@ import java.util.HashMap;
|
|||||||
import java.util.List;
|
import java.util.List;
|
||||||
import java.util.Map;
|
import java.util.Map;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.MACHINE_MAN;
|
import static org.kohsuke.github.internal.Previews.MACHINE_MAN;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a access token for a GitHub App Installation
|
* Creates a access token for a GitHub App Installation
|
||||||
@@ -14,12 +14,11 @@ import static org.kohsuke.github.Previews.MACHINE_MAN;
|
|||||||
* @see GHAppInstallation#createToken(Map) GHAppInstallation#createToken(Map)
|
* @see GHAppInstallation#createToken(Map) GHAppInstallation#createToken(Map)
|
||||||
* @see GHAppInstallation#createToken() GHAppInstallation#createToken()
|
* @see GHAppInstallation#createToken() GHAppInstallation#createToken()
|
||||||
*/
|
*/
|
||||||
public class GHAppCreateTokenBuilder {
|
public class GHAppCreateTokenBuilder extends GitHubInteractiveObject {
|
||||||
private final GitHub root;
|
|
||||||
protected final Requester builder;
|
protected final Requester builder;
|
||||||
private final String apiUrlTail;
|
private final String apiUrlTail;
|
||||||
|
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
GHAppCreateTokenBuilder(GitHub root, String apiUrlTail) {
|
GHAppCreateTokenBuilder(GitHub root, String apiUrlTail) {
|
||||||
this.root = root;
|
this.root = root;
|
||||||
@@ -27,7 +26,7 @@ public class GHAppCreateTokenBuilder {
|
|||||||
this.builder = root.createRequest();
|
this.builder = root.createRequest();
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
GHAppCreateTokenBuilder(GitHub root, String apiUrlTail, Map<String, GHPermissionType> permissions) {
|
GHAppCreateTokenBuilder(GitHub root, String apiUrlTail, Map<String, GHPermissionType> permissions) {
|
||||||
this(root, apiUrlTail);
|
this(root, apiUrlTail);
|
||||||
@@ -43,7 +42,7 @@ public class GHAppCreateTokenBuilder {
|
|||||||
* Array containing the repositories Ids
|
* Array containing the repositories Ids
|
||||||
* @return a GHAppCreateTokenBuilder
|
* @return a GHAppCreateTokenBuilder
|
||||||
*/
|
*/
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppCreateTokenBuilder repositoryIds(List<Long> repositoryIds) {
|
public GHAppCreateTokenBuilder repositoryIds(List<Long> repositoryIds) {
|
||||||
this.builder.with("repository_ids", repositoryIds);
|
this.builder.with("repository_ids", repositoryIds);
|
||||||
@@ -58,7 +57,7 @@ public class GHAppCreateTokenBuilder {
|
|||||||
* Map containing the permission names and types.
|
* Map containing the permission names and types.
|
||||||
* @return a GHAppCreateTokenBuilder
|
* @return a GHAppCreateTokenBuilder
|
||||||
*/
|
*/
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppCreateTokenBuilder permissions(Map<String, GHPermissionType> permissions) {
|
public GHAppCreateTokenBuilder permissions(Map<String, GHPermissionType> permissions) {
|
||||||
Map<String, String> retMap = new HashMap<>();
|
Map<String, String> retMap = new HashMap<>();
|
||||||
@@ -78,7 +77,7 @@ public class GHAppCreateTokenBuilder {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* on error
|
* on error
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(MACHINE_MAN)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppInstallationToken create() throws IOException {
|
public GHAppInstallationToken create() throws IOException {
|
||||||
return builder.method("POST")
|
return builder.method("POST")
|
||||||
|
|||||||
@@ -8,8 +8,8 @@ import java.net.URL;
|
|||||||
import java.util.List;
|
import java.util.List;
|
||||||
import java.util.Map;
|
import java.util.Map;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.GAMBIT;
|
import static org.kohsuke.github.internal.Previews.GAMBIT;
|
||||||
import static org.kohsuke.github.Previews.MACHINE_MAN;
|
import static org.kohsuke.github.internal.Previews.MACHINE_MAN;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* A Github App Installation.
|
* A Github App Installation.
|
||||||
@@ -22,7 +22,6 @@ import static org.kohsuke.github.Previews.MACHINE_MAN;
|
|||||||
* @see GHApp#getInstallationByUser(String) GHApp#getInstallationByUser(String)
|
* @see GHApp#getInstallationByUser(String) GHApp#getInstallationByUser(String)
|
||||||
*/
|
*/
|
||||||
public class GHAppInstallation extends GHObject {
|
public class GHAppInstallation extends GHObject {
|
||||||
private GitHub root;
|
|
||||||
private GHUser account;
|
private GHUser account;
|
||||||
|
|
||||||
@JsonProperty("access_tokens_url")
|
@JsonProperty("access_tokens_url")
|
||||||
@@ -124,7 +123,7 @@ public class GHAppInstallation extends GHObject {
|
|||||||
*
|
*
|
||||||
* @return the paged iterable
|
* @return the paged iterable
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(MACHINE_MAN)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public PagedSearchIterable<GHRepository> listRepositories() {
|
public PagedSearchIterable<GHRepository> listRepositories() {
|
||||||
GitHubRequest request;
|
GitHubRequest request;
|
||||||
@@ -322,7 +321,7 @@ public class GHAppInstallation extends GHObject {
|
|||||||
* on error
|
* on error
|
||||||
* @see <a href="https://developer.github.com/v3/apps/#delete-an-installation">Delete an installation</a>
|
* @see <a href="https://developer.github.com/v3/apps/#delete-an-installation">Delete an installation</a>
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(GAMBIT)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public void deleteInstallation() throws IOException {
|
public void deleteInstallation() throws IOException {
|
||||||
root.createRequest()
|
root.createRequest()
|
||||||
@@ -344,7 +343,7 @@ public class GHAppInstallation extends GHObject {
|
|||||||
* @return a GHAppCreateTokenBuilder instance
|
* @return a GHAppCreateTokenBuilder instance
|
||||||
* @deprecated Use {@link GHAppInstallation#createToken()} instead.
|
* @deprecated Use {@link GHAppInstallation#createToken()} instead.
|
||||||
*/
|
*/
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppCreateTokenBuilder createToken(Map<String, GHPermissionType> permissions) {
|
public GHAppCreateTokenBuilder createToken(Map<String, GHPermissionType> permissions) {
|
||||||
return new GHAppCreateTokenBuilder(root,
|
return new GHAppCreateTokenBuilder(root,
|
||||||
@@ -361,7 +360,7 @@ public class GHAppInstallation extends GHObject {
|
|||||||
*
|
*
|
||||||
* @return a GHAppCreateTokenBuilder instance
|
* @return a GHAppCreateTokenBuilder instance
|
||||||
*/
|
*/
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppCreateTokenBuilder createToken() {
|
public GHAppCreateTokenBuilder createToken() {
|
||||||
return new GHAppCreateTokenBuilder(root, String.format("/app/installations/%d/access_tokens", getId()));
|
return new GHAppCreateTokenBuilder(root, String.format("/app/installations/%d/access_tokens", getId()));
|
||||||
|
|||||||
@@ -14,9 +14,7 @@ import java.util.Map;
|
|||||||
* @author Paulo Miguel Almeida
|
* @author Paulo Miguel Almeida
|
||||||
* @see GHAppInstallation#createToken(Map) GHAppInstallation#createToken(Map)
|
* @see GHAppInstallation#createToken(Map) GHAppInstallation#createToken(Map)
|
||||||
*/
|
*/
|
||||||
public class GHAppInstallationToken {
|
public class GHAppInstallationToken extends GitHubInteractiveObject {
|
||||||
private GitHub root;
|
|
||||||
|
|
||||||
private String token;
|
private String token;
|
||||||
protected String expires_at;
|
protected String expires_at;
|
||||||
private Map<String, String> permissions;
|
private Map<String, String> permissions;
|
||||||
|
|||||||
@@ -9,7 +9,6 @@ import java.net.URL;
|
|||||||
* @see GHRelease#getAssets() GHRelease#getAssets()
|
* @see GHRelease#getAssets() GHRelease#getAssets()
|
||||||
*/
|
*/
|
||||||
public class GHAsset extends GHObject {
|
public class GHAsset extends GHObject {
|
||||||
GitHub root;
|
|
||||||
GHRepository owner;
|
GHRepository owner;
|
||||||
private String name;
|
private String name;
|
||||||
private String label;
|
private String label;
|
||||||
|
|||||||
@@ -33,7 +33,6 @@ public class GHAuthorization extends GHObject {
|
|||||||
public static final String WRITE_KEY = "write:public_key";
|
public static final String WRITE_KEY = "write:public_key";
|
||||||
public static final String ADMIN_KEY = "admin:public_key";
|
public static final String ADMIN_KEY = "admin:public_key";
|
||||||
|
|
||||||
private GitHub root;
|
|
||||||
private List<String> scopes;
|
private List<String> scopes;
|
||||||
private String token;
|
private String token;
|
||||||
private String token_last_eight;
|
private String token_last_eight;
|
||||||
|
|||||||
@@ -3,6 +3,7 @@ package org.kohsuke.github;
|
|||||||
import com.fasterxml.jackson.annotation.JsonCreator;
|
import com.fasterxml.jackson.annotation.JsonCreator;
|
||||||
import com.fasterxml.jackson.annotation.JsonProperty;
|
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
@@ -20,8 +21,7 @@ import javax.annotation.CheckForNull;
|
|||||||
value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD",
|
value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD",
|
||||||
"URF_UNREAD_FIELD" },
|
"URF_UNREAD_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public class GHBranch {
|
public class GHBranch extends GitHubInteractiveObject {
|
||||||
private GitHub root;
|
|
||||||
private GHRepository owner;
|
private GHRepository owner;
|
||||||
|
|
||||||
private String name;
|
private String name;
|
||||||
@@ -78,7 +78,7 @@ public class GHBranch {
|
|||||||
*
|
*
|
||||||
* @return true if the push to this branch is restricted via branch protection.
|
* @return true if the push to this branch is restricted via branch protection.
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(Previews.LUKE_CAGE)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public boolean isProtected() {
|
public boolean isProtected() {
|
||||||
return protection;
|
return protection;
|
||||||
@@ -89,7 +89,7 @@ public class GHBranch {
|
|||||||
*
|
*
|
||||||
* @return API URL that deals with the protection of this branch.
|
* @return API URL that deals with the protection of this branch.
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(Previews.LUKE_CAGE)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public URL getProtectionUrl() {
|
public URL getProtectionUrl() {
|
||||||
return GitHubClient.parseURL(protection_url);
|
return GitHubClient.parseURL(protection_url);
|
||||||
@@ -102,6 +102,8 @@ public class GHBranch {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
|
@Preview(Previews.LUKE_CAGE)
|
||||||
|
@Deprecated
|
||||||
public GHBranchProtection getProtection() throws IOException {
|
public GHBranchProtection getProtection() throws IOException {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
.withPreview(Previews.LUKE_CAGE)
|
.withPreview(Previews.LUKE_CAGE)
|
||||||
@@ -135,7 +137,7 @@ public class GHBranch {
|
|||||||
* @return GHBranchProtectionBuilder for enabling protection
|
* @return GHBranchProtectionBuilder for enabling protection
|
||||||
* @see GHCommitStatus#getContext() GHCommitStatus#getContext()
|
* @see GHCommitStatus#getContext() GHCommitStatus#getContext()
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(Previews.LUKE_CAGE)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHBranchProtectionBuilder enableProtection() {
|
public GHBranchProtectionBuilder enableProtection() {
|
||||||
return new GHBranchProtectionBuilder(this);
|
return new GHBranchProtectionBuilder(this);
|
||||||
|
|||||||
@@ -6,7 +6,7 @@ import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
|||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.util.Collection;
|
import java.util.Collection;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.ZZZAX;
|
import static org.kohsuke.github.internal.Previews.ZZZAX;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The type GHBranchProtection.
|
* The type GHBranchProtection.
|
||||||
@@ -17,14 +17,12 @@ import static org.kohsuke.github.Previews.ZZZAX;
|
|||||||
value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD",
|
value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD",
|
||||||
"URF_UNREAD_FIELD" },
|
"URF_UNREAD_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public class GHBranchProtection {
|
public class GHBranchProtection extends GitHubInteractiveObject {
|
||||||
private static final String REQUIRE_SIGNATURES_URI = "/required_signatures";
|
private static final String REQUIRE_SIGNATURES_URI = "/required_signatures";
|
||||||
|
|
||||||
@JsonProperty
|
@JsonProperty
|
||||||
private EnforceAdmins enforceAdmins;
|
private EnforceAdmins enforceAdmins;
|
||||||
|
|
||||||
private GitHub root;
|
|
||||||
|
|
||||||
@JsonProperty("required_pull_request_reviews")
|
@JsonProperty("required_pull_request_reviews")
|
||||||
private RequiredReviews requiredReviews;
|
private RequiredReviews requiredReviews;
|
||||||
|
|
||||||
@@ -43,7 +41,7 @@ public class GHBranchProtection {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(ZZZAX)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public void enabledSignedCommits() throws IOException {
|
public void enabledSignedCommits() throws IOException {
|
||||||
requester().method("POST").withUrlPath(url + REQUIRE_SIGNATURES_URI).fetch(RequiredSignatures.class);
|
requester().method("POST").withUrlPath(url + REQUIRE_SIGNATURES_URI).fetch(RequiredSignatures.class);
|
||||||
@@ -55,7 +53,7 @@ public class GHBranchProtection {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(ZZZAX)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public void disableSignedCommits() throws IOException {
|
public void disableSignedCommits() throws IOException {
|
||||||
requester().method("DELETE").withUrlPath(url + REQUIRE_SIGNATURES_URI).send();
|
requester().method("DELETE").withUrlPath(url + REQUIRE_SIGNATURES_URI).send();
|
||||||
@@ -86,7 +84,7 @@ public class GHBranchProtection {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(ZZZAX)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public boolean getRequiredSignatures() throws IOException {
|
public boolean getRequiredSignatures() throws IOException {
|
||||||
return requester().withUrlPath(url + REQUIRE_SIGNATURES_URI).fetch(RequiredSignatures.class).enabled;
|
return requester().withUrlPath(url + REQUIRE_SIGNATURES_URI).fetch(RequiredSignatures.class).enabled;
|
||||||
|
|||||||
@@ -12,7 +12,7 @@ import java.util.List;
|
|||||||
import java.util.Map;
|
import java.util.Map;
|
||||||
import java.util.Set;
|
import java.util.Set;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.*;
|
import static org.kohsuke.github.internal.Previews.LUKE_CAGE;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Builder to configure the branch protection settings.
|
* Builder to configure the branch protection settings.
|
||||||
|
|||||||
@@ -1,8 +1,13 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
import com.fasterxml.jackson.annotation.JsonProperty;
|
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||||
|
import com.infradna.tool.bridge_method_injector.WithBridgeMethods;
|
||||||
import edu.umd.cs.findbugs.annotations.NonNull;
|
import edu.umd.cs.findbugs.annotations.NonNull;
|
||||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
|
import org.kohsuke.github.GHWorkflowRun.Conclusion;
|
||||||
|
import org.kohsuke.github.GHWorkflowRun.Status;
|
||||||
|
import org.kohsuke.github.internal.EnumUtils;
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
@@ -10,6 +15,7 @@ import java.util.Arrays;
|
|||||||
import java.util.Collections;
|
import java.util.Collections;
|
||||||
import java.util.Date;
|
import java.util.Date;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
|
import java.util.Locale;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Represents a check run.
|
* Represents a check run.
|
||||||
@@ -22,7 +28,6 @@ public class GHCheckRun extends GHObject {
|
|||||||
|
|
||||||
@JsonProperty("repository")
|
@JsonProperty("repository")
|
||||||
GHRepository owner;
|
GHRepository owner;
|
||||||
GitHub root;
|
|
||||||
|
|
||||||
private String status;
|
private String status;
|
||||||
private String conclusion;
|
private String conclusion;
|
||||||
@@ -80,12 +85,27 @@ public class GHCheckRun extends GHObject {
|
|||||||
* @return Status of the check run
|
* @return Status of the check run
|
||||||
* @see Status
|
* @see Status
|
||||||
*/
|
*/
|
||||||
public String getStatus() {
|
@WithBridgeMethods(value = String.class, adapterMethod = "statusAsStr")
|
||||||
|
public Status getStatus() {
|
||||||
|
return Status.from(status);
|
||||||
|
}
|
||||||
|
|
||||||
|
@SuppressFBWarnings(value = "UPM_UNCALLED_PRIVATE_METHOD", justification = "Bridge method of getStatus")
|
||||||
|
private Object statusAsStr(Status status, Class type) {
|
||||||
return status;
|
return status;
|
||||||
}
|
}
|
||||||
|
|
||||||
public static enum Status {
|
public static enum Status {
|
||||||
QUEUED, IN_PROGRESS, COMPLETED
|
QUEUED, IN_PROGRESS, COMPLETED, UNKNOWN;
|
||||||
|
|
||||||
|
public static Status from(String value) {
|
||||||
|
return EnumUtils.getNullableEnumOrDefault(Status.class, value, Status.UNKNOWN);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String toString() {
|
||||||
|
return name().toLowerCase(Locale.ROOT);
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -94,7 +114,13 @@ public class GHCheckRun extends GHObject {
|
|||||||
* @return Status of the check run
|
* @return Status of the check run
|
||||||
* @see Conclusion
|
* @see Conclusion
|
||||||
*/
|
*/
|
||||||
public String getConclusion() {
|
@WithBridgeMethods(value = String.class, adapterMethod = "conclusionAsStr")
|
||||||
|
public Conclusion getConclusion() {
|
||||||
|
return Conclusion.from(conclusion);
|
||||||
|
}
|
||||||
|
|
||||||
|
@SuppressFBWarnings(value = "UPM_UNCALLED_PRIVATE_METHOD", justification = "Bridge method of getConclusion")
|
||||||
|
private Object conclusionAsStr(Conclusion conclusion, Class type) {
|
||||||
return conclusion;
|
return conclusion;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -105,7 +131,16 @@ public class GHCheckRun extends GHObject {
|
|||||||
* Parameters - <code>conclusion</code></a>.
|
* Parameters - <code>conclusion</code></a>.
|
||||||
*/
|
*/
|
||||||
public static enum Conclusion {
|
public static enum Conclusion {
|
||||||
SUCCESS, FAILURE, NEUTRAL, CANCELLED, TIMED_OUT, ACTION_REQUIRED, SKIPPED
|
ACTION_REQUIRED, CANCELLED, FAILURE, NEUTRAL, SUCCESS, SKIPPED, STALE, TIMED_OUT, UNKNOWN;
|
||||||
|
|
||||||
|
public static Conclusion from(String value) {
|
||||||
|
return EnumUtils.getNullableEnumOrDefault(Conclusion.class, value, Conclusion.UNKNOWN);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String toString() {
|
||||||
|
return name().toLowerCase(Locale.ROOT);
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -298,7 +333,7 @@ public class GHCheckRun extends GHObject {
|
|||||||
*
|
*
|
||||||
* @return a builder which you should customize, then call {@link GHCheckRunBuilder#create}
|
* @return a builder which you should customize, then call {@link GHCheckRunBuilder#create}
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(Previews.ANTIOPE)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public @NonNull GHCheckRunBuilder update() {
|
public @NonNull GHCheckRunBuilder update() {
|
||||||
return new GHCheckRunBuilder(owner, getId());
|
return new GHCheckRunBuilder(owner, getId());
|
||||||
|
|||||||
@@ -28,6 +28,7 @@ import com.fasterxml.jackson.annotation.JsonInclude;
|
|||||||
import edu.umd.cs.findbugs.annotations.CheckForNull;
|
import edu.umd.cs.findbugs.annotations.CheckForNull;
|
||||||
import edu.umd.cs.findbugs.annotations.NonNull;
|
import edu.umd.cs.findbugs.annotations.NonNull;
|
||||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.util.Collections;
|
import java.util.Collections;
|
||||||
@@ -46,7 +47,7 @@ import java.util.Locale;
|
|||||||
* @see <a href="https://developer.github.com/v3/checks/runs/#update-a-check-run">documentation</a>
|
* @see <a href="https://developer.github.com/v3/checks/runs/#update-a-check-run">documentation</a>
|
||||||
*/
|
*/
|
||||||
@SuppressFBWarnings(value = "URF_UNREAD_FIELD", justification = "Jackson serializes these even without a getter")
|
@SuppressFBWarnings(value = "URF_UNREAD_FIELD", justification = "Jackson serializes these even without a getter")
|
||||||
@Preview
|
@Preview(Previews.ANTIOPE)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public final class GHCheckRunBuilder {
|
public final class GHCheckRunBuilder {
|
||||||
|
|
||||||
@@ -151,7 +152,7 @@ public final class GHCheckRunBuilder {
|
|||||||
}
|
}
|
||||||
GHCheckRun run = requester.with("output", output).with("actions", actions).fetch(GHCheckRun.class).wrap(repo);
|
GHCheckRun run = requester.with("output", output).with("actions", actions).fetch(GHCheckRun.class).wrap(repo);
|
||||||
while (!extraAnnotations.isEmpty()) {
|
while (!extraAnnotations.isEmpty()) {
|
||||||
Output output2 = new Output(output.title, output.summary);
|
Output output2 = new Output(output.title, output.summary).withText(output.text);
|
||||||
int i = Math.min(extraAnnotations.size(), MAX_ANNOTATIONS);
|
int i = Math.min(extraAnnotations.size(), MAX_ANNOTATIONS);
|
||||||
output2.annotations = extraAnnotations.subList(0, i);
|
output2.annotations = extraAnnotations.subList(0, i);
|
||||||
extraAnnotations = extraAnnotations.subList(i, extraAnnotations.size());
|
extraAnnotations = extraAnnotations.subList(i, extraAnnotations.size());
|
||||||
|
|||||||
@@ -8,7 +8,7 @@ import javax.annotation.Nonnull;
|
|||||||
* Iterable for check-runs listing.
|
* Iterable for check-runs listing.
|
||||||
*/
|
*/
|
||||||
class GHCheckRunsIterable extends PagedIterable<GHCheckRun> {
|
class GHCheckRunsIterable extends PagedIterable<GHCheckRun> {
|
||||||
private GitHub root;
|
private final transient GitHub root;
|
||||||
private final GitHubRequest request;
|
private final GitHubRequest request;
|
||||||
|
|
||||||
private GHCheckRunsPage result;
|
private GHCheckRunsPage result;
|
||||||
|
|||||||
@@ -21,7 +21,6 @@ public class GHCheckSuite extends GHObject {
|
|||||||
|
|
||||||
@JsonProperty("repository")
|
@JsonProperty("repository")
|
||||||
GHRepository owner;
|
GHRepository owner;
|
||||||
GitHub root;
|
|
||||||
|
|
||||||
private String nodeId;
|
private String nodeId;
|
||||||
private String headBranch;
|
private String headBranch;
|
||||||
|
|||||||
@@ -11,7 +11,8 @@ import java.util.Collections;
|
|||||||
import java.util.Date;
|
import java.util.Date;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.GROOT;
|
import static org.kohsuke.github.internal.Previews.ANTIOPE;
|
||||||
|
import static org.kohsuke.github.internal.Previews.GROOT;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* A commit in a repository.
|
* A commit in a repository.
|
||||||
@@ -65,7 +66,7 @@ public class GHCommit {
|
|||||||
* @return the authored date
|
* @return the authored date
|
||||||
*/
|
*/
|
||||||
public Date getAuthoredDate() {
|
public Date getAuthoredDate() {
|
||||||
return GitHubClient.parseDate(author.date);
|
return author.getDate();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -84,7 +85,7 @@ public class GHCommit {
|
|||||||
* @return the commit date
|
* @return the commit date
|
||||||
*/
|
*/
|
||||||
public Date getCommitDate() {
|
public Date getCommitDate() {
|
||||||
return GitHubClient.parseDate(committer.date);
|
return committer.getDate();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -121,7 +122,6 @@ public class GHCommit {
|
|||||||
* @deprecated Use {@link GitUser} instead.
|
* @deprecated Use {@link GitUser} instead.
|
||||||
*/
|
*/
|
||||||
public static class GHAuthor extends GitUser {
|
public static class GHAuthor extends GitUser {
|
||||||
private String date;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -453,7 +453,7 @@ public class GHCommit {
|
|||||||
*
|
*
|
||||||
* @return {@link PagedIterable} with the pull requests which contain this commit
|
* @return {@link PagedIterable} with the pull requests which contain this commit
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(GROOT)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public PagedIterable<GHPullRequest> listPullRequests() {
|
public PagedIterable<GHPullRequest> listPullRequests() {
|
||||||
return owner.root.createRequest()
|
return owner.root.createRequest()
|
||||||
@@ -469,7 +469,7 @@ public class GHCommit {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(GROOT)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public PagedIterable<GHBranch> listBranchesWhereHead() throws IOException {
|
public PagedIterable<GHBranch> listBranchesWhereHead() throws IOException {
|
||||||
return owner.root.createRequest()
|
return owner.root.createRequest()
|
||||||
@@ -565,7 +565,7 @@ public class GHCommit {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* on error
|
* on error
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(ANTIOPE)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public PagedIterable<GHCheckRun> getCheckRuns() throws IOException {
|
public PagedIterable<GHCheckRun> getCheckRuns() throws IOException {
|
||||||
return owner.getCheckRuns(sha);
|
return owner.getCheckRuns(sha);
|
||||||
|
|||||||
@@ -5,7 +5,7 @@ import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
|||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.*;
|
import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* A comment attached to a commit (or a specific line in a specific file of a commit.)
|
* A comment attached to a commit (or a specific line in a specific file of a commit.)
