mirror of
https://github.com/jlengrand/github-api.git
synced 2026-03-22 15:50:29 +00:00
Compare commits
917 Commits
github-api
...
github-api
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
304ab10cf9 | ||
|
|
dc46341432 | ||
|
|
99aea9296e | ||
|
|
b0693037f3 | ||
|
|
c19cfd98d1 | ||
|
|
cdc0e2ad6b | ||
|
|
6606b5c7d1 | ||
|
|
551dbf2a06 | ||
|
|
d734237788 | ||
|
|
47e2a5aea1 | ||
|
|
57cdc308e8 | ||
|
|
8919c5f8c7 | ||
|
|
b8f00bc699 | ||
|
|
042038f480 | ||
|
|
fb03e749bd | ||
|
|
e522239832 | ||
|
|
ae69324196 | ||
|
|
5194c2d9bc | ||
|
|
daf5c5eb98 | ||
|
|
a7b4c97020 | ||
|
|
420d5d06f3 | ||
|
|
a7cd052b7c | ||
|
|
6e1b943823 | ||
|
|
8a3559ada5 | ||
|
|
ea3cbd4c71 | ||
|
|
34a1f9d6e4 | ||
|
|
629bd510c1 | ||
|
|
40937a5cc6 | ||
|
|
8509957102 | ||
|
|
b0aea0c575 | ||
|
|
1f7f646bec | ||
|
|
a59ee6a82d | ||
|
|
1fefc77582 | ||
|
|
199eee4e25 | ||
|
|
854df5321b | ||
|
|
bd509070ac | ||
|
|
a8c7c97d06 | ||
|
|
6d86cfb4f6 | ||
|
|
fb3e956502 | ||
|
|
9b0dbe6f34 | ||
|
|
c10c7237a7 | ||
|
|
36612fe97f | ||
|
|
18e2056a10 | ||
|
|
8c8f1451d4 | ||
|
|
be67f1d9e2 | ||
|
|
90bc250269 | ||
|
|
1bd178654f | ||
|
|
f22bf160f9 | ||
|
|
4261c42949 | ||
|
|
40cfb85a8e | ||
|
|
f08299b134 | ||
|
|
a04ab45abc | ||
|
|
0647df2d2b | ||
|
|
d4cc3af1e9 | ||
|
|
936ab499ce | ||
|
|
453f475b4e | ||
|
|
bda3855b86 | ||
|
|
772a6c112b | ||
|
|
9b4134cada | ||
|
|
ed9f54006d | ||
|
|
3b1f176544 | ||
|
|
d2732bcf54 | ||
|
|
a1461f401a | ||
|
|
f9fd30275c | ||
|
|
eeea14dab4 | ||
|
|
1df807a198 | ||
|
|
0848287069 | ||
|
|
334b37a256 | ||
|
|
8776a3b672 | ||
|
|
657550f767 | ||
|
|
45a0114f75 | ||
|
|
a8ddd3e12a | ||
|
|
b668396151 | ||
|
|
9e7c33369c | ||
|
|
8943ca6d1a | ||
|
|
b3460c1f9d | ||
|
|
5166c9265f | ||
|
|
35c8cfa01d | ||
|
|
8e6dbf3772 | ||
|
|
cb381dfa06 | ||
|
|
80124e3b85 | ||
|
|
7aae27e36f | ||
|
|
b212956fbb | ||
|
|
d033355e84 | ||
|
|
59d7a117d0 | ||
|
|
dfbb38c5f1 | ||
|
|
3f9954144a | ||
|
|
1b84efdbfa | ||
|
|
c33e78a7dc | ||
|
|
747c759bbb | ||
|
|
e0a709676e | ||
|
|
a96275c286 | ||
|
|
ca7c809feb | ||
|
|
a8a0bcb7db | ||
|
|
0e2bf23830 | ||
|
|
44a8b797fb | ||
|
|
cdede298a9 | ||
|
|
f6ac4d3559 | ||
|
|
7e1531dbca | ||
|
|
9aeb422157 | ||
|
|
fba0f8cf8e | ||
|
|
0f4a5227e1 | ||
|
|
d16a752b43 | ||
|
|
4d9aed90d6 | ||
|
|
4bec27fd49 | ||
|
|
be3bd74bb7 | ||
|
|
f1720b7bbc | ||
|
|
7a79a18d8f | ||
|
|
472034c950 | ||
|
|
0b14cee817 | ||
|
|
b50ab56f9e | ||
|
|
26d30663c4 | ||
|
|
ffecc390eb | ||
|
|
252ca04084 | ||
|
|
aae5c56a31 | ||
|
|
6670446037 | ||
|
|
bd39b07bb5 | ||
|
|
a9438b6121 | ||
|
|
f546cf4521 | ||
|
|
43efa78750 | ||
|
|
9e3de43802 | ||
|
|
dc615e432e | ||
|
|
cf9caa6af5 | ||
|
|
15f748358d | ||
|
|
b30d648623 | ||
|
|
33d70560b8 | ||
|
|
865a49d2e8 | ||
|
|
4fca68c25c | ||
|
|
f131a0c1c2 | ||
|
|
cd4368fa79 | ||
|
|
4ec4b160b0 | ||
|
|
a585b4957f | ||
|
|
e6b02b3bed | ||
|
|
1ef0ec0432 | ||
|
|
2e87bd86a1 | ||
|
|
0228a0d023 | ||
|
|
6365f3749d | ||
|
|
25c18130f9 | ||
|
|
436c19634d | ||
|
|
1a6facc685 | ||
|
|
bd0093c8ea | ||
|
|
e150280010 | ||
|
|
827fd5e472 | ||
|
|
f89fbc67b9 | ||
|
|
c567a88892 | ||
|
|
6a39d7fca5 | ||
|
|
a15e67f065 | ||
|
|
7a1bce9578 | ||
|
|
f2b4de7943 | ||
|
|
b3ff4ac6d9 | ||
|
|
1c56e7fab5 | ||
|
|
70ba4df385 | ||
|
|
8062c705e8 | ||
|
|
fafb23c1a6 | ||
|
|
4e7ac7030c | ||
|
|
4803daca5a | ||
|
|
facfc61316 | ||
|
|
e3e495bfb1 | ||
|
|
e007284d2f | ||
|
|
1da8416ebd | ||
|
|
79b49a469c | ||
|
|
5888efcaef | ||
|
|
459d1b4f56 | ||
|
|
9151102bda | ||
|
|
3819984add | ||
|
|
3b58fbc186 | ||
|
|
55e589b3d9 | ||
|
|
e64d64d8d8 | ||
|
|
37c2d9135b | ||
|
|
30c96221bd | ||
|
|
bf7305e3f8 | ||
|
|
3b12a229c3 | ||
|
|
5726ceb8dc | ||
|
|
c06c06624d | ||
|
|
ad40d7071e | ||
|
|
f55a39eb90 | ||
|
|
c3869bee31 | ||
|
|
6eac15df0f | ||
|
|
6f5d3c32c3 | ||
|
|
68ef40e4d0 | ||
|
|
4046bc4f72 | ||
|
|
1b8d131915 | ||
|
|
f5ad332d28 | ||
|
|
938603ff60 | ||
|
|
17af78f2bb | ||
|
|
7588267743 | ||
|
|
ed4f9c8176 | ||
|
|
bbb46e88b0 | ||
|
|
3db7aac0d8 | ||
|
|
fdbbd2e563 | ||
|
|
e92f1321d4 | ||
|
|
da2aaff9e5 | ||
|
|
208904b634 | ||
|
|
a433bcda2e | ||
|
|
4bba692170 | ||
|
|
59b61cd8be | ||
|
|
247b013e16 | ||
|
|
77baafa643 | ||
|
|
3c56f1f076 | ||
|
|
224d8c7cb4 | ||
|
|
0feb520549 | ||
|
|
ca365b12f6 | ||
|
|
bde6ad9a06 | ||
|
|
4953f4500d | ||
|
|
7fee1fcc74 | ||
|
|
4415ac8fd2 | ||
|
|
8c81e48a31 | ||
|
|
9ad0329c56 | ||
|
|
78f533bbfc | ||
|
|
79c7dd9ecf | ||
|
|
5d796d1f79 | ||
|
|
68a82be6c4 | ||
|
|
2676ef2b73 | ||
|
|
04b283c539 | ||
|
|
98b067937a | ||
|
|
8ababb60bf | ||
|
|
b51d655f77 | ||
|
|
74496d32da | ||
|
|
316e278be1 | ||
|
|
d881bf6504 | ||
|
|
c74fbbe1fd | ||
|
|
929d9fb7bd | ||
|
|
5d069d0531 | ||
|
|
dd9e6dc5d3 | ||
|
|
d22c77c41d | ||
|
|
3a11b7ccbf | ||
|
|
d7931777bc | ||
|
|
9d161b28bb | ||
|
|
9b16a1caa0 | ||
|
|
9a918e3bac | ||
|
|
d4c5c6a1e0 | ||
|
|
63fda3555c | ||
|
|
6a2381c06b | ||
|
|
e9c0a16c26 | ||
|
|
2101a67ac1 | ||
|
|
ddac568aaa | ||
|
|
262ae9f635 | ||
|
|
381502fb80 | ||
|
|
92fb441eb2 | ||
|
|
29e08037a8 | ||
|
|
84cc6d9315 | ||
|
|
b8d5a1c732 | ||
|
|
0197ab9661 | ||
|
|
b7915e61a6 | ||
|
|
586db99450 | ||
|
|
5377d0dd18 | ||
|
|
bb48d55bd4 | ||
|
|
c5d3a7d573 | ||
|
|
8267050f06 | ||
|
|
610b02968e | ||
|
|
a7112c42df | ||
|
|
8a474a3b00 | ||
|
|
59e18d155e | ||
|
|
12ca5d8063 | ||
|
|
c959e0a928 | ||
|
|
89a08b021d | ||
|
|
04b553cdec | ||
|
|
15e9ee30ee | ||
|
|
a0d650a86c | ||
|
|
1a6ad48e08 | ||
|
|
7c82eeb018 | ||
|
|
b188e74ee0 | ||
|
|
c21bd5765a | ||
|
|
b78c37a695 | ||
|
|
2f151d45c3 | ||
|
|
3ebe3afdbd | ||
|
|
f4845df6c0 | ||
|
|
272b87f04d | ||
|
|
ff790eeefb | ||
|
|
97e918da03 | ||
|
|
4f30998873 | ||
|
|
a0fc478a28 | ||
|
|
bb03fd1968 | ||
|
|
0c65f74662 | ||
|
|
29ac2bd4f5 | ||
|
|
0d8b4f32e8 | ||
|
|
83db7f24eb | ||
|
|
5f9976a193 | ||
|
|
9480ef485b | ||
|
|
a9b7432584 | ||
|
|
6d7081910f | ||
|
|
aa96089ab4 | ||
|
|
58ae681417 | ||
|
|
c038e0af5e | ||
|
|
4f9976c0cb | ||
|
|
e308e5ed57 | ||
|
|
7b1b1ca994 | ||
|
|
551be49a1a | ||
|
|
a3888e6902 | ||
|
|
43bb6a0dd8 | ||
|
|
6e3f754366 | ||
|
|
6360112432 | ||
|
|
f1ca0b5417 | ||
|
|
0894c8007c | ||
|
|
05863acbcd | ||
|
|
0e4cd06137 | ||
|
|
85d2d974e7 | ||
|
|
3f021f9552 | ||
|
|
0456f10709 | ||
|
|
b7d03f7463 | ||
|
|
07a392c2a7 | ||
|
|
5b69de770f | ||
|
|
4688870984 | ||
|
|
bf67069768 | ||
|
|
91764c1c74 | ||
|
|
8b2a3e1221 | ||
|
|
def2f0b37d | ||
|
|
5d7479a3dd | ||
|
|
ceb2d35f9f | ||
|
|
fc38dba59a | ||
|
|
75b383d398 | ||
|
|
ee2d9491fb | ||
|
|
bf86a7c75a | ||
|
|
70f6d129e2 | ||
|
|
a4ac2aa99a | ||
|
|
ae3b6fbe6b | ||
|
|
e357fca963 | ||
|
|
c84cc89805 | ||
|
|
181238cd50 | ||
|
|
214c24c736 | ||
|
|
cf51ce8f26 | ||
|
|
2b7ed40d01 | ||
|
|
349ef7a54c | ||
|
|
94df5fc389 | ||
|
|
906238a297 | ||
|
|
7963fa82b5 | ||
|
|
1aba6012fb | ||
|
|
ff4324ac67 | ||
|
|
11bc669e1d | ||
|
|
dcf26d58e4 | ||
|
|
4d46872c35 | ||
|
|
4f0d62f421 | ||
|
|
f7ad1f517b | ||
|
|
345d6197f3 | ||
|
|
bb4d44138a | ||
|
|
a8ef0cde53 | ||
|
|
77dc009c95 | ||
|
|
aa298c93cc | ||
|
|
dfb0a5240e | ||
|
|
9cfc3c22b5 | ||
|
|
b177d98e29 | ||
|
|
5405fb0370 | ||
|
|
72a1c24b3b | ||
|
|
f146ae94ec | ||
|
|
a0bbba748a | ||
|
|
81bf818573 | ||
|
|
d5913dc292 | ||
|
|
e1e901b794 | ||
|
|
2f2f26767e | ||
|
|
bffa78c1b8 | ||
|
|
c55719c67a | ||
|
|
cb3b4a6642 | ||
|
|
92c141cee6 | ||
|
|
fd1a1a1c23 | ||
|
|
b835884b2e | ||
|
|
660763908d | ||
|
|
fe8bdb755a | ||
|
|
67dc6d2d23 | ||
|
|
9c8d73cbe2 | ||
|
|
5db97d92dd | ||
|
|
ac470dddb5 | ||
|
|
43063fe8ce | ||
|
|
59e0046c1e | ||
|
|
36ab05c265 | ||
|
|
2b2be05dae | ||
|
|
fb1adbd1ef | ||
|
|
ab68a59b25 | ||
|
|
9c7de767e9 | ||
|
|
8ba5cf7c2e | ||
|
|
b194a19b98 | ||
|
|
1d344b016f | ||
|
|
474f3ef4ca | ||
|
|
9830927020 | ||
|
|
727932a442 | ||
|
|
cd92b51845 | ||
|
|
fe26d16411 | ||
|
|
d68c66ce2b | ||
|
|
e7bfbfb48f | ||
|
|
f2a88ae61c | ||
|
|
e2113f6ee5 | ||
|
|
3867224024 | ||
|
|
9ee0bf43bc | ||
|
|
2844542efa | ||
|
|
e3fcae9392 | ||
|
|
c6ccfa91f3 | ||
|
|
b6fcee1cb9 | ||
|
|
9071befb04 | ||
|
|
bdd5fe98f3 | ||
|
|
a3d3e83a49 | ||
|
|
08bde72028 | ||
|
|
108a136368 | ||
|
|
57d87ad6b1 | ||
|
|
0c22815ff7 | ||
|
|
0ca792ecfd | ||
|
|
987c34c69e | ||
|
|
c1c02bc8ab | ||
|
|
4ee369f27c | ||
|
|
c9012efdcb | ||
|
|
41524fc67d | ||
|
|
04ff61e981 | ||
|
|
532468dc67 | ||
|
|
9c9a2dae47 | ||
|
|
c8a868b57f | ||
|
|
4b3f81ee34 | ||
|
|
afa170ba7c | ||
|
|
46e3b2272e | ||
|
|
52472e90ec | ||
|
|
4ef0d00846 | ||
|
|
580f2537f2 | ||
|
|
3d9fd96026 | ||
|
|
f449b92721 | ||
|
|
3b0216b023 | ||
|
|
98cf839737 | ||
|
|
0bb0846505 | ||
|
|
70969400a3 | ||
|
|
147e8d5d12 | ||
|
|
cacc3e6edd | ||
|
|
a284eca147 | ||
|
|
0d3ba9d7f0 | ||
|
|
be8064d642 | ||
|
|
e30dba742d | ||
|
|
44b72ed647 | ||
|
|
666bd77dac | ||
|
|
0a6613e60d | ||
|
|
62e186c123 | ||
|
|
50dd8f5bcc | ||
|
|
d5fcac9c45 | ||
|
|
c2bed85190 | ||
