mirror of
https://github.com/jlengrand/github-api.git
synced 2026-04-05 00:11:22 +00:00
Compare commits
451 Commits
github-api
...
github-api
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
304ab10cf9 | ||
|
|
dc46341432 | ||
|
|
99aea9296e | ||
|
|
b0693037f3 | ||
|
|
c19cfd98d1 | ||
|
|
cdc0e2ad6b | ||
|
|
6606b5c7d1 | ||
|
|
551dbf2a06 | ||
|
|
d734237788 | ||
|
|
47e2a5aea1 | ||
|
|
57cdc308e8 | ||
|
|
8919c5f8c7 | ||
|
|
b8f00bc699 | ||
|
|
042038f480 | ||
|
|
fb03e749bd | ||
|
|
e522239832 | ||
|
|
ae69324196 | ||
|
|
5194c2d9bc | ||
|
|
daf5c5eb98 | ||
|
|
a7b4c97020 | ||
|
|
420d5d06f3 | ||
|
|
a7cd052b7c | ||
|
|
6e1b943823 | ||
|
|
8a3559ada5 | ||
|
|
ea3cbd4c71 | ||
|
|
34a1f9d6e4 | ||
|
|
629bd510c1 | ||
|
|
40937a5cc6 | ||
|
|
8509957102 | ||
|
|
b0aea0c575 | ||
|
|
1f7f646bec | ||
|
|
a59ee6a82d | ||
|
|
1fefc77582 | ||
|
|
199eee4e25 | ||
|
|
854df5321b | ||
|
|
bd509070ac | ||
|
|
a8c7c97d06 | ||
|
|
6d86cfb4f6 | ||
|
|
fb3e956502 | ||
|
|
9b0dbe6f34 | ||
|
|
c10c7237a7 | ||
|
|
36612fe97f | ||
|
|
18e2056a10 | ||
|
|
8c8f1451d4 | ||
|
|
be67f1d9e2 | ||
|
|
90bc250269 | ||
|
|
1bd178654f | ||
|
|
f22bf160f9 | ||
|
|
4261c42949 | ||
|
|
40cfb85a8e | ||
|
|
f08299b134 | ||
|
|
a04ab45abc | ||
|
|
0647df2d2b | ||
|
|
d4cc3af1e9 | ||
|
|
936ab499ce | ||
|
|
453f475b4e | ||
|
|
bda3855b86 | ||
|
|
772a6c112b | ||
|
|
9b4134cada | ||
|
|
ed9f54006d | ||
|
|
3b1f176544 | ||
|
|
d2732bcf54 | ||
|
|
a1461f401a | ||
|
|
f9fd30275c | ||
|
|
eeea14dab4 | ||
|
|
1df807a198 | ||
|
|
0848287069 | ||
|
|
334b37a256 | ||
|
|
8776a3b672 | ||
|
|
657550f767 | ||
|
|
45a0114f75 | ||
|
|
a8ddd3e12a | ||
|
|
b668396151 | ||
|
|
9e7c33369c | ||
|
|
8943ca6d1a | ||
|
|
b3460c1f9d | ||
|
|
5166c9265f | ||
|
|
35c8cfa01d | ||
|
|
8e6dbf3772 | ||
|
|
cb381dfa06 | ||
|
|
80124e3b85 | ||
|
|
7aae27e36f | ||
|
|
b212956fbb | ||
|
|
d033355e84 | ||
|
|
59d7a117d0 | ||
|
|
dfbb38c5f1 | ||
|
|
3f9954144a | ||
|
|
1b84efdbfa | ||
|
|
c33e78a7dc | ||
|
|
747c759bbb | ||
|
|
e0a709676e | ||
|
|
a96275c286 | ||
|
|
ca7c809feb | ||
|
|
a8a0bcb7db | ||
|
|
0e2bf23830 | ||
|
|
44a8b797fb | ||
|
|
cdede298a9 | ||
|
|
f6ac4d3559 | ||
|
|
7e1531dbca | ||
|
|
9aeb422157 | ||
|
|
fba0f8cf8e | ||
|
|
0f4a5227e1 | ||
|
|
d16a752b43 | ||
|
|
4d9aed90d6 | ||
|
|
4bec27fd49 | ||
|
|
be3bd74bb7 | ||
|
|
f1720b7bbc | ||
|
|
7a79a18d8f | ||
|
|
472034c950 | ||
|
|
0b14cee817 | ||
|
|
b50ab56f9e | ||
|
|
26d30663c4 | ||
|
|
ffecc390eb | ||
|
|
252ca04084 | ||
|
|
aae5c56a31 | ||
|
|
6670446037 | ||
|
|
bd39b07bb5 | ||
|
|
a9438b6121 | ||
|
|
f546cf4521 | ||
|
|
43efa78750 | ||
|
|
9e3de43802 | ||
|
|
dc615e432e | ||
|
|
cf9caa6af5 | ||
|
|
15f748358d | ||
|
|
b30d648623 | ||
|
|
33d70560b8 | ||
|
|
865a49d2e8 | ||
|
|
4fca68c25c | ||
|
|
f131a0c1c2 | ||
|
|
cd4368fa79 | ||
|
|
4ec4b160b0 | ||
|
|
a585b4957f | ||
|
|
e6b02b3bed | ||
|
|
1ef0ec0432 | ||
|
|
2e87bd86a1 | ||
|
|
0228a0d023 | ||
|
|
6365f3749d | ||
|
|
25c18130f9 | ||
|
|
436c19634d | ||
|
|
1a6facc685 | ||
|
|
bd0093c8ea | ||
|
|
e150280010 | ||
|
|
827fd5e472 | ||
|
|
f89fbc67b9 | ||
|
|
c567a88892 | ||
|
|
6a39d7fca5 | ||
|
|
a15e67f065 | ||
|
|
7a1bce9578 | ||
|
|
f2b4de7943 | ||
|
|
b3ff4ac6d9 | ||
|
|
1c56e7fab5 | ||
|
|
70ba4df385 | ||
|
|
8062c705e8 | ||
|
|
fafb23c1a6 | ||
|
|
4e7ac7030c | ||
|
|
4803daca5a | ||
|
|
facfc61316 | ||
|
|
e3e495bfb1 | ||
|
|
e007284d2f | ||
|
|
1da8416ebd | ||
|
|
79b49a469c | ||
|
|
5888efcaef | ||
|
|
459d1b4f56 | ||
|
|
9151102bda | ||
|
|
3819984add | ||
|
|
3b58fbc186 | ||
|
|
55e589b3d9 | ||
|
|
e64d64d8d8 | ||
|
|
37c2d9135b | ||
|
|
30c96221bd | ||
|
|
bf7305e3f8 | ||
|
|
3b12a229c3 | ||
|
|
5726ceb8dc | ||
|
|
c06c06624d | ||
|
|
ad40d7071e | ||
|
|
f55a39eb90 | ||
|
|
c3869bee31 | ||
|
|
6eac15df0f | ||
|
|
6f5d3c32c3 | ||
|
|
68ef40e4d0 | ||
|
|
4046bc4f72 | ||
|
|
1b8d131915 | ||
|
|
f5ad332d28 | ||
|
|
938603ff60 | ||
|
|
17af78f2bb | ||
|
|
7588267743 | ||
|
|
ed4f9c8176 | ||
|
|
bbb46e88b0 | ||
|
|
3db7aac0d8 | ||
|
|
fdbbd2e563 | ||
|
|
e92f1321d4 | ||
|
|
da2aaff9e5 | ||
|
|
208904b634 | ||
|
|
a433bcda2e | ||
|
|
4bba692170 | ||
|
|
59b61cd8be | ||
|
|
247b013e16 | ||
|
|
77baafa643 | ||
|
|
3c56f1f076 | ||
|
|
224d8c7cb4 | ||
|
|
0feb520549 | ||
|
|
ca365b12f6 | ||
|
|
bde6ad9a06 | ||
|
|
4953f4500d | ||
|
|
7fee1fcc74 | ||
|
|
4415ac8fd2 | ||
|
|
8c81e48a31 | ||
|
|
9ad0329c56 | ||
|
|
78f533bbfc | ||
|
|
79c7dd9ecf | ||
|
|
5d796d1f79 | ||
|
|
68a82be6c4 | ||
|
|
2676ef2b73 | ||
|
|
04b283c539 | ||
|
|
98b067937a | ||
|
|
8ababb60bf | ||
|
|
b51d655f77 | ||
|
|
74496d32da | ||
|
|
316e278be1 | ||
|
|
d881bf6504 | ||
|
|
c74fbbe1fd | ||
|
|
929d9fb7bd | ||
|
|
5d069d0531 | ||
|
|
dd9e6dc5d3 | ||
|
|
d22c77c41d | ||
|
|
3a11b7ccbf | ||
|
|
d7931777bc | ||
|
|
9d161b28bb | ||
|
|
9b16a1caa0 | ||
|
|
9a918e3bac | ||
|
|
d4c5c6a1e0 | ||
|
|
63fda3555c | ||
|
|
6a2381c06b | ||
|
|
e9c0a16c26 | ||
|
|
2101a67ac1 | ||
|
|
ddac568aaa | ||
|
|
262ae9f635 | ||
|
|
381502fb80 | ||
|
|
92fb441eb2 | ||
|
|
29e08037a8 | ||
|
|
84cc6d9315 | ||
|
|
b8d5a1c732 | ||
|
|
0197ab9661 | ||
|
|
b7915e61a6 | ||
|
|
586db99450 | ||
|
|
5377d0dd18 | ||
|
|
bb48d55bd4 | ||
|
|
c5d3a7d573 | ||
|
|
8267050f06 | ||
|
|
610b02968e | ||
|
|
a7112c42df | ||
|
|
8a474a3b00 | ||
|
|
59e18d155e | ||
|
|
12ca5d8063 | ||
|
|
c959e0a928 | ||
|
|
89a08b021d | ||
|
|
04b553cdec | ||
|
|
15e9ee30ee | ||
|
|
a0d650a86c | ||
|
|
1a6ad48e08 | ||
|
|
7c82eeb018 | ||
|
|
b188e74ee0 | ||
|
|
c21bd5765a | ||
|
|
b78c37a695 | ||
|
|
2f151d45c3 | ||
|
|
3ebe3afdbd | ||
|
|
f4845df6c0 | ||
|
|
272b87f04d | ||
|
|
ff790eeefb | ||
|
|
97e918da03 | ||
|
|
4f30998873 | ||
|
|
a0fc478a28 | ||
|
|
bb03fd1968 | ||
|
|
0c65f74662 | ||
|
|
29ac2bd4f5 | ||
|
|
0d8b4f32e8 | ||
|
|
83db7f24eb | ||
|
|
5f9976a193 | ||
|
|
9480ef485b | ||
|
|
a9b7432584 | ||
|
|
6d7081910f | ||
|
|
aa96089ab4 | ||
|
|
58ae681417 | ||
|
|
c038e0af5e | ||
|
|
4f9976c0cb | ||
|
|
e308e5ed57 | ||
|
|
7b1b1ca994 | ||
|
|
551be49a1a | ||
|
|
a3888e6902 | ||
|
|
43bb6a0dd8 | ||
|
|
6e3f754366 | ||
|
|
6360112432 | ||
|
|
f1ca0b5417 | ||
|
|
0894c8007c | ||
|
|
05863acbcd | ||
|
|
0e4cd06137 | ||
|
|
85d2d974e7 | ||
|
|
3f021f9552 | ||
|
|
0456f10709 | ||
|
|
b7d03f7463 | ||
|
|
07a392c2a7 | ||
|
|
5b69de770f | ||
|
|
4688870984 | ||
|
|
bf67069768 | ||
|
|
91764c1c74 | ||
|
|
8b2a3e1221 | ||
|
|
def2f0b37d | ||
|
|
5d7479a3dd | ||
|
|
ceb2d35f9f | ||
|
|
fc38dba59a | ||
|
|
75b383d398 | ||
|
|
ee2d9491fb | ||
|
|
bf86a7c75a | ||
|
|
70f6d129e2 | ||
|
|
a4ac2aa99a | ||
|
|
ae3b6fbe6b | ||
|
|
e357fca963 | ||
|
|
c84cc89805 | ||
|
|
181238cd50 | ||
|
|
214c24c736 | ||
|
|
cf51ce8f26 | ||
|
|
2b7ed40d01 | ||
|
|
349ef7a54c | ||
|
|
94df5fc389 | ||
|
|
906238a297 | ||
|
|
7963fa82b5 | ||
|
|
1aba6012fb | ||
|
|
ff4324ac67 | ||
|
|
11bc669e1d | ||
|
|
dcf26d58e4 | ||
|
|
4d46872c35 | ||
|
|
4f0d62f421 | ||
|
|
f7ad1f517b | ||
|
|
345d6197f3 | ||
|
|
bb4d44138a | ||
|
|
a8ef0cde53 | ||
|
|
77dc009c95 | ||
|
|
aa298c93cc | ||
|
|
dfb0a5240e | ||
|
|
9cfc3c22b5 | ||
|
|
b177d98e29 | ||
|
|
5405fb0370 | ||
|
|
72a1c24b3b | ||
|
|
f146ae94ec | ||
|
|
a0bbba748a | ||
|
|
81bf818573 | ||
|
|
d5913dc292 | ||
|
|
e1e901b794 | ||
|
|
2f2f26767e | ||
|
|
bffa78c1b8 | ||
|
|
c55719c67a | ||
|
|
cb3b4a6642 | ||
|
|
92c141cee6 | ||
|
|
fd1a1a1c23 | ||
|
|
b835884b2e | ||
|
|
660763908d | ||
|
|
fe8bdb755a | ||
|
|
67dc6d2d23 | ||
|
|
9c8d73cbe2 | ||
|
|
5db97d92dd | ||
|
|
ac470dddb5 | ||
|
|
43063fe8ce | ||
|
|
59e0046c1e | ||
|
|
36ab05c265 | ||
|
|
2b2be05dae | ||
|
|
fb1adbd1ef | ||
|
|
ab68a59b25 | ||
|
|
9c7de767e9 | ||
|
|
8ba5cf7c2e | ||
|
|
b194a19b98 | ||
|
|
1d344b016f | ||
|
|
474f3ef4ca | ||
|
|
9830927020 | ||
|
|
727932a442 | ||
|
|
cd92b51845 | ||
|
|
fe26d16411 | ||
|
|
d68c66ce2b | ||
|
|
e7bfbfb48f | ||
|
|
f2a88ae61c | ||
|
|
e2113f6ee5 | ||
|
|
3867224024 | ||
|
|
9ee0bf43bc | ||
|
|
2844542efa | ||
|
|
e3fcae9392 | ||
|
|
c6ccfa91f3 | ||
|
|
b6fcee1cb9 | ||
|
|
9071befb04 | ||
|
|
bdd5fe98f3 | ||
|
|
a3d3e83a49 | ||
|
|
08bde72028 | ||
|
|
108a136368 | ||
|
|
57d87ad6b1 | ||
|
|
0c22815ff7 | ||
|
|
0ca792ecfd | ||
|
|
987c34c69e | ||
|
|
c1c02bc8ab | ||
|
|
4ee369f27c | ||
|
|
c9012efdcb | ||
|
|
41524fc67d | ||
|
|
04ff61e981 | ||
|
|
532468dc67 | ||
|
|
9c9a2dae47 | ||
|
|
c8a868b57f | ||
|
|
4b3f81ee34 | ||
|
|
afa170ba7c | ||
|
|
46e3b2272e | ||
|
|
52472e90ec | ||
|
|
4ef0d00846 | ||
|
|
580f2537f2 | ||
|
|
3d9fd96026 | ||
|
|
f449b92721 | ||
|
|
3b0216b023 | ||
|
|
98cf839737 | ||
|
|
0bb0846505 | ||
|
|
70969400a3 | ||
|
|
147e8d5d12 | ||
|
|
cacc3e6edd | ||
|
|
a284eca147 | ||
|
|
0d3ba9d7f0 | ||
|
|
be8064d642 | ||
|
|
e30dba742d | ||
|
|
44b72ed647 | ||
|
|
666bd77dac | ||
|
|
0a6613e60d | ||
|
|
62e186c123 | ||
|
|
50dd8f5bcc | ||
|
|
d5fcac9c45 | ||
|
|
c2bed85190 | ||
|
|
183b463ef2 | ||
|
|
92fdac44a0 | ||
|
|
12829ecc73 | ||
|
|
51319c3b26 | ||
|
|
8fd827040b | ||
|
|
5ec46eae0d | ||
|
|
32c03301be | ||
|
|
df7f29b2ab | ||
|
|
e863113c36 | ||
|
|
8e2c1d7382 | ||
|
|
ab7b9cccba | ||
|
|
81bf61a161 | ||
|
|
b40f008647 | ||
|
|
734e41702b | ||
|
|
038dd20a91 | ||
|
|
1dd62b8550 | ||
|
|
715deebe05 | ||
|
|
b3fe3d8590 | ||
|
|
f74c3ed3ea | ||
|
|
2c9aebeeed | ||
|
|
7474f1e11f | ||
|
|
dba9c55b64 | ||
|
|
b432364397 |
1
.gitattributes
vendored
Normal file
1
.gitattributes
vendored
Normal file
@@ -0,0 +1 @@
|
||||
*.java text eol=lf
|
||||
1
.github/PULL_REQUEST_TEMPLATE.md
vendored
1
.github/PULL_REQUEST_TEMPLATE.md
vendored
@@ -7,7 +7,6 @@ We love getting PRs, but we hate asking people for the same basic changes every
|
||||
- [ ] Push your changes to a branch other than `master`. Create your PR from that branch.
|
||||
- [ ] Add JavaDocs and other comments
|
||||
- [ ] Write tests that run and pass in CI. See [CONTRIBUTING.md](CONTRIBUTING.md) for details on how to capture snapshot data.
|
||||
- [ ] Run `mvn clean compile` locally. This may reformat your code, commit those changes.
|
||||
- [ ] Run `mvn -D enable-ci clean install site` locally. If this command doesn't succeed, your change will not pass CI.
|
||||
|
||||
# When creating a PR:
|
||||
|
||||
12
.github/dependabot.yml
vendored
Normal file
12
.github/dependabot.yml
vendored
Normal file
@@ -0,0 +1,12 @@
|
||||
version: 2
|
||||
updates:
|
||||
- package-ecosystem: "maven"
|
||||
directory: "/"
|
||||
schedule:
|
||||
interval: "monthly"
|
||||
time: "02:00"
|
||||
- package-ecosystem: "github-actions"
|
||||
directory: "/"
|
||||
schedule:
|
||||
interval: "monthly"
|
||||
time: "02:00"
|
||||
5
.github/release-drafter.yml
vendored
5
.github/release-drafter.yml
vendored
@@ -1,5 +1,6 @@
|
||||
name-template: 'v$NEXT_PATCH_VERSION 🌈'
|
||||
tag-template: 'v$NEXT_PATCH_VERSION'
|
||||
name-template: 'v$NEXT_MINOR_VERSION 🌈'
|
||||
tag-template: 'github-api-$NEXT_MINOR_VERSION'
|
||||
version-template: '$MAJOR.$MINOR'
|
||||
categories:
|
||||
- title: '🚀 Features'
|
||||
labels:
|
||||
|
||||
34
.github/workflows/maven-build.yml
vendored
34
.github/workflows/maven-build.yml
vendored
@@ -2,14 +2,18 @@ name: CI
|
||||
|
||||
on: [push, pull_request]
|
||||
|
||||
# this is required by spotless for JDK 16+
|
||||
env:
|
||||
JAVA_11_PLUS_MAVEN_OPTS: "--add-opens jdk.compiler/com.sun.tools.javac.util=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.file=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.parser=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.tree=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.api=ALL-UNNAMED"
|
||||
|
||||
jobs:
|
||||
build:
|
||||
name: build-only (Java ${{ matrix.java }})
|
||||
runs-on: ubuntu-latest
|
||||
strategy:
|
||||
fail-fast: false
|
||||
matrix:
|
||||
java: [ 13 ]
|
||||
java: [ 16 ]
|
||||
steps:
|
||||
- uses: actions/checkout@v2
|
||||
- name: Set up JDK
|
||||
@@ -17,18 +21,21 @@ jobs:
|
||||
with:
|
||||
java-version: ${{ matrix.java }}
|
||||
- name: Cached .m2
|
||||
uses: actions/cache@v1
|
||||
uses: actions/cache@v2.1.4
|
||||
with:
|
||||
path: ~/.m2/repository
|
||||
key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
|
||||
restore-keys: |
|
||||
${{ runner.os }}-maven-
|
||||
- name: Maven Install (skipTests)
|
||||
env:
|
||||
MAVEN_OPTS: ${{ env.JAVA_11_PLUS_MAVEN_OPTS }}
|
||||
run: mvn -B install -DskipTests -D enable-ci --file pom.xml
|
||||
site:
|
||||
name: site (Java ${{ matrix.java }})
|
||||
runs-on: ubuntu-latest
|
||||
strategy:
|
||||
fail-fast: false
|
||||
matrix:
|
||||
java: [ 8, 11 ]
|
||||
steps:
|
||||
@@ -37,7 +44,7 @@ jobs:
|
||||
uses: actions/setup-java@v1
|
||||
with:
|
||||
java-version: ${{ matrix.java }}
|
||||
- uses: actions/cache@v1
|
||||
- uses: actions/cache@v2.1.4
|
||||
with:
|
||||
path: ~/.m2/repository
|
||||
key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
|
||||
@@ -49,24 +56,37 @@ jobs:
|
||||
name: test (${{ matrix.os }}, Java ${{ matrix.java }})
|
||||
runs-on: ${{ matrix.os }}-latest
|
||||
strategy:
|
||||
fail-fast: false
|
||||
matrix:
|
||||
os: [ ubuntu, windows ]
|
||||
java: [ 8, 11, 13, 15-ea ]
|
||||
java: [ 8, 11, 16 ]
|
||||
steps:
|
||||
- uses: actions/checkout@v2
|
||||
- name: Set up JDK
|
||||
uses: actions/setup-java@v1
|
||||
with:
|
||||
java-version: ${{ matrix.java }}
|
||||
- uses: actions/cache@v1
|
||||
- uses: actions/cache@v2.1.4
|
||||
with:
|
||||
path: ~/.m2/repository
|
||||
key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
|
||||
restore-keys: |
|
||||
${{ runner.os }}-maven-
|
||||
# JDK 8
|
||||
- name: Maven Install without Code Coverage
|
||||
if: matrix.os == 'windows'
|
||||
if: matrix.os == 'windows' && matrix.java == '8'
|
||||
run: mvn -B install --file pom.xml
|
||||
- name: Maven Install with Code Coverage
|
||||
if: matrix.os != 'windows'
|
||||
if: matrix.os != 'windows' && matrix.java == '8'
|
||||
run: mvn -B install -D enable-ci --file pom.xml
|
||||
# JDK 11+
|
||||
- name: Maven Install without Code Coverage
|
||||
if: matrix.os == 'windows' && matrix.java != '8'
|
||||
env:
|
||||
MAVEN_OPTS: ${{ env.JAVA_11_PLUS_MAVEN_OPTS }}
|
||||
run: mvn -B install --file pom.xml
|
||||
- name: Maven Install with Code Coverage
|
||||
if: matrix.os != 'windows' && matrix.java != '8'
|
||||
env:
|
||||
MAVEN_OPTS: ${{ env.JAVA_11_PLUS_MAVEN_OPTS }}
|
||||
run: mvn -B install -D enable-ci --file pom.xml
|
||||
|
||||
@@ -1,5 +1,7 @@
|
||||
# Changelog
|
||||
|
||||
For changes after v1.101 see the [GitHub Releases page](https://github.com/hub4j/github-api/releases) for the project.
|
||||
|
||||
## [github-api-1.101](https://github.com/hub4j/github-api/tree/github-api-1.101) (2019-11-27)
|
||||
|
||||
[Full Changelog](https://github.com/hub4j/github-api/compare/github-api-1.100...github-api-1.101)
|
||||
|
||||
@@ -14,10 +14,14 @@ Example:
|
||||
|
||||
This the default behavior.
|
||||
|
||||
Example for a single test case:
|
||||
|
||||
`mvn install -Dtest=WireMockStatusReporterTest#user_whenProxying_AuthCorrectlyConfigured`
|
||||
|
||||
|
||||
### Setting up credential
|
||||
|
||||
1. Create an OAuth token on github.com
|
||||
1. Create a "Personal access token" on https://github.com/ (`Settings` > `Developer settings` > `Personal access tokens`)
|
||||
2. Set the GITHUB_OAUTH environment variable to the value of that token
|
||||
3. Set the system property `test.github.useProxy` (usually like "-Dtest.github.useProxy" as a Java VM option)
|
||||
|
||||
@@ -27,21 +31,37 @@ This the default behavior.
|
||||
|
||||
`WireMockStatusReporterTest: GitHub proxying and user auth correctly configured for user login: <your login>`
|
||||
|
||||
Whenever you run tests with `-Dtest.github.useProxy`, they will try to get data from local files but will fallback to proxying to github if not found.
|
||||
|
||||
Whenever you run tests with `-Dtest.github.useProxy`, they will try to get data from local files but will fallback to proxying to GitHub if not found.
|
||||
|
||||
### Writing a new test
|
||||
|
||||
Once you have credentials setup, you add new test classes and test methods as you would normally.
|
||||
Keep `useProxy` enabled and iterate on your tests as needed. Remember, while proxying your tests are interacting with GitHub - you will need to clean up your state between runs.
|
||||
|
||||
When you are ready to create a snapshot of your test data,
|
||||
run your test with `test.github.takeSnapshot` ("-Dtest.github.takeSnapshot" as a Java VM option). For example:
|
||||
#### Running tests using GitHub test proxy
|
||||
|
||||
`mvn install -Dtest.github.takeSnapshot -Dtest=YourTestClassName`
|
||||
Keep `useProxy` enabled and iterate on your tests as needed. With `useProxy` enabled your tests will interact with
|
||||
GitHub - you will need to clean up your server-state between runs. This can be done manually to start with.
|
||||
Once your test code is somewhat stable, use `getGitHubBeforeAfter()` to get a `GitHub` instance for test setup and cleanup.
|
||||
Interactions with that `GitHub` instance will not be recorded as part of the test, keeping the test data files to a minimum.
|
||||
|
||||
The above command would create snapshot WireMock data files under the path `src/test/resources/org/kohsuhke/github/YourTestClassName/wiremock`.
|
||||
Each method would get a separate director that would hold the data files for that test method.
|
||||
#### Running tests against your personal GitHub user account
|
||||
|
||||
By default, test helper methods such as `getTempRepository()` target the `hub4j-test-org` GitHub organization.
|
||||
Please request access to this org to record your tests before submitting a PR. This helps keep the project stable and nimble.
|
||||
Until you have access (or if you don't want access), you can set the following additional system property to target
|
||||
your personal github account.
|
||||
|
||||
`mvn install -Dtest.github.org=false -Dtest=YourTestClassName`
|
||||
|
||||
#### Taking a snapshot
|
||||
|
||||
When you are ready to create a snapshot of your test data, run your test with `test.github.takeSnapshot` ("-Dtest.github.takeSnapshot" as
|
||||
a Java VM option). For example:
|
||||
|
||||
`mvn install -Dtest.github.takeSnapshot -Dtest.github.org=false -Dtest=YourTestClassName`
|
||||
|
||||
The above command will create snapshot WireMock data files under the path `src/test/resources/org/kohsuhke/github/YourTestClassName/wiremock`.
|
||||
Each method will get a separate directory that will hold the data files for that test method.
|
||||
|
||||
Add all files including the generated data to your commit and submit a PR.
|
||||
|
||||
|
||||
237
pom.xml
237
pom.xml
@@ -2,7 +2,7 @@
|
||||
<modelVersion>4.0.0</modelVersion>
|
||||
<groupId>org.kohsuke</groupId>
|
||||
<artifactId>github-api</artifactId>
|
||||
<version>1.114</version>
|
||||
<version>1.126</version>
|
||||
<name>GitHub API for Java</name>
|
||||
<url>https://github-api.kohsuke.org/</url>
|
||||
<description>GitHub API for Java</description>
|
||||
@@ -11,7 +11,7 @@
|
||||
<connection>scm:git:git@github.com/hub4j/${project.artifactId}.git</connection>
|
||||
<developerConnection>scm:git:ssh://git@github.com/hub4j/${project.artifactId}.git</developerConnection>
|
||||
<url>https://github.com/hub4j/github-api/</url>
|
||||
<tag>github-api-1.114</tag>
|
||||
<tag>github-api-1.126</tag>
|
||||
</scm>
|
||||
|
||||
<distributionManagement>
|
||||
@@ -33,19 +33,20 @@
|
||||
|
||||
<properties>
|
||||
<project.build.sourceEncoding>UTF-8</project.build.sourceEncoding>
|
||||
<spotbugs-maven-plugin.version>4.0.0</spotbugs-maven-plugin.version>
|
||||
<spotbugs.version>4.0.4</spotbugs.version>
|
||||
<spotbugs-maven-plugin.version>4.2.0</spotbugs-maven-plugin.version>
|
||||
<spotbugs.version>4.2.1</spotbugs.version>
|
||||
<spotbugs-maven-plugin.failOnError>true</spotbugs-maven-plugin.failOnError>
|
||||
<hamcrest.version>2.2</hamcrest.version>
|
||||
<okhttp3.version>4.4.1</okhttp3.version>
|
||||
<okio.version>2.5.0</okio.version>
|
||||
<formatter-maven-plugin.goal>format</formatter-maven-plugin.goal>
|
||||
<impsort-maven-plugin.goal>sort</impsort-maven-plugin.goal>
|
||||
<!-- Using this as the minimum bar for code coverage. Adding methods without covering them will fail this. -->
|
||||
<jacoco.coverage.target.bundle.method>0.60</jacoco.coverage.target.bundle.method>
|
||||
<jacoco.coverage.target.class.method>0.25</jacoco.coverage.target.class.method>
|
||||
<jacoco.coverage.target.bundle.method>0.70</jacoco.coverage.target.bundle.method>
|
||||
<jacoco.coverage.target.class.method>0.50</jacoco.coverage.target.class.method>
|
||||
<!-- For non-ci builds we'd like the build to still complete if jacoco metrics aren't met. -->
|
||||
<jacoco.haltOnFailure>false</jacoco.haltOnFailure>
|
||||
<jjwt.suite.version>0.11.2</jjwt.suite.version>
|
||||
|
||||
<surefire.argLine />
|
||||
</properties>
|
||||
|
||||
<build>
|
||||
@@ -79,6 +80,14 @@
|
||||
</testResources>
|
||||
<pluginManagement>
|
||||
<plugins>
|
||||
<plugin>
|
||||
<artifactId>maven-surefire-plugin</artifactId>
|
||||
<version>2.22.2</version>
|
||||
<configuration>
|
||||
<!-- SUREFIRE-1226 workaround -->
|
||||
<trimStackTrace>false</trimStackTrace>
|
||||
</configuration>
|
||||
</plugin>
|
||||
<plugin>
|
||||
<groupId>org.apache.maven.plugins</groupId>
|
||||
<artifactId>maven-source-plugin</artifactId>
|
||||
@@ -92,7 +101,7 @@
|
||||
<plugin>
|
||||
<groupId>org.jacoco</groupId>
|
||||
<artifactId>jacoco-maven-plugin</artifactId>
|
||||
<version>0.8.5</version>
|
||||
<version>0.8.6</version>
|
||||
<executions>
|
||||
<execution>
|
||||
<goals>
|
||||
@@ -145,59 +154,39 @@
|
||||
<!-- Sample only -->
|
||||
<exclude>org.kohsuke.github.example.*</exclude>
|
||||
|
||||
<!-- No methods -->
|
||||
<exclude>org.kohsuke.github.Previews</exclude>
|
||||
|
||||
<!-- Deprecated -->
|
||||
<exclude>org.kohsuke.github.extras.OkHttp3Connector</exclude>
|
||||
<exclude>org.kohsuke.github.EnforcementLevel</exclude>
|
||||
<exclude>org.kohsuke.github.GHPerson.1</exclude>
|
||||
|
||||
<!-- These fail coverage on windows because tests are disabled -->
|
||||
<exclude>org.kohsuke.github.GHAsset</exclude>
|
||||
<exclude>org.kohsuke.github.GHReleaseBuilder</exclude>
|
||||
<exclude>org.kohsuke.github.GHRelease</exclude>
|
||||
<!-- TODO: Some coverage, but more needed -->
|
||||
<exclude>org.kohsuke.github.GHPullRequestReviewBuilder.DraftReviewComment</exclude>
|
||||
<exclude>org.kohsuke.github.GHIssue.PullRequest</exclude>
|
||||
<exclude>org.kohsuke.github.GHCommitSearchBuilder</exclude>
|
||||
<exclude>org.kohsuke.github.GHRepositorySearchBuilder</exclude>
|
||||
<exclude>org.kohsuke.github.GHUserSearchBuilder</exclude>
|
||||
|
||||
<!-- TODO: These still need test coverage -->
|
||||
<exclude>org.kohsuke.github.GHBranchProtection.RequiredSignatures</exclude>
|
||||
<exclude>org.kohsuke.github.GHBranchProtectionBuilder.Restrictions</exclude>
|
||||
<exclude>org.kohsuke.github.GHBranchProtection.Restrictions</exclude>
|
||||
<exclude>org.kohsuke.github.GHCommentAuthorAssociation</exclude>
|
||||
<exclude>org.kohsuke.github.GHCommitBuilder.UserInfo</exclude>
|
||||
<exclude>org.kohsuke.github.GHCommitState</exclude>
|
||||
<exclude>org.kohsuke.github.GHCompare.Commit</exclude>
|
||||
<exclude>org.kohsuke.github.GHCompare.InnerCommit</exclude>
|
||||
<exclude>org.kohsuke.github.GHCompare.Status</exclude>
|
||||
<exclude>org.kohsuke.github.GHCompare.Tree</exclude>
|
||||
<exclude>org.kohsuke.github.GHCompare.User</exclude>
|
||||
<exclude>org.kohsuke.github.GHCompare</exclude>
|
||||
<exclude>org.kohsuke.github.GHDeployKey</exclude>
|
||||
<exclude>org.kohsuke.github.GHDeploymentStatusBuilder</exclude>
|
||||
<exclude>org.kohsuke.github.GHDirection</exclude>
|
||||
<exclude>org.kohsuke.github.GHEmail</exclude>
|
||||
<exclude>org.kohsuke.github.GHEventPayload.Ping</exclude>
|
||||
<exclude>org.kohsuke.github.GHEventPayload.Release</exclude>
|
||||
<exclude>org.kohsuke.github.GHException</exclude>
|
||||
<exclude>org.kohsuke.github.GHHook</exclude>
|
||||
<exclude>org.kohsuke.github.GHHooks.OrgContext</exclude>
|
||||
<exclude>org.kohsuke.github.GHInvitation</exclude>
|
||||
<exclude>org.kohsuke.github.GHMilestoneState</exclude>
|
||||
<exclude>org.kohsuke.github.GHOrgHook</exclude>
|
||||
<exclude>org.kohsuke.github.GHProject.ProjectStateFilter</exclude>
|
||||
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.Authorship</exclude>
|
||||
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.Commit</exclude>
|
||||
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.CommitPointer</exclude>
|
||||
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.Tree</exclude>
|
||||
<exclude>org.kohsuke.github.GHPullRequestCommitDetail</exclude>
|
||||
<exclude>org.kohsuke.github.GHPullRequestFileDetail</exclude>
|
||||
<exclude>org.kohsuke.github.GHPullRequestQueryBuilder.Sort</exclude>
|
||||
<exclude>org.kohsuke.github.GHReleaseUpdater</exclude>
|
||||
<exclude>org.kohsuke.github.GHRepository.ForkSort</exclude>
|
||||
<exclude>org.kohsuke.github.GHRequestedAction</exclude>
|
||||
<exclude>org.kohsuke.github.GHStargazer</exclude>
|
||||
<exclude>org.kohsuke.github.GHTagObject</exclude>
|
||||
<exclude>org.kohsuke.github.GHTeam.Role</exclude>
|
||||
<exclude>org.kohsuke.github.GHUserSearchBuilder.Sort</exclude>
|
||||
<exclude>org.kohsuke.github.GHVerifiedKey</exclude>
|
||||
</excludes>
|
||||
</rule>
|
||||
@@ -233,7 +222,7 @@
|
||||
<plugin>
|
||||
<groupId>org.apache.maven.plugins</groupId>
|
||||
<artifactId>maven-site-plugin</artifactId>
|
||||
<version>3.9.0</version>
|
||||
<version>3.9.1</version>
|
||||
</plugin>
|
||||
<plugin>
|
||||
<groupId>org.apache.maven.plugins</groupId>
|
||||
@@ -253,7 +242,7 @@
|
||||
<plugin>
|
||||
<groupId>org.apache.maven.plugins</groupId>
|
||||
<artifactId>maven-project-info-reports-plugin</artifactId>
|
||||
<version>3.1.0</version>
|
||||
<version>3.1.1</version>
|
||||
<dependencies>
|
||||
<dependency>
|
||||
<groupId>org.apache.bcel</groupId>
|
||||
@@ -280,16 +269,20 @@
|
||||
|
||||
<plugin>
|
||||
<artifactId>maven-surefire-plugin</artifactId>
|
||||
<version>2.22.2</version>
|
||||
<configuration>
|
||||
<!-- SUREFIRE-1226 workaround -->
|
||||
<trimStackTrace>false</trimStackTrace>
|
||||
</configuration>
|
||||
<executions>
|
||||
<execution>
|
||||
<id>default-test</id>
|
||||
<configuration>
|
||||
<excludesFile>src/test/resources/slow-or-flaky-tests.txt</excludesFile>
|
||||
<argLine>${surefire.argLine}</argLine>
|
||||
</configuration>
|
||||
</execution>
|
||||
</executions>
|
||||
</plugin>
|
||||
<plugin>
|
||||
<groupId>org.codehaus.mojo</groupId>
|
||||
<artifactId>animal-sniffer-maven-plugin</artifactId>
|
||||
<version>1.18</version>
|
||||
<version>1.20</version>
|
||||
<configuration>
|
||||
<signature>
|
||||
<groupId>org.codehaus.mojo.signature</groupId>
|
||||
@@ -320,36 +313,35 @@
|
||||
</executions>
|
||||
</plugin>
|
||||
<plugin>
|
||||
<groupId>net.revelc.code.formatter</groupId>
|
||||
<artifactId>formatter-maven-plugin</artifactId>
|
||||
<version>2.11.0</version>
|
||||
<groupId>com.diffplug.spotless</groupId>
|
||||
<artifactId>spotless-maven-plugin</artifactId>
|
||||
<version>2.8.1</version>
|
||||
<executions>
|
||||
<execution>
|
||||
<id>spotless-check</id>
|
||||
<!-- runs in verify phase by default -->
|
||||
<goals>
|
||||
<goal>${formatter-maven-plugin.goal}</goal>
|
||||
<!-- can be disabled using -Dspotless.check.skip=true -->
|
||||
<goal>check</goal>
|
||||
</goals>
|
||||
<configuration>
|
||||
<configFile>src/main/resources/eclipse/formatter.xml</configFile>
|
||||
</configuration>
|
||||
</execution>
|
||||
</executions>
|
||||
</plugin>
|
||||
<plugin>
|
||||
<groupId>net.revelc.code</groupId>
|
||||
<artifactId>impsort-maven-plugin</artifactId>
|
||||
<version>1.4.1</version>
|
||||
<configuration>
|
||||
<groups>*,java.,javax.</groups>
|
||||
<removeUnused>true</removeUnused>
|
||||
<staticAfter>true</staticAfter>
|
||||
<java>
|
||||
<eclipse>
|
||||
<file>${basedir}/src/build/eclipse/formatter.xml</file>
|
||||
</eclipse>
|
||||
|
||||
<importOrder>
|
||||
<file>${basedir}/src/build/eclipse/eclipse.importorder</file>
|
||||
</importOrder>
|
||||
<removeUnusedImports />
|
||||
|
||||
<trimTrailingWhitespace />
|
||||
<endWithNewline />
|
||||
|
||||
</java>
|
||||
</configuration>
|
||||
<executions>
|
||||
<execution>
|
||||
<goals>
|
||||
<goal>${impsort-maven-plugin.goal}</goal>
|
||||
</goals>
|
||||
</execution>
|
||||
</executions>
|
||||
</plugin>
|
||||
<plugin>
|
||||
<groupId>com.github.spotbugs</groupId>
|
||||
@@ -386,6 +378,12 @@
|
||||
<artifactId>commons-lang3</artifactId>
|
||||
<version>3.9</version>
|
||||
</dependency>
|
||||
<dependency>
|
||||
<groupId>com.tngtech.archunit</groupId>
|
||||
<artifactId>archunit</artifactId>
|
||||
<version>0.17.0</version>
|
||||
<scope>test</scope>
|
||||
</dependency>
|
||||
<dependency>
|
||||
<groupId>org.hamcrest</groupId>
|
||||
<artifactId>hamcrest</artifactId>
|
||||
@@ -408,13 +406,19 @@
|
||||
<dependency>
|
||||
<groupId>junit</groupId>
|
||||
<artifactId>junit</artifactId>
|
||||
<version>4.13</version>
|
||||
<version>4.13.2</version>
|
||||
<scope>test</scope>
|
||||
</dependency>
|
||||
<dependency>
|
||||
<groupId>org.awaitility</groupId>
|
||||
<artifactId>awaitility</artifactId>
|
||||
<version>4.0.3</version>
|
||||
<scope>test</scope>
|
||||
</dependency>
|
||||
<dependency>
|
||||
<groupId>com.fasterxml.jackson.core</groupId>
|
||||
<artifactId>jackson-databind</artifactId>
|
||||
<version>2.10.2</version>
|
||||
<version>2.12.1</version>
|
||||
</dependency>
|
||||
<dependency>
|
||||
<groupId>commons-io</groupId>
|
||||
@@ -445,7 +449,7 @@
|
||||
<dependency>
|
||||
<groupId>org.kohsuke.stapler</groupId>
|
||||
<artifactId>stapler</artifactId>
|
||||
<version>1.259</version>
|
||||
<version>1.262</version>
|
||||
<scope>test</scope>
|
||||
</dependency>
|
||||
<dependency>
|
||||
@@ -457,9 +461,27 @@
|
||||
<dependency>
|
||||
<groupId>org.eclipse.jgit</groupId>
|
||||
<artifactId>org.eclipse.jgit</artifactId>
|
||||
<version>5.7.0.202003110725-r</version>
|
||||
<version>5.10.0.202012080955-r</version>
|
||||
<scope>test</scope>
|
||||
</dependency>
|
||||
<dependency>
|
||||
<groupId>io.jsonwebtoken</groupId>
|
||||
<artifactId>jjwt-api</artifactId>
|
||||
<version>${jjwt.suite.version}</version>
|
||||
<optional>true</optional>
|
||||
</dependency>
|
||||
<dependency>
|
||||
<groupId>io.jsonwebtoken</groupId>
|
||||
<artifactId>jjwt-impl</artifactId>
|
||||
<version>${jjwt.suite.version}</version>
|
||||
<optional>true</optional>
|
||||
</dependency>
|
||||
<dependency>
|
||||
<groupId>io.jsonwebtoken</groupId>
|
||||
<artifactId>jjwt-jackson</artifactId>
|
||||
<version>${jjwt.suite.version}</version>
|
||||
<optional>true</optional>
|
||||
</dependency>
|
||||
<dependency>
|
||||
<groupId>com.squareup.okio</groupId>
|
||||
<artifactId>okio</artifactId>
|
||||
@@ -495,7 +517,7 @@
|
||||
<dependency>
|
||||
<groupId>org.mockito</groupId>
|
||||
<artifactId>mockito-core</artifactId>
|
||||
<version>3.3.3</version>
|
||||
<version>3.7.7</version>
|
||||
<scope>test</scope>
|
||||
</dependency>
|
||||
<dependency>
|
||||
@@ -507,7 +529,7 @@
|
||||
<dependency>
|
||||
<groupId>com.github.tomakehurst</groupId>
|
||||
<artifactId>wiremock-jre8-standalone</artifactId>
|
||||
<version>2.26.3</version>
|
||||
<version>2.27.2</version>
|
||||
<scope>test</scope>
|
||||
</dependency>
|
||||
<dependency>
|
||||
@@ -516,6 +538,12 @@
|
||||
<version>2.8.6</version>
|
||||
<scope>test</scope>
|
||||
</dependency>
|
||||
<dependency>
|
||||
<groupId>org.slf4j</groupId>
|
||||
<artifactId>slf4j-simple</artifactId>
|
||||
<version>1.7.30</version>
|
||||
<scope>test</scope>
|
||||
</dependency>
|
||||
</dependencies>
|
||||
<repositories>
|
||||
<repository>
|
||||
@@ -530,6 +558,48 @@
|
||||
</pluginRepository>
|
||||
</pluginRepositories>
|
||||
<profiles>
|
||||
<!-- only enable slow-or-flaky-test if -Dtest= is not present -->
|
||||
<profile>
|
||||
<id>slow-or-flaky-test</id>
|
||||
<activation>
|
||||
<property>
|
||||
<name>!test</name>
|
||||
</property>
|
||||
</activation>
|
||||
<build>
|
||||
<plugins>
|
||||
<plugin>
|
||||
<artifactId>maven-surefire-plugin</artifactId>
|
||||
<executions>
|
||||
<execution>
|
||||
<id>slow-or-flaky-test</id>
|
||||
<phase>test</phase>
|
||||
<goals>
|
||||
<goal>test</goal>
|
||||
</goals>
|
||||
<configuration>
|
||||
<rerunFailingTestsCount>2</rerunFailingTestsCount>
|
||||
<!-- There are some tests that take longer or are a little
|
||||
flaky. Run them here. -->
|
||||
<includesFile>src/test/resources/slow-or-flaky-tests.txt</includesFile>
|
||||
<argLine>${surefire.argLine}</argLine>
|
||||
</configuration>
|
||||
</execution>
|
||||
</executions>
|
||||
</plugin>
|
||||
</plugins>
|
||||
</build>
|
||||
</profile>
|
||||
<profile>
|
||||
<id>jdk11+</id>
|
||||
<activation>
|
||||
<jdk>[11,)</jdk>
|
||||
</activation>
|
||||
<properties>
|
||||
<!-- this is required for GithubHttpUrlConnectionClient#setRequestMethod() to work with JDK 16+ -->
