mirror of
https://github.com/jlengrand/github-api.git
synced 2026-04-04 15:50:52 +00:00
Compare commits
789 Commits
github-api
...
junie-init
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
d85919658d | ||
|
|
6b30617090 | ||
|
|
3ced4fc9c8 | ||
|
|
4748db2bc3 | ||
|
|
e0ebec5d5c | ||
|
|
b1ff0a4453 | ||
|
|
6564648230 | ||
|
|
48cadbc814 | ||
|
|
fbfba70714 | ||
|
|
30a6cc504e | ||
|
|
54d8fe93a8 | ||
|
|
4abf33acdb | ||
|
|
c00d562b48 | ||
|
|
fad4753f0f | ||
|
|
c24df1d022 | ||
|
|
823465590e | ||
|
|
804db70049 | ||
|
|
1782e5a483 | ||
|
|
b6283a0493 | ||
|
|
0bb18ee7c5 | ||
|
|
1a77dd270f | ||
|
|
1c6ab19d59 | ||
|
|
ef4e64dcdd | ||
|
|
946b4e963b | ||
|
|
0d7867daf6 | ||
|
|
3044b5437b | ||
|
|
4a2886531d | ||
|
|
c5e2d8b2ae | ||
|
|
3041431468 | ||
|
|
63b9188dad | ||
|
|
2436ed0431 | ||
|
|
0295ad82fa | ||
|
|
c197dc6b7b | ||
|
|
a79971e406 | ||
|
|
1a56f9d093 | ||
|
|
35852055e8 | ||
|
|
196ee25452 | ||
|
|
7d8335423d | ||
|
|
eac4990eac | ||
|
|
0f17812732 | ||
|
|
3bafb965c5 | ||
|
|
0e02444c07 | ||
|
|
4dcc479d48 | ||
|
|
a564c97763 | ||
|
|
80e17109de | ||
|
|
c395b9d6b3 | ||
|
|
e34d33f1cd | ||
|
|
1c920dee06 | ||
|
|
955d2e0a07 | ||
|
|
d0912009dd | ||
|
|
e68950e619 | ||
|
|
93c026b7af | ||
|
|
5254839ff7 | ||
|
|
6ca0d83b70 | ||
|
|
8ed832a303 | ||
|
|
dbf6d3bf37 | ||
|
|
081a454ec8 | ||
|
|
543b643fdb | ||
|
|
d02f194668 | ||
|
|
9c8c00b77c | ||
|
|
a23de4707b | ||
|
|
301303bd90 | ||
|
|
4689b8f885 | ||
|
|
c4de682493 | ||
|
|
b23934a5a1 | ||
|
|
f2eecc3cc5 | ||
|
|
f5310965dc | ||
|
|
47ffff3407 | ||
|
|
f2a70a46ad | ||
|
|
acd5c6baa6 | ||
|
|
06d02059cb | ||
|
|
603288c361 | ||
|
|
09ee3168f9 | ||
|
|
1559d063c7 | ||
|
|
cfdcb182a4 | ||
|
|
d526b13d7d | ||
|
|
fffe31220e | ||
|
|
ce17396ea6 | ||
|
|
d18e81dc74 | ||
|
|
6ae5acba5d | ||
|
|
0a1c803f69 | ||
|
|
fa0865b208 | ||
|
|
886887913c | ||
|
|
5c64fec032 | ||
|
|
892f60ea16 | ||
|
|
f28f966040 | ||
|
|
0e9cc90d31 | ||
|
|
72dc5c5d18 | ||
|
|
02e02d39b0 | ||
|
|
e629a23bd4 | ||
|
|
f6e8a2c7c6 | ||
|
|
76bea5174f | ||
|
|
2be27d1a41 | ||
|
|
cd1454ac03 | ||
|
|
b550910f4c | ||
|
|
d13e490be2 | ||
|
|
3d451526ef | ||
|
|
bd38897d48 | ||
|
|
63ccbaf064 | ||
|
|
2beb806b8a | ||
|
|
552ba6693e | ||
|
|
2452add4d7 | ||
|
|
0dc931ceed | ||
|
|
1dfedc6a58 | ||
|
|
e33046a624 | ||
|
|
002b3f03da | ||
|
|
fd1817d111 | ||
|
|
7526b46f9d | ||
|
|
169fd18a54 | ||
|
|
0708812456 | ||
|
|
7d86070ac8 | ||
|
|
713b85f9de | ||
|
|
4fef5bb1fc | ||
|
|
f3eadcddb6 | ||
|
|
237171727d | ||
|
|
31212d33ae | ||
|
|
8af66133d2 | ||
|
|
9578e027b1 | ||
|
|
2c75b42b4e | ||
|
|
7854b30a76 | ||
|
|
cf2571858c | ||
|
|
092815747a | ||
|
|
649d7ed87f | ||
|
|
684560ef67 | ||
|
|
adf054ba5d | ||
|
|
dcdfee67cd | ||
|
|
9d7209ec62 | ||
|
|
b97e8a2c38 | ||
|
|
8bd3f391da | ||
|
|
5d0dbf6e2f | ||
|
|
38f3595552 | ||
|
|
b72e7fa2ee | ||
|
|
659b32f5ec | ||
|
|
d0c326bbf5 | ||
|
|
4a5aceb1f9 | ||
|
|
884248930e | ||
|
|
530d524366 | ||
|
|
5957da3d6d | ||
|
|
6efe428f57 | ||
|
|
25b9a2ce33 | ||
|
|
0ce78016cc | ||
|
|
696dd90b23 | ||
|
|
e66a72387e | ||
|
|
874ce23dd7 | ||
|
|
7479cac9a7 | ||
|
|
064ce1b0bc | ||
|
|
941573af49 | ||
|
|
2f9ff32176 | ||
|
|
b84d5a7c39 | ||
|
|
bd19f23b3f | ||
|
|
ee047ea9b5 | ||
|
|
601f18016a | ||
|
|
93abb0ed36 | ||
|
|
6453e585a9 | ||
|
|
3a1ed5a5b7 | ||
|
|
c5b45523d6 | ||
|
|
bf082f2a46 | ||
|
|
672febd88b | ||
|
|
927843ea83 | ||
|
|
8fac7d317e | ||
|
|
626574ae36 | ||
|
|
8c9eb3393b | ||
|
|
0c4728f46a | ||
|
|
837526ce5d | ||
|
|
afcfa906b8 | ||
|
|
8b3f50d4d3 | ||
|
|
9022455d85 | ||
|
|
8e20f4d9f5 | ||
|
|
7c8a7ff26e | ||
|
|
064d6944f3 | ||
|
|
b8b3cf9c80 | ||
|
|
18e7138812 | ||
|
|
bfb3b94478 | ||
|
|
6167d196d9 | ||
|
|
43ed7c7ac7 | ||
|
|
fc98e72569 | ||
|
|
258acf79f6 | ||
|
|
b509076d6f | ||
|
|
f57ea4c4e9 | ||
|
|
578fe085ce | ||
|
|
2553a79b02 | ||
|
|
4770316898 | ||
|
|
99f192d33c | ||
|
|
fc3bac0e77 | ||
|
|
ad2990b1b6 | ||
|
|
fab848a0d3 | ||
|
|
4a2244e661 | ||
|
|
bab5399327 | ||
|
|
52705ac695 | ||
|
|
73d2e1db5c | ||
|
|
83aa9d04ef | ||
|
|
97652c6803 | ||
|
|
f40daf8488 | ||
|
|
3e6a5bc718 | ||
|
|
78ffe5a759 | ||
|
|
9abfdc805b | ||
|
|
9e47a2b8c6 | ||
|
|
feba6ed8b6 | ||
|
|
acab40b704 | ||
|
|
435272065f | ||
|
|
c5c04672fc | ||
|
|
5eef764cba | ||
|
|
2682e0a1e2 | ||
|
|
a68d16d5de | ||
|
|
304ab10cf9 | ||
|
|
dc46341432 | ||
|
|
99aea9296e | ||
|
|
b0693037f3 | ||
|
|
c19cfd98d1 | ||
|
|
cdc0e2ad6b | ||
|
|
6606b5c7d1 | ||
|
|
551dbf2a06 | ||
|
|
d734237788 | ||
|
|
47e2a5aea1 | ||
|
|
57cdc308e8 | ||
|
|
8919c5f8c7 | ||
|
|
b8f00bc699 | ||
|
|
042038f480 | ||
|
|
fb03e749bd | ||
|
|
e522239832 | ||
|
|
ae69324196 | ||
|
|
5194c2d9bc | ||
|
|
daf5c5eb98 | ||
|
|
a7b4c97020 | ||
|
|
420d5d06f3 | ||
|
|
a7cd052b7c | ||
|
|
6e1b943823 | ||
|
|
8a3559ada5 | ||
|
|
ea3cbd4c71 | ||
|
|
34a1f9d6e4 | ||
|
|
629bd510c1 | ||
|
|
40937a5cc6 | ||
|
|
8509957102 | ||
|
|
b0aea0c575 | ||
|
|
1f7f646bec | ||
|
|
a59ee6a82d | ||
|
|
1fefc77582 | ||
|
|
199eee4e25 | ||
|
|
854df5321b | ||
|
|
bd509070ac | ||
|
|
a8c7c97d06 | ||
|
|
6d86cfb4f6 | ||
|
|
fb3e956502 | ||
|
|
9b0dbe6f34 | ||
|
|
c10c7237a7 | ||
|
|
36612fe97f | ||
|
|
18e2056a10 | ||
|
|
8c8f1451d4 | ||
|
|
be67f1d9e2 | ||
|
|
90bc250269 | ||
|
|
1bd178654f | ||
|
|
f22bf160f9 | ||
|
|
4261c42949 | ||
|
|
40cfb85a8e | ||
|
|
f08299b134 | ||
|
|
a04ab45abc | ||
|
|
0647df2d2b | ||
|
|
d4cc3af1e9 | ||
|
|
936ab499ce | ||
|
|
453f475b4e | ||
|
|
bda3855b86 | ||
|
|
772a6c112b | ||
|
|
9b4134cada | ||
|
|
ed9f54006d | ||
|
|
3b1f176544 | ||
|
|
d2732bcf54 | ||
|
|
a1461f401a | ||
|
|
f9fd30275c | ||
|
|
eeea14dab4 | ||
|
|
1df807a198 | ||
|
|
0848287069 | ||
|
|
334b37a256 | ||
|
|
8776a3b672 | ||
|
|
657550f767 | ||
|
|
45a0114f75 | ||
|
|
a8ddd3e12a | ||
|
|
b668396151 | ||
|
|
9e7c33369c | ||
|
|
8943ca6d1a | ||
|
|
b3460c1f9d | ||
|
|
5166c9265f | ||
|
|
35c8cfa01d | ||
|
|
8e6dbf3772 | ||
|
|
cb381dfa06 | ||
|
|
80124e3b85 | ||
|
|
7aae27e36f | ||
|
|
b212956fbb | ||
|
|
d033355e84 | ||
|
|
59d7a117d0 | ||
|
|
dfbb38c5f1 | ||
|
|
3f9954144a | ||
|
|
1b84efdbfa | ||
|
|
c33e78a7dc | ||
|
|
747c759bbb | ||
|
|
e0a709676e | ||
|
|
a96275c286 | ||
|
|
ca7c809feb | ||
|
|
a8a0bcb7db | ||
|
|
0e2bf23830 | ||
|
|
44a8b797fb | ||
|
|
cdede298a9 | ||
|
|
f6ac4d3559 | ||
|
|
7e1531dbca | ||
|
|
9aeb422157 | ||
|
|
fba0f8cf8e | ||
|
|
0f4a5227e1 | ||
|
|
d16a752b43 | ||
|
|
4d9aed90d6 | ||
|
|
4bec27fd49 | ||
|
|
be3bd74bb7 | ||
|
|
f1720b7bbc | ||
|
|
7a79a18d8f | ||
|
|
472034c950 | ||
|
|
0b14cee817 | ||
|
|
b50ab56f9e | ||
|
|
26d30663c4 | ||
|
|
ffecc390eb | ||
|
|
252ca04084 | ||
|
|
aae5c56a31 | ||
|
|
6670446037 | ||
|
|
bd39b07bb5 | ||
|
|
a9438b6121 | ||
|
|
f546cf4521 | ||
|
|
43efa78750 | ||
|
|
9e3de43802 | ||
|
|
dc615e432e | ||
|
|
cf9caa6af5 | ||
|
|
15f748358d | ||
|
|
b30d648623 | ||
|
|
33d70560b8 | ||
|
|
865a49d2e8 | ||
|
|
4fca68c25c | ||
|
|
f131a0c1c2 | ||
|
|
cd4368fa79 | ||
|
|
4ec4b160b0 | ||
|
|
a585b4957f | ||
|
|
e6b02b3bed | ||
|
|
1ef0ec0432 | ||
|
|
2e87bd86a1 | ||
|
|
0228a0d023 | ||
|
|
6365f3749d | ||
|
|
25c18130f9 | ||
|
|
436c19634d | ||
|
|
1a6facc685 | ||
|
|
bd0093c8ea | ||
|
|
e150280010 | ||
|
|
827fd5e472 | ||
|
|
f89fbc67b9 | ||
|
|
c567a88892 | ||
|
|
6a39d7fca5 | ||
|
|
a15e67f065 | ||
|
|
7a1bce9578 | ||
|
|
f2b4de7943 | ||
|
|
b3ff4ac6d9 | ||
|
|
1c56e7fab5 | ||
|
|
70ba4df385 | ||
|
|
8062c705e8 | ||
|
|
fafb23c1a6 | ||
|
|
4e7ac7030c | ||
|
|
4803daca5a | ||
|
|
facfc61316 | ||
|
|
e3e495bfb1 | ||
|
|
e007284d2f | ||
|
|
1da8416ebd | ||
|
|
79b49a469c | ||
|
|
5888efcaef | ||
|
|
459d1b4f56 | ||
|
|
9151102bda | ||
|
|
3819984add | ||
|
|
3b58fbc186 | ||
|
|
55e589b3d9 | ||
|
|
e64d64d8d8 | ||
|
|
37c2d9135b | ||
|
|
30c96221bd | ||
|
|
bf7305e3f8 | ||
|
|
3b12a229c3 | ||
|
|
5726ceb8dc | ||
|
|
c06c06624d | ||
|
|
ad40d7071e | ||
|
|
f55a39eb90 | ||
|
|
c3869bee31 | ||
|
|
6eac15df0f | ||
|
|
6f5d3c32c3 | ||
|
|
68ef40e4d0 | ||
|
|
4046bc4f72 | ||
|
|
1b8d131915 | ||
|
|
f5ad332d28 | ||
|
|
938603ff60 | ||
|
|
17af78f2bb | ||
|
|
7588267743 | ||
|
|
ed4f9c8176 | ||
|
|
bbb46e88b0 | ||
|
|
3db7aac0d8 | ||
|
|
fdbbd2e563 | ||
|
|
e92f1321d4 | ||
|
|
da2aaff9e5 | ||
|
|
208904b634 | ||
|
|
a433bcda2e | ||
|
|
4bba692170 | ||
|
|
59b61cd8be | ||
|
|
247b013e16 | ||
|
|
77baafa643 | ||
|
|
3c56f1f076 | ||
|
|
224d8c7cb4 | ||
|
|
0feb520549 | ||
|
|
ca365b12f6 | ||
|
|
bde6ad9a06 | ||
|
|
4953f4500d | ||
|
|
7fee1fcc74 | ||
|
|
4415ac8fd2 | ||
|
|
8c81e48a31 | ||
|
|
9ad0329c56 | ||
|
|
78f533bbfc | ||
|
|
79c7dd9ecf | ||
|
|
5d796d1f79 | ||
|
|
68a82be6c4 | ||
|
|
2676ef2b73 | ||
|
|
04b283c539 | ||
|
|
98b067937a | ||
|
|
8ababb60bf | ||
|
|
b51d655f77 | ||
|
|
74496d32da | ||
|
|
316e278be1 | ||
|
|
d881bf6504 | ||
|
|
c74fbbe1fd | ||
|
|
929d9fb7bd | ||
|
|
5d069d0531 | ||
|
|
dd9e6dc5d3 | ||
|
|
d22c77c41d | ||
|
|
3a11b7ccbf | ||
|
|
d7931777bc | ||
|
|
9d161b28bb | ||
|
|
9b16a1caa0 | ||
|
|
9a918e3bac | ||
|
|
d4c5c6a1e0 | ||
|
|
63fda3555c | ||
|
|
6a2381c06b | ||
|
|
e9c0a16c26 | ||
|
|
2101a67ac1 | ||
|
|
ddac568aaa | ||
|
|
262ae9f635 | ||
|
|
381502fb80 | ||
|
|
92fb441eb2 | ||
|
|
29e08037a8 | ||
|
|
84cc6d9315 | ||
|
|
b8d5a1c732 | ||
|
|
0197ab9661 | ||
|
|
b7915e61a6 | ||
|
|
586db99450 | ||
|
|
5377d0dd18 | ||
|
|
bb48d55bd4 | ||
|
|
c5d3a7d573 | ||
|
|
8267050f06 | ||
|
|
610b02968e | ||
|
|
a7112c42df | ||
|
|
8a474a3b00 | ||
|
|
59e18d155e | ||
|
|
12ca5d8063 | ||
|
|
c959e0a928 | ||
|
|
89a08b021d | ||
|
|
04b553cdec | ||
|
|
15e9ee30ee | ||
|
|
a0d650a86c | ||
|
|
1a6ad48e08 | ||
|
|
7c82eeb018 | ||
|
|
b188e74ee0 | ||
|
|
c21bd5765a | ||
|
|
b78c37a695 | ||
|
|
2f151d45c3 | ||
|
|
3ebe3afdbd | ||
|
|
f4845df6c0 | ||
|
|
272b87f04d | ||
|
|
ff790eeefb | ||
|
|
97e918da03 | ||
|
|
4f30998873 | ||
|
|
a0fc478a28 | ||
|
|
bb03fd1968 | ||
|
|
0c65f74662 | ||
|
|
29ac2bd4f5 | ||
|
|
0d8b4f32e8 | ||
|
|
83db7f24eb | ||
|
|
5f9976a193 | ||
|
|
9480ef485b | ||
|
|
a9b7432584 | ||
|
|
6d7081910f | ||
|
|
aa96089ab4 | ||
|
|
58ae681417 | ||
|
|
c038e0af5e | ||
|
|
4f9976c0cb | ||
|
|
e308e5ed57 | ||
|
|
7b1b1ca994 | ||
|
|
551be49a1a | ||
|
|
a3888e6902 | ||
|
|
43bb6a0dd8 | ||
|
|
6e3f754366 | ||
|
|
6360112432 | ||
|
|
f1ca0b5417 | ||
|
|
0894c8007c | ||
|
|
05863acbcd | ||
|
|
0e4cd06137 | ||
|
|
85d2d974e7 | ||
|
|
3f021f9552 | ||
|
|
0456f10709 | ||
|
|
b7d03f7463 | ||
|
|
07a392c2a7 | ||
|
|
5b69de770f | ||
|
|
4688870984 | ||
|
|
bf67069768 | ||
|
|
91764c1c74 | ||
|
|
8b2a3e1221 | ||
|
|
def2f0b37d | ||
|
|
5d7479a3dd | ||
|
|
ceb2d35f9f | ||
|
|
fc38dba59a | ||
|
|
75b383d398 | ||
|
|
ee2d9491fb | ||
|
|
bf86a7c75a | ||
|
|
70f6d129e2 | ||
|
|
a4ac2aa99a | ||
|
|
ae3b6fbe6b | ||
|
|
e357fca963 | ||
|
|
c84cc89805 | ||
|
|
181238cd50 | ||
|
|
214c24c736 | ||
|
|
cf51ce8f26 | ||
|
|
2b7ed40d01 | ||
|
|
349ef7a54c | ||
|
|
94df5fc389 | ||
|
|
906238a297 | ||
|
|
7963fa82b5 | ||
|
|
1aba6012fb | ||
|
|
ff4324ac67 | ||
|
|
11bc669e1d | ||
|
|
dcf26d58e4 | ||
|
|
4d46872c35 | ||
|
|
4f0d62f421 | ||
|
|
f7ad1f517b | ||
|
|
345d6197f3 | ||
|
|
bb4d44138a | ||
|
|
a8ef0cde53 | ||
|
|
77dc009c95 | ||
|
|
aa298c93cc | ||
|
|
dfb0a5240e | ||
|
|
9cfc3c22b5 | ||
|
|
b177d98e29 | ||
|
|
5405fb0370 | ||
|
|
72a1c24b3b | ||
|
|
f146ae94ec | ||
|
|
a0bbba748a | ||
|
|
81bf818573 | ||
|
|
d5913dc292 | ||
|
|
e1e901b794 | ||
|
|
2f2f26767e | ||
|
|
bffa78c1b8 | ||
|
|
c55719c67a | ||
|
|
cb3b4a6642 | ||
|
|
92c141cee6 | ||
|
|
fd1a1a1c23 | ||
|
|
b835884b2e | ||
|
|
660763908d | ||
|
|
fe8bdb755a | ||
|
|
67dc6d2d23 | ||
|
|
9c8d73cbe2 | ||
|
|
5db97d92dd | ||
|
|
ac470dddb5 | ||
|
|
43063fe8ce | ||
|
|
59e0046c1e | ||
|
|
36ab05c265 | ||
|
|
2b2be05dae | ||
|
|
fb1adbd1ef | ||
|
|
ab68a59b25 | ||
|
|
9c7de767e9 | ||
|
|
8ba5cf7c2e | ||
|
|
b194a19b98 | ||
|
|
1d344b016f | ||
|
|
474f3ef4ca | ||
|
|
9830927020 | ||
|
|
727932a442 | ||
|
|
cd92b51845 | ||
|
|
fe26d16411 | ||
|
|
d68c66ce2b | ||
|
|
e7bfbfb48f | ||
|
|
f2a88ae61c | ||
|
|
e2113f6ee5 | ||
|
|
3867224024 | ||
|
|
9ee0bf43bc | ||
|
|
2844542efa | ||
|
|
e3fcae9392 | ||
|
|
c6ccfa91f3 | ||
|
|
b6fcee1cb9 | ||
|
|
9071befb04 | ||
|
|
bdd5fe98f3 | ||
|
|
a3d3e83a49 | ||
|
|
08bde72028 | ||
|
|
108a136368 | ||
|
|
57d87ad6b1 | ||
|
|
0c22815ff7 | ||
|
|
0ca792ecfd | ||
|
|
987c34c69e | ||
|
|
c1c02bc8ab | ||
|
|
4ee369f27c | ||
|
|
c9012efdcb | ||
|
|
41524fc67d | ||
|
|
04ff61e981 | ||
|
|
532468dc67 | ||
|
|
9c9a2dae47 | ||
|
|
c8a868b57f | ||
|
|
4b3f81ee34 | ||
|
|
afa170ba7c | ||
|
|
46e3b2272e | ||
|
|
52472e90ec | ||
|
|
4ef0d00846 | ||
|
|
580f2537f2 | ||
|
|
3d9fd96026 | ||
|
|
f449b92721 | ||
|
|
3b0216b023 | ||
|
|
98cf839737 | ||
|
|
0bb0846505 | ||
|
|
70969400a3 | ||
|
|
147e8d5d12 | ||
|
|
cacc3e6edd | ||
|
|
a284eca147 | ||
|
|
0d3ba9d7f0 | ||
|
|
be8064d642 | ||
|
|
e30dba742d | ||
|
|
44b72ed647 | ||
|
|
666bd77dac | ||
|
|
0a6613e60d | ||
|
|
62e186c123 | ||
|
|
50dd8f5bcc | ||
|
|
d5fcac9c45 | ||
|
|
c2bed85190 | ||
|
|
183b463ef2 | ||
|
|
92fdac44a0 | ||
|
|
12829ecc73 | ||
|
|
51319c3b26 | ||
|
|
8fd827040b | ||
|
|
5ec46eae0d | ||
|
|
32c03301be | ||
|
|
df7f29b2ab | ||
|
|
e863113c36 | ||
|
|
8e2c1d7382 | ||
|
|
ab7b9cccba | ||
|
|
81bf61a161 | ||
|
|
b40f008647 | ||
|
|
734e41702b | ||
|
|
038dd20a91 | ||
|
|
1dd62b8550 | ||
|
|
715deebe05 | ||
|
|
b3fe3d8590 | ||
|
|
f74c3ed3ea | ||
|
|
2c9aebeeed | ||
|
|
7474f1e11f | ||
|
|
dba9c55b64 | ||
|
|
b432364397 | ||
|
|
696967bdd1 | ||
|
|
b76889efc3 | ||
|
|
e6a7b64ebe | ||
|
|
9daa0df311 | ||
|
|
612800bda5 | ||
|
|
a6bbb1dec9 | ||
|
|
873c93ab64 | ||
|
|
d15242e2d2 | ||
|
|
992d2b937c | ||
|
|
1e05ddad4b | ||
|
|
4f8a64610b | ||
|
|
b82366218c | ||
|
|
acbe1f4cb3 | ||
|
|
4c5e018583 | ||
|
|
6c0380e85c | ||
|
|
fde48e604f | ||
|
|
e83a4de5fb | ||
|
|
927d2799dc | ||
|
|
1ad701fe5d | ||
|
|
086425d2da | ||
|
|
beca54416a | ||
|
|
c92f5c5713 | ||
|
|
dee4e6caff | ||
|
|
dd5a39e72e | ||
|
|
e5ed52165c | ||
|
|
9484f8e0f5 | ||
|
|
947caffe0a | ||
|
|
870090e8df | ||
|
|
73f07f13c5 | ||
|
|
d1952bf591 | ||
|
|
5a612e1332 | ||
|
|
b00a9faea6 | ||
|
|
74db42a703 | ||
|
|
ddf625ca04 | ||
|
|
eca2f017d8 | ||
|
|
3190bde343 | ||
|
|
c6ebf42a47 | ||
|
|
c116b60d12 | ||
|
|
5d09e6d9ab | ||
|
|
2613ce0ac9 | ||
|
|
a88e9b28ea | ||
|
|
f0a3c26ee6 | ||
|
|
84c87ecb32 | ||
|
|
6573f44d41 | ||
|
|
3cacbc552c | ||
|
|
343d623e02 | ||
|
|
6b80bb2b11 | ||
|
|
56fe7452eb | ||
|
|
d3a66f6605 | ||
|
|
dd7b4712f1 | ||
|
|
9df5871f6b | ||
|
|
29aab9e9f4 | ||
|
|
af67eb7f0b | ||
|
|
10482c0141 | ||
|
|
a7a792251a | ||
|
|
aec2308144 | ||
|
|
0741b8aa6a | ||
|
|
3082622394 | ||
|
|
965c9cb0af | ||
|
|
495a46e2d8 | ||
|
|
05bda1192e | ||
|
|
6058af0ca1 | ||
|
|
1eb8bf9719 | ||
|
|
afc02faeda | ||
|
|
66f22de90f | ||
|
|
2949a2e0ff | ||
|
|
ba12efea9d | ||
|
|
e1180a12fb | ||
|
|
1393706f13 | ||
|
|
6f994f31f7 | ||
|
|
38aa99a063 | ||
|
|
85c44b3529 | ||
|
|
e1a2768de5 | ||
|
|
e1c9b27203 | ||
|
|
969f6ef826 | ||
|
|
7abc4d4e76 | ||
|
|
ac97147c1f | ||
|
|
dbd20fe396 | ||
|
|
44e57c9c4b | ||
|
|
488e5e531f | ||
|
|
42a6a8d770 | ||
|
|
f8e877ea05 | ||
|
|
65d6fc7272 | ||
|
|
63ce8e461b | ||
|
|
fbf4c48461 | ||
|
|
81a55db644 | ||
|
|
4d4edfa181 | ||
|
|
6f9182f1f6 | ||
|
|
fa600c03e2 | ||
|
|
4a53301e9f | ||
|
|
676984b3d5 | ||
|
|
e6d7f7248b | ||
|
|
50903b5c4a | ||
|
|
01e399fb91 | ||
|
|
911aeb7af0 | ||
|
|
7e5cd9abbc | ||
|
|
115527a21a | ||
|
|
eff4f4f601 | ||
|
|
16e0099a0d | ||
|
|
2c8c678275 | ||
|
|
3b51e87fbf | ||
|
|
6c6eef5e2b | ||
|
|
6e5910f44c | ||
|
|
a967189bc6 | ||
|
|
7069176cf6 | ||
|
|
44dcbe773d | ||
|
|
ca76975461 | ||
|
|
83122ac99e | ||
|
|
c3e9458555 | ||
|
|
057ba38873 | ||
|
|
81d7d6236b | ||
|
|
191dd49653 | ||
|
|
21e9dd6f51 | ||
|
|
cc2d14acc6 | ||
|
|
87f37e9f1c | ||
|
|
d536a9f874 | ||
|
|
b45f353fa9 | ||
|
|
a3073ec14e | ||
|
|
f77eb33029 | ||
|
|
c1c919097a | ||
|
|
e05348463c | ||
|
|
fdcf74eaf2 | ||
|
|
6d57a3e3b9 | ||
|
|
1f449c866e | ||
|
|
e12deccd24 | ||
|
|
3184ebb5ee | ||
|
|
4a35ed2b35 | ||
|
|
5c9474d1c8 | ||
|
|
2724211535 | ||
|
|
81068de0f1 | ||
|
|
df576e2738 | ||
|
|
bb1356b25d | ||
|
|
1b67960da4 | ||
|
|
d76718e8b2 |
12
.devcontainer/devcontainer.json
Normal file
12
.devcontainer/devcontainer.json
Normal file
@@ -0,0 +1,12 @@
|
|||||||
|
{
|
||||||
|
"name": "Java",
|
||||||
|
"image": "mcr.microsoft.com/devcontainers/java:1-21",
|
||||||
|
"features": {
|
||||||
|
"ghcr.io/devcontainers/features/java:1": {
|
||||||
|
"version": "none",
|
||||||
|
"installMaven": "true",
|
||||||
|
"mavenVersion": "3.8.6",
|
||||||
|
"installGradle": "true"
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
1
.gitattributes
vendored
Normal file
1
.gitattributes
vendored
Normal file
@@ -0,0 +1 @@
|
|||||||
|
*.java text eol=lf
|
||||||
10
.github/PULL_REQUEST_TEMPLATE.md
vendored
10
.github/PULL_REQUEST_TEMPLATE.md
vendored
@@ -1,12 +1,16 @@
|
|||||||
# Description
|
# Description
|
||||||
** Describe your change here**
|
|
||||||
|
<!-- Describe your change here -->
|
||||||
|
|
||||||
# Before submitting a PR:
|
# Before submitting a PR:
|
||||||
We love getting PRs, but we hate asking people for the same basic changes every time.
|
We love getting PRs, but we hate asking people for the same basic changes every time.
|
||||||
|
|
||||||
- [ ] Push your changes to a branch other than `master`. Create your PR from that branch.
|
- [ ] Push your changes to a branch other than `main`. Create your PR from that branch.
|
||||||
- [ ] Add JavaDocs and other comments
|
- [ ] Add JavaDocs and other comments
|
||||||
- [ ] Write tests that run and pass in CI. See [CONTRIBUTING.md](CONTRIBUTING.md) for details on how to capture snapshot data.
|
- [ ] Write tests that run and pass in CI. See [CONTRIBUTING.md](CONTRIBUTING.md) for details on how to capture snapshot data.
|
||||||
- [ ] Run `mvn clean compile` locally. This may reformat your code, commit those changes.
|
|
||||||
- [ ] Run `mvn -D enable-ci clean install site` locally. If this command doesn't succeed, your change will not pass CI.
|
- [ ] Run `mvn -D enable-ci clean install site` locally. If this command doesn't succeed, your change will not pass CI.
|
||||||
|
|
||||||
|
# When creating a PR:
|
||||||
|
|
||||||
|
- [ ] Fill in the "Description" above.
|
||||||
|
- [ ] Enable "Allow edits from maintainers".
|
||||||
|
|||||||
12
.github/dependabot.yml
vendored
Normal file
12
.github/dependabot.yml
vendored
Normal file
@@ -0,0 +1,12 @@
|
|||||||
|
version: 2
|
||||||
|
updates:
|
||||||
|
- package-ecosystem: "maven"
|
||||||
|
directory: "/"
|
||||||
|
schedule:
|
||||||
|
interval: "monthly"
|
||||||
|
time: "02:00"
|
||||||
|
- package-ecosystem: "github-actions"
|
||||||
|
directory: "/"
|
||||||
|
schedule:
|
||||||
|
interval: "monthly"
|
||||||
|
time: "02:00"
|
||||||
5
.github/release-drafter.yml
vendored
5
.github/release-drafter.yml
vendored
@@ -1,5 +1,6 @@
|
|||||||
name-template: 'v$NEXT_PATCH_VERSION 🌈'
|
name-template: 'v$NEXT_MINOR_VERSION 🌈'
|
||||||
tag-template: 'v$NEXT_PATCH_VERSION'
|
tag-template: 'github-api-$NEXT_MINOR_VERSION'
|
||||||
|
version-template: '$MAJOR.$MINOR'
|
||||||
categories:
|
categories:
|
||||||
- title: '🚀 Features'
|
- title: '🚀 Features'
|
||||||
labels:
|
labels:
|
||||||
|
|||||||
67
.github/workflows/codeql-analysis.yml
vendored
Normal file
67
.github/workflows/codeql-analysis.yml
vendored
Normal file
@@ -0,0 +1,67 @@
|
|||||||
|
# For most projects, this workflow file will not need changing; you simply need
|
||||||
|
# to commit it to your repository.
|
||||||
|
#
|
||||||
|
# You may wish to alter this file to override the set of languages analyzed,
|
||||||
|
# or to provide custom queries or build logic.
|
||||||
|
#
|
||||||
|
# ******** NOTE ********
|
||||||
|
# We have attempted to detect the languages in your repository. Please check
|
||||||
|
# the `language` matrix defined below to confirm you have the correct set of
|
||||||
|
# supported CodeQL languages.
|
||||||
|
#
|
||||||
|
name: "CodeQL"
|
||||||
|
|
||||||
|
on:
|
||||||
|
push:
|
||||||
|
branches: [ main, gh-pages ]
|
||||||
|
pull_request:
|
||||||
|
# The branches below must be a subset of the branches above
|
||||||
|
branches: [ main ]
|
||||||
|
schedule:
|
||||||
|
- cron: '20 0 * * 6'
|
||||||
|
|
||||||
|
jobs:
|
||||||
|
analyze:
|
||||||
|
name: Analyze
|
||||||
|
runs-on: ubuntu-latest
|
||||||
|
|
||||||
|
strategy:
|
||||||
|
fail-fast: false
|
||||||
|
matrix:
|
||||||
|
language: [ 'java' ]
|
||||||
|
# CodeQL supports [ 'cpp', 'csharp', 'go', 'java', 'javascript', 'python' ]
|
||||||
|
# Learn more:
|
||||||
|
# https://docs.github.com/en/free-pro-team@latest/github/finding-security-vulnerabilities-and-errors-in-your-code/configuring-code-scanning#changing-the-languages-that-are-analyzed
|
||||||
|
|
||||||
|
steps:
|
||||||
|
- name: Checkout repository
|
||||||
|
uses: actions/checkout@v2
|
||||||
|
|
||||||
|
# Initializes the CodeQL tools for scanning.
|
||||||
|
- name: Initialize CodeQL
|
||||||
|
uses: github/codeql-action/init@v1
|
||||||
|
with:
|
||||||
|
languages: ${{ matrix.language }}
|
||||||
|
# If you wish to specify custom queries, you can do so here or in a config file.
|
||||||
|
# By default, queries listed here will override any specified in a config file.
|
||||||
|
# Prefix the list here with "+" to use these queries and those in the config file.
|
||||||
|
# queries: ./path/to/local/query, your-org/your-repo/queries@main
|
||||||
|
|
||||||
|
# Autobuild attempts to build any compiled languages (C/C++, C#, or Java).
|
||||||
|
# If this step fails, then you should remove it and run the build manually (see below)
|
||||||
|
- name: Autobuild
|
||||||
|
uses: github/codeql-action/autobuild@v1
|
||||||
|
|
||||||
|
# ℹ️ Command-line programs to run using the OS shell.
|
||||||
|
# 📚 https://git.io/JvXDl
|
||||||
|
|
||||||
|
# ✏️ If the Autobuild fails above, remove it and uncomment the following three lines
|
||||||
|
# and modify them (or add more) to build your code if your project
|
||||||
|
# uses a compiled language
|
||||||
|
|
||||||
|
#- run: |
|
||||||
|
# make bootstrap
|
||||||
|
# make release
|
||||||
|
|
||||||
|
- name: Perform CodeQL Analysis
|
||||||
|
uses: github/codeql-action/analyze@v1
|
||||||
22
.github/workflows/junie.yml
vendored
Normal file
22
.github/workflows/junie.yml
vendored
Normal file
@@ -0,0 +1,22 @@
|
|||||||
|
name: Junie
|
||||||
|
run-name: Junie run ${{ inputs.run_id }}
|
||||||
|
|
||||||
|
permissions:
|
||||||
|
contents: write
|
||||||
|
pull-requests: write
|
||||||
|
|
||||||
|
on:
|
||||||
|
workflow_dispatch:
|
||||||
|
inputs:
|
||||||
|
run_id:
|
||||||
|
description: "id of workflow process"
|
||||||
|
required: true
|
||||||
|
workflow_params:
|
||||||
|
description: "stringified params"
|
||||||
|
required: true
|
||||||
|
|
||||||
|
jobs:
|
||||||
|
call-workflow-passing-data:
|
||||||
|
uses: jetbrains-junie/junie-workflows/.github/workflows/ej-issue.yml@main
|
||||||
|
with:
|
||||||
|
workflow_params: ${{ inputs.workflow_params }}
|
||||||
48
.github/workflows/maven-build.yml
vendored
48
.github/workflows/maven-build.yml
vendored
@@ -2,42 +2,51 @@ name: CI
|
|||||||
|
|
||||||
on: [push, pull_request]
|
on: [push, pull_request]
|
||||||
|
|
||||||
|
# this is required by spotless for JDK 16+
|
||||||
|
env:
|
||||||
|
JAVA_11_PLUS_MAVEN_OPTS: "--add-opens jdk.compiler/com.sun.tools.javac.util=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.file=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.parser=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.tree=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.api=ALL-UNNAMED"
|
||||||
|
|
||||||
jobs:
|
jobs:
|
||||||
build:
|
build:
|
||||||
name: build-only (Java ${{ matrix.java }})
|
name: build-only (Java ${{ matrix.java }})
|
||||||
runs-on: ubuntu-latest
|
runs-on: ubuntu-latest
|
||||||
strategy:
|
strategy:
|
||||||
|
fail-fast: false
|
||||||
matrix:
|
matrix:
|
||||||
java: [ 11 ]
|
java: [ 16 ]
|
||||||
steps:
|
steps:
|
||||||
- uses: actions/checkout@v2
|
- uses: actions/checkout@v2
|
||||||
- name: Set up JDK
|
- name: Set up JDK
|
||||||
uses: actions/setup-java@v1
|
uses: actions/setup-java@v2
|
||||||
with:
|
with:
|
||||||
java-version: ${{ matrix.java }}
|
java-version: ${{ matrix.java }}
|
||||||
|
distribution: 'adopt'
|
||||||
- name: Cached .m2
|
- name: Cached .m2
|
||||||
uses: actions/cache@v1
|
uses: actions/cache@v2.1.6
|
||||||
with:
|
with:
|
||||||
path: ~/.m2/repository
|
path: ~/.m2/repository
|
||||||
key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
|
key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
|
||||||
restore-keys: |
|
restore-keys: |
|
||||||
${{ runner.os }}-maven-
|
${{ runner.os }}-maven-
|
||||||
- name: Maven Install (skipTests)
|
- name: Maven Install (skipTests)
|
||||||
run: mvn -B install -DskipTests -D enable-ci --file pom.xml
|
env:
|
||||||
|
MAVEN_OPTS: ${{ env.JAVA_11_PLUS_MAVEN_OPTS }}
|
||||||
|
run: mvn -B install -DskipTests --file pom.xml
|
||||||
site:
|
site:
|
||||||
name: site (Java ${{ matrix.java }})
|
name: site (Java ${{ matrix.java }})
|
||||||
runs-on: ubuntu-latest
|
runs-on: ubuntu-latest
|
||||||
strategy:
|
strategy:
|
||||||
|
fail-fast: false
|
||||||
matrix:
|
matrix:
|
||||||
java: [ 8, 11 ]
|
java: [ 8, 11 ]
|
||||||
steps:
|
steps:
|
||||||
- uses: actions/checkout@v2
|
- uses: actions/checkout@v2
|
||||||
- name: Set up JDK
|
- name: Set up JDK
|
||||||
uses: actions/setup-java@v1
|
uses: actions/setup-java@v2
|
||||||
with:
|
with:
|
||||||
java-version: ${{ matrix.java }}
|
java-version: ${{ matrix.java }}
|
||||||
- uses: actions/cache@v1
|
distribution: 'adopt'
|
||||||
|
- uses: actions/cache@v2.1.6
|
||||||
with:
|
with:
|
||||||
path: ~/.m2/repository
|
path: ~/.m2/repository
|
||||||
key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
|
key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
|
||||||
@@ -49,24 +58,41 @@ jobs:
|
|||||||
name: test (${{ matrix.os }}, Java ${{ matrix.java }})
|
name: test (${{ matrix.os }}, Java ${{ matrix.java }})
|
||||||
runs-on: ${{ matrix.os }}-latest
|
runs-on: ${{ matrix.os }}-latest
|
||||||
strategy:
|
strategy:
|
||||||
|
fail-fast: false
|
||||||
matrix:
|
matrix:
|
||||||
os: [ ubuntu, windows ]
|
os: [ ubuntu, windows ]
|
||||||
java: [ 8, 11, 13 ]
|
java: [ 8, 11, 16 ]
|
||||||
steps:
|
steps:
|
||||||
- uses: actions/checkout@v2
|
- uses: actions/checkout@v2
|
||||||
- name: Set up JDK
|
- name: Set up JDK
|
||||||
uses: actions/setup-java@v1
|
uses: actions/setup-java@v2
|
||||||
with:
|
with:
|
||||||
java-version: ${{ matrix.java }}
|
java-version: ${{ matrix.java }}
|
||||||
- uses: actions/cache@v1
|
distribution: 'adopt'
|
||||||
|
- uses: actions/cache@v2.1.6
|
||||||
with:
|
with:
|
||||||
path: ~/.m2/repository
|
path: ~/.m2/repository
|
||||||
key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
|
key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
|
||||||
restore-keys: |
|
restore-keys: |
|
||||||
${{ runner.os }}-maven-
|
${{ runner.os }}-maven-
|
||||||
|
# JDK 8
|
||||||
- name: Maven Install without Code Coverage
|
- name: Maven Install without Code Coverage
|
||||||
if: matrix.os == 'windows'
|
if: matrix.os == 'windows' && matrix.java == '8'
|
||||||
run: mvn -B install --file pom.xml
|
run: mvn -B install --file pom.xml
|
||||||
- name: Maven Install with Code Coverage
|
- name: Maven Install with Code Coverage
|
||||||
if: matrix.os != 'windows'
|
if: matrix.os != 'windows' && matrix.java == '8'
|
||||||
run: mvn -B install -D enable-ci --file pom.xml
|
run: mvn -B install -D enable-ci --file pom.xml
|
||||||
|
- name: Codecov Report
|
||||||
|
if: matrix.os != 'windows' && matrix.java == '8'
|
||||||
|
uses: codecov/codecov-action@v1.5.0
|
||||||
|
# JDK 11+
|
||||||
|
- name: Maven Install without Code Coverage
|
||||||
|
if: matrix.os == 'windows' && matrix.java != '8'
|
||||||
|
env:
|
||||||
|
MAVEN_OPTS: ${{ env.JAVA_11_PLUS_MAVEN_OPTS }}
|
||||||
|
run: mvn -B install --file pom.xml "-Dsurefire.argLine=--add-opens java.base/java.net=ALL-UNNAMED"
|
||||||
|
- name: Maven Install with Code Coverage
|
||||||
|
if: matrix.os != 'windows' && matrix.java != '8'
|
||||||
|
env:
|
||||||
|
MAVEN_OPTS: ${{ env.JAVA_11_PLUS_MAVEN_OPTS }}
|
||||||
|
run: mvn -B install -D enable-ci --file pom.xml "-Dsurefire.argLine=--add-opens java.base/java.net=ALL-UNNAMED"
|
||||||
|
|||||||
16
.github/workflows/release-drafter.yml
vendored
Normal file
16
.github/workflows/release-drafter.yml
vendored
Normal file
@@ -0,0 +1,16 @@
|
|||||||
|
|
||||||
|
name: Release Drafter
|
||||||
|
|
||||||
|
on:
|
||||||
|
push:
|
||||||
|
branches:
|
||||||
|
- main
|
||||||
|
|
||||||
|
jobs:
|
||||||
|
update_release_draft:
|
||||||
|
runs-on: ubuntu-latest
|
||||||
|
steps:
|
||||||
|
- name: Release Drafter
|
||||||
|
uses: release-drafter/release-drafter@v5
|
||||||
|
env:
|
||||||
|
GITHUB_TOKEN: ${{ secrets.GITHUB_TOKEN }}
|
||||||
1326
CHANGELOG.md
1326
CHANGELOG.md
File diff suppressed because it is too large
Load Diff
@@ -14,10 +14,14 @@ Example:
|
|||||||
|
|
||||||
This the default behavior.