|
||||||
@@ -121,7 +121,7 @@ public class GHCommitComment extends GHObject implements Reactable {
|
|||||||
this.body = body;
|
this.body = body;
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHReaction createReaction(ReactionContent content) throws IOException {
|
public GHReaction createReaction(ReactionContent content) throws IOException {
|
||||||
return owner.root.createRequest()
|
return owner.root.createRequest()
|
||||||
@@ -133,7 +133,7 @@ public class GHCommitComment extends GHObject implements Reactable {
|
|||||||
.wrap(owner.root);
|
.wrap(owner.root);
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public PagedIterable<GHReaction> listReactions() {
|
public PagedIterable<GHReaction> listReactions() {
|
||||||
return owner.root.createRequest()
|
return owner.root.createRequest()
|
||||||
|
|||||||
@@ -1,6 +1,7 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
import org.apache.commons.lang3.StringUtils;
|
import org.apache.commons.lang3.StringUtils;
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
|
|
||||||
@@ -10,7 +11,7 @@ import java.io.IOException;
|
|||||||
* @author Marc de Verdelhan
|
* @author Marc de Verdelhan
|
||||||
* @see GitHub#searchCommits() GitHub#searchCommits()
|
* @see GitHub#searchCommits() GitHub#searchCommits()
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(Previews.CLOAK)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public class GHCommitSearchBuilder extends GHSearchBuilder<GHCommit> {
|
public class GHCommitSearchBuilder extends GHSearchBuilder<GHCommit> {
|
||||||
GHCommitSearchBuilder(GitHub root) {
|
GHCommitSearchBuilder(GitHub root) {
|
||||||
|
|||||||
@@ -18,8 +18,6 @@ public class GHCommitStatus extends GHObject {
|
|||||||
String context;
|
String context;
|
||||||
GHUser creator;
|
GHUser creator;
|
||||||
|
|
||||||
private GitHub root;
|
|
||||||
|
|
||||||
GHCommitStatus wrapUp(GitHub root) {
|
GHCommitStatus wrapUp(GitHub root) {
|
||||||
if (creator != null)
|
if (creator != null)
|
||||||
creator.wrapUp(root);
|
creator.wrapUp(root);
|
||||||
|
|||||||
@@ -15,15 +15,13 @@ import java.util.Base64;
|
|||||||
* @see GHRepository#getFileContent(String) GHRepository#getFileContent(String)
|
* @see GHRepository#getFileContent(String) GHRepository#getFileContent(String)
|
||||||
*/
|
*/
|
||||||
@SuppressWarnings({ "UnusedDeclaration" })
|
@SuppressWarnings({ "UnusedDeclaration" })
|
||||||
public class GHContent implements Refreshable {
|
public class GHContent extends GitHubInteractiveObject implements Refreshable {
|
||||||
/*
|
/*
|
||||||
* In normal use of this class, repository field is set via wrap(), but in the code search API, there's a nested
|
* In normal use of this class, repository field is set via wrap(), but in the code search API, there's a nested
|
||||||
* 'repository' field that gets populated from JSON.
|
* 'repository' field that gets populated from JSON.
|
||||||
*/
|
*/
|
||||||
private GHRepository repository;
|
private GHRepository repository;
|
||||||
|
|
||||||
private GitHub root;
|
|
||||||
|
|
||||||
private String type;
|
private String type;
|
||||||
private String encoding;
|
private String encoding;
|
||||||
private long size;
|
private long size;
|
||||||
|
|||||||
@@ -1,168 +1,25 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.BAPTISE;
|
import static org.kohsuke.github.internal.Previews.BAPTISTE;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a repository
|
* Creates a repository
|
||||||
*
|
*
|
||||||
* @author Kohsuke Kawaguchi
|
* @author Kohsuke Kawaguchi
|
||||||
*/
|
*/
|
||||||
public class GHCreateRepositoryBuilder {
|
public class GHCreateRepositoryBuilder extends GHRepositoryBuilder<GHCreateRepositoryBuilder> {
|
||||||
private final GitHub root;
|
|
||||||
protected final Requester builder;
|
|
||||||
private String apiUrlTail;
|
|
||||||
|
|
||||||
GHCreateRepositoryBuilder(GitHub root, String apiUrlTail, String name) {
|
public GHCreateRepositoryBuilder(String name, GitHub root, String apiTail) {
|
||||||
this.root = root;
|
super(GHCreateRepositoryBuilder.class, root, null);
|
||||||
this.apiUrlTail = apiUrlTail;
|
requester.method("POST").withUrlPath(apiTail);
|
||||||
this.builder = root.createRequest();
|
|
||||||
this.builder.with("name", name);
|
try {
|
||||||
|
name(name);
|
||||||
|
} catch (IOException e) {
|
||||||
|
// not going to happen here
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
|
||||||
* Description for repository
|
|
||||||
*
|
|
||||||
* @param description
|
|
||||||
* description of repository
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder description(String description) {
|
|
||||||
this.builder.with("description", description);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Homepage for repository
|
|
||||||
*
|
|
||||||
* @param homepage
|
|
||||||
* homepage of repository
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder homepage(URL homepage) {
|
|
||||||
return homepage(homepage.toExternalForm());
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Homepage for repository
|
|
||||||
*
|
|
||||||
* @param homepage
|
|
||||||
* homepage of repository
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder homepage(String homepage) {
|
|
||||||
this.builder.with("homepage", homepage);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Creates a private repository
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* private if true
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder private_(boolean enabled) {
|
|
||||||
this.builder.with("private", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Enables issue tracker
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* true if enabled
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder issues(boolean enabled) {
|
|
||||||
this.builder.with("has_issues", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Enables projects
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* true if enabled
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder projects(boolean enabled) {
|
|
||||||
this.builder.with("has_projects", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Enables wiki
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* true if enabled
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder wiki(boolean enabled) {
|
|
||||||
this.builder.with("has_wiki", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Enables downloads
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* true if enabled
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder downloads(boolean enabled) {
|
|
||||||
this.builder.with("has_downloads", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* If true, create an initial commit with empty README.
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* true if enabled
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder autoInit(boolean enabled) {
|
|
||||||
this.builder.with("auto_init", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Allow or disallow squash-merging pull requests.
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* true if enabled
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder allowSquashMerge(boolean enabled) {
|
|
||||||
this.builder.with("allow_squash_merge", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Allow or disallow merging pull requests with a merge commit.
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* true if enabled
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder allowMergeCommit(boolean enabled) {
|
|
||||||
this.builder.with("allow_merge_commit", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Allow or disallow rebase-merging pull requests.
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* true if enabled
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder allowRebaseMerge(boolean enabled) {
|
|
||||||
this.builder.with("allow_rebase_merge", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -171,10 +28,11 @@ public class GHCreateRepositoryBuilder {
|
|||||||
* @param language
|
* @param language
|
||||||
* template to base the ignore file on
|
* template to base the ignore file on
|
||||||
* @return a builder to continue with building See https://developer.github.com/v3/repos/#create
|
* @return a builder to continue with building See https://developer.github.com/v3/repos/#create
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
*/
|
*/
|
||||||
public GHCreateRepositoryBuilder gitignoreTemplate(String language) {
|
public GHCreateRepositoryBuilder gitignoreTemplate(String language) throws IOException {
|
||||||
this.builder.with("gitignore_template", language);
|
return with("gitignore_template", language);
|
||||||
return this;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -183,10 +41,24 @@ public class GHCreateRepositoryBuilder {
|
|||||||
* @param license
|
* @param license
|
||||||
* template to base the license file on
|
* template to base the license file on
|
||||||
* @return a builder to continue with building See https://developer.github.com/v3/repos/#create
|
* @return a builder to continue with building See https://developer.github.com/v3/repos/#create
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
*/
|
*/
|
||||||
public GHCreateRepositoryBuilder licenseTemplate(String license) {
|
public GHCreateRepositoryBuilder licenseTemplate(String license) throws IOException {
|
||||||
this.builder.with("license_template", license);
|
return with("license_template", license);
|
||||||
return this;
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* If true, create an initial commit with empty README.
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
* @return a builder to continue with building
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public GHCreateRepositoryBuilder autoInit(boolean enabled) throws IOException {
|
||||||
|
return with("auto_init", enabled);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -195,10 +67,12 @@ public class GHCreateRepositoryBuilder {
|
|||||||
* @param team
|
* @param team
|
||||||
* team to grant access to
|
* team to grant access to
|
||||||
* @return a builder to continue with building
|
* @return a builder to continue with building
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
*/
|
*/
|
||||||
public GHCreateRepositoryBuilder team(GHTeam team) {
|
public GHCreateRepositoryBuilder team(GHTeam team) throws IOException {
|
||||||
if (team != null)
|
if (team != null)
|
||||||
this.builder.with("team_id", team.getId());
|
return with("team_id", team.getId());
|
||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -208,13 +82,13 @@ public class GHCreateRepositoryBuilder {
|
|||||||
* @param enabled
|
* @param enabled
|
||||||
* true if enabled
|
* true if enabled
|
||||||
* @return a builder to continue with building
|
* @return a builder to continue with building
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
* @deprecated Use {@link #isTemplate(boolean)} method instead
|
||||||
*/
|
*/
|
||||||
@Preview
|
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHCreateRepositoryBuilder templateRepository(boolean enabled) {
|
public GHCreateRepositoryBuilder templateRepository(boolean enabled) throws IOException {
|
||||||
this.builder.withPreview(BAPTISE);
|
return isTemplate(enabled);
|
||||||
this.builder.with("is_template", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -223,14 +97,15 @@ public class GHCreateRepositoryBuilder {
|
|||||||
* @param owner
|
* @param owner
|
||||||
* organization or personage
|
* organization or personage
|
||||||
* @return a builder to continue with building
|
* @return a builder to continue with building
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
*/
|
*/
|
||||||
public GHCreateRepositoryBuilder owner(String owner) {
|
public GHCreateRepositoryBuilder owner(String owner) throws IOException {
|
||||||
this.builder.with("owner", owner);
|
return with("owner", owner);
|
||||||
return this;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Create repository from template repository.
|
* Create repository from template repository
|
||||||
*
|
*
|
||||||
* @param templateOwner
|
* @param templateOwner
|
||||||
* template repository owner
|
* template repository owner
|
||||||
@@ -239,11 +114,10 @@ public class GHCreateRepositoryBuilder {
|
|||||||
* @return a builder to continue with building
|
* @return a builder to continue with building
|
||||||
* @see <a href="https://developer.github.com/v3/previews/">GitHub API Previews</a>
|
* @see <a href="https://developer.github.com/v3/previews/">GitHub API Previews</a>
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(BAPTISTE)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHCreateRepositoryBuilder fromTemplateRepository(String templateOwner, String templateRepo) {
|
public GHCreateRepositoryBuilder fromTemplateRepository(String templateOwner, String templateRepo) {
|
||||||
this.builder.withPreview(BAPTISE);
|
requester.withPreview(BAPTISTE).withUrlPath("/repos/" + templateOwner + "/" + templateRepo + "/generate");
|
||||||
this.apiUrlTail = "/repos/" + templateOwner + "/" + templateRepo + "/generate";
|
|
||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -252,10 +126,9 @@ public class GHCreateRepositoryBuilder {
|
|||||||
*
|
*
|
||||||
* @return the gh repository
|
* @return the gh repository
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* if repsitory cannot be created
|
* if repository cannot be created
|
||||||
*/
|
*/
|
||||||
public GHRepository create() throws IOException {
|
public GHRepository create() throws IOException {
|
||||||
return builder.method("POST").withUrlPath(apiUrlTail).fetch(GHRepository.class).wrap(root);
|
return done();
|
||||||
}
|
}
|
||||||
|
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -1,5 +1,7 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
import java.util.Map;
|
import java.util.Map;
|
||||||
@@ -14,7 +16,6 @@ import java.util.Map;
|
|||||||
*/
|
*/
|
||||||
public class GHDeployment extends GHObject {
|
public class GHDeployment extends GHObject {
|
||||||
private GHRepository owner;
|
private GHRepository owner;
|
||||||
private GitHub root;
|
|
||||||
protected String sha;
|
protected String sha;
|
||||||
protected String ref;
|
protected String ref;
|
||||||
protected String task;
|
protected String task;
|
||||||
@@ -24,6 +25,9 @@ public class GHDeployment extends GHObject {
|
|||||||
protected String statuses_url;
|
protected String statuses_url;
|
||||||
protected String repository_url;
|
protected String repository_url;
|
||||||
protected GHUser creator;
|
protected GHUser creator;
|
||||||
|
protected String original_environment;
|
||||||
|
protected boolean transient_environment;
|
||||||
|
protected boolean production_environment;
|
||||||
|
|
||||||
GHDeployment wrap(GHRepository owner) {
|
GHDeployment wrap(GHRepository owner) {
|
||||||
this.owner = owner;
|
this.owner = owner;
|
||||||
@@ -89,6 +93,19 @@ public class GHDeployment extends GHObject {
|
|||||||
return payload;
|
return payload;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The environment defined when the deployment was first created.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @return the original deployment environment
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.FLASH)
|
||||||
|
public String getOriginalEnvironment() {
|
||||||
|
return original_environment;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets environment.
|
* Gets environment.
|
||||||
*
|
*
|
||||||
@@ -98,6 +115,33 @@ public class GHDeployment extends GHObject {
|
|||||||
return environment;
|
return environment;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Specifies if the given environment is specific to the deployment and will no longer exist at some point in the
|
||||||
|
* future.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @return the environment is transient
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
public boolean isTransientEnvironment() {
|
||||||
|
return transient_environment;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Specifies if the given environment is one that end-users directly interact with.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @return the environment is used by end-users directly
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
public boolean isProductionEnvironment() {
|
||||||
|
return production_environment;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets creator.
|
* Gets creator.
|
||||||
*
|
*
|
||||||
@@ -154,6 +198,8 @@ public class GHDeployment extends GHObject {
|
|||||||
public PagedIterable<GHDeploymentStatus> listStatuses() {
|
public PagedIterable<GHDeploymentStatus> listStatuses() {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
.withUrlPath(statuses_url)
|
.withUrlPath(statuses_url)
|
||||||
|
.withPreview(Previews.ANT_MAN)
|
||||||
|
.withPreview(Previews.FLASH)
|
||||||
.toIterable(GHDeploymentStatus[].class, item -> item.wrap(owner));
|
.toIterable(GHDeploymentStatus[].class, item -> item.wrap(owner));
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
@@ -1,5 +1,7 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
|
|
||||||
@@ -19,7 +21,10 @@ public class GHDeploymentBuilder {
|
|||||||
*/
|
*/
|
||||||
public GHDeploymentBuilder(GHRepository repo) {
|
public GHDeploymentBuilder(GHRepository repo) {
|
||||||
this.repo = repo;
|
this.repo = repo;
|
||||||
this.builder = repo.root.createRequest().method("POST");
|
this.builder = repo.root.createRequest()
|
||||||
|
.withPreview(Previews.ANT_MAN)
|
||||||
|
.withPreview(Previews.FLASH)
|
||||||
|
.method("POST");
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -40,6 +45,7 @@ public class GHDeploymentBuilder {
|
|||||||
*
|
*
|
||||||
* @param branch
|
* @param branch
|
||||||
* the branch
|
* the branch
|
||||||
|
*
|
||||||
* @return the gh deployment builder
|
* @return the gh deployment builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentBuilder ref(String branch) {
|
public GHDeploymentBuilder ref(String branch) {
|
||||||
@@ -52,6 +58,7 @@ public class GHDeploymentBuilder {
|
|||||||
*
|
*
|
||||||
* @param task
|
* @param task
|
||||||
* the task
|
* the task
|
||||||
|
*
|
||||||
* @return the gh deployment builder
|
* @return the gh deployment builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentBuilder task(String task) {
|
public GHDeploymentBuilder task(String task) {
|
||||||
@@ -64,6 +71,7 @@ public class GHDeploymentBuilder {
|
|||||||
*
|
*
|
||||||
* @param autoMerge
|
* @param autoMerge
|
||||||
* the auto merge
|
* the auto merge
|
||||||
|
*
|
||||||
* @return the gh deployment builder
|
* @return the gh deployment builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentBuilder autoMerge(boolean autoMerge) {
|
public GHDeploymentBuilder autoMerge(boolean autoMerge) {
|
||||||
@@ -76,6 +84,7 @@ public class GHDeploymentBuilder {
|
|||||||
*
|
*
|
||||||
* @param requiredContexts
|
* @param requiredContexts
|
||||||
* the required contexts
|
* the required contexts
|
||||||
|
*
|
||||||
* @return the gh deployment builder
|
* @return the gh deployment builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentBuilder requiredContexts(List<String> requiredContexts) {
|
public GHDeploymentBuilder requiredContexts(List<String> requiredContexts) {
|
||||||
@@ -88,6 +97,7 @@ public class GHDeploymentBuilder {
|
|||||||
*
|
*
|
||||||
* @param payload
|
* @param payload
|
||||||
* the payload
|
* the payload
|
||||||
|
*
|
||||||
* @return the gh deployment builder
|
* @return the gh deployment builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentBuilder payload(String payload) {
|
public GHDeploymentBuilder payload(String payload) {
|
||||||
@@ -100,6 +110,7 @@ public class GHDeploymentBuilder {
|
|||||||
*
|
*
|
||||||
* @param environment
|
* @param environment
|
||||||
* the environment
|
* the environment
|
||||||
|
*
|
||||||
* @return the gh deployment builder
|
* @return the gh deployment builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentBuilder environment(String environment) {
|
public GHDeploymentBuilder environment(String environment) {
|
||||||
@@ -107,11 +118,47 @@ public class GHDeploymentBuilder {
|
|||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Specifies if the given environment is specific to the deployment and will no longer exist at some point in the
|
||||||
|
* future.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @param transientEnvironment
|
||||||
|
* the environment is transient
|
||||||
|
*
|
||||||
|
* @return the gh deployment builder
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
public GHDeploymentBuilder transientEnvironment(boolean transientEnvironment) {
|
||||||
|
builder.with("transient_environment", transientEnvironment);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Specifies if the given environment is one that end-users directly interact with.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @param productionEnvironment
|
||||||
|
* the environment is used by end-users directly
|
||||||
|
*
|
||||||
|
* @return the gh deployment builder
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
public GHDeploymentBuilder productionEnvironment(boolean productionEnvironment) {
|
||||||
|
builder.with("production_environment", productionEnvironment);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Description gh deployment builder.
|
* Description gh deployment builder.
|
||||||
*
|
*
|
||||||
* @param description
|
* @param description
|
||||||
* the description
|
* the description
|
||||||
|
*
|
||||||
* @return the gh deployment builder
|
* @return the gh deployment builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentBuilder description(String description) {
|
public GHDeploymentBuilder description(String description) {
|
||||||
@@ -123,6 +170,7 @@ public class GHDeploymentBuilder {
|
|||||||
* Create gh deployment.
|
* Create gh deployment.
|
||||||
*
|
*
|
||||||
* @return the gh deployment
|
* @return the gh deployment
|
||||||
|
*
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
|
|||||||
@@ -1,8 +1,40 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Represents the state of deployment
|
* Represents the state of deployment
|
||||||
*/
|
*/
|
||||||
public enum GHDeploymentState {
|
public enum GHDeploymentState {
|
||||||
PENDING, SUCCESS, ERROR, FAILURE
|
PENDING,
|
||||||
|
SUCCESS,
|
||||||
|
ERROR,
|
||||||
|
FAILURE,
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The state of the deployment currently reflects it's in progress.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.FLASH)
|
||||||
|
IN_PROGRESS,
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The state of the deployment currently reflects it's queued up for processing.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.FLASH)
|
||||||
|
QUEUED,
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The state of the deployment currently reflects it's no longer active.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
INACTIVE
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -1,5 +1,7 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
import java.util.Locale;
|
import java.util.Locale;
|
||||||
|
|
||||||
@@ -8,19 +10,21 @@ import java.util.Locale;
|
|||||||
*/
|
*/
|
||||||
public class GHDeploymentStatus extends GHObject {
|
public class GHDeploymentStatus extends GHObject {
|
||||||
private GHRepository owner;
|
private GHRepository owner;
|
||||||
private GitHub root;
|
|
||||||
protected GHUser creator;
|
protected GHUser creator;
|
||||||
protected String state;
|
protected String state;
|
||||||
protected String description;
|
protected String description;
|
||||||
protected String target_url;
|
protected String target_url;
|
||||||
|
protected String log_url;
|
||||||
protected String deployment_url;
|
protected String deployment_url;
|
||||||
protected String repository_url;
|
protected String repository_url;
|
||||||
|
protected String environment_url;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Wrap gh deployment status.
|
* Wrap gh deployment status.
|
||||||
*
|
*
|
||||||
* @param owner
|
* @param owner
|
||||||
* the owner
|
* the owner
|
||||||
|
*
|
||||||
* @return the gh deployment status
|
* @return the gh deployment status
|
||||||
*/
|
*/
|
||||||
public GHDeploymentStatus wrap(GHRepository owner) {
|
public GHDeploymentStatus wrap(GHRepository owner) {
|
||||||
@@ -34,12 +38,30 @@ public class GHDeploymentStatus extends GHObject {
|
|||||||
/**
|
/**
|
||||||
* Gets target url.
|
* Gets target url.
|
||||||
*
|
*
|
||||||
|
* @deprecated Target url is deprecated in favor of {@link #getLogUrl() getLogUrl}
|
||||||
|
*
|
||||||
* @return the target url
|
* @return the target url
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public URL getTargetUrl() {
|
public URL getTargetUrl() {
|
||||||
return GitHubClient.parseURL(target_url);
|
return GitHubClient.parseURL(target_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets target url.
|
||||||
|
* <p>
|
||||||
|
* This method replaces {@link #getTargetUrl() getTargetUrl}}.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @return the target url
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
public URL getLogUrl() {
|
||||||
|
return GitHubClient.parseURL(log_url);
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets deployment url.
|
* Gets deployment url.
|
||||||
*
|
*
|
||||||
@@ -49,6 +71,19 @@ public class GHDeploymentStatus extends GHObject {
|
|||||||
return GitHubClient.parseURL(deployment_url);
|
return GitHubClient.parseURL(deployment_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets deployment environment url.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @return the deployment environment url
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
public URL getEnvironmentUrl() {
|
||||||
|
return GitHubClient.parseURL(environment_url);
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets repository url.
|
* Gets repository url.
|
||||||
*
|
*
|
||||||
|
|||||||
@@ -1,5 +1,7 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -21,6 +23,7 @@ public class GHDeploymentStatusBuilder {
|
|||||||
* the deployment id
|
* the deployment id
|
||||||
* @param state
|
* @param state
|
||||||
* the state
|
* the state
|
||||||
|
*
|
||||||
* @deprecated Use {@link GHDeployment#createStatus(GHDeploymentState)}
|
* @deprecated Use {@link GHDeployment#createStatus(GHDeploymentState)}
|
||||||
*/
|
*/
|
||||||
@Deprecated
|
@Deprecated
|
||||||
@@ -31,15 +34,38 @@ public class GHDeploymentStatusBuilder {
|
|||||||
GHDeploymentStatusBuilder(GHRepository repo, long deploymentId, GHDeploymentState state) {
|
GHDeploymentStatusBuilder(GHRepository repo, long deploymentId, GHDeploymentState state) {
|
||||||
this.repo = repo;
|
this.repo = repo;
|
||||||
this.deploymentId = deploymentId;
|
this.deploymentId = deploymentId;
|
||||||
this.builder = repo.root.createRequest().method("POST");
|
this.builder = repo.root.createRequest()
|
||||||
|
.withPreview(Previews.ANT_MAN)
|
||||||
|
.withPreview(Previews.FLASH)
|
||||||
|
.method("POST");
|
||||||
|
|
||||||
this.builder.with("state", state);
|
this.builder.with("state", state);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Add an inactive status to all prior non-transient, non-production environment deployments with the same
|
||||||
|
* repository and environment name as the created status's deployment.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @param autoInactive
|
||||||
|
* Add inactive status flag
|
||||||
|
*
|
||||||
|
* @return the gh deployment status builder
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview({ Previews.ANT_MAN, Previews.FLASH })
|
||||||
|
public GHDeploymentStatusBuilder autoInactive(boolean autoInactive) {
|
||||||
|
this.builder.with("auto_inactive", autoInactive);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Description gh deployment status builder.
|
* Description gh deployment status builder.
|
||||||
*
|
*
|
||||||
* @param description
|
* @param description
|
||||||
* the description
|
* the description
|
||||||
|
*
|
||||||
* @return the gh deployment status builder
|
* @return the gh deployment status builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentStatusBuilder description(String description) {
|
public GHDeploymentStatusBuilder description(String description) {
|
||||||
@@ -47,13 +73,70 @@ public class GHDeploymentStatusBuilder {
|
|||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Name for the target deployment environment, which can be changed when setting a deploy status.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @param environment
|
||||||
|
* the environment name
|
||||||
|
*
|
||||||
|
* @return the gh deployment status builder
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.FLASH)
|
||||||
|
public GHDeploymentStatusBuilder environment(String environment) {
|
||||||
|
this.builder.with("environment", environment);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The URL for accessing the environment
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @param environmentUrl
|
||||||
|
* the environment url
|
||||||
|
*
|
||||||
|
* @return the gh deployment status builder
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
public GHDeploymentStatusBuilder environmentUrl(String environmentUrl) {
|
||||||
|
this.builder.with("environment_url", environmentUrl);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The full URL of the deployment's output.
|
||||||
|
* <p>
|
||||||
|
* This method replaces {@link #targetUrl(String) targetUrl}.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @param logUrl
|
||||||
|
* the deployment output url
|
||||||
|
*
|
||||||
|
* @return the gh deployment status builder
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
public GHDeploymentStatusBuilder logUrl(String logUrl) {
|
||||||
|
this.builder.with("log_url", logUrl);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Target url gh deployment status builder.
|
* Target url gh deployment status builder.
|
||||||
*
|
*
|
||||||
|
* @deprecated Target url is deprecated in favor of {@link #logUrl(String) logUrl}
|
||||||
|
*
|
||||||
* @param targetUrl
|
* @param targetUrl
|
||||||
* the target url
|
* the target url
|
||||||
|
*
|
||||||
* @return the gh deployment status builder
|
* @return the gh deployment status builder
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public GHDeploymentStatusBuilder targetUrl(String targetUrl) {
|
public GHDeploymentStatusBuilder targetUrl(String targetUrl) {
|
||||||
this.builder.with("target_url", targetUrl);
|
this.builder.with("target_url", targetUrl);
|
||||||
return this;
|
return this;
|
||||||
@@ -63,6 +146,7 @@ public class GHDeploymentStatusBuilder {
|
|||||||
* Create gh deployment status.
|
* Create gh deployment status.