|
|
183b463ef2 | ||
|
|
92fdac44a0 | ||
|
|
12829ecc73 | ||
|
|
51319c3b26 | ||
|
|
8fd827040b | ||
|
|
5ec46eae0d | ||
|
|
32c03301be | ||
|
|
df7f29b2ab | ||
|
|
e863113c36 | ||
|
|
8e2c1d7382 | ||
|
|
ab7b9cccba | ||
|
|
81bf61a161 | ||
|
|
b40f008647 | ||
|
|
734e41702b | ||
|
|
038dd20a91 | ||
|
|
1dd62b8550 | ||
|
|
715deebe05 | ||
|
|
b3fe3d8590 | ||
|
|
f74c3ed3ea | ||
|
|
2c9aebeeed | ||
|
|
7474f1e11f | ||
|
|
dba9c55b64 | ||
|
|
b432364397 | ||
|
|
696967bdd1 | ||
|
|
b76889efc3 | ||
|
|
e6a7b64ebe | ||
|
|
9daa0df311 | ||
|
|
612800bda5 | ||
|
|
a6bbb1dec9 | ||
|
|
873c93ab64 | ||
|
|
d15242e2d2 | ||
|
|
992d2b937c | ||
|
|
1e05ddad4b | ||
|
|
4f8a64610b | ||
|
|
b82366218c | ||
|
|
acbe1f4cb3 | ||
|
|
4c5e018583 | ||
|
|
6c0380e85c | ||
|
|
fde48e604f | ||
|
|
e83a4de5fb | ||
|
|
927d2799dc | ||
|
|
1ad701fe5d | ||
|
|
086425d2da | ||
|
|
beca54416a | ||
|
|
c92f5c5713 | ||
|
|
dee4e6caff | ||
|
|
dd5a39e72e | ||
|
|
e5ed52165c | ||
|
|
9484f8e0f5 | ||
|
|
947caffe0a | ||
|
|
870090e8df | ||
|
|
73f07f13c5 | ||
|
|
d1952bf591 | ||
|
|
5a612e1332 | ||
|
|
b00a9faea6 | ||
|
|
74db42a703 | ||
|
|
ddf625ca04 | ||
|
|
eca2f017d8 | ||
|
|
3190bde343 | ||
|
|
c6ebf42a47 | ||
|
|
c116b60d12 | ||
|
|
5d09e6d9ab | ||
|
|
2613ce0ac9 | ||
|
|
a88e9b28ea | ||
|
|
f0a3c26ee6 | ||
|
|
84c87ecb32 | ||
|
|
6573f44d41 | ||
|
|
3cacbc552c | ||
|
|
343d623e02 | ||
|
|
6b80bb2b11 | ||
|
|
56fe7452eb | ||
|
|
d3a66f6605 | ||
|
|
dd7b4712f1 | ||
|
|
9df5871f6b | ||
|
|
29aab9e9f4 | ||
|
|
af67eb7f0b | ||
|
|
10482c0141 | ||
|
|
a7a792251a | ||
|
|
aec2308144 | ||
|
|
0741b8aa6a | ||
|
|
3082622394 | ||
|
|
965c9cb0af | ||
|
|
495a46e2d8 | ||
|
|
05bda1192e | ||
|
|
6058af0ca1 | ||
|
|
1eb8bf9719 | ||
|
|
afc02faeda | ||
|
|
66f22de90f | ||
|
|
2949a2e0ff | ||
|
|
ba12efea9d | ||
|
|
e1180a12fb | ||
|
|
1393706f13 | ||
|
|
6f994f31f7 | ||
|
|
38aa99a063 | ||
|
|
85c44b3529 | ||
|
|
e1a2768de5 | ||
|
|
e1c9b27203 | ||
|
|
969f6ef826 | ||
|
|
7abc4d4e76 | ||
|
|
ac97147c1f | ||
|
|
dbd20fe396 | ||
|
|
44e57c9c4b | ||
|
|
488e5e531f | ||
|
|
42a6a8d770 | ||
|
|
f8e877ea05 | ||
|
|
65d6fc7272 | ||
|
|
63ce8e461b | ||
|
|
fbf4c48461 | ||
|
|
81a55db644 | ||
|
|
4d4edfa181 | ||
|
|
6f9182f1f6 | ||
|
|
fa600c03e2 | ||
|
|
4a53301e9f | ||
|
|
676984b3d5 | ||
|
|
e6d7f7248b | ||
|
|
50903b5c4a | ||
|
|
01e399fb91 | ||
|
|
911aeb7af0 | ||
|
|
7e5cd9abbc | ||
|
|
115527a21a | ||
|
|
eff4f4f601 | ||
|
|
16e0099a0d | ||
|
|
2c8c678275 | ||
|
|
3b51e87fbf | ||
|
|
6c6eef5e2b | ||
|
|
6e5910f44c | ||
|
|
a967189bc6 | ||
|
|
7069176cf6 | ||
|
|
44dcbe773d | ||
|
|
ca76975461 | ||
|
|
83122ac99e | ||
|
|
c3e9458555 | ||
|
|
057ba38873 | ||
|
|
81d7d6236b | ||
|
|
191dd49653 | ||
|
|
21e9dd6f51 | ||
|
|
cc2d14acc6 | ||
|
|
87f37e9f1c | ||
|
|
d536a9f874 | ||
|
|
b45f353fa9 | ||
|
|
a3073ec14e | ||
|
|
f77eb33029 | ||
|
|
c1c919097a | ||
|
|
e05348463c | ||
|
|
fdcf74eaf2 | ||
|
|
6d57a3e3b9 | ||
|
|
1f449c866e | ||
|
|
e12deccd24 | ||
|
|
3184ebb5ee | ||
|
|
4a35ed2b35 | ||
|
|
5c9474d1c8 | ||
|
|
2321dc50c5 | ||
|
|
4efd2e8184 | ||
|
|
e30e153bfa | ||
|
|
2724211535 | ||
|
|
81068de0f1 | ||
|
|
7d842175f7 | ||
|
|
e0aee9f361 | ||
|
|
df576e2738 | ||
|
|
bb1356b25d | ||
|
|
1b67960da4 | ||
|
|
d76718e8b2 | ||
|
|
76c51922f1 | ||
|
|
f95e89a136 | ||
|
|
2dff60a23c | ||
|
|
95f83d1a29 | ||
|
|
b875ccecc1 | ||
|
|
e4c3802f16 | ||
|
|
081e485f4f | ||
|
|
4adf88da19 | ||
|
|
31e2b1b8d3 | ||
|
|
bd28abd343 | ||
|
|
955690b124 | ||
|
|
fa6f06ae15 | ||
|
|
263de140c5 | ||
|
|
ed85d06d69 | ||
|
|
4ff0870df8 | ||
|
|
410bac2040 | ||
|
|
38b1e367b1 | ||
|
|
3cddffa37f | ||
|
|
ea7a1a7175 | ||
|
|
36b5601588 | ||
|
|
7fc68f2969 | ||
|
|
c5ee07add4 | ||
|
|
32ff315b6b | ||
|
|
f919346f8f | ||
|
|
279df00404 | ||
|
|
bfd4b17fa0 | ||
|
|
5fe2817164 | ||
|
|
b337bb39bc | ||
|
|
65ae41c5f1 | ||
|
|
796c644c4a | ||
|
|
bfd9023a27 | ||
|
|
c9cdf5d03e | ||
|
|
f60bb41ad9 | ||
|
|
c333903b4a | ||
|
|
dd55e8a22c | ||
|
|
3ab9381d0a | ||
|
|
58f1fe0671 | ||
|
|
82b9c05d0f | ||
|
|
7c9397f7f6 | ||
|
|
6214b6a3ff | ||
|
|
883c8cc4c8 | ||
|
|
8d47c72913 | ||
|
|
89a6664e45 | ||
|
|
30d792d6e1 | ||
|
|
3745bf3157 | ||
|
|
a7fda3e50d | ||
|
|
7f07204fef | ||
|
|
8b51a44b7c | ||
|
|
c499c73dcc | ||
|
|
c01f3f5e8a | ||
|
|
2aef35655f | ||
|
|
7ddf1f5830 | ||
|
|
b2c513ea42 | ||
|
|
4c30f94355 | ||
|
|
e911e86c4c | ||
|
|
ca640b3f64 | ||
|
|
b4c4a05f3b | ||
|
|
fd3c36a259 | ||
|
|
d8274ac2d4 | ||
|
|
9c7479f953 | ||
|
|
b5dc3c4366 | ||
|
|
26b8082155 | ||
|
|
418df15f7b | ||
|
|
31ed0125b8 | ||
|
|
494318b879 | ||
|
|
f554ddc372 | ||
|
|
03de12c221 | ||
|
|
6c41f22b57 | ||
|
|
7ae96388e3 | ||
|
|
e8b4de00d2 | ||
|
|
cd7963b30d | ||
|
|
0dc44cffcf | ||
|
|
7a650132c5 | ||
|
|
c7fb390c38 | ||
|
|
572ff9df19 | ||
|
|
b715e0cef7 | ||
|
|
36ab2a889f | ||
|
|
a78d2f28d7 | ||
|
|
7d5a39ed89 | ||
|
|
772272ff36 | ||
|
|
2ab4eafee9 | ||
|
|
b15e0d4c45 | ||
|
|
b8180314d8 | ||
|
|
fcb8d03a0f | ||
|
|
09ec89bc2e | ||
|
|
863ad0f486 | ||
|
|
79a1bb3571 | ||
|
|
9f1d7323c7 | ||
|
|
64a82f4785 | ||
|
|
f37e4bd76e | ||
|
|
98ef2cc640 | ||
|
|
134222fd69 | ||
|
|
0cb2371517 | ||
|
|
b7de4359fd | ||
|
|
2607d6a107 | ||
|
|
db46b1ce13 | ||
|
|
d7b08d5207 | ||
|
|
29fbba832c | ||
|
|
fd621a442a | ||
|
|
a1a73568ae | ||
|
|
3daccbd6ec | ||
|
|
293deadb48 | ||
|
|
452b56c47b | ||
|
|
5cb6bfa633 | ||
|
|
0515cee6f3 | ||
|
|
4247112539 | ||
|
|
8d3374f574 | ||
|
|
26833e5f7c | ||
|
|
6752b46f67 | ||
|
|
b9429ffcaa | ||
|
|
10827c7e21 | ||
|
|
23cb4a34a4 | ||
|
|
adfd09565f | ||
|
|
78b9ff49d4 | ||
|
|
fca425d25e | ||
|
|
1a4238156c | ||
|
|
f6210cc014 | ||
|
|
6c8b466e59 | ||
|
|
2aebe97f9f | ||
|
|
157724bff8 | ||
|
|
6cbb1a0bee | ||
|
|
960a13dd38 | ||
|
|
9213f80435 | ||
|
|
bccae94c7a | ||
|
|
d71f77ce06 | ||
|
|
2787f3dc71 | ||
|
|
fb00baab5b | ||
|
|
9e22155d31 | ||
|
|
963373435d | ||
|
|
377987fa92 | ||
|
|
0b6980639e | ||
|
|
4f1cc9f94f | ||
|
|
6e5434a0ec | ||
|
|
3244f7c38f | ||
|
|
f27b676e89 | ||
|
|
4f2a80a4a3 | ||
|
|
a51bc27829 | ||
|
|
4fd321c93d | ||
|
|
bbd62bdef5 | ||
|
|
4bb1d78939 | ||
|
|
53c37ef413 | ||
|
|
a6511b6c5a | ||
|
|
829e96a2d0 | ||
|
|
2e25f37433 | ||
|
|
fbf6c73226 | ||
|
|
aab54e3f23 | ||
|
|
a6eff7fbfb | ||
|
|
d5667d2473 | ||
|
|
a42305dd59 | ||
|
|
c22a718d14 | ||
|
|
d0b23c79e2 | ||
|
|
76da04afd8 | ||
|
|
768f60709f | ||
|
|
8cd3acd318 | ||
|
|
ce7cfc0648 | ||
|
|
8b6cf55473 | ||
|
|
75d95d844c | ||
|
|
f54bfd3fb5 | ||
|
|
f8a8ee9b9d | ||
|
|
16faaae199 | ||
|
|
375417527b | ||
|
|
10b01ca6b3 | ||
|
|
f9006af04c | ||
|
|
57f947576e | ||
|
|
5a8f8c345b | ||
|
|
e96067e3c8 | ||
|
|
2242174515 | ||
|
|
73179c118b | ||
|
|
5b575134fc | ||
|
|
c11c06b896 | ||
|
|
ba8d2a251f | ||
|
|
c9589b73f4 | ||
|
|
32f4425100 | ||
|
|
05e81484f1 | ||
|
|
10cc79f737 | ||
|
|
957d9b180d | ||
|
|
883204fc43 | ||
|
|
6d3904fbbd | ||
|
|
56a51f18e7 | ||
|
|
307508b7a0 | ||
|
|
66fce79427 | ||
|
|
5e5708d8d4 | ||
|
|
944d92bbb4 | ||
|
|
0155d5aa39 | ||
|
|
fe4f45c2b0 | ||
|
|
1b63a58e63 | ||
|
|
46a141db9c | ||
|
|
66de06956c | ||
|
|
713dd62bd1 | ||
|
|
5ac65aafad | ||
|
|
4aef92e6fe | ||
|
|
a1b0e771e5 | ||
|
|
5baeac4706 | ||
|
|
87aa9bd673 | ||
|
|
2ec5ca56d5 | ||
|
|
b5c7f83ec8 | ||
|
|
eb3ebdbf52 | ||
|
|
c60698ff7e | ||
|
|
f8c2cda257 | ||
|
|
48f6c195e0 | ||
|
|
804fa60317 | ||
|
|
d77b99d3d4 | ||
|
|
006f1271d6 | ||
|
|
0d14514712 | ||
|
|
f25e5f9488 | ||
|
|
9e8bbfd175 | ||
|
|
3d11c96e23 | ||
|
|
a670737ca5 | ||
|
|
9fdd982e73 | ||
|
|
8024918e08 | ||
|
|
cda7607e1c | ||
|
|
816c83c80a | ||
|
|
0c3c490d58 | ||
|
|
99da6fb66f | ||
|
|
fa2601386c | ||
|
|
122833b0e3 | ||
|
|
8618dbf0d5 | ||
|
|
a0baf33459 | ||
|
|
0ee66ea928 | ||
|
|
f68d4aaf5b | ||
|
|
888abc9e2a | ||
|
|
c8115b1c10 | ||
|
|
137d4f591f | ||
|
|
337d49770d | ||
|
|
614c5578b0 | ||
|
|
d456e60800 | ||
|
|
064206fb9a | ||
|
|
a68fe3b39d | ||
|
|
1904c82941 | ||
|
|
6fc9dd4b30 | ||
|
|
158a31e924 | ||
|
|
b70b924db4 | ||
|
|
9018d72e97 | ||
|
|
5c395138ed | ||
|
|
af157adc1b | ||
|
|
1db4fca9db | ||
|
|
013f475859 | ||
|
|
b5bc38fa52 | ||
|
|
bd0e0cdfa4 | ||
|
|
dade4c4cc4 | ||
|
|
acc5a89dff | ||
|
|
d34881aa25 | ||
|
|
b8ad48997b | ||
|
|
77754b7246 | ||
|
|
6d5bf49a51 | ||
|
|
b7af635a9a | ||
|
|
f53b4e959c | ||
|
|
6716d156bb | ||
|
|
dc33e28452 | ||
|
|
9da4781759 | ||
|
|
0c6959cb4a | ||
|
|
ff3136df70 | ||
|
|
326c627221 | ||
|
|
075f382a8f | ||
|
|
dabb8fe49e | ||
|
|
90489e4392 | ||
|
|
ad45a74f87 | ||
|
|
60c045a713 | ||
|
|
f6c75e1f99 | ||
|
|
dd9245f6f2 | ||
|
|
7310a70743 | ||
|
|
82276837ac | ||
|
|
bd68252b44 | ||
|
|
6b1258e33a | ||
|
|
0400032923 | ||
|
|
d9563322f1 | ||
|
|
ab965969dd | ||
|
|
2f32e034d8 | ||
|
|
d7bb171c1e | ||
|
|
1cf7931f43 | ||
|
|
edc697dd73 | ||
|
|
54a059ff68 | ||
|
|
289282e235 | ||
|
|
825c36c15e | ||
|
|
1234c2e99e | ||
|
|