|
This the default behavior.
|
||||||
|
|
||||||
|
Example for a single test case:
|
||||||
|
|
||||||
|
`mvn install -Dtest=WireMockStatusReporterTest#user_whenProxying_AuthCorrectlyConfigured`
|
||||||
|
|
||||||
|
|
||||||
### Setting up credential
|
### Setting up credential
|
||||||
|
|
||||||
1. Create an OAuth token on github.com
|
1. Create a "Personal access token" on https://github.com/ (`Settings` > `Developer settings` > `Personal access tokens`)
|
||||||
2. Set the GITHUB_OAUTH environment variable to the value of that token
|
2. Set the GITHUB_OAUTH environment variable to the value of that token
|
||||||
3. Set the system property `test.github.useProxy` (usually like "-Dtest.github.useProxy" as a Java VM option)
|
3. Set the system property `test.github.useProxy` (usually like "-Dtest.github.useProxy" as a Java VM option)
|
||||||
|
|
||||||
@@ -27,21 +31,37 @@ This the default behavior.
|
|||||||
|
|
||||||
`WireMockStatusReporterTest: GitHub proxying and user auth correctly configured for user login: <your login>`
|
`WireMockStatusReporterTest: GitHub proxying and user auth correctly configured for user login: <your login>`
|
||||||
|
|
||||||
Whenever you run tests with `-Dtest.github.useProxy`, they will try to get data from local files but will fallback to proxying to github if not found.
|
Whenever you run tests with `-Dtest.github.useProxy`, they will try to get data from local files but will fallback to proxying to GitHub if not found.
|
||||||
|
|
||||||
|
|
||||||
### Writing a new test
|
### Writing a new test
|
||||||
|
|
||||||
Once you have credentials setup, you add new test classes and test methods as you would normally.
|
Once you have credentials setup, you add new test classes and test methods as you would normally.
|
||||||
Keep `useProxy` enabled and iterate on your tests as needed. Remember, while proxying your tests are interacting with GitHub - you will need to clean up your state between runs.
|
|
||||||
|
|
||||||
When you are ready to create a snapshot of your test data,
|
#### Running tests using GitHub test proxy
|
||||||
run your test with `test.github.takeSnapshot` ("-Dtest.github.takeSnapshot" as a Java VM option). For example:
|
|
||||||
|
|
||||||
`mvn install -Dtest.github.takeSnapshot -Dtest=YourTestClassName`
|
Keep `useProxy` enabled and iterate on your tests as needed. With `useProxy` enabled your tests will interact with
|
||||||
|
GitHub - you will need to clean up your server-state between runs. This can be done manually to start with.
|
||||||
|
Once your test code is somewhat stable, use `getNonRecordingGitHub()` to get a `GitHub` instance for test setup and cleanup.
|
||||||
|
Interactions with that `GitHub` instance will not be recorded as part of the test, keeping the test data files to a minimum.
|
||||||
|
|
||||||
The above command would create snapshot WireMock data files under the path `src/test/resources/org/kohsuhke/github/YourTestClassName/wiremock`.
|
#### Running tests against your personal GitHub user account
|
||||||
Each method would get a separate director that would hold the data files for that test method.
|
|
||||||
|
By default, test helper methods such as `getTempRepository()` target the `hub4j-test-org` GitHub organization.
|
||||||
|
Please request access to this org to record your tests before submitting a PR. This helps keep the project stable and nimble.
|
||||||
|
Until you have access (or if you don't want access), you can set the following additional system property to target
|
||||||
|
your personal github account.
|
||||||
|
|
||||||
|
`mvn install -Dtest.github.org=false -Dtest=YourTestClassName`
|
||||||
|
|
||||||
|
#### Taking a snapshot
|
||||||
|
|
||||||
|
When you are ready to create a snapshot of your test data, run your test with `test.github.takeSnapshot` ("-Dtest.github.takeSnapshot" as
|
||||||
|
a Java VM option). For example:
|
||||||
|
|
||||||
|
`mvn install -Dtest.github.takeSnapshot -Dtest.github.org=false -Dtest=YourTestClassName`
|
||||||
|
|
||||||
|
The above command will create snapshot WireMock data files under the path `src/test/resources/org/kohsuhke/github/YourTestClassName/wiremock`.
|
||||||
|
Each method will get a separate directory that will hold the data files for that test method.
|
||||||
|
|
||||||
Add all files including the generated data to your commit and submit a PR.
|
Add all files including the generated data to your commit and submit a PR.
|
||||||
|
|
||||||
|
|||||||
@@ -1,9 +1,9 @@
|
|||||||
# Java API for GitHub
|
# Java API for GitHub
|
||||||
|
|
||||||
[](https://mvnrepository.com/artifact/org.kohsuke/github-api)
|
[](https://mvnrepository.com/artifact/org.kohsuke/github-api)
|
||||||
[](https://gitter.im/github-api/github-api?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
|
[](https://gitter.im/hub4j/github-api?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
|
||||||

|

|
||||||
|
[](https://codecov.io/gh/hub4j/github-api)
|
||||||
|
|
||||||
|
|
||||||
See https://github-api.kohsuke.org/ for more details
|
See https://github-api.kohsuke.org/ for more details
|
||||||
|
|||||||
7
codecov.yml
Normal file
7
codecov.yml
Normal file
@@ -0,0 +1,7 @@
|
|||||||
|
ignore:
|
||||||
|
- "**/extras/okhttp3/ObsoleteUrlFactory**"
|
||||||
|
- "**/extras/OkHttpConnector"
|
||||||
|
- "**/extras/OkHttp3Connector"
|
||||||
|
- "**/example/**"
|
||||||
|
- "**/github/EnforcementLevel"
|
||||||
|
|
||||||
277
pom.xml
277
pom.xml
@@ -2,16 +2,16 @@
|
|||||||
<modelVersion>4.0.0</modelVersion>
|
<modelVersion>4.0.0</modelVersion>
|
||||||
<groupId>org.kohsuke</groupId>
|
<groupId>org.kohsuke</groupId>
|
||||||
<artifactId>github-api</artifactId>
|
<artifactId>github-api</artifactId>
|
||||||
<version>1.111</version>
|
<version>1.131-SNAPSHOT</version>
|
||||||
<name>GitHub API for Java</name>
|
<name>GitHub API for Java</name>
|
||||||
<url>https://github-api.kohsuke.org/</url>
|
<url>https://github-api.kohsuke.org/</url>
|
||||||
<description>GitHub API for Java</description>
|
<description>GitHub API for Java</description>
|
||||||
|
|
||||||
<scm>
|
<scm>
|
||||||
<connection>scm:git:git@github.com/github-api/${project.artifactId}.git</connection>
|
<connection>scm:git:git@github.com/hub4j/${project.artifactId}.git</connection>
|
||||||
<developerConnection>scm:git:ssh://git@github.com/github-api/${project.artifactId}.git</developerConnection>
|
<developerConnection>scm:git:ssh://git@github.com/hub4j/${project.artifactId}.git</developerConnection>
|
||||||
<url>https://github.com/github-api/github-api/</url>
|
<url>https://github.com/hub4j/github-api/</url>
|
||||||
<tag>github-api-1.111</tag>
|
<tag>HEAD</tag>
|
||||||
</scm>
|
</scm>
|
||||||
|
|
||||||
<distributionManagement>
|
<distributionManagement>
|
||||||
@@ -27,25 +27,27 @@
|
|||||||
</repository>
|
</repository>
|
||||||
<site>
|
<site>
|
||||||
<id>github-pages</id>
|
<id>github-pages</id>
|
||||||
<url>gitsite:git@github.com/github-api/${project.artifactId}.git</url>
|
<url>gitsite:git@github.com/hub4j/${project.artifactId}.git</url>
|
||||||
</site>
|
</site>
|
||||||
</distributionManagement>
|
</distributionManagement>
|
||||||
|
|
||||||
<properties>
|
<properties>
|
||||||
<project.build.sourceEncoding>UTF-8</project.build.sourceEncoding>
|
<project.build.sourceEncoding>UTF-8</project.build.sourceEncoding>
|
||||||
<spotbugs-maven-plugin.version>4.0.0</spotbugs-maven-plugin.version>
|
<spotbugs-maven-plugin.version>4.2.3</spotbugs-maven-plugin.version>
|
||||||
<spotbugs.version>4.0.2</spotbugs.version>
|
<spotbugs.version>4.2.3</spotbugs.version>
|
||||||
<spotbugs-maven-plugin.failOnError>true</spotbugs-maven-plugin.failOnError>
|
<spotbugs-maven-plugin.failOnError>true</spotbugs-maven-plugin.failOnError>
|
||||||
<hamcrest.version>2.2</hamcrest.version>
|
<hamcrest.version>2.2</hamcrest.version>
|
||||||
<okhttp3.version>4.4.1</okhttp3.version>
|
<okhttp3.version>4.4.1</okhttp3.version>
|
||||||
<okio.version>2.5.0</okio.version>
|
<okio.version>2.5.0</okio.version>
|
||||||
<formatter-maven-plugin.goal>format</formatter-maven-plugin.goal>
|
|
||||||
<impsort-maven-plugin.goal>sort</impsort-maven-plugin.goal>
|
|
||||||
<!-- Using this as the minimum bar for code coverage. Adding methods without covering them will fail this. -->
|
<!-- Using this as the minimum bar for code coverage. Adding methods without covering them will fail this. -->
|
||||||
<jacoco.coverage.target.bundle.method>0.60</jacoco.coverage.target.bundle.method>
|
<jacoco.coverage.target.bundle.method>0.70</jacoco.coverage.target.bundle.method>
|
||||||
<jacoco.coverage.target.class.method>0.25</jacoco.coverage.target.class.method>
|
<jacoco.coverage.target.class.method>0.50</jacoco.coverage.target.class.method>
|
||||||
<!-- For non-ci builds we'd like the build to still complete if jacoco metrics aren't met. -->
|
<!-- For non-ci builds we'd like the build to still complete if jacoco metrics aren't met. -->
|
||||||
<jacoco.haltOnFailure>false</jacoco.haltOnFailure>
|
<jacoco.haltOnFailure>false</jacoco.haltOnFailure>
|
||||||
|
<jjwt.suite.version>0.11.2</jjwt.suite.version>
|
||||||
|
|
||||||
|
<jacoco.surefire.argLine />
|
||||||
|
<surefire.argLine />
|
||||||
</properties>
|
</properties>
|
||||||
|
|
||||||
<build>
|
<build>
|
||||||
@@ -79,6 +81,14 @@
|
|||||||
</testResources>
|
</testResources>
|
||||||
<pluginManagement>
|
<pluginManagement>
|
||||||
<plugins>
|
<plugins>
|
||||||
|
<plugin>
|
||||||
|
<artifactId>maven-surefire-plugin</artifactId>
|
||||||
|
<version>2.22.2</version>
|
||||||
|
<configuration>
|
||||||
|
<!-- SUREFIRE-1226 workaround -->
|
||||||
|
<trimStackTrace>false</trimStackTrace>
|
||||||
|
</configuration>
|
||||||
|
</plugin>
|
||||||
<plugin>
|
<plugin>
|
||||||
<groupId>org.apache.maven.plugins</groupId>
|
<groupId>org.apache.maven.plugins</groupId>
|
||||||
<artifactId>maven-source-plugin</artifactId>
|
<artifactId>maven-source-plugin</artifactId>
|
||||||
@@ -92,12 +102,17 @@
|
|||||||
<plugin>
|
<plugin>
|
||||||
<groupId>org.jacoco</groupId>
|
<groupId>org.jacoco</groupId>
|
||||||
<artifactId>jacoco-maven-plugin</artifactId>
|
<artifactId>jacoco-maven-plugin</artifactId>
|
||||||
<version>0.8.5</version>
|
<version>0.8.7</version>
|
||||||
<executions>
|
<executions>
|
||||||
<execution>
|
<execution>
|
||||||
<goals>
|
<goals>
|
||||||
<goal>prepare-agent</goal>
|
<goal>prepare-agent</goal>
|
||||||
</goals>
|
</goals>
|
||||||
|
<configuration>
|
||||||
|
<propertyName>jacoco.surefire.argLine</propertyName>
|
||||||
|
<!-- no need to get data about external code. It dramatically reduces performance of JaCoCo for nothing -->
|
||||||
|
<include>org.kohsuke.*</include>
|
||||||
|
</configuration>
|
||||||
</execution>
|
</execution>
|
||||||
<!-- attached to Maven test phase -->
|
<!-- attached to Maven test phase -->
|
||||||
<execution>
|
<execution>
|
||||||
@@ -145,59 +160,41 @@
|
|||||||
<!-- Sample only -->
|
<!-- Sample only -->
|
||||||
<exclude>org.kohsuke.github.example.*</exclude>
|
<exclude>org.kohsuke.github.example.*</exclude>
|
||||||
|
|
||||||
<!-- No methods -->
|
|
||||||
<exclude>org.kohsuke.github.Previews</exclude>
|
|
||||||
|
|
||||||
<!-- Deprecated -->
|
<!-- Deprecated -->
|
||||||
|
<exclude>org.kohsuke.github.extras.OkHttpConnector</exclude>
|
||||||
<exclude>org.kohsuke.github.extras.OkHttp3Connector</exclude>
|
<exclude>org.kohsuke.github.extras.OkHttp3Connector</exclude>
|
||||||
<exclude>org.kohsuke.github.EnforcementLevel</exclude>
|
<exclude>org.kohsuke.github.EnforcementLevel</exclude>
|
||||||
<exclude>org.kohsuke.github.GHPerson.1</exclude>
|
<exclude>org.kohsuke.github.GHPerson.1</exclude>
|
||||||
|
|
||||||
<!-- These fail coverage on windows because tests are disabled -->
|
<!-- TODO: Some coverage, but more needed -->
|
||||||
<exclude>org.kohsuke.github.GHAsset</exclude>
|
<exclude>org.kohsuke.github.GHPullRequestReviewBuilder.DraftReviewComment</exclude>
|
||||||
<exclude>org.kohsuke.github.GHReleaseBuilder</exclude>
|
<exclude>org.kohsuke.github.GHIssue.PullRequest</exclude>
|
||||||
<exclude>org.kohsuke.github.GHRelease</exclude>
|
<exclude>org.kohsuke.github.GHCommitSearchBuilder</exclude>
|
||||||
|
<exclude>org.kohsuke.github.GHRepositorySearchBuilder</exclude>
|
||||||
|
<exclude>org.kohsuke.github.GHUserSearchBuilder</exclude>
|
||||||
|
|
||||||
<!-- TODO: These still need test coverage -->
|
<!-- TODO: These still need test coverage -->
|
||||||
<exclude>org.kohsuke.github.GHBranchProtection.RequiredSignatures</exclude>
|
<exclude>org.kohsuke.github.GHBranchProtection.RequiredSignatures</exclude>
|
||||||
<exclude>org.kohsuke.github.GHBranchProtectionBuilder.Restrictions</exclude>
|
<exclude>org.kohsuke.github.GHBranchProtectionBuilder.Restrictions</exclude>
|
||||||
<exclude>org.kohsuke.github.GHBranchProtection.Restrictions</exclude>
|
<exclude>org.kohsuke.github.GHBranchProtection.Restrictions</exclude>
|
||||||
<exclude>org.kohsuke.github.GHCommentAuthorAssociation</exclude>
|
<exclude>org.kohsuke.github.GHCommentAuthorAssociation</exclude>
|
||||||
<exclude>org.kohsuke.github.GHCommitBuilder.UserInfo</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHCommitState</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHCompare.Commit</exclude>
|
<exclude>org.kohsuke.github.GHCompare.Commit</exclude>
|
||||||
<exclude>org.kohsuke.github.GHCompare.InnerCommit</exclude>
|
<exclude>org.kohsuke.github.GHCompare.InnerCommit</exclude>
|
||||||
<exclude>org.kohsuke.github.GHCompare.Status</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHCompare.Tree</exclude>
|
<exclude>org.kohsuke.github.GHCompare.Tree</exclude>
|
||||||
<exclude>org.kohsuke.github.GHCompare.User</exclude>
|
<exclude>org.kohsuke.github.GHCompare.User</exclude>
|
||||||
<exclude>org.kohsuke.github.GHCompare</exclude>
|
<exclude>org.kohsuke.github.GHCompare</exclude>
|
||||||
<exclude>org.kohsuke.github.GHDeployKey</exclude>
|
<exclude>org.kohsuke.github.GHDeployKey</exclude>
|
||||||
<exclude>org.kohsuke.github.GHDeploymentStatusBuilder</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHDirection</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHEmail</exclude>
|
<exclude>org.kohsuke.github.GHEmail</exclude>
|
||||||
<exclude>org.kohsuke.github.GHEventPayload.Ping</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHEventPayload.Release</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHException</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHHook</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHHooks.OrgContext</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHInvitation</exclude>
|
<exclude>org.kohsuke.github.GHInvitation</exclude>
|
||||||
<exclude>org.kohsuke.github.GHMilestoneState</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHOrgHook</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHProject.ProjectStateFilter</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.Authorship</exclude>
|
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.Authorship</exclude>
|
||||||
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.Commit</exclude>
|
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.Commit</exclude>
|
||||||
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.CommitPointer</exclude>
|
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.CommitPointer</exclude>
|
||||||
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.Tree</exclude>
|
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.Tree</exclude>
|
||||||
<exclude>org.kohsuke.github.GHPullRequestCommitDetail</exclude>
|
<exclude>org.kohsuke.github.GHPullRequestCommitDetail</exclude>
|
||||||
<exclude>org.kohsuke.github.GHPullRequestFileDetail</exclude>
|
<exclude>org.kohsuke.github.GHPullRequestFileDetail</exclude>
|
||||||
<exclude>org.kohsuke.github.GHPullRequestQueryBuilder.Sort</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHReleaseUpdater</exclude>
|
<exclude>org.kohsuke.github.GHReleaseUpdater</exclude>
|
||||||
<exclude>org.kohsuke.github.GHRepository.ForkSort</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHRequestedAction</exclude>
|
<exclude>org.kohsuke.github.GHRequestedAction</exclude>
|
||||||
<exclude>org.kohsuke.github.GHStargazer</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHTagObject</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHTeam.Role</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHUserSearchBuilder.Sort</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHVerifiedKey</exclude>
|
<exclude>org.kohsuke.github.GHVerifiedKey</exclude>
|
||||||
</excludes>
|
</excludes>
|
||||||
</rule>
|
</rule>
|
||||||
@@ -209,7 +206,7 @@
|
|||||||
<plugin>
|
<plugin>
|
||||||
<groupId>org.apache.maven.plugins</groupId>
|
<groupId>org.apache.maven.plugins</groupId>
|
||||||
<artifactId>maven-javadoc-plugin</artifactId>
|
<artifactId>maven-javadoc-plugin</artifactId>
|
||||||
<version>3.2.0</version>
|
<version>3.3.0</version>
|
||||||
<configuration>
|
<configuration>
|
||||||
<source>8</source>
|
<source>8</source>
|
||||||
<failOnWarnings>true</failOnWarnings>
|
<failOnWarnings>true</failOnWarnings>
|
||||||
@@ -233,7 +230,7 @@
|
|||||||
<plugin>
|
<plugin>
|
||||||
<groupId>org.apache.maven.plugins</groupId>
|
<groupId>org.apache.maven.plugins</groupId>
|
||||||
<artifactId>maven-site-plugin</artifactId>
|
<artifactId>maven-site-plugin</artifactId>
|
||||||
<version>3.9.0</version>
|
<version>3.9.1</version>
|
||||||
</plugin>
|
</plugin>
|
||||||
<plugin>
|
<plugin>
|
||||||
<groupId>org.apache.maven.plugins</groupId>
|
<groupId>org.apache.maven.plugins</groupId>
|
||||||
@@ -253,12 +250,12 @@
|
|||||||
<plugin>
|
<plugin>
|
||||||
<groupId>org.apache.maven.plugins</groupId>
|
<groupId>org.apache.maven.plugins</groupId>
|
||||||
<artifactId>maven-project-info-reports-plugin</artifactId>
|
<artifactId>maven-project-info-reports-plugin</artifactId>
|
||||||
<version>3.0.0</version>
|
<version>3.1.2</version>
|
||||||
<dependencies>
|
<dependencies>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>org.apache.bcel</groupId>
|
<groupId>org.apache.bcel</groupId>
|
||||||
<artifactId>bcel</artifactId>
|
<artifactId>bcel</artifactId>
|
||||||
<version>6.4.1</version>
|
<version>6.5.0</version>
|
||||||
</dependency>
|
</dependency>
|
||||||
</dependencies>
|
</dependencies>
|
||||||
</plugin>
|
</plugin>
|
||||||
@@ -280,16 +277,20 @@
|
|||||||
|
|
||||||
<plugin>
|
<plugin>
|
||||||
<artifactId>maven-surefire-plugin</artifactId>
|
<artifactId>maven-surefire-plugin</artifactId>
|
||||||
<version>2.22.2</version>
|
<executions>
|
||||||
|
<execution>
|
||||||
|
<id>default-test</id>
|
||||||
<configuration>
|
<configuration>
|
||||||
<!-- SUREFIRE-1226 workaround -->
|
<excludesFile>src/test/resources/slow-or-flaky-tests.txt</excludesFile>
|
||||||
<trimStackTrace>false</trimStackTrace>
|
<argLine>@{jacoco.surefire.argLine} ${surefire.argLine}</argLine>
|
||||||
</configuration>
|
</configuration>
|
||||||
|
</execution>
|
||||||
|
</executions>
|
||||||
</plugin>
|
</plugin>
|
||||||
<plugin>
|
<plugin>
|
||||||
<groupId>org.codehaus.mojo</groupId>
|
<groupId>org.codehaus.mojo</groupId>
|
||||||
<artifactId>animal-sniffer-maven-plugin</artifactId>
|
<artifactId>animal-sniffer-maven-plugin</artifactId>
|
||||||
<version>1.18</version>
|
<version>1.20</version>
|
||||||
<configuration>
|
<configuration>
|
||||||
<signature>
|
<signature>
|
||||||
<groupId>org.codehaus.mojo.signature</groupId>
|
<groupId>org.codehaus.mojo.signature</groupId>
|
||||||
@@ -320,36 +321,35 @@
|
|||||||
</executions>
|
</executions>
|
||||||
</plugin>
|
</plugin>
|
||||||
<plugin>
|
<plugin>
|
||||||
<groupId>net.revelc.code.formatter</groupId>
|
<groupId>com.diffplug.spotless</groupId>
|
||||||
<artifactId>formatter-maven-plugin</artifactId>
|
<artifactId>spotless-maven-plugin</artifactId>
|
||||||
<version>2.11.0</version>
|
<version>2.11.1</version>
|
||||||
<executions>
|
<executions>
|
||||||
<execution>
|
<execution>
|
||||||
|
<id>spotless-check</id>
|
||||||
|
<!-- runs in verify phase by default -->
|
||||||
<goals>
|
<goals>
|
||||||
<goal>${formatter-maven-plugin.goal}</goal>
|
<!-- can be disabled using -Dspotless.check.skip=true -->
|
||||||
</goals>
|
<goal>check</goal>
|
||||||
<configuration>
|
|
||||||
<configFile>src/main/resources/eclipse/formatter.xml</configFile>
|
|
||||||
</configuration>
|
|
||||||
</execution>
|
|
||||||
</executions>
|
|
||||||
</plugin>
|
|
||||||
<plugin>
|
|
||||||
<groupId>net.revelc.code</groupId>
|
|
||||||
<artifactId>impsort-maven-plugin</artifactId>
|
|
||||||
<version>1.3.2</version>
|
|
||||||
<configuration>
|
|
||||||
<groups>*,java.,javax.</groups>
|
|
||||||
<removeUnused>true</removeUnused>
|
|
||||||
<staticAfter>true</staticAfter>
|
|
||||||
</configuration>
|
|
||||||
<executions>
|
|
||||||
<execution>
|
|
||||||
<goals>
|
|
||||||
<goal>${impsort-maven-plugin.goal}</goal>
|
|
||||||
</goals>
|
</goals>
|
||||||
</execution>
|
</execution>
|
||||||
</executions>
|
</executions>
|
||||||
|
<configuration>
|
||||||
|
<java>
|
||||||
|
<eclipse>
|
||||||
|
<file>${basedir}/src/build/eclipse/formatter.xml</file>
|
||||||
|
</eclipse>
|
||||||
|
|
||||||
|
<importOrder>
|
||||||
|
<file>${basedir}/src/build/eclipse/eclipse.importorder</file>
|
||||||
|
</importOrder>
|
||||||
|
<removeUnusedImports />
|
||||||
|
|
||||||
|
<trimTrailingWhitespace />
|
||||||
|
<endWithNewline />
|
||||||
|
|
||||||
|
</java>
|
||||||
|
</configuration>
|
||||||
</plugin>
|
</plugin>
|
||||||
<plugin>
|
<plugin>
|
||||||
<groupId>com.github.spotbugs</groupId>
|
<groupId>com.github.spotbugs</groupId>
|
||||||
@@ -386,6 +386,12 @@
|
|||||||
<artifactId>commons-lang3</artifactId>
|
<artifactId>commons-lang3</artifactId>
|
||||||
<version>3.9</version>
|
<version>3.9</version>
|
||||||
</dependency>
|
</dependency>
|
||||||
|
<dependency>
|
||||||
|
<groupId>com.tngtech.archunit</groupId>
|
||||||
|
<artifactId>archunit</artifactId>
|
||||||
|
<version>0.19.0</version>
|
||||||
|
<scope>test</scope>
|
||||||
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>org.hamcrest</groupId>
|
<groupId>org.hamcrest</groupId>
|
||||||
<artifactId>hamcrest</artifactId>
|
<artifactId>hamcrest</artifactId>
|
||||||
@@ -408,23 +414,29 @@
|
|||||||
<dependency>
|
<dependency>
|
||||||
<groupId>junit</groupId>
|
<groupId>junit</groupId>
|
||||||
<artifactId>junit</artifactId>
|
<artifactId>junit</artifactId>
|
||||||
<version>4.13</version>
|
<version>4.13.2</version>
|
||||||
|
<scope>test</scope>
|
||||||
|
</dependency>
|
||||||
|
<dependency>
|
||||||
|
<groupId>org.awaitility</groupId>
|
||||||
|
<artifactId>awaitility</artifactId>
|
||||||
|
<version>4.1.0</version>
|
||||||
<scope>test</scope>
|
<scope>test</scope>
|
||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>com.fasterxml.jackson.core</groupId>
|
<groupId>com.fasterxml.jackson.core</groupId>
|
||||||
<artifactId>jackson-databind</artifactId>
|
<artifactId>jackson-databind</artifactId>
|
||||||
<version>2.10.2</version>
|
<version>2.12.3</version>
|
||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>commons-io</groupId>
|
<groupId>commons-io</groupId>
|
||||||
<artifactId>commons-io</artifactId>
|
<artifactId>commons-io</artifactId>
|
||||||
<version>2.4</version>
|
<version>2.8.0</version>
|
||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>com.infradna.tool</groupId>
|
<groupId>com.infradna.tool</groupId>
|
||||||
<artifactId>bridge-method-annotation</artifactId>
|
<artifactId>bridge-method-annotation</artifactId>
|
||||||
<version>1.18</version>
|
<version>1.21</version>
|
||||||
<optional>true</optional>
|
<optional>true</optional>
|
||||||
</dependency>
|
</dependency>
|
||||||
<!-- for stapler-jetty -->
|
<!-- for stapler-jetty -->
|
||||||
@@ -445,7 +457,7 @@
|
|||||||
<dependency>
|
<dependency>
|
||||||
<groupId>org.kohsuke.stapler</groupId>
|
<groupId>org.kohsuke.stapler</groupId>
|
||||||
<artifactId>stapler</artifactId>
|
<artifactId>stapler</artifactId>
|
||||||
<version>1.259</version>
|
<version>1.263</version>
|
||||||
<scope>test</scope>
|
<scope>test</scope>
|
||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
@@ -457,9 +469,27 @@
|
|||||||
<dependency>
|
<dependency>
|
||||||
<groupId>org.eclipse.jgit</groupId>
|
<groupId>org.eclipse.jgit</groupId>
|
||||||
<artifactId>org.eclipse.jgit</artifactId>
|
<artifactId>org.eclipse.jgit</artifactId>
|
||||||
<version>5.7.0.202003110725-r</version>
|
<version>5.11.1.202105131744-r</version>
|
||||||
<scope>test</scope>
|
<scope>test</scope>
|
||||||
</dependency>
|
</dependency>
|
||||||
|
<dependency>
|
||||||
|
<groupId>io.jsonwebtoken</groupId>
|
||||||
|
<artifactId>jjwt-api</artifactId>
|
||||||
|
<version>${jjwt.suite.version}</version>
|
||||||
|
<optional>true</optional>
|
||||||
|
</dependency>
|
||||||
|
<dependency>
|
||||||
|
<groupId>io.jsonwebtoken</groupId>
|
||||||
|
<artifactId>jjwt-impl</artifactId>
|
||||||
|
<version>${jjwt.suite.version}</version>
|
||||||
|
<optional>true</optional>
|
||||||
|
</dependency>
|
||||||
|
<dependency>
|
||||||
|
<groupId>io.jsonwebtoken</groupId>
|
||||||
|
<artifactId>jjwt-jackson</artifactId>
|
||||||
|
<version>${jjwt.suite.version}</version>
|
||||||
|
<optional>true</optional>
|
||||||
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>com.squareup.okio</groupId>
|
<groupId>com.squareup.okio</groupId>
|
||||||
<artifactId>okio</artifactId>
|
<artifactId>okio</artifactId>
|
||||||
@@ -489,13 +519,13 @@
|
|||||||
<dependency>
|
<dependency>
|
||||||
<groupId>org.kohsuke</groupId>
|
<groupId>org.kohsuke</groupId>
|
||||||
<artifactId>wordnet-random-name</artifactId>
|
<artifactId>wordnet-random-name</artifactId>
|
||||||
<version>1.3</version>
|
<version>1.5</version>
|
||||||
<scope>test</scope>
|
<scope>test</scope>
|
||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>org.mockito</groupId>
|
<groupId>org.mockito</groupId>
|
||||||
<artifactId>mockito-core</artifactId>
|
<artifactId>mockito-core</artifactId>
|
||||||
<version>3.3.3</version>
|
<version>3.10.0</version>
|
||||||
<scope>test</scope>
|
<scope>test</scope>
|
||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
@@ -507,13 +537,19 @@
|
|||||||
<dependency>
|
<dependency>
|
||||||
<groupId>com.github.tomakehurst</groupId>
|
<groupId>com.github.tomakehurst</groupId>
|
||||||
<artifactId>wiremock-jre8-standalone</artifactId>
|
<artifactId>wiremock-jre8-standalone</artifactId>
|
||||||
<version>2.26.3</version>
|
<version>2.28.0</version>
|
||||||
<scope>test</scope>
|
<scope>test</scope>
|
||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>com.google.code.gson</groupId>
|
<groupId>com.google.code.gson</groupId>
|
||||||
<artifactId>gson</artifactId>
|
<artifactId>gson</artifactId>
|
||||||
<version>2.8.6</version>
|
<version>2.8.7</version>
|
||||||
|
<scope>test</scope>
|
||||||
|
</dependency>
|
||||||
|
<dependency>
|
||||||
|
<groupId>org.slf4j</groupId>
|
||||||
|
<artifactId>slf4j-simple</artifactId>
|
||||||
|
<version>1.7.30</version>
|
||||||
<scope>test</scope>
|
<scope>test</scope>
|
||||||
</dependency>
|
</dependency>
|
||||||
</dependencies>
|
</dependencies>
|
||||||
@@ -530,6 +566,38 @@
|
|||||||
</pluginRepository>
|
</pluginRepository>
|
||||||
</pluginRepositories>
|
</pluginRepositories>
|
||||||
<profiles>
|
<profiles>
|
||||||
|
<!-- only enable slow-or-flaky-test if -Dtest= is not present -->
|
||||||
|
<profile>
|
||||||
|
<id>slow-or-flaky-test</id>
|
||||||
|
<activation>
|
||||||
|
<property>
|
||||||
|
<name>!test</name>
|
||||||
|
</property>
|
||||||
|
</activation>
|
||||||
|
<build>
|
||||||
|
<plugins>
|
||||||
|
<plugin>
|
||||||
|
<artifactId>maven-surefire-plugin</artifactId>
|
||||||
|
<executions>
|
||||||
|
<execution>
|
||||||
|
<id>slow-or-flaky-test</id>
|
||||||
|
<phase>test</phase>
|
||||||
|
<goals>
|
||||||
|
<goal>test</goal>
|
||||||
|
</goals>
|
||||||
|
<configuration>
|
||||||
|
<rerunFailingTestsCount>2</rerunFailingTestsCount>
|
||||||
|
<!-- There are some tests that take longer or are a little
|
||||||
|
flaky. Run them here. -->
|
||||||
|
<includesFile>src/test/resources/slow-or-flaky-tests.txt</includesFile>
|
||||||
|
<argLine>@{jacoco.surefire.argLine} ${surefire.argLine}</argLine>
|
||||||
|
</configuration>
|
||||||
|
</execution>
|
||||||
|
</executions>
|
||||||
|
</plugin>
|
||||||
|
</plugins>
|
||||||
|
</build>
|
||||||
|
</profile>
|
||||||
<profile>
|
<profile>
|
||||||
<id>ci-non-windows</id>
|
<id>ci-non-windows</id>
|
||||||
<activation>
|
<activation>
|
||||||
@@ -541,8 +609,8 @@
|
|||||||
</os>
|
</os>
|
||||||
</activation>
|
</activation>
|
||||||
<properties>
|
<properties>
|
||||||
<formatter-maven-plugin.goal>validate</formatter-maven-plugin.goal>
|
<!-- Only fail code coverage on non-windows machines -->
|
||||||
<impsort-maven-plugin.goal>check</impsort-maven-plugin.goal>
|
<jacoco.haltOnFailure>true</jacoco.haltOnFailure>
|
||||||
</properties>
|
</properties>
|
||||||
</profile>
|
</profile>
|
||||||
<profile>
|
<profile>
|
||||||
@@ -552,24 +620,55 @@
|
|||||||
<name>enable-ci</name>
|
<name>enable-ci</name>
|
||||||
</property>
|
</property>
|
||||||
</activation>
|
</activation>
|
||||||
<properties>
|
|
||||||
<jacoco.haltOnFailure>true</jacoco.haltOnFailure>
|
|
||||||
</properties>
|
|
||||||
<build>
|
<build>
|
||||||
<plugins>
|
<plugins>
|
||||||
<plugin>
|
<plugin>
|
||||||
<groupId>org.jacoco</groupId>
|
<groupId>org.jacoco</groupId>
|
||||||
<artifactId>jacoco-maven-plugin</artifactId>
|
<artifactId>jacoco-maven-plugin</artifactId>
|
||||||
</plugin>
|
</plugin>
|
||||||
|
<plugin>
|
||||||
|
<groupId>com.diffplug.spotless</groupId>
|
||||||
|
<artifactId>spotless-maven-plugin</artifactId>
|
||||||
|
<executions>
|
||||||
|
<execution>
|
||||||
|
<id>spotless-check</id>
|
||||||
|
<!-- In CI, run check early in the build -->
|
||||||
|
<phase>process-sources</phase>
|
||||||
|
<goals>
|
||||||
|
<goal>check</goal>
|
||||||
|
</goals>
|
||||||
|
</execution>
|
||||||
|
</executions>
|
||||||
|
</plugin>
|
||||||
|
<plugin>
|
||||||
|
<groupId>org.apache.maven.plugins</groupId>
|
||||||
|
<artifactId>maven-enforcer-plugin</artifactId>
|
||||||
|
<version>3.0.0-M3</version>
|
||||||
|
<executions>
|
||||||
|
<execution>
|
||||||
|
<id>enforce-jacoco-exist</id>
|
||||||
|
<phase>verify</phase>
|
||||||
|
<goals>
|
||||||
|
<goal>enforce</goal>
|
||||||
|
</goals>
|
||||||
|
<configuration>
|
||||||
|
<rules>
|
||||||
|
<requireFilesExist>
|
||||||
|
<files>
|
||||||
|
<file>${project.build.directory}/jacoco.exec</file>
|
||||||
|
</files>
|
||||||
|
</requireFilesExist>
|
||||||
|
</rules>
|
||||||
|
<fail>true</fail>
|
||||||
|
</configuration>
|
||||||
|
</execution>
|
||||||
|
</executions>
|
||||||
|
</plugin>
|
||||||
</plugins>
|
</plugins>
|
||||||
</build>
|
</build>
|
||||||
</profile>
|
</profile>
|
||||||
<profile>
|
<profile>
|
||||||
<id>release</id>
|
<id>release</id>
|
||||||
<properties>
|
|
||||||
<formatter-maven-plugin.goal>validate</formatter-maven-plugin.goal>
|
|
||||||
<impsort-maven-plugin.goal>check</impsort-maven-plugin.goal>
|
|
||||||
</properties>
|
|
||||||
<build>
|
<build>
|
||||||
<plugins>
|
<plugins>
|
||||||
<plugin>
|
<plugin>
|
||||||
|
|||||||
6
src/build/eclipse/eclipse.importorder
Normal file
6
src/build/eclipse/eclipse.importorder
Normal file
@@ -0,0 +1,6 @@
|
|||||||
|
#Organize Import Order
|
||||||
|
# Import this file in Window -> Preferences -> Java -> Code Style -> Organize Imports -> Import...
|
||||||
|
0=
|
||||||
|
1=java
|
||||||
|
2=javax
|
||||||
|
3=\#
|
||||||
@@ -38,7 +38,7 @@ import javax.annotation.Nonnull;
|
|||||||
* Intermediate return type for this builder returned by calls to {@link #with(String, Object)}. If {@link S}
|
* Intermediate return type for this builder returned by calls to {@link #with(String, Object)}. If {@link S}
|
||||||
* the same as {@link R}, this builder will commit changes after each call to {@link #with(String, Object)}.
|
* the same as {@link R}, this builder will commit changes after each call to {@link #with(String, Object)}.
|
||||||
*/
|
*/
|
||||||
abstract class AbstractBuilder<R, S> {
|
abstract class AbstractBuilder<R, S> extends GitHubInteractiveObject {
|
||||||
|
|
||||||
@Nonnull
|
@Nonnull
|
||||||
private final Class<R> returnType;
|
private final Class<R> returnType;
|
||||||
@@ -75,6 +75,7 @@ abstract class AbstractBuilder<R, S> {
|
|||||||
@Nonnull Class<S> intermediateReturnType,
|
@Nonnull Class<S> intermediateReturnType,
|
||||||
@Nonnull GitHub root,
|
@Nonnull GitHub root,
|
||||||
@CheckForNull R baseInstance) {
|
@CheckForNull R baseInstance) {
|
||||||
|
super(root);
|
||||||
this.requester = root.createRequest();
|
this.requester = root.createRequest();
|
||||||
this.returnType = finalReturnType;
|
this.returnType = finalReturnType;
|
||||||
this.commitChangesImmediately = returnType.equals(intermediateReturnType);
|
this.commitChangesImmediately = returnType.equals(intermediateReturnType);
|
||||||
@@ -97,7 +98,7 @@ abstract class AbstractBuilder<R, S> {
|
|||||||
* if there is an I/O Exception
|
* if there is an I/O Exception
|
||||||
*/
|
*/
|
||||||
@Nonnull
|
@Nonnull
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public R done() throws IOException {
|
public R done() throws IOException {
|
||||||
R result;
|
R result;
|
||||||
@@ -127,7 +128,7 @@ abstract class AbstractBuilder<R, S> {
|
|||||||
* if an I/O error occurs
|
* if an I/O error occurs
|
||||||
*/
|
*/
|
||||||
@Nonnull
|
@Nonnull
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
protected S with(@Nonnull String name, Object value) throws IOException {
|
protected S with(@Nonnull String name, Object value) throws IOException {
|
||||||
requester.with(name, value);
|
requester.with(name, value);
|
||||||
@@ -148,7 +149,7 @@ abstract class AbstractBuilder<R, S> {
|
|||||||
* if an I/O error occurs
|
* if an I/O error occurs
|
||||||
*/
|
*/
|
||||||
@Nonnull
|
@Nonnull
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
protected S continueOrDone() throws IOException {
|
protected S continueOrDone() throws IOException {
|
||||||
// This little bit of roughness in this base class means all inheriting builders get to create Updater and
|
// This little bit of roughness in this base class means all inheriting builders get to create Updater and
|
||||||
|
|||||||
18
src/main/java/org/kohsuke/github/BetaApi.java
Normal file
18
src/main/java/org/kohsuke/github/BetaApi.java
Normal file
@@ -0,0 +1,18 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import java.lang.annotation.Documented;
|
||||||
|
import java.lang.annotation.Retention;
|
||||||
|
import java.lang.annotation.RetentionPolicy;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Indicates that the method/class/etc marked is a beta implementation of an sdk feature.
|
||||||
|
* <p>
|
||||||
|
* These APIs are subject to change and not a part of the backward compatibility commitment. Always used in conjunction
|
||||||
|
* with 'deprecated' to raise awareness to clients.
|
||||||
|
* </p>
|
||||||
|
*
|
||||||
|
*/
|
||||||
|
@Retention(RetentionPolicy.RUNTIME)
|
||||||
|
@Documented
|
||||||
|
public @interface BetaApi {
|
||||||
|
}
|
||||||
@@ -1,11 +1,14 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import org.kohsuke.github.internal.EnumUtils;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
import java.util.Map;
|
import java.util.Map;
|
||||||
|
import java.util.stream.Collectors;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.MACHINE_MAN;
|
import static org.kohsuke.github.internal.Previews.MACHINE_MAN;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* A Github App.
|
* A Github App.