|
||||||
*
|
*
|
||||||
* @return the gh deployment status
|
* @return the gh deployment status
|
||||||
|
*
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
|
|||||||
@@ -1,7 +1,7 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
import com.fasterxml.jackson.annotation.JacksonInject;
|
|
||||||
import com.fasterxml.jackson.annotation.JsonProperty;
|
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
@@ -18,8 +18,6 @@ import javax.annotation.Nonnull;
|
|||||||
*/
|
*/
|
||||||
public class GHDiscussion extends GHObject {
|
public class GHDiscussion extends GHObject {
|
||||||
|
|
||||||
@JacksonInject
|
|
||||||
private GitHub root;
|
|
||||||
private GHTeam team;
|
private GHTeam team;
|
||||||
private long number;
|
private long number;
|
||||||
private String body, title, htmlUrl;
|
private String body, title, htmlUrl;
|
||||||
@@ -130,7 +128,7 @@ public class GHDiscussion extends GHObject {
|
|||||||
*
|
*
|
||||||
* @return a {@link GHDiscussion.Updater}
|
* @return a {@link GHDiscussion.Updater}
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(Previews.SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHDiscussion.Updater update() {
|
public GHDiscussion.Updater update() {
|
||||||
return new GHDiscussion.Updater(this);
|
return new GHDiscussion.Updater(this);
|
||||||
@@ -141,7 +139,7 @@ public class GHDiscussion extends GHObject {
|
|||||||
*
|
*
|
||||||
* @return a {@link GHDiscussion.Setter}
|
* @return a {@link GHDiscussion.Setter}
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(Previews.SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHDiscussion.Setter set() {
|
public GHDiscussion.Setter set() {
|
||||||
return new GHDiscussion.Setter(this);
|
return new GHDiscussion.Setter(this);
|
||||||
|
|||||||
@@ -12,6 +12,7 @@ import java.util.Locale;
|
|||||||
public enum GHEvent {
|
public enum GHEvent {
|
||||||
CHECK_RUN,
|
CHECK_RUN,
|
||||||
CHECK_SUITE,
|
CHECK_SUITE,
|
||||||
|
CODE_SCANNING_ALERT,
|
||||||
COMMIT_COMMENT,
|
COMMIT_COMMENT,
|
||||||
CONTENT_REFERENCE,
|
CONTENT_REFERENCE,
|
||||||
CREATE,
|
CREATE,
|
||||||
|
|||||||
@@ -12,9 +12,7 @@ import java.util.Date;
|
|||||||
* @author Kohsuke Kawaguchi
|
* @author Kohsuke Kawaguchi
|
||||||
*/
|
*/
|
||||||
@SuppressFBWarnings(value = "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", justification = "JSON API")
|
@SuppressFBWarnings(value = "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", justification = "JSON API")
|
||||||
public class GHEventInfo {
|
public class GHEventInfo extends GitHubInteractiveObject {
|
||||||
private GitHub root;
|
|
||||||
|
|
||||||
// we don't want to expose Jackson dependency to the user. This needs databinding
|
// we don't want to expose Jackson dependency to the user. This needs databinding
|
||||||
private ObjectNode payload;
|
private ObjectNode payload;
|
||||||
|
|
||||||
|
|||||||
@@ -5,7 +5,9 @@ import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
|||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.io.Reader;
|
import java.io.Reader;
|
||||||
|
import java.util.Date;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
|
import java.util.Map;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Base type for types used in databinding of the event payload.
|
* Base type for types used in databinding of the event payload.
|
||||||
@@ -17,9 +19,7 @@ import java.util.List;
|
|||||||
*/
|
*/
|
||||||
@SuppressWarnings("UnusedDeclaration")
|
@SuppressWarnings("UnusedDeclaration")
|
||||||
@SuppressFBWarnings("UWF_UNWRITTEN_FIELD")
|
@SuppressFBWarnings("UWF_UNWRITTEN_FIELD")
|
||||||
public class GHEventPayload {
|
public class GHEventPayload extends GitHubInteractiveObject {
|
||||||
protected GitHub root;
|
|
||||||
|
|
||||||
// https://docs.github.com/en/free-pro-team@latest/developers/webhooks-and-events/webhook-events-and-payloads#webhook-payload-object-common-properties
|
// https://docs.github.com/en/free-pro-team@latest/developers/webhooks-and-events/webhook-events-and-payloads#webhook-payload-object-common-properties
|
||||||
// Webhook payload object common properties: action, sender, repository, organization, installation
|
// Webhook payload object common properties: action, sender, repository, organization, installation
|
||||||
private String action;
|
private String action;
|
||||||
@@ -382,9 +382,9 @@ public class GHEventPayload {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets label.
|
* Gets the added or removed label for labeled/unlabeled events.
|
||||||
*
|
*
|
||||||
* @return the label
|
* @return label the added or removed label
|
||||||
*/
|
*/
|
||||||
public GHLabel getLabel() {
|
public GHLabel getLabel() {
|
||||||
return label;
|
return label;
|
||||||
@@ -521,6 +521,10 @@ public class GHEventPayload {
|
|||||||
public static class Issue extends GHEventPayload {
|
public static class Issue extends GHEventPayload {
|
||||||
private GHIssue issue;
|
private GHIssue issue;
|
||||||
|
|
||||||
|
private GHLabel label;
|
||||||
|
|
||||||
|
private GHIssueChanges changes;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets issue.
|
* Gets issue.
|
||||||
*
|
*
|
||||||
@@ -540,6 +544,24 @@ public class GHEventPayload {
|
|||||||
this.issue = issue;
|
this.issue = issue;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the added or removed label for labeled/unlabeled events.
|
||||||
|
*
|
||||||
|
* @return label the added or removed label
|
||||||
|
*/
|
||||||
|
public GHLabel getLabel() {
|
||||||
|
return label;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get changes (for action="edited")
|
||||||
|
*
|
||||||
|
* @return changes
|
||||||
|
*/
|
||||||
|
public GHIssueChanges getChanges() {
|
||||||
|
return changes;
|
||||||
|
}
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
void wrapUp(GitHub root) {
|
void wrapUp(GitHub root) {
|
||||||
super.wrapUp(root);
|
super.wrapUp(root);
|
||||||
@@ -1069,7 +1091,7 @@ public class GHEventPayload {
|
|||||||
public static class PushCommit {
|
public static class PushCommit {
|
||||||
private GitUser author;
|
private GitUser author;
|
||||||
private GitUser committer;
|
private GitUser committer;
|
||||||
private String url, sha, message;
|
private String url, sha, message, timestamp;
|
||||||
private boolean distinct;
|
private boolean distinct;
|
||||||
private List<String> added, removed, modified;
|
private List<String> added, removed, modified;
|
||||||
|
|
||||||
@@ -1158,6 +1180,15 @@ public class GHEventPayload {
|
|||||||
public List<String> getModified() {
|
public List<String> getModified() {
|
||||||
return modified;
|
return modified;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Obtains the timestamp of the commit
|
||||||
|
*
|
||||||
|
* @return the timestamp
|
||||||
|
*/
|
||||||
|
public Date getTimestamp() {
|
||||||
|
return GitHubClient.parseDate(timestamp);
|
||||||
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -1216,6 +1247,7 @@ public class GHEventPayload {
|
|||||||
private String description;
|
private String description;
|
||||||
private GHCommitState state;
|
private GHCommitState state;
|
||||||
private GHCommit commit;
|
private GHCommit commit;
|
||||||
|
private String targetUrl;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets the status content.
|
* Gets the status content.
|
||||||
@@ -1226,6 +1258,15 @@ public class GHEventPayload {
|
|||||||
return context;
|
return context;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The optional link added to the status.
|
||||||
|
*
|
||||||
|
* @return a url
|
||||||
|
*/
|
||||||
|
public String getTargetUrl() {
|
||||||
|
return targetUrl;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets the status description.
|
* Gets the status description.
|
||||||
*
|
*
|
||||||
@@ -1286,4 +1327,86 @@ public class GHEventPayload {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Occurs when someone triggered a workflow run or sends a POST request to the "Create a workflow dispatch event"
|
||||||
|
* endpoint.
|
||||||
|
*
|
||||||
|
* @see <a href=
|
||||||
|
* "https://docs.github.com/en/developers/webhooks-and-events/webhook-events-and-payloads#workflow_dispatch">
|
||||||
|
* workflow dispatch event</a>
|
||||||
|
* @see <a href=
|
||||||
|
* "https://docs.github.com/en/actions/reference/events-that-trigger-workflows#workflow_dispatch">Events that
|
||||||
|
* trigger workflows</a>
|
||||||
|
*/
|
||||||
|
public static class WorkflowDispatch extends GHEventPayload {
|
||||||
|
private Map<String, Object> inputs;
|
||||||
|
private String ref;
|
||||||
|
private String workflow;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the map of input parameters passed to the workflow.
|
||||||
|
*
|
||||||
|
* @return the map of input parameters
|
||||||
|
*/
|
||||||
|
public Map<String, Object> getInputs() {
|
||||||
|
return inputs;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the ref of the branch (e.g. refs/heads/main)
|
||||||
|
*
|
||||||
|
* @return the ref of the branch
|
||||||
|
*/
|
||||||
|
public String getRef() {
|
||||||
|
return ref;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the path of the workflow file (e.g. .github/workflows/hello-world-workflow.yml).
|
||||||
|
*
|
||||||
|
* @return the path of the workflow file
|
||||||
|
*/
|
||||||
|
public String getWorkflow() {
|
||||||
|
return workflow;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A workflow run was requested or completed.
|
||||||
|
*
|
||||||
|
* @see <a href=
|
||||||
|
* "https://docs.github.com/en/developers/webhooks-and-events/webhook-events-and-payloads#workflow_run">
|
||||||
|
* workflow run event</a>
|
||||||
|
* @see <a href="https://docs.github.com/en/rest/reference/actions#workflow-runs">Actions Workflow Runs</a>
|
||||||
|
*/
|
||||||
|
public static class WorkflowRun extends GHEventPayload {
|
||||||
|
private GHWorkflowRun workflowRun;
|
||||||
|
private GHWorkflow workflow;
|
||||||
|
|
||||||
|
public GHWorkflowRun getWorkflowRun() {
|
||||||
|
return workflowRun;
|
||||||
|
}
|
||||||
|
|
||||||
|
public GHWorkflow getWorkflow() {
|
||||||
|
return workflow;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
void wrapUp(GitHub root) {
|
||||||
|
super.wrapUp(root);
|
||||||
|
if (workflowRun == null || workflow == null) {
|
||||||
|
throw new IllegalStateException(
|
||||||
|
"Expected workflow and workflow_run payload, but got something else. Maybe we've got another type of event?");
|
||||||
|
}
|
||||||
|
GHRepository repository = getRepository();
|
||||||
|
if (repository != null) {
|
||||||
|
workflowRun.wrapUp(repository);
|
||||||
|
workflow.wrapUp(repository);
|
||||||
|
} else {
|
||||||
|
workflowRun.wrapUp(root);
|
||||||
|
workflow.wrapUp(root);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -23,7 +23,6 @@ import java.util.Map.Entry;
|
|||||||
public class GHGist extends GHObject {
|
public class GHGist extends GHObject {
|
||||||
|
|
||||||
final GHUser owner;
|
final GHUser owner;
|
||||||
final GitHub root;
|
|
||||||
|
|
||||||
private String forks_url, commits_url, id, git_pull_url, git_push_url, html_url;
|
private String forks_url, commits_url, id, git_pull_url, git_push_url, html_url;
|
||||||
|
|
||||||
|
|||||||
@@ -13,7 +13,6 @@ import javax.annotation.Nonnull;
|
|||||||
* @see GitHub#createGist() GitHub#createGist()
|
* @see GitHub#createGist() GitHub#createGist()
|
||||||
*/
|
*/
|
||||||
public class GHGistBuilder {
|
public class GHGistBuilder {
|
||||||
private final GitHub root;
|
|
||||||
private final Requester req;
|
private final Requester req;
|
||||||
private final LinkedHashMap<String, Object> files = new LinkedHashMap<String, Object>();
|
private final LinkedHashMap<String, Object> files = new LinkedHashMap<String, Object>();
|
||||||
|
|
||||||
@@ -24,7 +23,6 @@ public class GHGistBuilder {
|
|||||||
* the root
|
* the root
|
||||||
*/
|
*/
|
||||||
public GHGistBuilder(GitHub root) {
|
public GHGistBuilder(GitHub root) {
|
||||||
this.root = root;
|
|
||||||
req = root.createRequest().method("POST");
|
req = root.createRequest().method("POST");
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
@@ -12,8 +12,7 @@ import java.util.Map;
|
|||||||
* functionality
|
* functionality
|
||||||
*/
|
*/
|
||||||
class GHHooks {
|
class GHHooks {
|
||||||
static abstract class Context {
|
static abstract class Context extends GitHubInteractiveObject {
|
||||||
private final GitHub root;
|
|
||||||
|
|
||||||
private Context(GitHub root) {
|
private Context(GitHub root) {
|
||||||
this.root = root;
|
this.root = root;
|
||||||
|
|||||||
@@ -16,7 +16,6 @@ import java.net.URL;
|
|||||||
"UUF_UNUSED_FIELD" },
|
"UUF_UNUSED_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public class GHInvitation extends GHObject {
|
public class GHInvitation extends GHObject {
|
||||||
/* package almost final */ GitHub root;
|
|
||||||
|
|
||||||
private int id;
|
private int id;
|
||||||
private GHRepository repository;
|
private GHRepository repository;
|
||||||
|
|||||||
@@ -39,7 +39,7 @@ import java.util.List;
|
|||||||
import java.util.Locale;
|
import java.util.Locale;
|
||||||
import java.util.Objects;
|
import java.util.Objects;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.SQUIRREL_GIRL;
|
import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Represents an issue on GitHub.
|
* Represents an issue on GitHub.
|
||||||
@@ -53,7 +53,6 @@ import static org.kohsuke.github.Previews.SQUIRREL_GIRL;
|
|||||||
public class GHIssue extends GHObject implements Reactable {
|
public class GHIssue extends GHObject implements Reactable {
|
||||||
private static final String ASSIGNEES = "assignees";
|
private static final String ASSIGNEES = "assignees";
|
||||||
|
|
||||||
GitHub root;
|
|
||||||
GHRepository owner;
|
GHRepository owner;
|
||||||
|
|
||||||
// API v3
|
// API v3
|
||||||
@@ -313,7 +312,7 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Sets labels.
|
* Sets labels on the target to a specific list.
|
||||||
*
|
*
|
||||||
* @param labels
|
* @param labels
|
||||||
* the labels
|
* the labels
|
||||||
@@ -327,6 +326,8 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
/**
|
/**
|
||||||
* Adds labels to the issue.
|
* Adds labels to the issue.
|
||||||
*
|
*
|
||||||
|
* Labels that are already present on the target are ignored.
|
||||||
|
*
|
||||||
* @param names
|
* @param names
|
||||||
* Names of the label
|
* Names of the label
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
@@ -339,6 +340,8 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
/**
|
/**
|
||||||
* Add labels.
|
* Add labels.
|
||||||
*
|
*
|
||||||
|
* Labels that are already present on the target are ignored.
|
||||||
|
*
|
||||||
* @param labels
|
* @param labels
|
||||||
* the labels
|
* the labels
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
@@ -351,6 +354,8 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
/**
|
/**
|
||||||
* Add labels.
|
* Add labels.
|
||||||
*
|
*
|
||||||
|
* Labels that are already present on the target are ignored.
|
||||||
|
*
|
||||||
* @param labels
|
* @param labels
|
||||||
* the labels
|
* the labels
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
@@ -361,21 +366,27 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
}
|
}
|
||||||
|
|
||||||
private void _addLabels(Collection<String> names) throws IOException {
|
private void _addLabels(Collection<String> names) throws IOException {
|
||||||
List<String> newLabels = new ArrayList<String>();
|
root.createRequest().with("labels", names).method("POST").withUrlPath(getIssuesApiRoute() + "/labels").send();
|
||||||
|
|
||||||
for (GHLabel label : getLabels()) {
|
|
||||||
newLabels.add(label.getName());
|
|
||||||
}
|
|
||||||
for (String name : names) {
|
|
||||||
if (!newLabels.contains(name)) {
|
|
||||||
newLabels.add(name);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
setLabels(newLabels.toArray(new String[0]));
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Remove a given label by name from this issue.
|
* Remove a single label.
|
||||||
|
*
|
||||||
|
* Attempting to remove a label that is not present throws {@link GHFileNotFoundException}.
|
||||||
|
*
|
||||||
|
* @param name
|
||||||
|
* the name
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception, throws {@link GHFileNotFoundException} if label was not present.
|
||||||
|
*/
|
||||||
|
public void removeLabel(String name) throws IOException {
|
||||||
|
root.createRequest().method("DELETE").withUrlPath(getIssuesApiRoute() + "/labels", name).send();
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Remove a collection of labels.
|
||||||
|
*
|
||||||
|
* Attempting to remove labels that are not present on the target are ignored.
|
||||||
*
|
*
|
||||||
* @param names
|
* @param names
|
||||||
* the names
|
* the names
|
||||||
@@ -387,7 +398,9 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Remove labels.
|
* Remove a collection of labels.
|
||||||
|
*
|
||||||
|
* Attempting to remove labels that are not present on the target are ignored.
|
||||||
*
|
*
|
||||||
* @param labels
|
* @param labels
|
||||||
* the labels
|
* the labels
|
||||||
@@ -400,7 +413,9 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Remove labels.
|
* Remove a collection of labels.
|
||||||
|
*
|
||||||
|
* Attempting to remove labels that are not present on the target are ignored.
|
||||||
*
|
*
|
||||||
* @param labels
|
* @param labels
|
||||||
* the labels
|
* the labels
|
||||||
@@ -412,15 +427,13 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
}
|
}
|
||||||
|
|
||||||
private void _removeLabels(Collection<String> names) throws IOException {
|
private void _removeLabels(Collection<String> names) throws IOException {
|
||||||
List<String> newLabels = new ArrayList<String>();
|
for (String name : names) {
|
||||||
|
try {
|
||||||
for (GHLabel l : getLabels()) {
|
removeLabel(name);
|
||||||
if (!names.contains(l.getName())) {
|
} catch (GHFileNotFoundException e) {
|
||||||
newLabels.add(l.getName());
|
// when trying to remove multiple labels, we ignore already removed
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
setLabels(newLabels.toArray(new String[0]));
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -448,7 +461,7 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
.toIterable(GHIssueComment[].class, item -> item.wrapUp(this));
|
.toIterable(GHIssueComment[].class, item -> item.wrapUp(this));
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHReaction createReaction(ReactionContent content) throws IOException {
|
public GHReaction createReaction(ReactionContent content) throws IOException {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
@@ -460,7 +473,7 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
.wrap(root);
|
.wrap(root);
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public PagedIterable<GHReaction> listReactions() {
|
public PagedIterable<GHReaction> listReactions() {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
|
|||||||
49
src/main/java/org/kohsuke/github/GHIssueChanges.java
Normal file
49
src/main/java/org/kohsuke/github/GHIssueChanges.java
Normal file
@@ -0,0 +1,49 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Wrapper to define changed fields on issues action="edited"
|
||||||
|
*
|
||||||
|
* @see GHEventPayload.Issue
|
||||||
|
*/
|
||||||
|
@SuppressFBWarnings("UWF_UNWRITTEN_FIELD")
|
||||||
|
public class GHIssueChanges {
|
||||||
|
|
||||||
|
private GHFrom title;
|
||||||
|
private GHFrom body;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Old issue title.
|
||||||
|
*
|
||||||
|
* @return old issue title (or null if not changed)
|
||||||
|
*/
|
||||||
|
public GHFrom getTitle() {
|
||||||
|
return title;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Old issue body.
|
||||||
|
*
|
||||||
|
* @return old issue body (or null if not changed)
|
||||||
|
*/
|
||||||
|
public GHFrom getBody() {
|
||||||
|
return body;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Wrapper for changed values.
|
||||||
|
*/
|
||||||
|
public static class GHFrom {
|
||||||
|
private String from;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Previous value that was changed.
|
||||||
|
*
|
||||||
|
* @return previous value
|
||||||
|
*/
|
||||||
|
public String getFrom() {
|
||||||
|
return from;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -26,7 +26,7 @@ package org.kohsuke.github;
|
|||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.*;
|
import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Comment to the issue
|
* Comment to the issue
|
||||||
@@ -126,7 +126,7 @@ public class GHIssueComment extends GHObject implements Reactable {
|
|||||||
owner.root.createRequest().method("DELETE").withUrlPath(getApiRoute()).send();
|
owner.root.createRequest().method("DELETE").withUrlPath(getApiRoute()).send();
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHReaction createReaction(ReactionContent content) throws IOException {
|
public GHReaction createReaction(ReactionContent content) throws IOException {
|
||||||
return owner.root.createRequest()
|
return owner.root.createRequest()
|
||||||
@@ -138,7 +138,7 @@ public class GHIssueComment extends GHObject implements Reactable {
|
|||||||
.wrap(owner.root);
|
.wrap(owner.root);
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public PagedIterable<GHReaction> listReactions() {
|
public PagedIterable<GHReaction> listReactions() {
|
||||||
return owner.root.createRequest()
|
return owner.root.createRequest()
|
||||||
|
|||||||
@@ -9,9 +9,7 @@ import java.util.Date;
|
|||||||
*
|
*
|
||||||
* @author Martin van Zijl
|
* @author Martin van Zijl
|
||||||
*/
|
*/
|
||||||
public class GHIssueEvent {
|
public class GHIssueEvent extends GitHubInteractiveObject {
|
||||||
private GitHub root;
|
|
||||||
|
|
||||||
private long id;
|
private long id;
|
||||||
private String node_id;
|
private String node_id;
|
||||||
private String url;
|
private String url;
|
||||||
|
|||||||
@@ -9,9 +9,7 @@ import org.apache.commons.lang3.builder.ToStringBuilder;
|
|||||||
* @author Kohsuke Kawaguchi
|
* @author Kohsuke Kawaguchi
|
||||||
*/
|
*/
|
||||||
@SuppressFBWarnings(value = "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", justification = "JSON API")
|
@SuppressFBWarnings(value = "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", justification = "JSON API")
|
||||||
public class GHKey {
|
public class GHKey extends GitHubInteractiveObject {
|
||||||
/* package almost final */ GitHub root;
|
|
||||||
|
|
||||||
protected String url, key, title;
|
protected String url, key, title;
|
||||||
protected boolean verified;
|
protected boolean verified;
|
||||||
protected int id;
|
protected int id;
|
||||||
|
|||||||
@@ -2,6 +2,7 @@ package org.kohsuke.github;
|
|||||||
|
|
||||||
import com.fasterxml.jackson.annotation.JacksonInject;
|
import com.fasterxml.jackson.annotation.JacksonInject;
|
||||||
import com.fasterxml.jackson.annotation.JsonCreator;
|
import com.fasterxml.jackson.annotation.JsonCreator;
|
||||||
|
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.util.ArrayList;
|
import java.util.ArrayList;
|
||||||
@@ -20,7 +21,12 @@ import javax.annotation.Nonnull;
|
|||||||
* @see GHIssue#getLabels() GHIssue#getLabels()
|
* @see GHIssue#getLabels() GHIssue#getLabels()
|
||||||
* @see GHRepository#listLabels() GHRepository#listLabels()
|
* @see GHRepository#listLabels() GHRepository#listLabels()
|
||||||
*/
|
*/
|
||||||
public class GHLabel {
|
public class GHLabel extends GitHubInteractiveObject {
|
||||||
|
|
||||||
|
private long id;
|
||||||
|
private String nodeId;
|
||||||
|
@JsonProperty("default")
|
||||||
|
private boolean default_;
|
||||||
|
|
||||||
@Nonnull
|
@Nonnull
|
||||||
private String url, name, color;
|
private String url, name, color;
|
||||||
@@ -28,9 +34,6 @@ public class GHLabel {
|
|||||||
@CheckForNull
|
@CheckForNull
|
||||||
private String description;
|
private String description;
|
||||||
|
|
||||||
@Nonnull
|
|
||||||
private final GitHub root;
|
|
||||||
|
|
||||||
@JsonCreator
|
@JsonCreator
|
||||||
private GHLabel(@JacksonInject @Nonnull GitHub root) {
|
private GHLabel(@JacksonInject @Nonnull GitHub root) {
|
||||||
this.root = root;
|
this.root = root;
|
||||||
@@ -45,6 +48,24 @@ public class GHLabel {
|
|||||||
return Objects.requireNonNull(root);
|
return Objects.requireNonNull(root);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets id.
|
||||||
|
*
|
||||||
|
* @return the id
|
||||||
|
*/
|
||||||
|
public long getId() {
|
||||||
|
return id;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets node id.
|
||||||
|
*
|
||||||
|
* @return the node id.
|
||||||
|
*/
|
||||||
|
public String getNodeId() {
|
||||||
|
return nodeId;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets url.
|
* Gets url.
|
||||||
*
|
*
|
||||||
@@ -85,6 +106,15 @@ public class GHLabel {
|
|||||||
return description;
|
return description;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* If the label is one of the default labels created by GitHub automatically.
|
||||||
|
*
|
||||||
|
* @return true if the label is a default one
|
||||||
|
*/
|
||||||
|
public boolean isDefault() {
|
||||||
|
return default_;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Sets color.
|
* Sets color.
|
||||||
*
|
*
|
||||||
@@ -132,7 +162,7 @@ public class GHLabel {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
static Creator create(GHRepository repository) throws IOException {
|
static Creator create(GHRepository repository) throws IOException {
|
||||||
return new Creator(repository);
|
return new Creator(repository);
|
||||||
@@ -179,7 +209,7 @@ public class GHLabel {
|
|||||||
*
|
*
|
||||||
* @return a {@link Updater}
|
* @return a {@link Updater}
|
||||||
*/
|
*/
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public Updater update() {
|
public Updater update() {
|
||||||
return new Updater(this);
|
return new Updater(this);
|
||||||
@@ -190,7 +220,7 @@ public class GHLabel {
|
|||||||
*
|
*
|
||||||
* @return a {@link Setter}
|
* @return a {@link Setter}
|
||||||
*/
|
*/
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public Setter set() {
|
public Setter set() {
|
||||||
return new Setter(this);
|
return new Setter(this);
|
||||||
@@ -227,7 +257,7 @@ public class GHLabel {
|
|||||||
*
|
*
|
||||||
* {@link #done()} is called automatically after the property is set.
|
* {@link #done()} is called automatically after the property is set.
|
||||||
*/
|
*/
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public static class Setter extends GHLabelBuilder<GHLabel> {
|
public static class Setter extends GHLabelBuilder<GHLabel> {
|
||||||
private Setter(@Nonnull GHLabel base) {
|
private Setter(@Nonnull GHLabel base) {
|
||||||
@@ -241,7 +271,7 @@ public class GHLabel {
|
|||||||
*
|
*
|
||||||
* Consumer must call {@link #done()} to commit changes.