|
||||
<surefire.argLine>--add-opens java.base/java.net=ALL-UNNAMED</surefire.argLine>
|
||||
</properties>
|
||||
</profile>
|
||||
<profile>
|
||||
<id>ci-non-windows</id>
|
||||
<activation>
|
||||
@@ -541,8 +611,8 @@
|
||||
</os>
|
||||
</activation>
|
||||
<properties>
|
||||
<formatter-maven-plugin.goal>validate</formatter-maven-plugin.goal>
|
||||
<impsort-maven-plugin.goal>check</impsort-maven-plugin.goal>
|
||||
<!-- Only fail code coverage on non-windows machines -->
|
||||
<jacoco.haltOnFailure>true</jacoco.haltOnFailure>
|
||||
</properties>
|
||||
</profile>
|
||||
<profile>
|
||||
@@ -552,24 +622,31 @@
|
||||
<name>enable-ci</name>
|
||||
</property>
|
||||
</activation>
|
||||
<properties>
|
||||
<jacoco.haltOnFailure>true</jacoco.haltOnFailure>
|
||||
</properties>
|
||||
<build>
|
||||
<plugins>
|
||||
<plugin>
|
||||
<groupId>org.jacoco</groupId>
|
||||
<artifactId>jacoco-maven-plugin</artifactId>
|
||||
</plugin>
|
||||
<plugin>
|
||||
<groupId>com.diffplug.spotless</groupId>
|
||||
<artifactId>spotless-maven-plugin</artifactId>
|
||||
<executions>
|
||||
<execution>
|
||||
<id>spotless-check</id>
|
||||
<!-- In CI, run check early in the build -->
|
||||
<phase>process-sources</phase>
|
||||
<goals>
|
||||
<goal>check</goal>
|
||||
</goals>
|
||||
</execution>
|
||||
</executions>
|
||||
</plugin>
|
||||
</plugins>
|
||||
</build>
|
||||
</profile>
|
||||
<profile>
|
||||
<id>release</id>
|
||||
<properties>
|
||||
<formatter-maven-plugin.goal>validate</formatter-maven-plugin.goal>
|
||||
<impsort-maven-plugin.goal>check</impsort-maven-plugin.goal>
|
||||
</properties>
|
||||
<build>
|
||||
<plugins>
|
||||
<plugin>
|
||||
|
||||
6
src/build/eclipse/eclipse.importorder
Normal file
6
src/build/eclipse/eclipse.importorder
Normal file
@@ -0,0 +1,6 @@
|
||||
#Organize Import Order
|
||||
# Import this file in Window -> Preferences -> Java -> Code Style -> Organize Imports -> Import...
|
||||
0=
|
||||
1=java
|
||||
2=javax
|
||||
3=\#
|
||||
@@ -38,7 +38,7 @@ import javax.annotation.Nonnull;
|
||||
* Intermediate return type for this builder returned by calls to {@link #with(String, Object)}. If {@link S}
|
||||
* the same as {@link R}, this builder will commit changes after each call to {@link #with(String, Object)}.
|
||||
*/
|
||||
abstract class AbstractBuilder<R, S> {
|
||||
abstract class AbstractBuilder<R, S> extends GitHubInteractiveObject {
|
||||
|
||||
@Nonnull
|
||||
private final Class<R> returnType;
|
||||
@@ -75,6 +75,7 @@ abstract class AbstractBuilder<R, S> {
|
||||
@Nonnull Class<S> intermediateReturnType,
|
||||
@Nonnull GitHub root,
|
||||
@CheckForNull R baseInstance) {
|
||||
super(root);
|
||||
this.requester = root.createRequest();
|
||||
this.returnType = finalReturnType;
|
||||
this.commitChangesImmediately = returnType.equals(intermediateReturnType);
|
||||
@@ -97,7 +98,7 @@ abstract class AbstractBuilder<R, S> {
|
||||
* if there is an I/O Exception
|
||||
*/
|
||||
@Nonnull
|
||||
@Preview
|
||||
@BetaApi
|
||||
@Deprecated
|
||||
public R done() throws IOException {
|
||||
R result;
|
||||
@@ -127,7 +128,7 @@ abstract class AbstractBuilder<R, S> {
|
||||
* if an I/O error occurs
|
||||
*/
|
||||
@Nonnull
|
||||
@Preview
|
||||
@BetaApi
|
||||
@Deprecated
|
||||
protected S with(@Nonnull String name, Object value) throws IOException {
|
||||
requester.with(name, value);
|
||||
@@ -148,7 +149,7 @@ abstract class AbstractBuilder<R, S> {
|
||||
* if an I/O error occurs
|
||||
*/
|
||||
@Nonnull
|
||||
@Preview
|
||||
@BetaApi
|
||||
@Deprecated
|
||||
protected S continueOrDone() throws IOException {
|
||||
// This little bit of roughness in this base class means all inheriting builders get to create Updater and
|
||||
|
||||
18
src/main/java/org/kohsuke/github/BetaApi.java
Normal file
18
src/main/java/org/kohsuke/github/BetaApi.java
Normal file
@@ -0,0 +1,18 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import java.lang.annotation.Documented;
|
||||
import java.lang.annotation.Retention;
|
||||
import java.lang.annotation.RetentionPolicy;
|
||||
|
||||
/**
|
||||
* Indicates that the method/class/etc marked is a beta implementation of an sdk feature.
|
||||
* <p>
|
||||
* These APIs are subject to change and not a part of the backward compatibility commitment. Always used in conjunction
|
||||
* with 'deprecated' to raise awareness to clients.
|
||||
* </p>
|
||||
*
|
||||
*/
|
||||
@Retention(RetentionPolicy.RUNTIME)
|
||||
@Documented
|
||||
public @interface BetaApi {
|
||||
}
|
||||
@@ -5,7 +5,7 @@ import java.net.URL;
|
||||
import java.util.List;
|
||||
import java.util.Map;
|
||||
|
||||
import static org.kohsuke.github.Previews.MACHINE_MAN;
|
||||
import static org.kohsuke.github.internal.Previews.MACHINE_MAN;
|
||||
|
||||
/**
|
||||
* A Github App.
|
||||
@@ -15,7 +15,6 @@ import static org.kohsuke.github.Previews.MACHINE_MAN;
|
||||
*/
|
||||
public class GHApp extends GHObject {
|
||||
|
||||
private GitHub root;
|
||||
private GHUser owner;
|
||||
private String name;
|
||||
private String description;
|
||||
@@ -189,7 +188,7 @@ public class GHApp extends GHObject {
|
||||
* @return a list of App installations
|
||||
* @see <a href="https://developer.github.com/v3/apps/#list-installations">List installations</a>
|
||||
*/
|
||||
@Preview
|
||||
@Preview(MACHINE_MAN)
|
||||
@Deprecated
|
||||
public PagedIterable<GHAppInstallation> listInstallations() {
|
||||
return root.createRequest()
|
||||
@@ -210,7 +209,7 @@ public class GHApp extends GHObject {
|
||||
* on error
|
||||
* @see <a href="https://developer.github.com/v3/apps/#get-an-installation">Get an installation</a>
|
||||
*/
|
||||
@Preview
|
||||
@Preview(MACHINE_MAN)
|
||||
@Deprecated
|
||||
public GHAppInstallation getInstallationById(long id) throws IOException {
|
||||
return root.createRequest()
|
||||
@@ -233,7 +232,7 @@ public class GHApp extends GHObject {
|
||||
* @see <a href="https://developer.github.com/v3/apps/#get-an-organization-installation">Get an organization
|
||||
* installation</a>
|
||||
*/
|
||||
@Preview
|
||||
@Preview(MACHINE_MAN)
|
||||
@Deprecated
|
||||
public GHAppInstallation getInstallationByOrganization(String name) throws IOException {
|
||||
return root.createRequest()
|
||||
@@ -258,7 +257,7 @@ public class GHApp extends GHObject {
|
||||
* @see <a href="https://developer.github.com/v3/apps/#get-a-repository-installation">Get a repository
|
||||
* installation</a>
|
||||
*/
|
||||
@Preview
|
||||
@Preview(MACHINE_MAN)
|
||||
@Deprecated
|
||||
public GHAppInstallation getInstallationByRepository(String ownerName, String repositoryName) throws IOException {
|
||||
return root.createRequest()
|
||||
@@ -280,7 +279,7 @@ public class GHApp extends GHObject {
|
||||
* on error
|
||||
* @see <a href="https://developer.github.com/v3/apps/#get-a-user-installation">Get a user installation</a>
|
||||
*/
|
||||
@Preview
|
||||
@Preview(MACHINE_MAN)
|
||||
@Deprecated
|
||||
public GHAppInstallation getInstallationByUser(String name) throws IOException {
|
||||
return root.createRequest()
|
||||
|
||||
@@ -5,7 +5,7 @@ import java.util.HashMap;
|
||||
import java.util.List;
|
||||
import java.util.Map;
|
||||
|
||||
import static org.kohsuke.github.Previews.MACHINE_MAN;
|
||||
import static org.kohsuke.github.internal.Previews.MACHINE_MAN;
|
||||
|
||||
/**
|
||||
* Creates a access token for a GitHub App Installation
|
||||
@@ -14,12 +14,11 @@ import static org.kohsuke.github.Previews.MACHINE_MAN;
|
||||
* @see GHAppInstallation#createToken(Map) GHAppInstallation#createToken(Map)
|
||||
* @see GHAppInstallation#createToken() GHAppInstallation#createToken()
|
||||
*/
|
||||
public class GHAppCreateTokenBuilder {
|
||||
private final GitHub root;
|
||||
public class GHAppCreateTokenBuilder extends GitHubInteractiveObject {
|
||||
protected final Requester builder;
|
||||
private final String apiUrlTail;
|
||||
|
||||
@Preview
|
||||
@BetaApi
|
||||
@Deprecated
|
||||
GHAppCreateTokenBuilder(GitHub root, String apiUrlTail) {
|
||||
this.root = root;
|
||||
@@ -27,7 +26,7 @@ public class GHAppCreateTokenBuilder {
|
||||
this.builder = root.createRequest();
|
||||
}
|
||||
|
||||
@Preview
|
||||
@BetaApi
|
||||
@Deprecated
|
||||
GHAppCreateTokenBuilder(GitHub root, String apiUrlTail, Map<String, GHPermissionType> permissions) {
|
||||
this(root, apiUrlTail);
|
||||
@@ -43,7 +42,7 @@ public class GHAppCreateTokenBuilder {
|
||||
* Array containing the repositories Ids
|
||||
* @return a GHAppCreateTokenBuilder
|
||||
*/
|
||||
@Preview
|
||||
@BetaApi
|
||||
@Deprecated
|
||||
public GHAppCreateTokenBuilder repositoryIds(List<Long> repositoryIds) {
|
||||
this.builder.with("repository_ids", repositoryIds);
|
||||
@@ -58,7 +57,7 @@ public class GHAppCreateTokenBuilder {
|
||||
* Map containing the permission names and types.
|
||||
* @return a GHAppCreateTokenBuilder
|
||||
*/
|
||||
@Preview
|
||||
@BetaApi
|
||||
@Deprecated
|
||||
public GHAppCreateTokenBuilder permissions(Map<String, GHPermissionType> permissions) {
|
||||
Map<String, String> retMap = new HashMap<>();
|
||||
@@ -78,7 +77,7 @@ public class GHAppCreateTokenBuilder {
|
||||
* @throws IOException
|
||||
* on error
|
||||
*/
|
||||
@Preview
|
||||
@Preview(MACHINE_MAN)
|
||||
@Deprecated
|
||||
public GHAppInstallationToken create() throws IOException {
|
||||
return builder.method("POST")
|
||||
|
||||
@@ -3,11 +3,13 @@ package org.kohsuke.github;
|
||||
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||
|
||||
import java.io.IOException;
|
||||
import java.net.MalformedURLException;
|
||||
import java.net.URL;
|
||||
import java.util.List;
|
||||
import java.util.Map;
|
||||
|
||||
import static org.kohsuke.github.Previews.GAMBIT;
|
||||
import static org.kohsuke.github.internal.Previews.GAMBIT;
|
||||
import static org.kohsuke.github.internal.Previews.MACHINE_MAN;
|
||||
|
||||
/**
|
||||
* A Github App Installation.
|
||||
@@ -20,7 +22,6 @@ import static org.kohsuke.github.Previews.GAMBIT;
|
||||
* @see GHApp#getInstallationByUser(String) GHApp#getInstallationByUser(String)
|
||||
*/
|
||||
public class GHAppInstallation extends GHObject {
|
||||
private GitHub root;
|
||||
private GHUser account;
|
||||
|
||||
@JsonProperty("access_tokens_url")
|
||||
@@ -117,6 +118,36 @@ public class GHAppInstallation extends GHObject {
|
||||
return repositoriesUrl;
|
||||
}
|
||||
|
||||
/**
|
||||
* List repositories that this app installation can access.
|
||||
*
|
||||
* @return the paged iterable
|
||||
*/
|
||||
@Preview(MACHINE_MAN)
|
||||
@Deprecated
|
||||
public PagedSearchIterable<GHRepository> listRepositories() {
|
||||
GitHubRequest request;
|
||||
|
||||
try {
|
||||
request = root.createRequest().withPreview(MACHINE_MAN).withUrlPath("/installation/repositories").build();
|
||||
} catch (MalformedURLException e) {
|
||||
throw new GHException("", e);
|
||||
}
|
||||
|
||||
return new PagedSearchIterable<>(root, request, GHAppInstallationRepositoryResult.class);
|
||||
}
|
||||
|
||||
private static class GHAppInstallationRepositoryResult extends SearchResult<GHRepository> {
|
||||
private GHRepository[] repositories;
|
||||
|
||||
@Override
|
||||
GHRepository[] getItems(GitHub root) {
|
||||
for (GHRepository item : repositories)
|
||||
item.wrap(root);
|
||||
return repositories;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Sets repositories url.
|
||||
*
|
||||
@@ -290,7 +321,7 @@ public class GHAppInstallation extends GHObject {
|
||||
* on error
|
||||
* @see <a href="https://developer.github.com/v3/apps/#delete-an-installation">Delete an installation</a>
|
||||
*/
|
||||
@Preview
|
||||
@Preview(GAMBIT)
|
||||
@Deprecated
|
||||
public void deleteInstallation() throws IOException {
|
||||
root.createRequest()
|
||||
@@ -312,7 +343,7 @@ public class GHAppInstallation extends GHObject {
|
||||
* @return a GHAppCreateTokenBuilder instance
|
||||
* @deprecated Use {@link GHAppInstallation#createToken()} instead.
|
||||
*/
|
||||
@Preview
|
||||
@BetaApi
|
||||
@Deprecated
|
||||
public GHAppCreateTokenBuilder createToken(Map<String, GHPermissionType> permissions) {
|
||||
return new GHAppCreateTokenBuilder(root,
|
||||
@@ -329,7 +360,7 @@ public class GHAppInstallation extends GHObject {
|
||||
*
|
||||
* @return a GHAppCreateTokenBuilder instance
|
||||
*/
|
||||
@Preview
|
||||
@BetaApi
|
||||
@Deprecated
|
||||
public GHAppCreateTokenBuilder createToken() {
|
||||
return new GHAppCreateTokenBuilder(root, String.format("/app/installations/%d/access_tokens", getId()));
|
||||
|
||||
@@ -14,9 +14,7 @@ import java.util.Map;
|
||||
* @author Paulo Miguel Almeida
|
||||
* @see GHAppInstallation#createToken(Map) GHAppInstallation#createToken(Map)
|
||||
*/
|
||||
public class GHAppInstallationToken {
|
||||
private GitHub root;
|
||||
|
||||
public class GHAppInstallationToken extends GitHubInteractiveObject {
|
||||
private String token;
|
||||
protected String expires_at;
|
||||
private Map<String, String> permissions;
|
||||
|
||||
@@ -9,7 +9,6 @@ import java.net.URL;
|
||||
* @see GHRelease#getAssets() GHRelease#getAssets()
|
||||
*/
|
||||
public class GHAsset extends GHObject {
|
||||
GitHub root;
|
||||
GHRepository owner;
|
||||
private String name;
|
||||
private String label;
|
||||
|
||||
@@ -33,7 +33,6 @@ public class GHAuthorization extends GHObject {
|
||||
public static final String WRITE_KEY = "write:public_key";
|
||||
public static final String ADMIN_KEY = "admin:public_key";
|
||||
|
||||
private GitHub root;
|
||||
private List<String> scopes;
|
||||
private String token;
|
||||
private String token_last_eight;
|
||||
|
||||
@@ -3,12 +3,15 @@ package org.kohsuke.github;
|
||||
import com.fasterxml.jackson.annotation.JsonCreator;
|
||||
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||
import org.kohsuke.github.internal.Previews;
|
||||
|
||||
import java.io.IOException;
|
||||
import java.net.URL;
|
||||
import java.util.Collection;
|
||||
import java.util.Objects;
|
||||
|
||||
import javax.annotation.CheckForNull;
|
||||
|
||||
/**
|
||||
* A branch in a repository.
|
||||
*
|
||||
@@ -18,8 +21,7 @@ import java.util.Objects;
|
||||
value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD",
|
||||
"URF_UNREAD_FIELD" },
|
||||
justification = "JSON API")
|
||||
public class GHBranch {
|
||||
private GitHub root;
|
||||
public class GHBranch extends GitHubInteractiveObject {
|
||||
private GHRepository owner;
|
||||
|
||||
private String name;
|
||||
@@ -76,7 +78,7 @@ public class GHBranch {
|
||||
*
|
||||
* @return true if the push to this branch is restricted via branch protection.
|
||||
*/
|
||||
@Preview
|
||||
@Preview(Previews.LUKE_CAGE)
|
||||
@Deprecated
|
||||
public boolean isProtected() {
|
||||
return protection;
|
||||
@@ -87,7 +89,7 @@ public class GHBranch {
|
||||
*
|
||||
* @return API URL that deals with the protection of this branch.
|
||||
*/
|
||||
@Preview
|
||||
@Preview(Previews.LUKE_CAGE)
|
||||
@Deprecated
|
||||
public URL getProtectionUrl() {
|
||||
return GitHubClient.parseURL(protection_url);
|
||||
@@ -100,8 +102,14 @@ public class GHBranch {
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
@Preview(Previews.LUKE_CAGE)
|
||||
@Deprecated
|
||||
public GHBranchProtection getProtection() throws IOException {
|
||||
return root.createRequest().setRawUrlPath(protection_url).fetch(GHBranchProtection.class).wrap(this);
|
||||
return root.createRequest()
|
||||
.withPreview(Previews.LUKE_CAGE)
|
||||
.setRawUrlPath(protection_url)
|
||||
.fetch(GHBranchProtection.class)
|
||||
.wrap(this);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -129,7 +137,7 @@ public class GHBranch {
|
||||
* @return GHBranchProtectionBuilder for enabling protection
|
||||
* @see GHCommitStatus#getContext() GHCommitStatus#getContext()
|
||||
*/
|
||||
@Preview
|
||||
@Preview(Previews.LUKE_CAGE)
|
||||
@Deprecated
|
||||
public GHBranchProtectionBuilder enableProtection() {
|
||||
return new GHBranchProtectionBuilder(this);
|
||||
@@ -161,6 +169,59 @@ public class GHBranch {
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Merge a branch into this branch.
|
||||
*
|
||||
* @param headBranch
|
||||
* the branch whose head will be merged
|
||||
*
|
||||
* @param commitMessage
|
||||
* the commit message
|
||||
*
|
||||
* @return the merge {@link GHCommit} created, or {@code null} if the base already contains the head (nothing to
|
||||
* merge).
|
||||
*
|
||||
* @throws IOException
|
||||
* if merging fails
|
||||
*/
|
||||
@CheckForNull
|
||||
public GHCommit merge(GHBranch headBranch, String commitMessage) throws IOException {
|
||||
return merge(headBranch.getName(), commitMessage);
|
||||
}
|
||||
|
||||
/**
|
||||
* Merge a ref into this branch.
|
||||
*
|
||||
* @param head
|
||||
* the ref name that will be merged into this branch. Follows the usual ref naming rules, could be a
|
||||
* branch name, tag, or commit sha.
|
||||
*
|
||||
* @param commitMessage
|
||||
* the commit message
|
||||
*
|
||||
* @return the merge {@link GHCommit} created, or {@code null} if the base already contains the head (nothing to
|
||||
* merge).
|
||||
*
|
||||
* @throws IOException
|
||||
* if merging fails
|
||||
*/
|
||||
@CheckForNull
|
||||
public GHCommit merge(String head, String commitMessage) throws IOException {
|
||||
GHCommit result = root.createRequest()
|
||||
.withUrlPath(owner.getApiTailUrl("merges"))
|
||||
.method("POST")
|
||||
.with("commit_message", commitMessage)
|
||||
.with("base", this.name)
|
||||
.with("head", head)
|
||||
.fetch(GHCommit.class);
|
||||
|
||||
if (result != null) {
|
||||
result.wrapUp(owner);
|
||||
}
|
||||
|
||||
return result;
|
||||
}
|
||||
|
||||
String getApiRoute() {
|
||||
return owner.getApiTailUrl("/branches/" + name);
|
||||
}
|
||||
|
||||
@@ -6,23 +6,23 @@ import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||
import java.io.IOException;
|
||||
import java.util.Collection;
|
||||
|
||||
import static org.kohsuke.github.Previews.ZZZAX;
|
||||
import static org.kohsuke.github.internal.Previews.ZZZAX;
|
||||
|
||||
/**
|
||||
* The type GHBranchProtection.
|
||||
*
|
||||
* @see <a href="https://docs.github.com/en/rest/reference/repos#get-branch-protection">GitHub Branch Protection</a>
|
||||
*/
|
||||
@SuppressFBWarnings(
|
||||
value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD",
|
||||
"URF_UNREAD_FIELD" },
|
||||
justification = "JSON API")
|
||||
public class GHBranchProtection {
|
||||
public class GHBranchProtection extends GitHubInteractiveObject {
|
||||
private static final String REQUIRE_SIGNATURES_URI = "/required_signatures";
|
||||
|
||||
@JsonProperty
|
||||
private EnforceAdmins enforceAdmins;
|
||||
|
||||
private GitHub root;
|
||||
|
||||
@JsonProperty("required_pull_request_reviews")
|
||||
private RequiredReviews requiredReviews;
|
||||
|
||||
@@ -41,7 +41,7 @@ public class GHBranchProtection {
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
@Preview
|
||||
@Preview(ZZZAX)
|
||||
@Deprecated
|
||||
public void enabledSignedCommits() throws IOException {
|
||||
requester().method("POST").withUrlPath(url + REQUIRE_SIGNATURES_URI).fetch(RequiredSignatures.class);
|
||||
@@ -53,7 +53,7 @@ public class GHBranchProtection {
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
@Preview
|
||||
@Preview(ZZZAX)
|
||||
@Deprecated
|
||||
public void disableSignedCommits() throws IOException {
|
||||
requester().method("DELETE").withUrlPath(url + REQUIRE_SIGNATURES_URI).send();
|
||||
@@ -84,7 +84,7 @@ public class GHBranchProtection {
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
@Preview
|
||||
@Preview(ZZZAX)
|
||||
@Deprecated
|
||||
public boolean getRequiredSignatures() throws IOException {
|
||||
return requester().withUrlPath(url + REQUIRE_SIGNATURES_URI).fetch(RequiredSignatures.class).enabled;
|
||||
|
||||
@@ -12,7 +12,7 @@ import java.util.List;
|
||||
import java.util.Map;
|
||||
import java.util.Set;
|
||||
|
||||
import static org.kohsuke.github.Previews.*;
|
||||
import static org.kohsuke.github.internal.Previews.LUKE_CAGE;
|
||||
|
||||
/**
|
||||
* Builder to configure the branch protection settings.
|
||||
|
||||
@@ -1,10 +1,21 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||
import com.infradna.tool.bridge_method_injector.WithBridgeMethods;
|
||||
import edu.umd.cs.findbugs.annotations.NonNull;
|
||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||
import org.kohsuke.github.GHWorkflowRun.Conclusion;
|
||||
import org.kohsuke.github.GHWorkflowRun.Status;
|
||||
import org.kohsuke.github.internal.EnumUtils;
|
||||
import org.kohsuke.github.internal.Previews;
|
||||
|
||||
import java.io.IOException;
|
||||
import java.net.URL;
|
||||
import java.util.Arrays;
|
||||
import java.util.Collections;
|
||||
import java.util.Date;
|
||||
import java.util.List;
|
||||
import java.util.Locale;
|
||||
|
||||
/**
|
||||
* Represents a check run.
|
||||
@@ -14,8 +25,9 @@ import java.util.Date;
|
||||
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD", "URF_UNREAD_FIELD" },
|
||||
justification = "JSON API")
|
||||
public class GHCheckRun extends GHObject {
|
||||
|
||||
@JsonProperty("repository")
|
||||
GHRepository owner;
|
||||
GitHub root;
|
||||
|
||||
private String status;
|
||||
private String conclusion;
|
||||
@@ -34,7 +46,7 @@ public class GHCheckRun extends GHObject {
|
||||
|
||||
GHCheckRun wrap(GHRepository owner) {
|
||||
this.owner = owner;
|
||||
this.root = owner.root;
|
||||
wrap(owner.root);
|
||||
return this;
|
||||
}
|
||||
|
||||
@@ -42,7 +54,24 @@ public class GHCheckRun extends GHObject {
|
||||
this.root = root;
|
||||
if (owner != null) {
|
||||
owner.wrap(root);
|
||||
if (pullRequests != null && pullRequests.length != 0) {
|
||||
for (GHPullRequest singlePull : pullRequests) {
|
||||
singlePull.wrap(owner);
|
||||
}
|
||||
}
|
||||
|
||||
}
|
||||
if (checkSuite != null) {
|
||||
if (owner != null) {
|
||||
checkSuite.wrap(owner);
|
||||
} else {
|
||||
checkSuite.wrap(root);
|
||||
}
|
||||
}
|
||||
if (app != null) {
|
||||
app.wrapUp(root);
|
||||
}
|
||||
|
||||
return this;
|
||||
}
|
||||
|
||||
@@ -56,12 +85,27 @@ public class GHCheckRun extends GHObject {
|
||||
* @return Status of the check run
|
||||
* @see Status
|
||||
*/
|
||||
public String getStatus() {
|
||||
@WithBridgeMethods(value = String.class, adapterMethod = "statusAsStr")
|
||||
public Status getStatus() {
|
||||
return Status.from(status);
|
||||
}
|
||||
|
||||
@SuppressFBWarnings(value = "UPM_UNCALLED_PRIVATE_METHOD", justification = "Bridge method of getStatus")
|
||||
private Object statusAsStr(Status status, Class type) {
|
||||
return status;
|
||||
}
|
||||
|
||||
public static enum Status {
|
||||
QUEUED, IN_PROGRESS, COMPLETED
|
||||
QUEUED, IN_PROGRESS, COMPLETED, UNKNOWN;
|
||||
|
||||
public static Status from(String value) {
|
||||
return EnumUtils.getNullableEnumOrDefault(Status.class, value, Status.UNKNOWN);
|
||||
}
|
||||
|
||||
@Override
|
||||
public String toString() {
|
||||
return name().toLowerCase(Locale.ROOT);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -70,12 +114,33 @@ public class GHCheckRun extends GHObject {
|
||||
* @return Status of the check run
|
||||
* @see Conclusion
|
||||
*/
|
||||
public String getConclusion() {
|
||||
@WithBridgeMethods(value = String.class, adapterMethod = "conclusionAsStr")
|
||||
public Conclusion getConclusion() {
|
||||
return Conclusion.from(conclusion);
|
||||
}
|
||||
|
||||
@SuppressFBWarnings(value = "UPM_UNCALLED_PRIVATE_METHOD", justification = "Bridge method of getConclusion")
|
||||
private Object conclusionAsStr(Conclusion conclusion, Class type) {
|
||||
return conclusion;
|
||||
}
|
||||
|
||||
/**
|
||||
* Final conclusion of the check.
|
||||
*
|
||||
* From <a href="https://docs.github.com/en/rest/reference/checks#create-a-check-run--parameters">Check Run
|
||||
* Parameters - <code>conclusion</code></a>.
|
||||
*/
|
||||
public static enum Conclusion {
|
||||
SUCCESS, FAILURE, NEUTRAL, CANCELLED, TIMED_OUT, ACTION_REQUIRED
|
||||
ACTION_REQUIRED, CANCELLED, FAILURE, NEUTRAL, SUCCESS, SKIPPED, STALE, TIMED_OUT, UNKNOWN;
|
||||
|
||||
public static Conclusion from(String value) {
|
||||
return EnumUtils.getNullableEnumOrDefault(Conclusion.class, value, Conclusion.UNKNOWN);
|
||||
}
|
||||
|
||||
@Override
|
||||
public String toString() {
|
||||
return name().toLowerCase(Locale.ROOT);
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -99,15 +164,22 @@ public class GHCheckRun extends GHObject {
|
||||
/**
|
||||
* Gets the pull requests participated in this check run.
|
||||
*
|
||||
* @return Pull requests of this check run
|
||||
* Note this field is only populated for events. When getting a {@link GHCheckRun} outside of an event, this is
|
||||
* always empty.
|
||||
*
|
||||
* @return the list of {@link GHPullRequest}s for this check run. Only populated for events.