|
||||||
@@ -15,13 +18,12 @@ import static org.kohsuke.github.Previews.MACHINE_MAN;
|
|||||||
*/
|
*/
|
||||||
public class GHApp extends GHObject {
|
public class GHApp extends GHObject {
|
||||||
|
|
||||||
private GitHub root;
|
|
||||||
private GHUser owner;
|
private GHUser owner;
|
||||||
private String name;
|
private String name;
|
||||||
private String description;
|
private String description;
|
||||||
private String externalUrl;
|
private String externalUrl;
|
||||||
private Map<String, String> permissions;
|
private Map<String, String> permissions;
|
||||||
private List<GHEvent> events;
|
private List<String> events;
|
||||||
private long installationsCount;
|
private long installationsCount;
|
||||||
private String htmlUrl;
|
private String htmlUrl;
|
||||||
|
|
||||||
@@ -39,7 +41,9 @@ public class GHApp extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param owner
|
* @param owner
|
||||||
* the owner
|
* the owner
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setOwner(GHUser owner) {
|
public void setOwner(GHUser owner) {
|
||||||
this.owner = owner;
|
this.owner = owner;
|
||||||
}
|
}
|
||||||
@@ -58,7 +62,9 @@ public class GHApp extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param name
|
* @param name
|
||||||
* the name
|
* the name
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setName(String name) {
|
public void setName(String name) {
|
||||||
this.name = name;
|
this.name = name;
|
||||||
}
|
}
|
||||||
@@ -77,7 +83,9 @@ public class GHApp extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param description
|
* @param description
|
||||||
* the description
|
* the description
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setDescription(String description) {
|
public void setDescription(String description) {
|
||||||
this.description = description;
|
this.description = description;
|
||||||
}
|
}
|
||||||
@@ -96,7 +104,9 @@ public class GHApp extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param externalUrl
|
* @param externalUrl
|
||||||
* the external url
|
* the external url
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setExternalUrl(String externalUrl) {
|
public void setExternalUrl(String externalUrl) {
|
||||||
this.externalUrl = externalUrl;
|
this.externalUrl = externalUrl;
|
||||||
}
|
}
|
||||||
@@ -107,7 +117,9 @@ public class GHApp extends GHObject {
|
|||||||
* @return the events
|
* @return the events
|
||||||
*/
|
*/
|
||||||
public List<GHEvent> getEvents() {
|
public List<GHEvent> getEvents() {
|
||||||
return events;
|
return events.stream()
|
||||||
|
.map(e -> EnumUtils.getEnumOrDefault(GHEvent.class, e, GHEvent.UNKNOWN))
|
||||||
|
.collect(Collectors.toList());
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -115,9 +127,11 @@ public class GHApp extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param events
|
* @param events
|
||||||
* the events
|
* the events
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setEvents(List<GHEvent> events) {
|
public void setEvents(List<GHEvent> events) {
|
||||||
this.events = events;
|
this.events = events.stream().map(GHEvent::symbol).collect(Collectors.toList());
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -134,7 +148,9 @@ public class GHApp extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param installationsCount
|
* @param installationsCount
|
||||||
* the installations count
|
* the installations count
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setInstallationsCount(long installationsCount) {
|
public void setInstallationsCount(long installationsCount) {
|
||||||
this.installationsCount = installationsCount;
|
this.installationsCount = installationsCount;
|
||||||
}
|
}
|
||||||
@@ -157,7 +173,9 @@ public class GHApp extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param permissions
|
* @param permissions
|
||||||
* the permissions
|
* the permissions
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setPermissions(Map<String, String> permissions) {
|
public void setPermissions(Map<String, String> permissions) {
|
||||||
this.permissions = permissions;
|
this.permissions = permissions;
|
||||||
}
|
}
|
||||||
@@ -175,7 +193,7 @@ public class GHApp extends GHObject {
|
|||||||
* @return a list of App installations
|
* @return a list of App installations
|
||||||
* @see <a href="https://developer.github.com/v3/apps/#list-installations">List installations</a>
|
* @see <a href="https://developer.github.com/v3/apps/#list-installations">List installations</a>
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(MACHINE_MAN)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public PagedIterable<GHAppInstallation> listInstallations() {
|
public PagedIterable<GHAppInstallation> listInstallations() {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
@@ -196,7 +214,7 @@ public class GHApp extends GHObject {
|
|||||||
* on error
|
* on error
|
||||||
* @see <a href="https://developer.github.com/v3/apps/#get-an-installation">Get an installation</a>
|
* @see <a href="https://developer.github.com/v3/apps/#get-an-installation">Get an installation</a>
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(MACHINE_MAN)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppInstallation getInstallationById(long id) throws IOException {
|
public GHAppInstallation getInstallationById(long id) throws IOException {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
@@ -219,7 +237,7 @@ public class GHApp extends GHObject {
|
|||||||
* @see <a href="https://developer.github.com/v3/apps/#get-an-organization-installation">Get an organization
|
* @see <a href="https://developer.github.com/v3/apps/#get-an-organization-installation">Get an organization
|
||||||
* installation</a>
|
* installation</a>
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(MACHINE_MAN)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppInstallation getInstallationByOrganization(String name) throws IOException {
|
public GHAppInstallation getInstallationByOrganization(String name) throws IOException {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
@@ -244,7 +262,7 @@ public class GHApp extends GHObject {
|
|||||||
* @see <a href="https://developer.github.com/v3/apps/#get-a-repository-installation">Get a repository
|
* @see <a href="https://developer.github.com/v3/apps/#get-a-repository-installation">Get a repository
|
||||||
* installation</a>
|
* installation</a>
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(MACHINE_MAN)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppInstallation getInstallationByRepository(String ownerName, String repositoryName) throws IOException {
|
public GHAppInstallation getInstallationByRepository(String ownerName, String repositoryName) throws IOException {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
@@ -266,7 +284,7 @@ public class GHApp extends GHObject {
|
|||||||
* on error
|
* on error
|
||||||
* @see <a href="https://developer.github.com/v3/apps/#get-a-user-installation">Get a user installation</a>
|
* @see <a href="https://developer.github.com/v3/apps/#get-a-user-installation">Get a user installation</a>
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(MACHINE_MAN)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppInstallation getInstallationByUser(String name) throws IOException {
|
public GHAppInstallation getInstallationByUser(String name) throws IOException {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
|
|||||||
@@ -5,7 +5,7 @@ import java.util.HashMap;
|
|||||||
import java.util.List;
|
import java.util.List;
|
||||||
import java.util.Map;
|
import java.util.Map;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.MACHINE_MAN;
|
import static org.kohsuke.github.internal.Previews.MACHINE_MAN;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a access token for a GitHub App Installation
|
* Creates a access token for a GitHub App Installation
|
||||||
@@ -14,12 +14,11 @@ import static org.kohsuke.github.Previews.MACHINE_MAN;
|
|||||||
* @see GHAppInstallation#createToken(Map) GHAppInstallation#createToken(Map)
|
* @see GHAppInstallation#createToken(Map) GHAppInstallation#createToken(Map)
|
||||||
* @see GHAppInstallation#createToken() GHAppInstallation#createToken()
|
* @see GHAppInstallation#createToken() GHAppInstallation#createToken()
|
||||||
*/
|
*/
|
||||||
public class GHAppCreateTokenBuilder {
|
public class GHAppCreateTokenBuilder extends GitHubInteractiveObject {
|
||||||
private final GitHub root;
|
|
||||||
protected final Requester builder;
|
protected final Requester builder;
|
||||||
private final String apiUrlTail;
|
private final String apiUrlTail;
|
||||||
|
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
GHAppCreateTokenBuilder(GitHub root, String apiUrlTail) {
|
GHAppCreateTokenBuilder(GitHub root, String apiUrlTail) {
|
||||||
this.root = root;
|
this.root = root;
|
||||||
@@ -27,7 +26,7 @@ public class GHAppCreateTokenBuilder {
|
|||||||
this.builder = root.createRequest();
|
this.builder = root.createRequest();
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
GHAppCreateTokenBuilder(GitHub root, String apiUrlTail, Map<String, GHPermissionType> permissions) {
|
GHAppCreateTokenBuilder(GitHub root, String apiUrlTail, Map<String, GHPermissionType> permissions) {
|
||||||
this(root, apiUrlTail);
|
this(root, apiUrlTail);
|
||||||
@@ -43,7 +42,7 @@ public class GHAppCreateTokenBuilder {
|
|||||||
* Array containing the repositories Ids
|
* Array containing the repositories Ids
|
||||||
* @return a GHAppCreateTokenBuilder
|
* @return a GHAppCreateTokenBuilder
|
||||||
*/
|
*/
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppCreateTokenBuilder repositoryIds(List<Long> repositoryIds) {
|
public GHAppCreateTokenBuilder repositoryIds(List<Long> repositoryIds) {
|
||||||
this.builder.with("repository_ids", repositoryIds);
|
this.builder.with("repository_ids", repositoryIds);
|
||||||
@@ -58,7 +57,7 @@ public class GHAppCreateTokenBuilder {
|
|||||||
* Map containing the permission names and types.
|
* Map containing the permission names and types.
|
||||||
* @return a GHAppCreateTokenBuilder
|
* @return a GHAppCreateTokenBuilder
|
||||||
*/
|
*/
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppCreateTokenBuilder permissions(Map<String, GHPermissionType> permissions) {
|
public GHAppCreateTokenBuilder permissions(Map<String, GHPermissionType> permissions) {
|
||||||
Map<String, String> retMap = new HashMap<>();
|
Map<String, String> retMap = new HashMap<>();
|
||||||
@@ -78,7 +77,7 @@ public class GHAppCreateTokenBuilder {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* on error
|
* on error
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(MACHINE_MAN)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppInstallationToken create() throws IOException {
|
public GHAppInstallationToken create() throws IOException {
|
||||||
return builder.method("POST")
|
return builder.method("POST")
|
||||||
|
|||||||
@@ -1,13 +1,17 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
import com.fasterxml.jackson.annotation.JsonProperty;
|
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||||
|
import org.kohsuke.github.internal.EnumUtils;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
|
import java.net.MalformedURLException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
import java.util.Map;
|
import java.util.Map;
|
||||||
|
import java.util.stream.Collectors;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.GAMBIT;
|
import static org.kohsuke.github.internal.Previews.GAMBIT;
|
||||||
|
import static org.kohsuke.github.internal.Previews.MACHINE_MAN;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* A Github App Installation.
|
* A Github App Installation.
|
||||||
@@ -20,7 +24,6 @@ import static org.kohsuke.github.Previews.GAMBIT;
|
|||||||
* @see GHApp#getInstallationByUser(String) GHApp#getInstallationByUser(String)
|
* @see GHApp#getInstallationByUser(String) GHApp#getInstallationByUser(String)
|
||||||
*/
|
*/
|
||||||
public class GHAppInstallation extends GHObject {
|
public class GHAppInstallation extends GHObject {
|
||||||
private GitHub root;
|
|
||||||
private GHUser account;
|
private GHUser account;
|
||||||
|
|
||||||
@JsonProperty("access_tokens_url")
|
@JsonProperty("access_tokens_url")
|
||||||
@@ -34,7 +37,7 @@ public class GHAppInstallation extends GHObject {
|
|||||||
@JsonProperty("target_type")
|
@JsonProperty("target_type")
|
||||||
private GHTargetType targetType;
|
private GHTargetType targetType;
|
||||||
private Map<String, GHPermissionType> permissions;
|
private Map<String, GHPermissionType> permissions;
|
||||||
private List<GHEvent> events;
|
private List<String> events;
|
||||||
@JsonProperty("single_file_name")
|
@JsonProperty("single_file_name")
|
||||||
private String singleFileName;
|
private String singleFileName;
|
||||||
@JsonProperty("repository_selection")
|
@JsonProperty("repository_selection")
|
||||||
@@ -59,7 +62,9 @@ public class GHAppInstallation extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param root
|
* @param root
|
||||||
* the root
|
* the root
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setRoot(GitHub root) {
|
public void setRoot(GitHub root) {
|
||||||
this.root = root;
|
this.root = root;
|
||||||
}
|
}
|
||||||
@@ -78,7 +83,9 @@ public class GHAppInstallation extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param account
|
* @param account
|
||||||
* the account
|
* the account
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setAccount(GHUser account) {
|
public void setAccount(GHUser account) {
|
||||||
this.account = account;
|
this.account = account;
|
||||||
}
|
}
|
||||||
@@ -97,7 +104,9 @@ public class GHAppInstallation extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param accessTokenUrl
|
* @param accessTokenUrl
|
||||||
* the access token url
|
* the access token url
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setAccessTokenUrl(String accessTokenUrl) {
|
public void setAccessTokenUrl(String accessTokenUrl) {
|
||||||
this.accessTokenUrl = accessTokenUrl;
|
this.accessTokenUrl = accessTokenUrl;
|
||||||
}
|
}
|
||||||
@@ -111,12 +120,44 @@ public class GHAppInstallation extends GHObject {
|
|||||||
return repositoriesUrl;
|
return repositoriesUrl;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* List repositories that this app installation can access.
|
||||||
|
*
|
||||||
|
* @return the paged iterable
|
||||||
|
*/
|
||||||
|
@Preview(MACHINE_MAN)
|
||||||
|
@Deprecated
|
||||||
|
public PagedSearchIterable<GHRepository> listRepositories() {
|
||||||
|
GitHubRequest request;
|
||||||
|
|
||||||
|
try {
|
||||||
|
request = root.createRequest().withPreview(MACHINE_MAN).withUrlPath("/installation/repositories").build();
|
||||||
|
} catch (MalformedURLException e) {
|
||||||
|
throw new GHException("", e);
|
||||||
|
}
|
||||||
|
|
||||||
|
return new PagedSearchIterable<>(root, request, GHAppInstallationRepositoryResult.class);
|
||||||
|
}
|
||||||
|
|
||||||
|
private static class GHAppInstallationRepositoryResult extends SearchResult<GHRepository> {
|
||||||
|
private GHRepository[] repositories;
|
||||||
|
|
||||||
|
@Override
|
||||||
|
GHRepository[] getItems(GitHub root) {
|
||||||
|
for (GHRepository item : repositories)
|
||||||
|
item.wrap(root);
|
||||||
|
return repositories;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Sets repositories url.
|
* Sets repositories url.
|
||||||
*
|
*
|
||||||
* @param repositoriesUrl
|
* @param repositoriesUrl
|
||||||
* the repositories url
|
* the repositories url
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setRepositoriesUrl(String repositoriesUrl) {
|
public void setRepositoriesUrl(String repositoriesUrl) {
|
||||||
this.repositoriesUrl = repositoriesUrl;
|
this.repositoriesUrl = repositoriesUrl;
|
||||||
}
|
}
|
||||||
@@ -135,7 +176,9 @@ public class GHAppInstallation extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param appId
|
* @param appId
|
||||||
* the app id
|
* the app id
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setAppId(long appId) {
|
public void setAppId(long appId) {
|
||||||
this.appId = appId;
|
this.appId = appId;
|
||||||
}
|
}
|
||||||
@@ -154,7 +197,9 @@ public class GHAppInstallation extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param targetId
|
* @param targetId
|
||||||
* the target id
|
* the target id
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setTargetId(long targetId) {
|
public void setTargetId(long targetId) {
|
||||||
this.targetId = targetId;
|
this.targetId = targetId;
|
||||||
}
|
}
|
||||||
@@ -173,7 +218,9 @@ public class GHAppInstallation extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param targetType
|
* @param targetType
|
||||||
* the target type
|
* the target type
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setTargetType(GHTargetType targetType) {
|
public void setTargetType(GHTargetType targetType) {
|
||||||
this.targetType = targetType;
|
this.targetType = targetType;
|
||||||
}
|
}
|
||||||
@@ -192,7 +239,9 @@ public class GHAppInstallation extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param permissions
|
* @param permissions
|
||||||
* the permissions
|
* the permissions
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setPermissions(Map<String, GHPermissionType> permissions) {
|
public void setPermissions(Map<String, GHPermissionType> permissions) {
|
||||||
this.permissions = permissions;
|
this.permissions = permissions;
|
||||||
}
|
}
|
||||||
@@ -203,7 +252,9 @@ public class GHAppInstallation extends GHObject {
|
|||||||
* @return the events
|
* @return the events
|
||||||
*/
|
*/
|
||||||
public List<GHEvent> getEvents() {
|
public List<GHEvent> getEvents() {
|
||||||
return events;
|
return events.stream()
|
||||||
|
.map(e -> EnumUtils.getEnumOrDefault(GHEvent.class, e, GHEvent.UNKNOWN))
|
||||||
|
.collect(Collectors.toList());
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -211,9 +262,11 @@ public class GHAppInstallation extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param events
|
* @param events
|
||||||
* the events
|
* the events
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setEvents(List<GHEvent> events) {
|
public void setEvents(List<GHEvent> events) {
|
||||||
this.events = events;
|
this.events = events.stream().map(GHEvent::symbol).collect(Collectors.toList());
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -230,7 +283,9 @@ public class GHAppInstallation extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param singleFileName
|
* @param singleFileName
|
||||||
* the single file name
|
* the single file name
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setSingleFileName(String singleFileName) {
|
public void setSingleFileName(String singleFileName) {
|
||||||
this.singleFileName = singleFileName;
|
this.singleFileName = singleFileName;
|
||||||
}
|
}
|
||||||
@@ -249,7 +304,9 @@ public class GHAppInstallation extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param repositorySelection
|
* @param repositorySelection
|
||||||
* the repository selection
|
* the repository selection
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setRepositorySelection(GHRepositorySelection repositorySelection) {
|
public void setRepositorySelection(GHRepositorySelection repositorySelection) {
|
||||||
this.repositorySelection = repositorySelection;
|
this.repositorySelection = repositorySelection;
|
||||||
}
|
}
|
||||||
@@ -268,13 +325,13 @@ public class GHAppInstallation extends GHObject {
|
|||||||
* on error
|
* on error
|
||||||
* @see <a href="https://developer.github.com/v3/apps/#delete-an-installation">Delete an installation</a>
|
* @see <a href="https://developer.github.com/v3/apps/#delete-an-installation">Delete an installation</a>
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(GAMBIT)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public void deleteInstallation() throws IOException {
|
public void deleteInstallation() throws IOException {
|
||||||
root.createRequest()
|
root.createRequest()
|
||||||
.method("DELETE")
|
.method("DELETE")
|
||||||
.withPreview(GAMBIT)
|
.withPreview(GAMBIT)
|
||||||
.withUrlPath(String.format("/app/installations/%d", id))
|
.withUrlPath(String.format("/app/installations/%d", getId()))
|
||||||
.send();
|
.send();
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -290,10 +347,12 @@ public class GHAppInstallation extends GHObject {
|
|||||||
* @return a GHAppCreateTokenBuilder instance
|
* @return a GHAppCreateTokenBuilder instance
|
||||||
* @deprecated Use {@link GHAppInstallation#createToken()} instead.
|
* @deprecated Use {@link GHAppInstallation#createToken()} instead.
|
||||||
*/
|
*/
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppCreateTokenBuilder createToken(Map<String, GHPermissionType> permissions) {
|
public GHAppCreateTokenBuilder createToken(Map<String, GHPermissionType> permissions) {
|
||||||
return new GHAppCreateTokenBuilder(root, String.format("/app/installations/%d/access_tokens", id), permissions);
|
return new GHAppCreateTokenBuilder(root,
|
||||||
|
String.format("/app/installations/%d/access_tokens", getId()),
|
||||||
|
permissions);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -305,9 +364,9 @@ public class GHAppInstallation extends GHObject {
|
|||||||
*
|
*
|
||||||
* @return a GHAppCreateTokenBuilder instance
|
* @return a GHAppCreateTokenBuilder instance
|
||||||
*/
|
*/
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppCreateTokenBuilder createToken() {
|
public GHAppCreateTokenBuilder createToken() {
|
||||||
return new GHAppCreateTokenBuilder(root, String.format("/app/installations/%d/access_tokens", id));
|
return new GHAppCreateTokenBuilder(root, String.format("/app/installations/%d/access_tokens", getId()));
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -14,9 +14,7 @@ import java.util.Map;
|
|||||||
* @author Paulo Miguel Almeida
|
* @author Paulo Miguel Almeida
|
||||||
* @see GHAppInstallation#createToken(Map) GHAppInstallation#createToken(Map)
|
* @see GHAppInstallation#createToken(Map) GHAppInstallation#createToken(Map)
|
||||||
*/
|
*/
|
||||||
public class GHAppInstallationToken {
|
public class GHAppInstallationToken extends GitHubInteractiveObject {
|
||||||
private GitHub root;
|
|
||||||
|
|
||||||
private String token;
|
private String token;
|
||||||
protected String expires_at;
|
protected String expires_at;
|
||||||
private Map<String, String> permissions;
|
private Map<String, String> permissions;
|
||||||
@@ -37,7 +35,9 @@ public class GHAppInstallationToken {
|
|||||||
*
|
*
|
||||||
* @param root
|
* @param root
|
||||||
* the root
|
* the root
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setRoot(GitHub root) {
|
public void setRoot(GitHub root) {
|
||||||
this.root = root;
|
this.root = root;
|
||||||
}
|
}
|
||||||
@@ -56,7 +56,9 @@ public class GHAppInstallationToken {
|
|||||||
*
|
*
|
||||||
* @param permissions
|
* @param permissions
|
||||||
* the permissions
|
* the permissions
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setPermissions(Map<String, String> permissions) {
|
public void setPermissions(Map<String, String> permissions) {
|
||||||
this.permissions = permissions;
|
this.permissions = permissions;
|
||||||
}
|
}
|
||||||
@@ -75,7 +77,9 @@ public class GHAppInstallationToken {
|
|||||||
*
|
*
|
||||||
* @param token
|
* @param token
|
||||||
* the token
|
* the token
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setToken(String token) {
|
public void setToken(String token) {
|
||||||
this.token = token;
|
this.token = token;
|
||||||
}
|
}
|
||||||
@@ -94,7 +98,9 @@ public class GHAppInstallationToken {
|
|||||||
*
|
*
|
||||||
* @param repositories
|
* @param repositories
|
||||||
* the repositories
|
* the repositories
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setRepositories(List<GHRepository> repositories) {
|
public void setRepositories(List<GHRepository> repositories) {
|
||||||
this.repositories = repositories;
|
this.repositories = repositories;
|
||||||
}
|
}
|
||||||
@@ -113,7 +119,9 @@ public class GHAppInstallationToken {
|
|||||||
*
|
*
|
||||||
* @param repositorySelection
|
* @param repositorySelection
|
||||||
* the repository selection
|
* the repository selection
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setRepositorySelection(GHRepositorySelection repositorySelection) {
|
public void setRepositorySelection(GHRepositorySelection repositorySelection) {
|
||||||
this.repositorySelection = repositorySelection;
|
this.repositorySelection = repositorySelection;
|
||||||
}
|
}
|
||||||
|
|||||||
140
src/main/java/org/kohsuke/github/GHArtifact.java
Normal file
140
src/main/java/org/kohsuke/github/GHArtifact.java
Normal file
@@ -0,0 +1,140 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import com.fasterxml.jackson.annotation.JsonIgnore;
|
||||||
|
import org.apache.commons.lang3.StringUtils;
|
||||||
|
import org.kohsuke.github.function.InputStreamFunction;
|
||||||
|
|
||||||
|
import java.io.IOException;
|
||||||
|
import java.net.URL;
|
||||||
|
import java.util.Date;
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
|
import static java.util.Objects.requireNonNull;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* An artifact from a workflow run.
|
||||||
|
*
|
||||||
|
* @author Guillaume Smet
|
||||||
|
*/
|
||||||
|
public class GHArtifact extends GHObject {
|
||||||
|
|
||||||
|
// Not provided by the API.
|
||||||
|
@JsonIgnore
|
||||||
|
private GHRepository owner;
|
||||||
|
|
||||||
|
private String name;
|
||||||
|
private long sizeInBytes;
|
||||||
|
private String archiveDownloadUrl;
|
||||||
|
private boolean expired;
|
||||||
|
private String expiresAt;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the name.
|
||||||
|
*
|
||||||
|
* @return the name
|
||||||
|
*/
|
||||||
|
public String getName() {
|
||||||
|
return name;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the size of the artifact in bytes.
|
||||||
|
*
|
||||||
|
* @return the size
|
||||||
|
*/
|
||||||
|
public long getSizeInBytes() {
|
||||||
|
return sizeInBytes;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the archive download URL.
|
||||||
|
*
|
||||||
|
* @return the archive download URL
|
||||||
|
*/
|
||||||
|
public URL getArchiveDownloadUrl() {
|
||||||
|
return GitHubClient.parseURL(archiveDownloadUrl);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* If this artifact has expired.
|
||||||
|
*
|
||||||
|
* @return if the artifact has expired
|
||||||
|
*/
|
||||||
|
public boolean isExpired() {
|
||||||
|
return expired;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the date at which this artifact will expire.
|
||||||
|
*
|
||||||
|
* @return the date of expiration
|
||||||
|
*/
|
||||||
|
public Date getExpiresAt() {
|
||||||
|
return GitHubClient.parseDate(expiresAt);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Repository to which the artifact belongs.
|
||||||
|
*
|
||||||
|
* @return the repository
|
||||||
|
*/
|
||||||
|
public GHRepository getRepository() {
|
||||||
|
return owner;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* @deprecated This object has no HTML URL.
|
||||||
|
*/
|
||||||
|
@Override
|
||||||
|
public URL getHtmlUrl() throws IOException {
|
||||||
|
return null;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Deletes the artifact.
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public void delete() throws IOException {
|
||||||
|
root.createRequest().method("DELETE").withUrlPath(getApiRoute()).fetchHttpStatusCode();
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Downloads the artifact.
|
||||||
|
*
|
||||||
|
* @param <T>
|
||||||
|
* the type of result
|
||||||
|
* @param streamFunction
|
||||||
|
* The {@link InputStreamFunction} that will process the stream
|
||||||
|
* @throws IOException
|
||||||
|
* The IO exception.
|
||||||
|
* @return the result of reading the stream.
|
||||||
|
*/
|
||||||
|
public <T> T download(InputStreamFunction<T> streamFunction) throws IOException {
|
||||||
|
requireNonNull(streamFunction, "Stream function must not be null");
|
||||||
|
|
||||||
|
return root.createRequest().method("GET").withUrlPath(getApiRoute(), "zip").fetchStream(streamFunction);
|
||||||
|
}
|
||||||
|
|
||||||
|
private String getApiRoute() {
|
||||||
|
if (owner == null) {
|
||||||
|
// Workflow runs returned from search to do not have an owner. Attempt to use url.
|
||||||
|
final URL url = Objects.requireNonNull(getUrl(), "Missing instance URL!");
|
||||||
|
return StringUtils.prependIfMissing(url.toString().replace(root.getApiUrl(), ""), "/");
|
||||||
|
}
|
||||||
|
return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/actions/artifacts/" + getId();
|
||||||
|
}
|
||||||
|
|
||||||
|
GHArtifact wrapUp(GHRepository owner) {
|
||||||
|
this.owner = owner;
|
||||||
|
return wrapUp(owner.root);
|
||||||
|
}
|
||||||
|
|
||||||
|
GHArtifact wrapUp(GitHub root) {
|
||||||
|
this.root = root;
|
||||||
|
if (owner != null)
|
||||||
|
owner.wrap(root);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
}
|
||||||
49
src/main/java/org/kohsuke/github/GHArtifactsIterable.java
Normal file
49
src/main/java/org/kohsuke/github/GHArtifactsIterable.java
Normal file
@@ -0,0 +1,49 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import java.net.MalformedURLException;
|
||||||
|
import java.util.Iterator;
|
||||||
|
|
||||||
|
import javax.annotation.Nonnull;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Iterable for artifacts listing.
|
||||||
|
*/
|
||||||
|
class GHArtifactsIterable extends PagedIterable<GHArtifact> {
|
||||||
|
private final transient GHRepository owner;
|
||||||
|
private final GitHubRequest request;
|
||||||
|
|
||||||
|
private GHArtifactsPage result;
|
||||||
|
|
||||||
|
public GHArtifactsIterable(GHRepository owner, GitHubRequest.Builder<?> requestBuilder) {
|
||||||
|
this.owner = owner;
|
||||||
|
try {
|
||||||
|
this.request = requestBuilder.build();
|
||||||
|
} catch (MalformedURLException e) {
|
||||||
|
throw new GHException("Malformed URL", e);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
@Nonnull
|
||||||
|
@Override
|
||||||
|
public PagedIterator<GHArtifact> _iterator(int pageSize) {
|
||||||
|
return new PagedIterator<>(
|
||||||
|
adapt(GitHubPageIterator.create(owner.getRoot().getClient(), GHArtifactsPage.class, request, pageSize)),
|
||||||
|
null);
|
||||||
|
}
|
||||||
|
|
||||||
|
protected Iterator<GHArtifact[]> adapt(final Iterator<GHArtifactsPage> base) {
|
||||||
|
return new Iterator<GHArtifact[]>() {
|
||||||
|
public boolean hasNext() {
|
||||||
|
return base.hasNext();
|
||||||
|
}
|
||||||
|
|
||||||
|
public GHArtifact[] next() {
|
||||||
|
GHArtifactsPage v = base.next();
|
||||||
|
if (result == null) {
|
||||||
|
result = v;
|
||||||
|
}
|
||||||
|
return v.getArtifacts(owner);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
}
|
||||||
|
}
|
||||||
20
src/main/java/org/kohsuke/github/GHArtifactsPage.java
Normal file
20
src/main/java/org/kohsuke/github/GHArtifactsPage.java
Normal file
@@ -0,0 +1,20 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Represents the one page of artifacts result when listing artifacts.
|
||||||
|
*/
|
||||||
|
class GHArtifactsPage {
|
||||||
|
private int total_count;
|
||||||
|
private GHArtifact[] artifacts;
|
||||||
|
|
||||||
|
public int getTotalCount() {
|
||||||
|
return total_count;
|
||||||
|
}
|
||||||
|
|
||||||
|
GHArtifact[] getArtifacts(GHRepository owner) {
|
||||||
|
for (GHArtifact artifact : artifacts) {
|
||||||
|
artifact.wrapUp(owner);
|
||||||
|
}
|
||||||
|
return artifacts;
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -9,7 +9,6 @@ import java.net.URL;
|
|||||||
* @see GHRelease#getAssets() GHRelease#getAssets()
|
* @see GHRelease#getAssets() GHRelease#getAssets()
|
||||||
*/
|
*/
|
||||||
public class GHAsset extends GHObject {
|
public class GHAsset extends GHObject {
|
||||||
GitHub root;
|
|
||||||
GHRepository owner;
|
GHRepository owner;
|
||||||
private String name;
|
private String name;
|
||||||
private String label;
|
private String label;
|
||||||
@@ -149,7 +148,7 @@ public class GHAsset extends GHObject {
|
|||||||
}
|
}
|
||||||
|
|
||||||
private String getApiRoute() {
|
private String getApiRoute() {
|
||||||
return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/releases/assets/" + id;
|
return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/releases/assets/" + getId();
|
||||||
}
|
}
|
||||||
|
|
||||||
GHAsset wrap(GHRelease release) {
|
GHAsset wrap(GHRelease release) {
|
||||||
|
|||||||
@@ -33,7 +33,6 @@ public class GHAuthorization extends GHObject {
|
|||||||
public static final String WRITE_KEY = "write:public_key";
|
public static final String WRITE_KEY = "write:public_key";
|
||||||
public static final String ADMIN_KEY = "admin:public_key";
|
public static final String ADMIN_KEY = "admin:public_key";
|
||||||
|
|
||||||
private GitHub root;
|
|
||||||
private List<String> scopes;
|
private List<String> scopes;
|
||||||
private String token;
|
private String token;
|
||||||
private String token_last_eight;
|
private String token_last_eight;
|
||||||
@@ -112,10 +111,12 @@ public class GHAuthorization extends GHObject {
|
|||||||
* Gets api url.
|
* Gets api url.
|
||||||
*
|
*
|
||||||
* @return the api url
|
* @return the api url
|
||||||
|
* @deprecated use {@link #getUrl()}
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
@SuppressFBWarnings(value = "NM_CONFUSING", justification = "It's a part of the library API, cannot be changed")
|
@SuppressFBWarnings(value = "NM_CONFUSING", justification = "It's a part of the library API, cannot be changed")
|
||||||
public URL getApiURL() {
|
public URL getApiURL() {
|
||||||
return GitHubClient.parseURL(url);
|
return getUrl();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|||||||
@@ -3,12 +3,15 @@ package org.kohsuke.github;
|
|||||||
import com.fasterxml.jackson.annotation.JsonCreator;
|
import com.fasterxml.jackson.annotation.JsonCreator;
|
||||||
import com.fasterxml.jackson.annotation.JsonProperty;
|
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
import java.util.Collection;
|
import java.util.Collection;
|
||||||
import java.util.Objects;
|
import java.util.Objects;
|
||||||
|
|
||||||
|
import javax.annotation.CheckForNull;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* A branch in a repository.
|
* A branch in a repository.
|
||||||
*
|
*
|
||||||
@@ -18,8 +21,7 @@ import java.util.Objects;
|
|||||||
value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD",
|
value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD",
|
||||||
"URF_UNREAD_FIELD" },
|
"URF_UNREAD_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public class GHBranch {
|
public class GHBranch extends GitHubInteractiveObject {
|
||||||
private GitHub root;
|
|
||||||
private GHRepository owner;
|
private GHRepository owner;
|
||||||
|
|
||||||
private String name;
|
private String name;
|
||||||
@@ -76,7 +78,7 @@ public class GHBranch {
|
|||||||
*
|
*
|
||||||
* @return true if the push to this branch is restricted via branch protection.
|
* @return true if the push to this branch is restricted via branch protection.
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(Previews.LUKE_CAGE)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public boolean isProtected() {
|
public boolean isProtected() {
|
||||||
return protection;
|
return protection;
|
||||||
@@ -87,7 +89,7 @@ public class GHBranch {
|
|||||||
*
|
*
|
||||||
* @return API URL that deals with the protection of this branch.
|
* @return API URL that deals with the protection of this branch.
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(Previews.LUKE_CAGE)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public URL getProtectionUrl() {
|
public URL getProtectionUrl() {
|
||||||
return GitHubClient.parseURL(protection_url);
|
return GitHubClient.parseURL(protection_url);
|
||||||
@@ -100,8 +102,14 @@ public class GHBranch {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
|
@Preview(Previews.LUKE_CAGE)
|
||||||
|
@Deprecated
|
||||||
public GHBranchProtection getProtection() throws IOException {
|
public GHBranchProtection getProtection() throws IOException {
|
||||||
return root.createRequest().withUrlPath(protection_url).fetch(GHBranchProtection.class).wrap(this);
|
return root.createRequest()
|
||||||
|
.withPreview(Previews.LUKE_CAGE)
|
||||||
|
.setRawUrlPath(protection_url)
|
||||||
|
.fetch(GHBranchProtection.class)
|
||||||
|
.wrap(this);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -120,7 +128,7 @@ public class GHBranch {
|
|||||||
* if disabling protection fails
|
* if disabling protection fails
|
||||||
*/
|
*/
|
||||||
public void disableProtection() throws IOException {
|
public void disableProtection() throws IOException {
|
||||||
root.createRequest().method("DELETE").withUrlPath(protection_url).send();
|
root.createRequest().method("DELETE").setRawUrlPath(protection_url).send();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -129,7 +137,7 @@ public class GHBranch {
|
|||||||
* @return GHBranchProtectionBuilder for enabling protection
|
* @return GHBranchProtectionBuilder for enabling protection
|
||||||
* @see GHCommitStatus#getContext() GHCommitStatus#getContext()
|
* @see GHCommitStatus#getContext() GHCommitStatus#getContext()
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(Previews.LUKE_CAGE)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHBranchProtectionBuilder enableProtection() {
|
public GHBranchProtectionBuilder enableProtection() {
|
||||||
return new GHBranchProtectionBuilder(this);
|
return new GHBranchProtectionBuilder(this);
|
||||||
@@ -161,6 +169,59 @@ public class GHBranch {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Merge a branch into this branch.
|
||||||
|
*
|
||||||
|
* @param headBranch
|
||||||
|
* the branch whose head will be merged
|
||||||
|
*
|
||||||
|
* @param commitMessage
|
||||||
|
* the commit message
|
||||||
|
*
|
||||||
|
* @return the merge {@link GHCommit} created, or {@code null} if the base already contains the head (nothing to
|
||||||
|
* merge).
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* if merging fails
|
||||||
|
*/
|
||||||
|
@CheckForNull
|
||||||
|
public GHCommit merge(GHBranch headBranch, String commitMessage) throws IOException {
|
||||||
|
return merge(headBranch.getName(), commitMessage);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Merge a ref into this branch.
|
||||||
|
*
|
||||||
|
* @param head
|
||||||
|
* the ref name that will be merged into this branch. Follows the usual ref naming rules, could be a
|
||||||
|
* branch name, tag, or commit sha.
|
||||||
|
*
|
||||||
|
* @param commitMessage
|
||||||
|
* the commit message
|
||||||
|
*
|
||||||
|
* @return the merge {@link GHCommit} created, or {@code null} if the base already contains the head (nothing to
|
||||||
|
* merge).
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* if merging fails
|
||||||
|
*/
|
||||||
|
@CheckForNull
|
||||||
|
public GHCommit merge(String head, String commitMessage) throws IOException {
|
||||||
|
GHCommit result = root.createRequest()
|
||||||
|
.withUrlPath(owner.getApiTailUrl("merges"))
|
||||||
|
.method("POST")
|
||||||
|
.with("commit_message", commitMessage)
|
||||||
|
.with("base", this.name)
|
||||||
|
.with("head", head)
|
||||||
|
.fetch(GHCommit.class);
|
||||||
|
|
||||||
|
if (result != null) {
|
||||||
|
result.wrapUp(owner);
|
||||||
|
}
|
||||||
|
|
||||||
|
return result;
|
||||||
|
}
|
||||||
|
|
||||||
String getApiRoute() {
|
String getApiRoute() {
|
||||||
return owner.getApiTailUrl("/branches/" + name);
|
return owner.getApiTailUrl("/branches/" + name);
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -6,23 +6,23 @@ import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
|||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.util.Collection;
|
import java.util.Collection;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.ZZZAX;
|
import static org.kohsuke.github.internal.Previews.ZZZAX;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The type GHBranchProtection.
|
* The type GHBranchProtection.
|
||||||
|
*
|
||||||
|
* @see <a href="https://docs.github.com/en/rest/reference/repos#get-branch-protection">GitHub Branch Protection</a>
|
||||||
*/
|
*/
|
||||||
@SuppressFBWarnings(
|
@SuppressFBWarnings(
|
||||||
value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD",
|
value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD",
|
||||||
"URF_UNREAD_FIELD" },
|
"URF_UNREAD_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public class GHBranchProtection {
|
public class GHBranchProtection extends GitHubInteractiveObject {
|
||||||
private static final String REQUIRE_SIGNATURES_URI = "/required_signatures";
|
private static final String REQUIRE_SIGNATURES_URI = "/required_signatures";
|
||||||
|
|
||||||
@JsonProperty
|
@JsonProperty
|
||||||
private EnforceAdmins enforceAdmins;
|
private EnforceAdmins enforceAdmins;
|
||||||
|
|
||||||
private GitHub root;
|
|
||||||
|
|
||||||
@JsonProperty("required_pull_request_reviews")
|
@JsonProperty("required_pull_request_reviews")
|
||||||
private RequiredReviews requiredReviews;
|
private RequiredReviews requiredReviews;
|
||||||
|
|
||||||
@@ -41,7 +41,7 @@ public class GHBranchProtection {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(ZZZAX)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public void enabledSignedCommits() throws IOException {
|
public void enabledSignedCommits() throws IOException {
|
||||||
requester().method("POST").withUrlPath(url + REQUIRE_SIGNATURES_URI).fetch(RequiredSignatures.class);
|
requester().method("POST").withUrlPath(url + REQUIRE_SIGNATURES_URI).fetch(RequiredSignatures.class);
|
||||||
@@ -53,7 +53,7 @@ public class GHBranchProtection {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(ZZZAX)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public void disableSignedCommits() throws IOException {
|
public void disableSignedCommits() throws IOException {
|
||||||
requester().method("DELETE").withUrlPath(url + REQUIRE_SIGNATURES_URI).send();
|
requester().method("DELETE").withUrlPath(url + REQUIRE_SIGNATURES_URI).send();
|
||||||
@@ -84,7 +84,7 @@ public class GHBranchProtection {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(ZZZAX)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public boolean getRequiredSignatures() throws IOException {
|
public boolean getRequiredSignatures() throws IOException {
|
||||||
return requester().withUrlPath(url + REQUIRE_SIGNATURES_URI).fetch(RequiredSignatures.class).enabled;
|
return requester().withUrlPath(url + REQUIRE_SIGNATURES_URI).fetch(RequiredSignatures.class).enabled;
|
||||||
|
|||||||
@@ -12,7 +12,7 @@ import java.util.List;
|
|||||||
import java.util.Map;
|
import java.util.Map;
|
||||||
import java.util.Set;
|
import java.util.Set;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.*;
|
import static org.kohsuke.github.internal.Previews.LUKE_CAGE;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Builder to configure the branch protection settings.
|
* Builder to configure the branch protection settings.
|
||||||
|
|||||||
@@ -1,10 +1,21 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||||
|
import com.infradna.tool.bridge_method_injector.WithBridgeMethods;
|
||||||
|
import edu.umd.cs.findbugs.annotations.NonNull;
|
||||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
|
import org.kohsuke.github.GHWorkflowRun.Conclusion;
|
||||||
|
import org.kohsuke.github.GHWorkflowRun.Status;
|
||||||
|
import org.kohsuke.github.internal.EnumUtils;
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
|
import java.util.Arrays;
|
||||||
|
import java.util.Collections;
|
||||||
import java.util.Date;
|
import java.util.Date;
|
||||||
|
import java.util.List;
|
||||||
|
import java.util.Locale;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Represents a check run.
|
* Represents a check run.
|
||||||
@@ -14,8 +25,9 @@ import java.util.Date;
|
|||||||
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD", "URF_UNREAD_FIELD" },
|
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD", "URF_UNREAD_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public class GHCheckRun extends GHObject {
|
public class GHCheckRun extends GHObject {
|
||||||
|
|
||||||
|
@JsonProperty("repository")
|
||||||
GHRepository owner;
|
GHRepository owner;
|
||||||
GitHub root;
|
|
||||||
|
|
||||||
private String status;
|
private String status;
|
||||||
private String conclusion;
|
private String conclusion;
|
||||||
@@ -34,7 +46,7 @@ public class GHCheckRun extends GHObject {
|
|||||||
|
|
||||||
GHCheckRun wrap(GHRepository owner) {
|
GHCheckRun wrap(GHRepository owner) {
|
||||||
this.owner = owner;
|
this.owner = owner;
|
||||||
this.root = owner.root;
|
wrap(owner.root);
|
||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -42,7 +54,24 @@ public class GHCheckRun extends GHObject {
|
|||||||
this.root = root;
|
this.root = root;
|
||||||
if (owner != null) {
|
if (owner != null) {
|
||||||
owner.wrap(root);
|
owner.wrap(root);
|
||||||
|
if (pullRequests != null && pullRequests.length != 0) {
|
||||||
|
for (GHPullRequest singlePull : pullRequests) {
|
||||||
|
singlePull.wrap(owner);
|
||||||
}
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
}
|
||||||
|
if (checkSuite != null) {
|
||||||
|
if (owner != null) {
|
||||||
|
checkSuite.wrap(owner);
|
||||||
|
} else {
|
||||||
|
checkSuite.wrap(root);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
if (app != null) {
|
||||||
|
app.wrapUp(root);
|
||||||
|
}
|
||||||
|
|
||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -56,12 +85,27 @@ public class GHCheckRun extends GHObject {
|
|||||||
* @return Status of the check run
|
* @return Status of the check run
|
||||||
* @see Status
|
* @see Status
|
||||||
*/
|
*/
|
||||||
public String getStatus() {
|
@WithBridgeMethods(value = String.class, adapterMethod = "statusAsStr")
|
||||||
|
public Status getStatus() {
|
||||||
|
return Status.from(status);
|
||||||
|
}
|
||||||
|
|
||||||
|
@SuppressFBWarnings(value = "UPM_UNCALLED_PRIVATE_METHOD", justification = "Bridge method of getStatus")
|
||||||
|
private Object statusAsStr(Status status, Class type) {
|
||||||
return status;
|
return status;
|
||||||
}
|
}
|
||||||
|
|
||||||
public static enum Status {
|
public static enum Status {
|
||||||
QUEUED, IN_PROGRESS, COMPLETED
|
QUEUED, IN_PROGRESS, COMPLETED, UNKNOWN;
|
||||||
|
|
||||||
|
public static Status from(String value) {
|
||||||
|
return EnumUtils.getNullableEnumOrDefault(Status.class, value, Status.UNKNOWN);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String toString() {
|
||||||
|
return name().toLowerCase(Locale.ROOT);
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -70,12 +114,33 @@ public class GHCheckRun extends GHObject {
|
|||||||
* @return Status of the check run
|
* @return Status of the check run
|
||||||
* @see Conclusion
|
* @see Conclusion
|
||||||
*/
|
*/
|
||||||
public String getConclusion() {
|
@WithBridgeMethods(value = String.class, adapterMethod = "conclusionAsStr")
|
||||||
|
public Conclusion getConclusion() {
|
||||||
|
return Conclusion.from(conclusion);
|
||||||
|
}
|
||||||
|
|
||||||
|
@SuppressFBWarnings(value = "UPM_UNCALLED_PRIVATE_METHOD", justification = "Bridge method of getConclusion")
|
||||||
|
private Object conclusionAsStr(Conclusion conclusion, Class type) {
|
||||||
return conclusion;
|
return conclusion;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Final conclusion of the check.
|
||||||
|
*
|
||||||
|
* From <a href="https://docs.github.com/en/rest/reference/checks#create-a-check-run--parameters">Check Run
|
||||||
|
* Parameters - <code>conclusion</code></a>.
|
||||||
|
*/
|
||||||
public static enum Conclusion {
|
public static enum Conclusion {
|
||||||
SUCCESS, FAILURE, NEUTRAL, CANCELLED, TIMED_OUT, ACTION_REQUIRED
|
ACTION_REQUIRED, CANCELLED, FAILURE, NEUTRAL, SUCCESS, SKIPPED, STALE, TIMED_OUT, UNKNOWN;
|
||||||
|
|
||||||
|
public static Conclusion from(String value) {
|
||||||
|
return EnumUtils.getNullableEnumOrDefault(Conclusion.class, value, Conclusion.UNKNOWN);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String toString() {
|
||||||
|
return name().toLowerCase(Locale.ROOT);
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -99,15 +164,22 @@ public class GHCheckRun extends GHObject {
|
|||||||
/**
|
/**
|
||||||
* Gets the pull requests participated in this check run.
|
* Gets the pull requests participated in this check run.
|
||||||
*
|
*
|
||||||
* @return Pull requests of this check run
|
* Note this field is only populated for events. When getting a {@link GHCheckRun} outside of an event, this is
|
||||||
|
* always empty.
|
||||||
|
*
|
||||||
|
* @return the list of {@link GHPullRequest}s for this check run. Only populated for events.