|
* Consumer must call {@link #done()} to commit changes.
|
||||||
*/
|
*/
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public static class Updater extends GHLabelBuilder<Updater> {
|
public static class Updater extends GHLabelBuilder<Updater> {
|
||||||
private Updater(@Nonnull GHLabel base) {
|
private Updater(@Nonnull GHLabel base) {
|
||||||
@@ -255,7 +285,7 @@ public class GHLabel {
|
|||||||
*
|
*
|
||||||
* Consumer must call {@link #done()} to create the new instance.
|
* Consumer must call {@link #done()} to create the new instance.
|
||||||
*/
|
*/
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public static class Creator extends GHLabelBuilder<Creator> {
|
public static class Creator extends GHLabelBuilder<Creator> {
|
||||||
private Creator(@Nonnull GHRepository repository) {
|
private Creator(@Nonnull GHRepository repository) {
|
||||||
|
|||||||
@@ -38,21 +38,21 @@ class GHLabelBuilder<S> extends AbstractBuilder<GHLabel, S> {
|
|||||||
}
|
}
|
||||||
|
|
||||||
@Nonnull
|
@Nonnull
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public S name(String value) throws IOException {
|
public S name(String value) throws IOException {
|
||||||
return with("name", value);
|
return with("name", value);
|
||||||
}
|
}
|
||||||
|
|
||||||
@Nonnull
|
@Nonnull
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public S color(String value) throws IOException {
|
public S color(String value) throws IOException {
|
||||||
return with("color", value);
|
return with("color", value);
|
||||||
}
|
}
|
||||||
|
|
||||||
@Nonnull
|
@Nonnull
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public S description(String value) throws IOException {
|
public S description(String value) throws IOException {
|
||||||
return with("description", value);
|
return with("description", value);
|
||||||
|
|||||||
@@ -44,9 +44,6 @@ import java.util.Objects;
|
|||||||
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public class GHLicense extends GHObject {
|
public class GHLicense extends GHObject {
|
||||||
@SuppressFBWarnings("IS2_INCONSISTENT_SYNC")
|
|
||||||
// root is set before the object is returned to the app
|
|
||||||
/* package almost final */ GitHub root;
|
|
||||||
|
|
||||||
// these fields are always present, even in the short form
|
// these fields are always present, even in the short form
|
||||||
protected String key, name;
|
protected String key, name;
|
||||||
|
|||||||
@@ -9,9 +9,7 @@ import java.net.URL;
|
|||||||
* @see GitHub#getMyMarketplacePurchases()
|
* @see GitHub#getMyMarketplacePurchases()
|
||||||
* @see GHMarketplaceListAccountBuilder#createRequest()
|
* @see GHMarketplaceListAccountBuilder#createRequest()
|
||||||
*/
|
*/
|
||||||
public class GHMarketplaceAccount {
|
public class GHMarketplaceAccount extends GitHubInteractiveObject {
|
||||||
|
|
||||||
protected GitHub root;
|
|
||||||
private String url;
|
private String url;
|
||||||
private long id;
|
private long id;
|
||||||
private String login;
|
private String login;
|
||||||
|
|||||||
@@ -8,8 +8,7 @@ import java.io.IOException;
|
|||||||
* @author Paulo Miguel Almeida
|
* @author Paulo Miguel Almeida
|
||||||
* @see GHMarketplacePlan#listAccounts()
|
* @see GHMarketplacePlan#listAccounts()
|
||||||
*/
|
*/
|
||||||
public class GHMarketplaceListAccountBuilder {
|
public class GHMarketplaceListAccountBuilder extends GitHubInteractiveObject {
|
||||||
private final GitHub root;
|
|
||||||
private final Requester builder;
|
private final Requester builder;
|
||||||
private final long planId;
|
private final long planId;
|
||||||
|
|
||||||
|
|||||||
@@ -10,8 +10,7 @@ import java.util.Date;
|
|||||||
* @author Paulo Miguel Almeida
|
* @author Paulo Miguel Almeida
|
||||||
* @see GHMarketplaceListAccountBuilder#createRequest()
|
* @see GHMarketplaceListAccountBuilder#createRequest()
|
||||||
*/
|
*/
|
||||||
public class GHMarketplacePendingChange {
|
public class GHMarketplacePendingChange extends GitHubInteractiveObject {
|
||||||
private GitHub root;
|
|
||||||
private long id;
|
private long id;
|
||||||
@SuppressFBWarnings(value = "UWF_UNWRITTEN_FIELD", justification = "Field comes from JSON deserialization")
|
@SuppressFBWarnings(value = "UWF_UNWRITTEN_FIELD", justification = "Field comes from JSON deserialization")
|
||||||
private Long unitCount;
|
private Long unitCount;
|
||||||
|
|||||||
@@ -11,9 +11,7 @@ import java.util.List;
|
|||||||
* @author Paulo Miguel Almeida
|
* @author Paulo Miguel Almeida
|
||||||
* @see GitHub#listMarketplacePlans()
|
* @see GitHub#listMarketplacePlans()
|
||||||
*/
|
*/
|
||||||
public class GHMarketplacePlan {
|
public class GHMarketplacePlan extends GitHubInteractiveObject {
|
||||||
|
|
||||||
private GitHub root;
|
|
||||||
private String url;
|
private String url;
|
||||||
private String accountsUrl;
|
private String accountsUrl;
|
||||||
private long id;
|
private long id;
|
||||||
|
|||||||
@@ -10,9 +10,8 @@ import java.util.Date;
|
|||||||
* @author Paulo Miguel Almeida
|
* @author Paulo Miguel Almeida
|
||||||
* @see GHMarketplaceListAccountBuilder#createRequest() GHMarketplaceListAccountBuilder#createRequest()
|
* @see GHMarketplaceListAccountBuilder#createRequest() GHMarketplaceListAccountBuilder#createRequest()
|
||||||
*/
|
*/
|
||||||
public class GHMarketplacePurchase {
|
public class GHMarketplacePurchase extends GitHubInteractiveObject {
|
||||||
|
|
||||||
private GitHub root;
|
|
||||||
private String billingCycle;
|
private String billingCycle;
|
||||||
private String nextBillingDate;
|
private String nextBillingDate;
|
||||||
private boolean onFreeTrial;
|
private boolean onFreeTrial;
|
||||||
|
|||||||
@@ -10,8 +10,7 @@ import java.util.Date;
|
|||||||
* @author Paulo Miguel Almeida
|
* @author Paulo Miguel Almeida
|
||||||
* @see GitHub#getMyMarketplacePurchases()
|
* @see GitHub#getMyMarketplacePurchases()
|
||||||
*/
|
*/
|
||||||
public class GHMarketplaceUserPurchase {
|
public class GHMarketplaceUserPurchase extends GitHubInteractiveObject {
|
||||||
protected GitHub root;
|
|
||||||
private String billingCycle;
|
private String billingCycle;
|
||||||
private String nextBillingDate;
|
private String nextBillingDate;
|
||||||
private boolean onFreeTrial;
|
private boolean onFreeTrial;
|
||||||
|
|||||||
@@ -10,9 +10,7 @@ import java.util.Locale;
|
|||||||
* @author Kohsuke Kawaguchi
|
* @author Kohsuke Kawaguchi
|
||||||
* @see GHMyself#listOrgMemberships() GHMyself#listOrgMemberships()
|
* @see GHMyself#listOrgMemberships() GHMyself#listOrgMemberships()
|
||||||
*/
|
*/
|
||||||
public class GHMembership /* extends GHObject --- but it doesn't have id, created_at, etc. */ {
|
public class GHMembership extends GitHubInteractiveObject {
|
||||||
GitHub root;
|
|
||||||
|
|
||||||
String url;
|
String url;
|
||||||
String state;
|
String state;
|
||||||
String role;
|
String role;
|
||||||
|
|||||||
@@ -11,7 +11,6 @@ import java.util.Locale;
|
|||||||
* @author Yusuke Kokubo
|
* @author Yusuke Kokubo
|
||||||
*/
|
*/
|
||||||
public class GHMilestone extends GHObject {
|
public class GHMilestone extends GHObject {
|
||||||
GitHub root;
|
|
||||||
GHRepository owner;
|
GHRepository owner;
|
||||||
|
|
||||||
GHUser creator;
|
GHUser creator;
|
||||||
|
|||||||
@@ -23,9 +23,7 @@ import java.util.NoSuchElementException;
|
|||||||
* @see GitHub#listNotifications() GitHub#listNotifications()
|
* @see GitHub#listNotifications() GitHub#listNotifications()
|
||||||
* @see GHRepository#listNotifications() GHRepository#listNotifications()
|
* @see GHRepository#listNotifications() GHRepository#listNotifications()
|
||||||
*/
|
*/
|
||||||
public class GHNotificationStream implements Iterable<GHThread> {
|
public class GHNotificationStream extends GitHubInteractiveObject implements Iterable<GHThread> {
|
||||||
private final GitHub root;
|
|
||||||
|
|
||||||
private Boolean all, participating;
|
private Boolean all, participating;
|
||||||
private String since;
|
private String since;
|
||||||
private String apiUrl;
|
private String apiUrl;
|
||||||
|
|||||||
@@ -20,7 +20,7 @@ import javax.annotation.CheckForNull;
|
|||||||
*/
|
*/
|
||||||
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public abstract class GHObject {
|
public abstract class GHObject extends GitHubInteractiveObject {
|
||||||
/**
|
/**
|
||||||
* Capture response HTTP headers on the state object.
|
* Capture response HTTP headers on the state object.
|
||||||
*/
|
*/
|
||||||
|
|||||||
@@ -10,7 +10,7 @@ import java.util.List;
|
|||||||
import java.util.Map;
|
import java.util.Map;
|
||||||
import java.util.TreeMap;
|
import java.util.TreeMap;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.INERTIA;
|
import static org.kohsuke.github.internal.Previews.INERTIA;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The type GHOrganization.
|
* The type GHOrganization.
|
||||||
@@ -97,7 +97,7 @@ public class GHOrganization extends GHPerson {
|
|||||||
* @return the gh create repository builder
|
* @return the gh create repository builder
|
||||||
*/
|
*/
|
||||||
public GHCreateRepositoryBuilder createRepository(String name) {
|
public GHCreateRepositoryBuilder createRepository(String name) {
|
||||||
return new GHCreateRepositoryBuilder(root, "/orgs/" + login + "/repos", name);
|
return new GHCreateRepositoryBuilder(name, root, "/orgs/" + login + "/repos");
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|||||||
@@ -18,7 +18,6 @@ import java.util.TreeMap;
|
|||||||
* @author Kohsuke Kawaguchi
|
* @author Kohsuke Kawaguchi
|
||||||
*/
|
*/
|
||||||
public abstract class GHPerson extends GHObject {
|
public abstract class GHPerson extends GHObject {
|
||||||
/* package almost final */ GitHub root;
|
|
||||||
|
|
||||||
// core data fields that exist even for "small" user data (such as the user info in pull request)
|
// core data fields that exist even for "small" user data (such as the user info in pull request)
|
||||||
protected String login, avatar_url;
|
protected String login, avatar_url;
|
||||||
|
|||||||
@@ -28,7 +28,7 @@ import java.io.IOException;
|
|||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
import java.util.Locale;
|
import java.util.Locale;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.INERTIA;
|
import static org.kohsuke.github.internal.Previews.INERTIA;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* A GitHub project.
|
* A GitHub project.
|
||||||
@@ -37,7 +37,6 @@ import static org.kohsuke.github.Previews.INERTIA;
|
|||||||
* @see <a href="https://developer.github.com/v3/projects/">Projects</a>
|
* @see <a href="https://developer.github.com/v3/projects/">Projects</a>
|
||||||
*/
|
*/
|
||||||
public class GHProject extends GHObject {
|
public class GHProject extends GHObject {
|
||||||
protected GitHub root;
|
|
||||||
protected GHObject owner;
|
protected GHObject owner;
|
||||||
|
|
||||||
private String owner_url;
|
private String owner_url;
|
||||||
|
|||||||
@@ -6,7 +6,7 @@ import java.io.FileNotFoundException;
|
|||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.INERTIA;
|
import static org.kohsuke.github.internal.Previews.INERTIA;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The type GHProjectCard.
|
* The type GHProjectCard.
|
||||||
@@ -14,7 +14,6 @@ import static org.kohsuke.github.Previews.INERTIA;
|
|||||||
* @author Gunnar Skjold
|
* @author Gunnar Skjold
|
||||||
*/
|
*/
|
||||||
public class GHProjectCard extends GHObject {
|
public class GHProjectCard extends GHObject {
|
||||||
private GitHub root;
|
|
||||||
private GHProject project;
|
private GHProject project;
|
||||||
private GHProjectColumn column;
|
private GHProjectColumn column;
|
||||||
|
|
||||||
|
|||||||
@@ -4,7 +4,7 @@ import java.io.FileNotFoundException;
|
|||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.INERTIA;
|
import static org.kohsuke.github.internal.Previews.INERTIA;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The type GHProjectColumn.
|
* The type GHProjectColumn.
|
||||||
@@ -12,7 +12,6 @@ import static org.kohsuke.github.Previews.INERTIA;
|
|||||||
* @author Gunnar Skjold
|
* @author Gunnar Skjold
|
||||||
*/
|
*/
|
||||||
public class GHProjectColumn extends GHObject {
|
public class GHProjectColumn extends GHObject {
|
||||||
protected GitHub root;
|
|
||||||
protected GHProject project;
|
protected GHProject project;
|
||||||
|
|
||||||
private String name;
|
private String name;
|
||||||
|
|||||||
@@ -36,8 +36,8 @@ import java.util.Objects;
|
|||||||
|
|
||||||
import javax.annotation.CheckForNull;
|
import javax.annotation.CheckForNull;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.LYDIAN;
|
import static org.kohsuke.github.internal.Previews.LYDIAN;
|
||||||
import static org.kohsuke.github.Previews.SHADOW_CAT;
|
import static org.kohsuke.github.internal.Previews.SHADOW_CAT;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* A pull request.
|
* A pull request.
|
||||||
@@ -576,7 +576,7 @@ public class GHPullRequest extends GHIssue implements Refreshable {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(LYDIAN)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public void updateBranch() throws IOException {
|
public void updateBranch() throws IOException {
|
||||||
root.createRequest()
|
root.createRequest()
|
||||||
|
|||||||
@@ -1,6 +1,6 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.SHADOW_CAT;
|
import static org.kohsuke.github.internal.Previews.SHADOW_CAT;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Lists up pull requests with some filtering and sorting.
|
* Lists up pull requests with some filtering and sorting.
|
||||||
|
|||||||
@@ -28,7 +28,7 @@ import java.net.URL;
|
|||||||
|
|
||||||
import javax.annotation.CheckForNull;
|
import javax.annotation.CheckForNull;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.*;
|
import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Review comment to the pull request
|
* Review comment to the pull request
|
||||||
@@ -153,7 +153,20 @@ public class GHPullRequestReviewComment extends GHObject implements Reactable {
|
|||||||
* @return the api route
|
* @return the api route
|
||||||
*/
|
*/
|
||||||
protected String getApiRoute() {
|
protected String getApiRoute() {
|
||||||
return "/repos/" + owner.getRepository().getFullName() + "/pulls/comments/" + getId();
|
return getApiRoute(false);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets api route.
|
||||||
|
*
|
||||||
|
* @param includePullNumber
|
||||||
|
* if true, includes the owning pull request's number in the route.
|
||||||
|
*
|
||||||
|
* @return the api route
|
||||||
|
*/
|
||||||
|
protected String getApiRoute(boolean includePullNumber) {
|
||||||
|
return "/repos/" + owner.getRepository().getFullName() + "/pulls"
|
||||||
|
+ (includePullNumber ? "/" + owner.getNumber() : "") + "/comments/" + getId();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -192,13 +205,12 @@ public class GHPullRequestReviewComment extends GHObject implements Reactable {
|
|||||||
return owner.root.createRequest()
|
return owner.root.createRequest()
|
||||||
.method("POST")
|
.method("POST")
|
||||||
.with("body", body)
|
.with("body", body)
|
||||||
.with("in_reply_to", getId())
|
.withUrlPath(getApiRoute(true) + "/replies")
|
||||||
.withUrlPath(getApiRoute() + "/comments")
|
|
||||||
.fetch(GHPullRequestReviewComment.class)
|
.fetch(GHPullRequestReviewComment.class)
|
||||||
.wrapUp(owner);
|
.wrapUp(owner);
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHReaction createReaction(ReactionContent content) throws IOException {
|
public GHReaction createReaction(ReactionContent content) throws IOException {
|
||||||
return owner.root.createRequest()
|
return owner.root.createRequest()
|
||||||
@@ -210,7 +222,7 @@ public class GHPullRequestReviewComment extends GHObject implements Reactable {
|
|||||||
.wrap(owner.root);
|
.wrap(owner.root);
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public PagedIterable<GHReaction> listReactions() {
|
public PagedIterable<GHReaction> listReactions() {
|
||||||
return owner.root.createRequest()
|
return owner.root.createRequest()
|
||||||
|
|||||||
@@ -7,8 +7,7 @@ package org.kohsuke.github;
|
|||||||
* the type parameter
|
* the type parameter
|
||||||
* @author Kohsuke Kawaguchi
|
* @author Kohsuke Kawaguchi
|
||||||
*/
|
*/
|
||||||
public abstract class GHQueryBuilder<T> {
|
public abstract class GHQueryBuilder<T> extends GitHubInteractiveObject {
|
||||||
protected final GitHub root;
|
|
||||||
protected final Requester req;
|
protected final Requester req;
|
||||||
|
|
||||||
GHQueryBuilder(GitHub root) {
|
GHQueryBuilder(GitHub root) {
|
||||||
|
|||||||
@@ -3,7 +3,7 @@ package org.kohsuke.github;
|
|||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.*;
|
import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Reaction to issue, comment, PR, and so on.
|
* Reaction to issue, comment, PR, and so on.
|
||||||
@@ -11,10 +11,9 @@ import static org.kohsuke.github.Previews.*;
|
|||||||
* @author Kohsuke Kawaguchi
|
* @author Kohsuke Kawaguchi
|
||||||
* @see Reactable
|
* @see Reactable
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public class GHReaction extends GHObject {
|
public class GHReaction extends GHObject {
|
||||||
private GitHub root;
|
|
||||||
|
|
||||||
private GHUser user;
|
private GHUser user;
|
||||||
private ReactionContent content;
|
private ReactionContent content;
|
||||||
|
|||||||
@@ -11,9 +11,7 @@ import java.net.URL;
|
|||||||
*
|
*
|
||||||
* @author Michael Clarke
|
* @author Michael Clarke
|
||||||
*/
|
*/
|
||||||
public class GHRef {
|
public class GHRef extends GitHubInteractiveObject {
|
||||||
/* package almost final */ GitHub root;
|
|
||||||
|
|
||||||
private String ref, url;
|
private String ref, url;
|
||||||
private GHObject object;
|
private GHObject object;
|
||||||
|
|
||||||
|
|||||||
@@ -19,7 +19,6 @@ import static java.lang.String.*;
|
|||||||
* @see GHRepository#createRelease(String) GHRepository#createRelease(String)
|
* @see GHRepository#createRelease(String) GHRepository#createRelease(String)
|
||||||
*/
|
*/
|
||||||
public class GHRelease extends GHObject {
|
public class GHRelease extends GHObject {
|
||||||
GitHub root;
|
|
||||||
GHRepository owner;
|
GHRepository owner;
|
||||||
|
|
||||||
private String html_url;
|
private String html_url;
|
||||||
@@ -260,7 +259,6 @@ public class GHRelease extends GHObject {
|
|||||||
* existing logic in place for backwards compatibility.
|
* existing logic in place for backwards compatibility.
|
||||||
*/
|
*/
|
||||||
@Deprecated
|
@Deprecated
|
||||||
@Preview
|
|
||||||
public List<GHAsset> assets() {
|
public List<GHAsset> assets() {
|
||||||
return assets;
|
return assets;
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -30,6 +30,7 @@ import edu.umd.cs.findbugs.annotations.CheckForNull;
|
|||||||
import edu.umd.cs.findbugs.annotations.NonNull;
|
import edu.umd.cs.findbugs.annotations.NonNull;
|
||||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
import org.apache.commons.lang3.StringUtils;
|
import org.apache.commons.lang3.StringUtils;
|
||||||
|
import org.kohsuke.github.function.InputStreamFunction;
|
||||||
|
|
||||||
import java.io.FileNotFoundException;
|
import java.io.FileNotFoundException;
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
@@ -49,13 +50,15 @@ import java.util.Iterator;
|
|||||||
import java.util.LinkedHashSet;
|
import java.util.LinkedHashSet;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
import java.util.Map;
|
import java.util.Map;
|
||||||
import java.util.Objects;
|
|
||||||
import java.util.Set;
|
import java.util.Set;
|
||||||
import java.util.TreeMap;
|
import java.util.TreeMap;
|
||||||
import java.util.WeakHashMap;
|
import java.util.WeakHashMap;
|
||||||
|
|
||||||
|
import javax.annotation.Nonnull;
|
||||||
|
|
||||||
import static java.util.Arrays.*;
|
import static java.util.Arrays.*;
|
||||||
import static org.kohsuke.github.Previews.*;
|
import static java.util.Objects.requireNonNull;
|
||||||
|
import static org.kohsuke.github.internal.Previews.*;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* A repository on GitHub.
|
* A repository on GitHub.
|
||||||
@@ -66,7 +69,6 @@ import static org.kohsuke.github.Previews.*;
|
|||||||
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public class GHRepository extends GHObject {
|
public class GHRepository extends GHObject {
|
||||||
/* package almost final */ transient GitHub root;
|
|
||||||
|
|
||||||
private String nodeId, description, homepage, name, full_name;
|
private String nodeId, description, homepage, name, full_name;
|
||||||
|
|
||||||
@@ -163,6 +165,8 @@ public class GHRepository extends GHObject {
|
|||||||
.with("task", task)
|
.with("task", task)
|
||||||
.with("environment", environment)
|
.with("environment", environment)
|
||||||
.withUrlPath(getApiTailUrl("deployments"))
|
.withUrlPath(getApiTailUrl("deployments"))
|
||||||
|
.withPreview(ANT_MAN)
|
||||||
|
.withPreview(FLASH)
|
||||||
.toIterable(GHDeployment[].class, item -> item.wrap(this));
|
.toIterable(GHDeployment[].class, item -> item.wrap(this));
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -178,6 +182,8 @@ public class GHRepository extends GHObject {
|
|||||||
public GHDeployment getDeployment(long id) throws IOException {
|
public GHDeployment getDeployment(long id) throws IOException {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
.withUrlPath(getApiTailUrl("deployments/" + id))
|
.withUrlPath(getApiTailUrl("deployments/" + id))
|
||||||
|
.withPreview(ANT_MAN)
|
||||||
|
.withPreview(FLASH)
|
||||||
.fetch(GHDeployment.class)
|
.fetch(GHDeployment.class)
|
||||||
.wrap(this);
|
.wrap(this);
|
||||||
}
|
}
|
||||||
@@ -704,7 +710,7 @@ public class GHRepository extends GHObject {
|
|||||||
* @return the boolean
|
* @return the boolean
|
||||||
*/
|
*/
|
||||||
@Deprecated
|
@Deprecated
|
||||||
@Preview
|
@Preview(BAPTISTE)
|
||||||
public boolean isTemplate() {
|
public boolean isTemplate() {
|
||||||
// isTemplate is still in preview, we do not want to retrieve it unless needed.
|
// isTemplate is still in preview, we do not want to retrieve it unless needed.
|
||||||
if (isTemplate == null) {
|
if (isTemplate == null) {
|
||||||
@@ -814,6 +820,13 @@ public class GHRepository extends GHObject {
|
|||||||
return size;
|
return size;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Affiliation of a repository collaborator
|
||||||
|
*/
|
||||||
|
public enum CollaboratorAffiliation {
|
||||||
|
ALL, DIRECT, OUTSIDE
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets the collaborators on this repository. This set always appear to include the owner.
|
* Gets the collaborators on this repository. This set always appear to include the owner.
|
||||||
*
|
*
|
||||||
@@ -837,6 +850,19 @@ public class GHRepository extends GHObject {
|
|||||||
return listUsers("collaborators");
|
return listUsers("collaborators");
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Lists up the collaborators on this repository.
|
||||||
|
*
|
||||||
|
* @param affiliation
|
||||||
|
* Filter users by affiliation
|
||||||
|
* @return Users paged iterable
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public PagedIterable<GHUser> listCollaborators(CollaboratorAffiliation affiliation) throws IOException {
|
||||||
|
return listUsers(root.createRequest().with("affiliation", affiliation), "collaborators");
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Lists all
|
* Lists all
|
||||||
* <a href="https://help.github.com/articles/assigning-issues-and-pull-requests-to-other-github-users/">the
|
* <a href="https://help.github.com/articles/assigning-issues-and-pull-requests-to-other-github-users/">the
|
||||||
@@ -884,6 +910,29 @@ public class GHRepository extends GHObject {
|
|||||||
return r;
|
return r;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the names of the collaborators on this repository. This method deviates from the principle of this library
|
||||||
|
* but it works a lot faster than {@link #getCollaborators()}.
|
||||||
|
*
|
||||||
|
* @param affiliation
|
||||||
|
* Filter users by affiliation
|
||||||
|
* @return the collaborator names
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public Set<String> getCollaboratorNames(CollaboratorAffiliation affiliation) throws IOException {
|
||||||
|
Set<String> r = new HashSet<>();
|
||||||
|
// no initializer - we just want to the logins
|
||||||
|
PagedIterable<GHUser> users = root.createRequest()
|
||||||
|
.withUrlPath(getApiTailUrl("collaborators"))
|
||||||
|
.with("affiliation", affiliation)
|
||||||
|
.toIterable(GHUser[].class, null);
|
||||||
|
for (GHUser u : users.toArray()) {
|
||||||
|
r.add(u.login);
|
||||||
|
}
|
||||||
|
return r;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Obtain permission for a given user in this repository.
|
* Obtain permission for a given user in this repository.
|
||||||
*
|
*
|
||||||
@@ -1039,14 +1088,6 @@ public class GHRepository extends GHObject {
|
|||||||
.send();
|
.send();
|
||||||
}
|
}
|
||||||
|
|
||||||
private void edit(String key, String value) throws IOException {
|
|
||||||
Requester requester = root.createRequest();
|
|
||||||
if (!key.equals("name")) {
|
|
||||||
requester.with("name", name); // even when we don't change the name, we need to send it in
|
|
||||||
}
|
|
||||||
requester.with(key, value).method("PATCH").withUrlPath(getApiTailUrl("")).send();
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Enables or disables the issue tracker for this repository.