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
GHPullRequest[] getPullRequests() throws IOException {
|
||||
public List<GHPullRequest> getPullRequests() throws IOException {
|
||||
if (pullRequests != null && pullRequests.length != 0) {
|
||||
for (GHPullRequest singlePull : pullRequests) {
|
||||
singlePull.refresh();
|
||||
// Only refresh if we haven't do so before
|
||||
singlePull.refresh(singlePull.getTitle());
|
||||
}
|
||||
return Collections.unmodifiableList(Arrays.asList(pullRequests));
|
||||
}
|
||||
return pullRequests;
|
||||
return Collections.emptyList();
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -256,4 +328,15 @@ public class GHCheckRun extends GHObject {
|
||||
NOTICE, WARNING, FAILURE
|
||||
}
|
||||
|
||||
/**
|
||||
* Updates this check run.
|
||||
*
|
||||
* @return a builder which you should customize, then call {@link GHCheckRunBuilder#create}
|
||||
*/
|
||||
@Preview(Previews.ANTIOPE)
|
||||
@Deprecated
|
||||
public @NonNull GHCheckRunBuilder update() {
|
||||
return new GHCheckRunBuilder(owner, getId());
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
@@ -28,6 +28,7 @@ import com.fasterxml.jackson.annotation.JsonInclude;
|
||||
import edu.umd.cs.findbugs.annotations.CheckForNull;
|
||||
import edu.umd.cs.findbugs.annotations.NonNull;
|
||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||
import org.kohsuke.github.internal.Previews;
|
||||
|
||||
import java.io.IOException;
|
||||
import java.util.Collections;
|
||||
@@ -37,30 +38,45 @@ import java.util.List;
|
||||
import java.util.Locale;
|
||||
|
||||
/**
|
||||
* Drafts a check run.
|
||||
* Drafts or updates a check run.
|
||||
*
|
||||
* @see GHCheckRun
|
||||
* @see GHRepository#createCheckRun
|
||||
* @see <a href="https://developer.github.com/v3/checks/runs/#create-a-check-run">documentation</a>
|
||||
* @see GHCheckRun#update()
|
||||
* @see <a href="https://developer.github.com/v3/checks/runs/#update-a-check-run">documentation</a>
|
||||
*/
|
||||
@SuppressFBWarnings(value = "URF_UNREAD_FIELD", justification = "Jackson serializes these even without a getter")
|
||||
@Preview
|
||||
@Preview(Previews.ANTIOPE)
|
||||
@Deprecated
|
||||
public final class GHCheckRunBuilder {
|
||||
|
||||
private final GHRepository repo;
|
||||
private final Requester requester;
|
||||
protected final GHRepository repo;
|
||||
protected final Requester requester;
|
||||
private Output output;
|
||||
private List<Action> actions;
|
||||
|
||||
GHCheckRunBuilder(GHRepository repo, String name, String headSHA) {
|
||||
private GHCheckRunBuilder(GHRepository repo, Requester requester) {
|
||||
this.repo = repo;
|
||||
requester = repo.root.createRequest()
|
||||
.withPreview(Previews.ANTIOPE)
|
||||
.method("POST")
|
||||
.with("name", name)
|
||||
.with("head_sha", headSHA)
|
||||
.withUrlPath(repo.getApiTailUrl("check-runs"));
|
||||
this.requester = requester;
|
||||
}
|
||||
|
||||
GHCheckRunBuilder(GHRepository repo, String name, String headSHA) {
|
||||
this(repo,
|
||||
repo.root.createRequest()
|
||||
.withPreview(Previews.ANTIOPE)
|
||||
.method("POST")
|
||||
.with("name", name)
|
||||
.with("head_sha", headSHA)
|
||||
.withUrlPath(repo.getApiTailUrl("check-runs")));
|
||||
}
|
||||
|
||||
GHCheckRunBuilder(GHRepository repo, long checkId) {
|
||||
this(repo,
|
||||
repo.root.createRequest()
|
||||
.withPreview(Previews.ANTIOPE)
|
||||
.method("PATCH")
|
||||
.withUrlPath(repo.getApiTailUrl("check-runs/" + checkId)));
|
||||
}
|
||||
|
||||
public @NonNull GHCheckRunBuilder withDetailsURL(@CheckForNull String detailsURL) {
|
||||
@@ -136,7 +152,7 @@ public final class GHCheckRunBuilder {
|
||||
}
|
||||
GHCheckRun run = requester.with("output", output).with("actions", actions).fetch(GHCheckRun.class).wrap(repo);
|
||||
while (!extraAnnotations.isEmpty()) {
|
||||
Output output2 = new Output(output.title, output.summary);
|
||||
Output output2 = new Output(output.title, output.summary).withText(output.text);
|
||||
int i = Math.min(extraAnnotations.size(), MAX_ANNOTATIONS);
|
||||
output2.annotations = extraAnnotations.subList(0, i);
|
||||
extraAnnotations = extraAnnotations.subList(i, extraAnnotations.size());
|
||||
|
||||
@@ -8,7 +8,7 @@ import javax.annotation.Nonnull;
|
||||
* Iterable for check-runs listing.
|
||||
*/
|
||||
class GHCheckRunsIterable extends PagedIterable<GHCheckRun> {
|
||||
private GitHub root;
|
||||
private final transient GitHub root;
|
||||
private final GitHubRequest request;
|
||||
|
||||
private GHCheckRunsPage result;
|
||||
|
||||
@@ -1,10 +1,14 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||
|
||||
import java.io.IOException;
|
||||
import java.net.URL;
|
||||
import java.util.Arrays;
|
||||
import java.util.Collections;
|
||||
import java.util.Date;
|
||||
import java.util.List;
|
||||
|
||||
/**
|
||||
* Represents a check suite.
|
||||
@@ -14,8 +18,9 @@ import java.util.Date;
|
||||
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD", "URF_UNREAD_FIELD" },
|
||||
justification = "JSON API")
|
||||
public class GHCheckSuite extends GHObject {
|
||||
|
||||
@JsonProperty("repository")
|
||||
GHRepository owner;
|
||||
GitHub root;
|
||||
|
||||
private String nodeId;
|
||||
private String headBranch;
|
||||
@@ -32,7 +37,7 @@ public class GHCheckSuite extends GHObject {
|
||||
|
||||
GHCheckSuite wrap(GHRepository owner) {
|
||||
this.owner = owner;
|
||||
this.root = owner.root;
|
||||
this.wrap(owner.root);
|
||||
return this;
|
||||
}
|
||||
|
||||
@@ -40,6 +45,14 @@ public class GHCheckSuite extends GHObject {
|
||||
this.root = root;
|
||||
if (owner != null) {
|
||||
owner.wrap(root);
|
||||
if (pullRequests != null && pullRequests.length != 0) {
|
||||
for (GHPullRequest singlePull : pullRequests) {
|
||||
singlePull.wrap(owner);
|
||||
}
|
||||
}
|
||||
}
|
||||
if (app != null) {
|
||||
app.wrapUp(root);
|
||||
}
|
||||
return this;
|
||||
}
|
||||
@@ -153,15 +166,22 @@ public class GHCheckSuite extends GHObject {
|
||||
/**
|
||||
* Gets the pull requests participated in this check suite.
|
||||
*
|
||||
* @return Pull requests
|
||||
* Note this field is only populated for events. When getting a {@link GHCheckSuite} outside of an event, this is
|
||||
* always empty.
|
||||
*
|
||||
* @return the list of {@link GHPullRequest}s for this check suite. Only populated for events.
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
GHPullRequest[] getPullRequests() throws IOException {
|
||||
public List<GHPullRequest> getPullRequests() throws IOException {
|
||||
if (pullRequests != null && pullRequests.length != 0) {
|
||||
for (GHPullRequest singlePull : pullRequests) {
|
||||
singlePull.refresh();
|
||||
// Only refresh if we haven't do so before
|
||||
singlePull.refresh(singlePull.getTitle());
|
||||
}
|
||||
return Collections.unmodifiableList(Arrays.asList(pullRequests));
|
||||
}
|
||||
return pullRequests;
|
||||
return Collections.emptyList();
|
||||
}
|
||||
|
||||
/**
|
||||
|
||||
@@ -11,6 +11,9 @@ import java.util.Collections;
|
||||
import java.util.Date;
|
||||
import java.util.List;
|
||||
|
||||
import static org.kohsuke.github.internal.Previews.ANTIOPE;
|
||||
import static org.kohsuke.github.internal.Previews.GROOT;
|
||||
|
||||
/**
|
||||
* A commit in a repository.
|
||||
*
|
||||
@@ -63,7 +66,7 @@ public class GHCommit {
|
||||
* @return the authored date
|
||||
*/
|
||||
public Date getAuthoredDate() {
|
||||
return GitHubClient.parseDate(author.date);
|
||||
return author.getDate();
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -82,7 +85,7 @@ public class GHCommit {
|
||||
* @return the commit date
|
||||
*/
|
||||
public Date getCommitDate() {
|
||||
return GitHubClient.parseDate(committer.date);
|
||||
return committer.getDate();
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -119,7 +122,6 @@ public class GHCommit {
|
||||
* @deprecated Use {@link GitUser} instead.
|
||||
*/
|
||||
public static class GHAuthor extends GitUser {
|
||||
private String date;
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -446,6 +448,39 @@ public class GHCommit {
|
||||
return owner.root.getUser(author.login);
|
||||
}
|
||||
|
||||
/**
|
||||
* Retrieves a list of pull requests which contain this commit.
|
||||
*
|
||||
* @return {@link PagedIterable} with the pull requests which contain this commit
|
||||
*/
|
||||
@Preview(GROOT)
|
||||
@Deprecated
|
||||
public PagedIterable<GHPullRequest> listPullRequests() {
|
||||
return owner.root.createRequest()
|
||||
.withPreview(GROOT)
|
||||
.withUrlPath(String.format("/repos/%s/%s/commits/%s/pulls", owner.getOwnerName(), owner.getName(), sha))
|
||||
.toIterable(GHPullRequest[].class, item -> item.wrapUp(owner));
|
||||
}
|
||||
|
||||
/**
|
||||
* Retrieves a list of branches where this commit is the head commit.
|
||||
*
|
||||
* @return {@link PagedIterable} with the branches where the commit is the head commit
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
@Preview(GROOT)
|
||||
@Deprecated
|
||||
public PagedIterable<GHBranch> listBranchesWhereHead() throws IOException {
|
||||
return owner.root.createRequest()
|
||||
.withPreview(GROOT)
|
||||
.withUrlPath(String.format("/repos/%s/%s/commits/%s/branches-where-head",
|
||||
owner.getOwnerName(),
|
||||
owner.getName(),
|
||||
sha))
|
||||
.toIterable(GHBranch[].class, item -> item.wrap(owner));
|
||||
}
|
||||
|
||||
/**
|
||||
* List comments paged iterable.
|
||||
*
|
||||
@@ -530,7 +565,7 @@ public class GHCommit {
|
||||
* @throws IOException
|
||||
* on error
|
||||
*/
|
||||
@Preview
|
||||
@Preview(ANTIOPE)
|
||||
@Deprecated
|
||||
public PagedIterable<GHCheckRun> getCheckRuns() throws IOException {
|
||||
return owner.getCheckRuns(sha);
|
||||
|
||||
@@ -89,6 +89,19 @@ public class GHCommitBuilder {
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Configures the PGP signature of this commit.
|
||||
*
|
||||
* @param signature
|
||||
* the signature calculated from the commit
|
||||
*
|
||||
* @return the gh commit builder
|
||||
*/
|
||||
public GHCommitBuilder withSignature(String signature) {
|
||||
req.with("signature", signature);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Configures the committer of this commit.
|
||||
*
|
||||
|
||||
@@ -5,7 +5,7 @@ import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||
import java.io.IOException;
|
||||
import java.net.URL;
|
||||
|
||||
import static org.kohsuke.github.Previews.*;
|
||||
import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
|
||||
|
||||
/**
|
||||
* A comment attached to a commit (or a specific line in a specific file of a commit.)
|
||||
@@ -121,7 +121,7 @@ public class GHCommitComment extends GHObject implements Reactable {
|
||||
this.body = body;
|
||||
}
|
||||
|
||||
@Preview
|
||||
@Preview(SQUIRREL_GIRL)
|
||||
@Deprecated
|
||||
public GHReaction createReaction(ReactionContent content) throws IOException {
|
||||
return owner.root.createRequest()
|
||||
@@ -133,7 +133,7 @@ public class GHCommitComment extends GHObject implements Reactable {
|
||||
.wrap(owner.root);
|
||||
}
|
||||
|
||||
@Preview
|
||||
@Preview(SQUIRREL_GIRL)
|
||||
@Deprecated
|
||||
public PagedIterable<GHReaction> listReactions() {
|
||||
return owner.root.createRequest()
|
||||
|
||||
@@ -1,6 +1,7 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import org.apache.commons.lang3.StringUtils;
|
||||
import org.kohsuke.github.internal.Previews;
|
||||
|
||||
import java.io.IOException;
|
||||
|
||||
@@ -10,7 +11,7 @@ import java.io.IOException;
|
||||
* @author Marc de Verdelhan
|
||||
* @see GitHub#searchCommits() GitHub#searchCommits()
|
||||
*/
|
||||
@Preview
|
||||
@Preview(Previews.CLOAK)
|
||||
@Deprecated
|
||||
public class GHCommitSearchBuilder extends GHSearchBuilder<GHCommit> {
|
||||
GHCommitSearchBuilder(GitHub root) {
|
||||
|
||||
@@ -18,8 +18,6 @@ public class GHCommitStatus extends GHObject {
|
||||
String context;
|
||||
GHUser creator;
|
||||
|
||||
private GitHub root;
|
||||
|
||||
GHCommitStatus wrapUp(GitHub root) {
|
||||
if (creator != null)
|
||||
creator.wrapUp(root);
|
||||
|
||||
@@ -15,21 +15,20 @@ import java.util.Base64;
|
||||
* @see GHRepository#getFileContent(String) GHRepository#getFileContent(String)
|
||||
*/
|
||||
@SuppressWarnings({ "UnusedDeclaration" })
|
||||
public class GHContent implements Refreshable {
|
||||
public class GHContent extends GitHubInteractiveObject implements Refreshable {
|
||||
/*
|
||||
* In normal use of this class, repository field is set via wrap(), but in the code search API, there's a nested
|
||||
* 'repository' field that gets populated from JSON.
|
||||
*/
|
||||
private GHRepository repository;
|
||||
|
||||
private GitHub root;
|
||||
|
||||
private String type;
|
||||
private String encoding;
|
||||
private long size;
|
||||
private String sha;
|
||||
private String name;
|
||||
private String path;
|
||||
private String target;
|
||||
private String content;
|
||||
private String url; // this is the API url
|
||||
private String git_url; // this is the Blob url
|
||||
@@ -99,6 +98,15 @@ public class GHContent implements Refreshable {
|
||||
return path;
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets target of a symlink. This will only be set if {@code "symlink".equals(getType())}
|
||||
*
|
||||
* @return the target
|
||||
*/
|
||||
public String getTarget() {
|
||||
return target;
|
||||
}
|
||||
|
||||
/**
|
||||
* Retrieve the decoded content that is stored at this location.
|
||||
*
|
||||
|
||||
@@ -1,166 +1,25 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import java.io.IOException;
|
||||
import java.net.URL;
|
||||
|
||||
import static org.kohsuke.github.internal.Previews.BAPTISTE;
|
||||
|
||||
/**
|
||||
* Creates a repository
|
||||
*
|
||||
* @author Kohsuke Kawaguchi
|
||||
*/
|
||||
public class GHCreateRepositoryBuilder {
|
||||
private final GitHub root;
|
||||
protected final Requester builder;
|
||||
private final String apiUrlTail;
|
||||
public class GHCreateRepositoryBuilder extends GHRepositoryBuilder<GHCreateRepositoryBuilder> {
|
||||
|
||||
GHCreateRepositoryBuilder(GitHub root, String apiUrlTail, String name) {
|
||||
this.root = root;
|
||||
this.apiUrlTail = apiUrlTail;
|
||||
this.builder = root.createRequest();
|
||||
this.builder.with("name", name);
|
||||
}
|
||||
public GHCreateRepositoryBuilder(String name, GitHub root, String apiTail) {
|
||||
super(GHCreateRepositoryBuilder.class, root, null);
|
||||
requester.method("POST").withUrlPath(apiTail);
|
||||
|
||||
/**
|
||||
* Description for repository
|
||||
*
|
||||
* @param description
|
||||
* description of repository
|
||||
* @return a builder to continue with building
|
||||
*/
|
||||
public GHCreateRepositoryBuilder description(String description) {
|
||||
this.builder.with("description", description);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Homepage for repository
|
||||
*
|
||||
* @param homepage
|
||||
* homepage of repository
|
||||
* @return a builder to continue with building
|
||||
*/
|
||||
public GHCreateRepositoryBuilder homepage(URL homepage) {
|
||||
return homepage(homepage.toExternalForm());
|
||||
}
|
||||
|
||||
/**
|
||||
* Homepage for repository
|
||||
*
|
||||
* @param homepage
|
||||
* homepage of repository
|
||||
* @return a builder to continue with building
|
||||
*/
|
||||
public GHCreateRepositoryBuilder homepage(String homepage) {
|
||||
this.builder.with("homepage", homepage);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Creates a private repository
|
||||
*
|
||||
* @param enabled
|
||||
* private if true
|
||||
* @return a builder to continue with building
|
||||
*/
|
||||
public GHCreateRepositoryBuilder private_(boolean enabled) {
|
||||
this.builder.with("private", enabled);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Enables issue tracker
|
||||
*
|
||||
* @param enabled
|
||||
* true if enabled
|
||||
* @return a builder to continue with building
|
||||
*/
|
||||
public GHCreateRepositoryBuilder issues(boolean enabled) {
|
||||
this.builder.with("has_issues", enabled);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Enables projects
|
||||
*
|
||||
* @param enabled
|
||||
* true if enabled
|
||||
* @return a builder to continue with building
|
||||
*/
|
||||
public GHCreateRepositoryBuilder projects(boolean enabled) {
|
||||
this.builder.with("has_projects", enabled);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Enables wiki
|
||||
*
|
||||
* @param enabled
|
||||
* true if enabled
|
||||
* @return a builder to continue with building
|
||||
*/
|
||||
public GHCreateRepositoryBuilder wiki(boolean enabled) {
|
||||
this.builder.with("has_wiki", enabled);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Enables downloads
|
||||
*
|
||||
* @param enabled
|
||||
* true if enabled
|
||||
* @return a builder to continue with building
|
||||
*/
|
||||
public GHCreateRepositoryBuilder downloads(boolean enabled) {
|
||||
this.builder.with("has_downloads", enabled);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* If true, create an initial commit with empty README.
|
||||
*
|
||||
* @param enabled
|
||||
* true if enabled
|
||||
* @return a builder to continue with building
|
||||
*/
|
||||
public GHCreateRepositoryBuilder autoInit(boolean enabled) {
|
||||
this.builder.with("auto_init", enabled);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Allow or disallow squash-merging pull requests.
|
||||
*
|
||||
* @param enabled
|
||||
* true if enabled
|
||||
* @return a builder to continue with building
|
||||
*/
|
||||
public GHCreateRepositoryBuilder allowSquashMerge(boolean enabled) {
|
||||
this.builder.with("allow_squash_merge", enabled);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Allow or disallow merging pull requests with a merge commit.
|
||||
*
|
||||
* @param enabled
|
||||
* true if enabled
|
||||
* @return a builder to continue with building
|
||||
*/
|
||||
public GHCreateRepositoryBuilder allowMergeCommit(boolean enabled) {
|
||||
this.builder.with("allow_merge_commit", enabled);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Allow or disallow rebase-merging pull requests.
|
||||
*
|
||||
* @param enabled
|
||||
* true if enabled
|
||||
* @return a builder to continue with building
|
||||
*/
|
||||
public GHCreateRepositoryBuilder allowRebaseMerge(boolean enabled) {
|
||||
this.builder.with("allow_rebase_merge", enabled);
|
||||
return this;
|
||||
try {
|
||||
name(name);
|
||||
} catch (IOException e) {
|
||||
// not going to happen here
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -169,10 +28,11 @@ public class GHCreateRepositoryBuilder {
|
||||
* @param language
|
||||
* template to base the ignore file on
|
||||
* @return a builder to continue with building See https://developer.github.com/v3/repos/#create
|
||||
* @throws IOException
|
||||
* In case of any networking error or error from the server.
|
||||
*/
|
||||
public GHCreateRepositoryBuilder gitignoreTemplate(String language) {
|
||||
this.builder.with("gitignore_template", language);
|
||||
return this;
|
||||
public GHCreateRepositoryBuilder gitignoreTemplate(String language) throws IOException {
|
||||
return with("gitignore_template", language);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -181,10 +41,24 @@ public class GHCreateRepositoryBuilder {
|
||||
* @param license
|
||||
* template to base the license file on
|
||||
* @return a builder to continue with building See https://developer.github.com/v3/repos/#create
|
||||
* @throws IOException
|
||||
* In case of any networking error or error from the server.
|
||||
*/
|
||||
public GHCreateRepositoryBuilder licenseTemplate(String license) {
|
||||
this.builder.with("license_template", license);
|
||||
return this;
|
||||
public GHCreateRepositoryBuilder licenseTemplate(String license) throws IOException {
|
||||
return with("license_template", license);
|
||||
}
|
||||
|
||||
/**
|
||||
* If true, create an initial commit with empty README.
|
||||
*
|
||||
* @param enabled
|
||||
* true if enabled
|
||||
* @return a builder to continue with building
|
||||
* @throws IOException
|
||||
* In case of any networking error or error from the server.
|
||||
*/
|
||||
public GHCreateRepositoryBuilder autoInit(boolean enabled) throws IOException {
|
||||
return with("auto_init", enabled);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -193,10 +67,57 @@ public class GHCreateRepositoryBuilder {
|
||||
* @param team
|
||||
* team to grant access to
|
||||
* @return a builder to continue with building
|
||||
* @throws IOException
|
||||
* In case of any networking error or error from the server.
|
||||
*/
|
||||
public GHCreateRepositoryBuilder team(GHTeam team) {
|
||||
public GHCreateRepositoryBuilder team(GHTeam team) throws IOException {
|
||||
if (team != null)
|
||||
this.builder.with("team_id", team.getId());
|
||||
return with("team_id", team.getId());
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Specifies whether the repository is a template.
|
||||
*
|
||||
* @param enabled
|
||||
* true if enabled
|
||||
* @return a builder to continue with building
|
||||
* @throws IOException
|
||||
* In case of any networking error or error from the server.
|
||||
* @deprecated Use {@link #isTemplate(boolean)} method instead
|
||||
*/
|
||||
@Deprecated
|
||||
public GHCreateRepositoryBuilder templateRepository(boolean enabled) throws IOException {
|
||||
return isTemplate(enabled);
|
||||
}
|
||||
|
||||
/**
|
||||
* Specifies the ownership of the repository.
|
||||
*
|
||||
* @param owner
|
||||
* organization or personage
|
||||
* @return a builder to continue with building
|
||||
* @throws IOException
|
||||
* In case of any networking error or error from the server.
|
||||
*/
|
||||
public GHCreateRepositoryBuilder owner(String owner) throws IOException {
|
||||
return with("owner", owner);
|
||||
}
|
||||
|
||||
/**
|
||||
* Create repository from template repository
|
||||
*
|
||||
* @param templateOwner
|
||||
* template repository owner
|
||||
* @param templateRepo
|
||||
* template repository
|
||||
* @return a builder to continue with building
|
||||
* @see <a href="https://developer.github.com/v3/previews/">GitHub API Previews</a>
|
||||
*/
|
||||
@Preview(BAPTISTE)
|
||||
@Deprecated
|
||||
public GHCreateRepositoryBuilder fromTemplateRepository(String templateOwner, String templateRepo) {
|
||||
requester.withPreview(BAPTISTE).withUrlPath("/repos/" + templateOwner + "/" + templateRepo + "/generate");
|
||||
return this;
|
||||
}
|
||||
|
||||
@@ -205,10 +126,9 @@ public class GHCreateRepositoryBuilder {
|
||||
*
|
||||
* @return the gh repository
|
||||
* @throws IOException
|
||||
* if repsitory cannot be created
|
||||
* if repository cannot be created
|
||||
*/
|
||||
public GHRepository create() throws IOException {
|
||||
return builder.method("POST").withUrlPath(apiUrlTail).fetch(GHRepository.class).wrap(root);
|
||||
return done();
|
||||
}
|
||||
|
||||
}
|
||||
|
||||
@@ -1,7 +1,10 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import org.kohsuke.github.internal.Previews;
|
||||
|
||||
import java.io.IOException;
|
||||
import java.net.URL;
|
||||
import java.util.Map;
|
||||
|
||||
/**
|
||||
* Represents a deployment
|
||||
@@ -13,7 +16,6 @@ import java.net.URL;
|
||||
*/
|
||||
public class GHDeployment extends GHObject {
|
||||
private GHRepository owner;
|
||||
private GitHub root;
|
||||
protected String sha;
|
||||
protected String ref;
|
||||
protected String task;
|
||||
@@ -23,6 +25,9 @@ public class GHDeployment extends GHObject {
|
||||
protected String statuses_url;
|
||||
protected String repository_url;
|
||||
protected GHUser creator;
|
||||
protected String original_environment;
|
||||
protected boolean transient_environment;
|
||||
protected boolean production_environment;
|
||||
|
||||
GHDeployment wrap(GHRepository owner) {
|
||||
this.owner = owner;
|
||||
@@ -60,7 +65,8 @@ public class GHDeployment extends GHObject {
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets payload.
|
||||
* Gets payload. <b>NOTE:</b> only use this method if you can guarantee the payload will be a simple string,
|
||||
* otherwise use {@link #getPayloadObject()}.
|
||||
*
|
||||
* @return the payload
|
||||
*/
|
||||
@@ -68,6 +74,38 @@ public class GHDeployment extends GHObject {
|
||||
return (String) payload;
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets payload. <b>NOTE:</b> only use this method if you can guarantee the payload will be a JSON object (Map),
|
||||
* otherwise use {@link #getPayloadObject()}.
|
||||
*
|
||||
* @return the payload
|
||||
*/
|
||||
public Map<String, Object> getPayloadMap() {
|
||||
return (Map<String, Object>) payload;
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets payload without assuming its type. It could be a String or a Map.
|
||||
*
|
||||
* @return the payload
|
||||
*/
|
||||
public Object getPayloadObject() {
|
||||
return payload;
|
||||
}
|
||||
|
||||
/**
|
||||
* The environment defined when the deployment was first created.
|
||||
*
|
||||
* @deprecated until preview feature has graduated to stable
|
||||
*
|
||||
* @return the original deployment environment
|
||||
*/
|
||||
@Deprecated
|
||||
@Preview(Previews.FLASH)
|
||||
public String getOriginalEnvironment() {
|
||||
return original_environment;
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets environment.
|
||||
*
|
||||
@@ -77,6 +115,33 @@ public class GHDeployment extends GHObject {
|
||||
return environment;
|
||||
}
|
||||
|
||||
/**
|
||||
* Specifies if the given environment is specific to the deployment and will no longer exist at some point in the
|
||||
* future.
|
||||
*
|
||||
* @deprecated until preview feature has graduated to stable
|
||||
*
|
||||
* @return the environment is transient
|
||||
*/
|
||||
@Deprecated
|
||||
@Preview(Previews.ANT_MAN)
|
||||
public boolean isTransientEnvironment() {
|
||||
return transient_environment;
|
||||
}
|
||||
|
||||
/**
|
||||
* Specifies if the given environment is one that end-users directly interact with.
|
||||
*
|
||||
* @deprecated until preview feature has graduated to stable
|
||||
*
|
||||
* @return the environment is used by end-users directly
|
||||
*/
|
||||
@Deprecated
|
||||
@Preview(Previews.ANT_MAN)
|
||||
public boolean isProductionEnvironment() {
|
||||
return production_environment;
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets creator.
|
||||
*
|
||||
@@ -133,6 +198,8 @@ public class GHDeployment extends GHObject {
|
||||
public PagedIterable<GHDeploymentStatus> listStatuses() {
|
||||
return root.createRequest()
|
||||
.withUrlPath(statuses_url)
|
||||
.withPreview(Previews.ANT_MAN)
|
||||
.withPreview(Previews.FLASH)
|
||||
.toIterable(GHDeploymentStatus[].class, item -> item.wrap(owner));
|
||||
}
|
||||
|
||||
|
||||
@@ -1,5 +1,7 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import org.kohsuke.github.internal.Previews;
|
||||
|
||||
import java.io.IOException;
|
||||
import java.util.List;
|
||||
|
||||
@@ -19,7 +21,10 @@ public class GHDeploymentBuilder {
|
||||
*/
|
||||
public GHDeploymentBuilder(GHRepository repo) {
|
||||
this.repo = repo;
|
||||
this.builder = repo.root.createRequest().method("POST");
|
||||
this.builder = repo.root.createRequest()
|
||||
.withPreview(Previews.ANT_MAN)
|
||||
.withPreview(Previews.FLASH)
|
||||
.method("POST");
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -40,6 +45,7 @@ public class GHDeploymentBuilder {
|
||||
*
|
||||
* @param branch
|
||||
* the branch
|
||||
*
|
||||
* @return the gh deployment builder
|
||||
*/
|
||||
public GHDeploymentBuilder ref(String branch) {
|
||||
@@ -52,6 +58,7 @@ public class GHDeploymentBuilder {
|
||||
*
|
||||
* @param task
|
||||
* the task
|
||||
*
|
||||
* @return the gh deployment builder
|
||||
*/
|
||||
public GHDeploymentBuilder task(String task) {
|
||||
@@ -64,6 +71,7 @@ public class GHDeploymentBuilder {
|
||||
*
|
||||
* @param autoMerge
|
||||
* the auto merge
|
||||
*
|
||||
* @return the gh deployment builder
|
||||
*/
|
||||
public GHDeploymentBuilder autoMerge(boolean autoMerge) {
|
||||
@@ -76,6 +84,7 @@ public class GHDeploymentBuilder {
|
||||
*
|
||||
* @param requiredContexts
|
||||
* the required contexts
|
||||
*
|
||||
* @return the gh deployment builder
|
||||
*/
|
||||
public GHDeploymentBuilder requiredContexts(List<String> requiredContexts) {
|
||||
@@ -88,6 +97,7 @@ public class GHDeploymentBuilder {
|
||||
*
|
||||
* @param payload
|
||||
* the payload
|
||||
*
|
||||
* @return the gh deployment builder
|
||||
*/
|
||||
public GHDeploymentBuilder payload(String payload) {
|
||||
@@ -100,6 +110,7 @@ public class GHDeploymentBuilder {
|
||||
*
|
||||
* @param environment
|
||||
* the environment
|
||||
*
|
||||
* @return the gh deployment builder
|
||||
*/
|
||||
public GHDeploymentBuilder environment(String environment) {
|
||||
@@ -107,11 +118,47 @@ public class GHDeploymentBuilder {
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Specifies if the given environment is specific to the deployment and will no longer exist at some point in the
|
||||
* future.
|
||||
*
|
||||
* @deprecated until preview feature has graduated to stable
|
||||
*
|
||||
* @param transientEnvironment
|
||||
* the environment is transient
|
||||
*
|
||||
* @return the gh deployment builder
|
||||
*/
|
||||
@Deprecated
|
||||
@Preview(Previews.ANT_MAN)
|
||||
public GHDeploymentBuilder transientEnvironment(boolean transientEnvironment) {
|
||||
builder.with("transient_environment", transientEnvironment);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Specifies if the given environment is one that end-users directly interact with.
|
||||
*
|
||||
* @deprecated until preview feature has graduated to stable
|
||||
*
|
||||
* @param productionEnvironment
|
||||
* the environment is used by end-users directly
|
||||
*
|
||||
* @return the gh deployment builder
|
||||
*/
|
||||
@Deprecated
|
||||
@Preview(Previews.ANT_MAN)
|
||||
public GHDeploymentBuilder productionEnvironment(boolean productionEnvironment) {
|
||||
builder.with("production_environment", productionEnvironment);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Description gh deployment builder.
|
||||
*
|
||||
* @param description
|
||||
* the description
|
||||
*
|
||||
* @return the gh deployment builder
|
||||
*/
|
||||
public GHDeploymentBuilder description(String description) {
|
||||
@@ -123,6 +170,7 @@ public class GHDeploymentBuilder {
|
||||
* Create gh deployment.
|
||||
*
|
||||
* @return the gh deployment
|
||||
*
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
|
||||
@@ -1,8 +1,40 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import org.kohsuke.github.internal.Previews;
|
||||
|
||||
/**
|
||||
* Represents the state of deployment
|
||||
*/
|
||||
public enum GHDeploymentState {
|
||||
PENDING, SUCCESS, ERROR, FAILURE
|
||||
PENDING,
|
||||
SUCCESS,
|
||||
ERROR,
|
||||
FAILURE,
|
||||
|
||||
/**
|
||||
* The state of the deployment currently reflects it's in progress.
|
||||
*
|
||||
* @deprecated until preview feature has graduated to stable
|
||||
*/
|
||||
@Deprecated
|
||||
@Preview(Previews.FLASH)
|
||||
IN_PROGRESS,
|
||||
|
||||
/**
|
||||
* The state of the deployment currently reflects it's queued up for processing.
|
||||
*
|
||||
* @deprecated until preview feature has graduated to stable
|
||||
*/
|
||||
@Deprecated
|
||||
@Preview(Previews.FLASH)
|
||||
QUEUED,
|
||||
|
||||
/**
|
||||
* The state of the deployment currently reflects it's no longer active.
|
||||
*
|
||||
* @deprecated until preview feature has graduated to stable
|
||||
*/
|
||||
@Deprecated
|
||||
@Preview(Previews.ANT_MAN)
|
||||
INACTIVE
|
||||
}
|
||||
|
||||
@@ -1,5 +1,7 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import org.kohsuke.github.internal.Previews;
|
||||
|
||||
import java.net.URL;
|
||||
import java.util.Locale;
|
||||
|
||||
@@ -8,19 +10,21 @@ import java.util.Locale;
|
||||
*/
|
||||
public class GHDeploymentStatus extends GHObject {
|
||||
private GHRepository owner;
|
||||
private GitHub root;
|
||||
protected GHUser creator;
|
||||
protected String state;
|
||||
protected String description;
|
||||
protected String target_url;
|
||||
protected String log_url;
|
||||
protected String deployment_url;
|
||||
protected String repository_url;
|
||||
protected String environment_url;
|
||||
|
||||
/**
|
||||
* Wrap gh deployment status.
|
||||
*
|
||||
* @param owner
|
||||
* the owner
|
||||
*
|
||||
* @return the gh deployment status
|
||||
*/
|
||||
public GHDeploymentStatus wrap(GHRepository owner) {
|
||||
@@ -34,12 +38,30 @@ public class GHDeploymentStatus extends GHObject {
|
||||
/**
|
||||
* Gets target url.
|
||||
*
|
||||
* @deprecated Target url is deprecated in favor of {@link #getLogUrl() getLogUrl}
|
||||
*
|
||||
* @return the target url
|
||||
*/
|
||||
@Deprecated
|
||||
public URL getTargetUrl() {
|
||||
return GitHubClient.parseURL(target_url);
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets target url.
|
||||
* <p>
|
||||
* This method replaces {@link #getTargetUrl() getTargetUrl}}.
|
||||
*
|
||||
* @deprecated until preview feature has graduated to stable
|
||||
*
|
||||
* @return the target url
|
||||
*/
|
||||
@Deprecated
|
||||
@Preview(Previews.ANT_MAN)
|
||||
public URL getLogUrl() {
|
||||
return GitHubClient.parseURL(log_url);
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets deployment url.
|
||||
*
|
||||
@@ -49,6 +71,19 @@ public class GHDeploymentStatus extends GHObject {
|
||||
return GitHubClient.parseURL(deployment_url);
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets deployment environment url.
|
||||
*
|
||||
* @deprecated until preview feature has graduated to stable
|
||||
*
|
||||
* @return the deployment environment url
|
||||
*/
|
||||
@Deprecated
|
||||
@Preview(Previews.ANT_MAN)
|
||||
public URL getEnvironmentUrl() {
|
||||
return GitHubClient.parseURL(environment_url);
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets repository url.
|
||||
*
|
||||
|
||||
@@ -1,5 +1,7 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import org.kohsuke.github.internal.Previews;
|
||||
|
||||
import java.io.IOException;
|
||||
|
||||
/**
|
||||
@@ -21,6 +23,7 @@ public class GHDeploymentStatusBuilder {
|
||||
* the deployment id
|
||||
* @param state
|
||||
* the state
|
||||
*
|
||||
* @deprecated Use {@link GHDeployment#createStatus(GHDeploymentState)}
|
||||
*/
|
||||
@Deprecated
|
||||
@@ -31,15 +34,38 @@ public class GHDeploymentStatusBuilder {
|
||||
GHDeploymentStatusBuilder(GHRepository repo, long deploymentId, GHDeploymentState state) {
|
||||
this.repo = repo;
|
||||
this.deploymentId = deploymentId;
|
||||
this.builder = repo.root.createRequest().method("POST");
|
||||
this.builder = repo.root.createRequest()
|
||||
.withPreview(Previews.ANT_MAN)
|
||||
.withPreview(Previews.FLASH)
|
||||
.method("POST");
|
||||
|
||||
this.builder.with("state", state);
|
||||
}
|
||||
|
||||
/**
|
||||
* Add an inactive status to all prior non-transient, non-production environment deployments with the same
|
||||
* repository and environment name as the created status's deployment.
|
||||
*
|
||||
* @deprecated until preview feature has graduated to stable
|
||||
*
|
||||
* @param autoInactive
|
||||
* Add inactive status flag
|
||||
*
|
||||
* @return the gh deployment status builder
|
||||
*/
|
||||
@Deprecated
|
||||
@Preview({ Previews.ANT_MAN, Previews.FLASH })
|
||||
public GHDeploymentStatusBuilder autoInactive(boolean autoInactive) {
|
||||
this.builder.with("auto_inactive", autoInactive);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Description gh deployment status builder.
|
||||
*
|
||||
* @param description
|
||||
* the description
|
||||
*
|
||||
* @return the gh deployment status builder
|
||||
*/
|
||||
public GHDeploymentStatusBuilder description(String description) {
|
||||
@@ -47,13 +73,70 @@ public class GHDeploymentStatusBuilder {
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Name for the target deployment environment, which can be changed when setting a deploy status.
|
||||
*
|
||||
* @deprecated until preview feature has graduated to stable
|
||||
*
|
||||
* @param environment
|
||||
* the environment name
|
||||
*
|
||||
* @return the gh deployment status builder
|
||||
*/
|
||||
@Deprecated
|
||||
@Preview(Previews.FLASH)
|
||||
public GHDeploymentStatusBuilder environment(String environment) {
|
||||
this.builder.with("environment", environment);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* The URL for accessing the environment
|
||||
*
|
||||
* @deprecated until preview feature has graduated to stable
|
||||
*
|
||||
* @param environmentUrl
|
||||
* the environment url
|
||||
*
|
||||
* @return the gh deployment status builder
|
||||
*/
|
||||
@Deprecated
|
||||
@Preview(Previews.ANT_MAN)
|
||||
public GHDeploymentStatusBuilder environmentUrl(String environmentUrl) {
|
||||
this.builder.with("environment_url", environmentUrl);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* The full URL of the deployment's output.
|
||||
* <p>
|
||||
* This method replaces {@link #targetUrl(String) targetUrl}.
|
||||
*
|
||||
* @deprecated until preview feature has graduated to stable
|
||||
*
|
||||
* @param logUrl
|
||||
* the deployment output url
|
||||
*
|
||||
* @return the gh deployment status builder
|
||||
*/
|
||||
@Deprecated
|
||||
@Preview(Previews.ANT_MAN)
|
||||
public GHDeploymentStatusBuilder logUrl(String logUrl) {
|
||||
this.builder.with("log_url", logUrl);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Target url gh deployment status builder.