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
*/
|
*/
|
||||||
GHPullRequest[] getPullRequests() throws IOException {
|
public List<GHPullRequest> getPullRequests() throws IOException {
|
||||||
if (pullRequests != null && pullRequests.length != 0) {
|
if (pullRequests != null && pullRequests.length != 0) {
|
||||||
for (GHPullRequest singlePull : pullRequests) {
|
for (GHPullRequest singlePull : pullRequests) {
|
||||||
singlePull.refresh();
|
// Only refresh if we haven't do so before
|
||||||
|
singlePull.refresh(singlePull.getTitle());
|
||||||
}
|
}
|
||||||
|
return Collections.unmodifiableList(Arrays.asList(pullRequests));
|
||||||
}
|
}
|
||||||
return pullRequests;
|
return Collections.emptyList();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -256,4 +328,15 @@ public class GHCheckRun extends GHObject {
|
|||||||
NOTICE, WARNING, FAILURE
|
NOTICE, WARNING, FAILURE
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Updates this check run.
|
||||||
|
*
|
||||||
|
* @return a builder which you should customize, then call {@link GHCheckRunBuilder#create}
|
||||||
|
*/
|
||||||
|
@Preview(Previews.ANTIOPE)
|
||||||
|
@Deprecated
|
||||||
|
public @NonNull GHCheckRunBuilder update() {
|
||||||
|
return new GHCheckRunBuilder(owner, getId());
|
||||||
|
}
|
||||||
|
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -28,6 +28,7 @@ import com.fasterxml.jackson.annotation.JsonInclude;
|
|||||||
import edu.umd.cs.findbugs.annotations.CheckForNull;
|
import edu.umd.cs.findbugs.annotations.CheckForNull;
|
||||||
import edu.umd.cs.findbugs.annotations.NonNull;
|
import edu.umd.cs.findbugs.annotations.NonNull;
|
||||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.util.Collections;
|
import java.util.Collections;
|
||||||
@@ -37,30 +38,45 @@ import java.util.List;
|
|||||||
import java.util.Locale;
|
import java.util.Locale;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Drafts a check run.
|
* Drafts or updates a check run.
|
||||||
*
|
*
|
||||||
* @see GHCheckRun
|
* @see GHCheckRun
|
||||||
* @see GHRepository#createCheckRun
|
* @see GHRepository#createCheckRun
|
||||||
* @see <a href="https://developer.github.com/v3/checks/runs/#create-a-check-run">documentation</a>
|
* @see <a href="https://developer.github.com/v3/checks/runs/#create-a-check-run">documentation</a>
|
||||||
|
* @see GHCheckRun#update()
|
||||||
|
* @see <a href="https://developer.github.com/v3/checks/runs/#update-a-check-run">documentation</a>
|
||||||
*/
|
*/
|
||||||
@SuppressFBWarnings(value = "URF_UNREAD_FIELD", justification = "Jackson serializes these even without a getter")
|
@SuppressFBWarnings(value = "URF_UNREAD_FIELD", justification = "Jackson serializes these even without a getter")
|
||||||
@Preview
|
@Preview(Previews.ANTIOPE)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public final class GHCheckRunBuilder {
|
public final class GHCheckRunBuilder {
|
||||||
|
|
||||||
private final GHRepository repo;
|
protected final GHRepository repo;
|
||||||
private final Requester requester;
|
protected final Requester requester;
|
||||||
private Output output;
|
private Output output;
|
||||||
private List<Action> actions;
|
private List<Action> actions;
|
||||||
|
|
||||||
GHCheckRunBuilder(GHRepository repo, String name, String headSHA) {
|
private GHCheckRunBuilder(GHRepository repo, Requester requester) {
|
||||||
this.repo = repo;
|
this.repo = repo;
|
||||||
requester = repo.root.createRequest()
|
this.requester = requester;
|
||||||
|
}
|
||||||
|
|
||||||
|
GHCheckRunBuilder(GHRepository repo, String name, String headSHA) {
|
||||||
|
this(repo,
|
||||||
|
repo.root.createRequest()
|
||||||
.withPreview(Previews.ANTIOPE)
|
.withPreview(Previews.ANTIOPE)
|
||||||
.method("POST")
|
.method("POST")
|
||||||
.with("name", name)
|
.with("name", name)
|
||||||
.with("head_sha", headSHA)
|
.with("head_sha", headSHA)
|
||||||
.withUrlPath(repo.getApiTailUrl("check-runs"));
|
.withUrlPath(repo.getApiTailUrl("check-runs")));
|
||||||
|
}
|
||||||
|
|
||||||
|
GHCheckRunBuilder(GHRepository repo, long checkId) {
|
||||||
|
this(repo,
|
||||||
|
repo.root.createRequest()
|
||||||
|
.withPreview(Previews.ANTIOPE)
|
||||||
|
.method("PATCH")
|
||||||
|
.withUrlPath(repo.getApiTailUrl("check-runs/" + checkId)));
|
||||||
}
|
}
|
||||||
|
|
||||||
public @NonNull GHCheckRunBuilder withDetailsURL(@CheckForNull String detailsURL) {
|
public @NonNull GHCheckRunBuilder withDetailsURL(@CheckForNull String detailsURL) {
|
||||||
@@ -136,7 +152,7 @@ public final class GHCheckRunBuilder {
|
|||||||
}
|
}
|
||||||
GHCheckRun run = requester.with("output", output).with("actions", actions).fetch(GHCheckRun.class).wrap(repo);
|
GHCheckRun run = requester.with("output", output).with("actions", actions).fetch(GHCheckRun.class).wrap(repo);
|
||||||
while (!extraAnnotations.isEmpty()) {
|
while (!extraAnnotations.isEmpty()) {
|
||||||
Output output2 = new Output(output.title, output.summary);
|
Output output2 = new Output(output.title, output.summary).withText(output.text);
|
||||||
int i = Math.min(extraAnnotations.size(), MAX_ANNOTATIONS);
|
int i = Math.min(extraAnnotations.size(), MAX_ANNOTATIONS);
|
||||||
output2.annotations = extraAnnotations.subList(0, i);
|
output2.annotations = extraAnnotations.subList(0, i);
|
||||||
extraAnnotations = extraAnnotations.subList(i, extraAnnotations.size());
|
extraAnnotations = extraAnnotations.subList(i, extraAnnotations.size());
|
||||||
@@ -144,7 +160,7 @@ public final class GHCheckRunBuilder {
|
|||||||
.withPreview(Previews.ANTIOPE)
|
.withPreview(Previews.ANTIOPE)
|
||||||
.method("PATCH")
|
.method("PATCH")
|
||||||
.with("output", output2)
|
.with("output", output2)
|
||||||
.withUrlPath(repo.getApiTailUrl("check-runs/" + run.id))
|
.withUrlPath(repo.getApiTailUrl("check-runs/" + run.getId()))
|
||||||
.fetch(GHCheckRun.class)
|
.fetch(GHCheckRun.class)
|
||||||
.wrap(repo);
|
.wrap(repo);
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -8,13 +8,13 @@ import javax.annotation.Nonnull;
|
|||||||
* Iterable for check-runs listing.
|
* Iterable for check-runs listing.
|
||||||
*/
|
*/
|
||||||
class GHCheckRunsIterable extends PagedIterable<GHCheckRun> {
|
class GHCheckRunsIterable extends PagedIterable<GHCheckRun> {
|
||||||
private GitHub root;
|
private final GHRepository owner;
|
||||||
private final GitHubRequest request;
|
private final GitHubRequest request;
|
||||||
|
|
||||||
private GHCheckRunsPage result;
|
private GHCheckRunsPage result;
|
||||||
|
|
||||||
public GHCheckRunsIterable(GitHub root, GitHubRequest request) {
|
public GHCheckRunsIterable(GHRepository owner, GitHubRequest request) {
|
||||||
this.root = root;
|
this.owner = owner;
|
||||||
this.request = request;
|
this.request = request;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -22,7 +22,7 @@ class GHCheckRunsIterable extends PagedIterable<GHCheckRun> {
|
|||||||
@Override
|
@Override
|
||||||
public PagedIterator<GHCheckRun> _iterator(int pageSize) {
|
public PagedIterator<GHCheckRun> _iterator(int pageSize) {
|
||||||
return new PagedIterator<>(
|
return new PagedIterator<>(
|
||||||
adapt(GitHubPageIterator.create(root.getClient(), GHCheckRunsPage.class, request, pageSize)),
|
adapt(GitHubPageIterator.create(owner.getRoot().getClient(), GHCheckRunsPage.class, request, pageSize)),
|
||||||
null);
|
null);
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -37,7 +37,7 @@ class GHCheckRunsIterable extends PagedIterable<GHCheckRun> {
|
|||||||
if (result == null) {
|
if (result == null) {
|
||||||
result = v;
|
result = v;
|
||||||
}
|
}
|
||||||
return v.getCheckRuns(root);
|
return v.getCheckRuns(owner);
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -11,9 +11,9 @@ class GHCheckRunsPage {
|
|||||||
return total_count;
|
return total_count;
|
||||||
}
|
}
|
||||||
|
|
||||||
GHCheckRun[] getCheckRuns(GitHub root) {
|
GHCheckRun[] getCheckRuns(GHRepository owner) {
|
||||||
for (GHCheckRun check_run : check_runs) {
|
for (GHCheckRun check_run : check_runs) {
|
||||||
check_run.wrap(root);
|
check_run.wrap(owner);
|
||||||
}
|
}
|
||||||
return check_runs;
|
return check_runs;
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -1,10 +1,14 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
|
import java.util.Arrays;
|
||||||
|
import java.util.Collections;
|
||||||
import java.util.Date;
|
import java.util.Date;
|
||||||
|
import java.util.List;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Represents a check suite.
|
* Represents a check suite.
|
||||||
@@ -14,8 +18,9 @@ import java.util.Date;
|
|||||||
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD", "URF_UNREAD_FIELD" },
|
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD", "URF_UNREAD_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public class GHCheckSuite extends GHObject {
|
public class GHCheckSuite extends GHObject {
|
||||||
|
|
||||||
|
@JsonProperty("repository")
|
||||||
GHRepository owner;
|
GHRepository owner;
|
||||||
GitHub root;
|
|
||||||
|
|
||||||
private String nodeId;
|
private String nodeId;
|
||||||
private String headBranch;
|
private String headBranch;
|
||||||
@@ -32,7 +37,7 @@ public class GHCheckSuite extends GHObject {
|
|||||||
|
|
||||||
GHCheckSuite wrap(GHRepository owner) {
|
GHCheckSuite wrap(GHRepository owner) {
|
||||||
this.owner = owner;
|
this.owner = owner;
|
||||||
this.root = owner.root;
|
this.wrap(owner.root);
|
||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -40,6 +45,14 @@ public class GHCheckSuite extends GHObject {
|
|||||||
this.root = root;
|
this.root = root;
|
||||||
if (owner != null) {
|
if (owner != null) {
|
||||||
owner.wrap(root);
|
owner.wrap(root);
|
||||||
|
if (pullRequests != null && pullRequests.length != 0) {
|
||||||
|
for (GHPullRequest singlePull : pullRequests) {
|
||||||
|
singlePull.wrap(owner);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
if (app != null) {
|
||||||
|
app.wrapUp(root);
|
||||||
}
|
}
|
||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
@@ -153,15 +166,22 @@ public class GHCheckSuite extends GHObject {
|
|||||||
/**
|
/**
|
||||||
* Gets the pull requests participated in this check suite.
|
* Gets the pull requests participated in this check suite.
|
||||||
*
|
*
|
||||||
* @return Pull requests
|
* Note this field is only populated for events. When getting a {@link GHCheckSuite} outside of an event, this is
|
||||||
|
* always empty.
|
||||||
|
*
|
||||||
|
* @return the list of {@link GHPullRequest}s for this check suite. Only populated for events.
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
*/
|
*/
|
||||||
GHPullRequest[] getPullRequests() throws IOException {
|
public List<GHPullRequest> getPullRequests() throws IOException {
|
||||||
if (pullRequests != null && pullRequests.length != 0) {
|
if (pullRequests != null && pullRequests.length != 0) {
|
||||||
for (GHPullRequest singlePull : pullRequests) {
|
for (GHPullRequest singlePull : pullRequests) {
|
||||||
singlePull.refresh();
|
// Only refresh if we haven't do so before
|
||||||
|
singlePull.refresh(singlePull.getTitle());
|
||||||
}
|
}
|
||||||
|
return Collections.unmodifiableList(Arrays.asList(pullRequests));
|
||||||
}
|
}
|
||||||
return pullRequests;
|
return Collections.emptyList();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|||||||
@@ -11,6 +11,9 @@ import java.util.Collections;
|
|||||||
import java.util.Date;
|
import java.util.Date;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
|
|
||||||
|
import static org.kohsuke.github.internal.Previews.ANTIOPE;
|
||||||
|
import static org.kohsuke.github.internal.Previews.GROOT;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* A commit in a repository.
|
* A commit in a repository.
|
||||||
*
|
*
|
||||||
@@ -63,7 +66,7 @@ public class GHCommit {
|
|||||||
* @return the authored date
|
* @return the authored date
|
||||||
*/
|
*/
|
||||||
public Date getAuthoredDate() {
|
public Date getAuthoredDate() {
|
||||||
return GitHubClient.parseDate(author.date);
|
return author.getDate();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -82,7 +85,7 @@ public class GHCommit {
|
|||||||
* @return the commit date
|
* @return the commit date
|
||||||
*/
|
*/
|
||||||
public Date getCommitDate() {
|
public Date getCommitDate() {
|
||||||
return GitHubClient.parseDate(committer.date);
|
return committer.getDate();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -119,7 +122,6 @@ public class GHCommit {
|
|||||||
* @deprecated Use {@link GitUser} instead.
|
* @deprecated Use {@link GitUser} instead.
|
||||||
*/
|
*/
|
||||||
public static class GHAuthor extends GitUser {
|
public static class GHAuthor extends GitUser {
|
||||||
private String date;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -446,6 +448,39 @@ public class GHCommit {
|
|||||||
return owner.root.getUser(author.login);
|
return owner.root.getUser(author.login);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Retrieves a list of pull requests which contain this commit.
|
||||||
|
*
|
||||||
|
* @return {@link PagedIterable} with the pull requests which contain this commit
|
||||||
|
*/
|
||||||
|
@Preview(GROOT)
|
||||||
|
@Deprecated
|
||||||
|
public PagedIterable<GHPullRequest> listPullRequests() {
|
||||||
|
return owner.root.createRequest()
|
||||||
|
.withPreview(GROOT)
|
||||||
|
.withUrlPath(String.format("/repos/%s/%s/commits/%s/pulls", owner.getOwnerName(), owner.getName(), sha))
|
||||||
|
.toIterable(GHPullRequest[].class, item -> item.wrapUp(owner));
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Retrieves a list of branches where this commit is the head commit.
|
||||||
|
*
|
||||||
|
* @return {@link PagedIterable} with the branches where the commit is the head commit
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
@Preview(GROOT)
|
||||||
|
@Deprecated
|
||||||
|
public PagedIterable<GHBranch> listBranchesWhereHead() throws IOException {
|
||||||
|
return owner.root.createRequest()
|
||||||
|
.withPreview(GROOT)
|
||||||
|
.withUrlPath(String.format("/repos/%s/%s/commits/%s/branches-where-head",
|
||||||
|
owner.getOwnerName(),
|
||||||
|
owner.getName(),
|
||||||
|
sha))
|
||||||
|
.toIterable(GHBranch[].class, item -> item.wrap(owner));
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* List comments paged iterable.
|
* List comments paged iterable.
|
||||||
*
|
*
|
||||||
@@ -530,7 +565,7 @@ public class GHCommit {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* on error
|
* on error
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(ANTIOPE)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public PagedIterable<GHCheckRun> getCheckRuns() throws IOException {
|
public PagedIterable<GHCheckRun> getCheckRuns() throws IOException {
|
||||||
return owner.getCheckRuns(sha);
|
return owner.getCheckRuns(sha);
|
||||||
|
|||||||
@@ -89,6 +89,19 @@ public class GHCommitBuilder {
|
|||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Configures the PGP signature of this commit.
|
||||||
|
*
|
||||||
|
* @param signature
|
||||||
|
* the signature calculated from the commit
|
||||||
|
*
|
||||||
|
* @return the gh commit builder
|
||||||
|
*/
|
||||||
|
public GHCommitBuilder withSignature(String signature) {
|
||||||
|
req.with("signature", signature);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Configures the committer of this commit.
|
* Configures the committer of this commit.
|
||||||
*
|
*
|
||||||
|
|||||||
@@ -5,7 +5,7 @@ import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
|||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.*;
|
import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* A comment attached to a commit (or a specific line in a specific file of a commit.)
|
* A comment attached to a commit (or a specific line in a specific file of a commit.)
|
||||||
@@ -121,7 +121,7 @@ public class GHCommitComment extends GHObject implements Reactable {
|
|||||||
this.body = body;
|
this.body = body;
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHReaction createReaction(ReactionContent content) throws IOException {
|
public GHReaction createReaction(ReactionContent content) throws IOException {
|
||||||
return owner.root.createRequest()
|
return owner.root.createRequest()
|
||||||
@@ -133,7 +133,7 @@ public class GHCommitComment extends GHObject implements Reactable {
|
|||||||
.wrap(owner.root);
|
.wrap(owner.root);
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public PagedIterable<GHReaction> listReactions() {
|
public PagedIterable<GHReaction> listReactions() {
|
||||||
return owner.root.createRequest()
|
return owner.root.createRequest()
|
||||||
@@ -153,7 +153,7 @@ public class GHCommitComment extends GHObject implements Reactable {
|
|||||||
}
|
}
|
||||||
|
|
||||||
private String getApiTail() {
|
private String getApiTail() {
|
||||||
return String.format("/repos/%s/%s/comments/%s", owner.getOwnerName(), owner.getName(), id);
|
return String.format("/repos/%s/%s/comments/%s", owner.getOwnerName(), owner.getName(), getId());
|
||||||
}
|
}
|
||||||
|
|
||||||
GHCommitComment wrap(GHRepository owner) {
|
GHCommitComment wrap(GHRepository owner) {
|
||||||
|
|||||||
@@ -1,6 +1,7 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
import org.apache.commons.lang3.StringUtils;
|
import org.apache.commons.lang3.StringUtils;
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
|
|
||||||
@@ -10,7 +11,7 @@ import java.io.IOException;
|
|||||||
* @author Marc de Verdelhan
|
* @author Marc de Verdelhan
|
||||||
* @see GitHub#searchCommits() GitHub#searchCommits()
|
* @see GitHub#searchCommits() GitHub#searchCommits()
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(Previews.CLOAK)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public class GHCommitSearchBuilder extends GHSearchBuilder<GHCommit> {
|
public class GHCommitSearchBuilder extends GHSearchBuilder<GHCommit> {
|
||||||
GHCommitSearchBuilder(GitHub root) {
|
GHCommitSearchBuilder(GitHub root) {
|
||||||
|
|||||||
@@ -18,8 +18,6 @@ public class GHCommitStatus extends GHObject {
|
|||||||
String context;
|
String context;
|
||||||
GHUser creator;
|
GHUser creator;
|
||||||
|
|
||||||
private GitHub root;
|
|
||||||
|
|
||||||
GHCommitStatus wrapUp(GitHub root) {
|
GHCommitStatus wrapUp(GitHub root) {
|
||||||
if (creator != null)
|
if (creator != null)
|
||||||
creator.wrapUp(root);
|
creator.wrapUp(root);
|
||||||
|
|||||||
@@ -15,21 +15,20 @@ import java.util.Base64;
|
|||||||
* @see GHRepository#getFileContent(String) GHRepository#getFileContent(String)
|
* @see GHRepository#getFileContent(String) GHRepository#getFileContent(String)
|
||||||
*/
|
*/
|
||||||
@SuppressWarnings({ "UnusedDeclaration" })
|
@SuppressWarnings({ "UnusedDeclaration" })
|
||||||
public class GHContent implements Refreshable {
|
public class GHContent extends GitHubInteractiveObject implements Refreshable {
|
||||||
/*
|
/*
|
||||||
* In normal use of this class, repository field is set via wrap(), but in the code search API, there's a nested
|
* In normal use of this class, repository field is set via wrap(), but in the code search API, there's a nested
|
||||||
* 'repository' field that gets populated from JSON.
|
* 'repository' field that gets populated from JSON.
|
||||||
*/
|
*/
|
||||||
private GHRepository repository;
|
private GHRepository repository;
|
||||||
|
|
||||||
private GitHub root;
|
|
||||||
|
|
||||||
private String type;
|
private String type;
|
||||||
private String encoding;
|
private String encoding;
|
||||||
private long size;
|
private long size;
|
||||||
private String sha;
|
private String sha;
|
||||||
private String name;
|
private String name;
|
||||||
private String path;
|
private String path;
|
||||||
|
private String target;
|
||||||
private String content;
|
private String content;
|
||||||
private String url; // this is the API url
|
private String url; // this is the API url
|
||||||
private String git_url; // this is the Blob url
|
private String git_url; // this is the Blob url
|
||||||
@@ -99,6 +98,15 @@ public class GHContent implements Refreshable {
|
|||||||
return path;
|
return path;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets target of a symlink. This will only be set if {@code "symlink".equals(getType())}
|
||||||
|
*
|
||||||
|
* @return the target
|
||||||
|
*/
|
||||||
|
public String getTarget() {
|
||||||
|
return target;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Retrieve the decoded content that is stored at this location.
|
* Retrieve the decoded content that is stored at this location.
|
||||||
*
|
*
|
||||||
|
|||||||
@@ -118,6 +118,41 @@ public class GHContentSearchBuilder extends GHSearchBuilder<GHContent> {
|
|||||||
return q("repo:" + v);
|
return q("repo:" + v);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Order gh content search builder.
|
||||||
|
*
|
||||||
|
* @param v
|
||||||
|
* the v
|
||||||
|
* @return the gh content search builder
|
||||||
|
*/
|
||||||
|
public GHContentSearchBuilder order(GHDirection v) {
|
||||||
|
req.with("order", v);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Sort gh content search builder.
|
||||||
|
*
|
||||||
|
* @param sort
|
||||||
|
* the sort
|
||||||
|
* @return the gh content search builder
|
||||||
|
*/
|
||||||
|
public GHContentSearchBuilder sort(GHContentSearchBuilder.Sort sort) {
|
||||||
|
if (Sort.BEST_MATCH.equals(sort)) {
|
||||||
|
req.remove("sort");
|
||||||
|
} else {
|
||||||
|
req.with("sort", sort);
|
||||||
|
}
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The enum Sort.
|
||||||
|
*/
|
||||||
|
public enum Sort {
|
||||||
|
BEST_MATCH, INDEXED
|
||||||
|
}
|
||||||
|
|
||||||
private static class ContentSearchResult extends SearchResult<GHContent> {
|
private static class ContentSearchResult extends SearchResult<GHContent> {
|
||||||
private GHContent[] items;
|
private GHContent[] items;
|
||||||
|
|
||||||
|
|||||||
@@ -1,166 +1,25 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
|
||||||
|
import static org.kohsuke.github.internal.Previews.BAPTISTE;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a repository
|
* Creates a repository
|
||||||
*
|
*
|
||||||
* @author Kohsuke Kawaguchi
|
* @author Kohsuke Kawaguchi
|
||||||
*/
|
*/
|
||||||
public class GHCreateRepositoryBuilder {
|
public class GHCreateRepositoryBuilder extends GHRepositoryBuilder<GHCreateRepositoryBuilder> {
|
||||||
private final GitHub root;
|
|
||||||
protected final Requester builder;
|
|
||||||
private final String apiUrlTail;
|
|
||||||
|
|
||||||
GHCreateRepositoryBuilder(GitHub root, String apiUrlTail, String name) {
|
public GHCreateRepositoryBuilder(String name, GitHub root, String apiTail) {
|
||||||
this.root = root;
|
super(GHCreateRepositoryBuilder.class, root, null);
|
||||||
this.apiUrlTail = apiUrlTail;
|
requester.method("POST").withUrlPath(apiTail);
|
||||||
this.builder = root.createRequest();
|
|
||||||
this.builder.with("name", name);
|
try {
|
||||||
|
name(name);
|
||||||
|
} catch (IOException e) {
|
||||||
|
// not going to happen here
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
|
||||||
* Description for repository
|
|
||||||
*
|
|
||||||
* @param description
|
|
||||||
* description of repository
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder description(String description) {
|
|
||||||
this.builder.with("description", description);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Homepage for repository
|
|
||||||
*
|
|
||||||
* @param homepage
|
|
||||||
* homepage of repository
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder homepage(URL homepage) {
|
|
||||||
return homepage(homepage.toExternalForm());
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Homepage for repository
|
|
||||||
*
|
|
||||||
* @param homepage
|
|
||||||
* homepage of repository
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder homepage(String homepage) {
|
|
||||||
this.builder.with("homepage", homepage);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Creates a private repository
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* private if true
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder private_(boolean enabled) {
|
|
||||||
this.builder.with("private", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Enables issue tracker
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* true if enabled
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder issues(boolean enabled) {
|
|
||||||
this.builder.with("has_issues", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Enables projects
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* true if enabled
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder projects(boolean enabled) {
|
|
||||||
this.builder.with("has_projects", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Enables wiki
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* true if enabled
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder wiki(boolean enabled) {
|
|
||||||
this.builder.with("has_wiki", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Enables downloads
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* true if enabled
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder downloads(boolean enabled) {
|
|
||||||
this.builder.with("has_downloads", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* If true, create an initial commit with empty README.
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* true if enabled
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder autoInit(boolean enabled) {
|
|
||||||
this.builder.with("auto_init", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Allow or disallow squash-merging pull requests.
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* true if enabled
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder allowSquashMerge(boolean enabled) {
|
|
||||||
this.builder.with("allow_squash_merge", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Allow or disallow merging pull requests with a merge commit.
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* true if enabled
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder allowMergeCommit(boolean enabled) {
|
|
||||||
this.builder.with("allow_merge_commit", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Allow or disallow rebase-merging pull requests.
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* true if enabled
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder allowRebaseMerge(boolean enabled) {
|
|
||||||
this.builder.with("allow_rebase_merge", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -169,10 +28,11 @@ public class GHCreateRepositoryBuilder {
|
|||||||
* @param language
|
* @param language
|
||||||
* template to base the ignore file on
|
* template to base the ignore file on
|
||||||
* @return a builder to continue with building See https://developer.github.com/v3/repos/#create
|
* @return a builder to continue with building See https://developer.github.com/v3/repos/#create
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
*/
|
*/
|
||||||
public GHCreateRepositoryBuilder gitignoreTemplate(String language) {
|
public GHCreateRepositoryBuilder gitignoreTemplate(String language) throws IOException {
|
||||||
this.builder.with("gitignore_template", language);
|
return with("gitignore_template", language);
|
||||||
return this;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -181,10 +41,24 @@ public class GHCreateRepositoryBuilder {
|
|||||||
* @param license
|
* @param license
|
||||||
* template to base the license file on
|
* template to base the license file on
|
||||||
* @return a builder to continue with building See https://developer.github.com/v3/repos/#create
|
* @return a builder to continue with building See https://developer.github.com/v3/repos/#create
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
*/
|
*/
|
||||||
public GHCreateRepositoryBuilder licenseTemplate(String license) {
|
public GHCreateRepositoryBuilder licenseTemplate(String license) throws IOException {
|
||||||
this.builder.with("license_template", license);
|
return with("license_template", license);
|
||||||
return this;
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* If true, create an initial commit with empty README.
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
* @return a builder to continue with building
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public GHCreateRepositoryBuilder autoInit(boolean enabled) throws IOException {
|
||||||
|
return with("auto_init", enabled);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -193,10 +67,57 @@ public class GHCreateRepositoryBuilder {
|
|||||||
* @param team
|
* @param team
|
||||||
* team to grant access to
|
* team to grant access to
|
||||||
* @return a builder to continue with building
|
* @return a builder to continue with building
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
*/
|
*/
|
||||||
public GHCreateRepositoryBuilder team(GHTeam team) {
|
public GHCreateRepositoryBuilder team(GHTeam team) throws IOException {
|
||||||
if (team != null)
|
if (team != null)
|
||||||
this.builder.with("team_id", team.getId());
|
return with("team_id", team.getId());
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Specifies whether the repository is a template.
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
* @return a builder to continue with building
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
* @deprecated Use {@link #isTemplate(boolean)} method instead
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
public GHCreateRepositoryBuilder templateRepository(boolean enabled) throws IOException {
|
||||||
|
return isTemplate(enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Specifies the ownership of the repository.
|
||||||
|
*
|
||||||
|
* @param owner
|
||||||
|
* organization or personage
|
||||||
|
* @return a builder to continue with building
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public GHCreateRepositoryBuilder owner(String owner) throws IOException {
|
||||||
|
return with("owner", owner);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Create repository from template repository
|
||||||
|
*
|
||||||
|
* @param templateOwner
|
||||||
|
* template repository owner
|
||||||
|
* @param templateRepo
|
||||||
|
* template repository
|
||||||
|
* @return a builder to continue with building
|
||||||
|
* @see <a href="https://developer.github.com/v3/previews/">GitHub API Previews</a>
|
||||||
|
*/
|
||||||
|
@Preview(BAPTISTE)
|
||||||
|
@Deprecated
|
||||||
|
public GHCreateRepositoryBuilder fromTemplateRepository(String templateOwner, String templateRepo) {
|
||||||
|
requester.withPreview(BAPTISTE).withUrlPath("/repos/" + templateOwner + "/" + templateRepo + "/generate");
|
||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -205,10 +126,9 @@ public class GHCreateRepositoryBuilder {
|
|||||||
*
|
*
|
||||||
* @return the gh repository
|
* @return the gh repository
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* if repsitory cannot be created
|
* if repository cannot be created
|
||||||
*/
|
*/
|
||||||
public GHRepository create() throws IOException {
|
public GHRepository create() throws IOException {
|
||||||
return builder.method("POST").withUrlPath(apiUrlTail).fetch(GHRepository.class).wrap(root);
|
return done();
|
||||||
}
|
}
|
||||||
|
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -1,7 +1,10 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
|
import java.util.Map;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Represents a deployment
|
* Represents a deployment
|
||||||
@@ -13,7 +16,6 @@ import java.net.URL;
|
|||||||
*/
|
*/
|
||||||
public class GHDeployment extends GHObject {
|
public class GHDeployment extends GHObject {
|
||||||
private GHRepository owner;
|
private GHRepository owner;
|
||||||
private GitHub root;
|
|
||||||
protected String sha;
|
protected String sha;
|
||||||
protected String ref;
|
protected String ref;
|
||||||
protected String task;
|
protected String task;
|
||||||
@@ -23,6 +25,9 @@ public class GHDeployment extends GHObject {
|
|||||||
protected String statuses_url;
|
protected String statuses_url;
|
||||||
protected String repository_url;
|
protected String repository_url;
|
||||||
protected GHUser creator;
|
protected GHUser creator;
|
||||||
|
protected String original_environment;
|
||||||
|
protected boolean transient_environment;
|
||||||
|
protected boolean production_environment;
|
||||||
|
|
||||||
GHDeployment wrap(GHRepository owner) {
|
GHDeployment wrap(GHRepository owner) {
|
||||||
this.owner = owner;
|
this.owner = owner;
|
||||||
@@ -60,7 +65,8 @@ public class GHDeployment extends GHObject {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets payload.
|
* Gets payload. <b>NOTE:</b> only use this method if you can guarantee the payload will be a simple string,
|
||||||
|
* otherwise use {@link #getPayloadObject()}.
|
||||||
*
|
*
|
||||||
* @return the payload
|
* @return the payload
|
||||||
*/
|
*/
|
||||||
@@ -68,6 +74,38 @@ public class GHDeployment extends GHObject {
|
|||||||
return (String) payload;
|
return (String) payload;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets payload. <b>NOTE:</b> only use this method if you can guarantee the payload will be a JSON object (Map),
|
||||||
|
* otherwise use {@link #getPayloadObject()}.
|
||||||
|
*
|
||||||
|
* @return the payload
|
||||||
|
*/
|
||||||
|
public Map<String, Object> getPayloadMap() {
|
||||||
|
return (Map<String, Object>) payload;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets payload without assuming its type. It could be a String or a Map.
|
||||||
|
*
|
||||||
|
* @return the payload
|
||||||
|
*/
|
||||||
|
public Object getPayloadObject() {
|
||||||
|
return payload;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The environment defined when the deployment was first created.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @return the original deployment environment
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.FLASH)
|
||||||
|
public String getOriginalEnvironment() {
|
||||||
|
return original_environment;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets environment.
|
* Gets environment.
|
||||||
*
|
*
|
||||||
@@ -77,6 +115,33 @@ public class GHDeployment extends GHObject {
|
|||||||
return environment;
|
return environment;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Specifies if the given environment is specific to the deployment and will no longer exist at some point in the
|
||||||
|
* future.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @return the environment is transient
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
public boolean isTransientEnvironment() {
|
||||||
|
return transient_environment;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Specifies if the given environment is one that end-users directly interact with.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @return the environment is used by end-users directly
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
public boolean isProductionEnvironment() {
|
||||||
|
return production_environment;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets creator.
|
* Gets creator.
|
||||||
*
|
*
|
||||||
@@ -122,7 +187,7 @@ public class GHDeployment extends GHObject {
|
|||||||
* @return the gh deployment status builder
|
* @return the gh deployment status builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentStatusBuilder createStatus(GHDeploymentState state) {
|
public GHDeploymentStatusBuilder createStatus(GHDeploymentState state) {
|
||||||
return new GHDeploymentStatusBuilder(owner, id, state);
|
return new GHDeploymentStatusBuilder(owner, getId(), state);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -133,6 +198,8 @@ public class GHDeployment extends GHObject {
|
|||||||
public PagedIterable<GHDeploymentStatus> listStatuses() {
|
public PagedIterable<GHDeploymentStatus> listStatuses() {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
.withUrlPath(statuses_url)
|
.withUrlPath(statuses_url)
|
||||||
|
.withPreview(Previews.ANT_MAN)
|
||||||
|
.withPreview(Previews.FLASH)
|
||||||
.toIterable(GHDeploymentStatus[].class, item -> item.wrap(owner));
|
.toIterable(GHDeploymentStatus[].class, item -> item.wrap(owner));
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
@@ -1,5 +1,7 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
|
|
||||||
@@ -19,7 +21,10 @@ public class GHDeploymentBuilder {
|
|||||||
*/
|
*/
|
||||||
public GHDeploymentBuilder(GHRepository repo) {
|
public GHDeploymentBuilder(GHRepository repo) {
|
||||||
this.repo = repo;
|
this.repo = repo;
|
||||||
this.builder = repo.root.createRequest().method("POST");
|
this.builder = repo.root.createRequest()
|
||||||
|
.withPreview(Previews.ANT_MAN)
|
||||||
|
.withPreview(Previews.FLASH)
|
||||||
|
.method("POST");
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -40,6 +45,7 @@ public class GHDeploymentBuilder {
|
|||||||
*
|
*
|
||||||
* @param branch
|
* @param branch
|
||||||
* the branch
|
* the branch
|
||||||
|
*
|
||||||
* @return the gh deployment builder
|
* @return the gh deployment builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentBuilder ref(String branch) {
|
public GHDeploymentBuilder ref(String branch) {
|
||||||
@@ -52,6 +58,7 @@ public class GHDeploymentBuilder {
|
|||||||
*
|
*
|
||||||
* @param task
|
* @param task
|
||||||
* the task
|
* the task
|
||||||
|
*
|
||||||
* @return the gh deployment builder
|
* @return the gh deployment builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentBuilder task(String task) {
|
public GHDeploymentBuilder task(String task) {
|
||||||
@@ -64,6 +71,7 @@ public class GHDeploymentBuilder {
|
|||||||
*
|
*
|
||||||
* @param autoMerge
|
* @param autoMerge
|
||||||
* the auto merge
|
* the auto merge
|
||||||
|
*
|
||||||
* @return the gh deployment builder
|
* @return the gh deployment builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentBuilder autoMerge(boolean autoMerge) {
|
public GHDeploymentBuilder autoMerge(boolean autoMerge) {
|
||||||
@@ -76,6 +84,7 @@ public class GHDeploymentBuilder {
|
|||||||
*
|
*
|
||||||
* @param requiredContexts
|
* @param requiredContexts
|
||||||
* the required contexts
|
* the required contexts
|
||||||
|
*
|
||||||
* @return the gh deployment builder
|
* @return the gh deployment builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentBuilder requiredContexts(List<String> requiredContexts) {
|
public GHDeploymentBuilder requiredContexts(List<String> requiredContexts) {
|
||||||
@@ -88,6 +97,7 @@ public class GHDeploymentBuilder {
|
|||||||
*
|
*
|
||||||
* @param payload
|
* @param payload
|
||||||
* the payload
|
* the payload
|
||||||
|
*
|
||||||
* @return the gh deployment builder
|
* @return the gh deployment builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentBuilder payload(String payload) {
|
public GHDeploymentBuilder payload(String payload) {
|
||||||
@@ -100,6 +110,7 @@ public class GHDeploymentBuilder {
|
|||||||
*
|
*
|
||||||
* @param environment
|
* @param environment
|
||||||
* the environment
|
* the environment
|
||||||
|
*
|
||||||
* @return the gh deployment builder
|
* @return the gh deployment builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentBuilder environment(String environment) {
|
public GHDeploymentBuilder environment(String environment) {
|
||||||
@@ -107,11 +118,47 @@ public class GHDeploymentBuilder {
|
|||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Specifies if the given environment is specific to the deployment and will no longer exist at some point in the
|
||||||
|
* future.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @param transientEnvironment
|
||||||
|
* the environment is transient
|
||||||
|
*
|
||||||
|
* @return the gh deployment builder
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
public GHDeploymentBuilder transientEnvironment(boolean transientEnvironment) {
|
||||||
|
builder.with("transient_environment", transientEnvironment);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Specifies if the given environment is one that end-users directly interact with.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @param productionEnvironment
|
||||||
|
* the environment is used by end-users directly
|
||||||
|
*
|
||||||
|
* @return the gh deployment builder
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
public GHDeploymentBuilder productionEnvironment(boolean productionEnvironment) {
|
||||||
|
builder.with("production_environment", productionEnvironment);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Description gh deployment builder.
|
* Description gh deployment builder.
|
||||||
*
|
*
|
||||||
* @param description
|
* @param description
|
||||||
* the description
|
* the description
|
||||||
|
*
|
||||||
* @return the gh deployment builder
|
* @return the gh deployment builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentBuilder description(String description) {
|
public GHDeploymentBuilder description(String description) {
|
||||||
@@ -123,6 +170,7 @@ public class GHDeploymentBuilder {
|
|||||||
* Create gh deployment.
|
* Create gh deployment.
|
||||||
*
|
*
|
||||||
* @return the gh deployment
|
* @return the gh deployment
|
||||||
|
*
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
|
|||||||
@@ -1,8 +1,40 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Represents the state of deployment
|
* Represents the state of deployment
|
||||||
*/
|
*/
|
||||||
public enum GHDeploymentState {
|
public enum GHDeploymentState {
|
||||||
PENDING, SUCCESS, ERROR, FAILURE
|
PENDING,
|
||||||
|
SUCCESS,
|
||||||
|
ERROR,
|
||||||
|
FAILURE,
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The state of the deployment currently reflects it's in progress.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.FLASH)
|
||||||
|
IN_PROGRESS,
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The state of the deployment currently reflects it's queued up for processing.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.FLASH)
|
||||||
|
QUEUED,
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The state of the deployment currently reflects it's no longer active.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
INACTIVE
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -1,5 +1,7 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
import java.util.Locale;
|
import java.util.Locale;
|
||||||
|
|
||||||
@@ -8,19 +10,21 @@ import java.util.Locale;
|
|||||||
*/
|
*/
|
||||||
public class GHDeploymentStatus extends GHObject {
|
public class GHDeploymentStatus extends GHObject {
|
||||||
private GHRepository owner;
|
private GHRepository owner;
|
||||||
private GitHub root;
|
|
||||||
protected GHUser creator;
|
protected GHUser creator;
|
||||||
protected String state;
|
protected String state;
|
||||||
protected String description;
|
protected String description;
|
||||||
protected String target_url;
|
protected String target_url;
|
||||||
|
protected String log_url;
|
||||||
protected String deployment_url;
|
protected String deployment_url;
|
||||||
protected String repository_url;
|
protected String repository_url;
|
||||||
|
protected String environment_url;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Wrap gh deployment status.
|
* Wrap gh deployment status.
|
||||||
*
|
*
|
||||||
* @param owner
|
* @param owner
|
||||||
* the owner
|
* the owner
|
||||||
|
*
|
||||||
* @return the gh deployment status
|
* @return the gh deployment status
|
||||||
*/
|
*/
|
||||||
public GHDeploymentStatus wrap(GHRepository owner) {
|
public GHDeploymentStatus wrap(GHRepository owner) {
|
||||||
@@ -34,12 +38,30 @@ public class GHDeploymentStatus extends GHObject {
|
|||||||
/**
|
/**
|
||||||
* Gets target url.
|
* Gets target url.
|
||||||
*
|
*
|
||||||
|
* @deprecated Target url is deprecated in favor of {@link #getLogUrl() getLogUrl}
|
||||||
|
*
|
||||||
* @return the target url
|
* @return the target url
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public URL getTargetUrl() {
|
public URL getTargetUrl() {
|
||||||
return GitHubClient.parseURL(target_url);
|
return GitHubClient.parseURL(target_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets target url.
|
||||||
|
* <p>
|
||||||
|
* This method replaces {@link #getTargetUrl() getTargetUrl}}.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @return the target url
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
public URL getLogUrl() {
|
||||||
|
return GitHubClient.parseURL(log_url);
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets deployment url.
|
* Gets deployment url.
|
||||||
*
|
*
|
||||||
@@ -49,6 +71,19 @@ public class GHDeploymentStatus extends GHObject {
|
|||||||
return GitHubClient.parseURL(deployment_url);
|
return GitHubClient.parseURL(deployment_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets deployment environment url.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @return the deployment environment url
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
public URL getEnvironmentUrl() {
|
||||||
|
return GitHubClient.parseURL(environment_url);
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets repository url.
|
* Gets repository url.
|
||||||
*
|
*
|
||||||
|
|||||||
@@ -1,5 +1,7 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -21,6 +23,7 @@ public class GHDeploymentStatusBuilder {
|
|||||||
* the deployment id
|
* the deployment id
|
||||||
* @param state
|
* @param state
|
||||||
* the state
|
* the state
|
||||||
|
*
|
||||||
* @deprecated Use {@link GHDeployment#createStatus(GHDeploymentState)}
|
* @deprecated Use {@link GHDeployment#createStatus(GHDeploymentState)}
|
||||||
*/
|
*/
|
||||||
@Deprecated
|
@Deprecated
|
||||||
@@ -31,15 +34,38 @@ public class GHDeploymentStatusBuilder {
|
|||||||
GHDeploymentStatusBuilder(GHRepository repo, long deploymentId, GHDeploymentState state) {
|
GHDeploymentStatusBuilder(GHRepository repo, long deploymentId, GHDeploymentState state) {
|
||||||
this.repo = repo;
|
this.repo = repo;
|
||||||
this.deploymentId = deploymentId;
|
this.deploymentId = deploymentId;
|
||||||
this.builder = repo.root.createRequest().method("POST");
|
this.builder = repo.root.createRequest()
|
||||||
|
.withPreview(Previews.ANT_MAN)
|
||||||
|
.withPreview(Previews.FLASH)
|
||||||
|
.method("POST");
|
||||||
|
|
||||||
this.builder.with("state", state);
|
this.builder.with("state", state);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Add an inactive status to all prior non-transient, non-production environment deployments with the same
|
||||||
|
* repository and environment name as the created status's deployment.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @param autoInactive
|
||||||
|
* Add inactive status flag
|
||||||
|
*
|
||||||
|
* @return the gh deployment status builder
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview({ Previews.ANT_MAN, Previews.FLASH })
|
||||||
|
public GHDeploymentStatusBuilder autoInactive(boolean autoInactive) {
|
||||||
|
this.builder.with("auto_inactive", autoInactive);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Description gh deployment status builder.
|
* Description gh deployment status builder.
|
||||||
*
|
*
|
||||||
* @param description
|
* @param description
|
||||||
* the description
|
* the description
|
||||||
|
*
|
||||||
* @return the gh deployment status builder
|
* @return the gh deployment status builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentStatusBuilder description(String description) {
|
public GHDeploymentStatusBuilder description(String description) {
|
||||||
@@ -47,13 +73,70 @@ public class GHDeploymentStatusBuilder {
|
|||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Name for the target deployment environment, which can be changed when setting a deploy status.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @param environment
|
||||||
|
* the environment name
|
||||||
|
*
|
||||||
|
* @return the gh deployment status builder
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.FLASH)
|
||||||
|
public GHDeploymentStatusBuilder environment(String environment) {
|
||||||
|
this.builder.with("environment", environment);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The URL for accessing the environment
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @param environmentUrl
|
||||||
|
* the environment url
|
||||||
|
*
|
||||||
|
* @return the gh deployment status builder
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
public GHDeploymentStatusBuilder environmentUrl(String environmentUrl) {
|
||||||
|
this.builder.with("environment_url", environmentUrl);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The full URL of the deployment's output.