|
* Enables or disables the issue tracker for this repository.
|
||||||
*
|
*
|
||||||
@@ -1056,7 +1097,7 @@ public class GHRepository extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void enableIssueTracker(boolean v) throws IOException {
|
public void enableIssueTracker(boolean v) throws IOException {
|
||||||
edit("has_issues", String.valueOf(v));
|
set().issues(v);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1068,7 +1109,7 @@ public class GHRepository extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void enableProjects(boolean v) throws IOException {
|
public void enableProjects(boolean v) throws IOException {
|
||||||
edit("has_projects", String.valueOf(v));
|
set().projects(v);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1080,7 +1121,7 @@ public class GHRepository extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void enableWiki(boolean v) throws IOException {
|
public void enableWiki(boolean v) throws IOException {
|
||||||
edit("has_wiki", String.valueOf(v));
|
set().wiki(v);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1092,7 +1133,7 @@ public class GHRepository extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void enableDownloads(boolean v) throws IOException {
|
public void enableDownloads(boolean v) throws IOException {
|
||||||
edit("has_downloads", String.valueOf(v));
|
set().downloads(v);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1104,7 +1145,7 @@ public class GHRepository extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void renameTo(String name) throws IOException {
|
public void renameTo(String name) throws IOException {
|
||||||
edit("name", name);
|
set().name(name);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1116,7 +1157,7 @@ public class GHRepository extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void setDescription(String value) throws IOException {
|
public void setDescription(String value) throws IOException {
|
||||||
edit("description", value);
|
set().description(value);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1128,7 +1169,7 @@ public class GHRepository extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void setHomepage(String value) throws IOException {
|
public void setHomepage(String value) throws IOException {
|
||||||
edit("homepage", value);
|
set().homepage(value);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1140,7 +1181,7 @@ public class GHRepository extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void setDefaultBranch(String value) throws IOException {
|
public void setDefaultBranch(String value) throws IOException {
|
||||||
edit("default_branch", value);
|
set().defaultBranch(value);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1152,7 +1193,7 @@ public class GHRepository extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void setPrivate(boolean value) throws IOException {
|
public void setPrivate(boolean value) throws IOException {
|
||||||
edit("private", Boolean.toString(value));
|
set().private_(value);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1164,7 +1205,7 @@ public class GHRepository extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void allowSquashMerge(boolean value) throws IOException {
|
public void allowSquashMerge(boolean value) throws IOException {
|
||||||
edit("allow_squash_merge", Boolean.toString(value));
|
set().allowSquashMerge(value);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1176,7 +1217,7 @@ public class GHRepository extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void allowMergeCommit(boolean value) throws IOException {
|
public void allowMergeCommit(boolean value) throws IOException {
|
||||||
edit("allow_merge_commit", Boolean.toString(value));
|
set().allowMergeCommit(value);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1188,7 +1229,7 @@ public class GHRepository extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void allowRebaseMerge(boolean value) throws IOException {
|
public void allowRebaseMerge(boolean value) throws IOException {
|
||||||
edit("allow_rebase_merge", Boolean.toString(value));
|
set().allowRebaseMerge(value);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1200,7 +1241,7 @@ public class GHRepository extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void deleteBranchOnMerge(boolean value) throws IOException {
|
public void deleteBranchOnMerge(boolean value) throws IOException {
|
||||||
edit("delete_branch_on_merge", Boolean.toString(value));
|
set().deleteBranchOnMerge(value);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1237,12 +1278,30 @@ public class GHRepository extends GHObject {
|
|||||||
* In case of any networking error or error from the server.
|
* In case of any networking error or error from the server.
|
||||||
*/
|
*/
|
||||||
public void archive() throws IOException {
|
public void archive() throws IOException {
|
||||||
edit("archived", "true");
|
set().archive();
|
||||||
// Generall would not update this record,
|
// Generally would not update this record,
|
||||||
// but do so here since this will result in any other update actions failing
|
// but doing so here since this will result in any other update actions failing
|
||||||
archived = true;
|
archived = true;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Creates a builder that can be used to bulk update repository settings.
|
||||||
|
*
|
||||||
|
* @return the repository updater
|
||||||
|
*/
|
||||||
|
public Updater update() {
|
||||||
|
return new Updater(this);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Creates a builder that can be used to bulk update repository settings.
|
||||||
|
*
|
||||||
|
* @return the repository updater
|
||||||
|
*/
|
||||||
|
public Setter set() {
|
||||||
|
return new Setter(this);
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Sort orders for listing forks
|
* Sort orders for listing forks
|
||||||
*/
|
*/
|
||||||
@@ -1724,7 +1783,7 @@ public class GHRepository extends GHObject {
|
|||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
.withHeader("Accept", "application/vnd.github.v3.raw")
|
.withHeader("Accept", "application/vnd.github.v3.raw")
|
||||||
.withUrlPath(target)
|
.withUrlPath(target)
|
||||||
.fetchStream();
|
.fetchStream(Requester::copyInputStream);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1878,7 +1937,7 @@ public class GHRepository extends GHObject {
|
|||||||
* @see <a href="https://developer.github.com/v3/checks/runs/#list-check-runs-for-a-specific-ref">List check runs
|
* @see <a href="https://developer.github.com/v3/checks/runs/#list-check-runs-for-a-specific-ref">List check runs
|
||||||
* for a specific ref</a>
|
* for a specific ref</a>
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(ANTIOPE)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public PagedIterable<GHCheckRun> getCheckRuns(String ref) throws IOException {
|
public PagedIterable<GHCheckRun> getCheckRuns(String ref) throws IOException {
|
||||||
GitHubRequest request = root.createRequest()
|
GitHubRequest request = root.createRequest()
|
||||||
@@ -1952,7 +2011,7 @@ public class GHRepository extends GHObject {
|
|||||||
* the commit hash
|
* the commit hash
|
||||||
* @return a builder which you should customize, then call {@link GHCheckRunBuilder#create}
|
* @return a builder which you should customize, then call {@link GHCheckRunBuilder#create}
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(ANTIOPE)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public @NonNull GHCheckRunBuilder createCheckRun(@NonNull String name, @NonNull String headSHA) {
|
public @NonNull GHCheckRunBuilder createCheckRun(@NonNull String name, @NonNull String headSHA) {
|
||||||
return new GHCheckRunBuilder(this, name, headSHA);
|
return new GHCheckRunBuilder(this, name, headSHA);
|
||||||
@@ -1965,7 +2024,7 @@ public class GHRepository extends GHObject {
|
|||||||
* the existing checkId
|
* the existing checkId
|
||||||
* @return a builder which you should customize, then call {@link GHCheckRunBuilder#create}
|
* @return a builder which you should customize, then call {@link GHCheckRunBuilder#create}
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(BAPTISTE)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public @NonNull GHCheckRunBuilder updateCheckRun(long checkId) {
|
public @NonNull GHCheckRunBuilder updateCheckRun(long checkId) {
|
||||||
return new GHCheckRunBuilder(this, checkId);
|
return new GHCheckRunBuilder(this, checkId);
|
||||||
@@ -2088,9 +2147,11 @@ public class GHRepository extends GHObject {
|
|||||||
}
|
}
|
||||||
|
|
||||||
private PagedIterable<GHUser> listUsers(final String suffix) {
|
private PagedIterable<GHUser> listUsers(final String suffix) {
|
||||||
return root.createRequest()
|
return listUsers(root.createRequest(), suffix);
|
||||||
.withUrlPath(getApiTailUrl(suffix))
|
}
|
||||||
.toIterable(GHUser[].class, item -> item.wrapUp(root));
|
|
||||||
|
private PagedIterable<GHUser> listUsers(Requester requester, final String suffix) {
|
||||||
|
return requester.withUrlPath(getApiTailUrl(suffix)).toIterable(GHUser[].class, item -> item.wrapUp(root));
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -2153,8 +2214,13 @@ public class GHRepository extends GHObject {
|
|||||||
justification = "It causes a performance degradation, but we have already exposed it to the API")
|
justification = "It causes a performance degradation, but we have already exposed it to the API")
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public Set<URL> getPostCommitHooks() {
|
public Set<URL> getPostCommitHooks() {
|
||||||
|
synchronized (this) {
|
||||||
|
if (postCommitHooks == null) {
|
||||||
|
postCommitHooks = setupPostCommitHooks();
|
||||||
|
}
|
||||||
return postCommitHooks;
|
return postCommitHooks;
|
||||||
}
|
}
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Live set view of the post-commit hook.
|
* Live set view of the post-commit hook.
|
||||||
@@ -2162,7 +2228,12 @@ public class GHRepository extends GHObject {
|
|||||||
@SuppressFBWarnings(value = "DMI_COLLECTION_OF_URLS",
|
@SuppressFBWarnings(value = "DMI_COLLECTION_OF_URLS",
|
||||||
justification = "It causes a performance degradation, but we have already exposed it to the API")
|
justification = "It causes a performance degradation, but we have already exposed it to the API")
|
||||||
@SkipFromToString
|
@SkipFromToString
|
||||||
private final Set<URL> postCommitHooks = new AbstractSet<URL>() {
|
private /* final */ transient Set<URL> postCommitHooks;
|
||||||
|
|
||||||
|
@SuppressFBWarnings(value = "DMI_COLLECTION_OF_URLS",
|
||||||
|
justification = "It causes a performance degradation, but we have already exposed it to the API")
|
||||||
|
private Set<URL> setupPostCommitHooks() {
|
||||||
|
return new AbstractSet<URL>() {
|
||||||
private List<URL> getPostCommitHooks() {
|
private List<URL> getPostCommitHooks() {
|
||||||
try {
|
try {
|
||||||
List<URL> r = new ArrayList<>();
|
List<URL> r = new ArrayList<>();
|
||||||
@@ -2213,6 +2284,7 @@ public class GHRepository extends GHObject {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
|
}
|
||||||
|
|
||||||
GHRepository wrap(GitHub root) {
|
GHRepository wrap(GitHub root) {
|
||||||
this.root = root;
|
this.root = root;
|
||||||
@@ -2738,7 +2810,7 @@ public class GHRepository extends GHObject {
|
|||||||
.with("mode", mode == null ? null : mode.toString())
|
.with("mode", mode == null ? null : mode.toString())
|
||||||
.with("context", getFullName())
|
.with("context", getFullName())
|
||||||
.withUrlPath("/markdown")
|
.withUrlPath("/markdown")
|
||||||
.fetchStream(),
|
.fetchStream(Requester::copyInputStream),
|
||||||
"UTF-8");
|
"UTF-8");
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -2826,6 +2898,71 @@ public class GHRepository extends GHObject {
|
|||||||
.wrapUp(root);
|
.wrapUp(root);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Lists all the workflows of this repository.
|
||||||
|
*
|
||||||
|
* @return the paged iterable
|
||||||
|
*/
|
||||||
|
public PagedIterable<GHWorkflow> listWorkflows() {
|
||||||
|
return root.createRequest()
|
||||||
|
.withUrlPath(getApiTailUrl("actions/workflows"))
|
||||||
|
.toIterable(GHWorkflow[].class, item -> item.wrapUp(root));
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets a workflow by id.
|
||||||
|
*
|
||||||
|
* @param id
|
||||||
|
* the id of the workflow run
|
||||||
|
* @return the workflow run
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public GHWorkflow getWorkflow(long id) throws IOException {
|
||||||
|
return getWorkflow(String.valueOf(id));
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets a workflow by name of the file.
|
||||||
|
*
|
||||||
|
* @param nameOrId
|
||||||
|
* either the name of the file (e.g. my-workflow.yml) or the id as a string
|
||||||
|
* @return the workflow run
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public GHWorkflow getWorkflow(String nameOrId) throws IOException {
|
||||||
|
return root.createRequest()
|
||||||
|
.withUrlPath(getApiTailUrl("actions/workflows"), nameOrId)
|
||||||
|
.fetch(GHWorkflow.class)
|
||||||
|
.wrapUp(this);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Retrieves workflow runs.
|
||||||
|
*
|
||||||
|
* @return the workflow run query builder
|
||||||
|
*/
|
||||||
|
public GHWorkflowRunQueryBuilder queryWorkflowRuns() {
|
||||||
|
return new GHWorkflowRunQueryBuilder(this);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets a workflow run.
|
||||||
|
*
|
||||||
|
* @param id
|
||||||
|
* the id of the workflow run
|
||||||
|
* @return the workflow run
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public GHWorkflowRun getWorkflowRun(long id) throws IOException {
|
||||||
|
return root.createRequest()
|
||||||
|
.withUrlPath(getApiTailUrl("actions/runs"), String.valueOf(id))
|
||||||
|
.fetch(GHWorkflowRun.class)
|
||||||
|
.wrapUp(this);
|
||||||
|
}
|
||||||
|
|
||||||
// Only used within listTopics().
|
// Only used within listTopics().
|
||||||
private static class Topics {
|
private static class Topics {
|
||||||
public List<String> names;
|
public List<String> names;
|
||||||
@@ -2892,6 +3029,52 @@ public class GHRepository extends GHObject {
|
|||||||
.wrap(this);
|
.wrap(this);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Streams a zip archive of the repository, optionally at a given <code>ref</code>.
|
||||||
|
*
|
||||||
|
* @param <T>
|
||||||
|
* the type of result
|
||||||
|
* @param streamFunction
|
||||||
|
* The {@link InputStreamFunction} that will process the stream
|
||||||
|
* @param ref
|
||||||
|
* if <code>null</code> the repository's default branch, usually <code>master</code>,
|
||||||
|
* @throws IOException
|
||||||
|
* The IO exception.
|
||||||
|
* @return the result of reading the stream.
|
||||||
|
*/
|
||||||
|
public <T> T readZip(InputStreamFunction<T> streamFunction, String ref) throws IOException {
|
||||||
|
return downloadArchive("zip", ref, streamFunction);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Streams a tar archive of the repository, optionally at a given <code>ref</code>.
|
||||||
|
*
|
||||||
|
* @param <T>
|
||||||
|
* the type of result
|
||||||
|
* @param streamFunction
|
||||||
|
* The {@link InputStreamFunction} that will process the stream
|
||||||
|
* @param ref
|
||||||
|
* if <code>null</code> the repository's default branch, usually <code>master</code>,
|
||||||
|
* @throws IOException
|
||||||
|
* The IO exception.
|
||||||
|
* @return the result of reading the stream.
|
||||||
|
*/
|
||||||
|
public <T> T readTar(InputStreamFunction<T> streamFunction, String ref) throws IOException {
|
||||||
|
return downloadArchive("tar", ref, streamFunction);
|
||||||
|
}
|
||||||
|
|
||||||
|
private <T> T downloadArchive(@Nonnull String type,
|
||||||
|
@CheckForNull String ref,
|
||||||
|
@Nonnull InputStreamFunction<T> streamFunction) throws IOException {
|
||||||
|
requireNonNull(streamFunction, "Sink must not be null");
|
||||||
|
String tailUrl = getApiTailUrl(type + "ball");
|
||||||
|
if (ref != null) {
|
||||||
|
tailUrl += "/" + ref;
|
||||||
|
}
|
||||||
|
final Requester builder = root.createRequest().method("GET").withUrlPath(tailUrl);
|
||||||
|
return builder.fetchStream(streamFunction);
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Populate this object.
|
* Populate this object.
|
||||||
*
|
*
|
||||||
@@ -2903,20 +3086,60 @@ public class GHRepository extends GHObject {
|
|||||||
return; // can't populate if the root is offline
|
return; // can't populate if the root is offline
|
||||||
}
|
}
|
||||||
|
|
||||||
final URL url = Objects.requireNonNull(getUrl(), "Missing instance URL!");
|
final URL url = requireNonNull(getUrl(), "Missing instance URL!");
|
||||||
|
|
||||||
try {
|
try {
|
||||||
// IMPORTANT: the url for repository records is does not reliably point to the API url.
|
// IMPORTANT: the url for repository records does not reliably point to the API url.
|
||||||
// There is bug in Push event payloads that returns the wrong url.
|
// There is bug in Push event payloads that returns the wrong url.
|
||||||
// All other occurrences of "url" take the form "https://api.github.com/...".
|
// All other occurrences of "url" take the form "https://api.github.com/...".
|
||||||
// For Push event repository records, they take the form "https://github.com/{fullName}".
|
// For Push event repository records, they take the form "https://github.com/{fullName}".
|
||||||
root.createRequest().withPreview(BAPTISE).setRawUrlPath(url.toString()).fetchInto(this).wrap(root);
|
root.createRequest().withPreview(BAPTISTE).setRawUrlPath(url.toString()).fetchInto(this).wrap(root);
|
||||||
} catch (HttpException e) {
|
} catch (HttpException e) {
|
||||||
if (e.getCause() instanceof JsonParseException) {
|
if (e.getCause() instanceof JsonParseException) {
|
||||||
root.createRequest().withPreview(BAPTISE).withUrlPath("/repos/" + full_name).fetchInto(this).wrap(root);
|
root.createRequest()
|
||||||
|
.withPreview(BAPTISTE)
|
||||||
|
.withUrlPath("/repos/" + full_name)
|
||||||
|
.fetchInto(this)
|
||||||
|
.wrap(root);
|
||||||
} else {
|
} else {
|
||||||
throw e;
|
throw e;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A {@link GHRepositoryBuilder} that allows multiple properties to be updated per request.
|
||||||
|
*
|
||||||
|
* Consumer must call {@link #done()} to commit changes.
|
||||||
|
*/
|
||||||
|
@BetaApi
|
||||||
|
@Deprecated
|
||||||
|
public static class Updater extends GHRepositoryBuilder<Updater> {
|
||||||
|
protected Updater(@Nonnull GHRepository repository) {
|
||||||
|
super(Updater.class, repository.root, null);
|
||||||
|
// even when we don't change the name, we need to send it in
|
||||||
|
// this requirement may be out-of-date, but we do not want to break it
|
||||||
|
requester.with("name", repository.name);
|
||||||
|
|
||||||
|
requester.method("PATCH").withUrlPath(repository.getApiTailUrl(""));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A {@link GHRepositoryBuilder} that allows multiple properties to be updated per request.
|
||||||
|
*
|
||||||
|
* Consumer must call {@link #done()} to commit changes.
|
||||||
|
*/
|
||||||
|
@BetaApi
|
||||||
|
@Deprecated
|
||||||
|
public static class Setter extends GHRepositoryBuilder<GHRepository> {
|
||||||
|
protected Setter(@Nonnull GHRepository repository) {
|
||||||
|
super(GHRepository.class, repository.root, null);
|
||||||
|
// even when we don't change the name, we need to send it in
|
||||||
|
// this requirement may be out-of-date, but we do not want to break it
|
||||||
|
requester.with("name", repository.name);
|
||||||
|
|
||||||
|
requester.method("PATCH").withUrlPath(repository.getApiTailUrl(""));
|
||||||
|
}
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
235
src/main/java/org/kohsuke/github/GHRepositoryBuilder.java
Normal file
235
src/main/java/org/kohsuke/github/GHRepositoryBuilder.java
Normal file
@@ -0,0 +1,235 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import java.io.IOException;
|
||||||
|
import java.net.URL;
|
||||||
|
|
||||||
|
import static org.kohsuke.github.internal.Previews.BAPTISTE;
|
||||||
|
|
||||||
|
abstract class GHRepositoryBuilder<S> extends AbstractBuilder<GHRepository, S> {
|
||||||
|
|
||||||
|
protected GHRepositoryBuilder(Class<S> intermediateReturnType, GitHub root, GHRepository baseInstance) {
|
||||||
|
super(GHRepository.class, intermediateReturnType, root, baseInstance);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Allow or disallow squash-merging pull requests.
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S allowSquashMerge(boolean enabled) throws IOException {
|
||||||
|
return with("allow_squash_merge", enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Allow or disallow merging pull requests with a merge commit.
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S allowMergeCommit(boolean enabled) throws IOException {
|
||||||
|
return with("allow_merge_commit", enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Allow or disallow rebase-merging pull requests.
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S allowRebaseMerge(boolean enabled) throws IOException {
|
||||||
|
return with("allow_rebase_merge", enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* After pull requests are merged, you can have head branches deleted automatically.
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S deleteBranchOnMerge(boolean enabled) throws IOException {
|
||||||
|
return with("delete_branch_on_merge", enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Default repository branch
|
||||||
|
*
|
||||||
|
* @param branch
|
||||||
|
* branch name
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S defaultBranch(String branch) throws IOException {
|
||||||
|
return with("default_branch", branch);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Description for repository
|
||||||
|
*
|
||||||
|
* @param description
|
||||||
|
* description of repository
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S description(String description) throws IOException {
|
||||||
|
return with("description", description);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Homepage for repository
|
||||||
|
*
|
||||||
|
* @param homepage
|
||||||
|
* homepage of repository
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S homepage(URL homepage) throws IOException {
|
||||||
|
return homepage(homepage.toExternalForm());
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Homepage for repository
|
||||||
|
*
|
||||||
|
* @param homepage
|
||||||
|
* homepage of repository
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S homepage(String homepage) throws IOException {
|
||||||
|
return with("homepage", homepage);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Sets the repository to private
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* private if true
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S private_(boolean enabled) throws IOException {
|
||||||
|
return with("private", enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Enables issue tracker
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S issues(boolean enabled) throws IOException {
|
||||||
|
return with("has_issues", enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Enables projects
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S projects(boolean enabled) throws IOException {
|
||||||
|
return with("has_projects", enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Enables wiki
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
* @return a builder to continue with building
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S wiki(boolean enabled) throws IOException {
|
||||||
|
return with("has_wiki", enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Enables downloads
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S downloads(boolean enabled) throws IOException {
|
||||||
|
return with("has_downloads", enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Specifies whether the repository is a template.
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
* @return a builder to continue with building
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
@Preview(BAPTISTE)
|
||||||
|
@Deprecated
|
||||||
|
public S isTemplate(boolean enabled) throws IOException {
|
||||||
|
requester.withPreview(BAPTISTE);
|
||||||
|
return with("is_template", enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public GHRepository done() throws IOException {
|
||||||
|
return super.done().wrap(this.root);
|
||||||
|
}
|
||||||
|
|
||||||
|
S archive() throws IOException {
|
||||||
|
return with("archived", true);
|
||||||
|
}
|
||||||
|
|
||||||
|
S name(String name) throws IOException {
|
||||||
|
return with("name", name);
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -16,10 +16,9 @@ import java.util.NoSuchElementException;
|
|||||||
*
|
*
|
||||||
* @author Martin van Zijl
|
* @author Martin van Zijl
|
||||||
*/
|
*/
|
||||||
public class GHRepositoryStatistics {
|
public class GHRepositoryStatistics extends GitHubInteractiveObject {
|
||||||
|
|
||||||
private final GHRepository repo;
|
private final GHRepository repo;
|
||||||
private final GitHub root;
|
|
||||||
|
|
||||||
private static final int MAX_WAIT_ITERATIONS = 3;
|
private static final int MAX_WAIT_ITERATIONS = 3;
|
||||||
private static final int WAIT_SLEEP_INTERVAL = 5000;
|
private static final int WAIT_SLEEP_INTERVAL = 5000;
|
||||||
@@ -60,7 +59,7 @@ public class GHRepositoryStatistics {
|
|||||||
* @throws InterruptedException
|
* @throws InterruptedException
|
||||||
* the interrupted exception
|
* the interrupted exception
|
||||||
*/
|
*/
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
@SuppressWarnings("SleepWhileInLoop")
|
@SuppressWarnings("SleepWhileInLoop")
|
||||||
@SuppressFBWarnings(value = { "RCN_REDUNDANT_NULLCHECK_OF_NONNULL_VALUE" }, justification = "JSON API")
|
@SuppressFBWarnings(value = { "RCN_REDUNDANT_NULLCHECK_OF_NONNULL_VALUE" }, justification = "JSON API")
|
||||||
@@ -99,7 +98,6 @@ public class GHRepositoryStatistics {
|
|||||||
"URF_UNREAD_FIELD" },
|
"URF_UNREAD_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public static class ContributorStats extends GHObject {
|
public static class ContributorStats extends GHObject {
|
||||||
/* package almost final */ private GitHub root;
|
|
||||||
private GHUser author;
|
private GHUser author;
|
||||||
private int total;
|
private int total;
|
||||||
private List<Week> weeks;
|
private List<Week> weeks;
|
||||||
@@ -255,7 +253,6 @@ public class GHRepositoryStatistics {
|
|||||||
value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public static class CommitActivity extends GHObject {
|
public static class CommitActivity extends GHObject {
|
||||||
/* package almost final */ private GitHub root;
|
|
||||||
private List<Integer> days;
|
private List<Integer> days;
|
||||||
private int total;
|
private int total;
|
||||||
private long week;
|
private long week;
|
||||||
@@ -398,7 +395,6 @@ public class GHRepositoryStatistics {
|
|||||||
* The type Participation.
|
* The type Participation.