b8fae1308d | ||
|
|
dddcf624e6 | ||
|
|
b33fe9f7fe | ||
|
|
5a799400a9 | ||
|
|
76919a819f | ||
|
|
9c30f846b2 | ||
|
|
9230f51988 | ||
|
|
712035dc9a | ||
|
|
32e5c5b4ad | ||
|
|
134a6fab7e | ||
|
|
82e27cb962 | ||
|
|
8bcad7b3f9 | ||
|
|
d767575f76 | ||
|
|
7214c7d393 | ||
|
|
205e5ab03d | ||
|
|
6576beae76 | ||
|
|
001f8f1f50 | ||
|
|
3b694a87ef | ||
|
|
84dd06d769 | ||
|
|
c5cb16abfb | ||
|
|
79fb34324d | ||
|
|
303aef3548 | ||
|
|
fd278f8c32 | ||
|
|
53041a4117 | ||
|
|
9b3fe3b13a | ||
|
|
5c6c5081e9 | ||
|
|
e087ea0ac7 | ||
|
|
71c44dc805 | ||
|
|
c5c8596664 | ||
|
|
92a86f4d1c | ||
|
|
8098b68b8e | ||
|
|
7356001723 | ||
|
|
aba60587ab | ||
|
|
936a6a04fb | ||
|
|
9675126298 | ||
|
|
6a5886ea1c | ||
|
|
648c6a5a8f | ||
|
|
14b7bf4753 | ||
|
|
0e310fa96a | ||
|
|
0f6c282c80 | ||
|
|
4c3a0d329b | ||
|
|
7c495c2177 | ||
|
|
2f86a9e534 | ||
|
|
12c3a0b1fa | ||
|
|
58c069ec5c | ||
|
|
7916600a7b | ||
|
|
3e4f160c5d | ||
|
|
ad683fee89 | ||
|
|
3bf8baee85 | ||
|
|
8792213594 | ||
|
|
9ab8bdfe4a | ||
|
|
90301ae9ee |
1
.gitattributes
vendored
Normal file
1
.gitattributes
vendored
Normal file
@@ -0,0 +1 @@
|
|||||||
|
*.java text eol=lf
|
||||||
7
.github/PULL_REQUEST_TEMPLATE.md
vendored
7
.github/PULL_REQUEST_TEMPLATE.md
vendored
@@ -7,4 +7,9 @@ We love getting PRs, but we hate asking people for the same basic changes every
|
|||||||
- [ ] Push your changes to a branch other than `master`. Create your PR from that branch.
|
- [ ] Push your changes to a branch other than `master`. Create your PR from that branch.
|
||||||
- [ ] Add JavaDocs and other comments
|
- [ ] Add JavaDocs and other comments
|
||||||
- [ ] Write tests that run and pass in CI. See [CONTRIBUTING.md](CONTRIBUTING.md) for details on how to capture snapshot data.
|
- [ ] Write tests that run and pass in CI. See [CONTRIBUTING.md](CONTRIBUTING.md) for details on how to capture snapshot data.
|
||||||
- [ ] Run `mvn -P ci install site` locally. This may reformat your code, commit those changes. If this command doesn't succeed, your change will not pass CI.
|
- [ ] Run `mvn -D enable-ci clean install site` locally. If this command doesn't succeed, your change will not pass CI.
|
||||||
|
|
||||||
|
# When creating a PR:
|
||||||
|
|
||||||
|
- [ ] Fill in the "Description" above.
|
||||||
|
- [ ] Enable "Allow edits from maintainers".
|
||||||
|
|||||||
12
.github/dependabot.yml
vendored
Normal file
12
.github/dependabot.yml
vendored
Normal file
@@ -0,0 +1,12 @@
|
|||||||
|
version: 2
|
||||||
|
updates:
|
||||||
|
- package-ecosystem: "maven"
|
||||||
|
directory: "/"
|
||||||
|
schedule:
|
||||||
|
interval: "monthly"
|
||||||
|
time: "02:00"
|
||||||
|
- package-ecosystem: "github-actions"
|
||||||
|
directory: "/"
|
||||||
|
schedule:
|
||||||
|
interval: "monthly"
|
||||||
|
time: "02:00"
|
||||||
5
.github/release-drafter.yml
vendored
5
.github/release-drafter.yml
vendored
@@ -1,5 +1,6 @@
|
|||||||
name-template: 'v$NEXT_PATCH_VERSION 🌈'
|
name-template: 'v$NEXT_MINOR_VERSION 🌈'
|
||||||
tag-template: 'v$NEXT_PATCH_VERSION'
|
tag-template: 'github-api-$NEXT_MINOR_VERSION'
|
||||||
|
version-template: '$MAJOR.$MINOR'
|
||||||
categories:
|
categories:
|
||||||
- title: '🚀 Features'
|
- title: '🚀 Features'
|
||||||
labels:
|
labels:
|
||||||
|
|||||||
84
.github/workflows/maven-build.yml
vendored
84
.github/workflows/maven-build.yml
vendored
@@ -1,22 +1,92 @@
|
|||||||
name: Java CI Build and Test
|
name: CI
|
||||||
|
|
||||||
on: [push, pull_request]
|
on: [push, pull_request]
|
||||||
|
|
||||||
|
# this is required by spotless for JDK 16+
|
||||||
|
env:
|
||||||
|
JAVA_11_PLUS_MAVEN_OPTS: "--add-opens jdk.compiler/com.sun.tools.javac.util=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.file=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.parser=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.tree=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.api=ALL-UNNAMED"
|
||||||
|
|
||||||
jobs:
|
jobs:
|
||||||
build:
|
build:
|
||||||
|
name: build-only (Java ${{ matrix.java }})
|
||||||
runs-on: ubuntu-latest
|
runs-on: ubuntu-latest
|
||||||
strategy:
|
strategy:
|
||||||
|
fail-fast: false
|
||||||
matrix:
|
matrix:
|
||||||
java: [ '1.8.0', '11.0.x', '13.0.x' ]
|
java: [ 16 ]
|
||||||
steps:
|
steps:
|
||||||
- uses: actions/checkout@v2
|
- uses: actions/checkout@v2
|
||||||
- name: Set up JDK
|
- name: Set up JDK
|
||||||
uses: actions/setup-java@v1
|
uses: actions/setup-java@v1
|
||||||
with:
|
with:
|
||||||
java-version: ${{ matrix.java }}
|
java-version: ${{ matrix.java }}
|
||||||
- name: Maven Download all dependencies
|
- name: Cached .m2
|
||||||
run: mvn -B org.apache.maven.plugins:maven-dependency-plugin:3.1.1:go-offline -P ci
|
uses: actions/cache@v2.1.4
|
||||||
- name: Maven Build
|
with:
|
||||||
run: mvn -B install site -P ci --file pom.xml
|
path: ~/.m2/repository
|
||||||
|
key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
|
||||||
|
restore-keys: |
|
||||||
|
${{ runner.os }}-maven-
|
||||||
|
- name: Maven Install (skipTests)
|
||||||
|
env:
|
||||||
|
MAVEN_OPTS: ${{ env.JAVA_11_PLUS_MAVEN_OPTS }}
|
||||||
|
run: mvn -B install -DskipTests -D enable-ci --file pom.xml
|
||||||
|
site:
|
||||||
|
name: site (Java ${{ matrix.java }})
|
||||||
|
runs-on: ubuntu-latest
|
||||||
|
strategy:
|
||||||
|
fail-fast: false
|
||||||
|
matrix:
|
||||||
|
java: [ 8, 11 ]
|
||||||
|
steps:
|
||||||
|
- uses: actions/checkout@v2
|
||||||
|
- name: Set up JDK
|
||||||
|
uses: actions/setup-java@v1
|
||||||
|
with:
|
||||||
|
java-version: ${{ matrix.java }}
|
||||||
|
- uses: actions/cache@v2.1.4
|
||||||
|
with:
|
||||||
|
path: ~/.m2/repository
|
||||||
|
key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
|
||||||
|
restore-keys: |
|
||||||
|
${{ runner.os }}-maven-
|
||||||
|
- name: Maven Site
|
||||||
|
run: mvn -B site -D enable-ci --file pom.xml
|
||||||
|
test:
|
||||||
|
name: test (${{ matrix.os }}, Java ${{ matrix.java }})
|
||||||
|
runs-on: ${{ matrix.os }}-latest
|
||||||
|
strategy:
|
||||||
|
fail-fast: false
|
||||||
|
matrix:
|
||||||
|
os: [ ubuntu, windows ]
|
||||||
|
java: [ 8, 11, 16 ]
|
||||||
|
steps:
|
||||||
|
- uses: actions/checkout@v2
|
||||||
|
- name: Set up JDK
|
||||||
|
uses: actions/setup-java@v1
|
||||||
|
with:
|
||||||
|
java-version: ${{ matrix.java }}
|
||||||
|
- uses: actions/cache@v2.1.4
|
||||||
|
with:
|
||||||
|
path: ~/.m2/repository
|
||||||
|
key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
|
||||||
|
restore-keys: |
|
||||||
|
${{ runner.os }}-maven-
|
||||||
|
# JDK 8
|
||||||
|
- name: Maven Install without Code Coverage
|
||||||
|
if: matrix.os == 'windows' && matrix.java == '8'
|
||||||
|
run: mvn -B install --file pom.xml
|
||||||
|
- name: Maven Install with Code Coverage
|
||||||
|
if: matrix.os != 'windows' && matrix.java == '8'
|
||||||
|
run: mvn -B install -D enable-ci --file pom.xml
|
||||||
|
# JDK 11+
|
||||||
|
- name: Maven Install without Code Coverage
|
||||||
|
if: matrix.os == 'windows' && matrix.java != '8'
|
||||||
|
env:
|
||||||
|
MAVEN_OPTS: ${{ env.JAVA_11_PLUS_MAVEN_OPTS }}
|
||||||
|
run: mvn -B install --file pom.xml
|
||||||
|
- name: Maven Install with Code Coverage
|
||||||
|
if: matrix.os != 'windows' && matrix.java != '8'
|
||||||
|
env:
|
||||||
|
MAVEN_OPTS: ${{ env.JAVA_11_PLUS_MAVEN_OPTS }}
|
||||||
|
run: mvn -B install -D enable-ci --file pom.xml
|
||||||
|
|||||||
2
.gitignore
vendored
2
.gitignore
vendored
@@ -9,3 +9,5 @@ target
|
|||||||
.DS_Store
|
.DS_Store
|
||||||
|
|
||||||
dependency-reduced-pom.xml
|
dependency-reduced-pom.xml
|
||||||
|
.factorypath
|
||||||
|
.vscode/settings.json
|
||||||
|
|||||||
1326
CHANGELOG.md
1326
CHANGELOG.md
File diff suppressed because it is too large
Load Diff
@@ -14,10 +14,14 @@ Example:
|
|||||||
|
|
||||||
This the default behavior.
|
This the default behavior.
|
||||||
|
|
||||||
|
Example for a single test case:
|
||||||
|
|
||||||
|
`mvn install -Dtest=WireMockStatusReporterTest#user_whenProxying_AuthCorrectlyConfigured`
|
||||||
|
|
||||||
|
|
||||||
### Setting up credential
|
### Setting up credential
|
||||||
|
|
||||||
1. Create an OAuth token on github.com
|
1. Create a "Personal access token" on https://github.com/ (`Settings` > `Developer settings` > `Personal access tokens`)
|
||||||
2. Set the GITHUB_OAUTH environment variable to the value of that token
|
2. Set the GITHUB_OAUTH environment variable to the value of that token
|
||||||
3. Set the system property `test.github.useProxy` (usually like "-Dtest.github.useProxy" as a Java VM option)
|
3. Set the system property `test.github.useProxy` (usually like "-Dtest.github.useProxy" as a Java VM option)
|
||||||
|
|
||||||
@@ -27,21 +31,37 @@ This the default behavior.