|
||||
*
|
||||
* @deprecated Target url is deprecated in favor of {@link #logUrl(String) logUrl}
|
||||
*
|
||||
* @param targetUrl
|
||||
* the target url
|
||||
*
|
||||
* @return the gh deployment status builder
|
||||
*/
|
||||
@Deprecated
|
||||
public GHDeploymentStatusBuilder targetUrl(String targetUrl) {
|
||||
this.builder.with("target_url", targetUrl);
|
||||
return this;
|
||||
@@ -63,6 +146,7 @@ public class GHDeploymentStatusBuilder {
|
||||
* Create gh deployment status.
|
||||
*
|
||||
* @return the gh deployment status
|
||||
*
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
|
||||
@@ -1,7 +1,7 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import com.fasterxml.jackson.annotation.JacksonInject;
|
||||
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||
import org.kohsuke.github.internal.Previews;
|
||||
|
||||
import java.io.IOException;
|
||||
import java.net.URL;
|
||||
@@ -18,8 +18,6 @@ import javax.annotation.Nonnull;
|
||||
*/
|
||||
public class GHDiscussion extends GHObject {
|
||||
|
||||
@JacksonInject
|
||||
private GitHub root;
|
||||
private GHTeam team;
|
||||
private long number;
|
||||
private String body, title, htmlUrl;
|
||||
@@ -130,7 +128,7 @@ public class GHDiscussion extends GHObject {
|
||||
*
|
||||
* @return a {@link GHDiscussion.Updater}
|
||||
*/
|
||||
@Preview
|
||||
@Preview(Previews.SQUIRREL_GIRL)
|
||||
@Deprecated
|
||||
public GHDiscussion.Updater update() {
|
||||
return new GHDiscussion.Updater(this);
|
||||
@@ -141,7 +139,7 @@ public class GHDiscussion extends GHObject {
|
||||
*
|
||||
* @return a {@link GHDiscussion.Setter}
|
||||
*/
|
||||
@Preview
|
||||
@Preview(Previews.SQUIRREL_GIRL)
|
||||
@Deprecated
|
||||
public GHDiscussion.Setter set() {
|
||||
return new GHDiscussion.Setter(this);
|
||||
|
||||
@@ -12,6 +12,7 @@ import java.util.Locale;
|
||||
public enum GHEvent {
|
||||
CHECK_RUN,
|
||||
CHECK_SUITE,
|
||||
CODE_SCANNING_ALERT,
|
||||
COMMIT_COMMENT,
|
||||
CONTENT_REFERENCE,
|
||||
CREATE,
|
||||
@@ -62,6 +63,8 @@ public enum GHEvent {
|
||||
TEAM,
|
||||
TEAM_ADD,
|
||||
WATCH,
|
||||
WORKFLOW_DISPATCH,
|
||||
WORKFLOW_RUN,
|
||||
|
||||
/**
|
||||
* Special event type that means "every possible event"
|
||||
|
||||
@@ -12,9 +12,7 @@ import java.util.Date;
|
||||
* @author Kohsuke Kawaguchi
|
||||
*/
|
||||
@SuppressFBWarnings(value = "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", justification = "JSON API")
|
||||
public class GHEventInfo {
|
||||
private GitHub root;
|
||||
|
||||
public class GHEventInfo extends GitHubInteractiveObject {
|
||||
// we don't want to expose Jackson dependency to the user. This needs databinding
|
||||
private ObjectNode payload;
|
||||
|
||||
|
||||
File diff suppressed because it is too large
Load Diff
@@ -23,7 +23,6 @@ import java.util.Map.Entry;
|
||||
public class GHGist extends GHObject {
|
||||
|
||||
final GHUser owner;
|
||||
final GitHub root;
|
||||
|
||||
private String forks_url, commits_url, id, git_pull_url, git_push_url, html_url;
|
||||
|
||||
|
||||
@@ -13,7 +13,6 @@ import javax.annotation.Nonnull;
|
||||
* @see GitHub#createGist() GitHub#createGist()
|
||||
*/
|
||||
public class GHGistBuilder {
|
||||
private final GitHub root;
|
||||
private final Requester req;
|
||||
private final LinkedHashMap<String, Object> files = new LinkedHashMap<String, Object>();
|
||||
|
||||
@@ -24,7 +23,6 @@ public class GHGistBuilder {
|
||||
* the root
|
||||
*/
|
||||
public GHGistBuilder(GitHub root) {
|
||||
this.root = root;
|
||||
req = root.createRequest().method("POST");
|
||||
}
|
||||
|
||||
|
||||
@@ -12,8 +12,7 @@ import java.util.Map;
|
||||
* functionality
|
||||
*/
|
||||
class GHHooks {
|
||||
static abstract class Context {
|
||||
private final GitHub root;
|
||||
static abstract class Context extends GitHubInteractiveObject {
|
||||
|
||||
private Context(GitHub root) {
|
||||
this.root = root;
|
||||
|
||||
@@ -16,7 +16,6 @@ import java.net.URL;
|
||||
"UUF_UNUSED_FIELD" },
|
||||
justification = "JSON API")
|
||||
public class GHInvitation extends GHObject {
|
||||
/* package almost final */ GitHub root;
|
||||
|
||||
private int id;
|
||||
private GHRepository repository;
|
||||
|
||||
@@ -39,7 +39,7 @@ import java.util.List;
|
||||
import java.util.Locale;
|
||||
import java.util.Objects;
|
||||
|
||||
import static org.kohsuke.github.Previews.SQUIRREL_GIRL;
|
||||
import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
|
||||
|
||||
/**
|
||||
* Represents an issue on GitHub.
|
||||
@@ -53,7 +53,6 @@ import static org.kohsuke.github.Previews.SQUIRREL_GIRL;
|
||||
public class GHIssue extends GHObject implements Reactable {
|
||||
private static final String ASSIGNEES = "assignees";
|
||||
|
||||
GitHub root;
|
||||
GHRepository owner;
|
||||
|
||||
// API v3
|
||||
@@ -158,10 +157,8 @@ public class GHIssue extends GHObject implements Reactable {
|
||||
* Gets labels.
|
||||
*
|
||||
* @return the labels
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
public Collection<GHLabel> getLabels() throws IOException {
|
||||
public Collection<GHLabel> getLabels() {
|
||||
if (labels == null) {
|
||||
return Collections.emptyList();
|
||||
}
|
||||
@@ -239,7 +236,7 @@ public class GHIssue extends GHObject implements Reactable {
|
||||
}
|
||||
|
||||
private void editIssue(String key, Object value) throws IOException {
|
||||
root.createRequest().with(key, value).method("PATCH").withUrlPath(getIssuesApiRoute()).send();
|
||||
root.createRequest().withNullable(key, value).method("PATCH").withUrlPath(getIssuesApiRoute()).send();
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -296,9 +293,9 @@ public class GHIssue extends GHObject implements Reactable {
|
||||
*/
|
||||
public void setMilestone(GHMilestone milestone) throws IOException {
|
||||
if (milestone == null) {
|
||||
editNullable("milestone", null);
|
||||
editIssue("milestone", null);
|
||||
} else {
|
||||
edit("milestone", milestone.getNumber());
|
||||
editIssue("milestone", milestone.getNumber());
|
||||
}
|
||||
}
|
||||
|
||||
@@ -315,7 +312,7 @@ public class GHIssue extends GHObject implements Reactable {
|
||||
}
|
||||
|
||||
/**
|
||||
* Sets labels.
|
||||
* Sets labels on the target to a specific list.
|
||||
*
|
||||
* @param labels
|
||||
* the labels
|
||||
@@ -329,6 +326,8 @@ public class GHIssue extends GHObject implements Reactable {
|
||||
/**
|
||||
* Adds labels to the issue.
|
||||
*
|
||||
* Labels that are already present on the target are ignored.
|
||||
*
|
||||
* @param names
|
||||
* Names of the label
|
||||
* @throws IOException
|
||||
@@ -341,6 +340,8 @@ public class GHIssue extends GHObject implements Reactable {
|
||||
/**
|
||||
* Add labels.
|
||||
*
|
||||
* Labels that are already present on the target are ignored.
|
||||
*
|
||||
* @param labels
|
||||
* the labels
|
||||
* @throws IOException
|
||||
@@ -353,6 +354,8 @@ public class GHIssue extends GHObject implements Reactable {
|
||||
/**
|
||||
* Add labels.
|
||||
*
|
||||
* Labels that are already present on the target are ignored.
|
||||
*
|
||||
* @param labels
|
||||
* the labels
|
||||
* @throws IOException
|
||||
@@ -363,21 +366,27 @@ public class GHIssue extends GHObject implements Reactable {
|
||||
}
|
||||
|
||||
private void _addLabels(Collection<String> names) throws IOException {
|
||||
List<String> newLabels = new ArrayList<String>();
|
||||
|
||||
for (GHLabel label : getLabels()) {
|
||||
newLabels.add(label.getName());
|
||||
}
|
||||
for (String name : names) {
|
||||
if (!newLabels.contains(name)) {
|
||||
newLabels.add(name);
|
||||
}
|
||||
}
|
||||
setLabels(newLabels.toArray(new String[0]));
|
||||
root.createRequest().with("labels", names).method("POST").withUrlPath(getIssuesApiRoute() + "/labels").send();
|
||||
}
|
||||
|
||||
/**
|
||||
* Remove a given label by name from this issue.
|
||||
* Remove a single label.
|
||||
*
|
||||
* Attempting to remove a label that is not present throws {@link GHFileNotFoundException}.
|
||||
*
|
||||
* @param name
|
||||
* the name
|
||||
* @throws IOException
|
||||
* the io exception, throws {@link GHFileNotFoundException} if label was not present.
|
||||
*/
|
||||
public void removeLabel(String name) throws IOException {
|
||||
root.createRequest().method("DELETE").withUrlPath(getIssuesApiRoute() + "/labels", name).send();
|
||||
}
|
||||
|
||||
/**
|
||||
* Remove a collection of labels.
|
||||
*
|
||||
* Attempting to remove labels that are not present on the target are ignored.
|
||||
*
|
||||
* @param names
|
||||
* the names
|
||||
@@ -389,7 +398,9 @@ public class GHIssue extends GHObject implements Reactable {
|
||||
}
|
||||
|
||||
/**
|
||||
* Remove labels.
|
||||
* Remove a collection of labels.
|
||||
*
|
||||
* Attempting to remove labels that are not present on the target are ignored.
|
||||
*
|
||||
* @param labels
|
||||
* the labels
|
||||
@@ -402,7 +413,9 @@ public class GHIssue extends GHObject implements Reactable {
|
||||
}
|
||||
|
||||
/**
|
||||
* Remove labels.
|
||||
* Remove a collection of labels.
|
||||
*
|
||||
* Attempting to remove labels that are not present on the target are ignored.
|
||||
*
|
||||
* @param labels
|
||||
* the labels
|
||||
@@ -414,15 +427,13 @@ public class GHIssue extends GHObject implements Reactable {
|
||||
}
|
||||
|
||||
private void _removeLabels(Collection<String> names) throws IOException {
|
||||
List<String> newLabels = new ArrayList<String>();
|
||||
|
||||
for (GHLabel l : getLabels()) {
|
||||
if (!names.contains(l.getName())) {
|
||||
newLabels.add(l.getName());
|
||||
for (String name : names) {
|
||||
try {
|
||||
removeLabel(name);
|
||||
} catch (GHFileNotFoundException e) {
|
||||
// when trying to remove multiple labels, we ignore already removed
|
||||
}
|
||||
}
|
||||
|
||||
setLabels(newLabels.toArray(new String[0]));
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -450,7 +461,7 @@ public class GHIssue extends GHObject implements Reactable {
|
||||
.toIterable(GHIssueComment[].class, item -> item.wrapUp(this));
|
||||
}
|
||||
|
||||
@Preview
|
||||
@Preview(SQUIRREL_GIRL)
|
||||
@Deprecated
|
||||
public GHReaction createReaction(ReactionContent content) throws IOException {
|
||||
return root.createRequest()
|
||||
@@ -462,7 +473,7 @@ public class GHIssue extends GHObject implements Reactable {
|
||||
.wrap(root);
|
||||
}
|
||||
|
||||
@Preview
|
||||
@Preview(SQUIRREL_GIRL)
|
||||
@Deprecated
|
||||
public PagedIterable<GHReaction> listReactions() {
|
||||
return root.createRequest()
|
||||
|
||||
49
src/main/java/org/kohsuke/github/GHIssueChanges.java
Normal file
49
src/main/java/org/kohsuke/github/GHIssueChanges.java
Normal file
@@ -0,0 +1,49 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||
|
||||
/**
|
||||
* Wrapper to define changed fields on issues action="edited"
|
||||
*
|
||||
* @see GHEventPayload.Issue
|
||||
*/
|
||||
@SuppressFBWarnings("UWF_UNWRITTEN_FIELD")
|
||||
public class GHIssueChanges {
|
||||
|
||||
private GHFrom title;
|
||||
private GHFrom body;
|
||||
|
||||
/**
|
||||
* Old issue title.
|
||||
*
|
||||
* @return old issue title (or null if not changed)
|
||||
*/
|
||||
public GHFrom getTitle() {
|
||||
return title;
|
||||
}
|
||||
|
||||
/**
|
||||
* Old issue body.
|
||||
*
|
||||
* @return old issue body (or null if not changed)
|
||||
*/
|
||||
public GHFrom getBody() {
|
||||
return body;
|
||||
}
|
||||
|
||||
/**
|
||||
* Wrapper for changed values.
|
||||
*/
|
||||
public static class GHFrom {
|
||||
private String from;
|
||||
|
||||
/**
|
||||
* Previous value that was changed.
|
||||
*
|
||||
* @return previous value
|
||||
*/
|
||||
public String getFrom() {
|
||||
return from;
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -26,7 +26,7 @@ package org.kohsuke.github;
|
||||
import java.io.IOException;
|
||||
import java.net.URL;
|
||||
|
||||
import static org.kohsuke.github.Previews.*;
|
||||
import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
|
||||
|
||||
/**
|
||||
* Comment to the issue
|
||||
@@ -126,7 +126,7 @@ public class GHIssueComment extends GHObject implements Reactable {
|
||||
owner.root.createRequest().method("DELETE").withUrlPath(getApiRoute()).send();
|
||||
}
|
||||
|
||||
@Preview
|
||||
@Preview(SQUIRREL_GIRL)
|
||||
@Deprecated
|
||||
public GHReaction createReaction(ReactionContent content) throws IOException {
|
||||
return owner.root.createRequest()
|
||||
@@ -138,7 +138,7 @@ public class GHIssueComment extends GHObject implements Reactable {
|
||||
.wrap(owner.root);
|
||||
}
|
||||
|
||||
@Preview
|
||||
@Preview(SQUIRREL_GIRL)
|
||||
@Deprecated
|
||||
public PagedIterable<GHReaction> listReactions() {
|
||||
return owner.root.createRequest()
|
||||
|
||||
@@ -9,9 +9,7 @@ import java.util.Date;
|
||||
*
|
||||
* @author Martin van Zijl
|
||||
*/
|
||||
public class GHIssueEvent {
|
||||
private GitHub root;
|
||||
|
||||
public class GHIssueEvent extends GitHubInteractiveObject {
|
||||
private long id;
|
||||
private String node_id;
|
||||
private String url;
|
||||
|
||||
@@ -9,9 +9,7 @@ import org.apache.commons.lang3.builder.ToStringBuilder;
|
||||
* @author Kohsuke Kawaguchi
|
||||
*/
|
||||
@SuppressFBWarnings(value = "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", justification = "JSON API")
|
||||
public class GHKey {
|
||||
/* package almost final */ GitHub root;
|
||||
|
||||
public class GHKey extends GitHubInteractiveObject {
|
||||
protected String url, key, title;
|
||||
protected boolean verified;
|
||||
protected int id;
|
||||
|
||||
@@ -2,6 +2,7 @@ package org.kohsuke.github;
|
||||
|
||||
import com.fasterxml.jackson.annotation.JacksonInject;
|
||||
import com.fasterxml.jackson.annotation.JsonCreator;
|
||||
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||
|
||||
import java.io.IOException;
|
||||
import java.util.ArrayList;
|
||||
@@ -20,7 +21,12 @@ import javax.annotation.Nonnull;
|
||||
* @see GHIssue#getLabels() GHIssue#getLabels()
|
||||
* @see GHRepository#listLabels() GHRepository#listLabels()
|
||||
*/
|
||||
public class GHLabel {
|
||||
public class GHLabel extends GitHubInteractiveObject {
|
||||
|
||||
private long id;
|
||||
private String nodeId;
|
||||
@JsonProperty("default")
|
||||
private boolean default_;
|
||||
|
||||
@Nonnull
|
||||
private String url, name, color;
|
||||
@@ -28,9 +34,6 @@ public class GHLabel {
|
||||
@CheckForNull
|
||||
private String description;
|
||||
|
||||
@Nonnull
|
||||
private final GitHub root;
|
||||
|
||||
@JsonCreator
|
||||
private GHLabel(@JacksonInject @Nonnull GitHub root) {
|
||||
this.root = root;
|
||||
@@ -45,6 +48,24 @@ public class GHLabel {
|
||||
return Objects.requireNonNull(root);
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets id.
|
||||
*
|
||||
* @return the id
|
||||
*/
|
||||
public long getId() {
|
||||
return id;
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets node id.
|
||||
*
|
||||
* @return the node id.
|
||||
*/
|
||||
public String getNodeId() {
|
||||
return nodeId;
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets url.
|
||||
*
|
||||
@@ -85,6 +106,15 @@ public class GHLabel {
|
||||
return description;
|
||||
}
|
||||
|
||||
/**
|
||||
* If the label is one of the default labels created by GitHub automatically.
|
||||
*
|
||||
* @return true if the label is a default one
|
||||
*/
|
||||
public boolean isDefault() {
|
||||
return default_;
|
||||
}
|
||||
|
||||
/**
|
||||
* Sets color.
|
||||
*
|
||||
@@ -132,7 +162,7 @@ public class GHLabel {
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
@Preview
|
||||
@BetaApi
|
||||
@Deprecated
|
||||
static Creator create(GHRepository repository) throws IOException {
|
||||
return new Creator(repository);
|
||||
@@ -179,7 +209,7 @@ public class GHLabel {
|
||||
*
|
||||
* @return a {@link Updater}
|
||||
*/
|
||||
@Preview
|
||||
@BetaApi
|
||||
@Deprecated
|
||||
public Updater update() {
|
||||
return new Updater(this);
|
||||
@@ -190,7 +220,7 @@ public class GHLabel {
|
||||
*
|
||||
* @return a {@link Setter}
|
||||
*/
|
||||
@Preview
|
||||
@BetaApi
|
||||
@Deprecated
|
||||
public Setter set() {
|
||||
return new Setter(this);
|
||||
@@ -227,7 +257,7 @@ public class GHLabel {
|
||||
*
|
||||
* {@link #done()} is called automatically after the property is set.
|
||||
*/
|
||||
@Preview
|
||||
@BetaApi
|
||||
@Deprecated
|
||||
public static class Setter extends GHLabelBuilder<GHLabel> {
|
||||
private Setter(@Nonnull GHLabel base) {
|
||||
@@ -241,7 +271,7 @@ public class GHLabel {
|
||||
*
|
||||
* Consumer must call {@link #done()} to commit changes.
|
||||
*/
|
||||
@Preview
|
||||
@BetaApi
|
||||
@Deprecated
|
||||
public static class Updater extends GHLabelBuilder<Updater> {
|
||||
private Updater(@Nonnull GHLabel base) {
|
||||
@@ -255,7 +285,7 @@ public class GHLabel {
|
||||
*
|
||||
* Consumer must call {@link #done()} to create the new instance.
|
||||
*/
|
||||
@Preview
|
||||
@BetaApi
|
||||
@Deprecated
|
||||
public static class Creator extends GHLabelBuilder<Creator> {
|
||||
private Creator(@Nonnull GHRepository repository) {
|
||||
|
||||
@@ -38,21 +38,21 @@ class GHLabelBuilder<S> extends AbstractBuilder<GHLabel, S> {
|
||||
}
|
||||
|
||||
@Nonnull
|
||||
@Preview
|
||||
@BetaApi
|
||||
@Deprecated
|
||||
public S name(String value) throws IOException {
|
||||
return with("name", value);
|
||||
}
|
||||
|
||||
@Nonnull
|
||||
@Preview
|
||||
@BetaApi
|
||||
@Deprecated
|
||||
public S color(String value) throws IOException {
|
||||
return with("color", value);
|
||||
}
|
||||
|
||||
@Nonnull
|
||||
@Preview
|
||||
@BetaApi
|
||||
@Deprecated
|
||||
public S description(String value) throws IOException {
|
||||
return with("description", value);
|
||||
|
||||
@@ -44,9 +44,6 @@ import java.util.Objects;
|
||||
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
||||
justification = "JSON API")
|
||||
public class GHLicense extends GHObject {
|
||||
@SuppressFBWarnings("IS2_INCONSISTENT_SYNC")
|
||||
// root is set before the object is returned to the app
|
||||
/* package almost final */ GitHub root;
|
||||
|
||||
// these fields are always present, even in the short form
|
||||
protected String key, name;
|
||||
|
||||
@@ -9,9 +9,7 @@ import java.net.URL;
|
||||
* @see GitHub#getMyMarketplacePurchases()
|
||||
* @see GHMarketplaceListAccountBuilder#createRequest()
|
||||
*/
|
||||
public class GHMarketplaceAccount {
|
||||
|
||||
protected GitHub root;
|
||||
public class GHMarketplaceAccount extends GitHubInteractiveObject {
|
||||
private String url;
|
||||
private long id;
|
||||
private String login;
|
||||
|
||||
@@ -8,8 +8,7 @@ import java.io.IOException;
|
||||
* @author Paulo Miguel Almeida
|
||||
* @see GHMarketplacePlan#listAccounts()
|
||||
*/
|
||||
public class GHMarketplaceListAccountBuilder {
|
||||
private final GitHub root;
|
||||
public class GHMarketplaceListAccountBuilder extends GitHubInteractiveObject {
|
||||
private final Requester builder;
|
||||
private final long planId;
|
||||
|
||||
|
||||
@@ -10,8 +10,7 @@ import java.util.Date;
|
||||
* @author Paulo Miguel Almeida
|
||||
* @see GHMarketplaceListAccountBuilder#createRequest()
|
||||
*/
|
||||
public class GHMarketplacePendingChange {
|
||||
private GitHub root;
|
||||
public class GHMarketplacePendingChange extends GitHubInteractiveObject {
|
||||
private long id;
|
||||
@SuppressFBWarnings(value = "UWF_UNWRITTEN_FIELD", justification = "Field comes from JSON deserialization")
|
||||
private Long unitCount;
|
||||
|
||||
@@ -11,9 +11,7 @@ import java.util.List;
|
||||
* @author Paulo Miguel Almeida
|
||||
* @see GitHub#listMarketplacePlans()
|
||||
*/
|
||||
public class GHMarketplacePlan {
|
||||
|
||||
private GitHub root;
|
||||
public class GHMarketplacePlan extends GitHubInteractiveObject {
|
||||
private String url;
|
||||
private String accountsUrl;
|
||||
private long id;
|
||||
|
||||
@@ -10,9 +10,8 @@ import java.util.Date;
|
||||
* @author Paulo Miguel Almeida
|
||||
* @see GHMarketplaceListAccountBuilder#createRequest() GHMarketplaceListAccountBuilder#createRequest()
|
||||
*/
|
||||
public class GHMarketplacePurchase {
|
||||
public class GHMarketplacePurchase extends GitHubInteractiveObject {
|
||||
|
||||
private GitHub root;
|
||||
private String billingCycle;
|
||||
private String nextBillingDate;
|
||||
private boolean onFreeTrial;
|
||||
|
||||
@@ -10,8 +10,7 @@ import java.util.Date;
|
||||
* @author Paulo Miguel Almeida
|
||||
* @see GitHub#getMyMarketplacePurchases()
|
||||
*/
|
||||
public class GHMarketplaceUserPurchase {
|
||||
protected GitHub root;
|
||||
public class GHMarketplaceUserPurchase extends GitHubInteractiveObject {
|
||||
private String billingCycle;
|
||||
private String nextBillingDate;
|
||||
private boolean onFreeTrial;
|
||||
|
||||
@@ -10,9 +10,7 @@ import java.util.Locale;
|
||||
* @author Kohsuke Kawaguchi
|
||||
* @see GHMyself#listOrgMemberships() GHMyself#listOrgMemberships()
|
||||
*/
|
||||
public class GHMembership /* extends GHObject --- but it doesn't have id, created_at, etc. */ {
|
||||
GitHub root;
|
||||
|
||||
public class GHMembership extends GitHubInteractiveObject {
|
||||
String url;
|
||||
String state;
|
||||
String role;
|
||||
|
||||
@@ -11,7 +11,6 @@ import java.util.Locale;
|
||||
* @author Yusuke Kokubo
|
||||
*/
|
||||
public class GHMilestone extends GHObject {
|
||||
GitHub root;
|
||||
GHRepository owner;
|
||||
|
||||
GHUser creator;
|
||||
|
||||
@@ -23,9 +23,7 @@ import java.util.NoSuchElementException;
|
||||
* @see GitHub#listNotifications() GitHub#listNotifications()
|
||||
* @see GHRepository#listNotifications() GHRepository#listNotifications()
|
||||
*/
|
||||
public class GHNotificationStream implements Iterable<GHThread> {
|
||||
private final GitHub root;
|
||||
|
||||
public class GHNotificationStream extends GitHubInteractiveObject implements Iterable<GHThread> {
|
||||
private Boolean all, participating;
|
||||
private String since;
|
||||
private String apiUrl;
|
||||
|
||||
@@ -20,7 +20,7 @@ import javax.annotation.CheckForNull;
|
||||
*/
|
||||
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
||||
justification = "JSON API")
|
||||
public abstract class GHObject {
|
||||
public abstract class GHObject extends GitHubInteractiveObject {
|
||||
/**
|
||||
* Capture response HTTP headers on the state object.
|
||||
*/
|
||||
|
||||
@@ -10,7 +10,7 @@ import java.util.List;
|
||||
import java.util.Map;
|
||||
import java.util.TreeMap;
|
||||
|
||||
import static org.kohsuke.github.Previews.INERTIA;
|
||||
import static org.kohsuke.github.internal.Previews.INERTIA;
|
||||
|
||||
/**
|
||||
* The type GHOrganization.
|
||||
@@ -97,7 +97,7 @@ public class GHOrganization extends GHPerson {
|
||||
* @return the gh create repository builder
|
||||
*/
|
||||
public GHCreateRepositoryBuilder createRepository(String name) {
|
||||
return new GHCreateRepositoryBuilder(root, "/orgs/" + login + "/repos", name);
|
||||
return new GHCreateRepositoryBuilder(name, root, "/orgs/" + login + "/repos");
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -421,7 +421,7 @@ public class GHOrganization extends GHPerson {
|
||||
* The enum Permission.
|
||||
*/
|
||||
public enum Permission {
|
||||
ADMIN, PUSH, PULL
|
||||
ADMIN, MAINTAIN, PUSH, TRIAGE, PULL
|
||||
}
|
||||
|
||||
/**
|
||||
|
||||
@@ -18,7 +18,6 @@ import java.util.TreeMap;
|
||||
* @author Kohsuke Kawaguchi
|
||||
*/
|
||||
public abstract class GHPerson extends GHObject {
|
||||
/* package almost final */ GitHub root;
|
||||
|
||||
// core data fields that exist even for "small" user data (such as the user info in pull request)
|
||||
protected String login, avatar_url;
|
||||
@@ -154,10 +153,7 @@ public abstract class GHPerson extends GHObject {
|
||||
*/
|
||||
public GHRepository getRepository(String name) throws IOException {
|
||||
try {
|
||||
return root.createRequest()
|
||||
.withUrlPath("/repos/" + login + '/' + name)
|
||||
.fetch(GHRepository.class)
|
||||
.wrap(root);
|
||||
return GHRepository.read(root, login, name);
|
||||
} catch (FileNotFoundException e) {
|
||||
return null;
|
||||
}
|
||||
|
||||
@@ -28,7 +28,7 @@ import java.io.IOException;
|
||||
import java.net.URL;
|
||||
import java.util.Locale;
|
||||
|
||||
import static org.kohsuke.github.Previews.INERTIA;
|
||||
import static org.kohsuke.github.internal.Previews.INERTIA;
|
||||
|
||||
/**
|
||||
* A GitHub project.
|
||||
@@ -37,7 +37,6 @@ import static org.kohsuke.github.Previews.INERTIA;
|
||||
* @see <a href="https://developer.github.com/v3/projects/">Projects</a>
|
||||
*/
|
||||
public class GHProject extends GHObject {
|
||||
protected GitHub root;
|
||||
protected GHObject owner;
|
||||
|
||||
private String owner_url;
|
||||
@@ -80,10 +79,8 @@ public class GHProject extends GHObject {
|
||||
} else if (owner_url.contains("/users/")) {
|
||||
owner = root.createRequest().withUrlPath(getOwnerUrl().getPath()).fetch(GHUser.class).wrapUp(root);
|
||||
} else if (owner_url.contains("/repos/")) {
|
||||
owner = root.createRequest()
|
||||
.withUrlPath(getOwnerUrl().getPath())
|
||||
.fetch(GHRepository.class)
|
||||
.wrap(root);
|
||||
String[] pathElements = getOwnerUrl().getPath().split("/");
|
||||
owner = GHRepository.read(root, pathElements[1], pathElements[2]);
|
||||
}
|
||||
} catch (FileNotFoundException e) {
|
||||
return null;
|
||||
|
||||
@@ -6,7 +6,7 @@ import java.io.FileNotFoundException;
|
||||
import java.io.IOException;
|
||||
import java.net.URL;
|
||||
|
||||
import static org.kohsuke.github.Previews.INERTIA;
|
||||
import static org.kohsuke.github.internal.Previews.INERTIA;
|
||||
|
||||
/**
|
||||
* The type GHProjectCard.
|
||||
@@ -14,7 +14,6 @@ import static org.kohsuke.github.Previews.INERTIA;
|
||||
* @author Gunnar Skjold
|
||||
*/
|
||||
public class GHProjectCard extends GHObject {
|
||||
private GitHub root;
|
||||
private GHProject project;
|
||||
private GHProjectColumn column;
|
||||
|
||||
|
||||
@@ -4,7 +4,7 @@ import java.io.FileNotFoundException;
|
||||
import java.io.IOException;
|
||||
import java.net.URL;
|
||||
|
||||
import static org.kohsuke.github.Previews.INERTIA;
|
||||
import static org.kohsuke.github.internal.Previews.INERTIA;
|
||||
|
||||
/**
|
||||
* The type GHProjectColumn.
|
||||
@@ -12,7 +12,6 @@ import static org.kohsuke.github.Previews.INERTIA;
|
||||
* @author Gunnar Skjold
|
||||
*/
|
||||
public class GHProjectColumn extends GHObject {
|
||||
protected GitHub root;
|
||||
protected GHProject project;
|
||||
|
||||
private String name;
|
||||
|
||||
@@ -29,7 +29,6 @@ import java.io.IOException;
|
||||
import java.net.URL;
|
||||
import java.util.ArrayList;
|
||||
import java.util.Arrays;
|
||||
import java.util.Collection;
|
||||
import java.util.Collections;
|
||||
import java.util.Date;
|
||||
import java.util.List;
|
||||
@@ -37,7 +36,8 @@ import java.util.Objects;
|
||||
|
||||
import javax.annotation.CheckForNull;
|
||||
|
||||
import static org.kohsuke.github.Previews.SHADOW_CAT;
|
||||
import static org.kohsuke.github.internal.Previews.LYDIAN;
|
||||
import static org.kohsuke.github.internal.Previews.SHADOW_CAT;
|
||||
|
||||
/**
|
||||
* A pull request.
|
||||
@@ -72,13 +72,6 @@ public class GHPullRequest extends GHIssue implements Refreshable {
|
||||
private GHUser[] requested_reviewers;
|
||||
private GHTeam[] requested_teams;
|
||||
|
||||
/**
|
||||
* GitHub doesn't return some properties of {@link GHIssue} when requesting the GET on the 'pulls' API route as
|
||||
* opposed to 'issues' API route. This flag remembers whether we made the GET call on the 'issues' route on this
|
||||
* object to fill in those missing details
|
||||
*/
|
||||
private transient boolean fetchedIssueDetails;
|
||||
|
||||
GHPullRequest wrapUp(GHRepository owner) {
|
||||
this.wrap(owner);
|
||||
return wrapUp(owner.root);
|
||||
@@ -177,12 +170,6 @@ public class GHPullRequest extends GHIssue implements Refreshable {
|
||||
return GitHubClient.parseDate(merged_at);
|
||||
}
|
||||
|
||||
@Override
|
||||
public Collection<GHLabel> getLabels() throws IOException {
|
||||
fetchIssue();
|
||||
return super.getLabels();
|
||||
}
|
||||
|
||||
@Override
|
||||
public GHUser getClosedBy() {
|
||||
return null;
|
||||
@@ -565,6 +552,41 @@ public class GHPullRequest extends GHIssue implements Refreshable {
|
||||
.send();
|
||||
}
|
||||
|
||||
/**
|
||||
* Set the base branch on the pull request
|
||||
*
|
||||
* @param newBaseBranch
|
||||
* the name of the new base branch
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
* @return the updated pull request
|
||||
*/
|
||||
public GHPullRequest setBaseBranch(String newBaseBranch) throws IOException {
|
||||
return root.createRequest()
|
||||
.method("PATCH")
|
||||
.with("base", newBaseBranch)
|
||||
.withUrlPath(getApiRoute())
|
||||
.fetch(GHPullRequest.class)
|
||||
.wrapUp(root);
|
||||
}
|
||||
|
||||
/**
|
||||
* Updates the branch. The same as pressing the button in the web GUI.
|
||||
*
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
@Preview(LYDIAN)
|
||||
@Deprecated
|
||||
public void updateBranch() throws IOException {
|
||||
root.createRequest()
|
||||
.withPreview(LYDIAN)
|
||||
.method("PUT")
|
||||
.with("expected_head_sha", head.getSha())
|
||||
.withUrlPath(getApiRoute() + "/update-branch")
|
||||
.send();
|
||||
}
|
||||
|
||||
/**
|
||||
* Merge this pull request.
|
||||
* <p>
|
||||
@@ -626,10 +648,4 @@ public class GHPullRequest extends GHIssue implements Refreshable {
|
||||
MERGE, SQUASH, REBASE
|
||||
}
|
||||
|
||||
private void fetchIssue() throws IOException {
|
||||
if (!fetchedIssueDetails) {
|
||||
root.createRequest().withUrlPath(getIssuesApiRoute()).fetchInto(this);
|
||||
fetchedIssueDetails = true;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
86
src/main/java/org/kohsuke/github/GHPullRequestChanges.java
Normal file
86
src/main/java/org/kohsuke/github/GHPullRequestChanges.java
Normal file
@@ -0,0 +1,86 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||
|
||||
/**
|
||||
* Wrapper to define changed fields on pull_request action="edited"
|
||||
*
|
||||
* @see GHEventPayload.PullRequest
|
||||
*/
|
||||
@SuppressFBWarnings("UWF_UNWRITTEN_FIELD")
|
||||
public class GHPullRequestChanges {
|
||||
|
||||
private GHCommitPointer base;
|
||||
private GHFrom title;
|
||||
private GHFrom body;
|
||||
|
||||
/**
|
||||
* Old target branch for pull request.
|
||||
*
|
||||
* @return old target branch info (or null if not changed)
|
||||
*/
|
||||
public GHCommitPointer getBase() {
|
||||
return base;
|
||||
}
|
||||
|
||||
/**
|
||||
* Old pull request title.
|
||||
*
|
||||
* @return old pull request title (or null if not changed)
|
||||
*/
|
||||
public GHFrom getTitle() {
|
||||
return title;
|
||||
}
|
||||
|
||||
/**
|
||||
* Old pull request body.
|
||||
*
|
||||
* @return old pull request body (or null if not changed)
|
||||
*/
|
||||
public GHFrom getBody() {
|
||||
return body;
|
||||
}
|
||||
|
||||
/**
|
||||
* @see org.kohsuke.github.GHCommitPointer
|
||||
*/
|
||||
public static class GHCommitPointer {
|
||||
private GHFrom ref;
|
||||
private GHFrom sha;
|
||||
|
||||
/**
|
||||
* Named ref to the commit. This (from value) appears to be a "short ref" that doesn't include "refs/heads/"
|
||||
* portion.
|
||||
*
|
||||
* @return the ref
|
||||
*/
|
||||
public GHFrom getRef() {
|
||||
return ref;
|
||||
}
|
||||
|
||||
/**
|
||||
* SHA1 of the commit.
|
||||
*
|
||||
* @return sha
|
||||
*/
|
||||
public GHFrom getSha() {
|
||||
return sha;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Wrapper for changed values.
|
||||
*/
|
||||
public static class GHFrom {
|
||||
private String from;
|
||||
|
||||
/**
|
||||
* Previous value that was changed.
|
||||
*
|
||||
* @return previous value
|
||||
*/
|
||||
public String getFrom() {
|
||||
return from;
|
||||
}
|
||||
}
|
||||
}
|
||||
@@ -1,6 +1,6 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import static org.kohsuke.github.Previews.SHADOW_CAT;
|
||||
import static org.kohsuke.github.internal.Previews.SHADOW_CAT;
|
||||
|
||||
/**
|
||||
* Lists up pull requests with some filtering and sorting.
|
||||
|
||||
@@ -46,6 +46,7 @@ public class GHPullRequestReview extends GHObject {
|
||||
private String commit_id;
|
||||
private GHPullRequestReviewState state;
|
||||
private String submitted_at;
|
||||
private String html_url;
|
||||
|
||||
GHPullRequestReview wrapUp(GHPullRequest owner) {
|
||||
this.owner = owner;
|
||||
@@ -102,7 +103,7 @@ public class GHPullRequestReview extends GHObject {
|
||||
|
||||
@Override
|
||||
public URL getHtmlUrl() {
|
||||
return null;
|
||||
return GitHubClient.parseURL(html_url);
|
||||
}
|
||||
|
||||
/**
|
||||
|
||||
@@ -28,7 +28,7 @@ import java.net.URL;
|
||||
|
||||
import javax.annotation.CheckForNull;
|
||||
|
||||
import static org.kohsuke.github.Previews.*;
|
||||
import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
|
||||
|
||||
/**
|
||||
* Review comment to the pull request
|
||||
@@ -153,7 +153,20 @@ public class GHPullRequestReviewComment extends GHObject implements Reactable {
|
||||
* @return the api route
|
||||
*/
|
||||
protected String getApiRoute() {
|
||||
return "/repos/" + owner.getRepository().getFullName() + "/pulls/comments/" + getId();
|
||||
return getApiRoute(false);
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets api route.