|
||||||
*/
|
*/
|
||||||
public static class Participation extends GHObject {
|
public static class Participation extends GHObject {
|
||||||
/* package almost final */ private GitHub root;
|
|
||||||
private List<Integer> all;
|
private List<Integer> all;
|
||||||
private List<Integer> owner;
|
private List<Integer> owner;
|
||||||
|
|
||||||
|
|||||||
@@ -8,7 +8,6 @@ import java.net.URL;
|
|||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public class GHRequestedAction extends GHObject {
|
public class GHRequestedAction extends GHObject {
|
||||||
private GHRepository owner;
|
private GHRepository owner;
|
||||||
private GitHub root;
|
|
||||||
private String identifier;
|
private String identifier;
|
||||||
private String label;
|
private String label;
|
||||||
private String description;
|
private String description;
|
||||||
|
|||||||
@@ -10,11 +10,10 @@ import java.util.Date;
|
|||||||
* @see GHRepository#getSubscription() GHRepository#getSubscription()
|
* @see GHRepository#getSubscription() GHRepository#getSubscription()
|
||||||
* @see GHThread#getSubscription() GHThread#getSubscription()
|
* @see GHThread#getSubscription() GHThread#getSubscription()
|
||||||
*/
|
*/
|
||||||
public class GHSubscription {
|
public class GHSubscription extends GitHubInteractiveObject {
|
||||||
private String created_at, url, repository_url, reason;
|
private String created_at, url, repository_url, reason;
|
||||||
private boolean subscribed, ignored;
|
private boolean subscribed, ignored;
|
||||||
|
|
||||||
private GitHub root;
|
|
||||||
private GHRepository repo;
|
private GHRepository repo;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|||||||
@@ -9,9 +9,8 @@ import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
|||||||
*/
|
*/
|
||||||
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public class GHTag {
|
public class GHTag extends GitHubInteractiveObject {
|
||||||
private GHRepository owner;
|
private GHRepository owner;
|
||||||
private GitHub root;
|
|
||||||
|
|
||||||
private String name;
|
private String name;
|
||||||
private GHCommit commit;
|
private GHCommit commit;
|
||||||
|
|||||||
@@ -9,9 +9,8 @@ import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
|||||||
*/
|
*/
|
||||||
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public class GHTagObject {
|
public class GHTagObject extends GitHubInteractiveObject {
|
||||||
private GHRepository owner;
|
private GHRepository owner;
|
||||||
private GitHub root;
|
|
||||||
|
|
||||||
private String tag;
|
private String tag;
|
||||||
private String sha;
|
private String sha;
|
||||||
|
|||||||
@@ -24,8 +24,6 @@ public class GHTeam extends GHObject implements Refreshable {
|
|||||||
|
|
||||||
private GHOrganization organization; // populated by GET /user/teams where Teams+Orgs are returned together
|
private GHOrganization organization; // populated by GET /user/teams where Teams+Orgs are returned together
|
||||||
|
|
||||||
protected /* final */ GitHub root;
|
|
||||||
|
|
||||||
public enum Privacy {
|
public enum Privacy {
|
||||||
SECRET, // only visible to organization owners and members of this team.
|
SECRET, // only visible to organization owners and members of this team.
|
||||||
CLOSED // visible to all members of this organization.
|
CLOSED // visible to all members of this organization.
|
||||||
|
|||||||
@@ -7,9 +7,7 @@ import java.io.IOException;
|
|||||||
*
|
*
|
||||||
* https://developer.github.com/v3/teams/#create-team
|
* https://developer.github.com/v3/teams/#create-team
|
||||||
*/
|
*/
|
||||||
public class GHTeamBuilder {
|
public class GHTeamBuilder extends GitHubInteractiveObject {
|
||||||
|
|
||||||
private final GitHub root;
|
|
||||||
protected final Requester builder;
|
protected final Requester builder;
|
||||||
private final String orgName;
|
private final String orgName;
|
||||||
|
|
||||||
|
|||||||
@@ -17,7 +17,6 @@ import java.util.Date;
|
|||||||
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public class GHThread extends GHObject {
|
public class GHThread extends GHObject {
|
||||||
private GitHub root;
|
|
||||||
private GHRepository repository;
|
private GHRepository repository;
|
||||||
private Subject subject;
|
private Subject subject;
|
||||||
private String reason;
|
private String reason;
|
||||||
|
|||||||
149
src/main/java/org/kohsuke/github/GHWorkflow.java
Normal file
149
src/main/java/org/kohsuke/github/GHWorkflow.java
Normal file
@@ -0,0 +1,149 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import com.fasterxml.jackson.annotation.JsonIgnore;
|
||||||
|
import org.apache.commons.lang3.StringUtils;
|
||||||
|
|
||||||
|
import java.io.IOException;
|
||||||
|
import java.net.URL;
|
||||||
|
import java.util.Collections;
|
||||||
|
import java.util.Map;
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A workflow.
|
||||||
|
*
|
||||||
|
* @author Guillaume Smet
|
||||||
|
* @see GHRepository#getWorkflow(long)
|
||||||
|
*/
|
||||||
|
public class GHWorkflow extends GHObject {
|
||||||
|
|
||||||
|
// Not provided by the API.
|
||||||
|
@JsonIgnore
|
||||||
|
private GHRepository owner;
|
||||||
|
|
||||||
|
private String name;
|
||||||
|
private String path;
|
||||||
|
private String state;
|
||||||
|
|
||||||
|
private String htmlUrl;
|
||||||
|
private String badgeUrl;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The name of the workflow.
|
||||||
|
*
|
||||||
|
* @return the name
|
||||||
|
*/
|
||||||
|
public String getName() {
|
||||||
|
return name;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The path of the workflow e.g. .github/workflows/blank.yaml
|
||||||
|
*
|
||||||
|
* @return the path
|
||||||
|
*/
|
||||||
|
public String getPath() {
|
||||||
|
return path;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The state of the workflow.
|
||||||
|
*
|
||||||
|
* @return the state
|
||||||
|
*/
|
||||||
|
public String getState() {
|
||||||
|
return state;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public URL getHtmlUrl() throws IOException {
|
||||||
|
return GitHubClient.parseURL(htmlUrl);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The badge URL, like https://github.com/octo-org/octo-repo/workflows/CI/badge.svg
|
||||||
|
*
|
||||||
|
* @return the badge url
|
||||||
|
*/
|
||||||
|
public URL getBadgeUrl() {
|
||||||
|
return GitHubClient.parseURL(badgeUrl);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Disable the workflow.
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public void disable() throws IOException {
|
||||||
|
root.createRequest().method("PUT").withUrlPath(getApiRoute(), "disable").fetchHttpStatusCode();
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Enable the workflow.
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public void enable() throws IOException {
|
||||||
|
root.createRequest().method("PUT").withUrlPath(getApiRoute(), "enable").fetchHttpStatusCode();
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Create a workflow dispatch event which triggers a manual workflow run.
|
||||||
|
*
|
||||||
|
* @param ref
|
||||||
|
* the git reference for the workflow. The reference can be a branch or tag name.
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public void dispatch(String ref) throws IOException {
|
||||||
|
dispatch(ref, Collections.emptyMap());
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Create a workflow dispatch event which triggers a manual workflow run.
|
||||||
|
*
|
||||||
|
* @param ref
|
||||||
|
* the git reference for the workflow. The reference can be a branch or tag name.
|
||||||
|
* @param inputs
|
||||||
|
* input keys and values configured in the workflow file. The maximum number of properties is 10. Any
|
||||||
|
* default properties configured in the workflow file will be used when inputs are omitted.
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public void dispatch(String ref, Map<String, Object> inputs) throws IOException {
|
||||||
|
Requester requester = root.createRequest()
|
||||||
|
.method("POST")
|
||||||
|
.withUrlPath(getApiRoute(), "dispatches")
|
||||||
|
.with("ref", ref);
|
||||||
|
|
||||||
|
if (!inputs.isEmpty()) {
|
||||||
|
requester.with("inputs", inputs);
|
||||||
|
}
|
||||||
|
|
||||||
|
requester.fetchHttpStatusCode();
|
||||||
|
}
|
||||||
|
|
||||||
|
private String getApiRoute() {
|
||||||
|
if (owner == null) {
|
||||||
|
// Workflow runs returned from search to do not have an owner. Attempt to use url.
|
||||||
|
final URL url = Objects.requireNonNull(getUrl(), "Missing instance URL!");
|
||||||
|
return StringUtils.prependIfMissing(url.toString().replace(root.getApiUrl(), ""), "/");
|
||||||
|
|
||||||
|
}
|
||||||
|
return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/actions/workflows/" + getId();
|
||||||
|
}
|
||||||
|
|
||||||
|
GHWorkflow wrapUp(GHRepository owner) {
|
||||||
|
this.owner = owner;
|
||||||
|
return wrapUp(owner.root);
|
||||||
|
}
|
||||||
|
|
||||||
|
GHWorkflow wrapUp(GitHub root) {
|
||||||
|
this.root = root;
|
||||||
|
if (owner != null)
|
||||||
|
owner.wrap(root);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
}
|
||||||
387
src/main/java/org/kohsuke/github/GHWorkflowRun.java
Normal file
387
src/main/java/org/kohsuke/github/GHWorkflowRun.java
Normal file
@@ -0,0 +1,387 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||||
|
import org.apache.commons.lang3.StringUtils;
|
||||||
|
import org.kohsuke.github.internal.EnumUtils;
|
||||||
|
|
||||||
|
import java.io.IOException;
|
||||||
|
import java.net.URL;
|
||||||
|
import java.util.Arrays;
|
||||||
|
import java.util.Collections;
|
||||||
|
import java.util.Date;
|
||||||
|
import java.util.List;
|
||||||
|
import java.util.Locale;
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A workflow run.
|
||||||
|
*
|
||||||
|
* @author Guillaume Smet
|
||||||
|
* @see GHRepository#getWorkflowRun(long)
|
||||||
|
*/
|
||||||
|
public class GHWorkflowRun extends GHObject {
|
||||||
|
|
||||||
|
@JsonProperty("repository")
|
||||||
|
private GHRepository owner;
|
||||||
|
|
||||||
|
private String name;
|
||||||
|
private long runNumber;
|
||||||
|
private long workflowId;
|
||||||
|
|
||||||
|
private String htmlUrl;
|
||||||
|
private String jobsUrl;
|
||||||
|
private String logsUrl;
|
||||||
|
private String checkSuiteUrl;
|
||||||
|
private String artifactsUrl;
|
||||||
|
private String cancelUrl;
|
||||||
|
private String rerunUrl;
|
||||||
|
private String workflowUrl;
|
||||||
|
|
||||||
|
private String headBranch;
|
||||||
|
private String headSha;
|
||||||
|
private GHRepository headRepository;
|
||||||
|
private HeadCommit headCommit;
|
||||||
|
|
||||||
|
private String event;
|
||||||
|
private String status;
|
||||||
|
private String conclusion;
|
||||||
|
|
||||||
|
private GHPullRequest[] pullRequests;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The name of the workflow run.
|
||||||
|
*
|
||||||
|
* @return the name
|
||||||
|
*/
|
||||||
|
public String getName() {
|
||||||
|
return name;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The run number.
|
||||||
|
*
|
||||||
|
* @return the run number
|
||||||
|
*/
|
||||||
|
public long getRunNumber() {
|
||||||
|
return runNumber;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The workflow id.
|
||||||
|
*
|
||||||
|
* @return the workflow id
|
||||||
|
*/
|
||||||
|
public long getWorkflowId() {
|
||||||
|
return workflowId;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public URL getHtmlUrl() throws IOException {
|
||||||
|
return GitHubClient.parseURL(htmlUrl);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The jobs URL, like https://api.github.com/repos/octo-org/octo-repo/actions/runs/30433642/jobs
|
||||||
|
*
|
||||||
|
* @return the diff url
|
||||||
|
*/
|
||||||
|
public URL getJobsUrl() {
|
||||||
|
return GitHubClient.parseURL(jobsUrl);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The logs URL, like https://api.github.com/repos/octo-org/octo-repo/actions/runs/30433642/logs
|
||||||
|
*
|
||||||
|
* @return the diff url
|
||||||
|
*/
|
||||||
|
public URL getLogsUrl() {
|
||||||
|
return GitHubClient.parseURL(logsUrl);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The check suite URL, like https://api.github.com/repos/octo-org/octo-repo/check-suites/414944374
|
||||||
|
*
|
||||||
|
* @return the diff url
|
||||||
|
*/
|
||||||
|
public URL getCheckSuiteUrl() {
|
||||||
|
return GitHubClient.parseURL(checkSuiteUrl);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The artifacts URL, like https://api.github.com/repos/octo-org/octo-repo/actions/runs/30433642/artifacts
|
||||||
|
*
|
||||||
|
* @return the diff url
|
||||||
|
*/
|
||||||
|
public URL getArtifactsUrl() {
|
||||||
|
return GitHubClient.parseURL(artifactsUrl);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The cancel URL, like https://api.github.com/repos/octo-org/octo-repo/actions/runs/30433642/cancel
|
||||||
|
*
|
||||||
|
* @return the diff url
|
||||||
|
*/
|
||||||
|
public URL getCancelUrl() {
|
||||||
|
return GitHubClient.parseURL(cancelUrl);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The rerun URL, like https://api.github.com/repos/octo-org/octo-repo/actions/runs/30433642/rerun
|
||||||
|
*
|
||||||
|
* @return the diff url
|
||||||
|
*/
|
||||||
|
public URL getRerunUrl() {
|
||||||
|
return GitHubClient.parseURL(rerunUrl);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The workflow URL, like https://api.github.com/repos/octo-org/octo-repo/actions/workflows/159038
|
||||||
|
*
|
||||||
|
* @return the diff url
|
||||||
|
*/
|
||||||
|
public URL getWorkflowUrl() {
|
||||||
|
return GitHubClient.parseURL(workflowUrl);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The head branch name the changes are on.
|
||||||
|
*
|
||||||
|
* @return head branch name
|
||||||
|
*/
|
||||||
|
public String getHeadBranch() {
|
||||||
|
return headBranch;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the HEAD SHA.
|
||||||
|
*
|
||||||
|
* @return sha for the HEAD commit
|
||||||
|
*/
|
||||||
|
public String getHeadSha() {
|
||||||
|
return headSha;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The commit of current head.
|
||||||
|
*
|
||||||
|
* @return head commit
|
||||||
|
*/
|
||||||
|
public HeadCommit getHeadCommit() {
|
||||||
|
return headCommit;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The repository of current head.
|
||||||
|
*
|
||||||
|
* @return head repository
|
||||||
|
*/
|
||||||
|
public GHRepository getHeadRepository() {
|
||||||
|
return headRepository;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The type of event that triggered the build.
|
||||||
|
*
|
||||||
|
* @return type of event
|
||||||
|
*/
|
||||||
|
public GHEvent getEvent() {
|
||||||
|
return Enum.valueOf(GHEvent.class, event.toUpperCase(Locale.ROOT));
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets status of the workflow run.
|
||||||
|
* <p>
|
||||||
|
* Can be {@code UNKNOWN} if the value returned by GitHub is unknown from the API.
|
||||||
|
*
|
||||||
|
* @return status of the workflow run
|
||||||
|
*/
|
||||||
|
public Status getStatus() {
|
||||||
|
return Status.from(status);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the conclusion of the workflow run.
|
||||||
|
* <p>
|
||||||
|
* Can be {@code UNKNOWN} if the value returned by GitHub is unknown from the API.
|
||||||
|
*
|
||||||
|
* @return conclusion of the workflow run
|
||||||
|
*/
|
||||||
|
public Conclusion getConclusion() {
|
||||||
|
return Conclusion.from(conclusion);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the pull requests participated in this workflow run.
|
||||||
|
*
|
||||||
|
* Note this field is only populated for events. When getting a {@link GHWorkflowRun} outside of an event, this is
|
||||||
|
* always empty.
|
||||||
|
*
|
||||||
|
* @return the list of {@link GHPullRequest}s for this workflow run. Only populated for events.
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public List<GHPullRequest> getPullRequests() throws IOException {
|
||||||
|
if (pullRequests != null && pullRequests.length != 0) {
|
||||||
|
for (GHPullRequest pullRequest : pullRequests) {
|
||||||
|
// Only refresh if we haven't do so before
|
||||||
|
pullRequest.refresh(pullRequest.getTitle());
|
||||||
|
}
|
||||||
|
return Collections.unmodifiableList(Arrays.asList(pullRequests));
|
||||||
|
}
|
||||||
|
return Collections.emptyList();
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Cancel the workflow run.
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public void cancel() throws IOException {
|
||||||
|
root.createRequest().method("POST").withUrlPath(getApiRoute(), "cancel").fetchHttpStatusCode();
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Delete the workflow run.
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public void delete() throws IOException {
|
||||||
|
root.createRequest().method("DELETE").withUrlPath(getApiRoute()).fetchHttpStatusCode();
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Rerun the workflow run.
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public void rerun() throws IOException {
|
||||||
|
root.createRequest().method("POST").withUrlPath(getApiRoute(), "rerun").fetchHttpStatusCode();
|
||||||
|
}
|
||||||
|
|
||||||
|
private String getApiRoute() {
|
||||||
|
if (owner == null) {
|
||||||
|
// Workflow runs returned from search to do not have an owner. Attempt to use url.
|
||||||
|
final URL url = Objects.requireNonNull(getUrl(), "Missing instance URL!");
|
||||||
|
return StringUtils.prependIfMissing(url.toString().replace(root.getApiUrl(), ""), "/");
|
||||||
|
|
||||||
|
}
|
||||||
|
return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/actions/runs/" + getId();
|
||||||
|
}
|
||||||
|
|
||||||
|
GHWorkflowRun wrapUp(GHRepository owner) {
|
||||||
|
this.owner = owner;
|
||||||
|
return wrapUp(owner.root);
|
||||||
|
}
|
||||||
|
|
||||||
|
GHWorkflowRun wrapUp(GitHub root) {
|
||||||
|
this.root = root;
|
||||||
|
if (owner != null) {
|
||||||
|
owner.wrap(root);
|
||||||
|
if (pullRequests != null) {
|
||||||
|
for (GHPullRequest singlePull : pullRequests) {
|
||||||
|
singlePull.wrap(owner);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
} else if (pullRequests != null) {
|
||||||
|
for (GHPullRequest singlePull : pullRequests) {
|
||||||
|
singlePull.wrap(root);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
if (headRepository != null) {
|
||||||
|
headRepository.wrap(root);
|
||||||
|
}
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
public static class HeadCommit {
|
||||||
|
private String id;
|
||||||
|
private String treeId;
|
||||||
|
private String message;
|
||||||
|
private String timestamp;
|
||||||
|
private GitUser author;
|
||||||
|
private GitUser committer;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets id of the commit
|
||||||
|
*
|
||||||
|
* @return id of the commit
|
||||||
|
*/
|
||||||
|
public String getId() {
|
||||||
|
return id;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets id of the tree.
|
||||||
|
*
|
||||||
|
* @return id of the tree
|
||||||
|
*/
|
||||||
|
public String getTreeId() {
|
||||||
|
return treeId;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets message.
|
||||||
|
*
|
||||||
|
* @return commit message.
|
||||||
|
*/
|
||||||
|
public String getMessage() {
|
||||||
|
return message;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets timestamp of the commit.
|
||||||
|
*
|
||||||
|
* @return timestamp of the commit
|
||||||
|
*/
|
||||||
|
public Date getTimestamp() {
|
||||||
|
return GitHubClient.parseDate(timestamp);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets author.
|
||||||
|
*
|
||||||
|
* @return the author
|
||||||
|
*/
|
||||||
|
public GitUser getAuthor() {
|
||||||
|
return author;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets committer.
|
||||||
|
*
|
||||||
|
* @return the committer
|
||||||
|
*/
|
||||||
|
public GitUser getCommitter() {
|
||||||
|
return committer;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
public static enum Status {
|
||||||
|
QUEUED, IN_PROGRESS, COMPLETED, UNKNOWN;
|
||||||
|
|
||||||
|
public static Status from(String value) {
|
||||||
|
return EnumUtils.getNullableEnumOrDefault(Status.class, value, Status.UNKNOWN);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String toString() {
|
||||||
|
return name().toLowerCase(Locale.ROOT);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
public static enum Conclusion {
|
||||||
|
ACTION_REQUIRED, CANCELLED, FAILURE, NEUTRAL, SUCCESS, SKIPPED, STALE, TIMED_OUT, UNKNOWN;
|
||||||
|
|
||||||
|
public static Conclusion from(String value) {
|
||||||
|
return EnumUtils.getNullableEnumOrDefault(Conclusion.class, value, Conclusion.UNKNOWN);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String toString() {
|
||||||
|
return name().toLowerCase(Locale.ROOT);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
101
src/main/java/org/kohsuke/github/GHWorkflowRunQueryBuilder.java
Normal file
101
src/main/java/org/kohsuke/github/GHWorkflowRunQueryBuilder.java
Normal file
@@ -0,0 +1,101 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import org.kohsuke.github.GHWorkflowRun.Status;
|
||||||
|
|
||||||
|
import java.net.MalformedURLException;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Lists up workflow runs with some filtering and sorting.
|
||||||
|
*
|
||||||
|
* @author Guillaume Smet
|
||||||
|
* @see GHRepository#queryWorkflowRuns()
|
||||||
|
*/
|
||||||
|
public class GHWorkflowRunQueryBuilder extends GHQueryBuilder<GHWorkflowRun> {
|
||||||
|
private final GHRepository repo;
|
||||||
|
|
||||||
|
GHWorkflowRunQueryBuilder(GHRepository repo) {
|
||||||
|
super(repo.root);
|
||||||
|
this.repo = repo;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Actor workflow run query builder.
|
||||||
|
*
|
||||||
|
* @param actor
|
||||||
|
* the actor
|
||||||
|
* @return the gh workflow run query builder
|
||||||
|
*/
|
||||||
|
public GHWorkflowRunQueryBuilder actor(String actor) {
|
||||||
|
req.with("actor", actor);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Actor workflow run query builder.
|
||||||
|
*
|
||||||
|
* @param actor
|
||||||
|
* the actor
|
||||||
|
* @return the gh workflow run query builder
|
||||||
|
*/
|
||||||
|
public GHWorkflowRunQueryBuilder actor(GHUser actor) {
|
||||||
|
req.with("actor", actor.getLogin());
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Branch workflow run query builder.
|
||||||
|
*
|
||||||
|
* @param branch
|
||||||
|
* the branch
|
||||||
|
* @return the gh workflow run query builder
|
||||||
|
*/
|
||||||
|
public GHWorkflowRunQueryBuilder branch(String branch) {
|
||||||
|
req.with("branch", branch);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Event workflow run query builder.
|
||||||
|
*
|
||||||
|
* @param event
|
||||||
|
* the event
|
||||||
|
* @return the gh workflow run query builder
|
||||||
|
*/
|
||||||
|
public GHWorkflowRunQueryBuilder event(GHEvent event) {
|
||||||
|
req.with("event", event.symbol());
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Event workflow run query builder.
|
||||||
|
*
|
||||||
|
* @param event
|
||||||
|
* the event
|
||||||
|
* @return the gh workflow run query builder
|
||||||
|
*/
|
||||||
|
public GHWorkflowRunQueryBuilder event(String event) {
|
||||||
|
req.with("event", event);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Status workflow run query builder.
|
||||||
|
*
|
||||||
|
* @param status
|
||||||
|
* the status
|
||||||
|
* @return the gh workflow run query builder
|
||||||
|
*/
|
||||||
|
public GHWorkflowRunQueryBuilder status(Status status) {
|
||||||
|
req.with("status", status.toString());
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public PagedIterable<GHWorkflowRun> list() {
|
||||||
|
try {
|
||||||
|
return new GHWorkflowRunsIterable(root, req.withUrlPath(repo.getApiTailUrl("actions/runs")).build());
|
||||||
|
} catch (MalformedURLException e) {
|
||||||
|
throw new GHException(e.getMessage(), e);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
44
src/main/java/org/kohsuke/github/GHWorkflowRunsIterable.java
Normal file
44
src/main/java/org/kohsuke/github/GHWorkflowRunsIterable.java
Normal file
@@ -0,0 +1,44 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import java.util.Iterator;
|
||||||
|
|
||||||
|
import javax.annotation.Nonnull;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Iterable for workflow runs listing.
|
||||||
|
*/
|
||||||
|
class GHWorkflowRunsIterable extends PagedIterable<GHWorkflowRun> {
|
||||||
|
private final transient GitHub root;
|
||||||
|
private final GitHubRequest request;
|
||||||
|
|
||||||
|
private GHWorkflowRunsPage result;
|
||||||
|
|
||||||
|
public GHWorkflowRunsIterable(GitHub root, GitHubRequest request) {
|
||||||
|
this.root = root;
|
||||||
|
this.request = request;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Nonnull
|
||||||
|
@Override
|
||||||
|
public PagedIterator<GHWorkflowRun> _iterator(int pageSize) {
|
||||||
|
return new PagedIterator<>(
|
||||||
|
adapt(GitHubPageIterator.create(root.getClient(), GHWorkflowRunsPage.class, request, pageSize)),
|
||||||
|
null);
|
||||||
|
}
|
||||||
|
|
||||||
|
protected Iterator<GHWorkflowRun[]> adapt(final Iterator<GHWorkflowRunsPage> base) {
|
||||||
|
return new Iterator<GHWorkflowRun[]>() {
|
||||||
|
public boolean hasNext() {
|
||||||
|
return base.hasNext();
|
||||||
|
}
|
||||||
|
|
||||||
|
public GHWorkflowRun[] next() {
|
||||||
|
GHWorkflowRunsPage v = base.next();
|
||||||
|
if (result == null) {
|
||||||
|
result = v;
|
||||||
|
}
|
||||||
|
return v.getWorkflowRuns(root);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
}
|
||||||
|
}
|
||||||
20
src/main/java/org/kohsuke/github/GHWorkflowRunsPage.java
Normal file
20
src/main/java/org/kohsuke/github/GHWorkflowRunsPage.java
Normal file
@@ -0,0 +1,20 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Represents the one page of workflow runs result when listing workflow runs.
|
||||||
|
*/
|
||||||
|
class GHWorkflowRunsPage {
|
||||||
|
private int totalCount;
|
||||||
|
private GHWorkflowRun[] workflowRuns;
|
||||||
|
|
||||||
|
public int getTotalCount() {
|
||||||
|
return totalCount;
|
||||||
|
}
|
||||||
|
|
||||||
|
GHWorkflowRun[] getWorkflowRuns(GitHub root) {
|
||||||
|
for (GHWorkflowRun workflowRun : workflowRuns) {
|
||||||
|
workflowRun.wrapUp(root);
|
||||||
|
}
|
||||||
|
return workflowRuns;
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -26,6 +26,8 @@ package org.kohsuke.github;
|
|||||||
import com.fasterxml.jackson.databind.ObjectReader;
|
import com.fasterxml.jackson.databind.ObjectReader;
|
||||||
import com.fasterxml.jackson.databind.ObjectWriter;
|
import com.fasterxml.jackson.databind.ObjectWriter;
|
||||||
import com.infradna.tool.bridge_method_injector.WithBridgeMethods;
|
import com.infradna.tool.bridge_method_injector.WithBridgeMethods;
|
||||||
|
import org.kohsuke.github.authorization.AuthorizationProvider;
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.io.*;
|
import java.io.*;
|
||||||
import java.util.*;
|
import java.util.*;
|
||||||
@@ -37,8 +39,8 @@ import java.util.logging.Logger;
|
|||||||
import javax.annotation.CheckForNull;
|
import javax.annotation.CheckForNull;
|
||||||
import javax.annotation.Nonnull;
|
import javax.annotation.Nonnull;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.INERTIA;
|
import static org.kohsuke.github.internal.Previews.INERTIA;
|
||||||
import static org.kohsuke.github.Previews.MACHINE_MAN;
|
import static org.kohsuke.github.internal.Previews.MACHINE_MAN;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Root of the GitHub API.