|
|||||||
|
|
||||||
`WireMockStatusReporterTest: GitHub proxying and user auth correctly configured for user login: <your login>`
|
`WireMockStatusReporterTest: GitHub proxying and user auth correctly configured for user login: <your login>`
|
||||||
|
|
||||||
Whenever you run tests with `-Dtest.github.useProxy`, they will try to get data from local files but will fallback to proxying to github if not found.
|
Whenever you run tests with `-Dtest.github.useProxy`, they will try to get data from local files but will fallback to proxying to GitHub if not found.
|
||||||
|
|
||||||
|
|
||||||
### Writing a new test
|
### Writing a new test
|
||||||
|
|
||||||
Once you have credentials setup, you add new test classes and test methods as you would normally.
|
Once you have credentials setup, you add new test classes and test methods as you would normally.
|
||||||
Keep `useProxy` enabled and iterate on your tests as needed. Remember, while proxying your tests are interacting with GitHub - you will need to clean up your state between runs.
|
|
||||||
|
|
||||||
When you are ready to create a snapshot of your test data,
|
#### Running tests using GitHub test proxy
|
||||||
run your test with `test.github.takeSnapshot` ("-Dtest.github.takeSnapshot" as a Java VM option). For example:
|
|
||||||
|
|
||||||
`mvn install -Dtest.github.takeSnapshot -Dtest=YourTestClassName`
|
Keep `useProxy` enabled and iterate on your tests as needed. With `useProxy` enabled your tests will interact with
|
||||||
|
GitHub - you will need to clean up your server-state between runs. This can be done manually to start with.
|
||||||
|
Once your test code is somewhat stable, use `getGitHubBeforeAfter()` to get a `GitHub` instance for test setup and cleanup.
|
||||||
|
Interactions with that `GitHub` instance will not be recorded as part of the test, keeping the test data files to a minimum.
|
||||||
|
|
||||||
The above command would create snapshot WireMock data files under the path `src/test/resources/org/kohsuhke/github/YourTestClassName/wiremock`.
|
#### Running tests against your personal GitHub user account
|
||||||
Each method would get a separate director that would hold the data files for that test method.
|
|
||||||
|
By default, test helper methods such as `getTempRepository()` target the `hub4j-test-org` GitHub organization.
|
||||||
|
Please request access to this org to record your tests before submitting a PR. This helps keep the project stable and nimble.
|
||||||
|
Until you have access (or if you don't want access), you can set the following additional system property to target
|
||||||
|
your personal github account.
|
||||||
|
|
||||||
|
`mvn install -Dtest.github.org=false -Dtest=YourTestClassName`
|
||||||
|
|
||||||
|
#### Taking a snapshot
|
||||||
|
|
||||||
|
When you are ready to create a snapshot of your test data, run your test with `test.github.takeSnapshot` ("-Dtest.github.takeSnapshot" as
|
||||||
|
a Java VM option). For example:
|
||||||
|
|
||||||
|
`mvn install -Dtest.github.takeSnapshot -Dtest.github.org=false -Dtest=YourTestClassName`
|
||||||
|
|
||||||
|
The above command will create snapshot WireMock data files under the path `src/test/resources/org/kohsuhke/github/YourTestClassName/wiremock`.
|
||||||
|
Each method will get a separate directory that will hold the data files for that test method.
|
||||||
|
|
||||||
Add all files including the generated data to your commit and submit a PR.
|
Add all files including the generated data to your commit and submit a PR.
|
||||||
|
|
||||||
|
|||||||
@@ -1,7 +1,9 @@
|
|||||||
# Java API for GitHub
|
# Java API for GitHub
|
||||||
|
|
||||||
[](https://mvnrepository.com/artifact/org.kohsuke/github-api)
|
[](https://mvnrepository.com/artifact/org.kohsuke/github-api)
|
||||||
[](https://gitter.im/github-api/github-api?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
|
[](https://gitter.im/hub4j/github-api?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
|
||||||
|

|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
See https://github-api.kohsuke.org/ for more details
|
See https://github-api.kohsuke.org/ for more details
|
||||||
|
|||||||
333
pom.xml
333
pom.xml
@@ -2,16 +2,16 @@
|
|||||||
<modelVersion>4.0.0</modelVersion>
|
<modelVersion>4.0.0</modelVersion>
|
||||||
<groupId>org.kohsuke</groupId>
|
<groupId>org.kohsuke</groupId>
|
||||||
<artifactId>github-api</artifactId>
|
<artifactId>github-api</artifactId>
|
||||||
<version>1.106</version>
|
<version>1.126</version>
|
||||||
<name>GitHub API for Java</name>
|
<name>GitHub API for Java</name>
|
||||||
<url>https://github-api.kohsuke.org/</url>
|
<url>https://github-api.kohsuke.org/</url>
|
||||||
<description>GitHub API for Java</description>
|
<description>GitHub API for Java</description>
|
||||||
|
|
||||||
<scm>
|
<scm>
|
||||||
<connection>scm:git:git@github.com/github-api/${project.artifactId}.git</connection>
|
<connection>scm:git:git@github.com/hub4j/${project.artifactId}.git</connection>
|
||||||
<developerConnection>scm:git:ssh://git@github.com/github-api/${project.artifactId}.git</developerConnection>
|
<developerConnection>scm:git:ssh://git@github.com/hub4j/${project.artifactId}.git</developerConnection>
|
||||||
<url>https://${project.artifactId}.kohsuke.org/</url>
|
<url>https://github.com/hub4j/github-api/</url>
|
||||||
<tag>github-api-1.106</tag>
|
<tag>github-api-1.126</tag>
|
||||||
</scm>
|
</scm>
|
||||||
|
|
||||||
<distributionManagement>
|
<distributionManagement>
|
||||||
@@ -27,25 +27,26 @@
|
|||||||
</repository>
|
</repository>
|
||||||
<site>
|
<site>
|
||||||
<id>github-pages</id>
|
<id>github-pages</id>
|
||||||
<url>gitsite:git@github.com/github-api/${project.artifactId}.git</url>
|
<url>gitsite:git@github.com/hub4j/${project.artifactId}.git</url>
|
||||||
</site>
|
</site>
|
||||||
</distributionManagement>
|
</distributionManagement>
|
||||||
|
|
||||||
<properties>
|
<properties>
|
||||||
<project.build.sourceEncoding>UTF-8</project.build.sourceEncoding>
|
<project.build.sourceEncoding>UTF-8</project.build.sourceEncoding>
|
||||||
<spotbugs-maven-plugin.version>3.1.12.2</spotbugs-maven-plugin.version>
|
<spotbugs-maven-plugin.version>4.2.0</spotbugs-maven-plugin.version>
|
||||||
<spotbugs.version>3.1.12</spotbugs.version>
|
<spotbugs.version>4.2.1</spotbugs.version>
|
||||||
<spotbugs-maven-plugin.failOnError>true</spotbugs-maven-plugin.failOnError>
|
<spotbugs-maven-plugin.failOnError>true</spotbugs-maven-plugin.failOnError>
|
||||||
<hamcrest.version>2.2</hamcrest.version>
|
<hamcrest.version>2.2</hamcrest.version>
|
||||||
<okhttp3.version>4.3.1</okhttp3.version>
|
<okhttp3.version>4.4.1</okhttp3.version>
|
||||||
<okio.version>2.4.3</okio.version>
|
<okio.version>2.5.0</okio.version>
|
||||||
<formatter-maven-plugin.goal>format</formatter-maven-plugin.goal>
|
|
||||||
<impsort-maven-plugin.goal>sort</impsort-maven-plugin.goal>
|
|
||||||
<!-- Using this as the minimum bar for code coverage. Adding methods without covering them will fail this. -->
|
<!-- Using this as the minimum bar for code coverage. Adding methods without covering them will fail this. -->
|
||||||
<jacoco.coverage.target.bundle.method>0.556</jacoco.coverage.target.bundle.method>
|
<jacoco.coverage.target.bundle.method>0.70</jacoco.coverage.target.bundle.method>
|
||||||
<jacoco.coverage.target.class.method>0.25</jacoco.coverage.target.class.method>
|
<jacoco.coverage.target.class.method>0.50</jacoco.coverage.target.class.method>
|
||||||
<!-- For non-ci builds we'd like the build to still complete if jacoco metrics aren't met. -->
|
<!-- For non-ci builds we'd like the build to still complete if jacoco metrics aren't met. -->
|
||||||
<jacoco.haltOnFailure>false</jacoco.haltOnFailure>
|
<jacoco.haltOnFailure>false</jacoco.haltOnFailure>
|
||||||
|
<jjwt.suite.version>0.11.2</jjwt.suite.version>
|
||||||
|
|
||||||
|
<surefire.argLine />
|
||||||
</properties>
|
</properties>
|
||||||
|
|
||||||
<build>
|
<build>
|
||||||
@@ -80,52 +81,12 @@
|
|||||||
<pluginManagement>
|
<pluginManagement>
|
||||||
<plugins>
|
<plugins>
|
||||||
<plugin>
|
<plugin>
|
||||||
<groupId>org.apache.maven.plugins</groupId>
|
<artifactId>maven-surefire-plugin</artifactId>
|
||||||
<artifactId>maven-shade-plugin</artifactId>
|
<version>2.22.2</version>
|
||||||
<version>3.2.1</version>
|
|
||||||
<executions>
|
|
||||||
<execution>
|
|
||||||
<id>shaded-jar</id>
|
|
||||||
<phase>package</phase>
|
|
||||||
<goals>
|
|
||||||
<goal>shade</goal>
|
|
||||||
</goals>
|
|
||||||
<configuration>
|
<configuration>
|
||||||
<relocations>
|
<!-- SUREFIRE-1226 workaround -->
|
||||||
<relocation>
|
<trimStackTrace>false</trimStackTrace>
|
||||||
<pattern>com.fasterxml.jackson</pattern>
|
|
||||||
<shadedPattern>hidden.com.fasterxml.jackson</shadedPattern>
|
|
||||||
</relocation>
|
|
||||||
<relocation>
|
|
||||||
<pattern>org.apache</pattern>
|
|
||||||
<shadedPattern>hidden.org.apache</shadedPattern>
|
|
||||||
</relocation>
|
|
||||||
</relocations>
|
|
||||||
<artifactSet>
|
|
||||||
<excludes>
|
|
||||||
<exclude>com.infradna.tool:bridge-method-annotation</exclude>
|
|
||||||
<exclude>org.jenkins-ci:annotation-indexer</exclude>
|
|
||||||
<exclude>com.squareup.*:*</exclude>
|
|
||||||
<exclude>org.jetbrains*:*</exclude>
|
|
||||||
<exclude>com.github.spotbugs:*</exclude>
|
|
||||||
<exclude>com.google.code.findbugs:*</exclude>
|
|
||||||
</excludes>
|
|
||||||
</artifactSet>
|
|
||||||
<shadedArtifactAttached>true</shadedArtifactAttached>
|
|
||||||
<filters>
|
|
||||||
<filter>
|
|
||||||
<artifact>*:*</artifact>
|
|
||||||
<excludes>
|
|
||||||
<exclude>module-info.class</exclude>
|
|
||||||
<exclude>META-INF/*.SF</exclude>
|
|
||||||
<exclude>META-INF/*.DSA</exclude>
|
|
||||||
<exclude>META-INF/*.RSA</exclude>
|
|
||||||
</excludes>
|
|
||||||
</filter>
|
|
||||||
</filters>
|
|
||||||
</configuration>
|
</configuration>
|
||||||
</execution>
|
|
||||||
</executions>
|
|
||||||
</plugin>
|
</plugin>
|
||||||
<plugin>
|
<plugin>
|
||||||
<groupId>org.apache.maven.plugins</groupId>
|
<groupId>org.apache.maven.plugins</groupId>
|
||||||
@@ -140,7 +101,7 @@
|
|||||||
<plugin>
|
<plugin>
|
||||||
<groupId>org.jacoco</groupId>
|
<groupId>org.jacoco</groupId>
|
||||||
<artifactId>jacoco-maven-plugin</artifactId>
|
<artifactId>jacoco-maven-plugin</artifactId>
|
||||||
<version>0.8.5</version>
|
<version>0.8.6</version>
|
||||||
<executions>
|
<executions>
|
||||||
<execution>
|
<execution>
|
||||||
<goals>
|
<goals>
|
||||||
@@ -193,65 +154,40 @@
|
|||||||
<!-- Sample only -->
|
<!-- Sample only -->
|
||||||
<exclude>org.kohsuke.github.example.*</exclude>
|
<exclude>org.kohsuke.github.example.*</exclude>
|
||||||
|
|
||||||
<!-- No methods -->
|
|
||||||
<exclude>org.kohsuke.github.DeleteToken</exclude>
|
|
||||||
<exclude>org.kohsuke.github.Previews</exclude>
|
|
||||||
|
|
||||||
<!-- Deprecated -->
|
<!-- Deprecated -->
|
||||||
<exclude>org.kohsuke.github.extras.OkHttp3Connector</exclude>
|
<exclude>org.kohsuke.github.extras.OkHttp3Connector</exclude>
|
||||||
<exclude>org.kohsuke.github.EnforcementLevel</exclude>
|
<exclude>org.kohsuke.github.EnforcementLevel</exclude>
|
||||||
<exclude>org.kohsuke.github.GHPerson.1</exclude>
|
<exclude>org.kohsuke.github.GHPerson.1</exclude>
|
||||||
<exclude>org.kohsuke.github.GHPerson.1.1</exclude>
|
<!-- TODO: Some coverage, but more needed -->
|
||||||
|
<exclude>org.kohsuke.github.GHPullRequestReviewBuilder.DraftReviewComment</exclude>
|
||||||
|
<exclude>org.kohsuke.github.GHIssue.PullRequest</exclude>
|
||||||
|
<exclude>org.kohsuke.github.GHCommitSearchBuilder</exclude>
|
||||||
|
<exclude>org.kohsuke.github.GHRepositorySearchBuilder</exclude>
|
||||||
|
<exclude>org.kohsuke.github.GHUserSearchBuilder</exclude>
|
||||||
|
|
||||||
<!-- TODO: These still need test coverage -->
|
<!-- TODO: These still need test coverage -->
|
||||||
<exclude>org.kohsuke.github.GitHub.GHApiInfo</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHBranchProtection.RequiredSignatures</exclude>
|
<exclude>org.kohsuke.github.GHBranchProtection.RequiredSignatures</exclude>
|
||||||
<exclude>org.kohsuke.github.GHBranchProtectionBuilder.Restrictions</exclude>
|
<exclude>org.kohsuke.github.GHBranchProtectionBuilder.Restrictions</exclude>