|
||||
*
|
||||
* @param includePullNumber
|
||||
* if true, includes the owning pull request's number in the route.
|
||||
*
|
||||
* @return the api route
|
||||
*/
|
||||
protected String getApiRoute(boolean includePullNumber) {
|
||||
return "/repos/" + owner.getRepository().getFullName() + "/pulls"
|
||||
+ (includePullNumber ? "/" + owner.getNumber() : "") + "/comments/" + getId();
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -192,13 +205,12 @@ public class GHPullRequestReviewComment extends GHObject implements Reactable {
|
||||
return owner.root.createRequest()
|
||||
.method("POST")
|
||||
.with("body", body)
|
||||
.with("in_reply_to", getId())
|
||||
.withUrlPath(getApiRoute() + "/comments")
|
||||
.withUrlPath(getApiRoute(true) + "/replies")
|
||||
.fetch(GHPullRequestReviewComment.class)
|
||||
.wrapUp(owner);
|
||||
}
|
||||
|
||||
@Preview
|
||||
@Preview(SQUIRREL_GIRL)
|
||||
@Deprecated
|
||||
public GHReaction createReaction(ReactionContent content) throws IOException {
|
||||
return owner.root.createRequest()
|
||||
@@ -210,7 +222,7 @@ public class GHPullRequestReviewComment extends GHObject implements Reactable {
|
||||
.wrap(owner.root);
|
||||
}
|
||||
|
||||
@Preview
|
||||
@Preview(SQUIRREL_GIRL)
|
||||
@Deprecated
|
||||
public PagedIterable<GHReaction> listReactions() {
|
||||
return owner.root.createRequest()
|
||||
|
||||
@@ -7,8 +7,7 @@ package org.kohsuke.github;
|
||||
* the type parameter
|
||||
* @author Kohsuke Kawaguchi
|
||||
*/
|
||||
public abstract class GHQueryBuilder<T> {
|
||||
protected final GitHub root;
|
||||
public abstract class GHQueryBuilder<T> extends GitHubInteractiveObject {
|
||||
protected final Requester req;
|
||||
|
||||
GHQueryBuilder(GitHub root) {
|
||||
|
||||
@@ -6,6 +6,7 @@ import com.fasterxml.jackson.annotation.JsonProperty;
|
||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||
import org.apache.commons.lang3.StringUtils;
|
||||
|
||||
import java.time.Duration;
|
||||
import java.time.ZonedDateTime;
|
||||
import java.time.format.DateTimeFormatter;
|
||||
import java.time.format.DateTimeParseException;
|
||||
@@ -29,7 +30,7 @@ public class GHRateLimit {
|
||||
/**
|
||||
* Remaining calls that can be made.
|
||||
*
|
||||
* @deprecated This value should never have been made public. Use {@link #getRemaining()}
|
||||
* @deprecated This field should never have been made public. Use {@link #getRemaining()}
|
||||
*/
|
||||
@Deprecated
|
||||
public int remaining;
|
||||
@@ -37,7 +38,7 @@ public class GHRateLimit {
|
||||
/**
|
||||
* Allotted API call per hour.
|
||||
*
|
||||
* @deprecated This value should never have been made public. Use {@link #getLimit()}
|
||||
* @deprecated This field should never have been made public. Use {@link #getLimit()}
|
||||
*/
|
||||
@Deprecated
|
||||
public int limit;
|
||||
@@ -48,7 +49,7 @@ public class GHRateLimit {
|
||||
* date. To use this field in any meaningful way, it must be converted to a long using {@link Date#getTime()}
|
||||
* multiplied by 1000.
|
||||
*
|
||||
* @deprecated This value should never have been made public. Use {@link #getResetDate()}
|
||||
* @deprecated This field should never have been made public. Use {@link #getResetDate()}
|
||||
*/
|
||||
@Deprecated
|
||||
public Date reset;
|
||||
@@ -65,17 +66,58 @@ public class GHRateLimit {
|
||||
@Nonnull
|
||||
private final Record integrationManifest;
|
||||
|
||||
/**
|
||||
* The default GHRateLimit provided to new {@link GitHubClient}s.
|
||||
*
|
||||
* Contains all expired records that will cause {@link GitHubClient#rateLimit(RateLimitTarget)} to refresh with new
|
||||
* data when called.
|
||||
*
|
||||
* Private, but made internal for testing.
|
||||
*/
|
||||
@Nonnull
|
||||
static GHRateLimit Unknown() {
|
||||
return new GHRateLimit(new UnknownLimitRecord(),
|
||||
new UnknownLimitRecord(),
|
||||
new UnknownLimitRecord(),
|
||||
new UnknownLimitRecord());
|
||||
}
|
||||
static final GHRateLimit DEFAULT = new GHRateLimit(UnknownLimitRecord.DEFAULT,
|
||||
UnknownLimitRecord.DEFAULT,
|
||||
UnknownLimitRecord.DEFAULT,
|
||||
UnknownLimitRecord.DEFAULT);
|
||||
|
||||
/**
|
||||
* Creates a new {@link GHRateLimit} from a single record for the specified endpoint with place holders for other
|
||||
* records.
|
||||
*
|
||||
* This is used to create {@link GHRateLimit} instances that can merged with other instances.
|
||||
*
|
||||
* @param record
|
||||
* the rate limit record. Can be a regular {@link Record} constructed from header information or an
|
||||
* {@link UnknownLimitRecord} placeholder.
|
||||
* @param rateLimitTarget
|
||||
* which rate limit record to fill
|
||||
* @return a new {@link GHRateLimit} instance containing the supplied record
|
||||
*/
|
||||
@Nonnull
|
||||
static GHRateLimit fromHeaderRecord(Record header) {
|
||||
return new GHRateLimit(header, new UnknownLimitRecord(), new UnknownLimitRecord(), new UnknownLimitRecord());
|
||||
static GHRateLimit fromRecord(@Nonnull Record record, @Nonnull RateLimitTarget rateLimitTarget) {
|
||||
if (rateLimitTarget == RateLimitTarget.CORE || rateLimitTarget == RateLimitTarget.NONE) {
|
||||
return new GHRateLimit(record,
|
||||
UnknownLimitRecord.DEFAULT,
|
||||
UnknownLimitRecord.DEFAULT,
|
||||
UnknownLimitRecord.DEFAULT);
|
||||
} else if (rateLimitTarget == RateLimitTarget.SEARCH) {
|
||||
return new GHRateLimit(UnknownLimitRecord.DEFAULT,
|
||||
record,
|
||||
UnknownLimitRecord.DEFAULT,
|
||||
UnknownLimitRecord.DEFAULT);
|
||||
} else if (rateLimitTarget == RateLimitTarget.GRAPHQL) {
|
||||
return new GHRateLimit(UnknownLimitRecord.DEFAULT,
|
||||
UnknownLimitRecord.DEFAULT,
|
||||
record,
|
||||
UnknownLimitRecord.DEFAULT);
|
||||
} else if (rateLimitTarget == RateLimitTarget.INTEGRATION_MANIFEST) {
|
||||
return new GHRateLimit(UnknownLimitRecord.DEFAULT,
|
||||
UnknownLimitRecord.DEFAULT,
|
||||
UnknownLimitRecord.DEFAULT,
|
||||
record);
|
||||
} else {
|
||||
throw new IllegalArgumentException("Unknown rate limit target: " + rateLimitTarget.toString());
|
||||
}
|
||||
}
|
||||
|
||||
@JsonCreator
|
||||
@@ -142,7 +184,7 @@ public class GHRateLimit {
|
||||
}
|
||||
|
||||
/**
|
||||
* Whether the rate limit reset date for this instance has passed.
|
||||
* Whether the reset date for the Core API rate limit has passed.
|
||||
*
|
||||
* @return true if the rate limit reset date has passed. Otherwise false.
|
||||
* @since 1.100
|
||||
@@ -152,7 +194,7 @@ public class GHRateLimit {
|
||||
}
|
||||
|
||||
/**
|
||||
* The core object provides your rate limit status for all non-search-related resources in the REST API.
|
||||
* The core object provides the rate limit status for all non-search-related resources in the REST API.
|
||||
*
|
||||
* @return a rate limit record
|
||||
* @since 1.100
|
||||
@@ -163,42 +205,43 @@ public class GHRateLimit {
|
||||
}
|
||||
|
||||
/**
|
||||
* The search object provides your rate limit status for the Search API. TODO: integrate with header limit updating.
|
||||
* Issue #605.
|
||||
* The search record provides the rate limit status for the Search API.
|
||||
*
|
||||
* @return a rate limit record
|
||||
* @since 1.115
|
||||
*/
|
||||
@Nonnull
|
||||
Record getSearch() {
|
||||
public Record getSearch() {
|
||||
return search;
|
||||
}
|
||||
|
||||
/**
|
||||
* The graphql object provides your rate limit status for the GraphQL API. TODO: integrate with header limit
|
||||
* updating. Issue #605.
|
||||
* The graphql record provides the rate limit status for the GraphQL API.
|
||||
*
|
||||
* @return a rate limit record
|
||||
* @since 1.115
|
||||
*/
|
||||
@Nonnull
|
||||
Record getGraphQL() {
|
||||
public Record getGraphQL() {
|
||||
return graphql;
|
||||
}
|
||||
|
||||
/**
|
||||
* The integration_manifest object provides your rate limit status for the GitHub App Manifest code conversion
|
||||
* endpoint. TODO: integrate with header limit updating. Issue #605.
|
||||
* The integration manifest record provides the rate limit status for the GitHub App Manifest code conversion
|
||||
* endpoint.
|
||||
*
|
||||
* @return a rate limit record
|
||||
* @since 1.115
|
||||
*/
|
||||
@Nonnull
|
||||
Record getIntegrationManifest() {
|
||||
public Record getIntegrationManifest() {
|
||||
return integrationManifest;
|
||||
}
|
||||
|
||||
@Override
|
||||
public String toString() {
|
||||
return "GHRateLimit {" + "core " + getCore().toString() + "search " + getSearch().toString() + "graphql "
|
||||
+ getGraphQL().toString() + "integrationManifest " + getIntegrationManifest().toString() + '}';
|
||||
return "GHRateLimit {" + "core " + getCore().toString() + ", search " + getSearch().toString() + ", graphql "
|
||||
+ getGraphQL().toString() + ", integrationManifest " + getIntegrationManifest().toString() + "}";
|
||||
}
|
||||
|
||||
@Override
|
||||
@@ -221,44 +264,111 @@ public class GHRateLimit {
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets the appropriate {@link Record} for a particular url path.
|
||||
* Merge a {@link GHRateLimit} with another one to create a new {@link GHRateLimit} keeping the latest
|
||||
* {@link Record}s from each.
|
||||
*
|
||||
* @param urlPath
|
||||
* the url path of the request
|
||||
* @return the {@link Record} for a url path.
|
||||
* @param newLimit
|
||||
* {@link GHRateLimit} with potentially updated {@link Record}s.
|
||||
* @return a merged {@link GHRateLimit} with the latest {@link Record}s from these two instances. If the merged
|
||||
* instance is equal to the current instance, the current instance is returned.
|
||||
*/
|
||||
@Nonnull
|
||||
Record getRecordForUrlPath(@Nonnull String urlPath) {
|
||||
if (urlPath.equals("/rate_limit")) {
|
||||
return new UnknownLimitRecord();
|
||||
} else if (urlPath.startsWith("/search")) {
|
||||
return getSearch();
|
||||
} else if (urlPath.startsWith("/graphql")) {
|
||||
return getGraphQL();
|
||||
} else if (urlPath.startsWith("/app-manifests")) {
|
||||
return getIntegrationManifest();
|
||||
} else {
|
||||
GHRateLimit getMergedRateLimit(@Nonnull GHRateLimit newLimit) {
|
||||
|
||||
GHRateLimit merged = new GHRateLimit(getCore().currentOrUpdated(newLimit.getCore()),
|
||||
getSearch().currentOrUpdated(newLimit.getSearch()),
|
||||
getGraphQL().currentOrUpdated(newLimit.getGraphQL()),
|
||||
getIntegrationManifest().currentOrUpdated(newLimit.getIntegrationManifest()));
|
||||
|
||||
if (merged.equals(this)) {
|
||||
merged = this;
|
||||
}
|
||||
|
||||
return merged;
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets the specified {@link Record}.
|
||||
*
|
||||
* {@link RateLimitTarget#NONE} will return {@link UnknownLimitRecord#DEFAULT} to prevent any clients from
|
||||
* accidentally waiting on that record to reset before continuing.
|
||||
*
|
||||
* @param rateLimitTarget
|
||||
* the target rate limit record
|
||||
* @return the target {@link Record} from this instance.
|
||||
*/
|
||||
@Nonnull
|
||||
Record getRecord(@Nonnull RateLimitTarget rateLimitTarget) {
|
||||
if (rateLimitTarget == RateLimitTarget.CORE) {
|
||||
return getCore();
|
||||
} else if (rateLimitTarget == RateLimitTarget.SEARCH) {
|
||||
return getSearch();
|
||||
} else if (rateLimitTarget == RateLimitTarget.GRAPHQL) {
|
||||
return getGraphQL();
|
||||
} else if (rateLimitTarget == RateLimitTarget.INTEGRATION_MANIFEST) {
|
||||
return getIntegrationManifest();
|
||||
} else if (rateLimitTarget == RateLimitTarget.NONE) {
|
||||
return UnknownLimitRecord.DEFAULT;
|
||||
} else {
|
||||
throw new IllegalArgumentException("Unknown rate limit target: " + rateLimitTarget.toString());
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* A limit record used as a placeholder when the the actual limit is not known.
|
||||
* <p>
|
||||
* Has a large limit and long duration so that it will doesn't expire too often.
|
||||
*
|
||||
* @since 1.100
|
||||
*/
|
||||
public static class UnknownLimitRecord extends Record {
|
||||
|
||||
// One hour
|
||||
private static final long unknownLimitResetSeconds = 60L * 60L;
|
||||
private static final long defaultUnknownLimitResetSeconds = Duration.ofSeconds(30).getSeconds();
|
||||
|
||||
/**
|
||||
* The number of seconds until a {@link UnknownLimitRecord} will expire.
|
||||
*
|
||||
* This is set to a somewhat short duration, rather than a long one. This avoids
|
||||
* {@link {@link GitHubClient#rateLimit(RateLimitTarget)}} requesting rate limit updates continuously, but also
|
||||
* avoids holding on to stale unknown records indefinitely.
|
||||
*
|
||||
* When merging {@link GHRateLimit} instances, {@link UnknownLimitRecord}s will be superseded by incoming
|
||||
* regular {@link Record}s.
|
||||
*
|
||||
* @see GHRateLimit#getMergedRateLimit(GHRateLimit)
|
||||
*/
|
||||
static long unknownLimitResetSeconds = defaultUnknownLimitResetSeconds;
|
||||
|
||||
static final int unknownLimit = 1000000;
|
||||
static final int unknownRemaining = 999999;
|
||||
|
||||
private UnknownLimitRecord() {
|
||||
super(unknownLimit, unknownRemaining, System.currentTimeMillis() / 1000L + unknownLimitResetSeconds);
|
||||
// The default UnknownLimitRecord is an expired record.
|
||||
private static final UnknownLimitRecord DEFAULT = new UnknownLimitRecord(Long.MIN_VALUE);
|
||||
|
||||
// The starting current UnknownLimitRecord is an expired record.
|
||||
private static UnknownLimitRecord current = DEFAULT;
|
||||
|
||||
/**
|
||||
* Create a new unknown record that resets at the specified time.
|
||||
*
|
||||
* @param resetEpochSeconds
|
||||
* the epoch second time when this record will expire.
|
||||
*/
|
||||
private UnknownLimitRecord(long resetEpochSeconds) {
|
||||
super(unknownLimit, unknownRemaining, resetEpochSeconds);
|
||||
}
|
||||
|
||||
static synchronized Record current() {
|
||||
if (current.isExpired()) {
|
||||
current = new UnknownLimitRecord(System.currentTimeMillis() / 1000L + unknownLimitResetSeconds);
|
||||
}
|
||||
return current;
|
||||
}
|
||||
|
||||
/**
|
||||
* Reset the current UnknownLimitRecord. For use during testing only.
|
||||
*/
|
||||
static synchronized void reset() {
|
||||
current = DEFAULT;
|
||||
unknownLimitResetSeconds = defaultUnknownLimitResetSeconds;
|
||||
}
|
||||
}
|
||||
|
||||
@@ -274,14 +384,12 @@ public class GHRateLimit {
|
||||
private final int remaining;
|
||||
|
||||
/**
|
||||
* Allotted API call per hour.
|
||||
* Allotted API call per time period.
|
||||
*/
|
||||
private final int limit;
|
||||
|
||||
/**
|
||||
* The time at which the current rate limit window resets in UTC epoch seconds.
|
||||
*
|
||||
* This is the raw value returned by the server.
|
||||
*/
|
||||
private final long resetEpochSeconds;
|
||||
|
||||
@@ -291,9 +399,11 @@ public class GHRateLimit {
|
||||
private final long createdAtEpochSeconds = System.currentTimeMillis() / 1000;
|
||||
|
||||
/**
|
||||
* The time at which the rate limit will reset. This value is calculated based on
|
||||
* {@link #getResetEpochSeconds()} by calling {@link #calculateResetDate}. If the clock on the local machine not
|
||||
* synchronized with the server clock, this time value will be adjusted to match the local machine's clock.
|
||||
* The date at which the rate limit will reset, adjusted to local machine time if the local machine's clock not
|
||||
* synchronized with to the same clock as the GitHub server.
|
||||
*
|
||||
* @see #calculateResetDate(String)
|
||||
* @see #getResetDate()
|
||||
*/
|
||||
@Nonnull
|
||||
private final Date resetDate;
|
||||
@@ -341,12 +451,58 @@ public class GHRateLimit {
|
||||
this.resetDate = calculateResetDate(updatedAt);
|
||||
}
|
||||
|
||||
/**
|
||||
* Determine if the current {@link Record} is outdated compared to another. Rate Limit dates are only accurate
|
||||
* to the second, so we look at other information in the record as well.
|
||||
*
|
||||
* {@link Record}s with earlier {@link #getResetEpochSeconds()} are replaced by those with later.
|
||||
* {@link Record}s with the same {@link #getResetEpochSeconds()} are replaced by those with less remaining
|
||||
* count.
|
||||
*
|
||||
* {@link UnknownLimitRecord}s compare with each other like regular {@link Record}s.
|
||||
*
|
||||
* {@link Record}s are replaced by {@link UnknownLimitRecord}s only when the current {@link Record} is expired
|
||||
* and the {@link UnknownLimitRecord} is not. Otherwise Regular {@link Record}s are not replaced by
|
||||
* {@link UnknownLimitRecord}s.
|
||||
*
|
||||
* Expiration is only considered after other checks, meaning expired records may sometimes be replaced by other
|
||||
* expired records.
|
||||
*
|
||||
* @param other
|
||||
* the other {@link Record}
|
||||
* @return the {@link Record} that is most current
|
||||
*/
|
||||
Record currentOrUpdated(@Nonnull Record other) {
|
||||
// This set of checks avoids most calls to isExpired()
|
||||
// Depends on UnknownLimitRecord.current() to prevent continuous updating of GHRateLimit rateLimit()
|
||||
if (getResetEpochSeconds() > other.getResetEpochSeconds()
|
||||
|| (getResetEpochSeconds() == other.getResetEpochSeconds()
|
||||
&& getRemaining() <= other.getRemaining())) {
|
||||
// If the current record has a later reset
|
||||
// or the current record has the same reset and fewer or same requests remaining
|
||||
// Then it is most recent
|
||||
return this;
|
||||
} else if (!(other instanceof UnknownLimitRecord)) {
|
||||
// If the above is not the case that means other has a later reset
|
||||
// or the same resent and fewer requests remaining.
|
||||
// If the other record is not an unknown record, the the other is more recent
|
||||
return other;
|
||||
} else if (this.isExpired() && !other.isExpired()) {
|
||||
// The other is an unknown record.
|
||||
// If the current record has expired and the other hasn't, return the other.
|
||||
return other;
|
||||
}
|
||||
|
||||
// If none of the above, the current record is most valid.
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Recalculates the {@link #resetDate} relative to the local machine clock.
|
||||
* <p>
|
||||
* {@link RateLimitChecker}s and {@link RateLimitHandler}s use {@link #getResetDate()} to make decisions about
|
||||
* how long to wait for until for the rate limit to reset. That means that {@link #getResetDate()} needs to be
|
||||
* accurate to the local machine.
|
||||
* calculated based on the local machine clock.
|
||||
* </p>
|
||||
* <p>
|
||||
* When we say that the clock on two machines is "synchronized", we mean that the UTC time returned from
|
||||
@@ -415,7 +571,7 @@ public class GHRateLimit {
|
||||
* {@link #getResetDate()} or implement a {@link RateLimitChecker} instead.
|
||||
*
|
||||
* @return a long representing the time in epoch seconds when the rate limit will reset
|
||||
* @see #getResetDate() #getResetDate()
|
||||
* @see #getResetDate()
|
||||
*/
|
||||
public long getResetEpochSeconds() {
|
||||
return resetEpochSeconds;
|
||||
@@ -424,6 +580,8 @@ public class GHRateLimit {
|
||||
/**
|
||||
* Whether the rate limit reset date indicated by this instance is expired
|
||||
*
|
||||
* If attempting to wait for the rate limit to reset, consider implementing a {@link RateLimitChecker} instead.
|
||||
*
|
||||
* @return true if the rate limit reset date has passed. Otherwise false.
|
||||
*/
|
||||
public boolean isExpired() {
|
||||
@@ -431,8 +589,8 @@ public class GHRateLimit {
|
||||
}
|
||||
|
||||
/**
|
||||
* Returns the date at which the rate limit will reset, adjusted to local machine time if the local machine's
|
||||
* clock not synchronized with to the same clock as the GitHub server.
|
||||
* The date at which the rate limit will reset, adjusted to local machine time if the local machine's clock not
|
||||
* synchronized with to the same clock as the GitHub server.
|
||||
*
|
||||
* If attempting to wait for the rate limit to reset, consider implementing a {@link RateLimitChecker} instead.
|
||||
*
|
||||
|
||||
@@ -3,7 +3,7 @@ package org.kohsuke.github;
|
||||
import java.io.IOException;
|
||||
import java.net.URL;
|
||||
|
||||
import static org.kohsuke.github.Previews.*;
|
||||
import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
|
||||
|
||||
/**
|
||||
* Reaction to issue, comment, PR, and so on.
|
||||
@@ -11,10 +11,9 @@ import static org.kohsuke.github.Previews.*;
|
||||
* @author Kohsuke Kawaguchi
|
||||
* @see Reactable
|
||||
*/
|
||||
@Preview
|
||||
@Preview(SQUIRREL_GIRL)
|
||||
@Deprecated
|
||||
public class GHReaction extends GHObject {
|
||||
private GitHub root;
|
||||
|
||||
private GHUser user;
|
||||
private ReactionContent content;
|
||||
|
||||
@@ -1,5 +1,6 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import com.fasterxml.jackson.databind.JsonMappingException;
|
||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||
|
||||
import java.io.IOException;
|
||||
@@ -10,9 +11,7 @@ import java.net.URL;
|
||||
*
|
||||
* @author Michael Clarke
|
||||
*/
|
||||
public class GHRef {
|
||||
/* package almost final */ GitHub root;
|
||||
|
||||
public class GHRef extends GitHubInteractiveObject {
|
||||
private String ref, url;
|
||||
private GHObject object;
|
||||
|
||||
@@ -90,6 +89,78 @@ public class GHRef {
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Retrive a ref of the given type for the current GitHub repository.
|
||||
*
|
||||
* @param repository
|
||||
* the repository to read from
|
||||
* @param refName
|
||||
* eg: heads/branch
|
||||
* @return refs matching the request type
|
||||
* @throws IOException
|
||||
* on failure communicating with GitHub, potentially due to an invalid ref type being requested
|
||||
*/
|
||||
static GHRef read(GHRepository repository, String refName) throws IOException {
|
||||
// Also accept e.g. "refs/heads/branch" for consistency with createRef().
|
||||
if (refName.startsWith("refs/")) {
|
||||
refName = refName.replaceFirst("refs/", "");
|
||||
}
|
||||
|
||||
// We would expect this to use `git/ref/%s` but some versions of GHE seem to not support it
|
||||
// Instead use `git/refs/%s` and check the result actually matches the ref
|
||||
GHRef result = null;
|
||||
try {
|
||||
result = repository.root.createRequest()
|
||||
.withUrlPath(repository.getApiTailUrl(String.format("git/refs/%s", refName)))
|
||||
.fetch(GHRef.class)
|
||||
.wrap(repository.root);
|
||||
} catch (IOException e) {
|
||||
// If the parse exception is due to the above returning an array instead of a single ref
|
||||
// that means the individual ref did not exist. Handled by result check below.
|
||||
// Otherwise, rethrow.
|
||||
if (!(e.getCause() instanceof JsonMappingException)) {
|
||||
throw e;
|
||||
}
|
||||
}
|
||||
|
||||
// Verify that the ref returned is the one requested
|
||||
// Used .endsWith(refName) instead of .equals("refs/" + refName) to workaround a GitBucket
|
||||
// issue where the "ref" field omits the "refs/" prefix. "endsWith()" is functionally
|
||||
// the same for this scenario - the server refs matching is prefix-based, so
|
||||
// a ref that ends with the correct string will always be the correct one.
|
||||
if (result == null || !result.getRef().endsWith(refName)) {
|
||||
throw new GHFileNotFoundException(String.format("git/refs/%s", refName)
|
||||
+ " {\"message\":\"Not Found\",\"documentation_url\":\"https://developer.github.com/v3/git/refs/#get-a-reference\"}");
|
||||
}
|
||||
return result;
|
||||
}
|
||||
|
||||
/**
|
||||
* Retrieves all refs of the given type for the current GitHub repository.
|
||||
*
|
||||
* @param repository
|
||||
* the repository to read from
|
||||
* @param refType
|
||||
* the type of reg to search for e.g. <code>tags</code> or <code>commits</code>
|
||||
* @return paged iterable of all refs of the specified type
|
||||
* @throws IOException
|
||||
* on failure communicating with GitHub, potentially due to an invalid ref type being requested
|
||||
*/
|
||||
static PagedIterable<GHRef> readMatching(GHRepository repository, String refType) throws IOException {
|
||||
if (refType.startsWith("refs/")) {
|
||||
refType = refType.replaceFirst("refs/", "");
|
||||
}
|
||||
|
||||
String url = repository.getApiTailUrl(String.format("git/refs/%s", refType));
|
||||
// if no types, do not end with slash just to be safe.
|
||||
if (refType.equals("")) {
|
||||
url = url.substring(0, url.length() - 1);
|
||||
}
|
||||
return repository.root.createRequest()
|
||||
.withUrlPath(url)
|
||||
.toIterable(GHRef[].class, item -> item.wrap(repository.root));
|
||||
}
|
||||
|
||||
/**
|
||||
* The type GHObject.
|
||||
*/
|
||||
|
||||
@@ -15,14 +15,15 @@ import static java.lang.String.*;
|
||||
* Release in a github repository.
|
||||
*
|
||||
* @see GHRepository#getReleases() GHRepository#getReleases()
|
||||
* @see GHRepository#listReleases() () GHRepository#listReleases()
|
||||
* @see GHRepository#createRelease(String) GHRepository#createRelease(String)
|
||||
*/
|
||||
public class GHRelease extends GHObject {
|
||||
GitHub root;
|
||||
GHRepository owner;
|
||||
|
||||
private String html_url;
|
||||
private String assets_url;
|
||||
private List<GHAsset> assets;
|
||||
private String upload_url;
|
||||
private String tag_name;
|
||||
private String target_commitish;
|
||||
@@ -249,18 +250,44 @@ public class GHRelease extends GHObject {
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets assets.
|
||||
* Get the cached assets.
|
||||
*
|
||||
* @return the assets
|
||||
*
|
||||
* @deprecated This should be the default behavior of {@link #getAssets()} in a future release. This method is
|
||||
* introduced in addition to enable a transition to using cached asset information while keeping the
|
||||
* existing logic in place for backwards compatibility.
|
||||
*/
|
||||
@Deprecated
|
||||
public List<GHAsset> assets() {
|
||||
return assets;
|
||||
}
|
||||
|
||||
/**
|
||||
* Re-fetch the assets of this release.
|
||||
*
|
||||
* @return the assets
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
* @deprecated The behavior of this method will change in a future release. It will then provide cached assets as
|
||||
* provided by {@link #assets()}. Use {@link #listAssets()} instead to fetch up-to-date information of
|
||||
* assets.
|
||||
*/
|
||||
@Deprecated
|
||||
public List<GHAsset> getAssets() throws IOException {
|
||||
return listAssets().toList();
|
||||
}
|
||||
|
||||
/**
|
||||
* Re-fetch the assets of this release.
|
||||
*
|
||||
* @return the assets
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
public List<GHAsset> getAssets() throws IOException {
|
||||
public PagedIterable<GHAsset> listAssets() throws IOException {
|
||||
Requester builder = owner.root.createRequest();
|
||||
|
||||
return builder.withUrlPath(getApiTailUrl("assets"))
|
||||
.toIterable(GHAsset[].class, item -> item.wrap(this))
|
||||
.toList();
|
||||
return builder.withUrlPath(getApiTailUrl("assets")).toIterable(GHAsset[].class, item -> item.wrap(this));
|
||||
}
|
||||
|
||||
/**
|
||||
|
||||
@@ -25,12 +25,12 @@ package org.kohsuke.github;
|
||||
|
||||
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||
import com.fasterxml.jackson.core.JsonParseException;
|
||||
import com.fasterxml.jackson.databind.JsonMappingException;
|
||||
import com.infradna.tool.bridge_method_injector.WithBridgeMethods;
|
||||
import edu.umd.cs.findbugs.annotations.CheckForNull;
|
||||
import edu.umd.cs.findbugs.annotations.NonNull;
|
||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||
import org.apache.commons.lang3.StringUtils;
|
||||
import org.kohsuke.github.function.InputStreamFunction;
|
||||
|
||||
import java.io.FileNotFoundException;
|
||||
import java.io.IOException;
|
||||
@@ -47,15 +47,18 @@ import java.util.Date;
|
||||
import java.util.HashMap;
|
||||
import java.util.HashSet;
|
||||
import java.util.Iterator;
|
||||
import java.util.LinkedHashSet;
|
||||
import java.util.List;
|
||||
import java.util.Map;
|
||||
import java.util.Objects;
|
||||
import java.util.Set;
|
||||
import java.util.TreeMap;
|
||||
import java.util.WeakHashMap;
|
||||
|
||||
import javax.annotation.Nonnull;
|
||||
|
||||
import static java.util.Arrays.*;
|
||||
import static org.kohsuke.github.Previews.*;
|
||||
import static java.util.Objects.requireNonNull;
|
||||
import static org.kohsuke.github.internal.Previews.*;
|
||||
|
||||
/**
|
||||
* A repository on GitHub.
|
||||
@@ -66,10 +69,11 @@ import static org.kohsuke.github.Previews.*;
|
||||
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
||||
justification = "JSON API")
|
||||
public class GHRepository extends GHObject {
|
||||
/* package almost final */ transient GitHub root;
|
||||
|
||||
private String nodeId, description, homepage, name, full_name;
|
||||
|
||||
private String html_url; // this is the UI
|
||||
|
||||
/*
|
||||
* The license information makes use of the preview API.
|
||||
*
|
||||
@@ -78,22 +82,30 @@ public class GHRepository extends GHObject {
|
||||
private GHLicense license;
|
||||
|
||||
private String git_url, ssh_url, clone_url, svn_url, mirror_url;
|
||||
|
||||
private GHUser owner; // not fully populated. beware.
|
||||
|
||||
private boolean has_issues, has_wiki, fork, has_downloads, has_pages, archived, has_projects;
|
||||
|
||||
private boolean allow_squash_merge;
|
||||
|
||||
private boolean allow_merge_commit;
|
||||
|
||||
private boolean allow_rebase_merge;
|
||||
|
||||
private boolean delete_branch_on_merge;
|
||||
|
||||
@JsonProperty("private")
|
||||
private boolean _private;
|
||||
|
||||
private int forks_count, stargazers_count, watchers_count, size, open_issues_count, subscribers_count;
|
||||
|
||||
private String pushed_at;
|
||||
|
||||
private Map<Integer, GHMilestone> milestones = new WeakHashMap<Integer, GHMilestone>();
|
||||
|
||||
private String default_branch, language;
|
||||
|
||||
private Map<String, GHCommit> commits = new WeakHashMap<String, GHCommit>();
|
||||
|
||||
@SkipFromToString
|
||||
@@ -101,6 +113,12 @@ public class GHRepository extends GHObject {
|
||||
|
||||
private GHRepository source, parent;
|
||||
|
||||
private Boolean isTemplate;
|
||||
|
||||
static GHRepository read(GitHub root, String owner, String name) throws IOException {
|
||||
return root.createRequest().withUrlPath("/repos/" + owner + '/' + name).fetch(GHRepository.class).wrap(root);
|
||||
}
|
||||
|
||||
/**
|
||||
* Create deployment gh deployment builder.
|
||||
*
|
||||
@@ -147,6 +165,8 @@ public class GHRepository extends GHObject {
|
||||
.with("task", task)
|
||||
.with("environment", environment)
|
||||
.withUrlPath(getApiTailUrl("deployments"))
|
||||
.withPreview(ANT_MAN)
|
||||
.withPreview(FLASH)
|
||||
.toIterable(GHDeployment[].class, item -> item.wrap(this));
|
||||
}
|
||||
|
||||
@@ -162,6 +182,8 @@ public class GHRepository extends GHObject {
|
||||
public GHDeployment getDeployment(long id) throws IOException {
|
||||
return root.createRequest()
|
||||
.withUrlPath(getApiTailUrl("deployments/" + id))
|
||||
.withPreview(ANT_MAN)
|
||||
.withPreview(FLASH)
|
||||
.fetch(GHDeployment.class)
|
||||
.wrap(this);
|
||||
}
|
||||
@@ -682,6 +704,28 @@ public class GHRepository extends GHObject {
|
||||
return _private;
|
||||
}
|
||||
|
||||
/**
|
||||
* Is template boolean.
|
||||
*
|
||||
* @return the boolean
|
||||
*/
|
||||
@Deprecated
|
||||
@Preview(BAPTISTE)
|
||||
public boolean isTemplate() {
|
||||
// isTemplate is still in preview, we do not want to retrieve it unless needed.
|
||||
if (isTemplate == null) {
|
||||
try {
|
||||
populate();
|
||||
} catch (IOException e) {
|
||||
// Convert this to a runtime exception to avoid messy method signature
|
||||
throw new GHException("Could not populate the template setting of the repository", e);
|
||||
}
|
||||
// if this somehow is not populated, set it to false;
|
||||
isTemplate = Boolean.TRUE.equals(isTemplate);
|
||||
}
|
||||
return isTemplate;
|
||||
}
|
||||
|
||||
/**
|
||||
* Has downloads boolean.
|
||||
*
|
||||
@@ -776,6 +820,13 @@ public class GHRepository extends GHObject {
|
||||
return size;
|
||||
}
|
||||
|
||||
/**
|
||||
* Affiliation of a repository collaborator
|
||||
*/
|
||||
public enum CollaboratorAffiliation {
|
||||
ALL, DIRECT, OUTSIDE
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets the collaborators on this repository. This set always appear to include the owner.
|
||||
*
|
||||
@@ -799,6 +850,19 @@ public class GHRepository extends GHObject {
|
||||
return listUsers("collaborators");
|
||||
}
|
||||
|
||||
/**
|
||||
* Lists up the collaborators on this repository.
|
||||
*
|
||||
* @param affiliation
|
||||
* Filter users by affiliation
|
||||
* @return Users paged iterable
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
public PagedIterable<GHUser> listCollaborators(CollaboratorAffiliation affiliation) throws IOException {
|
||||
return listUsers(root.createRequest().with("affiliation", affiliation), "collaborators");
|
||||
}
|
||||
|
||||
/**
|
||||
* Lists all
|
||||
* <a href="https://help.github.com/articles/assigning-issues-and-pull-requests-to-other-github-users/">the
|
||||
@@ -846,6 +910,29 @@ public class GHRepository extends GHObject {
|
||||
return r;
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets the names of the collaborators on this repository. This method deviates from the principle of this library
|
||||
* but it works a lot faster than {@link #getCollaborators()}.
|
||||
*
|
||||
* @param affiliation
|
||||
* Filter users by affiliation
|
||||
* @return the collaborator names
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
public Set<String> getCollaboratorNames(CollaboratorAffiliation affiliation) throws IOException {
|
||||
Set<String> r = new HashSet<>();
|
||||
// no initializer - we just want to the logins
|
||||
PagedIterable<GHUser> users = root.createRequest()
|
||||
.withUrlPath(getApiTailUrl("collaborators"))
|
||||
.with("affiliation", affiliation)
|
||||
.toIterable(GHUser[].class, null);
|
||||
for (GHUser u : users.toArray()) {
|
||||
r.add(u.login);
|
||||
}
|
||||
return r;
|
||||
}
|
||||
|
||||
/**
|
||||
* Obtain permission for a given user in this repository.
|
||||
*
|
||||
@@ -971,12 +1058,12 @@ public class GHRepository extends GHObject {
|
||||
@NonNull String method,
|
||||
@CheckForNull GHOrganization.Permission permission) throws IOException {
|
||||
Requester requester = root.createRequest().method(method);
|
||||
|
||||
if (permission != null) {
|
||||
requester = requester.with("permission", permission).inBody();
|
||||
}
|
||||
|
||||
for (GHUser user : users) {
|
||||
// Make sure that the users collection doesn't have any duplicates
|
||||
for (GHUser user : new LinkedHashSet<GHUser>(users)) {
|
||||
requester.withUrlPath(getApiTailUrl("collaborators/" + user.getLogin())).send();
|
||||
}
|
||||
}
|
||||
@@ -1001,13 +1088,6 @@ public class GHRepository extends GHObject {
|
||||
.send();
|
||||
}
|
||||
|
||||
private void edit(String key, String value) throws IOException {
|
||||
Requester requester = root.createRequest();
|
||||
if (!key.equals("name"))
|
||||
requester.with("name", name); // even when we don't change the name, we need to send it in
|
||||
requester.with(key, value).method("PATCH").withUrlPath(getApiTailUrl("")).send();
|
||||
}
|
||||
|
||||
/**
|
||||
* Enables or disables the issue tracker for this repository.