|
||||||
|
* <p>
|
||||||
|
* This method replaces {@link #targetUrl(String) targetUrl}.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @param logUrl
|
||||||
|
* the deployment output url
|
||||||
|
*
|
||||||
|
* @return the gh deployment status builder
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
public GHDeploymentStatusBuilder logUrl(String logUrl) {
|
||||||
|
this.builder.with("log_url", logUrl);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Target url gh deployment status builder.
|
* Target url gh deployment status builder.
|
||||||
*
|
*
|
||||||
|
* @deprecated Target url is deprecated in favor of {@link #logUrl(String) logUrl}
|
||||||
|
*
|
||||||
* @param targetUrl
|
* @param targetUrl
|
||||||
* the target url
|
* the target url
|
||||||
|
*
|
||||||
* @return the gh deployment status builder
|
* @return the gh deployment status builder
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public GHDeploymentStatusBuilder targetUrl(String targetUrl) {
|
public GHDeploymentStatusBuilder targetUrl(String targetUrl) {
|
||||||
this.builder.with("target_url", targetUrl);
|
this.builder.with("target_url", targetUrl);
|
||||||
return this;
|
return this;
|
||||||
@@ -63,6 +146,7 @@ public class GHDeploymentStatusBuilder {
|
|||||||
* Create gh deployment status.
|
* Create gh deployment status.
|
||||||
*
|
*
|
||||||
* @return the gh deployment status
|
* @return the gh deployment status
|
||||||
|
*
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
|
|||||||
230
src/main/java/org/kohsuke/github/GHDiscussion.java
Normal file
230
src/main/java/org/kohsuke/github/GHDiscussion.java
Normal file
@@ -0,0 +1,230 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
|
import java.io.IOException;
|
||||||
|
import java.net.URL;
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
|
import javax.annotation.CheckForNull;
|
||||||
|
import javax.annotation.Nonnull;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A discussion in GitHub Team.
|
||||||
|
*
|
||||||
|
* @author Charles Moulliard
|
||||||
|
* @see <a href="https://developer.github.com/v3/teams/discussions">GitHub Team Discussions</a>
|
||||||
|
*/
|
||||||
|
public class GHDiscussion extends GHObject {
|
||||||
|
|
||||||
|
private GHTeam team;
|
||||||
|
private long number;
|
||||||
|
private String body, title, htmlUrl;
|
||||||
|
|
||||||
|
@JsonProperty(value = "private")
|
||||||
|
private boolean isPrivate;
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public URL getHtmlUrl() throws IOException {
|
||||||
|
return GitHubClient.parseURL(htmlUrl);
|
||||||
|
}
|
||||||
|
|
||||||
|
GHDiscussion wrapUp(GHTeam team) {
|
||||||
|
this.team = team;
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get the team to which this discussion belongs.
|
||||||
|
*
|
||||||
|
* @return the team for this discussion
|
||||||
|
*/
|
||||||
|
@Nonnull
|
||||||
|
public GHTeam getTeam() {
|
||||||
|
return team;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get the title of the discussion.
|
||||||
|
*
|
||||||
|
* @return the title
|
||||||
|
*/
|
||||||
|
public String getTitle() {
|
||||||
|
return title;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The description of this discussion.
|
||||||
|
*
|
||||||
|
* @return the body
|
||||||
|
*/
|
||||||
|
public String getBody() {
|
||||||
|
return body;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The number of this discussion.
|
||||||
|
*
|
||||||
|
* @return the number
|
||||||
|
*/
|
||||||
|
public long getNumber() {
|
||||||
|
return number;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The id number of this discussion. GitHub discussions have "number" instead of "id". This is provided for
|
||||||
|
* convenience.
|
||||||
|
*
|
||||||
|
* @return the id number for this discussion
|
||||||
|
* @see #getNumber()
|
||||||
|
*/
|
||||||
|
@Override
|
||||||
|
public long getId() {
|
||||||
|
return getNumber();
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Whether the discussion is private to the team.
|
||||||
|
*
|
||||||
|
* @return {@code true} if discussion is private.
|
||||||
|
*/
|
||||||
|
public boolean isPrivate() {
|
||||||
|
return isPrivate;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Begins the creation of a new instance.
|
||||||
|
*
|
||||||
|
* Consumer must call {@link GHDiscussion.Creator#done()} to commit changes.
|
||||||
|
*
|
||||||
|
* @param team
|
||||||
|
* the team in which the discussion will be created.
|
||||||
|
* @return a {@link GHLabel.Creator}
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
static GHDiscussion.Creator create(GHTeam team) throws IOException {
|
||||||
|
return new GHDiscussion.Creator(team);
|
||||||
|
}
|
||||||
|
|
||||||
|
static GHDiscussion read(GHTeam team, long discussionNumber) throws IOException {
|
||||||
|
return team.root.createRequest()
|
||||||
|
.setRawUrlPath(getRawUrlPath(team, discussionNumber))
|
||||||
|
.fetch(GHDiscussion.class)
|
||||||
|
.wrapUp(team);
|
||||||
|
}
|
||||||
|
|
||||||
|
static PagedIterable<GHDiscussion> readAll(GHTeam team) throws IOException {
|
||||||
|
return team.root.createRequest()
|
||||||
|
.setRawUrlPath(getRawUrlPath(team, null))
|
||||||
|
.toIterable(GHDiscussion[].class, item -> item.wrapUp(team));
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Begins a batch update
|
||||||
|
*
|
||||||
|
* Consumer must call {@link GHDiscussion.Updater#done()} to commit changes.
|
||||||
|
*
|
||||||
|
* @return a {@link GHDiscussion.Updater}
|
||||||
|
*/
|
||||||
|
@Preview(Previews.SQUIRREL_GIRL)
|
||||||
|
@Deprecated
|
||||||
|
public GHDiscussion.Updater update() {
|
||||||
|
return new GHDiscussion.Updater(this);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Begins a single property update.
|
||||||
|
*
|
||||||
|
* @return a {@link GHDiscussion.Setter}
|
||||||
|
*/
|
||||||
|
@Preview(Previews.SQUIRREL_GIRL)
|
||||||
|
@Deprecated
|
||||||
|
public GHDiscussion.Setter set() {
|
||||||
|
return new GHDiscussion.Setter(this);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Delete the discussion
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public void delete() throws IOException {
|
||||||
|
team.root.createRequest().method("DELETE").setRawUrlPath(getRawUrlPath(team, number)).send();
|
||||||
|
}
|
||||||
|
|
||||||
|
private static String getRawUrlPath(@Nonnull GHTeam team, @CheckForNull Long discussionNumber) {
|
||||||
|
return team.getUrl().toString() + "/discussions" + (discussionNumber == null ? "" : "/" + discussionNumber);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A {@link GHLabelBuilder} that updates a single property per request
|
||||||
|
*
|
||||||
|
* {@link #done()} is called automatically after the property is set.
|
||||||
|
*/
|
||||||
|
public static class Setter extends GHDiscussionBuilder<GHDiscussion> {
|
||||||
|
private Setter(@Nonnull GHDiscussion base) {
|
||||||
|
super(GHDiscussion.class, base.team, base);
|
||||||
|
requester.method("PATCH").setRawUrlPath(base.getUrl().toString());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A {@link GHLabelBuilder} that allows multiple properties to be updated per request.
|
||||||
|
*
|
||||||
|
* Consumer must call {@link #done()} to commit changes.
|
||||||
|
*/
|
||||||
|
public static class Updater extends GHDiscussionBuilder<Updater> {
|
||||||
|
private Updater(@Nonnull GHDiscussion base) {
|
||||||
|
super(GHDiscussion.Updater.class, base.team, base);
|
||||||
|
requester.method("PATCH").setRawUrlPath(base.getUrl().toString());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A {@link GHLabelBuilder} that creates a new {@link GHLabel}
|
||||||
|
*
|
||||||
|
* Consumer must call {@link #done()} to create the new instance.
|
||||||
|
*/
|
||||||
|
public static class Creator extends GHDiscussionBuilder<Creator> {
|
||||||
|
|
||||||
|
private Creator(@Nonnull GHTeam team) {
|
||||||
|
super(GHDiscussion.Creator.class, team, null);
|
||||||
|
requester.method("POST").setRawUrlPath(getRawUrlPath(team, null));
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Sets whether this discussion is private to this team.
|
||||||
|
*
|
||||||
|
* @param value
|
||||||
|
* privacy of this discussion
|
||||||
|
* @return either a continuing builder or an updated {@link GHDiscussion}
|
||||||
|
* @throws IOException
|
||||||
|
* if there is an I/O Exception
|
||||||
|
*/
|
||||||
|
@Nonnull
|
||||||
|
public Creator private_(boolean value) throws IOException {
|
||||||
|
return with("private", value);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean equals(Object o) {
|
||||||
|
if (this == o) {
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
if (o == null || getClass() != o.getClass()) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
GHDiscussion that = (GHDiscussion) o;
|
||||||
|
return number == that.number && Objects.equals(getUrl(), that.getUrl()) && Objects.equals(team, that.team)
|
||||||
|
&& Objects.equals(body, that.body) && Objects.equals(title, that.title);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int hashCode() {
|
||||||
|
return Objects.hash(team, number, body, title);
|
||||||
|
}
|
||||||
|
}
|
||||||
80
src/main/java/org/kohsuke/github/GHDiscussionBuilder.java
Normal file
80
src/main/java/org/kohsuke/github/GHDiscussionBuilder.java
Normal file
@@ -0,0 +1,80 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import java.io.IOException;
|
||||||
|
|
||||||
|
import javax.annotation.CheckForNull;
|
||||||
|
import javax.annotation.Nonnull;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Base class for creating or updating a discussion.
|
||||||
|
*
|
||||||
|
* @param <S>
|
||||||
|
* Intermediate return type for this builder returned by calls to {@link #with(String, Object)}. If {@link S}
|
||||||
|
* the same as {@link GHLabel}, this builder will commit changes after each call to
|
||||||
|
* {@link #with(String, Object)}.
|
||||||
|
*/
|
||||||
|
class GHDiscussionBuilder<S> extends AbstractBuilder<GHDiscussion, S> {
|
||||||
|
|
||||||
|
private final GHTeam team;
|
||||||
|
|
||||||
|
/**
|
||||||
|
*
|
||||||
|
* @param intermediateReturnType
|
||||||
|
* Intermediate return type for this builder returned by calls to {@link #with(String, Object)}. If
|
||||||
|
* {@link S} the same as {@link GHDiscussion}, this builder will commit changes after each call to
|
||||||
|
* {@link #with(String, Object)}.
|
||||||
|
* @param team
|
||||||
|
* the GitHub team. Updates will be sent to the root of this team.
|
||||||
|
* @param baseInstance
|
||||||
|
* instance on which to base this builder. If {@code null} a new instance will be created.
|
||||||
|
*/
|
||||||
|
protected GHDiscussionBuilder(@Nonnull Class<S> intermediateReturnType,
|
||||||
|
@Nonnull GHTeam team,
|
||||||
|
@CheckForNull GHDiscussion baseInstance) {
|
||||||
|
super(GHDiscussion.class, intermediateReturnType, team.root, baseInstance);
|
||||||
|
|
||||||
|
this.team = team;
|
||||||
|
|
||||||
|
if (baseInstance != null) {
|
||||||
|
requester.with("title", baseInstance.getTitle());
|
||||||
|
requester.with("body", baseInstance.getBody());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Title for this discussion.
|
||||||
|
*
|
||||||
|
* @param value
|
||||||
|
* title of discussion
|
||||||
|
* @return either a continuing builder or an updated {@link GHDiscussion}
|
||||||
|
* @throws IOException
|
||||||
|
* if there is an I/O Exception
|
||||||
|
*/
|
||||||
|
@Nonnull
|
||||||
|
public S title(String value) throws IOException {
|
||||||
|
return with("title", value);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Body content for this discussion.
|
||||||
|
*
|
||||||
|
* @param value
|
||||||
|
* body of discussion*
|
||||||
|
* @return either a continuing builder or an updated {@link GHDiscussion}
|
||||||
|
* @throws IOException
|
||||||
|
* if there is an I/O Exception
|
||||||
|
*/
|
||||||
|
@Nonnull
|
||||||
|
public S body(String value) throws IOException {
|
||||||
|
return with("body", value);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* {@inheritDoc}
|
||||||
|
*/
|
||||||
|
@Nonnull
|
||||||
|
@Override
|
||||||
|
public GHDiscussion done() throws IOException {
|
||||||
|
return super.done().wrapUp(team);
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -12,6 +12,7 @@ import java.util.Locale;
|
|||||||
public enum GHEvent {
|
public enum GHEvent {
|
||||||
CHECK_RUN,
|
CHECK_RUN,
|
||||||
CHECK_SUITE,
|
CHECK_SUITE,
|
||||||
|
CODE_SCANNING_ALERT,
|
||||||
COMMIT_COMMENT,
|
COMMIT_COMMENT,
|
||||||
CONTENT_REFERENCE,
|
CONTENT_REFERENCE,
|
||||||
CREATE,
|
CREATE,
|
||||||
@@ -19,6 +20,8 @@ public enum GHEvent {
|
|||||||
DEPLOY_KEY,
|
DEPLOY_KEY,
|
||||||
DEPLOYMENT,
|
DEPLOYMENT,
|
||||||
DEPLOYMENT_STATUS,
|
DEPLOYMENT_STATUS,
|
||||||
|
DISCUSSION,
|
||||||
|
DISCUSSION_COMMENT,
|
||||||
DOWNLOAD,
|
DOWNLOAD,
|
||||||
FOLLOW,
|
FOLLOW,
|
||||||
FORK,
|
FORK,
|
||||||
@@ -56,12 +59,20 @@ public enum GHEvent {
|
|||||||
REPOSITORY,
|
REPOSITORY,
|
||||||
REPOSITORY_IMPORT,
|
REPOSITORY_IMPORT,
|
||||||
REPOSITORY_VULNERABILITY_ALERT,
|
REPOSITORY_VULNERABILITY_ALERT,
|
||||||
|
SCHEDULE,
|
||||||
SECURITY_ADVISORY,
|
SECURITY_ADVISORY,
|
||||||
STAR,
|
STAR,
|
||||||
STATUS,
|
STATUS,
|
||||||
TEAM,
|
TEAM,
|
||||||
TEAM_ADD,
|
TEAM_ADD,
|
||||||
WATCH,
|
WATCH,
|
||||||
|
WORKFLOW_DISPATCH,
|
||||||
|
WORKFLOW_RUN,
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Special event type that means we haven't found an enum value corresponding to the event.
|
||||||
|
*/
|
||||||
|
UNKNOWN,
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Special event type that means "every possible event"
|
* Special event type that means "every possible event"
|
||||||
|
|||||||
@@ -4,7 +4,7 @@ import com.fasterxml.jackson.databind.node.ObjectNode;
|
|||||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.util.Date;
|
import java.util.*;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Represents an event.
|
* Represents an event.
|
||||||
@@ -12,14 +12,22 @@ import java.util.Date;
|
|||||||
* @author Kohsuke Kawaguchi
|
* @author Kohsuke Kawaguchi
|
||||||
*/
|
*/
|
||||||
@SuppressFBWarnings(value = "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", justification = "JSON API")
|
@SuppressFBWarnings(value = "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", justification = "JSON API")
|
||||||
public class GHEventInfo {
|
public class GHEventInfo extends GitHubInteractiveObject {
|
||||||
private GitHub root;
|
|
||||||
|
|
||||||
// we don't want to expose Jackson dependency to the user. This needs databinding
|
// we don't want to expose Jackson dependency to the user. This needs databinding
|
||||||
private ObjectNode payload;
|
private ObjectNode payload;
|
||||||
|
|
||||||
private long id;
|
private long id;
|
||||||
private String created_at;
|
private String created_at;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Representation of GitHub Event API Event Type.
|
||||||
|
*
|
||||||
|
* This is not the same as the values used for hook methods such as
|
||||||
|
* {@link GHRepository#createHook(String, Map, Collection, boolean)}.
|
||||||
|
*
|
||||||
|
* @see <a href="https://docs.github.com/en/developers/webhooks-and-events/github-event-types">GitHub event
|
||||||
|
* types</a>
|
||||||
|
*/
|
||||||
private String type;
|
private String type;
|
||||||
|
|
||||||
// these are all shallow objects
|
// these are all shallow objects
|
||||||
@@ -42,20 +50,45 @@ public class GHEventInfo {
|
|||||||
private String name; // owner/repo
|
private String name; // owner/repo
|
||||||
}
|
}
|
||||||
|
|
||||||
|
static final Map<String, GHEvent> mapTypeStringToEvent = createEventMap();
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Map for GitHub Event API Event Type to GHEvent.
|
||||||
|
*
|
||||||
|
* @see <a href="https://docs.github.com/en/developers/webhooks-and-events/github-event-types">GitHub event
|
||||||
|
* types</a>
|
||||||
|
*/
|
||||||
|
private static Map<String, GHEvent> createEventMap() {
|
||||||
|
HashMap<String, GHEvent> map = new HashMap<>();
|
||||||
|
map.put("CommitCommentEvent", GHEvent.COMMIT_COMMENT);
|
||||||
|
map.put("CreateEvent", GHEvent.CREATE);
|
||||||
|
map.put("DeleteEvent", GHEvent.DELETE);
|
||||||
|
map.put("ForkEvent", GHEvent.FORK);
|
||||||
|
map.put("GollumEvent", GHEvent.GOLLUM);
|
||||||
|
map.put("IssueCommentEvent", GHEvent.ISSUE_COMMENT);
|
||||||
|
map.put("IssuesEvent", GHEvent.ISSUES);
|
||||||
|
map.put("MemberEvent", GHEvent.MEMBER);
|
||||||
|
map.put("PublicEvent", GHEvent.PUBLIC);
|
||||||
|
map.put("PullRequestEvent", GHEvent.PULL_REQUEST);
|
||||||
|
map.put("PullRequestReviewEvent", GHEvent.PULL_REQUEST_REVIEW);
|
||||||
|
map.put("PullRequestReviewCommentEvent", GHEvent.PULL_REQUEST_REVIEW_COMMENT);
|
||||||
|
map.put("PushEvent", GHEvent.PUSH);
|
||||||
|
map.put("ReleaseEvent", GHEvent.RELEASE);
|
||||||
|
map.put("WatchEvent", GHEvent.WATCH);
|
||||||
|
return Collections.unmodifiableMap(map);
|
||||||
|
}
|
||||||
|
|
||||||
|
static GHEvent transformTypeToGHEvent(String type) {
|
||||||
|
return mapTypeStringToEvent.getOrDefault(type, GHEvent.UNKNOWN);
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets type.
|
* Gets type.
|
||||||
*
|
*
|
||||||
* @return the type
|
* @return the type
|
||||||
*/
|
*/
|
||||||
public GHEvent getType() {
|
public GHEvent getType() {
|
||||||
String t = type;
|
return transformTypeToGHEvent(type);
|
||||||
if (t.endsWith("Event"))
|
|
||||||
t = t.substring(0, t.length() - 5);
|
|
||||||
for (GHEvent e : GHEvent.values()) {
|
|
||||||
if (e.name().replace("_", "").equalsIgnoreCase(t))
|
|
||||||
return e;
|
|
||||||
}
|
|
||||||
return null; // unknown event type
|
|
||||||
}
|
}
|
||||||
|
|
||||||
GHEventInfo wrapUp(GitHub root) {
|
GHEventInfo wrapUp(GitHub root) {
|
||||||
|
|||||||
File diff suppressed because it is too large
Load Diff
@@ -23,7 +23,6 @@ import java.util.Map.Entry;
|
|||||||
public class GHGist extends GHObject {
|
public class GHGist extends GHObject {
|
||||||
|
|
||||||
final GHUser owner;
|
final GHUser owner;
|
||||||
final GitHub root;
|
|
||||||
|
|
||||||
private String forks_url, commits_url, id, git_pull_url, git_push_url, html_url;
|
private String forks_url, commits_url, id, git_pull_url, git_push_url, html_url;
|
||||||
|
|
||||||
@@ -50,6 +49,30 @@ public class GHGist extends GHObject {
|
|||||||
this.owner = root.getUser(owner);
|
this.owner = root.getUser(owner);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Unlike most other GitHub objects, the id for Gists can be non-numeric, such as "aa5a315d61ae9438b18d". If the id
|
||||||
|
* is numeric, this method will get it. If id is not numeric, this will throw a runtime
|
||||||
|
* {@link NumberFormatException}.
|
||||||
|
*
|
||||||
|
* @return id of the Gist.
|
||||||
|
* @deprecated Use {@link #getGistId()} instead.
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Override
|
||||||
|
public long getId() {
|
||||||
|
return Long.parseLong(getGistId());
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the id for this Gist. Unlike most other GitHub objects, the id for Gists can be non-numeric, such as
|
||||||
|
* "aa5a315d61ae9438b18d". This should be used instead of {@link #getId()}.
|
||||||
|
*
|
||||||
|
* @return id of this Gist
|
||||||
|
*/
|
||||||
|
public String getGistId() {
|
||||||
|
return this.id;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets owner.
|
* Gets owner.
|
||||||
*
|
*
|
||||||
@@ -97,6 +120,11 @@ public class GHGist extends GHObject {
|
|||||||
return git_push_url;
|
return git_push_url;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get the html url.
|
||||||
|
*
|
||||||
|
* @return the github html url
|
||||||
|
*/
|
||||||
public URL getHtmlUrl() {
|
public URL getHtmlUrl() {
|
||||||
return GitHubClient.parseURL(html_url);
|
return GitHubClient.parseURL(html_url);
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -4,6 +4,8 @@ import java.io.IOException;
|
|||||||
import java.util.Collections;
|
import java.util.Collections;
|
||||||
import java.util.LinkedHashMap;
|
import java.util.LinkedHashMap;
|
||||||
|
|
||||||
|
import javax.annotation.Nonnull;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Builder pattern for creating a new Gist.
|
* Builder pattern for creating a new Gist.
|
||||||
*
|
*
|
||||||
@@ -11,7 +13,6 @@ import java.util.LinkedHashMap;
|
|||||||
* @see GitHub#createGist() GitHub#createGist()
|
* @see GitHub#createGist() GitHub#createGist()
|
||||||
*/
|
*/
|
||||||
public class GHGistBuilder {
|
public class GHGistBuilder {
|
||||||
private final GitHub root;
|
|
||||||
private final Requester req;
|
private final Requester req;
|
||||||
private final LinkedHashMap<String, Object> files = new LinkedHashMap<String, Object>();
|
private final LinkedHashMap<String, Object> files = new LinkedHashMap<String, Object>();
|
||||||
|
|
||||||
@@ -22,7 +23,6 @@ public class GHGistBuilder {
|
|||||||
* the root
|
* the root
|
||||||
*/
|
*/
|
||||||
public GHGistBuilder(GitHub root) {
|
public GHGistBuilder(GitHub root) {
|
||||||
this.root = root;
|
|
||||||
req = root.createRequest().method("POST");
|
req = root.createRequest().method("POST");
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -59,7 +59,7 @@ public class GHGistBuilder {
|
|||||||
* the content
|
* the content
|
||||||
* @return Adds a new file.
|
* @return Adds a new file.
|
||||||
*/
|
*/
|
||||||
public GHGistBuilder file(String fileName, String content) {
|
public GHGistBuilder file(@Nonnull String fileName, @Nonnull String content) {
|
||||||
files.put(fileName, Collections.singletonMap("content", content));
|
files.put(fileName, Collections.singletonMap("content", content));
|
||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -1,8 +1,11 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.util.Collections;
|
import java.util.HashMap;
|
||||||
import java.util.LinkedHashMap;
|
import java.util.LinkedHashMap;
|
||||||
|
import java.util.Map;
|
||||||
|
|
||||||
|
import javax.annotation.Nonnull;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Builder pattern for updating a Gist.
|
* Builder pattern for updating a Gist.
|
||||||
@@ -12,7 +15,7 @@ import java.util.LinkedHashMap;
|
|||||||
public class GHGistUpdater {
|
public class GHGistUpdater {
|
||||||
private final GHGist base;
|
private final GHGist base;
|
||||||
private final Requester builder;
|
private final Requester builder;
|
||||||
LinkedHashMap<String, Object> files;
|
LinkedHashMap<String, Map<String, String>> files;
|
||||||
|
|
||||||
GHGistUpdater(GHGist base) {
|
GHGistUpdater(GHGist base) {
|
||||||
this.base = base;
|
this.base = base;
|
||||||
@@ -32,16 +35,15 @@ public class GHGistUpdater {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public GHGistUpdater addFile(String fileName, String content) throws IOException {
|
public GHGistUpdater addFile(@Nonnull String fileName, @Nonnull String content) throws IOException {
|
||||||
updateFile(fileName, content);
|
updateFile(fileName, content);
|
||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
// // This method does not work.
|
public GHGistUpdater deleteFile(@Nonnull String fileName) throws IOException {
|
||||||
// public GHGistUpdater deleteFile(String fileName) throws IOException {
|
files.put(fileName, null);
|
||||||
// files.put(fileName, Collections.singletonMap("filename", null));
|
return this;
|
||||||
// return this;
|
}
|
||||||
// }
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Rename file gh gist updater.
|
* Rename file gh gist updater.
|
||||||
@@ -54,8 +56,9 @@ public class GHGistUpdater {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public GHGistUpdater renameFile(String fileName, String newFileName) throws IOException {
|
public GHGistUpdater renameFile(@Nonnull String fileName, @Nonnull String newFileName) throws IOException {
|
||||||
files.put(fileName, Collections.singletonMap("filename", newFileName));
|
Map<String, String> file = files.computeIfAbsent(fileName, d -> new HashMap<>());
|
||||||
|
file.put("filename", newFileName);
|
||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -70,8 +73,31 @@ public class GHGistUpdater {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public GHGistUpdater updateFile(String fileName, String content) throws IOException {
|
public GHGistUpdater updateFile(@Nonnull String fileName, @Nonnull String content) throws IOException {
|
||||||
files.put(fileName, Collections.singletonMap("content", content));
|
Map<String, String> file = files.computeIfAbsent(fileName, d -> new HashMap<>());
|
||||||
|
file.put("content", content);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Update file name and content
|
||||||
|
*
|
||||||
|
* @param fileName
|
||||||
|
* the file name
|
||||||
|
* @param newFileName
|
||||||
|
* the new file name
|
||||||
|
* @param content
|
||||||
|
* the content
|
||||||
|
* @return the gh gist updater
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public GHGistUpdater updateFile(@Nonnull String fileName, @Nonnull String newFileName, @Nonnull String content)
|
||||||
|
throws IOException {
|
||||||
|
Map<String, String> file = files.computeIfAbsent(fileName, d -> new HashMap<>());
|
||||||
|
file.put("content", content);
|
||||||
|
file.put("filename", newFileName);
|
||||||
|
files.put(fileName, file);
|
||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
@@ -1,13 +1,13 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
|
import org.kohsuke.github.internal.EnumUtils;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
import java.util.Collections;
|
import java.util.Collections;
|
||||||
import java.util.EnumSet;
|
import java.util.EnumSet;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
import java.util.Locale;
|
|
||||||
import java.util.Map;
|
import java.util.Map;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -40,10 +40,7 @@ public abstract class GHHook extends GHObject {
|
|||||||
public EnumSet<GHEvent> getEvents() {
|
public EnumSet<GHEvent> getEvents() {
|
||||||
EnumSet<GHEvent> s = EnumSet.noneOf(GHEvent.class);
|
EnumSet<GHEvent> s = EnumSet.noneOf(GHEvent.class);
|
||||||
for (String e : events) {
|
for (String e : events) {
|
||||||
if (e.equals("*"))
|
s.add(e.equals("*") ? GHEvent.ALL : EnumUtils.getEnumOrDefault(GHEvent.class, e, GHEvent.UNKNOWN));
|
||||||
s.add(GHEvent.ALL);
|
|
||||||
else
|
|
||||||
s.add(Enum.valueOf(GHEvent.class, e.toUpperCase(Locale.ENGLISH)));
|
|
||||||
}
|
}
|
||||||
return s;
|
return s;
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -12,8 +12,7 @@ import java.util.Map;
|
|||||||
* functionality
|
* functionality
|
||||||
*/
|
*/
|
||||||
class GHHooks {
|
class GHHooks {
|
||||||
static abstract class Context {
|
static abstract class Context extends GitHubInteractiveObject {
|
||||||
private final GitHub root;
|
|
||||||
|
|
||||||
private Context(GitHub root) {
|
private Context(GitHub root) {
|
||||||
this.root = root;
|
this.root = root;
|
||||||
|
|||||||
@@ -16,7 +16,6 @@ import java.net.URL;
|
|||||||
"UUF_UNUSED_FIELD" },
|
"UUF_UNUSED_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public class GHInvitation extends GHObject {
|
public class GHInvitation extends GHObject {
|
||||||
/* package almost final */ GitHub root;
|
|
||||||
|
|
||||||
private int id;
|
private int id;
|
||||||
private GHRepository repository;
|
private GHRepository repository;
|
||||||
|
|||||||
@@ -37,8 +37,9 @@ import java.util.Collections;
|
|||||||
import java.util.Date;
|
import java.util.Date;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
import java.util.Locale;
|
import java.util.Locale;
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.SQUIRREL_GIRL;
|
import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Represents an issue on GitHub.
|
* Represents an issue on GitHub.
|
||||||
@@ -52,7 +53,6 @@ import static org.kohsuke.github.Previews.SQUIRREL_GIRL;
|
|||||||
public class GHIssue extends GHObject implements Reactable {
|
public class GHIssue extends GHObject implements Reactable {
|
||||||
private static final String ASSIGNEES = "assignees";
|
private static final String ASSIGNEES = "assignees";
|
||||||
|
|
||||||
GitHub root;
|
|
||||||
GHRepository owner;
|
GHRepository owner;
|
||||||
|
|
||||||
// API v3
|
// API v3
|
||||||
@@ -157,10 +157,8 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
* Gets labels.
|
* Gets labels.
|
||||||
*
|
*
|
||||||
* @return the labels
|
* @return the labels
|
||||||
* @throws IOException
|
|
||||||
* the io exception
|
|
||||||
*/
|
*/
|
||||||
public Collection<GHLabel> getLabels() throws IOException {
|
public Collection<GHLabel> getLabels() {
|
||||||
if (labels == null) {
|
if (labels == null) {
|
||||||
return Collections.emptyList();
|
return Collections.emptyList();
|
||||||
}
|
}
|
||||||
@@ -179,10 +177,12 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
/**
|
/**
|
||||||
* Gets api url.
|
* Gets api url.
|
||||||
*
|
*
|
||||||
* @return the api url
|
* @return API URL of this object.
|
||||||
|
* @deprecated use {@link #getUrl()}
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public URL getApiURL() {
|
public URL getApiURL() {
|
||||||
return GitHubClient.parseURL(url);
|
return getUrl();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -236,7 +236,7 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
}
|
}
|
||||||
|
|
||||||
private void editIssue(String key, Object value) throws IOException {
|
private void editIssue(String key, Object value) throws IOException {
|
||||||
root.createRequest().with(key, value).method("PATCH").withUrlPath(getIssuesApiRoute()).send();
|
root.createRequest().withNullable(key, value).method("PATCH").withUrlPath(getIssuesApiRoute()).send();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -293,9 +293,9 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
*/
|
*/
|
||||||
public void setMilestone(GHMilestone milestone) throws IOException {
|
public void setMilestone(GHMilestone milestone) throws IOException {
|
||||||
if (milestone == null) {
|
if (milestone == null) {
|
||||||
editNullable("milestone", null);
|
editIssue("milestone", null);
|
||||||
} else {
|
} else {
|
||||||
edit("milestone", milestone.getNumber());
|
editIssue("milestone", milestone.getNumber());
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -312,7 +312,7 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Sets labels.
|
* Sets labels on the target to a specific list.
|
||||||
*
|
*
|
||||||
* @param labels
|
* @param labels
|
||||||
* the labels
|
* the labels
|
||||||
@@ -326,100 +326,137 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
/**
|
/**
|
||||||
* Adds labels to the issue.
|
* Adds labels to the issue.
|
||||||
*
|
*
|
||||||
|
* Labels that are already present on the target are ignored.
|
||||||
|
*
|
||||||
|
* @return the complete list of labels including the new additions
|
||||||
* @param names
|
* @param names
|
||||||
* Names of the label
|
* Names of the label
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void addLabels(String... names) throws IOException {
|
@WithBridgeMethods(void.class)
|
||||||
_addLabels(Arrays.asList(names));
|
public List<GHLabel> addLabels(String... names) throws IOException {
|
||||||
|
return _addLabels(Arrays.asList(names));
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Add labels.
|
* Add labels.
|
||||||
*
|
*
|
||||||
|
* Labels that are already present on the target are ignored.
|
||||||
|
*
|
||||||
|
* @return the complete list of labels including the new additions
|
||||||
* @param labels
|
* @param labels
|
||||||
* the labels
|
* the labels
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void addLabels(GHLabel... labels) throws IOException {
|
@WithBridgeMethods(void.class)
|
||||||
addLabels(Arrays.asList(labels));
|
public List<GHLabel> addLabels(GHLabel... labels) throws IOException {
|
||||||
|
return addLabels(Arrays.asList(labels));
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Add labels.
|
* Add labels.
|
||||||
*
|
*
|
||||||
|
* Labels that are already present on the target are ignored.
|
||||||
|
*
|
||||||
|
* @return the complete list of labels including the new additions
|
||||||
* @param labels
|
* @param labels
|
||||||
* the labels
|
* the labels
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void addLabels(Collection<GHLabel> labels) throws IOException {
|
@WithBridgeMethods(void.class)
|
||||||
_addLabels(GHLabel.toNames(labels));
|
public List<GHLabel> addLabels(Collection<GHLabel> labels) throws IOException {
|
||||||
|
return _addLabels(GHLabel.toNames(labels));
|
||||||
}
|
}
|
||||||
|
|
||||||
private void _addLabels(Collection<String> names) throws IOException {
|
private List<GHLabel> _addLabels(Collection<String> names) throws IOException {
|
||||||
List<String> newLabels = new ArrayList<String>();
|
return Arrays.asList(root.createRequest()
|
||||||
|
.with("labels", names)
|
||||||
for (GHLabel label : getLabels()) {
|
.method("POST")
|
||||||
newLabels.add(label.getName());
|
.withUrlPath(getIssuesApiRoute() + "/labels")
|
||||||
}
|
.fetch(GHLabel[].class));
|
||||||
for (String name : names) {
|
|
||||||
if (!newLabels.contains(name)) {
|
|
||||||
newLabels.add(name);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
setLabels(newLabels.toArray(new String[0]));
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Remove a given label by name from this issue.
|
* Remove a single label.
|
||||||
*
|
*
|
||||||
|
* Attempting to remove a label that is not present throws {@link GHFileNotFoundException}.
|
||||||
|
*
|
||||||
|
* @return the remaining list of labels
|
||||||
|
* @param name
|
||||||
|
* the name
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception, throws {@link GHFileNotFoundException} if label was not present.
|
||||||
|
*/
|
||||||
|
@WithBridgeMethods(void.class)
|
||||||
|
public List<GHLabel> removeLabel(String name) throws IOException {
|
||||||
|
return Arrays.asList(root.createRequest()
|
||||||
|
.method("DELETE")
|
||||||
|
.withUrlPath(getIssuesApiRoute() + "/labels", name)
|
||||||
|
.fetch(GHLabel[].class));
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Remove a collection of labels.
|
||||||
|
*
|
||||||
|
* Attempting to remove labels that are not present on the target are ignored.
|
||||||
|
*
|
||||||
|
* @return the remaining list of labels
|
||||||
* @param names
|
* @param names
|
||||||
* the names
|
* the names
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void removeLabels(String... names) throws IOException {
|
@WithBridgeMethods(void.class)
|
||||||
_removeLabels(Arrays.asList(names));
|
public List<GHLabel> removeLabels(String... names) throws IOException {
|
||||||
|
return _removeLabels(Arrays.asList(names));
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Remove labels.
|
* Remove a collection of labels.
|
||||||
*
|
*
|
||||||
|
* Attempting to remove labels that are not present on the target are ignored.
|
||||||
|
*
|
||||||
|
* @return the remaining list of labels
|
||||||
* @param labels
|
* @param labels
|
||||||
* the labels
|
* the labels
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
* @see #removeLabels(String...) #removeLabels(String...)
|
* @see #removeLabels(String...) #removeLabels(String...)
|
||||||
*/
|
*/
|
||||||
public void removeLabels(GHLabel... labels) throws IOException {
|
@WithBridgeMethods(void.class)
|
||||||
removeLabels(Arrays.asList(labels));
|
public List<GHLabel> removeLabels(GHLabel... labels) throws IOException {
|
||||||
|
return removeLabels(Arrays.asList(labels));
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Remove labels.
|
* Remove a collection of labels.
|
||||||
*
|
*
|
||||||
|
* Attempting to remove labels that are not present on the target are ignored.
|
||||||
|
*
|
||||||
|
* @return the remaining list of labels
|
||||||
* @param labels
|
* @param labels
|
||||||
* the labels
|
* the labels
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void removeLabels(Collection<GHLabel> labels) throws IOException {
|
@WithBridgeMethods(void.class)
|
||||||
_removeLabels(GHLabel.toNames(labels));
|
public List<GHLabel> removeLabels(Collection<GHLabel> labels) throws IOException {
|
||||||
|
return _removeLabels(GHLabel.toNames(labels));
|
||||||
}
|
}
|
||||||
|
|
||||||
private void _removeLabels(Collection<String> names) throws IOException {
|
private List<GHLabel> _removeLabels(Collection<String> names) throws IOException {
|
||||||
List<String> newLabels = new ArrayList<String>();
|
List<GHLabel> remainingLabels = Collections.emptyList();
|
||||||
|
for (String name : names) {
|
||||||
for (GHLabel l : getLabels()) {
|
try {
|
||||||
if (!names.contains(l.getName())) {
|
remainingLabels = removeLabel(name);
|
||||||
newLabels.add(l.getName());
|
} catch (GHFileNotFoundException e) {
|
||||||
|
// when trying to remove multiple labels, we ignore already removed
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
return remainingLabels;
|
||||||
setLabels(newLabels.toArray(new String[0]));
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -447,7 +484,7 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
.toIterable(GHIssueComment[].class, item -> item.wrapUp(this));
|
.toIterable(GHIssueComment[].class, item -> item.wrapUp(this));
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHReaction createReaction(ReactionContent content) throws IOException {
|
public GHReaction createReaction(ReactionContent content) throws IOException {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
@@ -459,7 +496,7 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
.wrap(root);
|
.wrap(root);
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public PagedIterable<GHReaction> listReactions() {
|
public PagedIterable<GHReaction> listReactions() {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
@@ -570,7 +607,8 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
protected String getIssuesApiRoute() {
|
protected String getIssuesApiRoute() {
|
||||||
if (owner == null) {
|
if (owner == null) {
|
||||||
// Issues returned from search to do not have an owner. Attempt to use url.
|
// Issues returned from search to do not have an owner. Attempt to use url.
|
||||||
return StringUtils.prependIfMissing(getUrl().toString().replace(root.getApiUrl(), ""), "/");
|
final URL url = Objects.requireNonNull(getUrl(), "Missing instance URL!");
|
||||||
|
return StringUtils.prependIfMissing(url.toString().replace(root.getApiUrl(), ""), "/");
|
||||||
}
|
}
|
||||||
return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/issues/" + number;
|
return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/issues/" + number;
|
||||||
}
|
}
|
||||||
|
|||||||
49
src/main/java/org/kohsuke/github/GHIssueChanges.java
Normal file
49
src/main/java/org/kohsuke/github/GHIssueChanges.java
Normal file
@@ -0,0 +1,49 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Wrapper to define changed fields on issues action="edited"
|
||||||
|
*
|
||||||
|
* @see GHEventPayload.Issue
|
||||||
|
*/
|
||||||
|
@SuppressFBWarnings("UWF_UNWRITTEN_FIELD")
|
||||||
|
public class GHIssueChanges {
|
||||||
|
|
||||||
|
private GHFrom title;
|
||||||
|
private GHFrom body;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Old issue title.
|
||||||
|
*
|
||||||
|
* @return old issue title (or null if not changed)
|
||||||
|
*/
|
||||||
|
public GHFrom getTitle() {
|
||||||
|
return title;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Old issue body.
|
||||||
|
*
|
||||||
|
* @return old issue body (or null if not changed)
|
||||||
|
*/
|
||||||
|
public GHFrom getBody() {
|
||||||
|
return body;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Wrapper for changed values.
|
||||||
|
*/
|
||||||
|
public static class GHFrom {
|
||||||
|
private String from;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Previous value that was changed.
|
||||||
|
*
|
||||||
|
* @return previous value
|
||||||
|
*/
|
||||||
|
public String getFrom() {
|
||||||
|
return from;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -26,7 +26,7 @@ package org.kohsuke.github;
|
|||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.*;
|
import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Comment to the issue
|
* Comment to the issue
|
||||||
@@ -126,7 +126,7 @@ public class GHIssueComment extends GHObject implements Reactable {
|
|||||||
owner.root.createRequest().method("DELETE").withUrlPath(getApiRoute()).send();
|
owner.root.createRequest().method("DELETE").withUrlPath(getApiRoute()).send();
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHReaction createReaction(ReactionContent content) throws IOException {
|
public GHReaction createReaction(ReactionContent content) throws IOException {
|
||||||
return owner.root.createRequest()
|
return owner.root.createRequest()
|
||||||
@@ -138,7 +138,7 @@ public class GHIssueComment extends GHObject implements Reactable {
|
|||||||
.wrap(owner.root);
|
.wrap(owner.root);
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public PagedIterable<GHReaction> listReactions() {
|
public PagedIterable<GHReaction> listReactions() {
|
||||||
return owner.root.createRequest()
|
return owner.root.createRequest()
|
||||||
@@ -149,6 +149,6 @@ public class GHIssueComment extends GHObject implements Reactable {
|
|||||||
|
|
||||||
private String getApiRoute() {
|
private String getApiRoute() {
|
||||||
return "/repos/" + owner.getRepository().getOwnerName() + "/" + owner.getRepository().getName()
|
return "/repos/" + owner.getRepository().getOwnerName() + "/" + owner.getRepository().getName()
|
||||||
+ "/issues/comments/" + id;
|
+ "/issues/comments/" + getId();
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -5,11 +5,11 @@ import java.util.Date;
|
|||||||
/**
|
/**
|
||||||
* The type GHIssueEvent.
|
* The type GHIssueEvent.
|
||||||
*
|
*
|
||||||
|
* @see <a href="https://developer.github.com/v3/issues/events/">Github documentation for issue events</a>
|
||||||
|
*
|
||||||
* @author Martin van Zijl
|
* @author Martin van Zijl
|
||||||
*/
|
*/
|
||||||
public class GHIssueEvent {
|
public class GHIssueEvent extends GitHubInteractiveObject {
|
||||||
private GitHub root;
|
|
||||||
|
|
||||||
private long id;
|
private long id;
|
||||||
private String node_id;
|
private String node_id;
|
||||||
private String url;
|
private String url;
|
||||||
@@ -18,6 +18,9 @@ public class GHIssueEvent {
|
|||||||
private String commit_id;
|
private String commit_id;
|
||||||
private String commit_url;
|
private String commit_url;
|
||||||
private String created_at;
|
private String created_at;
|
||||||
|
private GHMilestone milestone;
|
||||||
|
private GHLabel label;
|
||||||
|
private GHUser assignee;
|
||||||
|
|
||||||
private GHIssue issue;
|
private GHIssue issue;
|
||||||
|
|
||||||
@@ -111,6 +114,36 @@ public class GHIssueEvent {
|
|||||||
return issue;
|
return issue;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get the {@link GHMilestone} that this issue was added to or removed from. Only present for events "milestoned"
|
||||||
|
* and "demilestoned", <code>null</code> otherwise.
|
||||||
|
*
|
||||||
|
* @return the milestone
|
||||||
|
*/
|
||||||
|
public GHMilestone getMilestone() {
|
||||||
|
return milestone;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get the {@link GHLabel} that was added to or removed from the issue. Only present for events "labeled" and
|
||||||
|
* "unlabeled", <code>null</code> otherwise.
|
||||||
|
*
|
||||||
|
* @return the label
|
||||||
|
*/
|
||||||
|
public GHLabel getLabel() {
|
||||||
|
return label;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get the {@link GHUser} that was assigned or unassigned from the issue. Only present for events "assigned" and
|
||||||
|
* "unassigned", <code>null</code> otherwise.