|
||||||
<exclude>org.kohsuke.github.GHBranchProtection.Restrictions</exclude>
|
<exclude>org.kohsuke.github.GHBranchProtection.Restrictions</exclude>
|
||||||
<exclude>org.kohsuke.github.GHCommentAuthorAssociation</exclude>
|
<exclude>org.kohsuke.github.GHCommentAuthorAssociation</exclude>
|
||||||
<exclude>org.kohsuke.github.GHCommitBuilder.UserInfo</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHCommitSearchBuilder.CommitSearchResult</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHCommitSearchBuilder.Sort</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHCommitSearchBuilder</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHCommitState</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHCompare.Commit</exclude>
|
<exclude>org.kohsuke.github.GHCompare.Commit</exclude>
|
||||||
<exclude>org.kohsuke.github.GHCompare.InnerCommit</exclude>
|
<exclude>org.kohsuke.github.GHCompare.InnerCommit</exclude>
|
||||||
<exclude>org.kohsuke.github.GHCompare.Status</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHCompare.Tree</exclude>
|
<exclude>org.kohsuke.github.GHCompare.Tree</exclude>
|
||||||
<exclude>org.kohsuke.github.GHCompare.User</exclude>
|
<exclude>org.kohsuke.github.GHCompare.User</exclude>
|
||||||
<exclude>org.kohsuke.github.GHCompare</exclude>
|
<exclude>org.kohsuke.github.GHCompare</exclude>
|
||||||
<exclude>org.kohsuke.github.GHDeployKey</exclude>
|
<exclude>org.kohsuke.github.GHDeployKey</exclude>
|
||||||
<exclude>org.kohsuke.github.GHDeploymentStatusBuilder</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHDirection</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHEmail</exclude>
|
<exclude>org.kohsuke.github.GHEmail</exclude>
|
||||||
<exclude>org.kohsuke.github.GHEventPayload.Ping</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHEventPayload.Release</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHException</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHHook</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHHooks.OrgContext</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHInvitation</exclude>
|
<exclude>org.kohsuke.github.GHInvitation</exclude>
|
||||||
<exclude>org.kohsuke.github.GHIssueSearchBuilder.IssueSearchResult</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHIssueSearchBuilder.Sort</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHIssueSearchBuilder</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHMilestoneState</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHOrgHook</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHProject.ProjectStateFilter</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.Authorship</exclude>
|
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.Authorship</exclude>
|
||||||
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.Commit</exclude>
|
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.Commit</exclude>
|
||||||
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.CommitPointer</exclude>
|
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.CommitPointer</exclude>
|
||||||
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.Tree</exclude>
|
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.Tree</exclude>
|
||||||
<exclude>org.kohsuke.github.GHPullRequestCommitDetail</exclude>
|
<exclude>org.kohsuke.github.GHPullRequestCommitDetail</exclude>
|
||||||
<exclude>org.kohsuke.github.GHPullRequestFileDetail</exclude>
|
<exclude>org.kohsuke.github.GHPullRequestFileDetail</exclude>
|
||||||
<exclude>org.kohsuke.github.GHPullRequestQueryBuilder.Sort</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHReleaseUpdater</exclude>
|
<exclude>org.kohsuke.github.GHReleaseUpdater</exclude>
|
||||||
<exclude>org.kohsuke.github.GHRepository.ForkSort</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHRequestedAction</exclude>
|
<exclude>org.kohsuke.github.GHRequestedAction</exclude>
|
||||||
<exclude>org.kohsuke.github.GHStargazer</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHTagObject</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHTeam.Role</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHUserSearchBuilder.Sort</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHVerifiedKey</exclude>
|
<exclude>org.kohsuke.github.GHVerifiedKey</exclude>
|
||||||
<exclude>org.kohsuke.github.GitHubBuilder.1</exclude>
|
|
||||||
</excludes>
|
</excludes>
|
||||||
</rule>
|
</rule>
|
||||||
</rules>
|
</rules>
|
||||||
@@ -262,7 +198,7 @@
|
|||||||
<plugin>
|
<plugin>
|
||||||
<groupId>org.apache.maven.plugins</groupId>
|
<groupId>org.apache.maven.plugins</groupId>
|
||||||
<artifactId>maven-javadoc-plugin</artifactId>
|
<artifactId>maven-javadoc-plugin</artifactId>
|
||||||
<version>3.1.1</version>
|
<version>3.2.0</version>
|
||||||
<configuration>
|
<configuration>
|
||||||
<source>8</source>
|
<source>8</source>
|
||||||
<failOnWarnings>true</failOnWarnings>
|
<failOnWarnings>true</failOnWarnings>
|
||||||
@@ -286,7 +222,7 @@
|
|||||||
<plugin>
|
<plugin>
|
||||||
<groupId>org.apache.maven.plugins</groupId>
|
<groupId>org.apache.maven.plugins</groupId>
|
||||||
<artifactId>maven-site-plugin</artifactId>
|
<artifactId>maven-site-plugin</artifactId>
|
||||||
<version>3.8.2</version>
|
<version>3.9.1</version>
|
||||||
</plugin>
|
</plugin>
|
||||||
<plugin>
|
<plugin>
|
||||||
<groupId>org.apache.maven.plugins</groupId>
|
<groupId>org.apache.maven.plugins</groupId>
|
||||||
@@ -306,12 +242,12 @@
|
|||||||
<plugin>
|
<plugin>
|
||||||
<groupId>org.apache.maven.plugins</groupId>
|
<groupId>org.apache.maven.plugins</groupId>
|
||||||
<artifactId>maven-project-info-reports-plugin</artifactId>
|
<artifactId>maven-project-info-reports-plugin</artifactId>
|
||||||
<version>3.0.0</version>
|
<version>3.1.1</version>
|
||||||
<dependencies>
|
<dependencies>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>org.apache.bcel</groupId>
|
<groupId>org.apache.bcel</groupId>
|
||||||
<artifactId>bcel</artifactId>
|
<artifactId>bcel</artifactId>
|
||||||
<version>6.4.1</version>
|
<version>6.5.0</version>
|
||||||
</dependency>
|
</dependency>
|
||||||
</dependencies>
|
</dependencies>
|
||||||
</plugin>
|
</plugin>
|
||||||
@@ -333,12 +269,20 @@
|
|||||||
|
|
||||||
<plugin>
|
<plugin>
|
||||||
<artifactId>maven-surefire-plugin</artifactId>
|
<artifactId>maven-surefire-plugin</artifactId>
|
||||||
<version>2.22.2</version>
|
<executions>
|
||||||
|
<execution>
|
||||||
|
<id>default-test</id>
|
||||||
|
<configuration>
|
||||||
|
<excludesFile>src/test/resources/slow-or-flaky-tests.txt</excludesFile>
|
||||||
|
<argLine>${surefire.argLine}</argLine>
|
||||||
|
</configuration>
|
||||||
|
</execution>
|
||||||
|
</executions>
|
||||||
</plugin>
|
</plugin>
|
||||||
<plugin>
|
<plugin>
|
||||||
<groupId>org.codehaus.mojo</groupId>
|
<groupId>org.codehaus.mojo</groupId>
|
||||||
<artifactId>animal-sniffer-maven-plugin</artifactId>
|
<artifactId>animal-sniffer-maven-plugin</artifactId>
|
||||||
<version>1.18</version>
|
<version>1.20</version>
|
||||||
<configuration>
|
<configuration>
|
||||||
<signature>
|
<signature>
|
||||||
<groupId>org.codehaus.mojo.signature</groupId>
|
<groupId>org.codehaus.mojo.signature</groupId>
|
||||||
@@ -369,36 +313,35 @@
|
|||||||
</executions>
|
</executions>
|
||||||
</plugin>
|
</plugin>
|
||||||
<plugin>
|
<plugin>
|
||||||
<groupId>net.revelc.code.formatter</groupId>
|
<groupId>com.diffplug.spotless</groupId>
|
||||||
<artifactId>formatter-maven-plugin</artifactId>
|
<artifactId>spotless-maven-plugin</artifactId>
|
||||||
<version>2.11.0</version>
|
<version>2.8.1</version>
|
||||||
<executions>
|
<executions>
|
||||||
<execution>
|
<execution>
|
||||||
|
<id>spotless-check</id>
|
||||||
|
<!-- runs in verify phase by default -->
|
||||||
<goals>
|
<goals>
|
||||||
<goal>${formatter-maven-plugin.goal}</goal>
|
<!-- can be disabled using -Dspotless.check.skip=true -->
|
||||||
</goals>
|
<goal>check</goal>
|
||||||
<configuration>
|
|
||||||
<configFile>src/main/resources/eclipse/formatter.xml</configFile>
|
|
||||||
</configuration>
|
|
||||||
</execution>
|
|
||||||
</executions>
|
|
||||||
</plugin>
|
|
||||||
<plugin>
|
|
||||||
<groupId>net.revelc.code</groupId>
|
|
||||||
<artifactId>impsort-maven-plugin</artifactId>
|
|
||||||
<version>1.3.2</version>
|
|
||||||
<configuration>
|
|
||||||
<groups>*,java.,javax.</groups>
|
|
||||||
<removeUnused>true</removeUnused>
|
|
||||||
<staticAfter>true</staticAfter>
|
|
||||||
</configuration>
|
|
||||||
<executions>
|
|
||||||
<execution>
|
|
||||||
<goals>
|
|
||||||
<goal>${impsort-maven-plugin.goal}</goal>
|
|
||||||
</goals>
|
</goals>
|
||||||
</execution>
|
</execution>
|
||||||
</executions>
|
</executions>
|
||||||
|
<configuration>
|
||||||
|
<java>
|
||||||
|
<eclipse>
|
||||||
|
<file>${basedir}/src/build/eclipse/formatter.xml</file>
|
||||||
|
</eclipse>
|
||||||
|
|
||||||
|
<importOrder>
|
||||||
|
<file>${basedir}/src/build/eclipse/eclipse.importorder</file>
|
||||||
|
</importOrder>
|
||||||
|
<removeUnusedImports />
|
||||||
|
|
||||||
|
<trimTrailingWhitespace />
|
||||||
|
<endWithNewline />
|
||||||
|
|
||||||
|
</java>
|
||||||
|
</configuration>
|
||||||
</plugin>
|
</plugin>
|
||||||
<plugin>
|
<plugin>
|
||||||
<groupId>com.github.spotbugs</groupId>
|
<groupId>com.github.spotbugs</groupId>
|
||||||
@@ -435,6 +378,12 @@
|
|||||||
<artifactId>commons-lang3</artifactId>
|
<artifactId>commons-lang3</artifactId>
|
||||||
<version>3.9</version>
|
<version>3.9</version>
|
||||||
</dependency>
|
</dependency>
|
||||||
|
<dependency>
|
||||||
|
<groupId>com.tngtech.archunit</groupId>
|
||||||
|
<artifactId>archunit</artifactId>
|
||||||
|
<version>0.17.0</version>
|
||||||
|
<scope>test</scope>
|
||||||
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>org.hamcrest</groupId>
|
<groupId>org.hamcrest</groupId>
|
||||||
<artifactId>hamcrest</artifactId>
|
<artifactId>hamcrest</artifactId>
|
||||||
@@ -457,13 +406,19 @@
|
|||||||
<dependency>
|
<dependency>
|
||||||
<groupId>junit</groupId>
|
<groupId>junit</groupId>
|
||||||
<artifactId>junit</artifactId>
|
<artifactId>junit</artifactId>
|
||||||
<version>4.13</version>
|
<version>4.13.2</version>
|
||||||
|
<scope>test</scope>
|
||||||
|
</dependency>
|
||||||
|
<dependency>
|
||||||
|
<groupId>org.awaitility</groupId>
|
||||||
|
<artifactId>awaitility</artifactId>
|
||||||
|
<version>4.0.3</version>
|
||||||
<scope>test</scope>
|
<scope>test</scope>
|
||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>com.fasterxml.jackson.core</groupId>
|
<groupId>com.fasterxml.jackson.core</groupId>
|
||||||
<artifactId>jackson-databind</artifactId>
|
<artifactId>jackson-databind</artifactId>
|
||||||
<version>2.10.2</version>
|
<version>2.12.1</version>
|
||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>commons-io</groupId>
|
<groupId>commons-io</groupId>
|
||||||
@@ -494,7 +449,7 @@
|
|||||||
<dependency>
|
<dependency>
|
||||||
<groupId>org.kohsuke.stapler</groupId>
|
<groupId>org.kohsuke.stapler</groupId>
|
||||||
<artifactId>stapler</artifactId>
|
<artifactId>stapler</artifactId>
|
||||||
<version>1.258</version>
|
<version>1.262</version>
|
||||||
<scope>test</scope>
|
<scope>test</scope>
|
||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
@@ -506,9 +461,27 @@
|
|||||||
<dependency>
|
<dependency>
|
||||||
<groupId>org.eclipse.jgit</groupId>
|
<groupId>org.eclipse.jgit</groupId>
|
||||||
<artifactId>org.eclipse.jgit</artifactId>
|
<artifactId>org.eclipse.jgit</artifactId>
|
||||||
<version>5.6.0.201912101111-r</version>
|
<version>5.10.0.202012080955-r</version>
|
||||||
<scope>test</scope>
|
<scope>test</scope>
|
||||||
</dependency>
|
</dependency>
|
||||||
|
<dependency>
|
||||||
|
<groupId>io.jsonwebtoken</groupId>
|
||||||
|
<artifactId>jjwt-api</artifactId>
|
||||||
|
<version>${jjwt.suite.version}</version>
|
||||||
|
<optional>true</optional>
|
||||||
|
</dependency>
|
||||||
|
<dependency>
|
||||||
|
<groupId>io.jsonwebtoken</groupId>
|
||||||
|
<artifactId>jjwt-impl</artifactId>
|
||||||
|
<version>${jjwt.suite.version}</version>
|
||||||
|
<optional>true</optional>
|
||||||
|
</dependency>
|
||||||
|
<dependency>
|
||||||
|
<groupId>io.jsonwebtoken</groupId>
|
||||||
|
<artifactId>jjwt-jackson</artifactId>
|