|
||||
*
|
||||
@@ -1017,7 +1097,7 @@ public class GHRepository extends GHObject {
|
||||
* the io exception
|
||||
*/
|
||||
public void enableIssueTracker(boolean v) throws IOException {
|
||||
edit("has_issues", String.valueOf(v));
|
||||
set().issues(v);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -1029,7 +1109,7 @@ public class GHRepository extends GHObject {
|
||||
* the io exception
|
||||
*/
|
||||
public void enableProjects(boolean v) throws IOException {
|
||||
edit("has_projects", String.valueOf(v));
|
||||
set().projects(v);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -1041,7 +1121,7 @@ public class GHRepository extends GHObject {
|
||||
* the io exception
|
||||
*/
|
||||
public void enableWiki(boolean v) throws IOException {
|
||||
edit("has_wiki", String.valueOf(v));
|
||||
set().wiki(v);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -1053,7 +1133,7 @@ public class GHRepository extends GHObject {
|
||||
* the io exception
|
||||
*/
|
||||
public void enableDownloads(boolean v) throws IOException {
|
||||
edit("has_downloads", String.valueOf(v));
|
||||
set().downloads(v);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -1065,7 +1145,7 @@ public class GHRepository extends GHObject {
|
||||
* the io exception
|
||||
*/
|
||||
public void renameTo(String name) throws IOException {
|
||||
edit("name", name);
|
||||
set().name(name);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -1077,7 +1157,7 @@ public class GHRepository extends GHObject {
|
||||
* the io exception
|
||||
*/
|
||||
public void setDescription(String value) throws IOException {
|
||||
edit("description", value);
|
||||
set().description(value);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -1089,7 +1169,7 @@ public class GHRepository extends GHObject {
|
||||
* the io exception
|
||||
*/
|
||||
public void setHomepage(String value) throws IOException {
|
||||
edit("homepage", value);
|
||||
set().homepage(value);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -1101,7 +1181,7 @@ public class GHRepository extends GHObject {
|
||||
* the io exception
|
||||
*/
|
||||
public void setDefaultBranch(String value) throws IOException {
|
||||
edit("default_branch", value);
|
||||
set().defaultBranch(value);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -1113,7 +1193,7 @@ public class GHRepository extends GHObject {
|
||||
* the io exception
|
||||
*/
|
||||
public void setPrivate(boolean value) throws IOException {
|
||||
edit("private", Boolean.toString(value));
|
||||
set().private_(value);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -1125,7 +1205,7 @@ public class GHRepository extends GHObject {
|
||||
* the io exception
|
||||
*/
|
||||
public void allowSquashMerge(boolean value) throws IOException {
|
||||
edit("allow_squash_merge", Boolean.toString(value));
|
||||
set().allowSquashMerge(value);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -1137,7 +1217,7 @@ public class GHRepository extends GHObject {
|
||||
* the io exception
|
||||
*/
|
||||
public void allowMergeCommit(boolean value) throws IOException {
|
||||
edit("allow_merge_commit", Boolean.toString(value));
|
||||
set().allowMergeCommit(value);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -1149,7 +1229,7 @@ public class GHRepository extends GHObject {
|
||||
* the io exception
|
||||
*/
|
||||
public void allowRebaseMerge(boolean value) throws IOException {
|
||||
edit("allow_rebase_merge", Boolean.toString(value));
|
||||
set().allowRebaseMerge(value);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -1161,7 +1241,7 @@ public class GHRepository extends GHObject {
|
||||
* the io exception
|
||||
*/
|
||||
public void deleteBranchOnMerge(boolean value) throws IOException {
|
||||
edit("delete_branch_on_merge", Boolean.toString(value));
|
||||
set().deleteBranchOnMerge(value);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -1198,12 +1278,30 @@ public class GHRepository extends GHObject {
|
||||
* In case of any networking error or error from the server.
|
||||
*/
|
||||
public void archive() throws IOException {
|
||||
edit("archived", "true");
|
||||
// Generall would not update this record,
|
||||
// but do so here since this will result in any other update actions failing
|
||||
set().archive();
|
||||
// Generally would not update this record,
|
||||
// but doing so here since this will result in any other update actions failing
|
||||
archived = true;
|
||||
}
|
||||
|
||||
/**
|
||||
* Creates a builder that can be used to bulk update repository settings.
|
||||
*
|
||||
* @return the repository updater
|
||||
*/
|
||||
public Updater update() {
|
||||
return new Updater(this);
|
||||
}
|
||||
|
||||
/**
|
||||
* Creates a builder that can be used to bulk update repository settings.
|
||||
*
|
||||
* @return the repository updater
|
||||
*/
|
||||
public Setter set() {
|
||||
return new Setter(this);
|
||||
}
|
||||
|
||||
/**
|
||||
* Sort orders for listing forks
|
||||
*/
|
||||
@@ -1249,8 +1347,9 @@ public class GHRepository extends GHObject {
|
||||
// this API is asynchronous. we need to wait for a bit
|
||||
for (int i = 0; i < 10; i++) {
|
||||
GHRepository r = root.getMyself().getRepository(name);
|
||||
if (r != null)
|
||||
if (r != null) {
|
||||
return r;
|
||||
}
|
||||
try {
|
||||
Thread.sleep(3000);
|
||||
} catch (InterruptedException e) {
|
||||
@@ -1279,8 +1378,9 @@ public class GHRepository extends GHObject {
|
||||
// this API is asynchronous. we need to wait for a bit
|
||||
for (int i = 0; i < 10; i++) {
|
||||
GHRepository r = org.getRepository(name);
|
||||
if (r != null)
|
||||
if (r != null) {
|
||||
return r;
|
||||
}
|
||||
try {
|
||||
Thread.sleep(3000);
|
||||
} catch (InterruptedException e) {
|
||||
@@ -1541,8 +1641,7 @@ public class GHRepository extends GHObject {
|
||||
* on failure communicating with GitHub, potentially due to an invalid ref type being requested
|
||||
*/
|
||||
public PagedIterable<GHRef> listRefs() throws IOException {
|
||||
final String url = String.format("/repos/%s/%s/git/refs", getOwnerName(), name);
|
||||
return root.createRequest().withUrlPath(url).toIterable(GHRef[].class, item -> item.wrap(root));
|
||||
return listRefs("");
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -1568,11 +1667,7 @@ public class GHRepository extends GHObject {
|
||||
* on failure communicating with GitHub, potentially due to an invalid ref type being requested
|
||||
*/
|
||||
public PagedIterable<GHRef> listRefs(String refType) throws IOException {
|
||||
if (refType.startsWith("refs/")) {
|
||||
refType = refType.replaceFirst("refs/", "");
|
||||
}
|
||||
final String url = String.format("/repos/%s/%s/git/refs/%s", getOwnerName(), name, refType);
|
||||
return root.createRequest().withUrlPath(url).toIterable(GHRef[].class, item -> item.wrap(root));
|
||||
return GHRef.readMatching(this, refType);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -1585,34 +1680,7 @@ public class GHRepository extends GHObject {
|
||||
* on failure communicating with GitHub, potentially due to an invalid ref type being requested
|
||||
*/
|
||||
public GHRef getRef(String refName) throws IOException {
|
||||
// Also accept e.g. "refs/heads/branch" for consistency with createRef().
|
||||
if (refName.startsWith("refs/")) {
|
||||
refName = refName.replaceFirst("refs/", "");
|
||||
}
|
||||
|
||||
// We would expect this to use `git/ref/%s` but some versions of GHE seem to not support it
|
||||
// Instead use `git/refs/%s` and check the result actually matches the ref
|
||||
GHRef result = null;
|
||||
try {
|
||||
result = root.createRequest()
|
||||
.withUrlPath(getApiTailUrl(String.format("git/refs/%s", refName)))
|
||||
.fetch(GHRef.class)
|
||||
.wrap(root);
|
||||
} catch (IOException e) {
|
||||
// If the parse exception is due to the above returning an array instead of a single ref
|
||||
// that means the individual ref did not exist
|
||||
if (!(e.getCause() instanceof JsonMappingException)) {
|
||||
throw e;
|
||||
}
|
||||
}
|
||||
|
||||
// Verify that the ref returned is the one requested
|
||||
if (result == null || !result.getRef().equals("refs/" + refName)) {
|
||||
throw new GHFileNotFoundException(String.format("git/refs/%s", refName)
|
||||
+ " {\"message\":\"Not Found\",\"documentation_url\":\"https://developer.github.com/v3/git/refs/#get-a-reference\"}");
|
||||
}
|
||||
return result;
|
||||
|
||||
return GHRef.read(this, refName);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -1715,7 +1783,7 @@ public class GHRepository extends GHObject {
|
||||
return root.createRequest()
|
||||
.withHeader("Accept", "application/vnd.github.v3.raw")
|
||||
.withUrlPath(target)
|
||||
.fetchStream();
|
||||
.fetchStream(Requester::copyInputStream);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -1779,6 +1847,20 @@ public class GHRepository extends GHObject {
|
||||
.toIterable(GHCommitComment[].class, item -> item.wrap(this));
|
||||
}
|
||||
|
||||
/**
|
||||
* Lists all comments on a specific commit.
|
||||
*
|
||||
* @param commitSha
|
||||
* the hash of the commit
|
||||
*
|
||||
* @return the paged iterable
|
||||
*/
|
||||
public PagedIterable<GHCommitComment> listCommitComments(String commitSha) {
|
||||
return root.createRequest()
|
||||
.withUrlPath(String.format("/repos/%s/%s/commits/%s/comments", getOwnerName(), name, commitSha))
|
||||
.toIterable(GHCommitComment[].class, item -> item.wrap(this));
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets the basic license details for the repository.
|
||||
* <p>
|
||||
@@ -1855,7 +1937,7 @@ public class GHRepository extends GHObject {
|
||||
* @see <a href="https://developer.github.com/v3/checks/runs/#list-check-runs-for-a-specific-ref">List check runs
|
||||
* for a specific ref</a>
|
||||
*/
|
||||
@Preview
|
||||
@Preview(ANTIOPE)
|
||||
@Deprecated
|
||||
public PagedIterable<GHCheckRun> getCheckRuns(String ref) throws IOException {
|
||||
GitHubRequest request = root.createRequest()
|
||||
@@ -1929,12 +2011,25 @@ public class GHRepository extends GHObject {
|
||||
* the commit hash
|
||||
* @return a builder which you should customize, then call {@link GHCheckRunBuilder#create}
|
||||
*/
|
||||
@Preview
|
||||
@Preview(ANTIOPE)
|
||||
@Deprecated
|
||||
public @NonNull GHCheckRunBuilder createCheckRun(@NonNull String name, @NonNull String headSHA) {
|
||||
return new GHCheckRunBuilder(this, name, headSHA);
|
||||
}
|
||||
|
||||
/**
|
||||
* Updates an existing check run.
|
||||
*
|
||||
* @param checkId
|
||||
* the existing checkId
|
||||
* @return a builder which you should customize, then call {@link GHCheckRunBuilder#create}
|
||||
*/
|
||||
@Preview(BAPTISTE)
|
||||
@Deprecated
|
||||
public @NonNull GHCheckRunBuilder updateCheckRun(long checkId) {
|
||||
return new GHCheckRunBuilder(this, checkId);
|
||||
}
|
||||
|
||||
/**
|
||||
* Lists repository events.
|
||||
*
|
||||
@@ -2052,9 +2147,11 @@ public class GHRepository extends GHObject {
|
||||
}
|
||||
|
||||
private PagedIterable<GHUser> listUsers(final String suffix) {
|
||||
return root.createRequest()
|
||||
.withUrlPath(getApiTailUrl(suffix))
|
||||
.toIterable(GHUser[].class, item -> item.wrapUp(root));
|
||||
return listUsers(root.createRequest(), suffix);
|
||||
}
|
||||
|
||||
private PagedIterable<GHUser> listUsers(Requester requester, final String suffix) {
|
||||
return requester.withUrlPath(getApiTailUrl(suffix)).toIterable(GHUser[].class, item -> item.wrapUp(root));
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -2117,7 +2214,12 @@ public class GHRepository extends GHObject {
|
||||
justification = "It causes a performance degradation, but we have already exposed it to the API")
|
||||
@Deprecated
|
||||
public Set<URL> getPostCommitHooks() {
|
||||
return postCommitHooks;
|
||||
synchronized (this) {
|
||||
if (postCommitHooks == null) {
|
||||
postCommitHooks = setupPostCommitHooks();
|
||||
}
|
||||
return postCommitHooks;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -2126,57 +2228,63 @@ public class GHRepository extends GHObject {
|
||||
@SuppressFBWarnings(value = "DMI_COLLECTION_OF_URLS",
|
||||
justification = "It causes a performance degradation, but we have already exposed it to the API")
|
||||
@SkipFromToString
|
||||
private final Set<URL> postCommitHooks = new AbstractSet<URL>() {
|
||||
private List<URL> getPostCommitHooks() {
|
||||
try {
|
||||
List<URL> r = new ArrayList<>();
|
||||
for (GHHook h : getHooks()) {
|
||||
if (h.getName().equals("web")) {
|
||||
r.add(new URL(h.getConfig().get("url")));
|
||||
private /* final */ transient Set<URL> postCommitHooks;
|
||||
|
||||
@SuppressFBWarnings(value = "DMI_COLLECTION_OF_URLS",
|
||||
justification = "It causes a performance degradation, but we have already exposed it to the API")
|
||||
private Set<URL> setupPostCommitHooks() {
|
||||
return new AbstractSet<URL>() {
|
||||
private List<URL> getPostCommitHooks() {
|
||||
try {
|
||||
List<URL> r = new ArrayList<>();
|
||||
for (GHHook h : getHooks()) {
|
||||
if (h.getName().equals("web")) {
|
||||
r.add(new URL(h.getConfig().get("url")));
|
||||
}
|
||||
}
|
||||
return r;
|
||||
} catch (IOException e) {
|
||||
throw new GHException("Failed to retrieve post-commit hooks", e);
|
||||
}
|
||||
return r;
|
||||
} catch (IOException e) {
|
||||
throw new GHException("Failed to retrieve post-commit hooks", e);
|
||||
}
|
||||
}
|
||||
|
||||
@Override
|
||||
public Iterator<URL> iterator() {
|
||||
return getPostCommitHooks().iterator();
|
||||
}
|
||||
|
||||
@Override
|
||||
public int size() {
|
||||
return getPostCommitHooks().size();
|
||||
}
|
||||
|
||||
@Override
|
||||
public boolean add(URL url) {
|
||||
try {
|
||||
createWebHook(url);
|
||||
return true;
|
||||
} catch (IOException e) {
|
||||
throw new GHException("Failed to update post-commit hooks", e);
|
||||
@Override
|
||||
public Iterator<URL> iterator() {
|
||||
return getPostCommitHooks().iterator();
|
||||
}
|
||||
}
|
||||
|
||||
@Override
|
||||
public boolean remove(Object url) {
|
||||
try {
|
||||
String _url = ((URL) url).toExternalForm();
|
||||
for (GHHook h : getHooks()) {
|
||||
if (h.getName().equals("web") && h.getConfig().get("url").equals(_url)) {
|
||||
h.delete();
|
||||
return true;
|
||||
@Override
|
||||
public int size() {
|
||||
return getPostCommitHooks().size();
|
||||
}
|
||||
|
||||
@Override
|
||||
public boolean add(URL url) {
|
||||
try {
|
||||
createWebHook(url);
|
||||
return true;
|
||||
} catch (IOException e) {
|
||||
throw new GHException("Failed to update post-commit hooks", e);
|
||||
}
|
||||
}
|
||||
|
||||
@Override
|
||||
public boolean remove(Object url) {
|
||||
try {
|
||||
String _url = ((URL) url).toExternalForm();
|
||||
for (GHHook h : getHooks()) {
|
||||
if (h.getName().equals("web") && h.getConfig().get("url").equals(_url)) {
|
||||
h.delete();
|
||||
return true;
|
||||
}
|
||||
}
|
||||
return false;
|
||||
} catch (IOException e) {
|
||||
throw new GHException("Failed to update post-commit hooks", e);
|
||||
}
|
||||
return false;
|
||||
} catch (IOException e) {
|
||||
throw new GHException("Failed to update post-commit hooks", e);
|
||||
}
|
||||
}
|
||||
};
|
||||
};
|
||||
}
|
||||
|
||||
GHRepository wrap(GitHub root) {
|
||||
this.root = root;
|
||||
@@ -2702,7 +2810,7 @@ public class GHRepository extends GHObject {
|
||||
.with("mode", mode == null ? null : mode.toString())
|
||||
.with("context", getFullName())
|
||||
.withUrlPath("/markdown")
|
||||
.fetchStream(),
|
||||
.fetchStream(Requester::copyInputStream),
|
||||
"UTF-8");
|
||||
}
|
||||
|
||||
@@ -2754,8 +2862,9 @@ public class GHRepository extends GHObject {
|
||||
}
|
||||
|
||||
String getApiTailUrl(String tail) {
|
||||
if (tail.length() > 0 && !tail.startsWith("/"))
|
||||
if (tail.length() > 0 && !tail.startsWith("/")) {
|
||||
tail = '/' + tail;
|
||||
}
|
||||
return "/repos/" + getOwnerName() + "/" + name + tail;
|
||||
}
|
||||
|
||||
@@ -2789,6 +2898,69 @@ public class GHRepository extends GHObject {
|
||||
.wrapUp(root);
|
||||
}
|
||||
|
||||
/**
|
||||
* Lists all the workflows of this repository.
|
||||
*
|
||||
* @return the paged iterable
|
||||
*/
|
||||
public PagedIterable<GHWorkflow> listWorkflows() {
|
||||
return new GHWorkflowsIterable(this);
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets a workflow by id.
|
||||
*
|
||||
* @param id
|
||||
* the id of the workflow run
|
||||
* @return the workflow run
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
public GHWorkflow getWorkflow(long id) throws IOException {
|
||||
return getWorkflow(String.valueOf(id));
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets a workflow by name of the file.
|
||||
*
|
||||
* @param nameOrId
|
||||
* either the name of the file (e.g. my-workflow.yml) or the id as a string
|
||||
* @return the workflow run
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
public GHWorkflow getWorkflow(String nameOrId) throws IOException {
|
||||
return root.createRequest()
|
||||
.withUrlPath(getApiTailUrl("actions/workflows"), nameOrId)
|
||||
.fetch(GHWorkflow.class)
|
||||
.wrapUp(this);
|
||||
}
|
||||
|
||||
/**
|
||||
* Retrieves workflow runs.
|
||||
*
|
||||
* @return the workflow run query builder
|
||||
*/
|
||||
public GHWorkflowRunQueryBuilder queryWorkflowRuns() {
|
||||
return new GHWorkflowRunQueryBuilder(this);
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets a workflow run.
|
||||
*
|
||||
* @param id
|
||||
* the id of the workflow run
|
||||
* @return the workflow run
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
public GHWorkflowRun getWorkflowRun(long id) throws IOException {
|
||||
return root.createRequest()
|
||||
.withUrlPath(getApiTailUrl("actions/runs"), String.valueOf(id))
|
||||
.fetch(GHWorkflowRun.class)
|
||||
.wrapUp(this);
|
||||
}
|
||||
|
||||
// Only used within listTopics().
|
||||
private static class Topics {
|
||||
public List<String> names;
|
||||
@@ -2855,6 +3027,52 @@ public class GHRepository extends GHObject {
|
||||
.wrap(this);
|
||||
}
|
||||
|
||||
/**
|
||||
* Streams a zip archive of the repository, optionally at a given <code>ref</code>.
|
||||
*
|
||||
* @param <T>
|
||||
* the type of result
|
||||
* @param streamFunction
|
||||
* The {@link InputStreamFunction} that will process the stream
|
||||
* @param ref
|
||||
* if <code>null</code> the repository's default branch, usually <code>master</code>,
|
||||
* @throws IOException
|
||||
* The IO exception.
|
||||
* @return the result of reading the stream.
|
||||
*/
|
||||
public <T> T readZip(InputStreamFunction<T> streamFunction, String ref) throws IOException {
|
||||
return downloadArchive("zip", ref, streamFunction);
|
||||
}
|
||||
|
||||
/**
|
||||
* Streams a tar archive of the repository, optionally at a given <code>ref</code>.
|
||||
*
|
||||
* @param <T>
|
||||
* the type of result
|
||||
* @param streamFunction
|
||||
* The {@link InputStreamFunction} that will process the stream
|
||||
* @param ref
|
||||
* if <code>null</code> the repository's default branch, usually <code>master</code>,
|
||||
* @throws IOException
|
||||
* The IO exception.
|
||||
* @return the result of reading the stream.
|
||||
*/
|
||||
public <T> T readTar(InputStreamFunction<T> streamFunction, String ref) throws IOException {
|
||||
return downloadArchive("tar", ref, streamFunction);
|
||||
}
|
||||
|
||||
private <T> T downloadArchive(@Nonnull String type,
|
||||
@CheckForNull String ref,
|
||||
@Nonnull InputStreamFunction<T> streamFunction) throws IOException {
|
||||
requireNonNull(streamFunction, "Sink must not be null");
|
||||
String tailUrl = getApiTailUrl(type + "ball");
|
||||
if (ref != null) {
|
||||
tailUrl += "/" + ref;
|
||||
}
|
||||
final Requester builder = root.createRequest().method("GET").withUrlPath(tailUrl);
|
||||
return builder.fetchStream(streamFunction);
|
||||
}
|
||||
|
||||
/**
|
||||
* Populate this object.
|
||||
*
|
||||
@@ -2862,23 +3080,64 @@ public class GHRepository extends GHObject {
|
||||
* The IO exception
|
||||
*/
|
||||
void populate() throws IOException {
|
||||
if (root.isOffline())
|
||||
if (root.isOffline()) {
|
||||
return; // can't populate if the root is offline
|
||||
}
|
||||
|
||||
final URL url = Objects.requireNonNull(getUrl(), "Missing instance URL!");
|
||||
final URL url = requireNonNull(getUrl(), "Missing instance URL!");
|
||||
|
||||
try {
|
||||
// IMPORTANT: the url for repository records is does not reliably point to the API url.
|
||||
// IMPORTANT: the url for repository records does not reliably point to the API url.
|
||||
// There is bug in Push event payloads that returns the wrong url.
|
||||
// All other occurrences of "url" take the form "https://api.github.com/...".
|
||||
// For Push event repository records, they take the form "https://github.com/{fullName}".
|
||||
root.createRequest().setRawUrlPath(url.toString()).fetchInto(this).wrap(root);
|
||||
root.createRequest().withPreview(BAPTISTE).setRawUrlPath(url.toString()).fetchInto(this).wrap(root);
|
||||
} catch (HttpException e) {
|
||||
if (e.getCause() instanceof JsonParseException) {
|
||||
root.createRequest().withUrlPath("/repos/" + full_name).fetchInto(this).wrap(root);
|
||||
root.createRequest()
|
||||
.withPreview(BAPTISTE)
|
||||
.withUrlPath("/repos/" + full_name)
|
||||
.fetchInto(this)
|
||||
.wrap(root);
|
||||
} else {
|
||||
throw e;
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* A {@link GHRepositoryBuilder} that allows multiple properties to be updated per request.
|
||||
*
|
||||
* Consumer must call {@link #done()} to commit changes.
|
||||
*/
|
||||
@BetaApi
|
||||
@Deprecated
|
||||
public static class Updater extends GHRepositoryBuilder<Updater> {
|
||||
protected Updater(@Nonnull GHRepository repository) {
|
||||
super(Updater.class, repository.root, null);
|
||||
// even when we don't change the name, we need to send it in
|
||||
// this requirement may be out-of-date, but we do not want to break it
|
||||
requester.with("name", repository.name);
|
||||
|
||||
requester.method("PATCH").withUrlPath(repository.getApiTailUrl(""));
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* A {@link GHRepositoryBuilder} that allows multiple properties to be updated per request.
|
||||
*
|
||||
* Consumer must call {@link #done()} to commit changes.
|
||||
*/
|
||||
@BetaApi
|
||||
@Deprecated
|
||||
public static class Setter extends GHRepositoryBuilder<GHRepository> {
|
||||
protected Setter(@Nonnull GHRepository repository) {
|
||||
super(GHRepository.class, repository.root, null);
|
||||
// even when we don't change the name, we need to send it in
|
||||
// this requirement may be out-of-date, but we do not want to break it
|
||||
requester.with("name", repository.name);
|
||||
|
||||
requester.method("PATCH").withUrlPath(repository.getApiTailUrl(""));
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
235
src/main/java/org/kohsuke/github/GHRepositoryBuilder.java
Normal file
235
src/main/java/org/kohsuke/github/GHRepositoryBuilder.java
Normal file
@@ -0,0 +1,235 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import java.io.IOException;
|
||||
import java.net.URL;
|
||||
|
||||
import static org.kohsuke.github.internal.Previews.BAPTISTE;
|
||||
|
||||
abstract class GHRepositoryBuilder<S> extends AbstractBuilder<GHRepository, S> {
|
||||
|
||||
protected GHRepositoryBuilder(Class<S> intermediateReturnType, GitHub root, GHRepository baseInstance) {
|
||||
super(GHRepository.class, intermediateReturnType, root, baseInstance);
|
||||
}
|
||||
|
||||
/**
|
||||
* Allow or disallow squash-merging pull requests.
|
||||
*
|
||||
* @param enabled
|
||||
* true if enabled
|
||||
*
|
||||
* @return a builder to continue with building
|
||||
*
|
||||
* @throws IOException
|
||||
* In case of any networking error or error from the server.
|
||||
*/
|
||||
public S allowSquashMerge(boolean enabled) throws IOException {
|
||||
return with("allow_squash_merge", enabled);
|
||||
}
|
||||
|
||||
/**
|
||||
* Allow or disallow merging pull requests with a merge commit.
|
||||
*
|
||||
* @param enabled
|
||||
* true if enabled
|
||||
*
|
||||
* @return a builder to continue with building
|
||||
*
|
||||
* @throws IOException
|
||||
* In case of any networking error or error from the server.
|
||||
*/
|
||||
public S allowMergeCommit(boolean enabled) throws IOException {
|
||||
return with("allow_merge_commit", enabled);
|
||||
}
|
||||
|
||||
/**
|
||||
* Allow or disallow rebase-merging pull requests.
|
||||
*
|
||||
* @param enabled
|
||||
* true if enabled
|
||||
*
|
||||
* @return a builder to continue with building
|
||||
*
|
||||
* @throws IOException
|
||||
* In case of any networking error or error from the server.
|
||||
*/
|
||||
public S allowRebaseMerge(boolean enabled) throws IOException {
|
||||
return with("allow_rebase_merge", enabled);
|
||||
}
|
||||
|
||||
/**
|
||||
* After pull requests are merged, you can have head branches deleted automatically.
|
||||
*
|
||||
* @param enabled
|
||||
* true if enabled
|
||||
*
|
||||
* @return a builder to continue with building
|
||||
*
|
||||
* @throws IOException
|
||||
* In case of any networking error or error from the server.
|
||||
*/
|
||||
public S deleteBranchOnMerge(boolean enabled) throws IOException {
|
||||
return with("delete_branch_on_merge", enabled);
|
||||
}
|
||||
|
||||
/**
|
||||
* Default repository branch
|
||||
*
|
||||
* @param branch
|
||||
* branch name
|
||||
*
|
||||
* @return a builder to continue with building
|
||||
*
|
||||
* @throws IOException
|
||||
* In case of any networking error or error from the server.
|
||||
*/
|
||||
public S defaultBranch(String branch) throws IOException {
|
||||
return with("default_branch", branch);
|
||||
}
|
||||
|
||||
/**
|
||||
* Description for repository
|
||||
*
|
||||
* @param description
|
||||
* description of repository
|
||||
*
|
||||
* @return a builder to continue with building
|
||||
*
|
||||
* @throws IOException
|
||||
* In case of any networking error or error from the server.
|
||||
*/
|
||||
public S description(String description) throws IOException {
|
||||
return with("description", description);
|
||||
}
|
||||
|
||||
/**
|
||||
* Homepage for repository
|
||||
*
|
||||
* @param homepage
|
||||
* homepage of repository
|
||||
*
|
||||
* @return a builder to continue with building
|
||||
*
|
||||
* @throws IOException
|
||||
* In case of any networking error or error from the server.
|
||||
*/
|
||||
public S homepage(URL homepage) throws IOException {
|
||||
return homepage(homepage.toExternalForm());
|
||||
}
|
||||
|
||||
/**
|
||||
* Homepage for repository
|
||||
*
|
||||
* @param homepage
|
||||
* homepage of repository
|
||||
*
|
||||
* @return a builder to continue with building
|
||||
*
|
||||
* @throws IOException
|
||||
* In case of any networking error or error from the server.
|
||||
*/
|
||||
public S homepage(String homepage) throws IOException {
|
||||
return with("homepage", homepage);
|
||||
}
|
||||
|
||||
/**
|
||||
* Sets the repository to private
|
||||
*
|
||||
* @param enabled
|
||||
* private if true
|
||||
*
|
||||
* @return a builder to continue with building
|
||||
*
|
||||
* @throws IOException
|
||||
* In case of any networking error or error from the server.
|
||||
*/
|
||||
public S private_(boolean enabled) throws IOException {
|
||||
return with("private", enabled);
|
||||
}
|
||||
|
||||
/**
|
||||
* Enables issue tracker
|
||||
*
|
||||
* @param enabled
|
||||
* true if enabled
|
||||
*
|
||||
* @return a builder to continue with building
|
||||
*
|
||||
* @throws IOException
|
||||
* In case of any networking error or error from the server.
|
||||
*/
|
||||
public S issues(boolean enabled) throws IOException {
|
||||
return with("has_issues", enabled);
|
||||
}
|
||||
|
||||
/**
|
||||
* Enables projects
|
||||
*
|
||||
* @param enabled
|
||||
* true if enabled
|
||||
*
|
||||
* @return a builder to continue with building
|
||||
*
|
||||
* @throws IOException
|
||||
* In case of any networking error or error from the server.
|
||||
*/
|
||||
public S projects(boolean enabled) throws IOException {
|
||||
return with("has_projects", enabled);
|
||||
}
|
||||
|
||||
/**
|
||||
* Enables wiki
|
||||
*
|
||||
* @param enabled
|
||||
* true if enabled
|
||||
* @return a builder to continue with building
|
||||
* @throws IOException
|
||||
* In case of any networking error or error from the server.
|
||||
*/
|
||||
public S wiki(boolean enabled) throws IOException {
|
||||
return with("has_wiki", enabled);
|
||||
}
|
||||
|
||||
/**
|
||||
* Enables downloads
|
||||
*
|
||||
* @param enabled
|
||||
* true if enabled
|
||||
*
|
||||
* @return a builder to continue with building
|
||||
*
|
||||
* @throws IOException
|
||||
* In case of any networking error or error from the server.
|
||||
*/
|
||||
public S downloads(boolean enabled) throws IOException {
|
||||
return with("has_downloads", enabled);
|
||||
}
|
||||
|
||||
/**
|
||||
* Specifies whether the repository is a template.
|
||||
*
|
||||
* @param enabled
|
||||
* true if enabled
|
||||
* @return a builder to continue with building
|
||||
* @throws IOException
|
||||
* In case of any networking error or error from the server.
|
||||
*/
|
||||
@Preview(BAPTISTE)
|
||||
@Deprecated
|
||||
public S isTemplate(boolean enabled) throws IOException {
|
||||
requester.withPreview(BAPTISTE);
|
||||
return with("is_template", enabled);
|
||||
}
|
||||
|
||||
@Override
|
||||
public GHRepository done() throws IOException {
|
||||
return super.done().wrap(this.root);
|
||||
}
|
||||
|
||||
S archive() throws IOException {
|
||||
return with("archived", true);
|
||||
}
|
||||
|
||||
S name(String name) throws IOException {
|
||||
return with("name", name);
|
||||
}
|
||||
}
|
||||
@@ -16,10 +16,9 @@ import java.util.NoSuchElementException;
|
||||
*
|
||||
* @author Martin van Zijl
|
||||
*/
|
||||
public class GHRepositoryStatistics {
|
||||
public class GHRepositoryStatistics extends GitHubInteractiveObject {
|
||||
|
||||
private final GHRepository repo;
|
||||
private final GitHub root;
|
||||
|
||||
private static final int MAX_WAIT_ITERATIONS = 3;
|
||||
private static final int WAIT_SLEEP_INTERVAL = 5000;
|
||||
@@ -60,7 +59,7 @@ public class GHRepositoryStatistics {
|
||||
* @throws InterruptedException
|
||||
* the interrupted exception
|
||||
*/
|
||||
@Preview
|
||||
@BetaApi
|
||||
@Deprecated
|
||||
@SuppressWarnings("SleepWhileInLoop")
|
||||
@SuppressFBWarnings(value = { "RCN_REDUNDANT_NULLCHECK_OF_NONNULL_VALUE" }, justification = "JSON API")
|
||||
@@ -99,7 +98,6 @@ public class GHRepositoryStatistics {
|
||||
"URF_UNREAD_FIELD" },
|
||||
justification = "JSON API")
|
||||
public static class ContributorStats extends GHObject {
|
||||
/* package almost final */ private GitHub root;
|
||||
private GHUser author;
|
||||
private int total;
|
||||
private List<Week> weeks;
|
||||
@@ -255,7 +253,6 @@ public class GHRepositoryStatistics {
|
||||
value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
||||
justification = "JSON API")
|
||||
public static class CommitActivity extends GHObject {
|
||||
/* package almost final */ private GitHub root;
|
||||
private List<Integer> days;
|
||||
private int total;
|
||||
private long week;
|
||||
@@ -398,7 +395,6 @@ public class GHRepositoryStatistics {
|
||||
* The type Participation.
|
||||
*/
|
||||
public static class Participation extends GHObject {
|
||||
/* package almost final */ private GitHub root;
|
||||
private List<Integer> all;
|
||||
private List<Integer> owner;
|
||||
|
||||
|
||||
@@ -8,7 +8,6 @@ import java.net.URL;
|
||||
justification = "JSON API")
|
||||
public class GHRequestedAction extends GHObject {
|
||||
private GHRepository owner;
|
||||
private GitHub root;
|
||||
private String identifier;
|
||||
private String label;
|
||||
private String description;
|
||||
|
||||
@@ -25,6 +25,7 @@ public abstract class GHSearchBuilder<T> extends GHQueryBuilder<T> {
|
||||
super(root);
|
||||
this.receiverType = receiverType;
|
||||
req.withUrlPath(getApiUrl());
|
||||
req.rateLimit(RateLimitTarget.SEARCH);
|
||||
}
|
||||
|
||||
/**
|
||||
|
||||
@@ -10,11 +10,10 @@ import java.util.Date;
|
||||
* @see GHRepository#getSubscription() GHRepository#getSubscription()
|
||||
* @see GHThread#getSubscription() GHThread#getSubscription()
|
||||
*/
|
||||
public class GHSubscription {
|
||||
public class GHSubscription extends GitHubInteractiveObject {
|
||||
private String created_at, url, repository_url, reason;
|
||||
private boolean subscribed, ignored;
|
||||
|
||||
private GitHub root;
|
||||
private GHRepository repo;
|
||||
|
||||
/**
|
||||
|
||||
@@ -9,9 +9,8 @@ import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||
*/
|
||||
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
||||
justification = "JSON API")
|
||||
public class GHTag {
|
||||
public class GHTag extends GitHubInteractiveObject {
|
||||
private GHRepository owner;
|
||||
private GitHub root;
|
||||
|
||||
private String name;
|
||||
private GHCommit commit;
|
||||
|
||||
@@ -9,9 +9,8 @@ import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||
*/
|
||||
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
||||
justification = "JSON API")
|
||||
public class GHTagObject {
|
||||
public class GHTagObject extends GitHubInteractiveObject {
|
||||
private GHRepository owner;
|
||||
private GitHub root;
|
||||
|
||||
private String tag;
|
||||
private String sha;
|
||||
|
||||
@@ -24,8 +24,6 @@ public class GHTeam extends GHObject implements Refreshable {
|
||||
|
||||
private GHOrganization organization; // populated by GET /user/teams where Teams+Orgs are returned together
|
||||
|
||||
protected /* final */ GitHub root;
|
||||
|
||||
public enum Privacy {
|
||||
SECRET, // only visible to organization owners and members of this team.
|
||||
CLOSED // visible to all members of this organization.
|
||||
@@ -145,6 +143,22 @@ public class GHTeam extends GHObject implements Refreshable {
|
||||
return GHDiscussion.readAll(this);
|
||||
}
|
||||
|
||||
/**
|
||||
* List members with specified role paged iterable.
|
||||
*
|
||||
* @param role
|
||||
* the role
|
||||
* @return the paged iterable
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
public PagedIterable<GHUser> listMembers(String role) throws IOException {
|
||||
return root.createRequest()
|
||||
.withUrlPath(api("/members"))
|
||||
.with("role", role)
|
||||
.toIterable(GHUser[].class, item -> item.wrapUp(root));
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets a single discussion by ID.
|
||||
*
|
||||
@@ -171,7 +185,20 @@ public class GHTeam extends GHObject implements Refreshable {
|
||||
* the io exception
|
||||
*/
|
||||
public PagedIterable<GHUser> listMembers() throws IOException {
|
||||
return root.createRequest().withUrlPath(api("/members")).toIterable(GHUser[].class, item -> item.wrapUp(root));
|
||||
return listMembers("all");
|
||||
}
|
||||
|
||||
/**
|
||||
* Retrieves the teams that are children of this team.
|
||||
*
|
||||
* @return the paged iterable
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
public PagedIterable<GHTeam> listChildTeams() throws IOException {
|
||||
return root.createRequest()
|
||||
.withUrlPath(api("/teams"))
|
||||
.toIterable(GHTeam[].class, item -> item.wrapUp(this.organization));
|
||||
}
|
||||
|
||||
/**
|
||||
|
||||
@@ -7,9 +7,7 @@ import java.io.IOException;
|
||||
*
|
||||
* https://developer.github.com/v3/teams/#create-team
|
||||
*/
|
||||
public class GHTeamBuilder {
|
||||
|
||||
private final GitHub root;
|
||||
public class GHTeamBuilder extends GitHubInteractiveObject {
|
||||
protected final Requester builder;
|
||||
private final String orgName;
|
||||
|
||||
@@ -75,7 +73,7 @@ public class GHTeamBuilder {
|
||||
* parentTeamId of team
|
||||
* @return a builder to continue with building
|
||||
*/
|
||||
public GHTeamBuilder parentTeamId(int parentTeamId) {
|
||||
public GHTeamBuilder parentTeamId(long parentTeamId) {
|
||||
this.builder.with("parent_team_id", parentTeamId);
|
||||
return this;
|
||||
}
|
||||
|
||||
@@ -17,7 +17,6 @@ import java.util.Date;
|
||||
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
||||
justification = "JSON API")
|
||||
public class GHThread extends GHObject {
|
||||
private GitHub root;
|
||||
private GHRepository repository;
|
||||
private Subject subject;
|
||||
private String reason;
|
||||
|
||||
149
src/main/java/org/kohsuke/github/GHWorkflow.java
Normal file
149
src/main/java/org/kohsuke/github/GHWorkflow.java
Normal file
@@ -0,0 +1,149 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import com.fasterxml.jackson.annotation.JsonIgnore;
|
||||
import org.apache.commons.lang3.StringUtils;
|
||||
|
||||
import java.io.IOException;
|
||||
import java.net.URL;
|
||||
import java.util.Collections;
|
||||
import java.util.Map;
|
||||
import java.util.Objects;
|
||||
|
||||
/**
|
||||
* A workflow.
|
||||
*
|
||||
* @author Guillaume Smet
|
||||
* @see GHRepository#getWorkflow(long)
|
||||
*/
|
||||
public class GHWorkflow extends GHObject {
|
||||
|
||||
// Not provided by the API.
|
||||
@JsonIgnore
|
||||
private GHRepository owner;
|
||||
|
||||
private String name;
|
||||
private String path;
|
||||
private String state;
|
||||
|
||||
private String htmlUrl;
|
||||
private String badgeUrl;
|
||||
|
||||
/**
|
||||
* The name of the workflow.
|
||||
*
|
||||
* @return the name
|
||||
*/
|
||||
public String getName() {
|
||||
return name;
|
||||
}
|
||||
|
||||
/**
|
||||
* The path of the workflow e.g. .github/workflows/blank.yaml
|
||||
*
|
||||
* @return the path
|
||||
*/
|
||||
public String getPath() {
|
||||
return path;
|
||||
}
|
||||
|
||||
/**
|
||||
* The state of the workflow.
|
||||
*
|
||||
* @return the state
|
||||
*/
|
||||
public String getState() {
|
||||
return state;
|
||||
}
|
||||
|
||||
@Override
|
||||
public URL getHtmlUrl() throws IOException {
|
||||
return GitHubClient.parseURL(htmlUrl);
|
||||
}
|
||||
|
||||
/**
|
||||
* The badge URL, like https://github.com/octo-org/octo-repo/workflows/CI/badge.svg
|
||||
*
|
||||
* @return the badge url
|
||||
*/
|
||||
public URL getBadgeUrl() {
|
||||
return GitHubClient.parseURL(badgeUrl);
|
||||
}
|
||||
|
||||
/**
|
||||
* Disable the workflow.
|
||||
*
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
public void disable() throws IOException {
|
||||
root.createRequest().method("PUT").withUrlPath(getApiRoute(), "disable").fetchHttpStatusCode();
|
||||
}
|
||||
|
||||
/**
|
||||
* Enable the workflow.
|
||||
*
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
public void enable() throws IOException {
|
||||
root.createRequest().method("PUT").withUrlPath(getApiRoute(), "enable").fetchHttpStatusCode();
|
||||
}
|
||||
|
||||
/**
|
||||
* Create a workflow dispatch event which triggers a manual workflow run.
|
||||
*
|
||||
* @param ref
|
||||
* the git reference for the workflow. The reference can be a branch or tag name.