|
||||||
|
*
|
||||||
|
* @return the user
|
||||||
|
*/
|
||||||
|
public GHUser getAssignee() {
|
||||||
|
return assignee;
|
||||||
|
}
|
||||||
|
|
||||||
GHIssueEvent wrapUp(GitHub root) {
|
GHIssueEvent wrapUp(GitHub root) {
|
||||||
this.root = root;
|
this.root = root;
|
||||||
return this;
|
return this;
|
||||||
|
|||||||
@@ -9,9 +9,7 @@ import org.apache.commons.lang3.builder.ToStringBuilder;
|
|||||||
* @author Kohsuke Kawaguchi
|
* @author Kohsuke Kawaguchi
|
||||||
*/
|
*/
|
||||||
@SuppressFBWarnings(value = "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", justification = "JSON API")
|
@SuppressFBWarnings(value = "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", justification = "JSON API")
|
||||||
public class GHKey {
|
public class GHKey extends GitHubInteractiveObject {
|
||||||
/* package almost final */ GitHub root;
|
|
||||||
|
|
||||||
protected String url, key, title;
|
protected String url, key, title;
|
||||||
protected boolean verified;
|
protected boolean verified;
|
||||||
protected int id;
|
protected int id;
|
||||||
|
|||||||
@@ -2,6 +2,7 @@ package org.kohsuke.github;
|
|||||||
|
|
||||||
import com.fasterxml.jackson.annotation.JacksonInject;
|
import com.fasterxml.jackson.annotation.JacksonInject;
|
||||||
import com.fasterxml.jackson.annotation.JsonCreator;
|
import com.fasterxml.jackson.annotation.JsonCreator;
|
||||||
|
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.util.ArrayList;
|
import java.util.ArrayList;
|
||||||
@@ -20,7 +21,12 @@ import javax.annotation.Nonnull;
|
|||||||
* @see GHIssue#getLabels() GHIssue#getLabels()
|
* @see GHIssue#getLabels() GHIssue#getLabels()
|
||||||
* @see GHRepository#listLabels() GHRepository#listLabels()
|
* @see GHRepository#listLabels() GHRepository#listLabels()
|
||||||
*/
|
*/
|
||||||
public class GHLabel {
|
public class GHLabel extends GitHubInteractiveObject {
|
||||||
|
|
||||||
|
private long id;
|
||||||
|
private String nodeId;
|
||||||
|
@JsonProperty("default")
|
||||||
|
private boolean default_;
|
||||||
|
|
||||||
@Nonnull
|
@Nonnull
|
||||||
private String url, name, color;
|
private String url, name, color;
|
||||||
@@ -28,9 +34,6 @@ public class GHLabel {
|
|||||||
@CheckForNull
|
@CheckForNull
|
||||||
private String description;
|
private String description;
|
||||||
|
|
||||||
@Nonnull
|
|
||||||
private final GitHub root;
|
|
||||||
|
|
||||||
@JsonCreator
|
@JsonCreator
|
||||||
private GHLabel(@JacksonInject @Nonnull GitHub root) {
|
private GHLabel(@JacksonInject @Nonnull GitHub root) {
|
||||||
this.root = root;
|
this.root = root;
|
||||||
@@ -45,6 +48,24 @@ public class GHLabel {
|
|||||||
return Objects.requireNonNull(root);
|
return Objects.requireNonNull(root);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets id.
|
||||||
|
*
|
||||||
|
* @return the id
|
||||||
|
*/
|
||||||
|
public long getId() {
|
||||||
|
return id;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets node id.
|
||||||
|
*
|
||||||
|
* @return the node id.
|
||||||
|
*/
|
||||||
|
public String getNodeId() {
|
||||||
|
return nodeId;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets url.
|
* Gets url.
|
||||||
*
|
*
|
||||||
@@ -85,6 +106,15 @@ public class GHLabel {
|
|||||||
return description;
|
return description;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* If the label is one of the default labels created by GitHub automatically.
|
||||||
|
*
|
||||||
|
* @return true if the label is a default one
|
||||||
|
*/
|
||||||
|
public boolean isDefault() {
|
||||||
|
return default_;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Sets color.
|
* Sets color.
|
||||||
*
|
*
|
||||||
@@ -132,7 +162,7 @@ public class GHLabel {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
static Creator create(GHRepository repository) throws IOException {
|
static Creator create(GHRepository repository) throws IOException {
|
||||||
return new Creator(repository);
|
return new Creator(repository);
|
||||||
@@ -179,7 +209,7 @@ public class GHLabel {
|
|||||||
*
|
*
|
||||||
* @return a {@link Updater}
|
* @return a {@link Updater}
|
||||||
*/
|
*/
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public Updater update() {
|
public Updater update() {
|
||||||
return new Updater(this);
|
return new Updater(this);
|
||||||
@@ -190,7 +220,7 @@ public class GHLabel {
|
|||||||
*
|
*
|
||||||
* @return a {@link Setter}
|
* @return a {@link Setter}
|
||||||
*/
|
*/
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public Setter set() {
|
public Setter set() {
|
||||||
return new Setter(this);
|
return new Setter(this);
|
||||||
@@ -227,7 +257,7 @@ public class GHLabel {
|
|||||||
*
|
*
|
||||||
* {@link #done()} is called automatically after the property is set.
|
* {@link #done()} is called automatically after the property is set.
|
||||||
*/
|
*/
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public static class Setter extends GHLabelBuilder<GHLabel> {
|
public static class Setter extends GHLabelBuilder<GHLabel> {
|
||||||
private Setter(@Nonnull GHLabel base) {
|
private Setter(@Nonnull GHLabel base) {
|
||||||
@@ -241,7 +271,7 @@ public class GHLabel {
|
|||||||
*
|
*
|
||||||
* Consumer must call {@link #done()} to commit changes.
|
* Consumer must call {@link #done()} to commit changes.
|
||||||
*/
|
*/
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public static class Updater extends GHLabelBuilder<Updater> {
|
public static class Updater extends GHLabelBuilder<Updater> {
|
||||||
private Updater(@Nonnull GHLabel base) {
|
private Updater(@Nonnull GHLabel base) {
|
||||||
@@ -255,7 +285,7 @@ public class GHLabel {
|
|||||||
*
|
*
|
||||||
* Consumer must call {@link #done()} to create the new instance.
|
* Consumer must call {@link #done()} to create the new instance.
|
||||||
*/
|
*/
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public static class Creator extends GHLabelBuilder<Creator> {
|
public static class Creator extends GHLabelBuilder<Creator> {
|
||||||
private Creator(@Nonnull GHRepository repository) {
|
private Creator(@Nonnull GHRepository repository) {
|
||||||
|
|||||||
@@ -38,21 +38,21 @@ class GHLabelBuilder<S> extends AbstractBuilder<GHLabel, S> {
|
|||||||
}
|
}
|
||||||
|
|
||||||
@Nonnull
|
@Nonnull
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public S name(String value) throws IOException {
|
public S name(String value) throws IOException {
|
||||||
return with("name", value);
|
return with("name", value);
|
||||||
}
|
}
|
||||||
|
|
||||||
@Nonnull
|
@Nonnull
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public S color(String value) throws IOException {
|
public S color(String value) throws IOException {
|
||||||
return with("color", value);
|
return with("color", value);
|
||||||
}
|
}
|
||||||
|
|
||||||
@Nonnull
|
@Nonnull
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public S description(String value) throws IOException {
|
public S description(String value) throws IOException {
|
||||||
return with("description", value);
|
return with("description", value);
|
||||||
|
|||||||
49
src/main/java/org/kohsuke/github/GHLabelChanges.java
Normal file
49
src/main/java/org/kohsuke/github/GHLabelChanges.java
Normal file
@@ -0,0 +1,49 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Wrapper to define changed fields on label action="edited"
|
||||||
|
*
|
||||||
|
* @see GHEventPayload.Label
|
||||||
|
*/
|
||||||
|
@SuppressFBWarnings("UWF_UNWRITTEN_FIELD")
|
||||||
|
public class GHLabelChanges {
|
||||||
|
|
||||||
|
private GHFrom name;
|
||||||
|
private GHFrom color;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Old label name.
|
||||||
|
*
|
||||||
|
* @return old label name (or null if not changed)
|
||||||
|
*/
|
||||||
|
public GHFrom getName() {
|
||||||
|
return name;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Old label color.
|
||||||
|
*
|
||||||
|
* @return old label color (or null if not changed)
|
||||||
|
*/
|
||||||
|
public GHFrom getColor() {
|
||||||
|
return color;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Wrapper for changed values.
|
||||||
|
*/
|
||||||
|
public static class GHFrom {
|
||||||
|
private String from;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Previous value that was changed.
|
||||||
|
*
|
||||||
|
* @return previous value
|
||||||
|
*/
|
||||||
|
public String getFrom() {
|
||||||
|
return from;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -24,13 +24,13 @@
|
|||||||
|
|
||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
import com.infradna.tool.bridge_method_injector.WithBridgeMethods;
|
|
||||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
import java.util.ArrayList;
|
import java.util.ArrayList;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The GitHub Preview API's license information
|
* The GitHub Preview API's license information
|
||||||
@@ -44,9 +44,6 @@ import java.util.List;
|
|||||||
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public class GHLicense extends GHObject {
|
public class GHLicense extends GHObject {
|
||||||
@SuppressFBWarnings("IS2_INCONSISTENT_SYNC")
|
|
||||||
// root is set before the object is returned to the app
|
|
||||||
/* package almost final */ GitHub root;
|
|
||||||
|
|
||||||
// these fields are always present, even in the short form
|
// these fields are always present, even in the short form
|
||||||
protected String key, name;
|
protected String key, name;
|
||||||
@@ -78,14 +75,6 @@ public class GHLicense extends GHObject {
|
|||||||
return name;
|
return name;
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
|
||||||
* @return API URL of this object.
|
|
||||||
*/
|
|
||||||
@WithBridgeMethods(value = String.class, adapterMethod = "urlToString")
|
|
||||||
public URL getUrl() {
|
|
||||||
return GitHubClient.parseURL(url);
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Featured licenses are bold in the new repository drop-down
|
* Featured licenses are bold in the new repository drop-down
|
||||||
*
|
*
|
||||||
@@ -199,7 +188,14 @@ public class GHLicense extends GHObject {
|
|||||||
if (description != null)
|
if (description != null)
|
||||||
return; // already populated
|
return; // already populated
|
||||||
|
|
||||||
root.createRequest().withUrlPath(url).fetchInto(this);
|
if (root == null || root.isOffline()) {
|
||||||
|
return; // cannot populate, will have to live with what we have
|
||||||
|
}
|
||||||
|
|
||||||
|
URL url = getUrl();
|
||||||
|
if (url != null) {
|
||||||
|
root.createRequest().setRawUrlPath(url.toString()).fetchInto(this);
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
@@ -210,12 +206,12 @@ public class GHLicense extends GHObject {
|
|||||||
return false;
|
return false;
|
||||||
|
|
||||||
GHLicense that = (GHLicense) o;
|
GHLicense that = (GHLicense) o;
|
||||||
return this.url.equals(that.url);
|
return Objects.equals(getUrl(), that.getUrl());
|
||||||
}
|
}
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
public int hashCode() {
|
public int hashCode() {
|
||||||
return url.hashCode();
|
return Objects.hashCode(getUrl());
|
||||||
}
|
}
|
||||||
|
|
||||||
GHLicense wrap(GitHub root) {
|
GHLicense wrap(GitHub root) {
|
||||||
|
|||||||
@@ -9,9 +9,7 @@ import java.net.URL;
|
|||||||
* @see GitHub#getMyMarketplacePurchases()
|
* @see GitHub#getMyMarketplacePurchases()
|
||||||
* @see GHMarketplaceListAccountBuilder#createRequest()
|
* @see GHMarketplaceListAccountBuilder#createRequest()
|
||||||
*/
|
*/
|
||||||
public class GHMarketplaceAccount {
|
public class GHMarketplaceAccount extends GitHubInteractiveObject {
|
||||||
|
|
||||||
protected GitHub root;
|
|
||||||
private String url;
|
private String url;
|
||||||
private long id;
|
private long id;
|
||||||
private String login;
|
private String login;
|
||||||
|
|||||||
@@ -8,8 +8,7 @@ import java.io.IOException;
|
|||||||
* @author Paulo Miguel Almeida
|
* @author Paulo Miguel Almeida
|
||||||
* @see GHMarketplacePlan#listAccounts()
|
* @see GHMarketplacePlan#listAccounts()
|
||||||
*/
|
*/
|
||||||
public class GHMarketplaceListAccountBuilder {
|
public class GHMarketplaceListAccountBuilder extends GitHubInteractiveObject {
|
||||||
private final GitHub root;
|
|
||||||
private final Requester builder;
|
private final Requester builder;
|
||||||
private final long planId;
|
private final long planId;
|
||||||
|
|
||||||
|
|||||||
@@ -10,8 +10,7 @@ import java.util.Date;
|
|||||||
* @author Paulo Miguel Almeida
|
* @author Paulo Miguel Almeida
|
||||||
* @see GHMarketplaceListAccountBuilder#createRequest()
|
* @see GHMarketplaceListAccountBuilder#createRequest()
|
||||||
*/
|
*/
|
||||||
public class GHMarketplacePendingChange {
|
public class GHMarketplacePendingChange extends GitHubInteractiveObject {
|
||||||
private GitHub root;
|
|
||||||
private long id;
|
private long id;
|
||||||
@SuppressFBWarnings(value = "UWF_UNWRITTEN_FIELD", justification = "Field comes from JSON deserialization")
|
@SuppressFBWarnings(value = "UWF_UNWRITTEN_FIELD", justification = "Field comes from JSON deserialization")
|
||||||
private Long unitCount;
|
private Long unitCount;
|
||||||
|
|||||||
@@ -11,9 +11,7 @@ import java.util.List;
|
|||||||
* @author Paulo Miguel Almeida
|
* @author Paulo Miguel Almeida
|
||||||
* @see GitHub#listMarketplacePlans()
|
* @see GitHub#listMarketplacePlans()
|
||||||
*/
|
*/
|
||||||
public class GHMarketplacePlan {
|
public class GHMarketplacePlan extends GitHubInteractiveObject {
|
||||||
|
|
||||||
private GitHub root;
|
|
||||||
private String url;
|
private String url;
|
||||||
private String accountsUrl;
|
private String accountsUrl;
|
||||||
private long id;
|
private long id;
|
||||||
|
|||||||
@@ -10,9 +10,8 @@ import java.util.Date;
|
|||||||
* @author Paulo Miguel Almeida
|
* @author Paulo Miguel Almeida
|
||||||
* @see GHMarketplaceListAccountBuilder#createRequest() GHMarketplaceListAccountBuilder#createRequest()
|
* @see GHMarketplaceListAccountBuilder#createRequest() GHMarketplaceListAccountBuilder#createRequest()
|
||||||
*/
|
*/
|
||||||
public class GHMarketplacePurchase {
|
public class GHMarketplacePurchase extends GitHubInteractiveObject {
|
||||||
|
|
||||||
private GitHub root;
|
|
||||||
private String billingCycle;
|
private String billingCycle;
|
||||||
private String nextBillingDate;
|
private String nextBillingDate;
|
||||||
private boolean onFreeTrial;
|
private boolean onFreeTrial;
|
||||||
|
|||||||
@@ -10,8 +10,7 @@ import java.util.Date;
|
|||||||
* @author Paulo Miguel Almeida
|
* @author Paulo Miguel Almeida
|
||||||
* @see GitHub#getMyMarketplacePurchases()
|
* @see GitHub#getMyMarketplacePurchases()
|
||||||
*/
|
*/
|
||||||
public class GHMarketplaceUserPurchase {
|
public class GHMarketplaceUserPurchase extends GitHubInteractiveObject {
|
||||||
protected GitHub root;
|
|
||||||
private String billingCycle;
|
private String billingCycle;
|
||||||
private String nextBillingDate;
|
private String nextBillingDate;
|
||||||
private boolean onFreeTrial;
|
private boolean onFreeTrial;
|
||||||
|
|||||||
@@ -10,9 +10,7 @@ import java.util.Locale;
|
|||||||
* @author Kohsuke Kawaguchi
|
* @author Kohsuke Kawaguchi
|
||||||
* @see GHMyself#listOrgMemberships() GHMyself#listOrgMemberships()
|
* @see GHMyself#listOrgMemberships() GHMyself#listOrgMemberships()
|
||||||
*/
|
*/
|
||||||
public class GHMembership /* extends GHObject --- but it doesn't have id, created_at, etc. */ {
|
public class GHMembership extends GitHubInteractiveObject {
|
||||||
GitHub root;
|
|
||||||
|
|
||||||
String url;
|
String url;
|
||||||
String state;
|
String state;
|
||||||
String role;
|
String role;
|
||||||
|
|||||||
@@ -23,6 +23,9 @@ public class GHMeta {
|
|||||||
private List<String> api;
|
private List<String> api;
|
||||||
private List<String> pages;
|
private List<String> pages;
|
||||||
private List<String> importer = new ArrayList<>();
|
private List<String> importer = new ArrayList<>();
|
||||||
|
private List<String> packages;
|
||||||
|
private List<String> actions;
|
||||||
|
private List<String> dependabot;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Is verifiable password authentication boolean.
|
* Is verifiable password authentication boolean.
|
||||||
@@ -86,4 +89,31 @@ public class GHMeta {
|
|||||||
public List<String> getImporter() {
|
public List<String> getImporter() {
|
||||||
return Collections.unmodifiableList(importer);
|
return Collections.unmodifiableList(importer);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets package.
|
||||||
|
*
|
||||||
|
* @return the package
|
||||||
|
*/
|
||||||
|
public List<String> getPackages() {
|
||||||
|
return Collections.unmodifiableList(packages);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets actions.
|
||||||
|
*
|
||||||
|
* @return the actions
|
||||||
|
*/
|
||||||
|
public List<String> getActions() {
|
||||||
|
return Collections.unmodifiableList(actions);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets dependabot.
|
||||||
|
*
|
||||||
|
* @return the dependabot
|
||||||
|
*/
|
||||||
|
public List<String> getDependabot() {
|
||||||
|
return Collections.unmodifiableList(dependabot);
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -11,7 +11,6 @@ import java.util.Locale;
|
|||||||
* @author Yusuke Kokubo
|
* @author Yusuke Kokubo
|
||||||
*/
|
*/
|
||||||
public class GHMilestone extends GHObject {
|
public class GHMilestone extends GHObject {
|
||||||
GitHub root;
|
|
||||||
GHRepository owner;
|
GHRepository owner;
|
||||||
|
|
||||||
GHUser creator;
|
GHUser creator;
|
||||||
|
|||||||
@@ -23,9 +23,7 @@ import java.util.NoSuchElementException;
|
|||||||
* @see GitHub#listNotifications() GitHub#listNotifications()
|
* @see GitHub#listNotifications() GitHub#listNotifications()
|
||||||
* @see GHRepository#listNotifications() GHRepository#listNotifications()
|
* @see GHRepository#listNotifications() GHRepository#listNotifications()
|
||||||
*/
|
*/
|
||||||
public class GHNotificationStream implements Iterable<GHThread> {
|
public class GHNotificationStream extends GitHubInteractiveObject implements Iterable<GHThread> {
|
||||||
private final GitHub root;
|
|
||||||
|
|
||||||
private Boolean all, participating;
|
private Boolean all, participating;
|
||||||
private String since;
|
private String since;
|
||||||
private String apiUrl;
|
private String apiUrl;
|
||||||
|
|||||||
@@ -20,16 +20,18 @@ import javax.annotation.CheckForNull;
|
|||||||
*/
|
*/
|
||||||
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public abstract class GHObject {
|
public abstract class GHObject extends GitHubInteractiveObject {
|
||||||
/**
|
/**
|
||||||
* Capture response HTTP headers on the state object.
|
* Capture response HTTP headers on the state object.
|
||||||
*/
|
*/
|
||||||
protected transient Map<String, List<String>> responseHeaderFields;
|
protected transient Map<String, List<String>> responseHeaderFields;
|
||||||
|
|
||||||
protected String url;
|
private String url;
|
||||||
protected long id;
|
|
||||||
protected String created_at;
|
private long id;
|
||||||
protected String updated_at;
|
private String nodeId;
|
||||||
|
private String createdAt;
|
||||||
|
private String updatedAt;
|
||||||
|
|
||||||
GHObject() {
|
GHObject() {
|
||||||
}
|
}
|
||||||
@@ -74,12 +76,12 @@ public abstract class GHObject {
|
|||||||
*/
|
*/
|
||||||
@WithBridgeMethods(value = String.class, adapterMethod = "createdAtStr")
|
@WithBridgeMethods(value = String.class, adapterMethod = "createdAtStr")
|
||||||
public Date getCreatedAt() throws IOException {
|
public Date getCreatedAt() throws IOException {
|
||||||
return GitHubClient.parseDate(created_at);
|
return GitHubClient.parseDate(createdAt);
|
||||||
}
|
}
|
||||||
|
|
||||||
@SuppressFBWarnings(value = "UPM_UNCALLED_PRIVATE_METHOD", justification = "Bridge method of getCreatedAt")
|
@SuppressFBWarnings(value = "UPM_UNCALLED_PRIVATE_METHOD", justification = "Bridge method of getCreatedAt")
|
||||||
private Object createdAtStr(Date id, Class type) {
|
private Object createdAtStr(Date id, Class type) {
|
||||||
return created_at;
|
return createdAt;
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -110,7 +112,18 @@ public abstract class GHObject {
|
|||||||
* on error
|
* on error
|
||||||
*/
|
*/
|
||||||
public Date getUpdatedAt() throws IOException {
|
public Date getUpdatedAt() throws IOException {
|
||||||
return GitHubClient.parseDate(updated_at);
|
return GitHubClient.parseDate(updatedAt);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get Global node_id from Github object.
|
||||||
|
*
|
||||||
|
* @see <a href="https://developer.github.com/v4/guides/using-global-node-ids/">Using Global Node IDs</a>
|
||||||
|
*
|
||||||
|
* @return Global Node ID.
|
||||||
|
*/
|
||||||
|
public String getNodeId() {
|
||||||
|
return nodeId;
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|||||||
@@ -22,6 +22,6 @@ class GHOrgHook extends GHHook {
|
|||||||
|
|
||||||
@Override
|
@Override
|
||||||
String getApiRoute() {
|
String getApiRoute() {
|
||||||
return String.format("/orgs/%s/hooks/%d", organization.getLogin(), id);
|
return String.format("/orgs/%s/hooks/%d", organization.getLogin(), getId());
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -10,7 +10,7 @@ import java.util.List;
|
|||||||
import java.util.Map;
|
import java.util.Map;
|
||||||
import java.util.TreeMap;
|
import java.util.TreeMap;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.INERTIA;
|
import static org.kohsuke.github.internal.Previews.INERTIA;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The type GHOrganization.
|
* The type GHOrganization.
|
||||||
@@ -18,6 +18,9 @@ import static org.kohsuke.github.Previews.INERTIA;
|
|||||||
* @author Kohsuke Kawaguchi
|
* @author Kohsuke Kawaguchi
|
||||||
*/
|
*/
|
||||||
public class GHOrganization extends GHPerson {
|
public class GHOrganization extends GHPerson {
|
||||||
|
|
||||||
|
private boolean has_organization_projects;
|
||||||
|
|
||||||
GHOrganization wrapUp(GitHub root) {
|
GHOrganization wrapUp(GitHub root) {
|
||||||
return (GHOrganization) super.wrapUp(root);
|
return (GHOrganization) super.wrapUp(root);
|
||||||
}
|
}
|
||||||
@@ -97,7 +100,7 @@ public class GHOrganization extends GHPerson {
|
|||||||
* @return the gh create repository builder
|
* @return the gh create repository builder
|
||||||
*/
|
*/
|
||||||
public GHCreateRepositoryBuilder createRepository(String name) {
|
public GHCreateRepositoryBuilder createRepository(String name) {
|
||||||
return new GHCreateRepositoryBuilder(root, "/orgs/" + login + "/repos", name);
|
return new GHCreateRepositoryBuilder(name, root, "/orgs/" + login + "/repos");
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -128,6 +131,22 @@ public class GHOrganization extends GHPerson {
|
|||||||
.toIterable(GHTeam[].class, item -> item.wrapUp(this));
|
.toIterable(GHTeam[].class, item -> item.wrapUp(this));
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets a single team by ID.
|
||||||
|
*
|
||||||
|
* @param teamId
|
||||||
|
* id of the team that we want to query for
|
||||||
|
* @return the team
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*
|
||||||
|
* @deprecated Use {@link GHOrganization#getTeam(long)}
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
public GHTeam getTeam(int teamId) throws IOException {
|
||||||
|
return getTeam((long) teamId);
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets a single team by ID.
|
* Gets a single team by ID.
|
||||||
*
|
*
|
||||||
@@ -139,9 +158,9 @@ public class GHOrganization extends GHPerson {
|
|||||||
*
|
*
|
||||||
* @see <a href= "https://developer.github.com/v3/teams/#get-team-by-name">documentation</a>
|
* @see <a href= "https://developer.github.com/v3/teams/#get-team-by-name">documentation</a>
|
||||||
*/
|
*/
|
||||||
public GHTeam getTeam(int teamId) throws IOException {
|
public GHTeam getTeam(long teamId) throws IOException {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
.withUrlPath(String.format("/organizations/%d/team/%d", id, teamId))
|
.withUrlPath(String.format("/organizations/%d/team/%d", getId(), teamId))
|
||||||
.fetch(GHTeam.class)
|
.fetch(GHTeam.class)
|
||||||
.wrapUp(this);
|
.wrapUp(this);
|
||||||
}
|
}
|
||||||
@@ -351,6 +370,35 @@ public class GHOrganization extends GHPerson {
|
|||||||
root.createRequest().method("DELETE").withUrlPath("/orgs/" + login + "/public_members/" + u.getLogin()).send();
|
root.createRequest().method("DELETE").withUrlPath("/orgs/" + login + "/public_members/" + u.getLogin()).send();
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Are projects enabled for organization boolean.
|
||||||
|
*
|
||||||
|
* @return the boolean
|
||||||
|
*/
|
||||||
|
public boolean areOrganizationProjectsEnabled() {
|
||||||
|
return has_organization_projects;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Sets organization projects enabled status boolean
|
||||||
|
*
|
||||||
|
* @param newStatus
|
||||||
|
* enable status
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public void enableOrganizationProjects(boolean newStatus) throws IOException {
|
||||||
|
edit("has_organization_projects", newStatus);
|
||||||
|
}
|
||||||
|
|
||||||
|
private void edit(String key, Object value) throws IOException {
|
||||||
|
root.createRequest()
|
||||||
|
.withUrlPath(String.format("/orgs/%s", login))
|
||||||
|
.method("PATCH")
|
||||||
|
.with(key, value)
|
||||||
|
.fetchInto(this);
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Returns the projects for this organization.
|
* Returns the projects for this organization.
|
||||||
*
|
*
|
||||||
@@ -405,7 +453,7 @@ public class GHOrganization extends GHPerson {
|
|||||||
* The enum Permission.
|
* The enum Permission.
|
||||||
*/
|
*/
|
||||||
public enum Permission {
|
public enum Permission {
|
||||||
ADMIN, PUSH, PULL
|
ADMIN, MAINTAIN, PUSH, TRIAGE, PULL
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|||||||
@@ -18,16 +18,15 @@ import java.util.TreeMap;
|
|||||||
* @author Kohsuke Kawaguchi
|
* @author Kohsuke Kawaguchi
|
||||||
*/
|
*/
|
||||||
public abstract class GHPerson extends GHObject {
|
public abstract class GHPerson extends GHObject {
|
||||||
/* package almost final */ GitHub root;
|
|
||||||
|
|
||||||
// core data fields that exist even for "small" user data (such as the user info in pull request)
|
// core data fields that exist even for "small" user data (such as the user info in pull request)
|
||||||
protected String login, avatar_url;
|
protected String login, avatar_url;
|
||||||
|
|
||||||
// other fields (that only show up in full data)
|
// other fields (that only show up in full data)
|
||||||
protected String location, blog, email, name, company, type;
|
protected String location, blog, email, bio, name, company, type, twitter_username;
|
||||||
protected String html_url;
|
protected String html_url;
|
||||||
protected int followers, following, public_repos, public_gists;
|
protected int followers, following, public_repos, public_gists;
|
||||||
protected boolean site_admin;
|
protected boolean site_admin, hireable;
|
||||||
|
|
||||||
// other fields (that only show up in full data) that require privileged scope
|
// other fields (that only show up in full data) that require privileged scope
|
||||||
protected Integer total_private_repos;
|
protected Integer total_private_repos;
|
||||||
@@ -46,13 +45,16 @@ public abstract class GHPerson extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
protected synchronized void populate() throws IOException {
|
protected synchronized void populate() throws IOException {
|
||||||
if (created_at != null) {
|
if (super.getCreatedAt() != null) {
|
||||||
return; // already populated
|
return; // already populated
|
||||||
}
|
}
|
||||||
if (root == null || root.isOffline()) {
|
if (root == null || root.isOffline()) {
|
||||||
return; // cannot populate, will have to live with what we have
|
return; // cannot populate, will have to live with what we have
|
||||||
}
|
}
|
||||||
root.createRequest().withUrlPath(url).fetchInto(this);
|
URL url = getUrl();
|
||||||
|
if (url != null) {
|
||||||
|
root.createRequest().setRawUrlPath(url.toString()).fetchInto(this);
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -151,10 +153,7 @@ public abstract class GHPerson extends GHObject {
|
|||||||
*/
|
*/
|
||||||
public GHRepository getRepository(String name) throws IOException {
|
public GHRepository getRepository(String name) throws IOException {
|
||||||
try {
|
try {
|
||||||
return root.createRequest()
|
return GHRepository.read(root, login, name);
|
||||||
.withUrlPath("/repos/" + login + '/' + name)
|
|
||||||
.fetch(GHRepository.class)
|
|
||||||
.wrap(root);
|
|
||||||
} catch (FileNotFoundException e) {
|
} catch (FileNotFoundException e) {
|
||||||
return null;
|
return null;
|
||||||
}
|
}
|
||||||
@@ -234,6 +233,18 @@ public abstract class GHPerson extends GHObject {
|
|||||||
return location;
|
return location;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the Twitter Username of this user, like "GitHub"
|
||||||
|
*
|
||||||
|
* @return the Twitter username
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public String getTwitterUsername() throws IOException {
|
||||||
|
populate();
|
||||||
|
return twitter_username;
|
||||||
|
}
|
||||||
|
|
||||||
public Date getCreatedAt() throws IOException {
|
public Date getCreatedAt() throws IOException {
|
||||||
populate();
|
populate();
|
||||||
return super.getCreatedAt();
|
return super.getCreatedAt();
|
||||||
|
|||||||
@@ -28,7 +28,7 @@ import java.io.IOException;
|
|||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
import java.util.Locale;
|
import java.util.Locale;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.INERTIA;
|
import static org.kohsuke.github.internal.Previews.INERTIA;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* A GitHub project.
|
* A GitHub project.
|
||||||
@@ -37,12 +37,10 @@ import static org.kohsuke.github.Previews.INERTIA;
|
|||||||
* @see <a href="https://developer.github.com/v3/projects/">Projects</a>
|
* @see <a href="https://developer.github.com/v3/projects/">Projects</a>
|
||||||
*/
|
*/
|
||||||
public class GHProject extends GHObject {
|
public class GHProject extends GHObject {
|
||||||
protected GitHub root;
|
|
||||||
protected GHObject owner;
|
protected GHObject owner;
|
||||||
|
|
||||||
private String owner_url;
|
private String owner_url;
|
||||||
private String html_url;
|
private String html_url;
|
||||||
private String node_id;
|
|
||||||
private String name;
|
private String name;
|
||||||
private String body;
|
private String body;
|
||||||
private int number;
|
private int number;
|
||||||
@@ -81,10 +79,8 @@ public class GHProject extends GHObject {
|
|||||||
} else if (owner_url.contains("/users/")) {
|
} else if (owner_url.contains("/users/")) {
|
||||||
owner = root.createRequest().withUrlPath(getOwnerUrl().getPath()).fetch(GHUser.class).wrapUp(root);
|
owner = root.createRequest().withUrlPath(getOwnerUrl().getPath()).fetch(GHUser.class).wrapUp(root);
|
||||||
} else if (owner_url.contains("/repos/")) {
|
} else if (owner_url.contains("/repos/")) {
|
||||||
owner = root.createRequest()
|
String[] pathElements = getOwnerUrl().getPath().split("/");
|
||||||
.withUrlPath(getOwnerUrl().getPath())
|
owner = GHRepository.read(root, pathElements[1], pathElements[2]);
|
||||||
.fetch(GHRepository.class)
|
|
||||||
.wrap(root);
|
|
||||||
}
|
}
|
||||||
} catch (FileNotFoundException e) {
|
} catch (FileNotFoundException e) {
|
||||||
return null;
|
return null;
|
||||||
@@ -105,10 +101,12 @@ public class GHProject extends GHObject {
|
|||||||
/**
|
/**
|
||||||
* Gets node id.
|
* Gets node id.
|
||||||
*
|
*
|
||||||
|
* @deprecated Use {@link GHObject#getNodeId()}
|
||||||
* @return the node id
|
* @return the node id
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public String getNode_id() {
|
public String getNode_id() {
|
||||||
return node_id;
|
return getNodeId();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -191,7 +189,7 @@ public class GHProject extends GHObject {
|
|||||||
* @return the api route
|
* @return the api route
|
||||||
*/
|
*/
|
||||||
protected String getApiRoute() {
|
protected String getApiRoute() {
|
||||||
return "/projects/" + id;
|
return "/projects/" + getId();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -290,7 +288,7 @@ public class GHProject extends GHObject {
|
|||||||
final GHProject project = this;
|
final GHProject project = this;
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
.withPreview(INERTIA)
|
.withPreview(INERTIA)
|
||||||
.withUrlPath(String.format("/projects/%d/columns", id))
|
.withUrlPath(String.format("/projects/%d/columns", getId()))
|
||||||
.toIterable(GHProjectColumn[].class, item -> item.wrap(project));
|
.toIterable(GHProjectColumn[].class, item -> item.wrap(project));
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -308,7 +306,7 @@ public class GHProject extends GHObject {
|
|||||||
.method("POST")
|
.method("POST")
|
||||||
.withPreview(INERTIA)
|
.withPreview(INERTIA)
|
||||||
.with("name", name)
|
.with("name", name)
|
||||||
.withUrlPath(String.format("/projects/%d/columns", id))
|
.withUrlPath(String.format("/projects/%d/columns", getId()))
|
||||||
.fetch(GHProjectColumn.class)
|
.fetch(GHProjectColumn.class)
|
||||||
.wrap(this);
|
.wrap(this);
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -6,7 +6,7 @@ import java.io.FileNotFoundException;
|
|||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.INERTIA;
|
import static org.kohsuke.github.internal.Previews.INERTIA;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The type GHProjectCard.
|
* The type GHProjectCard.
|
||||||
@@ -14,7 +14,6 @@ import static org.kohsuke.github.Previews.INERTIA;
|
|||||||
* @author Gunnar Skjold
|
* @author Gunnar Skjold
|
||||||
*/
|
*/
|
||||||
public class GHProjectCard extends GHObject {
|
public class GHProjectCard extends GHObject {
|
||||||
private GitHub root;
|
|
||||||
private GHProject project;
|
private GHProject project;
|
||||||
private GHProjectColumn column;
|
private GHProjectColumn column;
|
||||||
|
|
||||||
@@ -213,7 +212,7 @@ public class GHProjectCard extends GHObject {
|
|||||||
* @return the api route
|
* @return the api route
|
||||||
*/
|
*/
|
||||||
protected String getApiRoute() {
|
protected String getApiRoute() {
|
||||||
return String.format("/projects/columns/cards/%d", id);
|
return String.format("/projects/columns/cards/%d", getId());
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|||||||
@@ -4,7 +4,7 @@ import java.io.FileNotFoundException;
|
|||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.INERTIA;
|
import static org.kohsuke.github.internal.Previews.INERTIA;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The type GHProjectColumn.
|
* The type GHProjectColumn.
|
||||||
@@ -12,7 +12,6 @@ import static org.kohsuke.github.Previews.INERTIA;
|
|||||||
* @author Gunnar Skjold
|
* @author Gunnar Skjold
|
||||||
*/
|
*/
|
||||||
public class GHProjectColumn extends GHObject {
|
public class GHProjectColumn extends GHObject {
|
||||||
protected GitHub root;
|
|
||||||
protected GHProject project;
|
protected GHProject project;
|
||||||
|
|
||||||
private String name;
|
private String name;
|
||||||
@@ -115,7 +114,7 @@ public class GHProjectColumn extends GHObject {
|
|||||||
* @return the api route
|
* @return the api route
|
||||||
*/
|
*/
|
||||||
protected String getApiRoute() {
|
protected String getApiRoute() {
|
||||||
return String.format("/projects/columns/%d", id);
|
return String.format("/projects/columns/%d", getId());
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -139,7 +138,7 @@ public class GHProjectColumn extends GHObject {
|
|||||||
final GHProjectColumn column = this;
|
final GHProjectColumn column = this;
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
.withPreview(INERTIA)
|
.withPreview(INERTIA)
|
||||||
.withUrlPath(String.format("/projects/columns/%d/cards", id))
|
.withUrlPath(String.format("/projects/columns/%d/cards", getId()))
|
||||||
.toIterable(GHProjectCard[].class, item -> item.wrap(column));
|
.toIterable(GHProjectCard[].class, item -> item.wrap(column));
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -157,7 +156,7 @@ public class GHProjectColumn extends GHObject {
|
|||||||
.method("POST")
|
.method("POST")
|
||||||
.withPreview(INERTIA)
|
.withPreview(INERTIA)
|
||||||
.with("note", note)
|
.with("note", note)
|
||||||
.withUrlPath(String.format("/projects/columns/%d/cards", id))
|
.withUrlPath(String.format("/projects/columns/%d/cards", getId()))
|
||||||
.fetch(GHProjectCard.class)
|
.fetch(GHProjectCard.class)
|
||||||
.wrap(this);
|
.wrap(this);
|
||||||
}
|
}
|
||||||
@@ -177,7 +176,7 @@ public class GHProjectColumn extends GHObject {
|
|||||||
.withPreview(INERTIA)
|
.withPreview(INERTIA)
|
||||||
.with("content_type", issue instanceof GHPullRequest ? "PullRequest" : "Issue")
|
.with("content_type", issue instanceof GHPullRequest ? "PullRequest" : "Issue")
|
||||||
.with("content_id", issue.getId())
|
.with("content_id", issue.getId())
|
||||||
.withUrlPath(String.format("/projects/columns/%d/cards", id))
|
.withUrlPath(String.format("/projects/columns/%d/cards", getId()))
|
||||||
.fetch(GHProjectCard.class)
|
.fetch(GHProjectCard.class)
|
||||||
.wrap(this);
|
.wrap(this);
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -29,14 +29,15 @@ import java.io.IOException;
|
|||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
import java.util.ArrayList;
|
import java.util.ArrayList;
|
||||||
import java.util.Arrays;
|
import java.util.Arrays;
|
||||||
import java.util.Collection;
|
|
||||||
import java.util.Collections;
|
import java.util.Collections;
|
||||||
import java.util.Date;
|
import java.util.Date;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
import javax.annotation.CheckForNull;
|
import javax.annotation.CheckForNull;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.SHADOW_CAT;
|
import static org.kohsuke.github.internal.Previews.LYDIAN;
|
||||||
|
import static org.kohsuke.github.internal.Previews.SHADOW_CAT;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* A pull request.
|
* A pull request.
|
||||||
@@ -71,13 +72,6 @@ public class GHPullRequest extends GHIssue implements Refreshable {
|
|||||||
private GHUser[] requested_reviewers;
|
private GHUser[] requested_reviewers;
|
||||||
private GHTeam[] requested_teams;
|
private GHTeam[] requested_teams;
|
||||||
|
|
||||||
/**
|
|
||||||
* GitHub doesn't return some properties of {@link GHIssue} when requesting the GET on the 'pulls' API route as
|
|
||||||
* opposed to 'issues' API route. This flag remembers whether we made the GET call on the 'issues' route on this
|
|
||||||
* object to fill in those missing details
|
|
||||||
*/
|
|
||||||
private transient boolean fetchedIssueDetails;
|
|
||||||
|
|
||||||
GHPullRequest wrapUp(GHRepository owner) {
|
GHPullRequest wrapUp(GHRepository owner) {
|
||||||
this.wrap(owner);
|
this.wrap(owner);
|
||||||
return wrapUp(owner.root);
|
return wrapUp(owner.root);
|
||||||
@@ -103,7 +97,9 @@ public class GHPullRequest extends GHIssue implements Refreshable {
|
|||||||
protected String getApiRoute() {
|
protected String getApiRoute() {
|
||||||
if (owner == null) {
|
if (owner == null) {
|
||||||
// Issues returned from search to do not have an owner. Attempt to use url.
|
// Issues returned from search to do not have an owner. Attempt to use url.
|
||||||
return StringUtils.prependIfMissing(getUrl().toString().replace(root.getApiUrl(), ""), "/");
|
final URL url = Objects.requireNonNull(getUrl(), "Missing instance URL!");
|
||||||
|
return StringUtils.prependIfMissing(url.toString().replace(root.getApiUrl(), ""), "/");
|
||||||
|
|
||||||
}
|
}
|
||||||
return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/pulls/" + number;
|
return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/pulls/" + number;
|
||||||
}
|
}
|
||||||
@@ -174,12 +170,6 @@ public class GHPullRequest extends GHIssue implements Refreshable {
|
|||||||
return GitHubClient.parseDate(merged_at);
|
return GitHubClient.parseDate(merged_at);
|
||||||
}
|
}
|
||||||
|
|
||||||
@Override
|
|
||||||
public Collection<GHLabel> getLabels() throws IOException {
|
|
||||||
fetchIssue();
|
|
||||||
return super.getLabels();
|
|
||||||
}
|
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
public GHUser getClosedBy() {
|
public GHUser getClosedBy() {
|
||||||
return null;
|
return null;
|
||||||
@@ -387,10 +377,14 @@ public class GHPullRequest extends GHIssue implements Refreshable {
|
|||||||
* Repopulates this object.
|
* Repopulates this object.
|
||||||
*/
|
*/
|
||||||
public void refresh() throws IOException {
|
public void refresh() throws IOException {
|
||||||
if (root.isOffline()) {
|
if (root == null || root.isOffline()) {
|
||||||
return; // cannot populate, will have to live with what we have
|
return; // cannot populate, will have to live with what we have
|
||||||
}
|
}
|
||||||
root.createRequest().withPreview(SHADOW_CAT).withUrlPath(url).fetchInto(this).wrapUp(owner);
|
|
||||||
|
URL url = getUrl();
|
||||||
|
if (url != null) {
|
||||||
|
root.createRequest().withPreview(SHADOW_CAT).setRawUrlPath(url.toString()).fetchInto(this).wrapUp(owner);
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -558,6 +552,41 @@ public class GHPullRequest extends GHIssue implements Refreshable {
|
|||||||
.send();
|
.send();
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Set the base branch on the pull request
|
||||||
|
*
|
||||||
|
* @param newBaseBranch
|
||||||
|
* the name of the new base branch
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
* @return the updated pull request
|
||||||
|
*/
|
||||||
|
public GHPullRequest setBaseBranch(String newBaseBranch) throws IOException {
|
||||||
|
return root.createRequest()
|
||||||
|
.method("PATCH")
|
||||||
|
.with("base", newBaseBranch)
|
||||||
|
.withUrlPath(getApiRoute())
|
||||||
|
.fetch(GHPullRequest.class)
|
||||||
|
.wrapUp(root);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Updates the branch. The same as pressing the button in the web GUI.