||||||
|
<version>${jjwt.suite.version}</version>
|
||||||
|
<optional>true</optional>
|
||||||
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>com.squareup.okio</groupId>
|
<groupId>com.squareup.okio</groupId>
|
||||||
<artifactId>okio</artifactId>
|
<artifactId>okio</artifactId>
|
||||||
@@ -544,7 +517,7 @@
|
|||||||
<dependency>
|
<dependency>
|
||||||
<groupId>org.mockito</groupId>
|
<groupId>org.mockito</groupId>
|
||||||
<artifactId>mockito-core</artifactId>
|
<artifactId>mockito-core</artifactId>
|
||||||
<version>3.2.4</version>
|
<version>3.7.7</version>
|
||||||
<scope>test</scope>
|
<scope>test</scope>
|
||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
@@ -556,7 +529,7 @@
|
|||||||
<dependency>
|
<dependency>
|
||||||
<groupId>com.github.tomakehurst</groupId>
|
<groupId>com.github.tomakehurst</groupId>
|
||||||
<artifactId>wiremock-jre8-standalone</artifactId>
|
<artifactId>wiremock-jre8-standalone</artifactId>
|
||||||
<version>2.25.1</version>
|
<version>2.27.2</version>
|
||||||
<scope>test</scope>
|
<scope>test</scope>
|
||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
@@ -565,6 +538,12 @@
|
|||||||
<version>2.8.6</version>
|
<version>2.8.6</version>
|
||||||
<scope>test</scope>
|
<scope>test</scope>
|
||||||
</dependency>
|
</dependency>
|
||||||
|
<dependency>
|
||||||
|
<groupId>org.slf4j</groupId>
|
||||||
|
<artifactId>slf4j-simple</artifactId>
|
||||||
|
<version>1.7.30</version>
|
||||||
|
<scope>test</scope>
|
||||||
|
</dependency>
|
||||||
</dependencies>
|
</dependencies>
|
||||||
<repositories>
|
<repositories>
|
||||||
<repository>
|
<repository>
|
||||||
@@ -579,42 +558,100 @@
|
|||||||
</pluginRepository>
|
</pluginRepository>
|
||||||
</pluginRepositories>
|
</pluginRepositories>
|
||||||
<profiles>
|
<profiles>
|
||||||
|
<!-- only enable slow-or-flaky-test if -Dtest= is not present -->
|
||||||
<profile>
|
<profile>
|
||||||
<id>ci</id>
|
<id>slow-or-flaky-test</id>
|
||||||
|
<activation>
|
||||||
|
<property>
|
||||||
|
<name>!test</name>
|
||||||
|
</property>
|
||||||
|
</activation>
|
||||||
|
<build>
|
||||||
|
<plugins>
|
||||||
|
<plugin>
|
||||||
|
<artifactId>maven-surefire-plugin</artifactId>
|
||||||
|
<executions>
|
||||||
|
<execution>
|
||||||
|
<id>slow-or-flaky-test</id>
|
||||||
|
<phase>test</phase>
|
||||||
|
<goals>
|
||||||
|
<goal>test</goal>
|
||||||
|
</goals>
|
||||||
|
<configuration>
|
||||||
|
<rerunFailingTestsCount>2</rerunFailingTestsCount>
|
||||||
|
<!-- There are some tests that take longer or are a little
|
||||||
|
flaky. Run them here. -->
|
||||||
|
<includesFile>src/test/resources/slow-or-flaky-tests.txt</includesFile>
|
||||||
|
<argLine>${surefire.argLine}</argLine>
|
||||||
|
</configuration>
|
||||||
|
</execution>
|
||||||
|
</executions>
|
||||||
|
</plugin>
|
||||||
|
</plugins>
|
||||||
|
</build>
|
||||||
|
</profile>
|
||||||
|
<profile>
|
||||||
|
<id>jdk11+</id>
|
||||||
|
<activation>
|
||||||
|
<jdk>[11,)</jdk>
|
||||||
|
</activation>
|
||||||
|
<properties>
|
||||||
|
<!-- this is required for GithubHttpUrlConnectionClient#setRequestMethod() to work with JDK 16+ -->
|
||||||
|
<surefire.argLine>--add-opens java.base/java.net=ALL-UNNAMED</surefire.argLine>
|
||||||
|
</properties>
|
||||||
|
</profile>
|
||||||
|
<profile>
|
||||||
|
<id>ci-non-windows</id>
|
||||||
|
<activation>
|
||||||
|
<property>
|
||||||
|
<name>enable-ci</name>
|
||||||
|
</property>
|
||||||
|
<os>
|
||||||
|
<family>!windows</family>
|
||||||
|
</os>
|
||||||
|
</activation>
|
||||||
|
<properties>
|
||||||
|
<!-- Only fail code coverage on non-windows machines -->
|
||||||
|
<jacoco.haltOnFailure>true</jacoco.haltOnFailure>
|
||||||
|
</properties>
|
||||||
|
</profile>
|
||||||
|
<profile>
|
||||||
|
<id>ci-all</id>
|
||||||
<activation>
|
<activation>
|
||||||
<property>
|
<property>
|
||||||
<name>enable-ci</name>
|
<name>enable-ci</name>
|
||||||
</property>
|
</property>
|
||||||
</activation>
|
</activation>
|
||||||
<properties>
|
|
||||||
<formatter-maven-plugin.goal>validate</formatter-maven-plugin.goal>
|
|
||||||
<impsort-maven-plugin.goal>check</impsort-maven-plugin.goal>
|
|
||||||
<jacoco.haltOnFailure>true</jacoco.haltOnFailure>
|
|
||||||
</properties>
|
|
||||||
<build>
|
<build>
|
||||||
<plugins>
|
<plugins>
|
||||||
<plugin>
|
|
||||||
<groupId>org.apache.maven.plugins</groupId>
|
|
||||||
<artifactId>maven-shade-plugin</artifactId>
|
|
||||||
</plugin>
|
|
||||||
<plugin>
|
<plugin>
|
||||||
<groupId>org.jacoco</groupId>
|
<groupId>org.jacoco</groupId>
|
||||||
<artifactId>jacoco-maven-plugin</artifactId>
|
<artifactId>jacoco-maven-plugin</artifactId>
|
||||||
</plugin>
|
</plugin>
|
||||||
|
<plugin>
|
||||||
|
<groupId>com.diffplug.spotless</groupId>
|
||||||
|
<artifactId>spotless-maven-plugin</artifactId>
|
||||||
|
<executions>
|
||||||
|
<execution>
|
||||||
|
<id>spotless-check</id>
|
||||||
|
<!-- In CI, run check early in the build -->
|
||||||
|
<phase>process-sources</phase>
|
||||||
|
<goals>
|
||||||
|
<goal>check</goal>
|
||||||
|
</goals>
|
||||||
|
</execution>
|
||||||
|
</executions>
|
||||||
|
</plugin>
|
||||||
</plugins>
|
</plugins>
|
||||||
</build>
|
</build>
|
||||||
</profile>
|
</profile>
|
||||||
<profile>
|
<profile>
|
||||||
<id>release</id>
|
<id>release</id>
|
||||||
<properties>
|
|
||||||
<formatter-maven-plugin.goal>validate</formatter-maven-plugin.goal>
|
|
||||||
<impsort-maven-plugin.goal>check</impsort-maven-plugin.goal>
|
|
||||||
</properties>
|
|
||||||
<build>
|
<build>
|
||||||
<plugins>
|
<plugins>
|
||||||
<plugin>
|
<plugin>
|
||||||
<groupId>org.apache.maven.plugins</groupId>
|
<groupId>org.jacoco</groupId>
|
||||||
<artifactId>maven-shade-plugin</artifactId>
|
<artifactId>jacoco-maven-plugin</artifactId>
|
||||||
</plugin>
|
</plugin>
|
||||||
<plugin>
|
<plugin>
|
||||||
<groupId>org.apache.maven.plugins</groupId>
|
<groupId>org.apache.maven.plugins</groupId>
|
||||||
@@ -665,6 +702,18 @@
|
|||||||
</profiles>
|
</profiles>
|
||||||
<reporting>
|
<reporting>
|
||||||
<plugins>
|
<plugins>
|
||||||
|
<plugin>
|
||||||
|
<groupId>org.jacoco</groupId>
|
||||||
|
<artifactId>jacoco-maven-plugin</artifactId>
|
||||||
|
<reportSets>
|
||||||
|
<reportSet>
|
||||||
|
<reports>
|
||||||
|
<!-- select non-aggregate reports -->
|
||||||
|
<report>report</report>
|
||||||
|
</reports>
|
||||||
|
</reportSet>
|
||||||
|
</reportSets>
|
||||||
|
</plugin>
|
||||||
<plugin>
|
<plugin>
|
||||||
<groupId>org.apache.maven.plugins</groupId>
|
<groupId>org.apache.maven.plugins</groupId>
|
||||||
<artifactId>maven-javadoc-plugin</artifactId>
|
<artifactId>maven-javadoc-plugin</artifactId>
|
||||||
|
|||||||
6
src/build/eclipse/eclipse.importorder
Normal file
6
src/build/eclipse/eclipse.importorder
Normal file
@@ -0,0 +1,6 @@
|
|||||||
|
#Organize Import Order
|
||||||
|
# Import this file in Window -> Preferences -> Java -> Code Style -> Organize Imports -> Import...
|
||||||
|
0=
|
||||||
|
1=java
|
||||||
|
2=javax
|
||||||
|
3=\#
|
||||||
166
src/main/java/org/kohsuke/github/AbstractBuilder.java
Normal file
166
src/main/java/org/kohsuke/github/AbstractBuilder.java
Normal file
@@ -0,0 +1,166 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import java.io.IOException;
|
||||||
|
|
||||||
|
import javax.annotation.CheckForNull;
|
||||||
|
import javax.annotation.Nonnull;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* An abstract data object builder/updater.
|
||||||
|
*
|
||||||
|
* This class can be use to make a Builder that supports both batch and single property changes.
|
||||||
|
* <p>
|
||||||
|
* Batching looks like this:
|
||||||
|
* </p>
|
||||||
|
*
|
||||||
|
* <pre>
|
||||||
|
* update().someName(value).otherName(value).done()
|
||||||
|
* </pre>
|
||||||
|
* <p>
|
||||||
|
* Single changes look like this:
|
||||||
|
* </p>
|
||||||
|
*
|
||||||
|
* <pre>
|
||||||
|
* set().someName(value);
|
||||||
|
* set().otherName(value);
|
||||||
|
* </pre>
|
||||||
|
* <p>
|
||||||
|
* If {@link S} is the same as {@link R}, {@link #with(String, Object)} will commit changes after the first value change
|
||||||
|
* and return a {@link R} from {@link #done()}.
|
||||||
|
* </p>
|
||||||
|
* <p>
|
||||||
|
* If {@link S} is not the same as {@link R}, {@link #with(String, Object)} will batch together multiple changes and let
|
||||||
|
* the user call {@link #done()} when they are ready.
|
||||||
|
*
|
||||||
|
* @param <R>
|
||||||
|
* Final return type built by this builder returned when {@link #done()}} is called.
|
||||||
|
* @param <S>
|
||||||
|
* Intermediate return type for this builder returned by calls to {@link #with(String, Object)}. If {@link S}
|
||||||
|
* the same as {@link R}, this builder will commit changes after each call to {@link #with(String, Object)}.
|
||||||
|
*/
|
||||||
|
abstract class AbstractBuilder<R, S> extends GitHubInteractiveObject {
|
||||||
|
|
||||||
|
@Nonnull
|
||||||
|
private final Class<R> returnType;
|
||||||
|
|
||||||
|
private final boolean commitChangesImmediately;
|
||||||
|
|
||||||
|
@CheckForNull
|
||||||
|
private final R baseInstance;
|
||||||
|
|
||||||
|
@Nonnull
|
||||||
|
protected final Requester requester;
|
||||||
|
|
||||||
|
// TODO: Not sure how update-in-place behavior should be controlled
|
||||||
|
// However, it certainly can be controlled dynamically down to the instance level or inherited for all children of
|
||||||
|
// some
|
||||||
|
// connection.
|
||||||
|
protected boolean updateInPlace;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Creates a builder.
|
||||||
|
*
|
||||||
|
* @param root
|
||||||
|
* the GitHub instance to connect to.
|
||||||
|
* @param intermediateReturnType
|
||||||
|
* the intermediate return type of type {@link S} returned by calls to {@link #with(String, Object)}.
|
||||||
|
* Must either be equal to {@code builtReturnType} or this instance must be castable to this class. If
|
||||||
|
* not, the constructor will throw {@link IllegalArgumentException}.
|
||||||
|
* @param finalReturnType
|
||||||
|
* the final return type for built by this builder returned when {@link #done()}} is called.
|
||||||
|
* @param baseInstance
|
||||||
|
* optional instance on which to base this builder.
|
||||||
|
*/
|
||||||
|
protected AbstractBuilder(@Nonnull Class<R> finalReturnType,
|
||||||
|
@Nonnull Class<S> intermediateReturnType,
|
||||||
|
@Nonnull GitHub root,
|
||||||
|
@CheckForNull R baseInstance) {
|
||||||
|
super(root);
|
||||||
|
this.requester = root.createRequest();
|
||||||
|
this.returnType = finalReturnType;
|
||||||
|
this.commitChangesImmediately = returnType.equals(intermediateReturnType);
|
||||||
|
if (!commitChangesImmediately && !intermediateReturnType.isInstance(this)) {
|
||||||
|
throw new IllegalArgumentException(
|
||||||
|
"Argument \"intermediateReturnType\": This instance must be castable to intermediateReturnType or finalReturnType must be equal to intermediateReturnType.");
|
||||||
|
}
|
||||||
|
|
||||||
|
this.baseInstance = baseInstance;
|
||||||
|
this.updateInPlace = false;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Finishes an update, committing changes.
|
||||||
|
*
|
||||||
|
* This method may update-in-place or not. Either way it returns the resulting instance.
|
||||||
|
*
|
||||||
|
* @return an instance with updated current data
|
||||||
|
* @throws IOException
|
||||||
|
* if there is an I/O Exception
|
||||||
|
*/
|
||||||
|
@Nonnull
|
||||||
|
@BetaApi
|
||||||
|
@Deprecated
|
||||||
|
public R done() throws IOException {
|
||||||
|
R result;
|
||||||
|
if (updateInPlace && baseInstance != null) {
|
||||||
|
result = requester.fetchInto(baseInstance);
|
||||||
|
} else {
|
||||||
|
result = requester.fetch(returnType);
|
||||||
|
}
|
||||||
|
return result;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Applies a value to a name for this builder.
|
||||||
|
*
|
||||||
|
* If {@link S} is the same as {@link R}, this method will commit changes after the first value change and return a
|
||||||
|
* {@link R} from {@link #done()}.
|
||||||
|
*
|
||||||
|
* If {@link S} is not the same as {@link R}, this method will return an {@link S} and letting the caller batch
|
||||||
|
* together multiple changes and call {@link #done()} when they are ready.