|
* Root of the GitHub API.
|
||||||
@@ -93,39 +95,112 @@ public class GitHub {
|
|||||||
* "http://ghe.acme.com/api/v3". Note that GitHub Enterprise has <code>/api/v3</code> in the URL. For
|
* "http://ghe.acme.com/api/v3". Note that GitHub Enterprise has <code>/api/v3</code> in the URL. For
|
||||||
* historical reasons, this parameter still accepts the bare domain name, but that's considered
|
* historical reasons, this parameter still accepts the bare domain name, but that's considered
|
||||||
* deprecated. Password is also considered deprecated as it is no longer required for api usage.
|
* deprecated. Password is also considered deprecated as it is no longer required for api usage.
|
||||||
* @param login
|
|
||||||
* The user ID on GitHub that you are logging in as. Can be omitted if the OAuth token is provided or if
|
|
||||||
* logging in anonymously. Specifying this would save one API call.
|
|
||||||
* @param oauthAccessToken
|
|
||||||
* Secret OAuth token.
|
|
||||||
* @param password
|
|
||||||
* User's password. Always used in conjunction with the {@code login} parameter
|
|
||||||
* @param connector
|
* @param connector
|
||||||
* HttpConnector to use. Pass null to use default connector.
|
* a connector
|
||||||
|
* @param rateLimitHandler
|
||||||
|
* rateLimitHandler
|
||||||
|
* @param abuseLimitHandler
|
||||||
|
* abuseLimitHandler
|
||||||
|
* @param rateLimitChecker
|
||||||
|
* rateLimitChecker
|
||||||
|
* @param authorizationProvider
|
||||||
|
* a authorization provider
|
||||||
*/
|
*/
|
||||||
GitHub(String apiUrl,
|
GitHub(String apiUrl,
|
||||||
String login,
|
|
||||||
String oauthAccessToken,
|
|
||||||
String jwtToken,
|
|
||||||
String password,
|
|
||||||
HttpConnector connector,
|
HttpConnector connector,
|
||||||
RateLimitHandler rateLimitHandler,
|
RateLimitHandler rateLimitHandler,
|
||||||
AbuseLimitHandler abuseLimitHandler,
|
AbuseLimitHandler abuseLimitHandler,
|
||||||
GitHubRateLimitChecker rateLimitChecker) throws IOException {
|
GitHubRateLimitChecker rateLimitChecker,
|
||||||
|
AuthorizationProvider authorizationProvider) throws IOException {
|
||||||
|
if (authorizationProvider instanceof DependentAuthorizationProvider) {
|
||||||
|
((DependentAuthorizationProvider) authorizationProvider).bind(this);
|
||||||
|
}
|
||||||
|
|
||||||
this.client = new GitHubHttpUrlConnectionClient(apiUrl,
|
this.client = new GitHubHttpUrlConnectionClient(apiUrl,
|
||||||
login,
|
|
||||||
oauthAccessToken,
|
|
||||||
jwtToken,
|
|
||||||
password,
|
|
||||||
connector,
|
connector,
|
||||||
rateLimitHandler,
|
rateLimitHandler,
|
||||||
abuseLimitHandler,
|
abuseLimitHandler,
|
||||||
rateLimitChecker,
|
rateLimitChecker,
|
||||||
(myself) -> setMyself(myself));
|
(myself) -> setMyself(myself),
|
||||||
|
authorizationProvider);
|
||||||
users = new ConcurrentHashMap<>();
|
users = new ConcurrentHashMap<>();
|
||||||
orgs = new ConcurrentHashMap<>();
|
orgs = new ConcurrentHashMap<>();
|
||||||
}
|
}
|
||||||
|
|
||||||
|
private GitHub(GitHubClient client) {
|
||||||
|
this.client = client;
|
||||||
|
users = new ConcurrentHashMap<>();
|
||||||
|
orgs = new ConcurrentHashMap<>();
|
||||||
|
}
|
||||||
|
|
||||||
|
public static abstract class DependentAuthorizationProvider implements AuthorizationProvider {
|
||||||
|
|
||||||
|
private GitHub baseGitHub;
|
||||||
|
private GitHub gitHub;
|
||||||
|
private final AuthorizationProvider authorizationProvider;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* An AuthorizationProvider that requires an authenticated GitHub instance to provide its authorization.
|
||||||
|
*
|
||||||
|
* @param authorizationProvider
|
||||||
|
* A authorization provider to be used when refreshing this authorization provider.
|
||||||
|
*/
|
||||||
|
@BetaApi
|
||||||
|
@Deprecated
|
||||||
|
protected DependentAuthorizationProvider(AuthorizationProvider authorizationProvider) {
|
||||||
|
this.authorizationProvider = authorizationProvider;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Binds this authorization provider to a github instance.
|
||||||
|
*
|
||||||
|
* Only needs to be implemented by dynamic credentials providers that use a github instance in order to refresh.
|
||||||
|
*
|
||||||
|
* @param github
|
||||||
|
* The github instance to be used for refreshing dynamic credentials
|
||||||
|
*/
|
||||||
|
synchronized void bind(GitHub github) {
|
||||||
|
if (baseGitHub != null) {
|
||||||
|
throw new IllegalStateException("Already bound to another GitHub instance.");
|
||||||
|
}
|
||||||
|
this.baseGitHub = github;
|
||||||
|
}
|
||||||
|
|
||||||
|
protected synchronized final GitHub gitHub() {
|
||||||
|
if (gitHub == null) {
|
||||||
|
gitHub = new GitHub.AuthorizationRefreshGitHubWrapper(this.baseGitHub, authorizationProvider);
|
||||||
|
}
|
||||||
|
return gitHub;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
private static class AuthorizationRefreshGitHubWrapper extends GitHub {
|
||||||
|
|
||||||
|
private final AuthorizationProvider authorizationProvider;
|
||||||
|
|
||||||
|
AuthorizationRefreshGitHubWrapper(GitHub github, AuthorizationProvider authorizationProvider) {
|
||||||
|
super(github.client);
|
||||||
|
this.authorizationProvider = authorizationProvider;
|
||||||
|
|
||||||
|
// no dependent authorization providers nest like this currently, but they might in future
|
||||||
|
if (authorizationProvider instanceof DependentAuthorizationProvider) {
|
||||||
|
((DependentAuthorizationProvider) authorizationProvider).bind(this);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
@Nonnull
|
||||||
|
@Override
|
||||||
|
Requester createRequest() {
|
||||||
|
try {
|
||||||
|
// Override
|
||||||
|
return super.createRequest().setHeader("Authorization", authorizationProvider.getEncodedAuthorization())
|
||||||
|
.rateLimit(RateLimitTarget.NONE);
|
||||||
|
} catch (IOException e) {
|
||||||
|
throw new GHException("Failed to create requester to refresh credentials", e);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Obtains the credential from "~/.github" or from the System Environment Properties.
|
* Obtains the credential from "~/.github" or from the System Environment Properties.
|
||||||
*
|
*
|
||||||
@@ -557,11 +632,28 @@ public class GitHub {
|
|||||||
* @return the repository by id
|
* @return the repository by id
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
|
*
|
||||||
|
* @deprecated Do not use this method. It was added due to misunderstanding of the type of parameter. Use
|
||||||
|
* {@link #getRepositoryById(long)} instead
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public GHRepository getRepositoryById(String id) throws IOException {
|
public GHRepository getRepositoryById(String id) throws IOException {
|
||||||
return createRequest().withUrlPath("/repositories/" + id).fetch(GHRepository.class).wrap(this);
|
return createRequest().withUrlPath("/repositories/" + id).fetch(GHRepository.class).wrap(this);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the repository object from its ID
|
||||||
|
*
|
||||||
|
* @param id
|
||||||
|
* the id
|
||||||
|
* @return the repository by id
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public GHRepository getRepositoryById(long id) throws IOException {
|
||||||
|
return createRequest().withUrlPath("/repositories/" + id).fetch(GHRepository.class).wrap(this);
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Returns a list of popular open source licenses
|
* Returns a list of popular open source licenses
|
||||||
*
|
*
|
||||||
@@ -845,7 +937,7 @@ public class GitHub {
|
|||||||
* @return the gh create repository builder
|
* @return the gh create repository builder
|
||||||
*/
|
*/
|
||||||
public GHCreateRepositoryBuilder createRepository(String name) {
|
public GHCreateRepositoryBuilder createRepository(String name) {
|
||||||
return new GHCreateRepositoryBuilder(this, "/user/repos", name);
|
return new GHCreateRepositoryBuilder(name, this, "/user/repos");
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1013,7 +1105,7 @@ public class GitHub {
|
|||||||
* @see <a href="https://developer.github.com/v3/apps/#get-the-authenticated-github-app">Get the authenticated
|
* @see <a href="https://developer.github.com/v3/apps/#get-the-authenticated-github-app">Get the authenticated
|
||||||
* GitHub App</a>
|
* GitHub App</a>
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(MACHINE_MAN)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHApp getApp() throws IOException {
|
public GHApp getApp() throws IOException {
|
||||||
return createRequest().withPreview(MACHINE_MAN).withUrlPath("/app").fetch(GHApp.class).wrapUp(this);
|
return createRequest().withPreview(MACHINE_MAN).withUrlPath("/app").fetch(GHApp.class).wrapUp(this);
|
||||||
@@ -1108,7 +1200,7 @@ public class GitHub {
|
|||||||
*
|
*
|
||||||
* @return the gh commit search builder
|
* @return the gh commit search builder
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(Previews.CLOAK)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHCommitSearchBuilder searchCommits() {
|
public GHCommitSearchBuilder searchCommits() {
|
||||||
return new GHCommitSearchBuilder(this);
|
return new GHCommitSearchBuilder(this);
|
||||||
@@ -1203,31 +1295,39 @@ public class GitHub {
|
|||||||
.with(new ByteArrayInputStream(text.getBytes("UTF-8")))
|
.with(new ByteArrayInputStream(text.getBytes("UTF-8")))
|
||||||
.contentType("text/plain;charset=UTF-8")
|
.contentType("text/plain;charset=UTF-8")
|
||||||
.withUrlPath("/markdown/raw")
|
.withUrlPath("/markdown/raw")
|
||||||
.fetchStream(),
|
.fetchStream(Requester::copyInputStream),
|
||||||
"UTF-8");
|
"UTF-8");
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Do not use this method. This method will be removed and should never have been needed in the first place.
|
* Gets an {@link ObjectWriter} that can be used to convert data objects in this library to JSON.
|
||||||
|
*
|
||||||
|
* If you must convert data object in this library to JSON, the {@link ObjectWriter} returned by this method is the
|
||||||
|
* only supported way of doing so. This {@link ObjectWriter} can be used to convert any library data object to JSON
|
||||||
|
* without throwing an exception.
|
||||||
|
*
|
||||||
|
* WARNING: While the JSON generated is generally expected to be stable, it is not part of the API of this library
|
||||||
|
* and may change without warning. Use with extreme caution.
|
||||||
*
|
*
|
||||||
* @return an {@link ObjectWriter} instance that can be further configured.
|
* @return an {@link ObjectWriter} instance that can be further configured.
|
||||||
* @deprecated DO NOT USE THIS METHOD. Provided for backward compatibility with projects that did their own jackson
|
|
||||||
* mapping of this project's data objects, such as Jenkins Blue Ocean.
|
|
||||||
*/
|
*/
|
||||||
@Deprecated
|
|
||||||
@Nonnull
|
@Nonnull
|
||||||
public static ObjectWriter getMappingObjectWriter() {
|
public static ObjectWriter getMappingObjectWriter() {
|
||||||
return GitHubClient.getMappingObjectWriter();
|
return GitHubClient.getMappingObjectWriter();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Do not use this method. This method will be removed and should never have been needed in the first place.
|
* Gets an {@link ObjectReader} that can be used to convert JSON into library data objects.
|
||||||
|
*
|
||||||
|
* If you must manually create library data objects from JSON, the {@link ObjectReader} returned by this method is
|
||||||
|
* the only supported way of doing so.
|
||||||
|
*
|
||||||
|
* WARNING: Objects generated from this method have limited functionality. They will not throw when being crated
|
||||||
|
* from valid JSON matching the expected object, but they are not guaranteed to be usable beyond that. Use with
|
||||||
|
* extreme caution.
|
||||||
*
|
*
|
||||||
* @return an {@link ObjectReader} instance that can be further configured.
|
* @return an {@link ObjectReader} instance that can be further configured.
|
||||||
* @deprecated DO NOT USE THIS METHOD. Provided for backward compatibility with projects that did their own jackson
|
|
||||||
* mapping of this project's data objects, such as Jenkins Blue Ocean.
|
|
||||||
*/
|
*/
|
||||||
@Deprecated
|
|
||||||
@Nonnull
|
@Nonnull
|
||||||
public static ObjectReader getMappingObjectReader() {
|
public static ObjectReader getMappingObjectReader() {
|
||||||
return GitHubClient.getMappingObjectReader(GitHub.offline());
|
return GitHubClient.getMappingObjectReader(GitHub.offline());
|
||||||
|
|||||||
@@ -1,6 +1,8 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
import org.apache.commons.io.IOUtils;
|
import org.apache.commons.io.IOUtils;
|
||||||
|
import org.kohsuke.github.authorization.AuthorizationProvider;
|
||||||
|
import org.kohsuke.github.authorization.ImmutableAuthorizationProvider;
|
||||||
import org.kohsuke.github.extras.ImpatientHttpConnector;
|
import org.kohsuke.github.extras.ImpatientHttpConnector;
|
||||||
|
|
||||||
import java.io.File;
|
import java.io.File;
|
||||||
@@ -24,16 +26,13 @@ public class GitHubBuilder implements Cloneable {
|
|||||||
|
|
||||||
// default scoped so unit tests can read them.
|
// default scoped so unit tests can read them.
|
||||||
/* private */ String endpoint = GitHubClient.GITHUB_URL;
|
/* private */ String endpoint = GitHubClient.GITHUB_URL;
|
||||||
/* private */ String user;
|
|
||||||
/* private */ String password;
|
|
||||||
/* private */ String oauthToken;
|
|
||||||
/* private */ String jwtToken;
|
|
||||||
|
|
||||||
private HttpConnector connector;
|
private HttpConnector connector;
|
||||||
|
|
||||||
private RateLimitHandler rateLimitHandler = RateLimitHandler.WAIT;
|
private RateLimitHandler rateLimitHandler = RateLimitHandler.WAIT;
|
||||||
private AbuseLimitHandler abuseLimitHandler = AbuseLimitHandler.WAIT;
|
private AbuseLimitHandler abuseLimitHandler = AbuseLimitHandler.WAIT;
|
||||||
private GitHubRateLimitChecker rateLimitChecker = new GitHubRateLimitChecker();
|
private GitHubRateLimitChecker rateLimitChecker = new GitHubRateLimitChecker();
|
||||||
|
/* private */ AuthorizationProvider authorizationProvider = AuthorizationProvider.ANONYMOUS;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Instantiates a new Git hub builder.
|
* Instantiates a new Git hub builder.
|
||||||
@@ -61,13 +60,13 @@ public class GitHubBuilder implements Cloneable {
|
|||||||
|
|
||||||
builder = fromEnvironment();
|
builder = fromEnvironment();
|
||||||
|
|
||||||
if (builder.oauthToken != null || builder.user != null || builder.jwtToken != null)
|
if (builder.authorizationProvider != null)
|
||||||
return builder;
|
return builder;
|
||||||
|
|
||||||
try {
|
try {
|
||||||
builder = fromPropertyFile();
|
builder = fromPropertyFile();
|
||||||
|
|
||||||
if (builder.oauthToken != null || builder.user != null || builder.jwtToken != null)
|
if (builder.authorizationProvider != null)
|
||||||
return builder;
|
return builder;
|
||||||
} catch (FileNotFoundException e) {
|
} catch (FileNotFoundException e) {
|
||||||
// fall through
|
// fall through
|
||||||
@@ -215,9 +214,20 @@ public class GitHubBuilder implements Cloneable {
|
|||||||
*/
|
*/
|
||||||
public static GitHubBuilder fromProperties(Properties props) {
|
public static GitHubBuilder fromProperties(Properties props) {
|
||||||
GitHubBuilder self = new GitHubBuilder();
|
GitHubBuilder self = new GitHubBuilder();
|
||||||
self.withOAuthToken(props.getProperty("oauth"), props.getProperty("login"));
|
String oauth = props.getProperty("oauth");
|
||||||
self.withJwtToken(props.getProperty("jwt"));
|
String jwt = props.getProperty("jwt");
|
||||||
self.withPassword(props.getProperty("login"), props.getProperty("password"));
|
String login = props.getProperty("login");
|
||||||
|
String password = props.getProperty("password");
|
||||||
|
|
||||||
|
if (oauth != null) {
|
||||||
|
self.withOAuthToken(oauth, login);
|
||||||
|
}
|
||||||
|
if (jwt != null) {
|
||||||
|
self.withJwtToken(jwt);
|
||||||
|
}
|
||||||
|
if (password != null) {
|
||||||
|
self.withPassword(login, password);
|
||||||
|
}
|
||||||
self.withEndpoint(props.getProperty("endpoint", GitHubClient.GITHUB_URL));
|
self.withEndpoint(props.getProperty("endpoint", GitHubClient.GITHUB_URL));
|
||||||
return self;
|
return self;
|
||||||
}
|
}
|
||||||
@@ -247,9 +257,7 @@ public class GitHubBuilder implements Cloneable {
|
|||||||
* @return the git hub builder
|
* @return the git hub builder
|
||||||
*/
|
*/
|
||||||
public GitHubBuilder withPassword(String user, String password) {
|
public GitHubBuilder withPassword(String user, String password) {
|
||||||
this.user = user;
|
return withAuthorizationProvider(ImmutableAuthorizationProvider.fromLoginAndPassword(user, password));
|
||||||
this.password = password;
|
|
||||||
return this;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -260,7 +268,7 @@ public class GitHubBuilder implements Cloneable {
|
|||||||
* @return the git hub builder
|
* @return the git hub builder
|
||||||
*/
|
*/
|
||||||
public GitHubBuilder withOAuthToken(String oauthToken) {
|
public GitHubBuilder withOAuthToken(String oauthToken) {
|
||||||
return withOAuthToken(oauthToken, null);
|
return withAuthorizationProvider(ImmutableAuthorizationProvider.fromOauthToken(oauthToken));
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -273,8 +281,21 @@ public class GitHubBuilder implements Cloneable {
|
|||||||
* @return the git hub builder
|
* @return the git hub builder
|
||||||
*/
|
*/
|
||||||
public GitHubBuilder withOAuthToken(String oauthToken, String user) {
|
public GitHubBuilder withOAuthToken(String oauthToken, String user) {
|
||||||
this.oauthToken = oauthToken;
|
return withAuthorizationProvider(ImmutableAuthorizationProvider.fromOauthToken(oauthToken, user));
|
||||||
this.user = user;
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Configures a {@link AuthorizationProvider} for this builder
|
||||||
|
*
|
||||||
|
* There can be only one authorization provider per client instance.
|
||||||
|
*
|
||||||
|
* @param authorizationProvider
|
||||||
|
* the authorization provider
|
||||||
|
* @return the git hub builder
|
||||||
|
*
|
||||||
|
*/
|
||||||
|
public GitHubBuilder withAuthorizationProvider(final AuthorizationProvider authorizationProvider) {
|
||||||
|
this.authorizationProvider = authorizationProvider;
|
||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -287,7 +308,7 @@ public class GitHubBuilder implements Cloneable {
|
|||||||
* @see GHAppInstallation#createToken(java.util.Map) GHAppInstallation#createToken(java.util.Map)
|
* @see GHAppInstallation#createToken(java.util.Map) GHAppInstallation#createToken(java.util.Map)
|
||||||
*/
|
*/
|
||||||
public GitHubBuilder withAppInstallationToken(String appInstallationToken) {
|
public GitHubBuilder withAppInstallationToken(String appInstallationToken) {
|
||||||
return withOAuthToken(appInstallationToken, "");
|
return withAuthorizationProvider(ImmutableAuthorizationProvider.fromAppInstallationToken(appInstallationToken));
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -298,8 +319,7 @@ public class GitHubBuilder implements Cloneable {
|
|||||||
* @return the git hub builder
|
* @return the git hub builder
|
||||||
*/
|
*/
|
||||||
public GitHubBuilder withJwtToken(String jwtToken) {
|
public GitHubBuilder withJwtToken(String jwtToken) {
|
||||||
this.jwtToken = jwtToken;
|
return withAuthorizationProvider(ImmutableAuthorizationProvider.fromJwtToken(jwtToken));
|
||||||
return this;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -421,14 +441,11 @@ public class GitHubBuilder implements Cloneable {
|
|||||||
*/
|
*/
|
||||||
public GitHub build() throws IOException {
|
public GitHub build() throws IOException {
|
||||||
return new GitHub(endpoint,
|
return new GitHub(endpoint,
|
||||||
user,
|
|
||||||
oauthToken,
|
|
||||||
jwtToken,
|
|
||||||
password,
|
|
||||||
connector,
|
connector,
|
||||||
rateLimitHandler,
|
rateLimitHandler,
|
||||||
abuseLimitHandler,
|
abuseLimitHandler,
|
||||||
rateLimitChecker);
|
rateLimitChecker,
|
||||||
|
authorizationProvider);
|
||||||
}
|
}
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
|
|||||||
@@ -1,33 +1,19 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
import com.fasterxml.jackson.databind.DeserializationFeature;
|
import com.fasterxml.jackson.databind.*;
|
||||||
import com.fasterxml.jackson.databind.InjectableValues;
|
|
||||||
import com.fasterxml.jackson.databind.MapperFeature;
|
|
||||||
import com.fasterxml.jackson.databind.ObjectMapper;
|
|
||||||
import com.fasterxml.jackson.databind.ObjectReader;
|
|
||||||
import com.fasterxml.jackson.databind.ObjectWriter;
|
|
||||||
import com.fasterxml.jackson.databind.PropertyNamingStrategy;
|
|
||||||
import com.fasterxml.jackson.databind.introspect.VisibilityChecker;
|
import com.fasterxml.jackson.databind.introspect.VisibilityChecker;
|
||||||
import org.apache.commons.io.IOUtils;
|
import org.apache.commons.io.IOUtils;
|
||||||
|
import org.kohsuke.github.authorization.AuthorizationProvider;
|
||||||
|
import org.kohsuke.github.authorization.UserAuthorizationProvider;
|
||||||
|
|
||||||
import java.io.FileNotFoundException;
|
import java.io.FileNotFoundException;
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.io.InterruptedIOException;
|
import java.io.InterruptedIOException;
|
||||||
import java.net.HttpURLConnection;
|
import java.net.*;
|
||||||
import java.net.MalformedURLException;
|
|
||||||
import java.net.SocketException;
|
|
||||||
import java.net.SocketTimeoutException;
|
|
||||||
import java.net.URL;
|
|
||||||
import java.nio.charset.StandardCharsets;
|
|
||||||
import java.time.Instant;
|
import java.time.Instant;
|
||||||
import java.time.format.DateTimeFormatter;
|
import java.time.format.DateTimeFormatter;
|
||||||
import java.time.temporal.ChronoUnit;
|
import java.time.temporal.ChronoUnit;
|
||||||
import java.util.Base64;
|
import java.util.*;
|
||||||
import java.util.Date;
|
|
||||||
import java.util.HashMap;
|
|
||||||
import java.util.List;
|
|
||||||
import java.util.Map;
|
|
||||||
import java.util.Objects;
|
|
||||||
import java.util.function.Consumer;
|
import java.util.function.Consumer;
|
||||||
import java.util.logging.Logger;
|
import java.util.logging.Logger;
|
||||||
|
|
||||||
@@ -56,17 +42,13 @@ abstract class GitHubClient {
|
|||||||
static final int retryTimeoutMillis = 100;
|
static final int retryTimeoutMillis = 100;
|
||||||
/* private */ final String login;
|
/* private */ final String login;
|
||||||
|
|
||||||
/**
|
|
||||||
* Value of the authorization header to be sent with the request.
|
|
||||||
*/
|
|
||||||
/* private */ final String encodedAuthorization;
|
|
||||||
|
|
||||||
// Cache of myself object.
|
// Cache of myself object.