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
@Preview(LYDIAN)
|
||||||
|
@Deprecated
|
||||||
|
public void updateBranch() throws IOException {
|
||||||
|
root.createRequest()
|
||||||
|
.withPreview(LYDIAN)
|
||||||
|
.method("PUT")
|
||||||
|
.with("expected_head_sha", head.getSha())
|
||||||
|
.withUrlPath(getApiRoute() + "/update-branch")
|
||||||
|
.send();
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Merge this pull request.
|
* Merge this pull request.
|
||||||
* <p>
|
* <p>
|
||||||
@@ -619,10 +648,4 @@ public class GHPullRequest extends GHIssue implements Refreshable {
|
|||||||
MERGE, SQUASH, REBASE
|
MERGE, SQUASH, REBASE
|
||||||
}
|
}
|
||||||
|
|
||||||
private void fetchIssue() throws IOException {
|
|
||||||
if (!fetchedIssueDetails) {
|
|
||||||
root.createRequest().withUrlPath(getIssuesApiRoute()).fetchInto(this);
|
|
||||||
fetchedIssueDetails = true;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
|
|||||||
86
src/main/java/org/kohsuke/github/GHPullRequestChanges.java
Normal file
86
src/main/java/org/kohsuke/github/GHPullRequestChanges.java
Normal file
@@ -0,0 +1,86 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Wrapper to define changed fields on pull_request action="edited"
|
||||||
|
*
|
||||||
|
* @see GHEventPayload.PullRequest
|
||||||
|
*/
|
||||||
|
@SuppressFBWarnings("UWF_UNWRITTEN_FIELD")
|
||||||
|
public class GHPullRequestChanges {
|
||||||
|
|
||||||
|
private GHCommitPointer base;
|
||||||
|
private GHFrom title;
|
||||||
|
private GHFrom body;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Old target branch for pull request.
|
||||||
|
*
|
||||||
|
* @return old target branch info (or null if not changed)
|
||||||
|
*/
|
||||||
|
public GHCommitPointer getBase() {
|
||||||
|
return base;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Old pull request title.
|
||||||
|
*
|
||||||
|
* @return old pull request title (or null if not changed)
|
||||||
|
*/
|
||||||
|
public GHFrom getTitle() {
|
||||||
|
return title;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Old pull request body.
|
||||||
|
*
|
||||||
|
* @return old pull request body (or null if not changed)
|
||||||
|
*/
|
||||||
|
public GHFrom getBody() {
|
||||||
|
return body;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* @see org.kohsuke.github.GHCommitPointer
|
||||||
|
*/
|
||||||
|
public static class GHCommitPointer {
|
||||||
|
private GHFrom ref;
|
||||||
|
private GHFrom sha;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Named ref to the commit. This (from value) appears to be a "short ref" that doesn't include "refs/heads/"
|
||||||
|
* portion.
|
||||||
|
*
|
||||||
|
* @return the ref
|
||||||
|
*/
|
||||||
|
public GHFrom getRef() {
|
||||||
|
return ref;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* SHA1 of the commit.
|
||||||
|
*
|
||||||
|
* @return sha
|
||||||
|
*/
|
||||||
|
public GHFrom getSha() {
|
||||||
|
return sha;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Wrapper for changed values.
|
||||||
|
*/
|
||||||
|
public static class GHFrom {
|
||||||
|
private String from;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Previous value that was changed.
|
||||||
|
*
|
||||||
|
* @return previous value
|
||||||
|
*/
|
||||||
|
public String getFrom() {
|
||||||
|
return from;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -1,6 +1,6 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.SHADOW_CAT;
|
import static org.kohsuke.github.internal.Previews.SHADOW_CAT;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Lists up pull requests with some filtering and sorting.
|
* Lists up pull requests with some filtering and sorting.
|
||||||
|
|||||||
@@ -46,6 +46,7 @@ public class GHPullRequestReview extends GHObject {
|
|||||||
private String commit_id;
|
private String commit_id;
|
||||||
private GHPullRequestReviewState state;
|
private GHPullRequestReviewState state;
|
||||||
private String submitted_at;
|
private String submitted_at;
|
||||||
|
private String html_url;
|
||||||
|
|
||||||
GHPullRequestReview wrapUp(GHPullRequest owner) {
|
GHPullRequestReview wrapUp(GHPullRequest owner) {
|
||||||
this.owner = owner;
|
this.owner = owner;
|
||||||
@@ -102,7 +103,7 @@ public class GHPullRequestReview extends GHObject {
|
|||||||
|
|
||||||
@Override
|
@Override
|
||||||
public URL getHtmlUrl() {
|
public URL getHtmlUrl() {
|
||||||
return null;
|
return GitHubClient.parseURL(html_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -111,7 +112,7 @@ public class GHPullRequestReview extends GHObject {
|
|||||||
* @return the api route
|
* @return the api route
|
||||||
*/
|
*/
|
||||||
protected String getApiRoute() {
|
protected String getApiRoute() {
|
||||||
return owner.getApiRoute() + "/reviews/" + id;
|
return owner.getApiRoute() + "/reviews/" + getId();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|||||||
@@ -28,7 +28,7 @@ import java.net.URL;
|
|||||||
|
|
||||||
import javax.annotation.CheckForNull;
|
import javax.annotation.CheckForNull;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.*;
|
import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Review comment to the pull request
|
* Review comment to the pull request
|
||||||
@@ -153,7 +153,20 @@ public class GHPullRequestReviewComment extends GHObject implements Reactable {
|
|||||||
* @return the api route
|
* @return the api route
|
||||||
*/
|
*/
|
||||||
protected String getApiRoute() {
|
protected String getApiRoute() {
|
||||||
return "/repos/" + owner.getRepository().getFullName() + "/pulls/comments/" + id;
|
return getApiRoute(false);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets api route.
|
||||||
|
*
|
||||||
|
* @param includePullNumber
|
||||||
|
* if true, includes the owning pull request's number in the route.
|
||||||
|
*
|
||||||
|
* @return the api route
|
||||||
|
*/
|
||||||
|
protected String getApiRoute(boolean includePullNumber) {
|
||||||
|
return "/repos/" + owner.getRepository().getFullName() + "/pulls"
|
||||||
|
+ (includePullNumber ? "/" + owner.getNumber() : "") + "/comments/" + getId();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -192,13 +205,12 @@ public class GHPullRequestReviewComment extends GHObject implements Reactable {
|
|||||||
return owner.root.createRequest()
|
return owner.root.createRequest()
|
||||||
.method("POST")
|
.method("POST")
|
||||||
.with("body", body)
|
.with("body", body)
|
||||||
.with("in_reply_to", getId())
|
.withUrlPath(getApiRoute(true) + "/replies")
|
||||||
.withUrlPath(getApiRoute() + "/comments")
|
|
||||||
.fetch(GHPullRequestReviewComment.class)
|
.fetch(GHPullRequestReviewComment.class)
|
||||||
.wrapUp(owner);
|
.wrapUp(owner);
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHReaction createReaction(ReactionContent content) throws IOException {
|
public GHReaction createReaction(ReactionContent content) throws IOException {
|
||||||
return owner.root.createRequest()
|
return owner.root.createRequest()
|
||||||
@@ -210,7 +222,7 @@ public class GHPullRequestReviewComment extends GHObject implements Reactable {
|
|||||||
.wrap(owner.root);
|
.wrap(owner.root);
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public PagedIterable<GHReaction> listReactions() {
|
public PagedIterable<GHReaction> listReactions() {
|
||||||
return owner.root.createRequest()
|
return owner.root.createRequest()
|
||||||
|
|||||||
@@ -7,8 +7,7 @@ package org.kohsuke.github;
|
|||||||
* the type parameter
|
* the type parameter
|
||||||
* @author Kohsuke Kawaguchi
|
* @author Kohsuke Kawaguchi
|
||||||
*/
|
*/
|
||||||
public abstract class GHQueryBuilder<T> {
|
public abstract class GHQueryBuilder<T> extends GitHubInteractiveObject {
|
||||||
protected final GitHub root;
|
|
||||||
protected final Requester req;
|
protected final Requester req;
|
||||||
|
|
||||||
GHQueryBuilder(GitHub root) {
|
GHQueryBuilder(GitHub root) {
|
||||||
|
|||||||
@@ -6,11 +6,13 @@ import com.fasterxml.jackson.annotation.JsonProperty;
|
|||||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
import org.apache.commons.lang3.StringUtils;
|
import org.apache.commons.lang3.StringUtils;
|
||||||
|
|
||||||
|
import java.time.Duration;
|
||||||
import java.time.ZonedDateTime;
|
import java.time.ZonedDateTime;
|
||||||
import java.time.format.DateTimeFormatter;
|
import java.time.format.DateTimeFormatter;
|
||||||
import java.time.format.DateTimeParseException;
|
import java.time.format.DateTimeParseException;
|
||||||
import java.util.Date;
|
import java.util.Date;
|
||||||
import java.util.Objects;
|
import java.util.Objects;
|
||||||
|
import java.util.concurrent.atomic.AtomicReference;
|
||||||
import java.util.logging.Logger;
|
import java.util.logging.Logger;
|
||||||
|
|
||||||
import javax.annotation.CheckForNull;
|
import javax.annotation.CheckForNull;
|
||||||
@@ -29,7 +31,7 @@ public class GHRateLimit {
|
|||||||
/**
|
/**
|
||||||
* Remaining calls that can be made.
|
* Remaining calls that can be made.
|
||||||
*
|
*
|
||||||
* @deprecated This value should never have been made public. Use {@link #getRemaining()}
|
* @deprecated This field should never have been made public. Use {@link #getRemaining()}
|
||||||
*/
|
*/
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public int remaining;
|
public int remaining;
|
||||||
@@ -37,7 +39,7 @@ public class GHRateLimit {
|
|||||||
/**
|
/**
|
||||||
* Allotted API call per hour.
|
* Allotted API call per hour.
|
||||||
*
|
*
|
||||||
* @deprecated This value should never have been made public. Use {@link #getLimit()}
|
* @deprecated This field should never have been made public. Use {@link #getLimit()}
|
||||||
*/
|
*/
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public int limit;
|
public int limit;
|
||||||
@@ -48,7 +50,7 @@ public class GHRateLimit {
|
|||||||
* date. To use this field in any meaningful way, it must be converted to a long using {@link Date#getTime()}
|
* date. To use this field in any meaningful way, it must be converted to a long using {@link Date#getTime()}
|
||||||
* multiplied by 1000.
|
* multiplied by 1000.
|
||||||
*
|
*
|
||||||
* @deprecated This value should never have been made public. Use {@link #getResetDate()}
|
* @deprecated This field should never have been made public. Use {@link #getResetDate()}
|
||||||
*/
|
*/
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public Date reset;
|
public Date reset;
|
||||||
@@ -65,17 +67,58 @@ public class GHRateLimit {
|
|||||||
@Nonnull
|
@Nonnull
|
||||||
private final Record integrationManifest;
|
private final Record integrationManifest;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The default GHRateLimit provided to new {@link GitHubClient}s.
|
||||||
|
*
|
||||||
|
* Contains all expired records that will cause {@link GitHubClient#rateLimit(RateLimitTarget)} to refresh with new
|
||||||
|
* data when called.
|
||||||
|
*
|
||||||
|
* Private, but made internal for testing.
|
||||||
|
*/
|
||||||
@Nonnull
|
@Nonnull
|
||||||
static GHRateLimit Unknown() {
|
static final GHRateLimit DEFAULT = new GHRateLimit(UnknownLimitRecord.DEFAULT,
|
||||||
return new GHRateLimit(new UnknownLimitRecord(),
|
UnknownLimitRecord.DEFAULT,
|
||||||
new UnknownLimitRecord(),
|
UnknownLimitRecord.DEFAULT,
|
||||||
new UnknownLimitRecord(),
|
UnknownLimitRecord.DEFAULT);
|
||||||
new UnknownLimitRecord());
|
|
||||||
}
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Creates a new {@link GHRateLimit} from a single record for the specified endpoint with place holders for other
|
||||||
|
* records.
|
||||||
|
*
|
||||||
|
* This is used to create {@link GHRateLimit} instances that can merged with other instances.
|
||||||
|
*
|
||||||
|
* @param record
|
||||||
|
* the rate limit record. Can be a regular {@link Record} constructed from header information or an
|
||||||
|
* {@link UnknownLimitRecord} placeholder.
|
||||||
|
* @param rateLimitTarget
|
||||||
|
* which rate limit record to fill
|
||||||
|
* @return a new {@link GHRateLimit} instance containing the supplied record
|
||||||
|
*/
|
||||||
@Nonnull
|
@Nonnull
|
||||||
static GHRateLimit fromHeaderRecord(Record header) {
|
static GHRateLimit fromRecord(@Nonnull Record record, @Nonnull RateLimitTarget rateLimitTarget) {
|
||||||
return new GHRateLimit(header, new UnknownLimitRecord(), new UnknownLimitRecord(), new UnknownLimitRecord());
|
if (rateLimitTarget == RateLimitTarget.CORE || rateLimitTarget == RateLimitTarget.NONE) {
|
||||||
|
return new GHRateLimit(record,
|
||||||
|
UnknownLimitRecord.DEFAULT,
|
||||||
|
UnknownLimitRecord.DEFAULT,
|
||||||
|
UnknownLimitRecord.DEFAULT);
|
||||||
|
} else if (rateLimitTarget == RateLimitTarget.SEARCH) {
|
||||||
|
return new GHRateLimit(UnknownLimitRecord.DEFAULT,
|
||||||
|
record,
|
||||||
|
UnknownLimitRecord.DEFAULT,
|
||||||
|
UnknownLimitRecord.DEFAULT);
|
||||||
|
} else if (rateLimitTarget == RateLimitTarget.GRAPHQL) {
|
||||||
|
return new GHRateLimit(UnknownLimitRecord.DEFAULT,
|
||||||
|
UnknownLimitRecord.DEFAULT,
|
||||||
|
record,
|
||||||
|
UnknownLimitRecord.DEFAULT);
|
||||||
|
} else if (rateLimitTarget == RateLimitTarget.INTEGRATION_MANIFEST) {
|
||||||
|
return new GHRateLimit(UnknownLimitRecord.DEFAULT,
|
||||||
|
UnknownLimitRecord.DEFAULT,
|
||||||
|
UnknownLimitRecord.DEFAULT,
|
||||||
|
record);
|
||||||
|
} else {
|
||||||
|
throw new IllegalArgumentException("Unknown rate limit target: " + rateLimitTarget.toString());
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@JsonCreator
|
@JsonCreator
|
||||||
@@ -142,7 +185,7 @@ public class GHRateLimit {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Whether the rate limit reset date for this instance has passed.
|
* Whether the reset date for the Core API rate limit has passed.
|
||||||
*
|
*
|
||||||
* @return true if the rate limit reset date has passed. Otherwise false.
|
* @return true if the rate limit reset date has passed. Otherwise false.
|
||||||
* @since 1.100
|
* @since 1.100
|
||||||
@@ -152,7 +195,7 @@ public class GHRateLimit {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The core object provides your rate limit status for all non-search-related resources in the REST API.
|
* The core object provides the rate limit status for all non-search-related resources in the REST API.
|
||||||
*
|
*
|
||||||
* @return a rate limit record
|
* @return a rate limit record
|
||||||
* @since 1.100
|
* @since 1.100
|
||||||
@@ -163,42 +206,43 @@ public class GHRateLimit {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The search object provides your rate limit status for the Search API. TODO: integrate with header limit updating.
|
* The search record provides the rate limit status for the Search API.
|
||||||
* Issue #605.
|
|
||||||
*
|
*
|
||||||
* @return a rate limit record
|
* @return a rate limit record
|
||||||
|
* @since 1.115
|
||||||
*/
|
*/
|
||||||
@Nonnull
|
@Nonnull
|
||||||
Record getSearch() {
|
public Record getSearch() {
|
||||||
return search;
|
return search;
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The graphql object provides your rate limit status for the GraphQL API. TODO: integrate with header limit
|
* The graphql record provides the rate limit status for the GraphQL API.
|
||||||
* updating. Issue #605.
|
|
||||||
*
|
*
|
||||||
* @return a rate limit record
|
* @return a rate limit record
|
||||||
|
* @since 1.115
|
||||||
*/
|
*/
|
||||||
@Nonnull
|
@Nonnull
|
||||||
Record getGraphQL() {
|
public Record getGraphQL() {
|
||||||
return graphql;
|
return graphql;
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The integration_manifest object provides your rate limit status for the GitHub App Manifest code conversion
|
* The integration manifest record provides the rate limit status for the GitHub App Manifest code conversion
|
||||||
* endpoint. TODO: integrate with header limit updating. Issue #605.
|
* endpoint.
|
||||||
*
|
*
|
||||||
* @return a rate limit record
|
* @return a rate limit record
|
||||||
|
* @since 1.115
|
||||||
*/
|
*/
|
||||||
@Nonnull
|
@Nonnull
|
||||||
Record getIntegrationManifest() {
|
public Record getIntegrationManifest() {
|
||||||
return integrationManifest;
|
return integrationManifest;
|
||||||
}
|
}
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
public String toString() {
|
public String toString() {
|
||||||
return "GHRateLimit {" + "core " + getCore().toString() + "search " + getSearch().toString() + "graphql "
|
return "GHRateLimit {" + "core " + getCore().toString() + ", search " + getSearch().toString() + ", graphql "
|
||||||
+ getGraphQL().toString() + "integrationManifest " + getIntegrationManifest().toString() + '}';
|
+ getGraphQL().toString() + ", integrationManifest " + getIntegrationManifest().toString() + "}";
|
||||||
}
|
}
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
@@ -221,44 +265,113 @@ public class GHRateLimit {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets the appropriate {@link Record} for a particular url path.
|
* Merge a {@link GHRateLimit} with another one to create a new {@link GHRateLimit} keeping the latest
|
||||||
|
* {@link Record}s from each.
|
||||||
*
|
*
|
||||||
* @param urlPath
|
* @param newLimit
|
||||||
* the url path of the request
|
* {@link GHRateLimit} with potentially updated {@link Record}s.
|
||||||
* @return the {@link Record} for a url path.
|
* @return a merged {@link GHRateLimit} with the latest {@link Record}s from these two instances. If the merged
|
||||||
|
* instance is equal to the current instance, the current instance is returned.
|
||||||
*/
|
*/
|
||||||
@Nonnull
|
@Nonnull
|
||||||
Record getRecordForUrlPath(@Nonnull String urlPath) {
|
GHRateLimit getMergedRateLimit(@Nonnull GHRateLimit newLimit) {
|
||||||
if (urlPath.equals("/rate_limit")) {
|
|
||||||
return new UnknownLimitRecord();
|
GHRateLimit merged = new GHRateLimit(getCore().currentOrUpdated(newLimit.getCore()),
|
||||||
} else if (urlPath.startsWith("/search")) {
|
getSearch().currentOrUpdated(newLimit.getSearch()),
|
||||||
return getSearch();
|
getGraphQL().currentOrUpdated(newLimit.getGraphQL()),
|
||||||
} else if (urlPath.startsWith("/graphql")) {
|
getIntegrationManifest().currentOrUpdated(newLimit.getIntegrationManifest()));
|
||||||
return getGraphQL();
|
|
||||||
} else if (urlPath.startsWith("/app-manifests")) {
|
if (merged.equals(this)) {
|
||||||
return getIntegrationManifest();
|
merged = this;
|
||||||
} else {
|
}
|
||||||
|
|
||||||
|
return merged;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the specified {@link Record}.
|
||||||
|
*
|
||||||
|
* {@link RateLimitTarget#NONE} will return {@link UnknownLimitRecord#DEFAULT} to prevent any clients from
|
||||||
|
* accidentally waiting on that record to reset before continuing.
|
||||||
|
*
|
||||||
|
* @param rateLimitTarget
|
||||||
|
* the target rate limit record
|
||||||
|
* @return the target {@link Record} from this instance.
|
||||||
|
*/
|
||||||
|
@Nonnull
|
||||||
|
Record getRecord(@Nonnull RateLimitTarget rateLimitTarget) {
|
||||||
|
if (rateLimitTarget == RateLimitTarget.CORE) {
|
||||||
return getCore();
|
return getCore();
|
||||||
|
} else if (rateLimitTarget == RateLimitTarget.SEARCH) {
|
||||||
|
return getSearch();
|
||||||
|
} else if (rateLimitTarget == RateLimitTarget.GRAPHQL) {
|
||||||
|
return getGraphQL();
|
||||||
|
} else if (rateLimitTarget == RateLimitTarget.INTEGRATION_MANIFEST) {
|
||||||
|
return getIntegrationManifest();
|
||||||
|
} else if (rateLimitTarget == RateLimitTarget.NONE) {
|
||||||
|
return UnknownLimitRecord.DEFAULT;
|
||||||
|
} else {
|
||||||
|
throw new IllegalArgumentException("Unknown rate limit target: " + rateLimitTarget.toString());
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* A limit record used as a placeholder when the the actual limit is not known.
|
* A limit record used as a placeholder when the the actual limit is not known.
|
||||||
* <p>
|
|
||||||
* Has a large limit and long duration so that it will doesn't expire too often.
|
|
||||||
*
|
*
|
||||||
* @since 1.100
|
* @since 1.100
|
||||||
*/
|
*/
|
||||||
public static class UnknownLimitRecord extends Record {
|
public static class UnknownLimitRecord extends Record {
|
||||||
|
|
||||||
// One hour
|
private static final long defaultUnknownLimitResetSeconds = Duration.ofSeconds(30).getSeconds();
|
||||||
private static final long unknownLimitResetSeconds = 60L * 60L;
|
|
||||||
|
/**
|
||||||
|
* The number of seconds until a {@link UnknownLimitRecord} will expire.
|
||||||
|
*
|
||||||
|
* This is set to a somewhat short duration, rather than a long one. This avoids
|
||||||
|
* {@link {@link GitHubClient#rateLimit(RateLimitTarget)}} requesting rate limit updates continuously, but also
|
||||||
|
* avoids holding on to stale unknown records indefinitely.
|
||||||
|
*
|
||||||
|
* When merging {@link GHRateLimit} instances, {@link UnknownLimitRecord}s will be superseded by incoming
|
||||||
|
* regular {@link Record}s.
|
||||||
|
*
|
||||||
|
* @see GHRateLimit#getMergedRateLimit(GHRateLimit)
|
||||||
|
*/
|
||||||
|
static long unknownLimitResetSeconds = defaultUnknownLimitResetSeconds;
|
||||||
|
|
||||||
static final int unknownLimit = 1000000;
|
static final int unknownLimit = 1000000;
|
||||||
static final int unknownRemaining = 999999;
|
static final int unknownRemaining = 999999;
|
||||||
|
|
||||||
private UnknownLimitRecord() {
|
// The default UnknownLimitRecord is an expired record.
|
||||||
super(unknownLimit, unknownRemaining, System.currentTimeMillis() / 1000L + unknownLimitResetSeconds);
|
private static final UnknownLimitRecord DEFAULT = new UnknownLimitRecord(Long.MIN_VALUE);
|
||||||
|
|
||||||
|
// The starting current UnknownLimitRecord is an expired record.
|
||||||
|
private static final AtomicReference<UnknownLimitRecord> current = new AtomicReference<>(DEFAULT);
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Create a new unknown record that resets at the specified time.
|
||||||
|
*
|
||||||
|
* @param resetEpochSeconds
|
||||||
|
* the epoch second time when this record will expire.
|
||||||
|
*/
|
||||||
|
private UnknownLimitRecord(long resetEpochSeconds) {
|
||||||
|
super(unknownLimit, unknownRemaining, resetEpochSeconds);
|
||||||
|
}
|
||||||
|
|
||||||
|
static Record current() {
|
||||||
|
Record result = current.get();
|
||||||
|
if (result.isExpired()) {
|
||||||
|
current.set(new UnknownLimitRecord(System.currentTimeMillis() / 1000L + unknownLimitResetSeconds));
|
||||||
|
result = current.get();
|
||||||
|
}
|
||||||
|
return result;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Reset the current UnknownLimitRecord. For use during testing only.
|
||||||
|
*/
|
||||||
|
static void reset() {
|
||||||
|
current.set(DEFAULT);
|
||||||
|
unknownLimitResetSeconds = defaultUnknownLimitResetSeconds;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -274,14 +387,12 @@ public class GHRateLimit {
|
|||||||
private final int remaining;
|
private final int remaining;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Allotted API call per hour.
|
* Allotted API call per time period.
|
||||||
*/
|
*/
|
||||||
private final int limit;
|
private final int limit;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The time at which the current rate limit window resets in UTC epoch seconds.
|
* The time at which the current rate limit window resets in UTC epoch seconds.
|
||||||
*
|
|
||||||
* This is the raw value returned by the server.
|
|
||||||
*/
|
*/
|
||||||
private final long resetEpochSeconds;
|
private final long resetEpochSeconds;
|
||||||
|
|
||||||
@@ -291,9 +402,11 @@ public class GHRateLimit {
|
|||||||
private final long createdAtEpochSeconds = System.currentTimeMillis() / 1000;
|
private final long createdAtEpochSeconds = System.currentTimeMillis() / 1000;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The time at which the rate limit will reset. This value is calculated based on
|
* The date at which the rate limit will reset, adjusted to local machine time if the local machine's clock not
|
||||||
* {@link #getResetEpochSeconds()} by calling {@link #calculateResetDate}. If the clock on the local machine not
|
* synchronized with to the same clock as the GitHub server.
|
||||||
* synchronized with the server clock, this time value will be adjusted to match the local machine's clock.
|
*
|
||||||
|
* @see #calculateResetDate(String)
|
||||||
|
* @see #getResetDate()
|
||||||
*/
|
*/
|
||||||
@Nonnull
|
@Nonnull
|
||||||
private final Date resetDate;
|
private final Date resetDate;
|
||||||
@@ -341,12 +454,58 @@ public class GHRateLimit {
|
|||||||
this.resetDate = calculateResetDate(updatedAt);
|
this.resetDate = calculateResetDate(updatedAt);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Determine if the current {@link Record} is outdated compared to another. Rate Limit dates are only accurate
|
||||||
|
* to the second, so we look at other information in the record as well.
|
||||||
|
*
|
||||||
|
* {@link Record}s with earlier {@link #getResetEpochSeconds()} are replaced by those with later.
|
||||||
|
* {@link Record}s with the same {@link #getResetEpochSeconds()} are replaced by those with less remaining
|
||||||
|
* count.
|
||||||
|
*
|
||||||
|
* {@link UnknownLimitRecord}s compare with each other like regular {@link Record}s.
|
||||||
|
*
|
||||||
|
* {@link Record}s are replaced by {@link UnknownLimitRecord}s only when the current {@link Record} is expired
|
||||||
|
* and the {@link UnknownLimitRecord} is not. Otherwise Regular {@link Record}s are not replaced by
|
||||||
|
* {@link UnknownLimitRecord}s.
|
||||||
|
*
|
||||||
|
* Expiration is only considered after other checks, meaning expired records may sometimes be replaced by other
|
||||||
|
* expired records.
|
||||||
|
*
|
||||||
|
* @param other
|
||||||
|
* the other {@link Record}
|
||||||
|
* @return the {@link Record} that is most current
|
||||||
|
*/
|
||||||
|
Record currentOrUpdated(@Nonnull Record other) {
|
||||||
|
// This set of checks avoids most calls to isExpired()
|
||||||
|
// Depends on UnknownLimitRecord.current() to prevent continuous updating of GHRateLimit rateLimit()
|
||||||
|
if (getResetEpochSeconds() > other.getResetEpochSeconds()
|
||||||
|
|| (getResetEpochSeconds() == other.getResetEpochSeconds()
|
||||||
|
&& getRemaining() <= other.getRemaining())) {
|
||||||
|
// If the current record has a later reset
|
||||||
|
// or the current record has the same reset and fewer or same requests remaining
|
||||||
|
// Then it is most recent
|
||||||
|
return this;
|
||||||
|
} else if (!(other instanceof UnknownLimitRecord)) {
|
||||||
|
// If the above is not the case that means other has a later reset
|
||||||
|
// or the same resent and fewer requests remaining.
|
||||||
|
// If the other record is not an unknown record, the the other is more recent
|
||||||
|
return other;
|
||||||
|
} else if (this.isExpired() && !other.isExpired()) {
|
||||||
|
// The other is an unknown record.
|
||||||
|
// If the current record has expired and the other hasn't, return the other.
|
||||||
|
return other;
|
||||||
|
}
|
||||||
|
|
||||||
|
// If none of the above, the current record is most valid.
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Recalculates the {@link #resetDate} relative to the local machine clock.
|
* Recalculates the {@link #resetDate} relative to the local machine clock.
|
||||||
* <p>
|
* <p>
|
||||||
* {@link RateLimitChecker}s and {@link RateLimitHandler}s use {@link #getResetDate()} to make decisions about
|
* {@link RateLimitChecker}s and {@link RateLimitHandler}s use {@link #getResetDate()} to make decisions about
|
||||||
* how long to wait for until for the rate limit to reset. That means that {@link #getResetDate()} needs to be
|
* how long to wait for until for the rate limit to reset. That means that {@link #getResetDate()} needs to be
|
||||||
* accurate to the local machine.
|
* calculated based on the local machine clock.
|
||||||
* </p>
|
* </p>
|
||||||
* <p>
|
* <p>
|
||||||
* When we say that the clock on two machines is "synchronized", we mean that the UTC time returned from
|
* When we say that the clock on two machines is "synchronized", we mean that the UTC time returned from
|
||||||
@@ -415,7 +574,7 @@ public class GHRateLimit {
|
|||||||
* {@link #getResetDate()} or implement a {@link RateLimitChecker} instead.
|
* {@link #getResetDate()} or implement a {@link RateLimitChecker} instead.
|
||||||
*
|
*
|
||||||
* @return a long representing the time in epoch seconds when the rate limit will reset
|
* @return a long representing the time in epoch seconds when the rate limit will reset
|
||||||
* @see #getResetDate() #getResetDate()
|
* @see #getResetDate()
|
||||||
*/
|
*/
|
||||||
public long getResetEpochSeconds() {
|
public long getResetEpochSeconds() {
|
||||||
return resetEpochSeconds;
|
return resetEpochSeconds;
|
||||||
@@ -424,6 +583,8 @@ public class GHRateLimit {
|
|||||||
/**
|
/**
|
||||||
* Whether the rate limit reset date indicated by this instance is expired
|
* Whether the rate limit reset date indicated by this instance is expired
|
||||||
*
|
*
|
||||||
|
* If attempting to wait for the rate limit to reset, consider implementing a {@link RateLimitChecker} instead.
|
||||||
|
*
|
||||||
* @return true if the rate limit reset date has passed. Otherwise false.
|
* @return true if the rate limit reset date has passed. Otherwise false.
|
||||||
*/
|
*/
|
||||||
public boolean isExpired() {
|
public boolean isExpired() {
|
||||||
@@ -431,8 +592,8 @@ public class GHRateLimit {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Returns the date at which the rate limit will reset, adjusted to local machine time if the local machine's
|
* The date at which the rate limit will reset, adjusted to local machine time if the local machine's clock not
|
||||||
* clock not synchronized with to the same clock as the GitHub server.
|
* synchronized with to the same clock as the GitHub server.
|
||||||
*
|
*
|
||||||
* If attempting to wait for the rate limit to reset, consider implementing a {@link RateLimitChecker} instead.
|
* If attempting to wait for the rate limit to reset, consider implementing a {@link RateLimitChecker} instead.
|
||||||
*
|
*
|
||||||
|
|||||||
@@ -3,7 +3,7 @@ package org.kohsuke.github;
|
|||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.*;
|
import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Reaction to issue, comment, PR, and so on.
|
* Reaction to issue, comment, PR, and so on.
|
||||||
@@ -11,10 +11,9 @@ import static org.kohsuke.github.Previews.*;
|
|||||||
* @author Kohsuke Kawaguchi
|
* @author Kohsuke Kawaguchi
|
||||||
* @see Reactable
|
* @see Reactable
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public class GHReaction extends GHObject {
|
public class GHReaction extends GHObject {
|
||||||
private GitHub root;
|
|
||||||
|
|
||||||
private GHUser user;
|
private GHUser user;
|
||||||
private ReactionContent content;
|
private ReactionContent content;
|
||||||
@@ -58,6 +57,6 @@ public class GHReaction extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void delete() throws IOException {
|
public void delete() throws IOException {
|
||||||
root.createRequest().method("DELETE").withPreview(SQUIRREL_GIRL).withUrlPath("/reactions/" + id).send();
|
root.createRequest().method("DELETE").withPreview(SQUIRREL_GIRL).withUrlPath("/reactions/" + getId()).send();
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -1,5 +1,6 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import com.fasterxml.jackson.databind.JsonMappingException;
|
||||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
@@ -10,9 +11,7 @@ import java.net.URL;
|
|||||||
*
|
*
|
||||||
* @author Michael Clarke
|
* @author Michael Clarke
|
||||||
*/
|
*/
|
||||||
public class GHRef {
|
public class GHRef extends GitHubInteractiveObject {
|
||||||
/* package almost final */ GitHub root;
|
|
||||||
|
|
||||||
private String ref, url;
|
private String ref, url;
|
||||||
private GHObject object;
|
private GHObject object;
|
||||||
|
|
||||||
@@ -90,6 +89,78 @@ public class GHRef {
|
|||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Retrive a ref of the given type for the current GitHub repository.
|
||||||
|
*
|
||||||
|
* @param repository
|
||||||
|
* the repository to read from
|
||||||
|
* @param refName
|
||||||
|
* eg: heads/branch
|
||||||
|
* @return refs matching the request type
|
||||||
|
* @throws IOException
|
||||||
|
* on failure communicating with GitHub, potentially due to an invalid ref type being requested
|
||||||
|
*/
|
||||||
|
static GHRef read(GHRepository repository, String refName) throws IOException {
|
||||||
|
// Also accept e.g. "refs/heads/branch" for consistency with createRef().
|
||||||
|
if (refName.startsWith("refs/")) {
|
||||||
|
refName = refName.replaceFirst("refs/", "");
|
||||||
|
}
|
||||||
|
|
||||||
|
// We would expect this to use `git/ref/%s` but some versions of GHE seem to not support it
|
||||||
|
// Instead use `git/refs/%s` and check the result actually matches the ref
|
||||||
|
GHRef result = null;
|
||||||
|
try {
|
||||||
|
result = repository.root.createRequest()
|
||||||
|
.withUrlPath(repository.getApiTailUrl(String.format("git/refs/%s", refName)))
|
||||||
|
.fetch(GHRef.class)
|
||||||
|
.wrap(repository.root);
|
||||||
|
} catch (IOException e) {
|
||||||
|
// If the parse exception is due to the above returning an array instead of a single ref
|
||||||
|
// that means the individual ref did not exist. Handled by result check below.
|
||||||
|
// Otherwise, rethrow.
|
||||||
|
if (!(e.getCause() instanceof JsonMappingException)) {
|
||||||
|
throw e;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Verify that the ref returned is the one requested
|
||||||
|
// Used .endsWith(refName) instead of .equals("refs/" + refName) to workaround a GitBucket
|
||||||
|
// issue where the "ref" field omits the "refs/" prefix. "endsWith()" is functionally
|
||||||
|
// the same for this scenario - the server refs matching is prefix-based, so
|
||||||
|
// a ref that ends with the correct string will always be the correct one.
|
||||||
|
if (result == null || !result.getRef().endsWith(refName)) {
|
||||||
|
throw new GHFileNotFoundException(String.format("git/refs/%s", refName)
|
||||||
|
+ " {\"message\":\"Not Found\",\"documentation_url\":\"https://developer.github.com/v3/git/refs/#get-a-reference\"}");
|
||||||
|
}
|
||||||
|
return result;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Retrieves all refs of the given type for the current GitHub repository.
|
||||||
|
*
|
||||||
|
* @param repository
|
||||||
|
* the repository to read from
|
||||||
|
* @param refType
|
||||||
|
* the type of reg to search for e.g. <code>tags</code> or <code>commits</code>
|
||||||
|
* @return paged iterable of all refs of the specified type
|
||||||
|
* @throws IOException
|
||||||
|
* on failure communicating with GitHub, potentially due to an invalid ref type being requested
|
||||||
|
*/
|
||||||
|
static PagedIterable<GHRef> readMatching(GHRepository repository, String refType) throws IOException {
|
||||||
|
if (refType.startsWith("refs/")) {
|
||||||
|
refType = refType.replaceFirst("refs/", "");
|
||||||
|
}
|
||||||
|
|
||||||
|
String url = repository.getApiTailUrl(String.format("git/refs/%s", refType));
|
||||||
|
// if no types, do not end with slash just to be safe.
|
||||||
|
if (refType.equals("")) {
|
||||||
|
url = url.substring(0, url.length() - 1);
|
||||||
|
}
|
||||||
|
return repository.root.createRequest()
|
||||||
|
.withUrlPath(url)
|
||||||
|
.toIterable(GHRef[].class, item -> item.wrap(repository.root));
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The type GHObject.
|
* The type GHObject.
|
||||||
*/
|
*/
|
||||||
|
|||||||
@@ -15,14 +15,15 @@ import static java.lang.String.*;
|
|||||||
* Release in a github repository.
|
* Release in a github repository.
|
||||||
*
|
*
|
||||||
* @see GHRepository#getReleases() GHRepository#getReleases()
|
* @see GHRepository#getReleases() GHRepository#getReleases()
|
||||||
|
* @see GHRepository#listReleases() () GHRepository#listReleases()
|
||||||
* @see GHRepository#createRelease(String) GHRepository#createRelease(String)
|
* @see GHRepository#createRelease(String) GHRepository#createRelease(String)
|
||||||
*/
|
*/
|
||||||
public class GHRelease extends GHObject {
|
public class GHRelease extends GHObject {
|
||||||
GitHub root;
|
|
||||||
GHRepository owner;
|
GHRepository owner;
|
||||||
|
|
||||||
private String html_url;
|
private String html_url;
|
||||||
private String assets_url;
|
private String assets_url;
|
||||||
|
private List<GHAsset> assets;
|
||||||
private String upload_url;
|
private String upload_url;
|
||||||
private String tag_name;
|
private String tag_name;
|
||||||
private String target_commitish;
|
private String target_commitish;
|
||||||
@@ -249,18 +250,44 @@ public class GHRelease extends GHObject {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets assets.
|
* Get the cached assets.
|
||||||
|
*
|
||||||
|
* @return the assets
|
||||||
|
*
|
||||||
|
* @deprecated This should be the default behavior of {@link #getAssets()} in a future release. This method is
|
||||||
|
* introduced in addition to enable a transition to using cached asset information while keeping the
|
||||||
|
* existing logic in place for backwards compatibility.
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
public List<GHAsset> assets() {
|
||||||
|
return assets;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Re-fetch the assets of this release.
|
||||||
|
*
|
||||||
|
* @return the assets
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
* @deprecated The behavior of this method will change in a future release. It will then provide cached assets as
|
||||||
|
* provided by {@link #assets()}. Use {@link #listAssets()} instead to fetch up-to-date information of
|
||||||
|
* assets.
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
public List<GHAsset> getAssets() throws IOException {
|
||||||
|
return listAssets().toList();
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Re-fetch the assets of this release.
|
||||||
*
|
*
|
||||||
* @return the assets
|
* @return the assets
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public List<GHAsset> getAssets() throws IOException {
|
public PagedIterable<GHAsset> listAssets() throws IOException {
|
||||||
Requester builder = owner.root.createRequest();
|
Requester builder = owner.root.createRequest();
|
||||||
|
return builder.withUrlPath(getApiTailUrl("assets")).toIterable(GHAsset[].class, item -> item.wrap(this));
|
||||||
return builder.withUrlPath(getApiTailUrl("assets"))
|
|
||||||
.toIterable(GHAsset[].class, item -> item.wrap(this))
|
|
||||||
.toList();
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -270,7 +297,7 @@ public class GHRelease extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void delete() throws IOException {
|
public void delete() throws IOException {
|
||||||
root.createRequest().method("DELETE").withUrlPath(owner.getApiTailUrl("releases/" + id)).send();
|
root.createRequest().method("DELETE").withUrlPath(owner.getApiTailUrl("releases/" + getId())).send();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -283,6 +310,6 @@ public class GHRelease extends GHObject {
|
|||||||
}
|
}
|
||||||
|
|
||||||
private String getApiTailUrl(String end) {
|
private String getApiTailUrl(String end) {
|
||||||
return owner.getApiTailUrl(format("releases/%s/%s", id, end));
|
return owner.getApiTailUrl(format("releases/%s/%s", getId(), end));
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -41,7 +41,7 @@ public class GHReleaseBuilder {
|
|||||||
* Specifies the commitish value that determines where the Git tag is created from. Can be any branch or commit SHA.
|
* Specifies the commitish value that determines where the Git tag is created from. Can be any branch or commit SHA.
|
||||||
*
|
*
|
||||||
* @param commitish
|
* @param commitish
|
||||||
* Defaults to the repository’s default branch (usually "master"). Unused if the Git tag already exists.
|
* Defaults to the repository’s default branch (usually "main"). Unused if the Git tag already exists.
|
||||||
* @return the gh release builder
|
* @return the gh release builder
|
||||||
*/
|
*/
|
||||||
public GHReleaseBuilder commitish(String commitish) {
|
public GHReleaseBuilder commitish(String commitish) {
|
||||||
|
|||||||
@@ -45,7 +45,7 @@ public class GHReleaseUpdater {
|
|||||||
* Specifies the commitish value that determines where the Git tag is created from. Can be any branch or commit SHA.
|
* Specifies the commitish value that determines where the Git tag is created from. Can be any branch or commit SHA.
|
||||||
*
|
*
|
||||||
* @param commitish
|
* @param commitish
|
||||||
* Defaults to the repository’s default branch (usually "master"). Unused if the Git tag already exists.
|
* Defaults to the repository’s default branch (usually "main"). Unused if the Git tag already exists.
|
||||||
* @return the gh release updater
|
* @return the gh release updater
|
||||||
*/
|
*/
|
||||||
public GHReleaseUpdater commitish(String commitish) {
|
public GHReleaseUpdater commitish(String commitish) {
|
||||||
@@ -100,7 +100,7 @@ public class GHReleaseUpdater {
|
|||||||
*/
|
*/
|
||||||
public GHRelease update() throws IOException {
|
public GHRelease update() throws IOException {
|
||||||
return builder.method("PATCH")
|
return builder.method("PATCH")
|
||||||
.withUrlPath(base.owner.getApiTailUrl("releases/" + base.id))
|
.withUrlPath(base.owner.getApiTailUrl("releases/" + base.getId()))
|
||||||
.fetch(GHRelease.class)
|
.fetch(GHRelease.class)
|
||||||
.wrap(base.owner);
|
.wrap(base.owner);
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -18,6 +18,6 @@ class GHRepoHook extends GHHook {
|
|||||||
|
|
||||||
@Override
|
@Override
|
||||||
String getApiRoute() {
|
String getApiRoute() {
|
||||||
return String.format("/repos/%s/%s/hooks/%d", repository.getOwnerName(), repository.getName(), id);
|
return String.format("/repos/%s/%s/hooks/%d", repository.getOwnerName(), repository.getName(), getId());
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -24,11 +24,14 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
import com.fasterxml.jackson.annotation.JsonProperty;
|
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||||
|
import com.fasterxml.jackson.core.JsonParseException;
|
||||||
import com.infradna.tool.bridge_method_injector.WithBridgeMethods;
|
import com.infradna.tool.bridge_method_injector.WithBridgeMethods;
|
||||||
import edu.umd.cs.findbugs.annotations.CheckForNull;
|
import edu.umd.cs.findbugs.annotations.CheckForNull;
|
||||||
import edu.umd.cs.findbugs.annotations.NonNull;
|
import edu.umd.cs.findbugs.annotations.NonNull;
|
||||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
import org.apache.commons.lang3.StringUtils;
|
import org.apache.commons.lang3.StringUtils;
|
||||||
|
import org.kohsuke.github.function.InputStreamFunction;
|
||||||
|
import org.kohsuke.github.internal.EnumUtils;
|
||||||
|
|
||||||
import java.io.FileNotFoundException;
|
import java.io.FileNotFoundException;
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
@@ -45,14 +48,26 @@ import java.util.Date;
|
|||||||
import java.util.HashMap;
|
import java.util.HashMap;
|
||||||
import java.util.HashSet;
|
import java.util.HashSet;
|
||||||
import java.util.Iterator;
|
import java.util.Iterator;
|
||||||
|
import java.util.LinkedHashSet;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
|
import java.util.Locale;
|
||||||
import java.util.Map;
|
import java.util.Map;
|
||||||
import java.util.Set;
|
import java.util.Set;
|
||||||
import java.util.TreeMap;
|
import java.util.TreeMap;
|
||||||
import java.util.WeakHashMap;
|
import java.util.WeakHashMap;
|
||||||
|
|
||||||
import static java.util.Arrays.*;
|
import javax.annotation.Nonnull;
|
||||||
import static org.kohsuke.github.Previews.*;
|
|
||||||
|
import static java.util.Arrays.asList;
|
||||||
|
import static java.util.Objects.requireNonNull;
|
||||||
|
import static org.kohsuke.github.internal.Previews.ANTIOPE;
|
||||||
|
import static org.kohsuke.github.internal.Previews.ANT_MAN;
|
||||||
|
import static org.kohsuke.github.internal.Previews.BAPTISTE;
|
||||||
|
import static org.kohsuke.github.internal.Previews.FLASH;
|
||||||
|
import static org.kohsuke.github.internal.Previews.INERTIA;
|
||||||
|
import static org.kohsuke.github.internal.Previews.MERCY;
|
||||||
|
import static org.kohsuke.github.internal.Previews.NEBULA;
|
||||||
|
import static org.kohsuke.github.internal.Previews.SHADOW_CAT;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* A repository on GitHub.
|
* A repository on GitHub.
|
||||||
@@ -63,10 +78,11 @@ import static org.kohsuke.github.Previews.*;
|
|||||||
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public class GHRepository extends GHObject {
|
public class GHRepository extends GHObject {
|
||||||
/* package almost final */ transient GitHub root;
|
|
||||||
|
|
||||||
private String nodeId, description, homepage, name, full_name;
|
private String nodeId, description, homepage, name, full_name;
|
||||||
|
|
||||||
private String html_url; // this is the UI
|
private String html_url; // this is the UI
|
||||||
|
|
||||||
/*
|
/*
|
||||||
* The license information makes use of the preview API.
|
* The license information makes use of the preview API.
|
||||||
*
|
*
|
||||||
@@ -75,22 +91,32 @@ public class GHRepository extends GHObject {
|
|||||||
private GHLicense license;
|
private GHLicense license;
|
||||||
|
|
||||||
private String git_url, ssh_url, clone_url, svn_url, mirror_url;
|
private String git_url, ssh_url, clone_url, svn_url, mirror_url;
|
||||||
|
|
||||||
private GHUser owner; // not fully populated. beware.
|
private GHUser owner; // not fully populated. beware.