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
public void dispatch(String ref) throws IOException {
|
||||
dispatch(ref, Collections.emptyMap());
|
||||
}
|
||||
|
||||
/**
|
||||
* Create a workflow dispatch event which triggers a manual workflow run.
|
||||
*
|
||||
* @param ref
|
||||
* the git reference for the workflow. The reference can be a branch or tag name.
|
||||
* @param inputs
|
||||
* input keys and values configured in the workflow file. The maximum number of properties is 10. Any
|
||||
* default properties configured in the workflow file will be used when inputs are omitted.
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
public void dispatch(String ref, Map<String, Object> inputs) throws IOException {
|
||||
Requester requester = root.createRequest()
|
||||
.method("POST")
|
||||
.withUrlPath(getApiRoute(), "dispatches")
|
||||
.with("ref", ref);
|
||||
|
||||
if (!inputs.isEmpty()) {
|
||||
requester.with("inputs", inputs);
|
||||
}
|
||||
|
||||
requester.fetchHttpStatusCode();
|
||||
}
|
||||
|
||||
private String getApiRoute() {
|
||||
if (owner == null) {
|
||||
// Workflow runs returned from search to do not have an owner. Attempt to use url.
|
||||
final URL url = Objects.requireNonNull(getUrl(), "Missing instance URL!");
|
||||
return StringUtils.prependIfMissing(url.toString().replace(root.getApiUrl(), ""), "/");
|
||||
|
||||
}
|
||||
return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/actions/workflows/" + getId();
|
||||
}
|
||||
|
||||
GHWorkflow wrapUp(GHRepository owner) {
|
||||
this.owner = owner;
|
||||
return wrapUp(owner.root);
|
||||
}
|
||||
|
||||
GHWorkflow wrapUp(GitHub root) {
|
||||
this.root = root;
|
||||
if (owner != null)
|
||||
owner.wrap(root);
|
||||
return this;
|
||||
}
|
||||
}
|
||||
387
src/main/java/org/kohsuke/github/GHWorkflowRun.java
Normal file
387
src/main/java/org/kohsuke/github/GHWorkflowRun.java
Normal file
@@ -0,0 +1,387 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||
import org.apache.commons.lang3.StringUtils;
|
||||
import org.kohsuke.github.internal.EnumUtils;
|
||||
|
||||
import java.io.IOException;
|
||||
import java.net.URL;
|
||||
import java.util.Arrays;
|
||||
import java.util.Collections;
|
||||
import java.util.Date;
|
||||
import java.util.List;
|
||||
import java.util.Locale;
|
||||
import java.util.Objects;
|
||||
|
||||
/**
|
||||
* A workflow run.
|
||||
*
|
||||
* @author Guillaume Smet
|
||||
* @see GHRepository#getWorkflowRun(long)
|
||||
*/
|
||||
public class GHWorkflowRun extends GHObject {
|
||||
|
||||
@JsonProperty("repository")
|
||||
private GHRepository owner;
|
||||
|
||||
private String name;
|
||||
private long runNumber;
|
||||
private long workflowId;
|
||||
|
||||
private String htmlUrl;
|
||||
private String jobsUrl;
|
||||
private String logsUrl;
|
||||
private String checkSuiteUrl;
|
||||
private String artifactsUrl;
|
||||
private String cancelUrl;
|
||||
private String rerunUrl;
|
||||
private String workflowUrl;
|
||||
|
||||
private String headBranch;
|
||||
private String headSha;
|
||||
private GHRepository headRepository;
|
||||
private HeadCommit headCommit;
|
||||
|
||||
private String event;
|
||||
private String status;
|
||||
private String conclusion;
|
||||
|
||||
private GHPullRequest[] pullRequests;
|
||||
|
||||
/**
|
||||
* The name of the workflow run.
|
||||
*
|
||||
* @return the name
|
||||
*/
|
||||
public String getName() {
|
||||
return name;
|
||||
}
|
||||
|
||||
/**
|
||||
* The run number.
|
||||
*
|
||||
* @return the run number
|
||||
*/
|
||||
public long getRunNumber() {
|
||||
return runNumber;
|
||||
}
|
||||
|
||||
/**
|
||||
* The workflow id.
|
||||
*
|
||||
* @return the workflow id
|
||||
*/
|
||||
public long getWorkflowId() {
|
||||
return workflowId;
|
||||
}
|
||||
|
||||
@Override
|
||||
public URL getHtmlUrl() throws IOException {
|
||||
return GitHubClient.parseURL(htmlUrl);
|
||||
}
|
||||
|
||||
/**
|
||||
* The jobs URL, like https://api.github.com/repos/octo-org/octo-repo/actions/runs/30433642/jobs
|
||||
*
|
||||
* @return the diff url
|
||||
*/
|
||||
public URL getJobsUrl() {
|
||||
return GitHubClient.parseURL(jobsUrl);
|
||||
}
|
||||
|
||||
/**
|
||||
* The logs URL, like https://api.github.com/repos/octo-org/octo-repo/actions/runs/30433642/logs
|
||||
*
|
||||
* @return the diff url
|
||||
*/
|
||||
public URL getLogsUrl() {
|
||||
return GitHubClient.parseURL(logsUrl);
|
||||
}
|
||||
|
||||
/**
|
||||
* The check suite URL, like https://api.github.com/repos/octo-org/octo-repo/check-suites/414944374
|
||||
*
|
||||
* @return the diff url
|
||||
*/
|
||||
public URL getCheckSuiteUrl() {
|
||||
return GitHubClient.parseURL(checkSuiteUrl);
|
||||
}
|
||||
|
||||
/**
|
||||
* The artifacts URL, like https://api.github.com/repos/octo-org/octo-repo/actions/runs/30433642/artifacts
|
||||
*
|
||||
* @return the diff url
|
||||
*/
|
||||
public URL getArtifactsUrl() {
|
||||
return GitHubClient.parseURL(artifactsUrl);
|
||||
}
|
||||
|
||||
/**
|
||||
* The cancel URL, like https://api.github.com/repos/octo-org/octo-repo/actions/runs/30433642/cancel
|
||||
*
|
||||
* @return the diff url
|
||||
*/
|
||||
public URL getCancelUrl() {
|
||||
return GitHubClient.parseURL(cancelUrl);
|
||||
}
|
||||
|
||||
/**
|
||||
* The rerun URL, like https://api.github.com/repos/octo-org/octo-repo/actions/runs/30433642/rerun
|
||||
*
|
||||
* @return the diff url
|
||||
*/
|
||||
public URL getRerunUrl() {
|
||||
return GitHubClient.parseURL(rerunUrl);
|
||||
}
|
||||
|
||||
/**
|
||||
* The workflow URL, like https://api.github.com/repos/octo-org/octo-repo/actions/workflows/159038
|
||||
*
|
||||
* @return the diff url
|
||||
*/
|
||||
public URL getWorkflowUrl() {
|
||||
return GitHubClient.parseURL(workflowUrl);
|
||||
}
|
||||
|
||||
/**
|
||||
* The head branch name the changes are on.
|
||||
*
|
||||
* @return head branch name
|
||||
*/
|
||||
public String getHeadBranch() {
|
||||
return headBranch;
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets the HEAD SHA.
|
||||
*
|
||||
* @return sha for the HEAD commit
|
||||
*/
|
||||
public String getHeadSha() {
|
||||
return headSha;
|
||||
}
|
||||
|
||||
/**
|
||||
* The commit of current head.
|
||||
*
|
||||
* @return head commit
|
||||
*/
|
||||
public HeadCommit getHeadCommit() {
|
||||
return headCommit;
|
||||
}
|
||||
|
||||
/**
|
||||
* The repository of current head.
|
||||
*
|
||||
* @return head repository
|
||||
*/
|
||||
public GHRepository getHeadRepository() {
|
||||
return headRepository;
|
||||
}
|
||||
|
||||
/**
|
||||
* The type of event that triggered the build.
|
||||
*
|
||||
* @return type of event
|
||||
*/
|
||||
public GHEvent getEvent() {
|
||||
return Enum.valueOf(GHEvent.class, event.toUpperCase(Locale.ROOT));
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets status of the workflow run.
|
||||
* <p>
|
||||
* Can be {@code UNKNOWN} if the value returned by GitHub is unknown from the API.
|
||||
*
|
||||
* @return status of the workflow run
|
||||
*/
|
||||
public Status getStatus() {
|
||||
return Status.from(status);
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets the conclusion of the workflow run.
|
||||
* <p>
|
||||
* Can be {@code UNKNOWN} if the value returned by GitHub is unknown from the API.
|
||||
*
|
||||
* @return conclusion of the workflow run
|
||||
*/
|
||||
public Conclusion getConclusion() {
|
||||
return Conclusion.from(conclusion);
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets the pull requests participated in this workflow run.
|
||||
*
|
||||
* Note this field is only populated for events. When getting a {@link GHWorkflowRun} outside of an event, this is
|
||||
* always empty.
|
||||
*
|
||||
* @return the list of {@link GHPullRequest}s for this workflow run. Only populated for events.
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
public List<GHPullRequest> getPullRequests() throws IOException {
|
||||
if (pullRequests != null && pullRequests.length != 0) {
|
||||
for (GHPullRequest pullRequest : pullRequests) {
|
||||
// Only refresh if we haven't do so before
|
||||
pullRequest.refresh(pullRequest.getTitle());
|
||||
}
|
||||
return Collections.unmodifiableList(Arrays.asList(pullRequests));
|
||||
}
|
||||
return Collections.emptyList();
|
||||
}
|
||||
|
||||
/**
|
||||
* Cancel the workflow run.
|
||||
*
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
public void cancel() throws IOException {
|
||||
root.createRequest().method("POST").withUrlPath(getApiRoute(), "cancel").fetchHttpStatusCode();
|
||||
}
|
||||
|
||||
/**
|
||||
* Delete the workflow run.
|
||||
*
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
public void delete() throws IOException {
|
||||
root.createRequest().method("DELETE").withUrlPath(getApiRoute()).fetchHttpStatusCode();
|
||||
}
|
||||
|
||||
/**
|
||||
* Rerun the workflow run.
|
||||
*
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
public void rerun() throws IOException {
|
||||
root.createRequest().method("POST").withUrlPath(getApiRoute(), "rerun").fetchHttpStatusCode();
|
||||
}
|
||||
|
||||
private String getApiRoute() {
|
||||
if (owner == null) {
|
||||
// Workflow runs returned from search to do not have an owner. Attempt to use url.
|
||||
final URL url = Objects.requireNonNull(getUrl(), "Missing instance URL!");
|
||||
return StringUtils.prependIfMissing(url.toString().replace(root.getApiUrl(), ""), "/");
|
||||
|
||||
}
|
||||
return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/actions/runs/" + getId();
|
||||
}
|
||||
|
||||
GHWorkflowRun wrapUp(GHRepository owner) {
|
||||
this.owner = owner;
|
||||
return wrapUp(owner.root);
|
||||
}
|
||||
|
||||
GHWorkflowRun wrapUp(GitHub root) {
|
||||
this.root = root;
|
||||
if (owner != null) {
|
||||
owner.wrap(root);
|
||||
if (pullRequests != null) {
|
||||
for (GHPullRequest singlePull : pullRequests) {
|
||||
singlePull.wrap(owner);
|
||||
}
|
||||
}
|
||||
} else if (pullRequests != null) {
|
||||
for (GHPullRequest singlePull : pullRequests) {
|
||||
singlePull.wrap(root);
|
||||
}
|
||||
}
|
||||
if (headRepository != null) {
|
||||
headRepository.wrap(root);
|
||||
}
|
||||
return this;
|
||||
}
|
||||
|
||||
public static class HeadCommit {
|
||||
private String id;
|
||||
private String treeId;
|
||||
private String message;
|
||||
private String timestamp;
|
||||
private GitUser author;
|
||||
private GitUser committer;
|
||||
|
||||
/**
|
||||
* Gets id of the commit
|
||||
*
|
||||
* @return id of the commit
|
||||
*/
|
||||
public String getId() {
|
||||
return id;
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets id of the tree.
|
||||
*
|
||||
* @return id of the tree
|
||||
*/
|
||||
public String getTreeId() {
|
||||
return treeId;
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets message.
|
||||
*
|
||||
* @return commit message.
|
||||
*/
|
||||
public String getMessage() {
|
||||
return message;
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets timestamp of the commit.
|
||||
*
|
||||
* @return timestamp of the commit
|
||||
*/
|
||||
public Date getTimestamp() {
|
||||
return GitHubClient.parseDate(timestamp);
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets author.
|
||||
*
|
||||
* @return the author
|
||||
*/
|
||||
public GitUser getAuthor() {
|
||||
return author;
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets committer.
|
||||
*
|
||||
* @return the committer
|
||||
*/
|
||||
public GitUser getCommitter() {
|
||||
return committer;
|
||||
}
|
||||
}
|
||||
|
||||
public static enum Status {
|
||||
QUEUED, IN_PROGRESS, COMPLETED, UNKNOWN;
|
||||
|
||||
public static Status from(String value) {
|
||||
return EnumUtils.getNullableEnumOrDefault(Status.class, value, Status.UNKNOWN);
|
||||
}
|
||||
|
||||
@Override
|
||||
public String toString() {
|
||||
return name().toLowerCase(Locale.ROOT);
|
||||
}
|
||||
}
|
||||
|
||||
public static enum Conclusion {
|
||||
ACTION_REQUIRED, CANCELLED, FAILURE, NEUTRAL, SUCCESS, SKIPPED, STALE, TIMED_OUT, UNKNOWN;
|
||||
|
||||
public static Conclusion from(String value) {
|
||||
return EnumUtils.getNullableEnumOrDefault(Conclusion.class, value, Conclusion.UNKNOWN);
|
||||
}
|
||||
|
||||
@Override
|
||||
public String toString() {
|
||||
return name().toLowerCase(Locale.ROOT);
|
||||
}
|
||||
}
|
||||
}
|
||||
101
src/main/java/org/kohsuke/github/GHWorkflowRunQueryBuilder.java
Normal file
101
src/main/java/org/kohsuke/github/GHWorkflowRunQueryBuilder.java
Normal file
@@ -0,0 +1,101 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import org.kohsuke.github.GHWorkflowRun.Status;
|
||||
|
||||
import java.net.MalformedURLException;
|
||||
|
||||
/**
|
||||
* Lists up workflow runs with some filtering and sorting.
|
||||
*
|
||||
* @author Guillaume Smet
|
||||
* @see GHRepository#queryWorkflowRuns()
|
||||
*/
|
||||
public class GHWorkflowRunQueryBuilder extends GHQueryBuilder<GHWorkflowRun> {
|
||||
private final GHRepository repo;
|
||||
|
||||
GHWorkflowRunQueryBuilder(GHRepository repo) {
|
||||
super(repo.root);
|
||||
this.repo = repo;
|
||||
}
|
||||
|
||||
/**
|
||||
* Actor workflow run query builder.
|
||||
*
|
||||
* @param actor
|
||||
* the actor
|
||||
* @return the gh workflow run query builder
|
||||
*/
|
||||
public GHWorkflowRunQueryBuilder actor(String actor) {
|
||||
req.with("actor", actor);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Actor workflow run query builder.
|
||||
*
|
||||
* @param actor
|
||||
* the actor
|
||||
* @return the gh workflow run query builder
|
||||
*/
|
||||
public GHWorkflowRunQueryBuilder actor(GHUser actor) {
|
||||
req.with("actor", actor.getLogin());
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Branch workflow run query builder.
|
||||
*
|
||||
* @param branch
|
||||
* the branch
|
||||
* @return the gh workflow run query builder
|
||||
*/
|
||||
public GHWorkflowRunQueryBuilder branch(String branch) {
|
||||
req.with("branch", branch);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Event workflow run query builder.
|
||||
*
|
||||
* @param event
|
||||
* the event
|
||||
* @return the gh workflow run query builder
|
||||
*/
|
||||
public GHWorkflowRunQueryBuilder event(GHEvent event) {
|
||||
req.with("event", event.symbol());
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Event workflow run query builder.
|
||||
*
|
||||
* @param event
|
||||
* the event
|
||||
* @return the gh workflow run query builder
|
||||
*/
|
||||
public GHWorkflowRunQueryBuilder event(String event) {
|
||||
req.with("event", event);
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Status workflow run query builder.
|
||||
*
|
||||
* @param status
|
||||
* the status
|
||||
* @return the gh workflow run query builder
|
||||
*/
|
||||
public GHWorkflowRunQueryBuilder status(Status status) {
|
||||
req.with("status", status.toString());
|
||||
return this;
|
||||
}
|
||||
|
||||
@Override
|
||||
public PagedIterable<GHWorkflowRun> list() {
|
||||
try {
|
||||
return new GHWorkflowRunsIterable(root, req.withUrlPath(repo.getApiTailUrl("actions/runs")).build());
|
||||
} catch (MalformedURLException e) {
|
||||
throw new GHException(e.getMessage(), e);
|
||||
}
|
||||
}
|
||||
}
|
||||
44
src/main/java/org/kohsuke/github/GHWorkflowRunsIterable.java
Normal file
44
src/main/java/org/kohsuke/github/GHWorkflowRunsIterable.java
Normal file
@@ -0,0 +1,44 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import java.util.Iterator;
|
||||
|
||||
import javax.annotation.Nonnull;
|
||||
|
||||
/**
|
||||
* Iterable for workflow runs listing.
|
||||
*/
|
||||
class GHWorkflowRunsIterable extends PagedIterable<GHWorkflowRun> {
|
||||
private final transient GitHub root;
|
||||
private final GitHubRequest request;
|
||||
|
||||
private GHWorkflowRunsPage result;
|
||||
|
||||
public GHWorkflowRunsIterable(GitHub root, GitHubRequest request) {
|
||||
this.root = root;
|
||||
this.request = request;
|
||||
}
|
||||
|
||||
@Nonnull
|
||||
@Override
|
||||
public PagedIterator<GHWorkflowRun> _iterator(int pageSize) {
|
||||
return new PagedIterator<>(
|
||||
adapt(GitHubPageIterator.create(root.getClient(), GHWorkflowRunsPage.class, request, pageSize)),
|
||||
null);
|
||||
}
|
||||
|
||||
protected Iterator<GHWorkflowRun[]> adapt(final Iterator<GHWorkflowRunsPage> base) {
|
||||
return new Iterator<GHWorkflowRun[]>() {
|
||||
public boolean hasNext() {
|
||||
return base.hasNext();
|
||||
}
|
||||
|
||||
public GHWorkflowRun[] next() {
|
||||
GHWorkflowRunsPage v = base.next();
|
||||
if (result == null) {
|
||||
result = v;
|
||||
}
|
||||
return v.getWorkflowRuns(root);
|
||||
}
|
||||
};
|
||||
}
|
||||
}
|
||||
20
src/main/java/org/kohsuke/github/GHWorkflowRunsPage.java
Normal file
20
src/main/java/org/kohsuke/github/GHWorkflowRunsPage.java
Normal file
@@ -0,0 +1,20 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
/**
|
||||
* Represents the one page of workflow runs result when listing workflow runs.
|
||||
*/
|
||||
class GHWorkflowRunsPage {
|
||||
private int totalCount;
|
||||
private GHWorkflowRun[] workflowRuns;
|
||||
|
||||
public int getTotalCount() {
|
||||
return totalCount;
|
||||
}
|
||||
|
||||
GHWorkflowRun[] getWorkflowRuns(GitHub root) {
|
||||
for (GHWorkflowRun workflowRun : workflowRuns) {
|
||||
workflowRun.wrapUp(root);
|
||||
}
|
||||
return workflowRuns;
|
||||
}
|
||||
}
|
||||
53
src/main/java/org/kohsuke/github/GHWorkflowsIterable.java
Normal file
53
src/main/java/org/kohsuke/github/GHWorkflowsIterable.java
Normal file
@@ -0,0 +1,53 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import java.net.MalformedURLException;
|
||||
import java.util.Iterator;
|
||||
|
||||
import javax.annotation.Nonnull;
|
||||
|
||||
/**
|
||||
* Iterable for workflows listing.
|
||||
*/
|
||||
class GHWorkflowsIterable extends PagedIterable<GHWorkflow> {
|
||||
private final transient GHRepository owner;
|
||||
|
||||
private GHWorkflowsPage result;
|
||||
|
||||
public GHWorkflowsIterable(GHRepository owner) {
|
||||
this.owner = owner;
|
||||
}
|
||||
|
||||
@Nonnull
|
||||
@Override
|
||||
public PagedIterator<GHWorkflow> _iterator(int pageSize) {
|
||||
try {
|
||||
GitHubRequest request = owner.getRoot()
|
||||
.createRequest()
|
||||
.withUrlPath(owner.getApiTailUrl("actions/workflows"))
|
||||
.build();
|
||||
|
||||
return new PagedIterator<>(
|
||||
adapt(GitHubPageIterator
|
||||
.create(owner.getRoot().getClient(), GHWorkflowsPage.class, request, pageSize)),
|
||||
null);
|
||||
} catch (MalformedURLException e) {
|
||||
throw new GHException("Malformed URL", e);
|
||||
}
|
||||
}
|
||||
|
||||
protected Iterator<GHWorkflow[]> adapt(final Iterator<GHWorkflowsPage> base) {
|
||||
return new Iterator<GHWorkflow[]>() {
|
||||
public boolean hasNext() {
|
||||
return base.hasNext();
|
||||
}
|
||||
|
||||
public GHWorkflow[] next() {
|
||||
GHWorkflowsPage v = base.next();
|
||||
if (result == null) {
|
||||
result = v;
|
||||
}
|
||||
return v.getWorkflows(owner);
|
||||
}
|
||||
};
|
||||
}
|
||||
}
|
||||
20
src/main/java/org/kohsuke/github/GHWorkflowsPage.java
Normal file
20
src/main/java/org/kohsuke/github/GHWorkflowsPage.java
Normal file
@@ -0,0 +1,20 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
/**
|
||||
* Represents the one page of workflow result when listing workflows.
|
||||
*/
|
||||
class GHWorkflowsPage {
|
||||
private int total_count;
|
||||
private GHWorkflow[] workflows;
|
||||
|
||||
public int getTotalCount() {
|
||||
return total_count;
|
||||
}
|
||||
|
||||
GHWorkflow[] getWorkflows(GHRepository owner) {
|
||||
for (GHWorkflow workflow : workflows) {
|
||||
workflow.wrapUp(owner);
|
||||
}
|
||||
return workflows;
|
||||
}
|
||||
}
|
||||
@@ -26,6 +26,8 @@ package org.kohsuke.github;
|
||||
import com.fasterxml.jackson.databind.ObjectReader;
|
||||
import com.fasterxml.jackson.databind.ObjectWriter;
|
||||
import com.infradna.tool.bridge_method_injector.WithBridgeMethods;
|
||||
import org.kohsuke.github.authorization.AuthorizationProvider;
|
||||
import org.kohsuke.github.internal.Previews;
|
||||
|
||||
import java.io.*;
|
||||
import java.util.*;
|
||||
@@ -37,8 +39,8 @@ import java.util.logging.Logger;
|
||||
import javax.annotation.CheckForNull;
|
||||
import javax.annotation.Nonnull;
|
||||
|
||||
import static org.kohsuke.github.Previews.INERTIA;
|
||||
import static org.kohsuke.github.Previews.MACHINE_MAN;
|
||||
import static org.kohsuke.github.internal.Previews.INERTIA;
|
||||
import static org.kohsuke.github.internal.Previews.MACHINE_MAN;
|
||||
|
||||
/**
|
||||
* Root of the GitHub API.
|
||||
@@ -93,39 +95,112 @@ public class GitHub {
|
||||
* "http://ghe.acme.com/api/v3". Note that GitHub Enterprise has <code>/api/v3</code> in the URL. For
|
||||
* historical reasons, this parameter still accepts the bare domain name, but that's considered
|
||||
* deprecated. Password is also considered deprecated as it is no longer required for api usage.
|
||||
* @param login
|
||||
* The user ID on GitHub that you are logging in as. Can be omitted if the OAuth token is provided or if
|
||||
* logging in anonymously. Specifying this would save one API call.
|
||||
* @param oauthAccessToken
|
||||
* Secret OAuth token.
|
||||
* @param password
|
||||
* User's password. Always used in conjunction with the {@code login} parameter
|
||||
* @param connector
|
||||
* HttpConnector to use. Pass null to use default connector.
|
||||
* a connector
|
||||
* @param rateLimitHandler
|
||||
* rateLimitHandler
|
||||
* @param abuseLimitHandler
|
||||
* abuseLimitHandler
|
||||
* @param rateLimitChecker
|
||||
* rateLimitChecker
|
||||
* @param authorizationProvider
|
||||
* a authorization provider
|
||||
*/
|
||||
GitHub(String apiUrl,
|
||||
String login,
|
||||
String oauthAccessToken,
|
||||
String jwtToken,
|
||||
String password,
|
||||
HttpConnector connector,
|
||||
RateLimitHandler rateLimitHandler,
|
||||
AbuseLimitHandler abuseLimitHandler,
|
||||
GitHubRateLimitChecker rateLimitChecker) throws IOException {
|
||||
GitHubRateLimitChecker rateLimitChecker,
|
||||
AuthorizationProvider authorizationProvider) throws IOException {
|
||||
if (authorizationProvider instanceof DependentAuthorizationProvider) {
|
||||
((DependentAuthorizationProvider) authorizationProvider).bind(this);
|
||||
}
|
||||
|
||||
this.client = new GitHubHttpUrlConnectionClient(apiUrl,
|
||||
login,
|
||||
oauthAccessToken,
|
||||
jwtToken,
|
||||
password,
|
||||
connector,
|
||||
rateLimitHandler,
|
||||
abuseLimitHandler,
|
||||
rateLimitChecker,
|
||||
(myself) -> setMyself(myself));
|
||||
(myself) -> setMyself(myself),
|
||||
authorizationProvider);
|
||||
users = new ConcurrentHashMap<>();
|
||||
orgs = new ConcurrentHashMap<>();
|
||||
}
|
||||
|
||||
private GitHub(GitHubClient client) {
|
||||
this.client = client;
|
||||
users = new ConcurrentHashMap<>();
|
||||
orgs = new ConcurrentHashMap<>();
|
||||
}
|
||||
|
||||
public static abstract class DependentAuthorizationProvider implements AuthorizationProvider {
|
||||
|
||||
private GitHub baseGitHub;
|
||||
private GitHub gitHub;
|
||||
private final AuthorizationProvider authorizationProvider;
|
||||
|
||||
/**
|
||||
* An AuthorizationProvider that requires an authenticated GitHub instance to provide its authorization.
|
||||
*
|
||||
* @param authorizationProvider
|
||||
* A authorization provider to be used when refreshing this authorization provider.
|
||||
*/
|
||||
@BetaApi
|
||||
@Deprecated
|
||||
protected DependentAuthorizationProvider(AuthorizationProvider authorizationProvider) {
|
||||
this.authorizationProvider = authorizationProvider;
|
||||
}
|
||||
|
||||
/**
|
||||
* Binds this authorization provider to a github instance.
|
||||
*
|
||||
* Only needs to be implemented by dynamic credentials providers that use a github instance in order to refresh.
|
||||
*
|
||||
* @param github
|
||||
* The github instance to be used for refreshing dynamic credentials
|
||||
*/
|
||||
synchronized void bind(GitHub github) {
|
||||
if (baseGitHub != null) {
|
||||
throw new IllegalStateException("Already bound to another GitHub instance.");
|
||||
}
|
||||
this.baseGitHub = github;
|
||||
}
|
||||
|
||||
protected synchronized final GitHub gitHub() {
|
||||
if (gitHub == null) {
|
||||
gitHub = new GitHub.AuthorizationRefreshGitHubWrapper(this.baseGitHub, authorizationProvider);
|
||||
}
|
||||
return gitHub;
|
||||
}
|
||||
}
|
||||
|
||||
private static class AuthorizationRefreshGitHubWrapper extends GitHub {
|
||||
|
||||
private final AuthorizationProvider authorizationProvider;
|
||||
|
||||
AuthorizationRefreshGitHubWrapper(GitHub github, AuthorizationProvider authorizationProvider) {
|
||||
super(github.client);
|
||||
this.authorizationProvider = authorizationProvider;
|
||||
|
||||
// no dependent authorization providers nest like this currently, but they might in future
|
||||
if (authorizationProvider instanceof DependentAuthorizationProvider) {
|
||||
((DependentAuthorizationProvider) authorizationProvider).bind(this);
|
||||
}
|
||||
}
|
||||
|
||||
@Nonnull
|
||||
@Override
|
||||
Requester createRequest() {
|
||||
try {
|
||||
// Override
|
||||
return super.createRequest().setHeader("Authorization", authorizationProvider.getEncodedAuthorization())
|
||||
.rateLimit(RateLimitTarget.NONE);
|
||||
} catch (IOException e) {
|
||||
throw new GHException("Failed to create requester to refresh credentials", e);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Obtains the credential from "~/.github" or from the System Environment Properties.
|
||||
*
|
||||
@@ -373,12 +448,20 @@ public class GitHub {
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets the current rate limit.
|
||||
* Gets the current full rate limit information from the server.
|
||||
*
|
||||
* For some versions of GitHub Enterprise, the {@code /rate_limit} endpoint returns a {@code 404 Not Found}. In that
|
||||
* case, the most recent {@link GHRateLimit} information will be returned, including rate limit information returned
|
||||
* in the response header for this request in if was present.
|
||||
*
|
||||
* For most use cases it would be better to implement a {@link RateLimitChecker} and add it via
|
||||
* {@link GitHubBuilder#withRateLimitChecker(RateLimitChecker)}.
|
||||
*
|
||||
* @return the rate limit
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
@Nonnull
|
||||
public GHRateLimit getRateLimit() throws IOException {
|
||||
return client.getRateLimit();
|
||||
}
|
||||
@@ -388,8 +471,11 @@ public class GitHub {
|
||||
* GitHub Enterprise) or if no requests have been made.
|
||||
*
|
||||
* @return the most recently observed rate limit data or {@code null}.
|
||||
* @deprecated implement a {@link RateLimitChecker} and add it via
|
||||
* {@link GitHubBuilder#withRateLimitChecker(RateLimitChecker)}.
|
||||
*/
|
||||
@CheckForNull
|
||||
@Nonnull
|
||||
@Deprecated
|
||||
public GHRateLimit lastRateLimit() {
|
||||
return client.lastRateLimit();
|
||||
}
|
||||
@@ -400,10 +486,13 @@ public class GitHub {
|
||||
* @return the current rate limit data.
|
||||
* @throws IOException
|
||||
* if we couldn't get the current rate limit data.
|
||||
* @deprecated implement a {@link RateLimitChecker} and add it via
|
||||
* {@link GitHubBuilder#withRateLimitChecker(RateLimitChecker)}.
|
||||
*/
|
||||
@Nonnull
|
||||
@Deprecated
|
||||
public GHRateLimit rateLimit() throws IOException {
|
||||
return client.rateLimit();
|
||||
return client.rateLimit(RateLimitTarget.CORE);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -518,7 +607,7 @@ public class GitHub {
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets the repository object from 'user/reponame' string that GitHub calls as "repository name"
|
||||
* Gets the repository object from 'owner/repo' string that GitHub calls as "repository name"
|
||||
*
|
||||
* @param name
|
||||
* the name
|
||||
@@ -529,9 +618,27 @@ public class GitHub {
|
||||
*/
|
||||
public GHRepository getRepository(String name) throws IOException {
|
||||
String[] tokens = name.split("/");
|
||||
return createRequest().withUrlPath("/repos/" + tokens[0] + '/' + tokens[1])
|
||||
.fetch(GHRepository.class)
|
||||
.wrap(this);
|
||||
if (tokens.length < 2) {
|
||||
throw new IllegalArgumentException("Repository name must be in format owner/repo");
|
||||
}
|
||||
return GHRepository.read(this, tokens[0], tokens[1]);
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets the repository object from its ID
|
||||
*
|
||||
* @param id
|
||||
* the id
|
||||
* @return the repository by id
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*
|
||||
* @deprecated Do not use this method. It was added due to misunderstanding of the type of parameter. Use
|
||||
* {@link #getRepositoryById(long)} instead
|
||||
*/
|
||||
@Deprecated
|
||||
public GHRepository getRepositoryById(String id) throws IOException {
|
||||
return createRequest().withUrlPath("/repositories/" + id).fetch(GHRepository.class).wrap(this);
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -543,7 +650,7 @@ public class GitHub {
|
||||
* @throws IOException
|
||||
* the io exception
|
||||
*/
|
||||
public GHRepository getRepositoryById(String id) throws IOException {
|
||||
public GHRepository getRepositoryById(long id) throws IOException {
|
||||
return createRequest().withUrlPath("/repositories/" + id).fetch(GHRepository.class).wrap(this);
|
||||
}
|
||||
|
||||
@@ -830,7 +937,7 @@ public class GitHub {
|
||||
* @return the gh create repository builder
|
||||
*/
|
||||
public GHCreateRepositoryBuilder createRepository(String name) {
|
||||
return new GHCreateRepositoryBuilder(this, "/user/repos", name);
|
||||
return new GHCreateRepositoryBuilder(name, this, "/user/repos");
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -998,7 +1105,7 @@ public class GitHub {
|
||||
* @see <a href="https://developer.github.com/v3/apps/#get-the-authenticated-github-app">Get the authenticated
|
||||
* GitHub App</a>
|
||||
*/
|
||||
@Preview
|
||||
@Preview(MACHINE_MAN)
|
||||
@Deprecated
|
||||
public GHApp getApp() throws IOException {
|
||||
return createRequest().withPreview(MACHINE_MAN).withUrlPath("/app").fetch(GHApp.class).wrapUp(this);
|
||||
@@ -1093,7 +1200,7 @@ public class GitHub {
|
||||
*
|
||||
* @return the gh commit search builder
|
||||
*/
|
||||
@Preview
|
||||
@Preview(Previews.CLOAK)
|
||||
@Deprecated
|
||||
public GHCommitSearchBuilder searchCommits() {
|
||||
return new GHCommitSearchBuilder(this);
|
||||
@@ -1188,31 +1295,39 @@ public class GitHub {
|
||||
.with(new ByteArrayInputStream(text.getBytes("UTF-8")))
|
||||
.contentType("text/plain;charset=UTF-8")
|
||||
.withUrlPath("/markdown/raw")
|
||||
.fetchStream(),
|
||||
.fetchStream(Requester::copyInputStream),
|
||||
"UTF-8");
|
||||
}
|
||||
|
||||
/**
|
||||
* Do not use this method. This method will be removed and should never have been needed in the first place.
|
||||
* Gets an {@link ObjectWriter} that can be used to convert data objects in this library to JSON.
|
||||
*
|
||||
* If you must convert data object in this library to JSON, the {@link ObjectWriter} returned by this method is the
|
||||
* only supported way of doing so. This {@link ObjectWriter} can be used to convert any library data object to JSON
|
||||
* without throwing an exception.
|
||||
*
|
||||
* WARNING: While the JSON generated is generally expected to be stable, it is not part of the API of this library
|
||||
* and may change without warning. Use with extreme caution.
|
||||
*
|
||||
* @return an {@link ObjectWriter} instance that can be further configured.
|
||||
* @deprecated DO NOT USE THIS METHOD. Provided for backward compatibility with projects that did their own jackson
|
||||
* mapping of this project's data objects, such as Jenkins Blue Ocean.