|
||||||
|
*
|
||||||
|
* @param name
|
||||||
|
* the name of the field
|
||||||
|
* @param value
|
||||||
|
* the value of the field
|
||||||
|
* @return either a continuing builder or an updated data record
|
||||||
|
* @throws IOException
|
||||||
|
* if an I/O error occurs
|
||||||
|
*/
|
||||||
|
@Nonnull
|
||||||
|
@BetaApi
|
||||||
|
@Deprecated
|
||||||
|
protected S with(@Nonnull String name, Object value) throws IOException {
|
||||||
|
requester.with(name, value);
|
||||||
|
return continueOrDone();
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Chooses whether to return a continuing builder or an updated data record
|
||||||
|
*
|
||||||
|
* If {@link S} is the same as {@link R}, this method will commit changes after the first value change and return a
|
||||||
|
* {@link R} from {@link #done()}.
|
||||||
|
*
|
||||||
|
* If {@link S} is not the same as {@link R}, this method will return an {@link S} and letting the caller batch
|
||||||
|
* together multiple changes and call {@link #done()} when they are ready.
|
||||||
|
*
|
||||||
|
* @return either a continuing builder or an updated data record
|
||||||
|
* @throws IOException
|
||||||
|
* if an I/O error occurs
|
||||||
|
*/
|
||||||
|
@Nonnull
|
||||||
|
@BetaApi
|
||||||
|
@Deprecated
|
||||||
|
protected S continueOrDone() throws IOException {
|
||||||
|
// This little bit of roughness in this base class means all inheriting builders get to create Updater and
|
||||||
|
// Setter classes from almost identical code. Creator can often be implemented with significant code reuse as
|
||||||
|
// well.
|
||||||
|
if (commitChangesImmediately) {
|
||||||
|
// These casts look strange and risky, but they they're actually guaranteed safe due to the return path
|
||||||
|
// being based on the previous comparison of class instances passed to the constructor.
|
||||||
|
return (S) done();
|
||||||
|
} else {
|
||||||
|
return (S) this;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -29,6 +29,10 @@ public abstract class AbuseLimitHandler {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* on failure
|
* on failure
|
||||||
* @see <a href="https://developer.github.com/v3/#abuse-rate-limits">API documentation from GitHub</a>
|
* @see <a href="https://developer.github.com/v3/#abuse-rate-limits">API documentation from GitHub</a>
|
||||||
|
* @see <a href=
|
||||||
|
* "https://developer.github.com/v3/guides/best-practices-for-integrators/#dealing-with-abuse-rate-limits">Dealing
|
||||||
|
* with abuse rate limits</a>
|
||||||
|
*
|
||||||
*/
|
*/
|
||||||
public abstract void onError(IOException e, HttpURLConnection uc) throws IOException;
|
public abstract void onError(IOException e, HttpURLConnection uc) throws IOException;
|
||||||
|
|
||||||
|
|||||||
18
src/main/java/org/kohsuke/github/BetaApi.java
Normal file
18
src/main/java/org/kohsuke/github/BetaApi.java
Normal file
@@ -0,0 +1,18 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import java.lang.annotation.Documented;
|
||||||
|
import java.lang.annotation.Retention;
|
||||||
|
import java.lang.annotation.RetentionPolicy;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Indicates that the method/class/etc marked is a beta implementation of an sdk feature.
|
||||||
|
* <p>
|
||||||
|
* These APIs are subject to change and not a part of the backward compatibility commitment. Always used in conjunction
|
||||||
|
* with 'deprecated' to raise awareness to clients.
|
||||||
|
* </p>
|
||||||
|
*
|
||||||
|
*/
|
||||||
|
@Retention(RetentionPolicy.RUNTIME)
|
||||||
|
@Documented
|
||||||
|
public @interface BetaApi {
|
||||||
|
}
|
||||||
@@ -1,35 +0,0 @@
|
|||||||
/*
|
|
||||||
* The MIT License
|
|
||||||
*
|
|
||||||
* Copyright (c) 2010, Kohsuke Kawaguchi
|
|
||||||
*
|
|
||||||
* Permission is hereby granted, free of charge, to any person obtaining a copy
|
|
||||||
* of this software and associated documentation files (the "Software"), to deal
|
|
||||||
* in the Software without restriction, including without limitation the rights
|
|
||||||
* to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
|
|
||||||
* copies of the Software, and to permit persons to whom the Software is
|
|
||||||
* furnished to do so, subject to the following conditions:
|
|
||||||
*
|
|
||||||
* The above copyright notice and this permission notice shall be included in
|
|
||||||
* all copies or substantial portions of the Software.
|
|
||||||
*
|
|
||||||
* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
|
|
||||||
* IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
|
|
||||||
* FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
|
|
||||||
* AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
|
|
||||||
* LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
|
|
||||||
* OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
|
|
||||||
* THE SOFTWARE.
|
|
||||||
*/
|
|
||||||
package org.kohsuke.github;
|
|
||||||
|
|
||||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
|
||||||
|
|
||||||
/**
|
|
||||||
* @author Kohsuke Kawaguchi
|
|
||||||
*/
|
|
||||||
@SuppressFBWarnings(value = "UUF_UNUSED_PUBLIC_OR_PROTECTED_FIELD",
|
|
||||||
justification = "Being constructed by JSON deserialization")
|
|
||||||
class DeleteToken {
|
|
||||||
public String delete_token;
|
|
||||||
}
|
|
||||||
@@ -5,7 +5,7 @@ import java.net.URL;
|
|||||||
import java.util.List;
|
import java.util.List;
|
||||||
import java.util.Map;
|
import java.util.Map;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.MACHINE_MAN;
|
import static org.kohsuke.github.internal.Previews.MACHINE_MAN;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* A Github App.
|
* A Github App.
|
||||||
@@ -15,7 +15,6 @@ import static org.kohsuke.github.Previews.MACHINE_MAN;
|
|||||||
*/
|
*/
|
||||||
public class GHApp extends GHObject {
|
public class GHApp extends GHObject {
|
||||||
|
|
||||||
private GitHub root;
|
|
||||||
private GHUser owner;
|
private GHUser owner;
|
||||||
private String name;
|
private String name;
|
||||||
private String description;
|
private String description;
|
||||||
@@ -39,7 +38,9 @@ public class GHApp extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param owner
|
* @param owner
|
||||||
* the owner
|
* the owner
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setOwner(GHUser owner) {
|
public void setOwner(GHUser owner) {
|
||||||
this.owner = owner;
|
this.owner = owner;
|
||||||
}
|
}
|
||||||
@@ -58,7 +59,9 @@ public class GHApp extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param name
|
* @param name
|
||||||
* the name
|
* the name
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setName(String name) {
|
public void setName(String name) {
|
||||||
this.name = name;
|
this.name = name;
|
||||||
}
|
}
|
||||||
@@ -77,7 +80,9 @@ public class GHApp extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param description
|
* @param description
|
||||||
* the description
|
* the description
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setDescription(String description) {
|
public void setDescription(String description) {
|
||||||
this.description = description;
|
this.description = description;
|
||||||
}
|
}
|
||||||
@@ -96,7 +101,9 @@ public class GHApp extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param externalUrl
|
* @param externalUrl
|
||||||
* the external url
|
* the external url
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setExternalUrl(String externalUrl) {
|
public void setExternalUrl(String externalUrl) {
|
||||||
this.externalUrl = externalUrl;
|
this.externalUrl = externalUrl;
|
||||||
}
|
}
|
||||||
@@ -115,7 +122,9 @@ public class GHApp extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param events
|
* @param events
|
||||||
* the events
|
* the events
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setEvents(List<GHEvent> events) {
|
public void setEvents(List<GHEvent> events) {
|
||||||
this.events = events;
|
this.events = events;
|
||||||
}
|
}
|
||||||
@@ -134,13 +143,15 @@ public class GHApp extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param installationsCount
|
* @param installationsCount
|
||||||
* the installations count
|
* the installations count
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setInstallationsCount(long installationsCount) {
|
public void setInstallationsCount(long installationsCount) {
|
||||||
this.installationsCount = installationsCount;
|
this.installationsCount = installationsCount;
|
||||||
}
|
}
|
||||||
|
|
||||||
public URL getHtmlUrl() {
|
public URL getHtmlUrl() {
|
||||||
return GitHub.parseURL(htmlUrl);
|
return GitHubClient.parseURL(htmlUrl);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -157,7 +168,9 @@ public class GHApp extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param permissions
|
* @param permissions
|
||||||
* the permissions
|
* the permissions
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setPermissions(Map<String, String> permissions) {
|
public void setPermissions(Map<String, String> permissions) {
|
||||||
this.permissions = permissions;
|
this.permissions = permissions;
|
||||||
}
|
}
|
||||||
@@ -175,7 +188,7 @@ public class GHApp extends GHObject {
|
|||||||
* @return a list of App installations
|
* @return a list of App installations
|
||||||
* @see <a href="https://developer.github.com/v3/apps/#list-installations">List installations</a>
|
* @see <a href="https://developer.github.com/v3/apps/#list-installations">List installations</a>
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(MACHINE_MAN)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public PagedIterable<GHAppInstallation> listInstallations() {
|
public PagedIterable<GHAppInstallation> listInstallations() {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
@@ -196,7 +209,7 @@ public class GHApp extends GHObject {
|
|||||||
* on error
|
* on error
|
||||||
* @see <a href="https://developer.github.com/v3/apps/#get-an-installation">Get an installation</a>
|
* @see <a href="https://developer.github.com/v3/apps/#get-an-installation">Get an installation</a>
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(MACHINE_MAN)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppInstallation getInstallationById(long id) throws IOException {
|
public GHAppInstallation getInstallationById(long id) throws IOException {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
@@ -219,7 +232,7 @@ public class GHApp extends GHObject {
|
|||||||
* @see <a href="https://developer.github.com/v3/apps/#get-an-organization-installation">Get an organization
|
* @see <a href="https://developer.github.com/v3/apps/#get-an-organization-installation">Get an organization
|
||||||
* installation</a>
|
* installation</a>
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(MACHINE_MAN)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppInstallation getInstallationByOrganization(String name) throws IOException {
|
public GHAppInstallation getInstallationByOrganization(String name) throws IOException {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
@@ -244,7 +257,7 @@ public class GHApp extends GHObject {
|
|||||||
* @see <a href="https://developer.github.com/v3/apps/#get-a-repository-installation">Get a repository
|
* @see <a href="https://developer.github.com/v3/apps/#get-a-repository-installation">Get a repository
|
||||||
* installation</a>
|
* installation</a>
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(MACHINE_MAN)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppInstallation getInstallationByRepository(String ownerName, String repositoryName) throws IOException {
|
public GHAppInstallation getInstallationByRepository(String ownerName, String repositoryName) throws IOException {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
@@ -266,7 +279,7 @@ public class GHApp extends GHObject {
|
|||||||
* on error
|
* on error
|
||||||
* @see <a href="https://developer.github.com/v3/apps/#get-a-user-installation">Get a user installation</a>
|
* @see <a href="https://developer.github.com/v3/apps/#get-a-user-installation">Get a user installation</a>
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(MACHINE_MAN)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppInstallation getInstallationByUser(String name) throws IOException {
|
public GHAppInstallation getInstallationByUser(String name) throws IOException {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
|
|||||||
@@ -5,7 +5,7 @@ import java.util.HashMap;
|
|||||||
import java.util.List;
|
import java.util.List;
|
||||||
import java.util.Map;
|
import java.util.Map;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.MACHINE_MAN;
|
import static org.kohsuke.github.internal.Previews.MACHINE_MAN;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a access token for a GitHub App Installation
|
* Creates a access token for a GitHub App Installation
|
||||||
@@ -14,12 +14,11 @@ import static org.kohsuke.github.Previews.MACHINE_MAN;
|
|||||||
* @see GHAppInstallation#createToken(Map) GHAppInstallation#createToken(Map)
|
* @see GHAppInstallation#createToken(Map) GHAppInstallation#createToken(Map)
|
||||||
* @see GHAppInstallation#createToken() GHAppInstallation#createToken()
|
* @see GHAppInstallation#createToken() GHAppInstallation#createToken()
|
||||||
*/
|
*/
|
||||||
public class GHAppCreateTokenBuilder {
|
public class GHAppCreateTokenBuilder extends GitHubInteractiveObject {
|
||||||
private final GitHub root;
|
|
||||||
protected final Requester builder;
|
protected final Requester builder;
|
||||||
private final String apiUrlTail;
|
private final String apiUrlTail;
|
||||||
|
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
GHAppCreateTokenBuilder(GitHub root, String apiUrlTail) {
|
GHAppCreateTokenBuilder(GitHub root, String apiUrlTail) {
|
||||||
this.root = root;
|
this.root = root;
|
||||||
@@ -27,7 +26,7 @@ public class GHAppCreateTokenBuilder {
|
|||||||
this.builder = root.createRequest();
|
this.builder = root.createRequest();
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
GHAppCreateTokenBuilder(GitHub root, String apiUrlTail, Map<String, GHPermissionType> permissions) {
|
GHAppCreateTokenBuilder(GitHub root, String apiUrlTail, Map<String, GHPermissionType> permissions) {
|
||||||
this(root, apiUrlTail);
|
this(root, apiUrlTail);
|
||||||
@@ -43,7 +42,7 @@ public class GHAppCreateTokenBuilder {
|
|||||||
* Array containing the repositories Ids
|
* Array containing the repositories Ids
|
||||||
* @return a GHAppCreateTokenBuilder
|
* @return a GHAppCreateTokenBuilder
|
||||||
*/
|
*/
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppCreateTokenBuilder repositoryIds(List<Long> repositoryIds) {
|
public GHAppCreateTokenBuilder repositoryIds(List<Long> repositoryIds) {
|
||||||
this.builder.with("repository_ids", repositoryIds);
|
this.builder.with("repository_ids", repositoryIds);
|
||||||
@@ -58,12 +57,12 @@ public class GHAppCreateTokenBuilder {
|
|||||||
* Map containing the permission names and types.
|
* Map containing the permission names and types.