|
||||||
private final String apiUrl;
|
private final String apiUrl;
|
||||||
|
|
||||||
protected final RateLimitHandler rateLimitHandler;
|
protected final RateLimitHandler rateLimitHandler;
|
||||||
protected final AbuseLimitHandler abuseLimitHandler;
|
protected final AbuseLimitHandler abuseLimitHandler;
|
||||||
private final GitHubRateLimitChecker rateLimitChecker;
|
private final GitHubRateLimitChecker rateLimitChecker;
|
||||||
|
private final AuthorizationProvider authorizationProvider;
|
||||||
|
|
||||||
private HttpConnector connector;
|
private HttpConnector connector;
|
||||||
|
|
||||||
@@ -91,15 +73,12 @@ abstract class GitHubClient {
|
|||||||
}
|
}
|
||||||
|
|
||||||
GitHubClient(String apiUrl,
|
GitHubClient(String apiUrl,
|
||||||
String login,
|
|
||||||
String oauthAccessToken,
|
|
||||||
String jwtToken,
|
|
||||||
String password,
|
|
||||||
HttpConnector connector,
|
HttpConnector connector,
|
||||||
RateLimitHandler rateLimitHandler,
|
RateLimitHandler rateLimitHandler,
|
||||||
AbuseLimitHandler abuseLimitHandler,
|
AbuseLimitHandler abuseLimitHandler,
|
||||||
GitHubRateLimitChecker rateLimitChecker,
|
GitHubRateLimitChecker rateLimitChecker,
|
||||||
Consumer<GHMyself> myselfConsumer) throws IOException {
|
Consumer<GHMyself> myselfConsumer,
|
||||||
|
AuthorizationProvider authorizationProvider) throws IOException {
|
||||||
|
|
||||||
if (apiUrl.endsWith("/")) {
|
if (apiUrl.endsWith("/")) {
|
||||||
apiUrl = apiUrl.substring(0, apiUrl.length() - 1); // normalize
|
apiUrl = apiUrl.substring(0, apiUrl.length() - 1); // normalize
|
||||||
@@ -111,33 +90,38 @@ abstract class GitHubClient {
|
|||||||
this.apiUrl = apiUrl;
|
this.apiUrl = apiUrl;
|
||||||
this.connector = connector;
|
this.connector = connector;
|
||||||
|
|
||||||
if (oauthAccessToken != null) {
|
// Prefer credential configuration via provider
|
||||||
encodedAuthorization = "token " + oauthAccessToken;
|
this.authorizationProvider = authorizationProvider;
|
||||||
} else {
|
|
||||||
if (jwtToken != null) {
|
|
||||||
encodedAuthorization = "Bearer " + jwtToken;
|
|
||||||
} else if (password != null) {
|
|
||||||
String authorization = (login + ':' + password);
|
|
||||||
String charsetName = StandardCharsets.UTF_8.name();
|
|
||||||
encodedAuthorization = "Basic "
|
|
||||||
+ Base64.getEncoder().encodeToString(authorization.getBytes(charsetName));
|
|
||||||
} else {// anonymous access
|
|
||||||
encodedAuthorization = null;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
|
|
||||||
this.rateLimitHandler = rateLimitHandler;
|
this.rateLimitHandler = rateLimitHandler;
|
||||||
this.abuseLimitHandler = abuseLimitHandler;
|
this.abuseLimitHandler = abuseLimitHandler;
|
||||||
this.rateLimitChecker = rateLimitChecker;
|
this.rateLimitChecker = rateLimitChecker;
|
||||||
|
|
||||||
if (login == null && encodedAuthorization != null && jwtToken == null) {
|
this.login = getCurrentUser(myselfConsumer);
|
||||||
|
}
|
||||||
|
|
||||||
|
private String getCurrentUser(Consumer<GHMyself> myselfConsumer) throws IOException {
|
||||||
|
String login = null;
|
||||||
|
if (this.authorizationProvider instanceof UserAuthorizationProvider
|
||||||
|
&& this.authorizationProvider.getEncodedAuthorization() != null) {
|
||||||
|
|
||||||
|
UserAuthorizationProvider userAuthorizationProvider = (UserAuthorizationProvider) this.authorizationProvider;
|
||||||
|
|
||||||
|
login = userAuthorizationProvider.getLogin();
|
||||||
|
|
||||||
|
if (login == null) {
|
||||||
|
try {
|
||||||
GHMyself myself = fetch(GHMyself.class, "/user");
|
GHMyself myself = fetch(GHMyself.class, "/user");
|
||||||
login = myself.getLogin();
|
|
||||||
if (myselfConsumer != null) {
|
if (myselfConsumer != null) {
|
||||||
myselfConsumer.accept(myself);
|
myselfConsumer.accept(myself);
|
||||||
}
|
}
|
||||||
|
login = myself.getLogin();
|
||||||
|
} catch (IOException e) {
|
||||||
|
return null;
|
||||||
}
|
}
|
||||||
this.login = login;
|
}
|
||||||
|
}
|
||||||
|
return login;
|
||||||
}
|
}
|
||||||
|
|
||||||
private <T> T fetch(Class<T> type, String urlPath) throws IOException {
|
private <T> T fetch(Class<T> type, String urlPath) throws IOException {
|
||||||
@@ -202,7 +186,13 @@ abstract class GitHubClient {
|
|||||||
* @return {@code true} if operations that require authentication will fail.
|
* @return {@code true} if operations that require authentication will fail.
|
||||||
*/
|
*/
|
||||||
public boolean isAnonymous() {
|
public boolean isAnonymous() {
|
||||||
return login == null && encodedAuthorization == null;
|
try {
|
||||||
|
return login == null && this.authorizationProvider.getEncodedAuthorization() == null;
|
||||||
|
} catch (IOException e) {
|
||||||
|
// An exception here means that the provider failed to provide authorization parameters,
|
||||||
|
// basically meaning the same as "no auth"
|
||||||
|
return false;
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -224,6 +214,11 @@ abstract class GitHubClient {
|
|||||||
return getRateLimit(RateLimitTarget.NONE);
|
return getRateLimit(RateLimitTarget.NONE);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
@CheckForNull
|
||||||
|
protected String getEncodedAuthorization() throws IOException {
|
||||||
|
return authorizationProvider.getEncodedAuthorization();
|
||||||
|
}
|
||||||
|
|
||||||
@Nonnull
|
@Nonnull
|
||||||
GHRateLimit getRateLimit(@Nonnull RateLimitTarget rateLimitTarget) throws IOException {
|
GHRateLimit getRateLimit(@Nonnull RateLimitTarget rateLimitTarget) throws IOException {
|
||||||
GHRateLimit result;
|
GHRateLimit result;
|
||||||
@@ -394,7 +389,6 @@ abstract class GitHubClient {
|
|||||||
"GitHub API request [" + (login == null ? "anonymous" : login) + "]: "
|
"GitHub API request [" + (login == null ? "anonymous" : login) + "]: "
|
||||||
+ request.method() + " " + request.url().toString());
|
+ request.method() + " " + request.url().toString());
|
||||||
}
|
}
|
||||||
|
|
||||||
rateLimitChecker.checkRateLimit(this, request);
|
rateLimitChecker.checkRateLimit(this, request);
|
||||||
|
|
||||||
responseInfo = getResponseInfo(request);
|
responseInfo = getResponseInfo(request);
|
||||||
|
|||||||
@@ -1,6 +1,7 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
import org.apache.commons.io.IOUtils;
|
import org.apache.commons.io.IOUtils;
|
||||||
|
import org.kohsuke.github.authorization.AuthorizationProvider;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.io.InputStream;
|
import java.io.InputStream;
|
||||||
@@ -33,25 +34,19 @@ import static org.apache.commons.lang3.StringUtils.defaultString;
|
|||||||
class GitHubHttpUrlConnectionClient extends GitHubClient {
|
class GitHubHttpUrlConnectionClient extends GitHubClient {
|
||||||
|
|
||||||
GitHubHttpUrlConnectionClient(String apiUrl,
|
GitHubHttpUrlConnectionClient(String apiUrl,
|
||||||
String login,
|
|
||||||
String oauthAccessToken,
|
|
||||||
String jwtToken,
|
|
||||||
String password,
|
|
||||||
HttpConnector connector,
|
HttpConnector connector,
|
||||||
RateLimitHandler rateLimitHandler,
|
RateLimitHandler rateLimitHandler,
|
||||||
AbuseLimitHandler abuseLimitHandler,
|
AbuseLimitHandler abuseLimitHandler,
|
||||||
GitHubRateLimitChecker rateLimitChecker,
|
GitHubRateLimitChecker rateLimitChecker,
|
||||||
Consumer<GHMyself> myselfConsumer) throws IOException {
|
Consumer<GHMyself> myselfConsumer,
|
||||||
|
AuthorizationProvider authorizationProvider) throws IOException {
|
||||||
super(apiUrl,
|
super(apiUrl,
|
||||||
login,
|
|
||||||
oauthAccessToken,
|
|
||||||
jwtToken,
|
|
||||||
password,
|
|
||||||
connector,
|
connector,
|
||||||
rateLimitHandler,
|
rateLimitHandler,
|
||||||
abuseLimitHandler,
|
abuseLimitHandler,
|
||||||
rateLimitChecker,
|
rateLimitChecker,
|
||||||
myselfConsumer);
|
myselfConsumer,
|
||||||
|
authorizationProvider);
|
||||||
}
|
}
|
||||||
|
|
||||||
@Nonnull
|
@Nonnull
|
||||||
@@ -114,8 +109,12 @@ class GitHubHttpUrlConnectionClient extends GitHubClient {
|
|||||||
|
|
||||||
// if the authentication is needed but no credential is given, try it anyway (so that some calls
|
// if the authentication is needed but no credential is given, try it anyway (so that some calls
|
||||||
// that do work with anonymous access in the reduced form should still work.)
|
// that do work with anonymous access in the reduced form should still work.)
|
||||||
if (client.encodedAuthorization != null)
|
if (!request.headers().containsKey("Authorization")) {
|
||||||
connection.setRequestProperty("Authorization", client.encodedAuthorization);
|
String authorization = client.getEncodedAuthorization();
|
||||||
|
if (authorization != null) {
|
||||||
|
connection.setRequestProperty("Authorization", client.getEncodedAuthorization());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
setRequestMethod(request.method(), connection);
|
setRequestMethod(request.method(), connection);
|
||||||
buildRequest(request, connection);
|
buildRequest(request, connection);
|
||||||
|
|||||||
@@ -0,0 +1,27 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import com.fasterxml.jackson.annotation.JacksonInject;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Defines a base class that all classes in this library that interact with GitHub inherit from.
|
||||||
|
*
|
||||||
|
* Ensures that all data references to GitHub connection are transient.
|
||||||
|
*
|
||||||
|
* Classes that do not need to interact with GitHub after they are instantiated do not need to inherit from this class.
|
||||||
|
*/
|
||||||
|
abstract class GitHubInteractiveObject {
|
||||||
|
@JacksonInject
|
||||||
|
/* package almost final */ transient GitHub root;
|
||||||
|
|
||||||
|
GitHubInteractiveObject() {
|
||||||
|
root = null;
|
||||||
|
}
|
||||||
|
|
||||||
|
GitHubInteractiveObject(GitHub root) {
|
||||||
|
this.root = root;
|
||||||
|
}
|
||||||
|
|
||||||
|
GitHub getRoot() {
|
||||||
|
return root;
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -2,6 +2,7 @@ package org.kohsuke.github;
|
|||||||
|
|
||||||
import edu.umd.cs.findbugs.annotations.NonNull;
|
import edu.umd.cs.findbugs.annotations.NonNull;
|
||||||
import org.apache.commons.lang3.StringUtils;
|
import org.apache.commons.lang3.StringUtils;
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.io.InputStream;
|
import java.io.InputStream;
|
||||||
import java.io.UnsupportedEncodingException;
|
import java.io.UnsupportedEncodingException;
|
||||||
@@ -437,6 +438,25 @@ class GitHubRequest {
|
|||||||
return withHeader("Accept", name);
|
return withHeader("Accept", name);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
public B withPreview(Previews preview) {
|
||||||
|
return withPreview(preview.mediaType());
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* With requester.
|
||||||
|
*
|
||||||
|
* @param Map
|
||||||
|
* map of key value pairs to add
|
||||||
|
* @return the request builder
|
||||||
|
*/
|
||||||
|
public B with(Map<String, Object> map) {
|
||||||
|
for (Map.Entry<String, Object> entry : map.entrySet()) {
|
||||||
|
with(entry.getKey(), entry.getValue());
|
||||||
|
}
|
||||||
|
|
||||||
|
return (B) this;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* With requester.
|
* With requester.
|
||||||
*
|
*
|
||||||
|
|||||||
@@ -4,6 +4,7 @@ import com.fasterxml.jackson.core.JsonParseException;
|
|||||||
import com.fasterxml.jackson.databind.InjectableValues;
|
import com.fasterxml.jackson.databind.InjectableValues;
|
||||||
import com.fasterxml.jackson.databind.JsonMappingException;
|
import com.fasterxml.jackson.databind.JsonMappingException;
|
||||||
import org.apache.commons.io.IOUtils;
|
import org.apache.commons.io.IOUtils;
|
||||||
|
import org.kohsuke.github.function.FunctionThrows;
|
||||||
|
|
||||||
import java.io.Closeable;
|
import java.io.Closeable;
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
@@ -194,24 +195,11 @@ class GitHubResponse<T> {
|
|||||||
/**
|
/**
|
||||||
* Represents a supplier of results that can throw.
|
* Represents a supplier of results that can throw.
|
||||||
*
|
*
|
||||||
* <p>
|
|
||||||
* This is a <a href="package-summary.html">functional interface</a> whose functional method is
|
|
||||||
* {@link #apply(ResponseInfo)}.
|
|
||||||
*
|
|
||||||
* @param <T>
|
* @param <T>
|
||||||
* the type of results supplied by this supplier
|
* the type of results supplied by this supplier
|
||||||
*/
|
*/
|
||||||
@FunctionalInterface
|
@FunctionalInterface
|
||||||
interface BodyHandler<T> {
|
interface BodyHandler<T> extends FunctionThrows<ResponseInfo, T, IOException> {
|
||||||
|
|
||||||
/**
|
|
||||||
* Gets a result.
|
|
||||||
*
|
|
||||||
* @return a result
|
|
||||||
* @throws IOException
|
|
||||||
* if an I/O Exception occurs.
|
|
||||||
*/
|
|
||||||
T apply(ResponseInfo input) throws IOException;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|||||||
@@ -42,8 +42,6 @@ public class GitUser {
|
|||||||
*
|
*
|
||||||
* @return GitHub username
|
* @return GitHub username
|
||||||
*/
|
*/
|
||||||
@Preview
|
|
||||||
@Deprecated
|
|
||||||
@CheckForNull
|
@CheckForNull
|
||||||
public String getUsername() {
|
public String getUsername() {
|
||||||
return username;
|
return username;
|
||||||
@@ -52,7 +50,7 @@ public class GitUser {
|
|||||||
/**
|
/**
|
||||||
* Gets date.
|
* Gets date.
|
||||||
*
|
*
|
||||||
* @return This field doesn't appear to be consistently available in all the situations where this class is used.
|
* @return Commit Date.
|
||||||
*/
|
*/
|
||||||
public Date getDate() {
|
public Date getDate() {
|
||||||
return GitHubClient.parseDate(date);
|
return GitHubClient.parseDate(date);
|
||||||
|
|||||||
@@ -18,7 +18,7 @@ import javax.annotation.Nonnull;
|
|||||||
"UWF_FIELD_NOT_INITIALIZED_IN_CONSTRUCTOR" },
|
"UWF_FIELD_NOT_INITIALIZED_IN_CONSTRUCTOR" },
|
||||||
justification = "Constructed by JSON API")
|
justification = "Constructed by JSON API")
|
||||||
public class PagedSearchIterable<T> extends PagedIterable<T> {
|
public class PagedSearchIterable<T> extends PagedIterable<T> {
|
||||||
private final GitHub root;
|
private final transient GitHub root;
|
||||||
|
|
||||||
private final GitHubRequest request;
|
private final GitHubRequest request;
|
||||||
|
|
||||||
|
|||||||
@@ -1,5 +1,7 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.lang.annotation.Documented;
|
import java.lang.annotation.Documented;
|
||||||
import java.lang.annotation.Retention;
|
import java.lang.annotation.Retention;
|
||||||
import java.lang.annotation.RetentionPolicy;
|
import java.lang.annotation.RetentionPolicy;
|
||||||
@@ -8,11 +10,23 @@ import java.lang.annotation.RetentionPolicy;
|
|||||||
* Indicates that the method/class/etc marked maps to GitHub API in the preview period.
|
* Indicates that the method/class/etc marked maps to GitHub API in the preview period.
|
||||||
* <p>
|
* <p>
|
||||||
* These APIs are subject to change and not a part of the backward compatibility commitment. Always used in conjunction
|
* These APIs are subject to change and not a part of the backward compatibility commitment. Always used in conjunction
|
||||||
* with 'deprecated' to raise awareness to clients.
|
* with 'deprecated' to raise awareness to clients. In addition, it's advised to update the targets documentation to
|
||||||
|
* signify that the deprecation is required until preview feature being used is promoted to stable.
|
||||||
*
|
*
|
||||||
* @author Kohsuke Kawaguchi
|
* @author Kohsuke Kawaguchi
|
||||||
*/
|
*/
|
||||||
@Retention(RetentionPolicy.RUNTIME)
|
@Retention(RetentionPolicy.RUNTIME)
|
||||||
@Documented
|
@Documented
|
||||||
public @interface Preview {
|
public @interface Preview {
|
||||||
|
|
||||||
|
/**
|
||||||
|
* An optional field defining what API media types must be set inorder to support the usage of this annotations
|
||||||
|
* target.
|
||||||
|
* <p>
|
||||||
|
* This value must be set using the existing constants defined in {@link Previews}
|
||||||
|
*
|
||||||
|
* @return The API preview media type.
|
||||||
|
*/
|
||||||
|
public Previews[] value();
|
||||||
|
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -2,12 +2,14 @@ package org.kohsuke.github;
|
|||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
|
|
||||||
|
import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Those {@link GHObject}s that can have {@linkplain GHReaction reactions}.
|
* Those {@link GHObject}s that can have {@linkplain GHReaction reactions}.
|
||||||
*
|
*
|
||||||
* @author Kohsuke Kawaguchi
|
* @author Kohsuke Kawaguchi
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public interface Reactable {
|
public interface Reactable {
|
||||||
/**
|
/**
|
||||||
@@ -15,7 +17,7 @@ public interface Reactable {
|
|||||||
*
|
*
|
||||||
* @return the paged iterable
|
* @return the paged iterable
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
PagedIterable<GHReaction> listReactions();
|
PagedIterable<GHReaction> listReactions();
|
||||||
|
|
||||||
@@ -28,7 +30,7 @@ public interface Reactable {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
GHReaction createReaction(ReactionContent content) throws IOException;
|
GHReaction createReaction(ReactionContent content) throws IOException;
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -23,7 +23,9 @@
|
|||||||
*/
|
*/
|
||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import edu.umd.cs.findbugs.annotations.NonNull;
|
||||||
import org.apache.commons.io.IOUtils;
|
import org.apache.commons.io.IOUtils;
|
||||||
|
import org.kohsuke.github.function.InputStreamFunction;
|
||||||
|
|
||||||
import java.io.ByteArrayInputStream;
|
import java.io.ByteArrayInputStream;
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
@@ -40,7 +42,7 @@ import javax.annotation.Nonnull;
|
|||||||
* @author Kohsuke Kawaguchi
|
* @author Kohsuke Kawaguchi
|
||||||
*/
|
*/
|
||||||
class Requester extends GitHubRequest.Builder<Requester> {
|
class Requester extends GitHubRequest.Builder<Requester> {
|
||||||
/* private */ final GitHubClient client;
|
/* private */ final transient GitHubClient client;
|
||||||
|
|
||||||
Requester(GitHubClient client) {
|
Requester(GitHubClient client) {
|
||||||
this.client = client;
|
this.client = client;
|
||||||
@@ -106,15 +108,31 @@ class Requester extends GitHubRequest.Builder<Requester> {
|
|||||||
* Response input stream. There are scenarios where direct stream reading is needed, however it is better to use
|
* Response input stream. There are scenarios where direct stream reading is needed, however it is better to use
|
||||||
* {@link #fetch(Class)} where possible.
|
* {@link #fetch(Class)} where possible.
|
||||||
*
|
*
|
||||||
* @return the input stream
|
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public InputStream fetchStream() throws IOException {
|
public <T> T fetchStream(@Nonnull InputStreamFunction<T> handler) throws IOException {
|
||||||
return client
|
return client.sendRequest(this, (responseInfo) -> handler.apply(responseInfo.bodyStream())).body();
|
||||||
.sendRequest(this,
|
}
|
||||||
(responseInfo) -> new ByteArrayInputStream(IOUtils.toByteArray(responseInfo.bodyStream())))
|
|
||||||
.body();
|
/**
|
||||||
|
* Helper function to make it easy to pull streams.
|
||||||
|
*
|
||||||
|
* Copies an input stream to an in-memory input stream. The performance on this is not great but
|
||||||
|
* {@link GitHubResponse.ResponseInfo#bodyStream()} is closed at the end of every call to
|
||||||
|
* {@link GitHubClient#sendRequest(GitHubRequest, GitHubResponse.BodyHandler)}, so any reads to the original input
|
||||||
|
* stream must be completed before then. There are a number of deprecated methods that return {@link InputStream}.
|
||||||
|
* This method keeps all of them using the same code path.
|
||||||
|
*
|
||||||
|
* @param inputStream
|
||||||
|
* the input stream to be copied
|
||||||
|
* @return an in-memory copy of the passed input stream
|
||||||
|
* @throws IOException
|
||||||
|
* if an error occurs while copying the stream
|
||||||
|
*/
|
||||||
|
@NonNull
|
||||||
|
public static InputStream copyInputStream(InputStream inputStream) throws IOException {
|
||||||
|
return new ByteArrayInputStream(IOUtils.toByteArray(inputStream));
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|||||||
@@ -0,0 +1,43 @@
|
|||||||
|
package org.kohsuke.github.authorization;
|
||||||
|
|
||||||
|
import java.io.IOException;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Provides a functional interface that returns a valid encodedAuthorization. This strategy allows for a provider that
|
||||||
|
* dynamically changes the credentials. Each request will request the credentials from the provider.
|
||||||
|
*/
|
||||||
|
public interface AuthorizationProvider {
|
||||||
|
/**
|
||||||
|
* An static instance for an ANONYMOUS authorization provider
|
||||||
|
*/
|
||||||
|
AuthorizationProvider ANONYMOUS = new AnonymousAuthorizationProvider();
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Returns the credentials to be used with a given request. As an example, a authorization provider for a bearer
|
||||||
|
* token will return something like:
|
||||||
|
*
|
||||||
|
* <pre>
|
||||||
|
* {@code
|
||||||
|
* @Override
|
||||||
|
* public String getEncodedAuthorization() {
|
||||||
|
* return "Bearer myBearerToken";
|
||||||
|
* }
|
||||||
|
* }
|
||||||
|
* </pre>
|
||||||
|
*
|
||||||
|
* @return encoded authorization string, can be null
|
||||||
|
* @throws IOException
|
||||||
|
* on any error that prevents the provider from getting a valid authorization
|
||||||
|
*/
|
||||||
|
String getEncodedAuthorization() throws IOException;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A {@link AuthorizationProvider} that ensures that no credentials are returned
|
||||||
|
*/
|
||||||
|
class AnonymousAuthorizationProvider implements AuthorizationProvider {
|
||||||
|
@Override
|
||||||
|
public String getEncodedAuthorization() throws IOException {
|
||||||
|
return null;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -0,0 +1,123 @@
|
|||||||
|
package org.kohsuke.github.authorization;
|
||||||
|
|
||||||
|
import java.io.UnsupportedEncodingException;
|
||||||
|
import java.nio.charset.StandardCharsets;
|
||||||
|
import java.util.Base64;
|
||||||
|
|
||||||
|
import javax.annotation.CheckForNull;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A {@link AuthorizationProvider} that always returns the same credentials
|
||||||
|
*/
|
||||||
|
public class ImmutableAuthorizationProvider implements AuthorizationProvider {
|
||||||
|
|
||||||
|
private final String authorization;
|
||||||
|
|
||||||
|
public ImmutableAuthorizationProvider(String authorization) {
|
||||||
|
this.authorization = authorization;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Builds and returns a {@link AuthorizationProvider} from a given oauthAccessToken
|
||||||
|
*
|
||||||
|
* @param oauthAccessToken
|
||||||
|
* The token
|
||||||
|
* @return a correctly configured {@link AuthorizationProvider} that will always return the same provided
|
||||||
|
* oauthAccessToken
|
||||||
|
*/
|
||||||
|
public static AuthorizationProvider fromOauthToken(String oauthAccessToken) {
|
||||||
|
return new UserProvider(String.format("token %s", oauthAccessToken));
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Builds and returns a {@link AuthorizationProvider} from a given oauthAccessToken
|
||||||
|
*
|
||||||
|
* @param oauthAccessToken
|
||||||
|
* The token
|
||||||
|
* @param login
|
||||||
|
* The login for this token
|
||||||
|
*
|
||||||
|
* @return a correctly configured {@link AuthorizationProvider} that will always return the same provided
|
||||||
|
* oauthAccessToken
|
||||||
|
*/
|
||||||
|
public static AuthorizationProvider fromOauthToken(String oauthAccessToken, String login) {
|
||||||
|
return new UserProvider(String.format("token %s", oauthAccessToken), login);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Builds and returns a {@link AuthorizationProvider} from a given App Installation Token
|
||||||
|
*
|
||||||
|
* @param appInstallationToken
|
||||||
|
* A string containing the GitHub App installation token
|
||||||
|
* @return the configured Builder from given GitHub App installation token.
|
||||||
|
*/
|
||||||
|
public static AuthorizationProvider fromAppInstallationToken(String appInstallationToken) {
|
||||||
|
return fromOauthToken(appInstallationToken, "");
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Builds and returns a {@link AuthorizationProvider} from a given jwtToken
|
||||||
|
*
|
||||||
|
* @param jwtToken
|
||||||
|
* The JWT token
|
||||||
|
* @return a correctly configured {@link AuthorizationProvider} that will always return the same provided jwtToken
|
||||||
|
*/
|
||||||
|
public static AuthorizationProvider fromJwtToken(String jwtToken) {
|
||||||
|
return new ImmutableAuthorizationProvider(String.format("Bearer %s", jwtToken));
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Builds and returns a {@link AuthorizationProvider} from the given user/password pair
|
||||||
|
*
|
||||||
|
* @param login
|
||||||
|
* The login for the user, usually the same as the username
|
||||||
|
* @param password
|
||||||
|
* The password for the associated user
|
||||||
|
* @return a correctly configured {@link AuthorizationProvider} that will always return the credentials for the same
|
||||||
|
* user and password combo
|
||||||
|
* @deprecated Login with password credentials are no longer supported by GitHub
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
public static AuthorizationProvider fromLoginAndPassword(String login, String password) {
|
||||||
|
try {
|
||||||
|
String authorization = (String.format("%s:%s", login, password));
|
||||||
|
String charsetName = StandardCharsets.UTF_8.name();
|
||||||
|
String b64encoded = Base64.getEncoder().encodeToString(authorization.getBytes(charsetName));
|
||||||
|
String encodedAuthorization = String.format("Basic %s", b64encoded);
|
||||||
|
return new UserProvider(encodedAuthorization, login);
|
||||||
|
} catch (UnsupportedEncodingException e) {
|
||||||
|
// If UTF-8 isn't supported, there are bigger problems
|
||||||
|
throw new IllegalStateException("Could not generate encoded authorization", e);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String getEncodedAuthorization() {
|
||||||
|
return this.authorization;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* An internal class representing all user-related credentials, which are credentials that have a login or should
|
||||||
|
* query the user endpoint for the login matching this credential.
|
||||||
|
*/
|
||||||
|
private static class UserProvider extends ImmutableAuthorizationProvider implements UserAuthorizationProvider {
|
||||||
|
|
||||||
|
private final String login;
|
||||||
|
|
||||||
|
UserProvider(String authorization) {
|
||||||
|
this(authorization, null);
|
||||||
|
}
|
||||||
|
|
||||||
|
UserProvider(String authorization, String login) {
|
||||||
|
super(authorization);
|
||||||
|
this.login = login;
|
||||||
|
}
|
||||||
|
|
||||||
|
@CheckForNull
|
||||||
|
@Override
|
||||||
|
public String getLogin() {
|
||||||
|
return login;
|
||||||
|
}
|
||||||
|
|
||||||
|
}
|
||||||
|
}
|
||||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user