|
||||
*/
|
||||
@Deprecated
|
||||
@Nonnull
|
||||
public static ObjectWriter getMappingObjectWriter() {
|
||||
return GitHubClient.getMappingObjectWriter();
|
||||
}
|
||||
|
||||
/**
|
||||
* Do not use this method. This method will be removed and should never have been needed in the first place.
|
||||
* Gets an {@link ObjectReader} that can be used to convert JSON into library data objects.
|
||||
*
|
||||
* If you must manually create library data objects from JSON, the {@link ObjectReader} returned by this method is
|
||||
* the only supported way of doing so.
|
||||
*
|
||||
* WARNING: Objects generated from this method have limited functionality. They will not throw when being crated
|
||||
* from valid JSON matching the expected object, but they are not guaranteed to be usable beyond that. Use with
|
||||
* extreme caution.
|
||||
*
|
||||
* @return an {@link ObjectReader} instance that can be further configured.
|
||||
* @deprecated DO NOT USE THIS METHOD. Provided for backward compatibility with projects that did their own jackson
|
||||
* mapping of this project's data objects, such as Jenkins Blue Ocean.
|
||||
*/
|
||||
@Deprecated
|
||||
@Nonnull
|
||||
public static ObjectReader getMappingObjectReader() {
|
||||
return GitHubClient.getMappingObjectReader(GitHub.offline());
|
||||
|
||||
@@ -1,6 +1,8 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import org.apache.commons.io.IOUtils;
|
||||
import org.kohsuke.github.authorization.AuthorizationProvider;
|
||||
import org.kohsuke.github.authorization.ImmutableAuthorizationProvider;
|
||||
import org.kohsuke.github.extras.ImpatientHttpConnector;
|
||||
|
||||
import java.io.File;
|
||||
@@ -24,16 +26,13 @@ public class GitHubBuilder implements Cloneable {
|
||||
|
||||
// default scoped so unit tests can read them.
|
||||
/* private */ String endpoint = GitHubClient.GITHUB_URL;
|
||||
/* private */ String user;
|
||||
/* private */ String password;
|
||||
/* private */ String oauthToken;
|
||||
/* private */ String jwtToken;
|
||||
|
||||
private HttpConnector connector;
|
||||
|
||||
private RateLimitHandler rateLimitHandler = RateLimitHandler.WAIT;
|
||||
private AbuseLimitHandler abuseLimitHandler = AbuseLimitHandler.WAIT;
|
||||
private GitHubRateLimitChecker rateLimitChecker = new GitHubRateLimitChecker();
|
||||
/* private */ AuthorizationProvider authorizationProvider = AuthorizationProvider.ANONYMOUS;
|
||||
|
||||
/**
|
||||
* Instantiates a new Git hub builder.
|
||||
@@ -61,13 +60,13 @@ public class GitHubBuilder implements Cloneable {
|
||||
|
||||
builder = fromEnvironment();
|
||||
|
||||
if (builder.oauthToken != null || builder.user != null || builder.jwtToken != null)
|
||||
if (builder.authorizationProvider != null)
|
||||
return builder;
|
||||
|
||||
try {
|
||||
builder = fromPropertyFile();
|
||||
|
||||
if (builder.oauthToken != null || builder.user != null || builder.jwtToken != null)
|
||||
if (builder.authorizationProvider != null)
|
||||
return builder;
|
||||
} catch (FileNotFoundException e) {
|
||||
// fall through
|
||||
@@ -215,9 +214,20 @@ public class GitHubBuilder implements Cloneable {
|
||||
*/
|
||||
public static GitHubBuilder fromProperties(Properties props) {
|
||||
GitHubBuilder self = new GitHubBuilder();
|
||||
self.withOAuthToken(props.getProperty("oauth"), props.getProperty("login"));
|
||||
self.withJwtToken(props.getProperty("jwt"));
|
||||
self.withPassword(props.getProperty("login"), props.getProperty("password"));
|
||||
String oauth = props.getProperty("oauth");
|
||||
String jwt = props.getProperty("jwt");
|
||||
String login = props.getProperty("login");
|
||||
String password = props.getProperty("password");
|
||||
|
||||
if (oauth != null) {
|
||||
self.withOAuthToken(oauth, login);
|
||||
}
|
||||
if (jwt != null) {
|
||||
self.withJwtToken(jwt);
|
||||
}
|
||||
if (password != null) {
|
||||
self.withPassword(login, password);
|
||||
}
|
||||
self.withEndpoint(props.getProperty("endpoint", GitHubClient.GITHUB_URL));
|
||||
return self;
|
||||
}
|
||||
@@ -247,9 +257,7 @@ public class GitHubBuilder implements Cloneable {
|
||||
* @return the git hub builder
|
||||
*/
|
||||
public GitHubBuilder withPassword(String user, String password) {
|
||||
this.user = user;
|
||||
this.password = password;
|
||||
return this;
|
||||
return withAuthorizationProvider(ImmutableAuthorizationProvider.fromLoginAndPassword(user, password));
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -260,7 +268,7 @@ public class GitHubBuilder implements Cloneable {
|
||||
* @return the git hub builder
|
||||
*/
|
||||
public GitHubBuilder withOAuthToken(String oauthToken) {
|
||||
return withOAuthToken(oauthToken, null);
|
||||
return withAuthorizationProvider(ImmutableAuthorizationProvider.fromOauthToken(oauthToken));
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -273,8 +281,21 @@ public class GitHubBuilder implements Cloneable {
|
||||
* @return the git hub builder
|
||||
*/
|
||||
public GitHubBuilder withOAuthToken(String oauthToken, String user) {
|
||||
this.oauthToken = oauthToken;
|
||||
this.user = user;
|
||||
return withAuthorizationProvider(ImmutableAuthorizationProvider.fromOauthToken(oauthToken, user));
|
||||
}
|
||||
|
||||
/**
|
||||
* Configures a {@link AuthorizationProvider} for this builder
|
||||
*
|
||||
* There can be only one authorization provider per client instance.
|
||||
*
|
||||
* @param authorizationProvider
|
||||
* the authorization provider
|
||||
* @return the git hub builder
|
||||
*
|
||||
*/
|
||||
public GitHubBuilder withAuthorizationProvider(final AuthorizationProvider authorizationProvider) {
|
||||
this.authorizationProvider = authorizationProvider;
|
||||
return this;
|
||||
}
|
||||
|
||||
@@ -287,7 +308,7 @@ public class GitHubBuilder implements Cloneable {
|
||||
* @see GHAppInstallation#createToken(java.util.Map) GHAppInstallation#createToken(java.util.Map)
|
||||
*/
|
||||
public GitHubBuilder withAppInstallationToken(String appInstallationToken) {
|
||||
return withOAuthToken(appInstallationToken, "");
|
||||
return withAuthorizationProvider(ImmutableAuthorizationProvider.fromAppInstallationToken(appInstallationToken));
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -298,8 +319,7 @@ public class GitHubBuilder implements Cloneable {
|
||||
* @return the git hub builder
|
||||
*/
|
||||
public GitHubBuilder withJwtToken(String jwtToken) {
|
||||
this.jwtToken = jwtToken;
|
||||
return this;
|
||||
return withAuthorizationProvider(ImmutableAuthorizationProvider.fromJwtToken(jwtToken));
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -358,6 +378,18 @@ public class GitHubBuilder implements Cloneable {
|
||||
return this;
|
||||
}
|
||||
|
||||
/**
|
||||
* Adds a {@link RateLimitChecker} for the Core API for this {@link GitHubBuilder}.
|
||||
*
|
||||
* @param coreRateLimitChecker
|
||||
* the {@link RateLimitChecker} for core GitHub API requests
|
||||
* @return the git hub builder
|
||||
* @see #withRateLimitChecker(RateLimitChecker, RateLimitTarget)
|
||||
*/
|
||||
public GitHubBuilder withRateLimitChecker(@Nonnull RateLimitChecker coreRateLimitChecker) {
|
||||
return withRateLimitChecker(coreRateLimitChecker, RateLimitTarget.CORE);
|
||||
}
|
||||
|
||||
/**
|
||||
* Adds a {@link RateLimitChecker} to this {@link GitHubBuilder}.
|
||||
* <p>
|
||||
@@ -376,15 +408,15 @@ public class GitHubBuilder implements Cloneable {
|
||||
* request.
|
||||
* </p>
|
||||
*
|
||||
* @param coreRateLimitChecker
|
||||
* the {@link RateLimitChecker} for core GitHub API requests
|
||||
* @param rateLimitChecker
|
||||
* the {@link RateLimitChecker} for requests
|
||||
* @param rateLimitTarget
|
||||
* the {@link RateLimitTarget} specifying which rate limit record to check
|
||||
* @return the git hub builder
|
||||
*/
|
||||
public GitHubBuilder withRateLimitChecker(@Nonnull RateLimitChecker coreRateLimitChecker) {
|
||||
this.rateLimitChecker = new GitHubRateLimitChecker(coreRateLimitChecker,
|
||||
RateLimitChecker.NONE,
|
||||
RateLimitChecker.NONE,
|
||||
RateLimitChecker.NONE);
|
||||
public GitHubBuilder withRateLimitChecker(@Nonnull RateLimitChecker rateLimitChecker,
|
||||
@Nonnull RateLimitTarget rateLimitTarget) {
|
||||
this.rateLimitChecker = this.rateLimitChecker.with(rateLimitChecker, rateLimitTarget);
|
||||
return this;
|
||||
}
|
||||
|
||||
@@ -409,14 +441,11 @@ public class GitHubBuilder implements Cloneable {
|
||||
*/
|
||||
public GitHub build() throws IOException {
|
||||
return new GitHub(endpoint,
|
||||
user,
|
||||
oauthToken,
|
||||
jwtToken,
|
||||
password,
|
||||
connector,
|
||||
rateLimitHandler,
|
||||
abuseLimitHandler,
|
||||
rateLimitChecker);
|
||||
rateLimitChecker,
|
||||
authorizationProvider);
|
||||
}
|
||||
|
||||
@Override
|
||||
|
||||
@@ -1,34 +1,19 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import com.fasterxml.jackson.databind.DeserializationFeature;
|
||||
import com.fasterxml.jackson.databind.InjectableValues;
|
||||
import com.fasterxml.jackson.databind.MapperFeature;
|
||||
import com.fasterxml.jackson.databind.ObjectMapper;
|
||||
import com.fasterxml.jackson.databind.ObjectReader;
|
||||
import com.fasterxml.jackson.databind.ObjectWriter;
|
||||
import com.fasterxml.jackson.databind.PropertyNamingStrategy;
|
||||
import com.fasterxml.jackson.databind.*;
|
||||
import com.fasterxml.jackson.databind.introspect.VisibilityChecker;
|
||||
import org.apache.commons.io.IOUtils;
|
||||
import org.apache.commons.lang3.StringUtils;
|
||||
import org.kohsuke.github.authorization.AuthorizationProvider;
|
||||
import org.kohsuke.github.authorization.UserAuthorizationProvider;
|
||||
|
||||
import java.io.FileNotFoundException;
|
||||
import java.io.IOException;
|
||||
import java.io.InterruptedIOException;
|
||||
import java.net.HttpURLConnection;
|
||||
import java.net.MalformedURLException;
|
||||
import java.net.SocketException;
|
||||
import java.net.SocketTimeoutException;
|
||||
import java.net.URL;
|
||||
import java.nio.charset.StandardCharsets;
|
||||
import java.text.ParseException;
|
||||
import java.text.SimpleDateFormat;
|
||||
import java.util.Base64;
|
||||
import java.util.Date;
|
||||
import java.util.HashMap;
|
||||
import java.util.List;
|
||||
import java.util.Map;
|
||||
import java.util.Objects;
|
||||
import java.util.TimeZone;
|
||||
import java.net.*;
|
||||
import java.time.Instant;
|
||||
import java.time.format.DateTimeFormatter;
|
||||
import java.time.temporal.ChronoUnit;
|
||||
import java.util.*;
|
||||
import java.util.function.Consumer;
|
||||
import java.util.logging.Logger;
|
||||
|
||||
@@ -45,7 +30,7 @@ import static java.util.logging.Level.*;
|
||||
* A GitHub API Client
|
||||
* <p>
|
||||
* A GitHubClient can be used to send requests and retrieve their responses. GitHubClient is thread-safe and can be used
|
||||
* to send multiple requests. GitHubClient also track some GitHub API information such as {@link #rateLimit()}.
|
||||
* to send multiple requests. GitHubClient also track some GitHub API information such as {@link GHRateLimit}.
|
||||
* </p>
|
||||
*/
|
||||
abstract class GitHubClient {
|
||||
@@ -57,32 +42,28 @@ abstract class GitHubClient {
|
||||
static final int retryTimeoutMillis = 100;
|
||||
/* private */ final String login;
|
||||
|
||||
/**
|
||||
* Value of the authorization header to be sent with the request.
|
||||
*/
|
||||
/* private */ final String encodedAuthorization;
|
||||
|
||||
// Cache of myself object.
|
||||
private final String apiUrl;
|
||||
|
||||
protected final RateLimitHandler rateLimitHandler;
|
||||
protected final AbuseLimitHandler abuseLimitHandler;
|
||||
private final GitHubRateLimitChecker rateLimitChecker;
|
||||
private final AuthorizationProvider authorizationProvider;
|
||||
|
||||
private HttpConnector connector;
|
||||
|
||||
private final Object headerRateLimitLock = new Object();
|
||||
private GHRateLimit headerRateLimit = null;
|
||||
private volatile GHRateLimit rateLimit = null;
|
||||
private final Object rateLimitLock = new Object();
|
||||
|
||||
@Nonnull
|
||||
private GHRateLimit rateLimit = GHRateLimit.DEFAULT;
|
||||
|
||||
private static final Logger LOGGER = Logger.getLogger(GitHubClient.class.getName());
|
||||
|
||||
private static final ObjectMapper MAPPER = new ObjectMapper();
|
||||
static final String GITHUB_URL = "https://api.github.com";
|
||||
|
||||
private static final String[] TIME_FORMATS = { "yyyy/MM/dd HH:mm:ss ZZZZ", "yyyy-MM-dd'T'HH:mm:ss'Z'",
|
||||
"yyyy-MM-dd'T'HH:mm:ss.S'Z'" // GitHub App endpoints return a different date format
|
||||
};
|
||||
private static final DateTimeFormatter DATE_TIME_PARSER_SLASHES = DateTimeFormatter
|
||||
.ofPattern("yyyy/MM/dd HH:mm:ss Z");
|
||||
|
||||
static {
|
||||
MAPPER.setVisibility(new VisibilityChecker.Std(NONE, NONE, NONE, NONE, ANY));
|
||||
@@ -92,15 +73,12 @@ abstract class GitHubClient {
|
||||
}
|
||||
|
||||
GitHubClient(String apiUrl,
|
||||
String login,
|
||||
String oauthAccessToken,
|
||||
String jwtToken,
|
||||
String password,
|
||||
HttpConnector connector,
|
||||
RateLimitHandler rateLimitHandler,
|
||||
AbuseLimitHandler abuseLimitHandler,
|
||||
GitHubRateLimitChecker rateLimitChecker,
|
||||
Consumer<GHMyself> myselfConsumer) throws IOException {
|
||||
Consumer<GHMyself> myselfConsumer,
|
||||
AuthorizationProvider authorizationProvider) throws IOException {
|
||||
|
||||
if (apiUrl.endsWith("/")) {
|
||||
apiUrl = apiUrl.substring(0, apiUrl.length() - 1); // normalize
|
||||
@@ -112,40 +90,43 @@ abstract class GitHubClient {
|
||||
this.apiUrl = apiUrl;
|
||||
this.connector = connector;
|
||||
|
||||
if (oauthAccessToken != null) {
|
||||
encodedAuthorization = "token " + oauthAccessToken;
|
||||
} else {
|
||||
if (jwtToken != null) {
|
||||
encodedAuthorization = "Bearer " + jwtToken;
|
||||
} else if (password != null) {
|
||||
String authorization = (login + ':' + password);
|
||||
String charsetName = StandardCharsets.UTF_8.name();
|
||||
encodedAuthorization = "Basic "
|
||||
+ Base64.getEncoder().encodeToString(authorization.getBytes(charsetName));
|
||||
} else {// anonymous access
|
||||
encodedAuthorization = null;
|
||||
}
|
||||
}
|
||||
// Prefer credential configuration via provider
|
||||
this.authorizationProvider = authorizationProvider;
|
||||
|
||||
this.rateLimitHandler = rateLimitHandler;
|
||||
this.abuseLimitHandler = abuseLimitHandler;
|
||||
this.rateLimitChecker = rateLimitChecker;
|
||||
|
||||
if (login == null && encodedAuthorization != null && jwtToken == null) {
|
||||
GHMyself myself = fetch(GHMyself.class, "/user");
|
||||
login = myself.getLogin();
|
||||
if (myselfConsumer != null) {
|
||||
myselfConsumer.accept(myself);
|
||||
this.login = getCurrentUser(myselfConsumer);
|
||||
}
|
||||
|
||||
private String getCurrentUser(Consumer<GHMyself> myselfConsumer) throws IOException {
|
||||
String login = null;
|
||||
if (this.authorizationProvider instanceof UserAuthorizationProvider
|
||||
&& this.authorizationProvider.getEncodedAuthorization() != null) {
|
||||
|
||||
UserAuthorizationProvider userAuthorizationProvider = (UserAuthorizationProvider) this.authorizationProvider;
|
||||
|
||||
login = userAuthorizationProvider.getLogin();
|
||||
|
||||
if (login == null) {
|
||||
try {
|
||||
GHMyself myself = fetch(GHMyself.class, "/user");
|
||||
if (myselfConsumer != null) {
|
||||
myselfConsumer.accept(myself);
|
||||
}
|
||||
login = myself.getLogin();
|
||||
} catch (IOException e) {
|
||||
return null;
|
||||
}
|
||||
}
|
||||
}
|
||||
this.login = login;
|
||||
return login;
|
||||
}
|
||||
|
||||
private <T> T fetch(Class<T> type, String urlPath) throws IOException {
|
||||
return this
|
||||
.sendRequest(GitHubRequest.newBuilder().withApiUrl(getApiUrl()).withUrlPath(urlPath).build(),
|
||||
(responseInfo) -> GitHubResponse.parseBody(responseInfo, type))
|
||||
.body();
|
||||
GitHubRequest request = GitHubRequest.newBuilder().withApiUrl(getApiUrl()).withUrlPath(urlPath).build();
|
||||
return this.sendRequest(request, (responseInfo) -> GitHubResponse.parseBody(responseInfo, type)).body();
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -205,15 +186,24 @@ abstract class GitHubClient {
|
||||
* @return {@code true} if operations that require authentication will fail.
|
||||
*/
|
||||
public boolean isAnonymous() {
|
||||
return login == null && encodedAuthorization == null;
|
||||
try {
|
||||
return login == null && this.authorizationProvider.getEncodedAuthorization() == null;
|
||||
} catch (IOException e) {
|
||||
// An exception here means that the provider failed to provide authorization parameters,
|
||||
// basically meaning the same as "no auth"
|
||||
return false;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets the current rate limit from the server.
|
||||
* Gets the current full rate limit information from the server.
|
||||
*
|
||||
* For some versions of GitHub Enterprise, the {@code /rate_limit} endpoint returns a {@code 404 Not Found}. In
|
||||
* that, if {@link #lastRateLimit()} is not {@code null} and is not expired, it will be returned. Otherwise, a
|
||||
* placeholder {@link GHRateLimit} instance with {@link GHRateLimit.UnknownLimitRecord}s will be returned.
|
||||
* For some versions of GitHub Enterprise, the {@code /rate_limit} endpoint returns a {@code 404 Not Found}. In that
|
||||
* case, the most recent {@link GHRateLimit} information will be returned, including rate limit information returned
|
||||
* in the response header for this request in if was present.
|
||||
*
|
||||
* For most use cases it would be better to implement a {@link RateLimitChecker} and add it via
|
||||
* {@link GitHubBuilder#withRateLimitChecker(RateLimitChecker)}.
|
||||
*
|
||||
* @return the rate limit
|
||||
* @throws IOException
|
||||
@@ -221,59 +211,100 @@ abstract class GitHubClient {
|
||||
*/
|
||||
@Nonnull
|
||||
public GHRateLimit getRateLimit() throws IOException {
|
||||
return getRateLimit(RateLimitTarget.NONE);
|
||||
}
|
||||
|
||||
@CheckForNull
|
||||
protected String getEncodedAuthorization() throws IOException {
|
||||
return authorizationProvider.getEncodedAuthorization();
|
||||
}
|
||||
|
||||
@Nonnull
|
||||
GHRateLimit getRateLimit(@Nonnull RateLimitTarget rateLimitTarget) throws IOException {
|
||||
GHRateLimit result;
|
||||
try {
|
||||
result = fetch(JsonRateLimit.class, "/rate_limit").resources;
|
||||
GitHubRequest request = GitHubRequest.newBuilder()
|
||||
.rateLimit(RateLimitTarget.NONE)
|
||||
.withApiUrl(getApiUrl())
|
||||
.withUrlPath("/rate_limit")
|
||||
.build();
|
||||
result = this
|
||||
.sendRequest(request, (responseInfo) -> GitHubResponse.parseBody(responseInfo, JsonRateLimit.class))
|
||||
.body().resources;
|
||||
} catch (FileNotFoundException e) {
|
||||
// For some versions of GitHub Enterprise, the rate_limit endpoint returns a 404.
|
||||
LOGGER.log(FINE, "/rate_limit returned 404 Not Found.");
|
||||
|
||||
// However some newer versions of GHE include rate limit header information
|
||||
// Use that if available
|
||||
result = lastRateLimit();
|
||||
if (result == null || result.isExpired()) {
|
||||
// return a default rate limit
|
||||
result = GHRateLimit.Unknown();
|
||||
}
|
||||
// If the header info is missing and the endpoint returns 404, fill the rate limit
|
||||
// with unknown
|
||||
result = GHRateLimit.fromRecord(GHRateLimit.UnknownLimitRecord.current(), rateLimitTarget);
|
||||
}
|
||||
|
||||
return rateLimit = result;
|
||||
return updateRateLimit(result);
|
||||
}
|
||||
|
||||
/**
|
||||
* Returns the most recently observed rate limit data or {@code null} if either there is no rate limit (for example
|
||||
* GitHub Enterprise) or if no requests have been made.
|
||||
* Returns the most recently observed rate limit data.
|
||||
*
|
||||
* @return the most recently observed rate limit data or {@code null}.
|
||||
* Generally, instead of calling this you should implement a {@link RateLimitChecker} or call
|
||||
*
|
||||
* @return the most recently observed rate limit data. This may include expired or
|
||||
* {@link GHRateLimit.UnknownLimitRecord} entries.
|
||||
* @deprecated implement a {@link RateLimitChecker} and add it via
|
||||
* {@link GitHubBuilder#withRateLimitChecker(RateLimitChecker)}.
|
||||
*/
|
||||
@CheckForNull
|
||||
public GHRateLimit lastRateLimit() {
|
||||
synchronized (headerRateLimitLock) {
|
||||
return headerRateLimit;
|
||||
@Nonnull
|
||||
@Deprecated
|
||||
GHRateLimit lastRateLimit() {
|
||||
synchronized (rateLimitLock) {
|
||||
return rateLimit;
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Gets the current rate limit while trying not to actually make any remote requests unless absolutely necessary.
|
||||
* Gets the current rate limit for an endpoint while trying not to actually make any remote requests unless
|
||||
* absolutely necessary.
|
||||
*
|
||||
* If {@link #lastRateLimit()} is not {@code null} and is not expired, it will be returned. If the information
|
||||
* returned from the last call to {@link #getRateLimit()} is not {@code null} and is not expired, then it will be
|
||||
* returned. Otherwise, the result of a call to {@link #getRateLimit()} will be returned.
|
||||
* If the {@link GHRateLimit.Record} for {@code urlPath} is not expired, it is returned. If the
|
||||
* {@link GHRateLimit.Record} for {@code urlPath} is expired, {@link #getRateLimit()} will be called to get the
|
||||
* current rate limit.
|
||||
*
|
||||
* @return the current rate limit data.
|
||||
* @param rateLimitTarget
|
||||
* the endpoint to get the rate limit for.
|
||||
*
|
||||
* @return the current rate limit data. {@link GHRateLimit.Record}s in this instance may be expired when returned.
|
||||
* @throws IOException
|
||||
* if there was an error getting current rate limit data.
|
||||
*/
|
||||
@Nonnull
|
||||
public GHRateLimit rateLimit() throws IOException {
|
||||
synchronized (headerRateLimitLock) {
|
||||
if (headerRateLimit != null && !headerRateLimit.isExpired()) {
|
||||
return headerRateLimit;
|
||||
GHRateLimit rateLimit(@Nonnull RateLimitTarget rateLimitTarget) throws IOException {
|
||||
synchronized (rateLimitLock) {
|
||||
if (rateLimit.getRecord(rateLimitTarget).isExpired()) {
|
||||
getRateLimit(rateLimitTarget);
|
||||
}
|
||||
return rateLimit;
|
||||
}
|
||||
GHRateLimit result = this.rateLimit;
|
||||
if (result == null || result.isExpired()) {
|
||||
result = getRateLimit();
|
||||
}
|
||||
|
||||
/**
|
||||
* Update the Rate Limit with the latest info from response header.
|
||||
*
|
||||
* Due to multi-threading, requests might complete out of order. This method calls
|
||||
* {@link GHRateLimit#getMergedRateLimit(GHRateLimit)} to ensure the most current records are used.
|
||||
*
|
||||
* @param observed
|
||||
* {@link GHRateLimit.Record} constructed from the response header information
|
||||
*/
|
||||
private GHRateLimit updateRateLimit(@Nonnull GHRateLimit observed) {
|
||||
synchronized (rateLimitLock) {
|
||||
observed = rateLimit.getMergedRateLimit(observed);
|
||||
|
||||
if (rateLimit != observed) {
|
||||
rateLimit = observed;
|
||||
LOGGER.log(FINE, "Rate limit now: {0}", rateLimit);
|
||||
}
|
||||
return rateLimit;
|
||||
}
|
||||
return result;
|
||||
}
|
||||
|
||||
/**
|
||||
@@ -358,7 +389,6 @@ abstract class GitHubClient {
|
||||
"GitHub API request [" + (login == null ? "anonymous" : login) + "]: "
|
||||
+ request.method() + " " + request.url().toString());
|
||||
}
|
||||
|
||||
rateLimitChecker.checkRateLimit(this, request);
|
||||
|
||||
responseInfo = getResponseInfo(request);
|
||||
@@ -369,7 +399,7 @@ abstract class GitHubClient {
|
||||
// Setting "Cache-Control" to "no-cache" stops the cache from supplying
|
||||
// "If-Modified-Since" or "If-None-Match" values.
|
||||
// This makes GitHub give us current data (not incorrectly cached data)
|
||||
request = request.toBuilder().withHeader("Cache-Control", "no-cache").build();
|
||||
request = request.toBuilder().setHeader("Cache-Control", "no-cache").build();
|
||||
continue;
|
||||
}
|
||||
if (!(isRateLimitResponse(responseInfo) || isAbuseLimitResponse(responseInfo))) {
|
||||
@@ -517,58 +547,25 @@ abstract class GitHubClient {
|
||||
}
|
||||
|
||||
private void noteRateLimit(@Nonnull GitHubResponse.ResponseInfo responseInfo) {
|
||||
if (responseInfo.request().urlPath().startsWith("/search")) {
|
||||
// the search API uses a different rate limit
|
||||
return;
|
||||
}
|
||||
|
||||
String limitString = responseInfo.headerField("X-RateLimit-Limit");
|
||||
if (StringUtils.isBlank(limitString)) {
|
||||
// if we are missing a header, return fast
|
||||
return;
|
||||
}
|
||||
String remainingString = responseInfo.headerField("X-RateLimit-Remaining");
|
||||
if (StringUtils.isBlank(remainingString)) {
|
||||
// if we are missing a header, return fast
|
||||
return;
|
||||
}
|
||||
String resetString = responseInfo.headerField("X-RateLimit-Reset");
|
||||
if (StringUtils.isBlank(resetString)) {
|
||||
// if we are missing a header, return fast
|
||||
return;
|
||||
}
|
||||
|
||||
int limit, remaining;
|
||||
long reset;
|
||||
try {
|
||||
String limitString = Objects.requireNonNull(responseInfo.headerField("X-RateLimit-Limit"),
|
||||
"Missing X-RateLimit-Limit");
|
||||
String remainingString = Objects.requireNonNull(responseInfo.headerField("X-RateLimit-Remaining"),
|
||||
"Missing X-RateLimit-Remaining");
|
||||
String resetString = Objects.requireNonNull(responseInfo.headerField("X-RateLimit-Reset"),
|
||||
"Missing X-RateLimit-Reset");
|
||||
int limit, remaining;
|
||||
long reset;
|
||||
limit = Integer.parseInt(limitString);
|
||||
} catch (NumberFormatException e) {
|
||||
if (LOGGER.isLoggable(FINEST)) {
|
||||
LOGGER.log(FINEST, "Malformed X-RateLimit-Limit header value " + limitString, e);
|
||||
}
|
||||
return;
|
||||
}
|
||||
try {
|
||||
|
||||
remaining = Integer.parseInt(remainingString);
|
||||
} catch (NumberFormatException e) {
|
||||
if (LOGGER.isLoggable(FINEST)) {
|
||||
LOGGER.log(FINEST, "Malformed X-RateLimit-Remaining header value " + remainingString, e);
|
||||
}
|
||||
return;
|
||||
}
|
||||
try {
|
||||
reset = Long.parseLong(resetString);
|
||||
} catch (NumberFormatException e) {
|
||||
GHRateLimit.Record observed = new GHRateLimit.Record(limit, remaining, reset, responseInfo);
|
||||
updateRateLimit(GHRateLimit.fromRecord(observed, responseInfo.request().rateLimitTarget()));
|
||||
} catch (NumberFormatException | NullPointerException e) {
|
||||
if (LOGGER.isLoggable(FINEST)) {
|
||||
LOGGER.log(FINEST, "Malformed X-RateLimit-Reset header value " + resetString, e);
|
||||
LOGGER.log(FINEST, "Missing or malformed X-RateLimit header: ", e);
|
||||
}
|
||||
return;
|
||||
}
|
||||
|
||||
GHRateLimit.Record observed = new GHRateLimit.Record(limit, remaining, reset, responseInfo);
|
||||
|
||||
updateCoreRateLimit(observed);
|
||||
}
|
||||
|
||||
private static void detectOTPRequired(@Nonnull GitHubResponse.ResponseInfo responseInfo) throws GHIOException {
|
||||
@@ -588,23 +585,6 @@ abstract class GitHubClient {
|
||||
"This operation requires a credential but none is given to the GitHub constructor");
|
||||
}
|
||||
|
||||
/**
|
||||
* Update the Rate Limit with the latest info from response header. Due to multi-threading requests might complete
|
||||
* out of order, we want to pick the one with the most recent info from the server. Calls
|
||||
* {@link #shouldReplace(GHRateLimit.Record, GHRateLimit.Record)}
|
||||
*
|
||||
* @param observed
|
||||
* {@link GHRateLimit.Record} constructed from the response header information
|
||||
*/
|
||||
private void updateCoreRateLimit(@Nonnull GHRateLimit.Record observed) {
|
||||
synchronized (headerRateLimitLock) {
|
||||
if (headerRateLimit == null || shouldReplace(observed, headerRateLimit.getCore())) {
|
||||
headerRateLimit = GHRateLimit.fromHeaderRecord(observed);
|
||||
LOGGER.log(FINE, "Rate limit now: {0}", headerRateLimit);
|
||||
}
|
||||
}
|
||||
}
|
||||
|
||||
private static class GHApiInfo {
|
||||
private String rate_limit_url;
|
||||
|
||||
@@ -654,37 +634,6 @@ abstract class GitHubClient {
|
||||
}
|
||||
}
|
||||
|
||||
/**
|
||||
* Determine if one {@link GHRateLimit.Record} should replace another. Header date is only accurate to the second,
|
||||
* so we look at the information in the record itself.
|
||||
*
|
||||
* {@link GHRateLimit.UnknownLimitRecord}s are always replaced by regular {@link GHRateLimit.Record}s. Regular
|
||||
* {@link GHRateLimit.Record}s are never replaced by {@link GHRateLimit.UnknownLimitRecord}s. Candidates with
|
||||
* resetEpochSeconds later than current record are more recent. Candidates with the same reset and a lower remaining
|
||||
* count are more recent. Candidates with an earlier reset are older.
|
||||
*
|
||||
* @param candidate
|
||||
* {@link GHRateLimit.Record} constructed from the response header information
|
||||
* @param current
|
||||
* the current {@link GHRateLimit.Record} record
|
||||
*/
|
||||
static boolean shouldReplace(@Nonnull GHRateLimit.Record candidate, @Nonnull GHRateLimit.Record current) {
|
||||
if (candidate instanceof GHRateLimit.UnknownLimitRecord
|
||||
&& !(current instanceof GHRateLimit.UnknownLimitRecord)) {
|
||||
// Unknown candidate never replaces a regular record
|
||||
return false;
|
||||
} else if (current instanceof GHRateLimit.UnknownLimitRecord
|
||||
&& !(candidate instanceof GHRateLimit.UnknownLimitRecord)) {
|
||||
// Any real record should replace an unknown Record.
|
||||
return true;
|
||||
} else {
|
||||
// records of the same type compare to each other as normal.
|
||||
return current.getResetEpochSeconds() < candidate.getResetEpochSeconds()
|
||||
|| (current.getResetEpochSeconds() == candidate.getResetEpochSeconds()
|
||||
&& current.getRemaining() > candidate.getRemaining());
|
||||
}
|
||||
}
|
||||
|
||||
static URL parseURL(String s) {
|
||||
try {
|
||||
return s == null ? null : new URL(s);
|
||||
@@ -696,22 +645,24 @@ abstract class GitHubClient {
|
||||
static Date parseDate(String timestamp) {
|
||||
if (timestamp == null)
|
||||
return null;
|
||||
for (String f : TIME_FORMATS) {
|
||||
try {
|
||||
SimpleDateFormat df = new SimpleDateFormat(f);
|
||||
df.setTimeZone(TimeZone.getTimeZone("GMT"));
|
||||
return df.parse(timestamp);
|
||||
} catch (ParseException e) {
|
||||
// try next
|
||||
}
|
||||
|
||||
return Date.from(parseInstant(timestamp));
|
||||
}
|
||||
|
||||
static Instant parseInstant(String timestamp) {
|
||||
if (timestamp == null)
|
||||
return null;
|
||||
|
||||
if (timestamp.charAt(4) == '/') {
|
||||
// Unsure where this is used, but retained for compatibility.
|
||||
return Instant.from(DATE_TIME_PARSER_SLASHES.parse(timestamp));
|
||||
} else {
|
||||
return Instant.from(DateTimeFormatter.ISO_OFFSET_DATE_TIME.parse(timestamp));
|
||||
}
|
||||
throw new IllegalStateException("Unable to parse the timestamp: " + timestamp);
|
||||
}
|
||||
|
||||
static String printDate(Date dt) {
|
||||
SimpleDateFormat df = new SimpleDateFormat("yyyy-MM-dd'T'HH:mm:ss'Z'");
|
||||
df.setTimeZone(TimeZone.getTimeZone("GMT"));
|
||||
return df.format(dt);
|
||||
return DateTimeFormatter.ISO_INSTANT.format(Instant.ofEpochMilli(dt.getTime()).truncatedTo(ChronoUnit.SECONDS));
|
||||
}
|
||||
|
||||
/**
|
||||
|
||||
@@ -1,6 +1,7 @@
|
||||
package org.kohsuke.github;
|
||||
|
||||
import org.apache.commons.io.IOUtils;
|
||||
import org.kohsuke.github.authorization.AuthorizationProvider;
|
||||
|
||||
import java.io.IOException;
|
||||
import java.io.InputStream;
|
||||
@@ -24,7 +25,7 @@ import static org.apache.commons.lang3.StringUtils.defaultString;
|
||||
* A GitHub API Client for HttpUrlConnection
|
||||
* <p>
|
||||
* A GitHubClient can be used to send requests and retrieve their responses. GitHubClient is thread-safe and can be used
|
||||
* to send multiple requests. GitHubClient also track some GitHub API information such as {@link #rateLimit()}.
|
||||
* to send multiple requests. GitHubClient also track some GitHub API information such as {@link GHRateLimit}.
|
||||
* </p>
|
||||
* <p>
|
||||
* GitHubHttpUrlConnectionClient gets a new {@link HttpURLConnection} for each call to send.
|
||||
@@ -33,25 +34,19 @@ import static org.apache.commons.lang3.StringUtils.defaultString;
|
||||
class GitHubHttpUrlConnectionClient extends GitHubClient {
|
||||
|
||||
GitHubHttpUrlConnectionClient(String apiUrl,
|
||||
String login,
|
||||
String oauthAccessToken,
|
||||
String jwtToken,
|
||||
String password,
|
||||
HttpConnector connector,
|
||||
RateLimitHandler rateLimitHandler,
|
||||
AbuseLimitHandler abuseLimitHandler,
|
||||
GitHubRateLimitChecker rateLimitChecker,
|
||||
Consumer<GHMyself> myselfConsumer) throws IOException {
|
||||
Consumer<GHMyself> myselfConsumer,
|
||||
AuthorizationProvider authorizationProvider) throws IOException {
|
||||
super(apiUrl,
|
||||
login,
|
||||
oauthAccessToken,
|
||||
jwtToken,
|
||||
password,
|
||||
connector,
|
||||
rateLimitHandler,
|
||||
abuseLimitHandler,
|
||||
rateLimitChecker,
|
||||
myselfConsumer);
|
||||
myselfConsumer,
|
||||
authorizationProvider);
|
||||
}
|
||||
|
||||
@Nonnull
|
||||
@@ -114,8 +109,12 @@ class GitHubHttpUrlConnectionClient extends GitHubClient {
|
||||
|
||||
// if the authentication is needed but no credential is given, try it anyway (so that some calls
|
||||
// that do work with anonymous access in the reduced form should still work.)
|
||||
if (client.encodedAuthorization != null)
|
||||
connection.setRequestProperty("Authorization", client.encodedAuthorization);
|
||||
if (!request.headers().containsKey("Authorization")) {
|
||||
String authorization = client.getEncodedAuthorization();
|
||||
if (authorization != null) {
|
||||
connection.setRequestProperty("Authorization", client.getEncodedAuthorization());
|
||||
}
|
||||
}
|
||||
|
||||
setRequestMethod(request.method(), connection);
|
||||
buildRequest(request, connection);
|
||||
|
||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user