|
||||||
|
|
||||||
private boolean has_issues, has_wiki, fork, has_downloads, has_pages, archived, has_projects;
|
private boolean has_issues, has_wiki, fork, has_downloads, has_pages, archived, has_projects;
|
||||||
|
|
||||||
private boolean allow_squash_merge;
|
private boolean allow_squash_merge;
|
||||||
|
|
||||||
private boolean allow_merge_commit;
|
private boolean allow_merge_commit;
|
||||||
|
|
||||||
private boolean allow_rebase_merge;
|
private boolean allow_rebase_merge;
|
||||||
|
|
||||||
private boolean delete_branch_on_merge;
|
private boolean delete_branch_on_merge;
|
||||||
|
|
||||||
@JsonProperty("private")
|
@JsonProperty("private")
|
||||||
private boolean _private;
|
private boolean _private;
|
||||||
|
|
||||||
|
private String visibility;
|
||||||
|
|
||||||
private int forks_count, stargazers_count, watchers_count, size, open_issues_count, subscribers_count;
|
private int forks_count, stargazers_count, watchers_count, size, open_issues_count, subscribers_count;
|
||||||
|
|
||||||
private String pushed_at;
|
private String pushed_at;
|
||||||
|
|
||||||
private Map<Integer, GHMilestone> milestones = new WeakHashMap<Integer, GHMilestone>();
|
private Map<Integer, GHMilestone> milestones = new WeakHashMap<Integer, GHMilestone>();
|
||||||
|
|
||||||
private String default_branch, language;
|
private String default_branch, language;
|
||||||
|
|
||||||
private Map<String, GHCommit> commits = new WeakHashMap<String, GHCommit>();
|
private Map<String, GHCommit> commits = new WeakHashMap<String, GHCommit>();
|
||||||
|
|
||||||
@SkipFromToString
|
@SkipFromToString
|
||||||
@@ -98,6 +124,12 @@ public class GHRepository extends GHObject {
|
|||||||
|
|
||||||
private GHRepository source, parent;
|
private GHRepository source, parent;
|
||||||
|
|
||||||
|
private Boolean isTemplate;
|
||||||
|
|
||||||
|
static GHRepository read(GitHub root, String owner, String name) throws IOException {
|
||||||
|
return root.createRequest().withUrlPath("/repos/" + owner + '/' + name).fetch(GHRepository.class).wrap(root);
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Create deployment gh deployment builder.
|
* Create deployment gh deployment builder.
|
||||||
*
|
*
|
||||||
@@ -144,6 +176,8 @@ public class GHRepository extends GHObject {
|
|||||||
.with("task", task)
|
.with("task", task)
|
||||||
.with("environment", environment)
|
.with("environment", environment)
|
||||||
.withUrlPath(getApiTailUrl("deployments"))
|
.withUrlPath(getApiTailUrl("deployments"))
|
||||||
|
.withPreview(ANT_MAN)
|
||||||
|
.withPreview(FLASH)
|
||||||
.toIterable(GHDeployment[].class, item -> item.wrap(this));
|
.toIterable(GHDeployment[].class, item -> item.wrap(this));
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -159,6 +193,8 @@ public class GHRepository extends GHObject {
|
|||||||
public GHDeployment getDeployment(long id) throws IOException {
|
public GHDeployment getDeployment(long id) throws IOException {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
.withUrlPath(getApiTailUrl("deployments/" + id))
|
.withUrlPath(getApiTailUrl("deployments/" + id))
|
||||||
|
.withPreview(ANT_MAN)
|
||||||
|
.withPreview(FLASH)
|
||||||
.fetch(GHDeployment.class)
|
.fetch(GHDeployment.class)
|
||||||
.wrap(this);
|
.wrap(this);
|
||||||
}
|
}
|
||||||
@@ -425,7 +461,7 @@ public class GHRepository extends GHObject {
|
|||||||
* Creates a named ref, such as tag, branch, etc.
|
* Creates a named ref, such as tag, branch, etc.
|
||||||
*
|
*
|
||||||
* @param name
|
* @param name
|
||||||
* The name of the fully qualified reference (ie: refs/heads/master). If it doesn't start with 'refs' and
|
* The name of the fully qualified reference (ie: refs/heads/main). If it doesn't start with 'refs' and
|
||||||
* have at least two slashes, it will be rejected.
|
* have at least two slashes, it will be rejected.
|
||||||
* @param sha
|
* @param sha
|
||||||
* The SHA1 value to set this reference to
|
* The SHA1 value to set this reference to
|
||||||
@@ -542,7 +578,15 @@ public class GHRepository extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public Map<String, Long> listLanguages() throws IOException {
|
public Map<String, Long> listLanguages() throws IOException {
|
||||||
return root.createRequest().withUrlPath(getApiTailUrl("languages")).fetch(HashMap.class);
|
HashMap<String, Long> result = new HashMap<>();
|
||||||
|
root.createRequest().withUrlPath(getApiTailUrl("languages")).fetch(HashMap.class).forEach((key, value) -> {
|
||||||
|
Long addValue = -1L;
|
||||||
|
if (value instanceof Integer) {
|
||||||
|
addValue = Long.valueOf((Integer) value);
|
||||||
|
}
|
||||||
|
result.put(key.toString(), addValue);
|
||||||
|
});
|
||||||
|
return result;
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -679,6 +723,63 @@ public class GHRepository extends GHObject {
|
|||||||
return _private;
|
return _private;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Visibility of a repository.
|
||||||
|
*/
|
||||||
|
public enum Visibility {
|
||||||
|
PUBLIC, INTERNAL, PRIVATE, UNKNOWN;
|
||||||
|
|
||||||
|
public static Visibility from(String value) {
|
||||||
|
return EnumUtils.getNullableEnumOrDefault(Visibility.class, value, Visibility.UNKNOWN);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String toString() {
|
||||||
|
return name().toLowerCase(Locale.ROOT);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the visibility of the repository.
|
||||||
|
*
|
||||||
|
* @return the visibility
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(NEBULA)
|
||||||
|
public Visibility getVisibility() {
|
||||||
|
if (visibility == null) {
|
||||||
|
try {
|
||||||
|
populate();
|
||||||
|
} catch (final IOException e) {
|
||||||
|
// Convert this to a runtime exception to avoid messy method signature
|
||||||
|
throw new GHException("Could not populate the visibility of the repository", e);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
return Visibility.from(visibility);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Is template boolean.
|
||||||
|
*
|
||||||
|
* @return the boolean
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(BAPTISTE)
|
||||||
|
public boolean isTemplate() {
|
||||||
|
// isTemplate is still in preview, we do not want to retrieve it unless needed.
|
||||||
|
if (isTemplate == null) {
|
||||||
|
try {
|
||||||
|
populate();
|
||||||
|
} catch (IOException e) {
|
||||||
|
// Convert this to a runtime exception to avoid messy method signature
|
||||||
|
throw new GHException("Could not populate the template setting of the repository", e);
|
||||||
|
}
|
||||||
|
// if this somehow is not populated, set it to false;
|
||||||
|
isTemplate = Boolean.TRUE.equals(isTemplate);
|
||||||
|
}
|
||||||
|
return isTemplate;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Has downloads boolean.
|
* Has downloads boolean.
|
||||||
*
|
*
|
||||||
@@ -747,16 +848,18 @@ public class GHRepository extends GHObject {
|
|||||||
/**
|
/**
|
||||||
* Returns the primary branch you'll configure in the "Admin > Options" config page.
|
* Returns the primary branch you'll configure in the "Admin > Options" config page.
|
||||||
*
|
*
|
||||||
* @return This field is null until the user explicitly configures the master branch.
|
* @return This field is null until the user explicitly configures the default branch.
|
||||||
*/
|
*/
|
||||||
public String getDefaultBranch() {
|
public String getDefaultBranch() {
|
||||||
return default_branch;
|
return default_branch;
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets master branch.
|
* Gets default branch.
|
||||||
*
|
*
|
||||||
* @return the master branch
|
* Name is an artifact of when "master" was the most common default.
|
||||||
|
*
|
||||||
|
* @return the default branch
|
||||||
* @deprecated Renamed to {@link #getDefaultBranch()}
|
* @deprecated Renamed to {@link #getDefaultBranch()}
|
||||||
*/
|
*/
|
||||||
@Deprecated
|
@Deprecated
|
||||||
@@ -773,6 +876,13 @@ public class GHRepository extends GHObject {
|
|||||||
return size;
|
return size;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Affiliation of a repository collaborator
|
||||||
|
*/
|
||||||
|
public enum CollaboratorAffiliation {
|
||||||
|
ALL, DIRECT, OUTSIDE
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets the collaborators on this repository. This set always appear to include the owner.
|
* Gets the collaborators on this repository. This set always appear to include the owner.
|
||||||
*
|
*
|
||||||
@@ -796,6 +906,19 @@ public class GHRepository extends GHObject {
|
|||||||
return listUsers("collaborators");
|
return listUsers("collaborators");
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Lists up the collaborators on this repository.
|
||||||
|
*
|
||||||
|
* @param affiliation
|
||||||
|
* Filter users by affiliation
|
||||||
|
* @return Users paged iterable
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public PagedIterable<GHUser> listCollaborators(CollaboratorAffiliation affiliation) throws IOException {
|
||||||
|
return listUsers(root.createRequest().with("affiliation", affiliation), "collaborators");
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Lists all
|
* Lists all
|
||||||
* <a href="https://help.github.com/articles/assigning-issues-and-pull-requests-to-other-github-users/">the
|
* <a href="https://help.github.com/articles/assigning-issues-and-pull-requests-to-other-github-users/">the
|
||||||
@@ -843,6 +966,29 @@ public class GHRepository extends GHObject {
|
|||||||
return r;
|
return r;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the names of the collaborators on this repository. This method deviates from the principle of this library
|
||||||
|
* but it works a lot faster than {@link #getCollaborators()}.
|
||||||
|
*
|
||||||
|
* @param affiliation
|
||||||
|
* Filter users by affiliation
|
||||||
|
* @return the collaborator names
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public Set<String> getCollaboratorNames(CollaboratorAffiliation affiliation) throws IOException {
|
||||||
|
Set<String> r = new HashSet<>();
|
||||||
|
// no initializer - we just want to the logins
|
||||||
|
PagedIterable<GHUser> users = root.createRequest()
|
||||||
|
.withUrlPath(getApiTailUrl("collaborators"))
|
||||||
|
.with("affiliation", affiliation)
|
||||||
|
.toIterable(GHUser[].class, null);
|
||||||
|
for (GHUser u : users.toArray()) {
|
||||||
|
r.add(u.login);
|
||||||
|
}
|
||||||
|
return r;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Obtain permission for a given user in this repository.
|
* Obtain permission for a given user in this repository.
|
||||||
*
|
*
|
||||||
@@ -968,12 +1114,12 @@ public class GHRepository extends GHObject {
|
|||||||
@NonNull String method,
|
@NonNull String method,
|
||||||
@CheckForNull GHOrganization.Permission permission) throws IOException {
|
@CheckForNull GHOrganization.Permission permission) throws IOException {
|
||||||
Requester requester = root.createRequest().method(method);
|
Requester requester = root.createRequest().method(method);
|
||||||
|
|
||||||
if (permission != null) {
|
if (permission != null) {
|
||||||
requester = requester.with("permission", permission).inBody();
|
requester = requester.with("permission", permission).inBody();
|
||||||
}
|
}
|
||||||
|
|
||||||
for (GHUser user : users) {
|
// Make sure that the users collection doesn't have any duplicates
|
||||||
|
for (GHUser user : new LinkedHashSet<GHUser>(users)) {
|
||||||
requester.withUrlPath(getApiTailUrl("collaborators/" + user.getLogin())).send();
|
requester.withUrlPath(getApiTailUrl("collaborators/" + user.getLogin())).send();
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
@@ -998,13 +1144,6 @@ public class GHRepository extends GHObject {
|
|||||||
.send();
|
.send();
|
||||||
}
|
}
|
||||||
|
|
||||||
private void edit(String key, String value) throws IOException {
|
|
||||||
Requester requester = root.createRequest();
|
|
||||||
if (!key.equals("name"))
|
|
||||||
requester.with("name", name); // even when we don't change the name, we need to send it in
|
|
||||||
requester.with(key, value).method("PATCH").withUrlPath(getApiTailUrl("")).send();
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Enables or disables the issue tracker for this repository.
|
* Enables or disables the issue tracker for this repository.
|
||||||
*
|
*
|
||||||
@@ -1014,7 +1153,7 @@ public class GHRepository extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void enableIssueTracker(boolean v) throws IOException {
|
public void enableIssueTracker(boolean v) throws IOException {
|
||||||
edit("has_issues", String.valueOf(v));
|
set().issues(v);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1026,7 +1165,7 @@ public class GHRepository extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void enableProjects(boolean v) throws IOException {
|
public void enableProjects(boolean v) throws IOException {
|
||||||
edit("has_projects", String.valueOf(v));
|
set().projects(v);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1038,7 +1177,7 @@ public class GHRepository extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void enableWiki(boolean v) throws IOException {
|
public void enableWiki(boolean v) throws IOException {
|
||||||
edit("has_wiki", String.valueOf(v));
|
set().wiki(v);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1050,7 +1189,7 @@ public class GHRepository extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void enableDownloads(boolean v) throws IOException {
|
public void enableDownloads(boolean v) throws IOException {
|
||||||
edit("has_downloads", String.valueOf(v));
|
set().downloads(v);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1062,7 +1201,7 @@ public class GHRepository extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void renameTo(String name) throws IOException {
|
public void renameTo(String name) throws IOException {
|
||||||
edit("name", name);
|
set().name(name);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1074,7 +1213,7 @@ public class GHRepository extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void setDescription(String value) throws IOException {
|
public void setDescription(String value) throws IOException {
|
||||||
edit("description", value);
|
set().description(value);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1086,7 +1225,7 @@ public class GHRepository extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void setHomepage(String value) throws IOException {
|
public void setHomepage(String value) throws IOException {
|
||||||
edit("homepage", value);
|
set().homepage(value);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1098,7 +1237,7 @@ public class GHRepository extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void setDefaultBranch(String value) throws IOException {
|
public void setDefaultBranch(String value) throws IOException {
|
||||||
edit("default_branch", value);
|
set().defaultBranch(value);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1110,7 +1249,27 @@ public class GHRepository extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void setPrivate(boolean value) throws IOException {
|
public void setPrivate(boolean value) throws IOException {
|
||||||
edit("private", Boolean.toString(value));
|
set().private_(value);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Sets visibility.
|
||||||
|
*
|
||||||
|
* @param value
|
||||||
|
* the value
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(NEBULA)
|
||||||
|
public void setVisibility(final Visibility value) throws IOException {
|
||||||
|
root.createRequest()
|
||||||
|
.method("PATCH")
|
||||||
|
.withPreview(NEBULA)
|
||||||
|
.with("name", name)
|
||||||
|
.with("visibility", value)
|
||||||
|
.withUrlPath(getApiTailUrl(""))
|
||||||
|
.send();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1122,7 +1281,7 @@ public class GHRepository extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void allowSquashMerge(boolean value) throws IOException {
|
public void allowSquashMerge(boolean value) throws IOException {
|
||||||
edit("allow_squash_merge", Boolean.toString(value));
|
set().allowSquashMerge(value);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1134,7 +1293,7 @@ public class GHRepository extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void allowMergeCommit(boolean value) throws IOException {
|
public void allowMergeCommit(boolean value) throws IOException {
|
||||||
edit("allow_merge_commit", Boolean.toString(value));
|
set().allowMergeCommit(value);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1146,7 +1305,7 @@ public class GHRepository extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void allowRebaseMerge(boolean value) throws IOException {
|
public void allowRebaseMerge(boolean value) throws IOException {
|
||||||
edit("allow_rebase_merge", Boolean.toString(value));
|
set().allowRebaseMerge(value);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1158,7 +1317,7 @@ public class GHRepository extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void deleteBranchOnMerge(boolean value) throws IOException {
|
public void deleteBranchOnMerge(boolean value) throws IOException {
|
||||||
edit("delete_branch_on_merge", Boolean.toString(value));
|
set().deleteBranchOnMerge(value);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1195,12 +1354,30 @@ public class GHRepository extends GHObject {
|
|||||||
* In case of any networking error or error from the server.
|
* In case of any networking error or error from the server.
|
||||||
*/
|
*/
|
||||||
public void archive() throws IOException {
|
public void archive() throws IOException {
|
||||||
edit("archived", "true");
|
set().archive();
|
||||||
// Generall would not update this record,
|
// Generally would not update this record,
|
||||||
// but do so here since this will result in any other update actions failing
|
// but doing so here since this will result in any other update actions failing
|
||||||
archived = true;
|
archived = true;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Creates a builder that can be used to bulk update repository settings.
|
||||||
|
*
|
||||||
|
* @return the repository updater
|
||||||
|
*/
|
||||||
|
public Updater update() {
|
||||||
|
return new Updater(this);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Creates a builder that can be used to bulk update repository settings.
|
||||||
|
*
|
||||||
|
* @return the repository updater
|
||||||
|
*/
|
||||||
|
public Setter set() {
|
||||||
|
return new Setter(this);
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Sort orders for listing forks
|
* Sort orders for listing forks
|
||||||
*/
|
*/
|
||||||
@@ -1246,8 +1423,9 @@ public class GHRepository extends GHObject {
|
|||||||
// this API is asynchronous. we need to wait for a bit
|
// this API is asynchronous. we need to wait for a bit
|
||||||
for (int i = 0; i < 10; i++) {
|
for (int i = 0; i < 10; i++) {
|
||||||
GHRepository r = root.getMyself().getRepository(name);
|
GHRepository r = root.getMyself().getRepository(name);
|
||||||
if (r != null)
|
if (r != null) {
|
||||||
return r;
|
return r;
|
||||||
|
}
|
||||||
try {
|
try {
|
||||||
Thread.sleep(3000);
|
Thread.sleep(3000);
|
||||||
} catch (InterruptedException e) {
|
} catch (InterruptedException e) {
|
||||||
@@ -1276,8 +1454,9 @@ public class GHRepository extends GHObject {
|
|||||||
// this API is asynchronous. we need to wait for a bit
|
// this API is asynchronous. we need to wait for a bit
|
||||||
for (int i = 0; i < 10; i++) {
|
for (int i = 0; i < 10; i++) {
|
||||||
GHRepository r = org.getRepository(name);
|
GHRepository r = org.getRepository(name);
|
||||||
if (r != null)
|
if (r != null) {
|
||||||
return r;
|
return r;
|
||||||
|
}
|
||||||
try {
|
try {
|
||||||
Thread.sleep(3000);
|
Thread.sleep(3000);
|
||||||
} catch (InterruptedException e) {
|
} catch (InterruptedException e) {
|
||||||
@@ -1538,8 +1717,7 @@ public class GHRepository extends GHObject {
|
|||||||
* on failure communicating with GitHub, potentially due to an invalid ref type being requested
|
* on failure communicating with GitHub, potentially due to an invalid ref type being requested
|
||||||
*/
|
*/
|
||||||
public PagedIterable<GHRef> listRefs() throws IOException {
|
public PagedIterable<GHRef> listRefs() throws IOException {
|
||||||
final String url = String.format("/repos/%s/%s/git/refs", getOwnerName(), name);
|
return listRefs("");
|
||||||
return root.createRequest().withUrlPath(url).toIterable(GHRef[].class, item -> item.wrap(root));
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1565,8 +1743,7 @@ public class GHRepository extends GHObject {
|
|||||||
* on failure communicating with GitHub, potentially due to an invalid ref type being requested
|
* on failure communicating with GitHub, potentially due to an invalid ref type being requested
|
||||||
*/
|
*/
|
||||||
public PagedIterable<GHRef> listRefs(String refType) throws IOException {
|
public PagedIterable<GHRef> listRefs(String refType) throws IOException {
|
||||||
final String url = String.format("/repos/%s/%s/git/refs/%s", getOwnerName(), name, refType);
|
return GHRef.readMatching(this, refType);
|
||||||
return root.createRequest().withUrlPath(url).toIterable(GHRef[].class, item -> item.wrap(root));
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1579,15 +1756,7 @@ public class GHRepository extends GHObject {
|
|||||||
* on failure communicating with GitHub, potentially due to an invalid ref type being requested
|
* on failure communicating with GitHub, potentially due to an invalid ref type being requested
|
||||||
*/
|
*/
|
||||||
public GHRef getRef(String refName) throws IOException {
|
public GHRef getRef(String refName) throws IOException {
|
||||||
// Also accept e.g. "refs/heads/branch" for consistency with createRef().
|
return GHRef.read(this, refName);
|
||||||
if (refName.startsWith("refs/")) {
|
|
||||||
refName = refName.replaceFirst("refs/", "");
|
|
||||||
}
|
|
||||||
|
|
||||||
return root.createRequest()
|
|
||||||
.withUrlPath(getApiTailUrl(String.format("git/refs/%s", refName)))
|
|
||||||
.fetch(GHRef.class)
|
|
||||||
.wrap(root);
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1608,7 +1777,7 @@ public class GHRepository extends GHObject {
|
|||||||
* Retrive a tree of the given type for the current GitHub repository.
|
* Retrive a tree of the given type for the current GitHub repository.
|
||||||
*
|
*
|
||||||
* @param sha
|
* @param sha
|
||||||
* sha number or branch name ex: "master"
|
* sha number or branch name ex: "main"
|
||||||
* @return refs matching the request type
|
* @return refs matching the request type
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* on failure communicating with GitHub, potentially due to an invalid tree type being requested
|
* on failure communicating with GitHub, potentially due to an invalid tree type being requested
|
||||||
@@ -1632,7 +1801,7 @@ public class GHRepository extends GHObject {
|
|||||||
* https://developer.github.com/v3/git/trees/#get-a-tree-recursively
|
* https://developer.github.com/v3/git/trees/#get-a-tree-recursively
|
||||||
*
|
*
|
||||||
* @param sha
|
* @param sha
|
||||||
* sha number or branch name ex: "master"
|
* sha number or branch name ex: "main"
|
||||||
* @param recursive
|
* @param recursive
|
||||||
* use 1
|
* use 1
|
||||||
* @return the tree recursive
|
* @return the tree recursive
|
||||||
@@ -1690,7 +1859,7 @@ public class GHRepository extends GHObject {
|
|||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
.withHeader("Accept", "application/vnd.github.v3.raw")
|
.withHeader("Accept", "application/vnd.github.v3.raw")
|
||||||
.withUrlPath(target)
|
.withUrlPath(target)
|
||||||
.fetchStream();
|
.fetchStream(Requester::copyInputStream);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1754,6 +1923,20 @@ public class GHRepository extends GHObject {
|
|||||||
.toIterable(GHCommitComment[].class, item -> item.wrap(this));
|
.toIterable(GHCommitComment[].class, item -> item.wrap(this));
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Lists all comments on a specific commit.
|
||||||
|
*
|
||||||
|
* @param commitSha
|
||||||
|
* the hash of the commit
|
||||||
|
*
|
||||||
|
* @return the paged iterable
|
||||||
|
*/
|
||||||
|
public PagedIterable<GHCommitComment> listCommitComments(String commitSha) {
|
||||||
|
return root.createRequest()
|
||||||
|
.withUrlPath(String.format("/repos/%s/%s/commits/%s/comments", getOwnerName(), name, commitSha))
|
||||||
|
.toIterable(GHCommitComment[].class, item -> item.wrap(this));
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets the basic license details for the repository.
|
* Gets the basic license details for the repository.
|
||||||
* <p>
|
* <p>
|
||||||
@@ -1830,14 +2013,14 @@ public class GHRepository extends GHObject {
|
|||||||
* @see <a href="https://developer.github.com/v3/checks/runs/#list-check-runs-for-a-specific-ref">List check runs
|
* @see <a href="https://developer.github.com/v3/checks/runs/#list-check-runs-for-a-specific-ref">List check runs
|
||||||
* for a specific ref</a>
|
* for a specific ref</a>
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(ANTIOPE)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public PagedIterable<GHCheckRun> getCheckRuns(String ref) throws IOException {
|
public PagedIterable<GHCheckRun> getCheckRuns(String ref) throws IOException {
|
||||||
GitHubRequest request = root.createRequest()
|
GitHubRequest request = root.createRequest()
|
||||||
.withUrlPath(String.format("/repos/%s/%s/commits/%s/check-runs", getOwnerName(), name, ref))
|
.withUrlPath(String.format("/repos/%s/%s/commits/%s/check-runs", getOwnerName(), name, ref))
|
||||||
.withPreview(ANTIOPE)
|
.withPreview(ANTIOPE)
|
||||||
.build();
|
.build();
|
||||||
return new GHCheckRunsIterable(root, request);
|
return new GHCheckRunsIterable(this, request);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -1904,12 +2087,25 @@ public class GHRepository extends GHObject {
|
|||||||
* the commit hash
|
* the commit hash
|
||||||
* @return a builder which you should customize, then call {@link GHCheckRunBuilder#create}
|
* @return a builder which you should customize, then call {@link GHCheckRunBuilder#create}
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(ANTIOPE)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public @NonNull GHCheckRunBuilder createCheckRun(@NonNull String name, @NonNull String headSHA) {
|
public @NonNull GHCheckRunBuilder createCheckRun(@NonNull String name, @NonNull String headSHA) {
|
||||||
return new GHCheckRunBuilder(this, name, headSHA);
|
return new GHCheckRunBuilder(this, name, headSHA);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Updates an existing check run.
|
||||||
|
*
|
||||||
|
* @param checkId
|
||||||
|
* the existing checkId
|
||||||
|
* @return a builder which you should customize, then call {@link GHCheckRunBuilder#create}
|
||||||
|
*/
|
||||||
|
@Preview(BAPTISTE)
|
||||||
|
@Deprecated
|
||||||
|
public @NonNull GHCheckRunBuilder updateCheckRun(long checkId) {
|
||||||
|
return new GHCheckRunBuilder(this, checkId);
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Lists repository events.
|
* Lists repository events.
|
||||||
*
|
*
|
||||||
@@ -2027,9 +2223,11 @@ public class GHRepository extends GHObject {
|
|||||||
}
|
}
|
||||||
|
|
||||||
private PagedIterable<GHUser> listUsers(final String suffix) {
|
private PagedIterable<GHUser> listUsers(final String suffix) {
|
||||||
return root.createRequest()
|
return listUsers(root.createRequest(), suffix);
|
||||||
.withUrlPath(getApiTailUrl(suffix))
|
}
|
||||||
.toIterable(GHUser[].class, item -> item.wrapUp(root));
|
|
||||||
|
private PagedIterable<GHUser> listUsers(Requester requester, final String suffix) {
|
||||||
|
return requester.withUrlPath(getApiTailUrl(suffix)).toIterable(GHUser[].class, item -> item.wrapUp(root));
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -2092,8 +2290,13 @@ public class GHRepository extends GHObject {
|
|||||||
justification = "It causes a performance degradation, but we have already exposed it to the API")
|
justification = "It causes a performance degradation, but we have already exposed it to the API")
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public Set<URL> getPostCommitHooks() {
|
public Set<URL> getPostCommitHooks() {
|
||||||
|
synchronized (this) {
|
||||||
|
if (postCommitHooks == null) {
|
||||||
|
postCommitHooks = setupPostCommitHooks();
|
||||||
|
}
|
||||||
return postCommitHooks;
|
return postCommitHooks;
|
||||||
}
|
}
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Live set view of the post-commit hook.
|
* Live set view of the post-commit hook.
|
||||||
@@ -2101,7 +2304,12 @@ public class GHRepository extends GHObject {
|
|||||||
@SuppressFBWarnings(value = "DMI_COLLECTION_OF_URLS",
|
@SuppressFBWarnings(value = "DMI_COLLECTION_OF_URLS",
|
||||||
justification = "It causes a performance degradation, but we have already exposed it to the API")
|
justification = "It causes a performance degradation, but we have already exposed it to the API")
|
||||||
@SkipFromToString
|
@SkipFromToString
|
||||||
private final Set<URL> postCommitHooks = new AbstractSet<URL>() {
|
private /* final */ transient Set<URL> postCommitHooks;
|
||||||
|
|
||||||
|
@SuppressFBWarnings(value = "DMI_COLLECTION_OF_URLS",
|
||||||
|
justification = "It causes a performance degradation, but we have already exposed it to the API")
|
||||||
|
private Set<URL> setupPostCommitHooks() {
|
||||||
|
return new AbstractSet<URL>() {
|
||||||
private List<URL> getPostCommitHooks() {
|
private List<URL> getPostCommitHooks() {
|
||||||
try {
|
try {
|
||||||
List<URL> r = new ArrayList<>();
|
List<URL> r = new ArrayList<>();
|
||||||
@@ -2152,12 +2360,19 @@ public class GHRepository extends GHObject {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
|
}
|
||||||
|
|
||||||
GHRepository wrap(GitHub root) {
|
GHRepository wrap(GitHub root) {
|
||||||
this.root = root;
|
this.root = root;
|
||||||
if (root.isOffline() && owner != null) {
|
if (root.isOffline() && owner != null) {
|
||||||
owner.wrapUp(root);
|
owner.wrapUp(root);
|
||||||
}
|
}
|
||||||
|
if (source != null) {
|
||||||
|
source.wrap(root);
|
||||||
|
}
|
||||||
|
if (parent != null) {
|
||||||
|
parent.wrap(root);
|
||||||
|
}
|
||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -2477,10 +2692,13 @@ public class GHRepository extends GHObject {
|
|||||||
* @see #getParent() #getParent()
|
* @see #getParent() #getParent()
|
||||||
*/
|
*/
|
||||||
public GHRepository getSource() throws IOException {
|
public GHRepository getSource() throws IOException {
|
||||||
if (source == null)
|
if (fork && source == null) {
|
||||||
|
populate();
|
||||||
|
}
|
||||||
|
if (source == null) {
|
||||||
return null;
|
return null;
|
||||||
if (source.root == null)
|
}
|
||||||
source = root.getRepository(source.getFullName());
|
|
||||||
return source;
|
return source;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -2495,10 +2713,13 @@ public class GHRepository extends GHObject {
|
|||||||
* @see #getSource() #getSource()
|
* @see #getSource() #getSource()
|
||||||
*/
|
*/
|
||||||
public GHRepository getParent() throws IOException {
|
public GHRepository getParent() throws IOException {
|
||||||
if (parent == null)
|
if (fork && parent == null) {
|
||||||
|
populate();
|
||||||
|
}
|
||||||
|
|
||||||
|
if (parent == null) {
|
||||||
return null;
|
return null;
|
||||||
if (parent.root == null)
|
}
|
||||||
parent = root.getRepository(parent.getFullName());
|
|
||||||
return parent;
|
return parent;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -2665,7 +2886,7 @@ public class GHRepository extends GHObject {
|
|||||||
.with("mode", mode == null ? null : mode.toString())
|
.with("mode", mode == null ? null : mode.toString())
|
||||||
.with("context", getFullName())
|
.with("context", getFullName())
|
||||||
.withUrlPath("/markdown")
|
.withUrlPath("/markdown")
|
||||||
.fetchStream(),
|
.fetchStream(Requester::copyInputStream),
|
||||||
"UTF-8");
|
"UTF-8");
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -2717,8 +2938,9 @@ public class GHRepository extends GHObject {
|
|||||||
}
|
}
|
||||||
|
|
||||||
String getApiTailUrl(String tail) {
|
String getApiTailUrl(String tail) {
|
||||||
if (tail.length() > 0 && !tail.startsWith("/"))
|
if (tail.length() > 0 && !tail.startsWith("/")) {
|
||||||
tail = '/' + tail;
|
tail = '/' + tail;
|
||||||
|
}
|
||||||
return "/repos/" + getOwnerName() + "/" + name + tail;
|
return "/repos/" + getOwnerName() + "/" + name + tail;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -2752,6 +2974,110 @@ public class GHRepository extends GHObject {
|
|||||||
.wrapUp(root);
|
.wrapUp(root);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Lists all the workflows of this repository.
|
||||||
|
*
|
||||||
|
* @return the paged iterable
|
||||||
|
*/
|
||||||
|
public PagedIterable<GHWorkflow> listWorkflows() {
|
||||||
|
return new GHWorkflowsIterable(this);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets a workflow by id.
|
||||||
|
*
|
||||||
|
* @param id
|
||||||
|
* the id of the workflow run
|
||||||
|
* @return the workflow run
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public GHWorkflow getWorkflow(long id) throws IOException {
|
||||||
|
return getWorkflow(String.valueOf(id));
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets a workflow by name of the file.
|
||||||
|
*
|
||||||
|
* @param nameOrId
|
||||||
|
* either the name of the file (e.g. my-workflow.yml) or the id as a string
|
||||||
|
* @return the workflow run
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public GHWorkflow getWorkflow(String nameOrId) throws IOException {
|
||||||
|
return root.createRequest()
|
||||||
|
.withUrlPath(getApiTailUrl("actions/workflows"), nameOrId)
|
||||||
|
.fetch(GHWorkflow.class)
|
||||||
|
.wrapUp(this);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Retrieves workflow runs.
|
||||||
|
*
|
||||||
|
* @return the workflow run query builder
|
||||||
|
*/
|
||||||
|
public GHWorkflowRunQueryBuilder queryWorkflowRuns() {
|
||||||
|
return new GHWorkflowRunQueryBuilder(this);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets a workflow run.
|
||||||
|
*
|
||||||
|
* @param id
|
||||||
|
* the id of the workflow run
|
||||||
|
* @return the workflow run
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public GHWorkflowRun getWorkflowRun(long id) throws IOException {
|
||||||
|
return root.createRequest()
|
||||||
|
.withUrlPath(getApiTailUrl("actions/runs"), String.valueOf(id))
|
||||||
|
.fetch(GHWorkflowRun.class)
|
||||||
|
.wrapUp(this);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Lists all the artifacts of this repository.
|
||||||
|
*
|
||||||
|
* @return the paged iterable
|
||||||
|
*/
|
||||||
|
public PagedIterable<GHArtifact> listArtifacts() {
|
||||||
|
return new GHArtifactsIterable(this, root.createRequest().withUrlPath(getApiTailUrl("actions/artifacts")));
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets an artifact by id.
|
||||||
|
*
|
||||||
|
* @param id
|
||||||
|
* the id of the artifact
|
||||||
|
* @return the artifact
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public GHArtifact getArtifact(long id) throws IOException {
|
||||||
|
return root.createRequest()
|
||||||
|
.withUrlPath(getApiTailUrl("actions/artifacts"), String.valueOf(id))
|
||||||
|
.fetch(GHArtifact.class)
|
||||||
|
.wrapUp(this);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets a job from a workflow run by id.
|
||||||
|
*
|
||||||
|
* @param id
|
||||||
|
* the id of the job
|
||||||
|
* @return the job
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public GHWorkflowJob getWorkflowJob(long id) throws IOException {
|
||||||
|
return root.createRequest()
|
||||||
|
.withUrlPath(getApiTailUrl("/actions/jobs"), String.valueOf(id))
|
||||||
|
.fetch(GHWorkflowJob.class)
|
||||||
|
.wrapUp(this);
|
||||||
|
}
|
||||||
|
|
||||||
// Only used within listTopics().
|
// Only used within listTopics().
|
||||||
private static class Topics {
|
private static class Topics {
|
||||||
public List<String> names;
|
public List<String> names;
|
||||||
@@ -2818,6 +3144,52 @@ public class GHRepository extends GHObject {
|
|||||||
.wrap(this);
|
.wrap(this);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Streams a zip archive of the repository, optionally at a given <code>ref</code>.
|
||||||
|
*
|
||||||
|
* @param <T>
|
||||||
|
* the type of result
|
||||||
|
* @param streamFunction
|
||||||
|
* The {@link InputStreamFunction} that will process the stream
|
||||||
|
* @param ref
|
||||||
|
* if <code>null</code> the repository's default branch, usually <code>main</code>,
|
||||||
|
* @throws IOException
|
||||||
|
* The IO exception.
|
||||||
|
* @return the result of reading the stream.
|
||||||
|
*/
|
||||||
|
public <T> T readZip(InputStreamFunction<T> streamFunction, String ref) throws IOException {
|
||||||
|
return downloadArchive("zip", ref, streamFunction);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Streams a tar archive of the repository, optionally at a given <code>ref</code>.
|
||||||
|
*
|
||||||
|
* @param <T>
|
||||||
|
* the type of result
|
||||||
|
* @param streamFunction
|
||||||
|
* The {@link InputStreamFunction} that will process the stream
|
||||||
|
* @param ref
|
||||||
|
* if <code>null</code> the repository's default branch, usually <code>main</code>,
|
||||||
|
* @throws IOException
|
||||||
|
* The IO exception.
|
||||||
|
* @return the result of reading the stream.
|
||||||
|
*/
|
||||||
|
public <T> T readTar(InputStreamFunction<T> streamFunction, String ref) throws IOException {
|
||||||
|
return downloadArchive("tar", ref, streamFunction);
|
||||||
|
}
|
||||||
|
|
||||||
|
private <T> T downloadArchive(@Nonnull String type,
|
||||||
|
@CheckForNull String ref,
|
||||||
|
@Nonnull InputStreamFunction<T> streamFunction) throws IOException {
|
||||||
|
requireNonNull(streamFunction, "Sink must not be null");
|
||||||
|
String tailUrl = getApiTailUrl(type + "ball");
|
||||||
|
if (ref != null) {
|
||||||
|
tailUrl += "/" + ref;
|
||||||
|
}
|
||||||
|
final Requester builder = root.createRequest().method("GET").withUrlPath(tailUrl);
|
||||||
|
return builder.fetchStream(streamFunction);
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Populate this object.
|
* Populate this object.
|
||||||
*
|
*
|
||||||
@@ -2825,9 +3197,70 @@ public class GHRepository extends GHObject {
|
|||||||
* The IO exception
|
* The IO exception
|
||||||
*/
|
*/
|
||||||
void populate() throws IOException {
|
void populate() throws IOException {
|
||||||
if (root.isOffline())
|
if (root.isOffline()) {
|
||||||
return; // can't populate if the root is offline
|
return; // can't populate if the root is offline
|
||||||
|
}
|
||||||
|
|
||||||
root.createRequest().withApiUrl(root.getApiUrl() + full_name).fetchInto(this).wrap(root);
|
final URL url = requireNonNull(getUrl(), "Missing instance URL!");
|
||||||
|
|
||||||
|
try {
|
||||||
|
// IMPORTANT: the url for repository records does not reliably point to the API url.
|
||||||
|
// There is bug in Push event payloads that returns the wrong url.
|
||||||
|
// All other occurrences of "url" take the form "https://api.github.com/...".
|
||||||
|
// For Push event repository records, they take the form "https://github.com/{fullName}".
|
||||||
|
root.createRequest()
|
||||||
|
.withPreview(BAPTISTE)
|
||||||
|
.withPreview(NEBULA)
|
||||||
|
.setRawUrlPath(url.toString())
|
||||||
|
.fetchInto(this)
|
||||||
|
.wrap(root);
|
||||||
|
} catch (HttpException e) {
|
||||||
|
if (e.getCause() instanceof JsonParseException) {
|
||||||
|
root.createRequest()
|
||||||
|
.withPreview(BAPTISTE)
|
||||||
|
.withPreview(NEBULA)
|
||||||
|
.withUrlPath("/repos/" + full_name)
|
||||||
|
.fetchInto(this)
|
||||||
|
.wrap(root);
|
||||||
|
} else {
|
||||||
|
throw e;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A {@link GHRepositoryBuilder} that allows multiple properties to be updated per request.
|
||||||
|
*
|
||||||
|
* Consumer must call {@link #done()} to commit changes.
|
||||||
|
*/
|
||||||
|
@BetaApi
|
||||||
|
@Deprecated
|
||||||
|
public static class Updater extends GHRepositoryBuilder<Updater> {
|
||||||
|
protected Updater(@Nonnull GHRepository repository) {
|
||||||
|
super(Updater.class, repository.root, null);
|
||||||
|
// even when we don't change the name, we need to send it in
|
||||||
|
// this requirement may be out-of-date, but we do not want to break it
|
||||||
|
requester.with("name", repository.name);
|
||||||
|
|
||||||
|
requester.method("PATCH").withUrlPath(repository.getApiTailUrl(""));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A {@link GHRepositoryBuilder} that allows multiple properties to be updated per request.
|
||||||
|
*
|
||||||
|
* Consumer must call {@link #done()} to commit changes.
|
||||||
|
*/
|
||||||
|
@BetaApi
|
||||||
|
@Deprecated
|
||||||
|
public static class Setter extends GHRepositoryBuilder<GHRepository> {
|
||||||
|
protected Setter(@Nonnull GHRepository repository) {
|
||||||
|
super(GHRepository.class, repository.root, null);
|
||||||
|
// even when we don't change the name, we need to send it in
|
||||||
|
// this requirement may be out-of-date, but we do not want to break it
|
||||||
|
requester.with("name", repository.name);
|
||||||
|
|
||||||
|
requester.method("PATCH").withUrlPath(repository.getApiTailUrl(""));
|
||||||
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
252
src/main/java/org/kohsuke/github/GHRepositoryBuilder.java
Normal file
252
src/main/java/org/kohsuke/github/GHRepositoryBuilder.java
Normal file
@@ -0,0 +1,252 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import org.kohsuke.github.GHRepository.Visibility;
|
||||||
|
|
||||||
|
import java.io.IOException;
|
||||||
|
import java.net.URL;
|
||||||
|
|
||||||
|
import static org.kohsuke.github.internal.Previews.BAPTISTE;
|
||||||
|
import static org.kohsuke.github.internal.Previews.NEBULA;
|
||||||
|
|
||||||
|
abstract class GHRepositoryBuilder<S> extends AbstractBuilder<GHRepository, S> {
|
||||||
|
|
||||||
|
protected GHRepositoryBuilder(Class<S> intermediateReturnType, GitHub root, GHRepository baseInstance) {
|
||||||
|
super(GHRepository.class, intermediateReturnType, root, baseInstance);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Allow or disallow squash-merging pull requests.
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S allowSquashMerge(boolean enabled) throws IOException {
|
||||||
|
return with("allow_squash_merge", enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Allow or disallow merging pull requests with a merge commit.
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S allowMergeCommit(boolean enabled) throws IOException {
|
||||||
|
return with("allow_merge_commit", enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Allow or disallow rebase-merging pull requests.
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S allowRebaseMerge(boolean enabled) throws IOException {
|
||||||
|
return with("allow_rebase_merge", enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* After pull requests are merged, you can have head branches deleted automatically.
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S deleteBranchOnMerge(boolean enabled) throws IOException {
|
||||||
|
return with("delete_branch_on_merge", enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Default repository branch
|
||||||
|
*
|
||||||
|
* @param branch
|
||||||
|
* branch name
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S defaultBranch(String branch) throws IOException {
|
||||||
|
return with("default_branch", branch);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Description for repository
|
||||||
|
*
|
||||||
|
* @param description
|
||||||
|
* description of repository
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S description(String description) throws IOException {
|
||||||
|
return with("description", description);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Homepage for repository
|
||||||
|
*
|
||||||
|
* @param homepage
|
||||||
|
* homepage of repository
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S homepage(URL homepage) throws IOException {
|
||||||
|
return homepage(homepage.toExternalForm());
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Homepage for repository
|
||||||
|
*
|
||||||
|
* @param homepage
|
||||||
|
* homepage of repository
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S homepage(String homepage) throws IOException {
|
||||||
|
return with("homepage", homepage);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Sets the repository to private
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* private if true
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S private_(boolean enabled) throws IOException {
|
||||||
|
return with("private", enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Sets the repository visibility
|
||||||
|
*
|
||||||
|
* @param visibility
|
||||||
|
* visibility of repository
|
||||||
|
* @return a builder to continue with building
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S visibility(final Visibility visibility) throws IOException {
|
||||||
|
requester.withPreview(NEBULA);
|
||||||
|
return with("visibility", visibility);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Enables issue tracker
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S issues(boolean enabled) throws IOException {
|
||||||
|
return with("has_issues", enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Enables projects
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S projects(boolean enabled) throws IOException {
|
||||||
|
return with("has_projects", enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Enables wiki
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
* @return a builder to continue with building
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S wiki(boolean enabled) throws IOException {
|
||||||
|
return with("has_wiki", enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Enables downloads
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S downloads(boolean enabled) throws IOException {
|
||||||
|
return with("has_downloads", enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Specifies whether the repository is a template.
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
* @return a builder to continue with building
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
@Preview(BAPTISTE)
|
||||||
|
@Deprecated
|
||||||
|
public S isTemplate(boolean enabled) throws IOException {
|
||||||
|
requester.withPreview(BAPTISTE);
|
||||||
|
return with("is_template", enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public GHRepository done() throws IOException {
|
||||||
|
return super.done().wrap(this.root);
|
||||||
|
}
|
||||||
|
|
||||||
|
S archive() throws IOException {
|
||||||
|
return with("archived", true);
|
||||||
|
}
|
||||||
|
|
||||||
|
S name(String name) throws IOException {
|
||||||
|
return with("name", name);
|
||||||
|
}
|
||||||
|
}
|
||||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user