|
||||||
* @return a GHAppCreateTokenBuilder
|
* @return a GHAppCreateTokenBuilder
|
||||||
*/
|
*/
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppCreateTokenBuilder permissions(Map<String, GHPermissionType> permissions) {
|
public GHAppCreateTokenBuilder permissions(Map<String, GHPermissionType> permissions) {
|
||||||
Map<String, String> retMap = new HashMap<>();
|
Map<String, String> retMap = new HashMap<>();
|
||||||
for (Map.Entry<String, GHPermissionType> entry : permissions.entrySet()) {
|
for (Map.Entry<String, GHPermissionType> entry : permissions.entrySet()) {
|
||||||
retMap.put(entry.getKey(), Requester.transformEnum(entry.getValue()));
|
retMap.put(entry.getKey(), GitHubRequest.transformEnum(entry.getValue()));
|
||||||
}
|
}
|
||||||
builder.with("permissions", retMap);
|
builder.with("permissions", retMap);
|
||||||
return this;
|
return this;
|
||||||
@@ -78,7 +77,7 @@ public class GHAppCreateTokenBuilder {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* on error
|
* on error
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(MACHINE_MAN)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppInstallationToken create() throws IOException {
|
public GHAppInstallationToken create() throws IOException {
|
||||||
return builder.method("POST")
|
return builder.method("POST")
|
||||||
|
|||||||
@@ -3,11 +3,13 @@ package org.kohsuke.github;
|
|||||||
import com.fasterxml.jackson.annotation.JsonProperty;
|
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
|
import java.net.MalformedURLException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
import java.util.Map;
|
import java.util.Map;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.GAMBIT;
|
import static org.kohsuke.github.internal.Previews.GAMBIT;
|
||||||
|
import static org.kohsuke.github.internal.Previews.MACHINE_MAN;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* A Github App Installation.
|
* A Github App Installation.
|
||||||
@@ -20,7 +22,6 @@ import static org.kohsuke.github.Previews.GAMBIT;
|
|||||||
* @see GHApp#getInstallationByUser(String) GHApp#getInstallationByUser(String)
|
* @see GHApp#getInstallationByUser(String) GHApp#getInstallationByUser(String)
|
||||||
*/
|
*/
|
||||||
public class GHAppInstallation extends GHObject {
|
public class GHAppInstallation extends GHObject {
|
||||||
private GitHub root;
|
|
||||||
private GHUser account;
|
private GHUser account;
|
||||||
|
|
||||||
@JsonProperty("access_tokens_url")
|
@JsonProperty("access_tokens_url")
|
||||||
@@ -42,7 +43,7 @@ public class GHAppInstallation extends GHObject {
|
|||||||
private String htmlUrl;
|
private String htmlUrl;
|
||||||
|
|
||||||
public URL getHtmlUrl() {
|
public URL getHtmlUrl() {
|
||||||
return GitHub.parseURL(htmlUrl);
|
return GitHubClient.parseURL(htmlUrl);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -59,7 +60,9 @@ public class GHAppInstallation extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param root
|
* @param root
|
||||||
* the root
|
* the root
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setRoot(GitHub root) {
|
public void setRoot(GitHub root) {
|
||||||
this.root = root;
|
this.root = root;
|
||||||
}
|
}
|
||||||
@@ -78,7 +81,9 @@ public class GHAppInstallation extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param account
|
* @param account
|
||||||
* the account
|
* the account
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setAccount(GHUser account) {
|
public void setAccount(GHUser account) {
|
||||||
this.account = account;
|
this.account = account;
|
||||||
}
|
}
|
||||||
@@ -97,7 +102,9 @@ public class GHAppInstallation extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param accessTokenUrl
|
* @param accessTokenUrl
|
||||||
* the access token url
|
* the access token url
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setAccessTokenUrl(String accessTokenUrl) {
|
public void setAccessTokenUrl(String accessTokenUrl) {
|
||||||
this.accessTokenUrl = accessTokenUrl;
|
this.accessTokenUrl = accessTokenUrl;
|
||||||
}
|
}
|
||||||
@@ -111,12 +118,44 @@ public class GHAppInstallation extends GHObject {
|
|||||||
return repositoriesUrl;
|
return repositoriesUrl;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* List repositories that this app installation can access.
|
||||||
|
*
|
||||||
|
* @return the paged iterable
|
||||||
|
*/
|
||||||
|
@Preview(MACHINE_MAN)
|
||||||
|
@Deprecated
|
||||||
|
public PagedSearchIterable<GHRepository> listRepositories() {
|
||||||
|
GitHubRequest request;
|
||||||
|
|
||||||
|
try {
|
||||||
|
request = root.createRequest().withPreview(MACHINE_MAN).withUrlPath("/installation/repositories").build();
|
||||||
|
} catch (MalformedURLException e) {
|
||||||
|
throw new GHException("", e);
|
||||||
|
}
|
||||||
|
|
||||||
|
return new PagedSearchIterable<>(root, request, GHAppInstallationRepositoryResult.class);
|
||||||
|
}
|
||||||
|
|
||||||
|
private static class GHAppInstallationRepositoryResult extends SearchResult<GHRepository> {
|
||||||
|
private GHRepository[] repositories;
|
||||||
|
|
||||||
|
@Override
|
||||||
|
GHRepository[] getItems(GitHub root) {
|
||||||
|
for (GHRepository item : repositories)
|
||||||
|
item.wrap(root);
|
||||||
|
return repositories;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Sets repositories url.
|
* Sets repositories url.
|
||||||
*
|
*
|
||||||
* @param repositoriesUrl
|
* @param repositoriesUrl
|
||||||
* the repositories url
|
* the repositories url
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setRepositoriesUrl(String repositoriesUrl) {
|
public void setRepositoriesUrl(String repositoriesUrl) {
|
||||||
this.repositoriesUrl = repositoriesUrl;
|
this.repositoriesUrl = repositoriesUrl;
|
||||||
}
|
}
|
||||||
@@ -135,7 +174,9 @@ public class GHAppInstallation extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param appId
|
* @param appId
|
||||||
* the app id
|
* the app id
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setAppId(long appId) {
|
public void setAppId(long appId) {
|
||||||
this.appId = appId;
|
this.appId = appId;
|
||||||
}
|
}
|
||||||
@@ -154,7 +195,9 @@ public class GHAppInstallation extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param targetId
|
* @param targetId
|
||||||
* the target id
|
* the target id
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setTargetId(long targetId) {
|
public void setTargetId(long targetId) {
|
||||||
this.targetId = targetId;
|
this.targetId = targetId;
|
||||||
}
|
}
|
||||||
@@ -173,7 +216,9 @@ public class GHAppInstallation extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param targetType
|
* @param targetType
|
||||||
* the target type
|
* the target type
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setTargetType(GHTargetType targetType) {
|
public void setTargetType(GHTargetType targetType) {
|
||||||
this.targetType = targetType;
|
this.targetType = targetType;
|
||||||
}
|
}
|
||||||
@@ -192,7 +237,9 @@ public class GHAppInstallation extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param permissions
|
* @param permissions
|
||||||
* the permissions
|
* the permissions
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setPermissions(Map<String, GHPermissionType> permissions) {
|
public void setPermissions(Map<String, GHPermissionType> permissions) {
|
||||||
this.permissions = permissions;
|
this.permissions = permissions;
|
||||||
}
|
}
|
||||||
@@ -211,7 +258,9 @@ public class GHAppInstallation extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param events
|
* @param events
|
||||||
* the events
|
* the events
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setEvents(List<GHEvent> events) {
|
public void setEvents(List<GHEvent> events) {
|
||||||
this.events = events;
|
this.events = events;
|
||||||
}
|
}
|
||||||
@@ -230,7 +279,9 @@ public class GHAppInstallation extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param singleFileName
|
* @param singleFileName
|
||||||
* the single file name
|
* the single file name
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setSingleFileName(String singleFileName) {
|
public void setSingleFileName(String singleFileName) {
|
||||||
this.singleFileName = singleFileName;
|
this.singleFileName = singleFileName;
|
||||||
}
|
}
|
||||||
@@ -249,7 +300,9 @@ public class GHAppInstallation extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param repositorySelection
|
* @param repositorySelection
|
||||||
* the repository selection
|
* the repository selection
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setRepositorySelection(GHRepositorySelection repositorySelection) {
|
public void setRepositorySelection(GHRepositorySelection repositorySelection) {
|
||||||
this.repositorySelection = repositorySelection;
|
this.repositorySelection = repositorySelection;
|
||||||
}
|
}
|
||||||
@@ -268,13 +321,13 @@ public class GHAppInstallation extends GHObject {
|
|||||||
* on error
|
* on error
|
||||||
* @see <a href="https://developer.github.com/v3/apps/#delete-an-installation">Delete an installation</a>
|
* @see <a href="https://developer.github.com/v3/apps/#delete-an-installation">Delete an installation</a>
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(GAMBIT)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public void deleteInstallation() throws IOException {
|
public void deleteInstallation() throws IOException {
|
||||||
root.createRequest()
|
root.createRequest()
|
||||||
.method("DELETE")
|
.method("DELETE")
|
||||||
.withPreview(GAMBIT)
|
.withPreview(GAMBIT)
|
||||||
.withUrlPath(String.format("/app/installations/%d", id))
|
.withUrlPath(String.format("/app/installations/%d", getId()))
|
||||||
.send();
|
.send();
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -290,10 +343,12 @@ public class GHAppInstallation extends GHObject {
|
|||||||
* @return a GHAppCreateTokenBuilder instance
|
* @return a GHAppCreateTokenBuilder instance
|
||||||
* @deprecated Use {@link GHAppInstallation#createToken()} instead.
|
* @deprecated Use {@link GHAppInstallation#createToken()} instead.
|
||||||
*/
|
*/
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppCreateTokenBuilder createToken(Map<String, GHPermissionType> permissions) {
|
public GHAppCreateTokenBuilder createToken(Map<String, GHPermissionType> permissions) {
|
||||||
return new GHAppCreateTokenBuilder(root, String.format("/app/installations/%d/access_tokens", id), permissions);
|
return new GHAppCreateTokenBuilder(root,
|
||||||
|
String.format("/app/installations/%d/access_tokens", getId()),
|
||||||
|
permissions);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -305,9 +360,9 @@ public class GHAppInstallation extends GHObject {
|
|||||||
*
|
*
|
||||||
* @return a GHAppCreateTokenBuilder instance
|
* @return a GHAppCreateTokenBuilder instance
|
||||||
*/
|
*/
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppCreateTokenBuilder createToken() {
|
public GHAppCreateTokenBuilder createToken() {
|
||||||
return new GHAppCreateTokenBuilder(root, String.format("/app/installations/%d/access_tokens", id));
|
return new GHAppCreateTokenBuilder(root, String.format("/app/installations/%d/access_tokens", getId()));
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -14,9 +14,7 @@ import java.util.Map;
|
|||||||
* @author Paulo Miguel Almeida
|
* @author Paulo Miguel Almeida
|
||||||
* @see GHAppInstallation#createToken(Map) GHAppInstallation#createToken(Map)
|
* @see GHAppInstallation#createToken(Map) GHAppInstallation#createToken(Map)
|
||||||
*/
|
*/
|
||||||
public class GHAppInstallationToken {
|
public class GHAppInstallationToken extends GitHubInteractiveObject {
|
||||||
private GitHub root;
|
|
||||||
|
|
||||||
private String token;
|
private String token;
|
||||||
protected String expires_at;
|
protected String expires_at;
|
||||||
private Map<String, String> permissions;
|
private Map<String, String> permissions;
|
||||||
@@ -37,7 +35,9 @@ public class GHAppInstallationToken {
|
|||||||
*
|
*
|
||||||
* @param root
|
* @param root
|
||||||
* the root
|
* the root
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setRoot(GitHub root) {
|
public void setRoot(GitHub root) {
|
||||||
this.root = root;
|
this.root = root;
|
||||||
}
|
}
|
||||||
@@ -56,7 +56,9 @@ public class GHAppInstallationToken {
|
|||||||
*
|
*
|
||||||
* @param permissions
|
* @param permissions
|
||||||
* the permissions
|
* the permissions
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setPermissions(Map<String, String> permissions) {
|
public void setPermissions(Map<String, String> permissions) {
|
||||||
this.permissions = permissions;
|
this.permissions = permissions;
|
||||||
}
|
}
|
||||||
@@ -75,7 +77,9 @@ public class GHAppInstallationToken {
|
|||||||
*
|
*
|
||||||
* @param token
|
* @param token
|
||||||
* the token
|
* the token
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setToken(String token) {
|
public void setToken(String token) {
|
||||||
this.token = token;
|
this.token = token;
|
||||||
}
|
}
|
||||||
@@ -94,7 +98,9 @@ public class GHAppInstallationToken {
|
|||||||
*
|
*
|
||||||
* @param repositories
|
* @param repositories
|
||||||
* the repositories
|
* the repositories
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setRepositories(List<GHRepository> repositories) {
|
public void setRepositories(List<GHRepository> repositories) {
|
||||||
this.repositories = repositories;
|
this.repositories = repositories;
|
||||||
}
|
}
|
||||||
@@ -113,7 +119,9 @@ public class GHAppInstallationToken {
|
|||||||
*
|
*
|
||||||
* @param repositorySelection
|
* @param repositorySelection
|
||||||
* the repository selection
|
* the repository selection
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setRepositorySelection(GHRepositorySelection repositorySelection) {
|
public void setRepositorySelection(GHRepositorySelection repositorySelection) {
|
||||||
this.repositorySelection = repositorySelection;
|
this.repositorySelection = repositorySelection;
|
||||||
}
|
}
|
||||||
@@ -127,7 +135,7 @@ public class GHAppInstallationToken {
|
|||||||
*/
|
*/
|
||||||
@WithBridgeMethods(value = String.class, adapterMethod = "expiresAtStr")
|
@WithBridgeMethods(value = String.class, adapterMethod = "expiresAtStr")
|
||||||
public Date getExpiresAt() throws IOException {
|
public Date getExpiresAt() throws IOException {
|
||||||
return GitHub.parseDate(expires_at);
|
return GitHubClient.parseDate(expires_at);
|
||||||
}
|
}
|
||||||
|
|
||||||
@SuppressFBWarnings(value = "UPM_UNCALLED_PRIVATE_METHOD", justification = "Bridge method of getExpiresAt")
|
@SuppressFBWarnings(value = "UPM_UNCALLED_PRIVATE_METHOD", justification = "Bridge method of getExpiresAt")
|
||||||
|
|||||||
@@ -9,7 +9,6 @@ import java.net.URL;
|
|||||||
* @see GHRelease#getAssets() GHRelease#getAssets()
|
* @see GHRelease#getAssets() GHRelease#getAssets()
|
||||||
*/
|
*/
|
||||||
public class GHAsset extends GHObject {
|
public class GHAsset extends GHObject {
|
||||||
GitHub root;
|
|
||||||
GHRepository owner;
|
GHRepository owner;
|
||||||
private String name;
|
private String name;
|
||||||
private String label;
|
private String label;
|
||||||
@@ -149,7 +148,7 @@ public class GHAsset extends GHObject {
|
|||||||
}
|
}
|
||||||
|
|
||||||
private String getApiRoute() {
|
private String getApiRoute() {
|
||||||
return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/releases/assets/" + id;
|
return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/releases/assets/" + getId();
|
||||||
}
|
}
|
||||||
|
|
||||||
GHAsset wrap(GHRelease release) {
|
GHAsset wrap(GHRelease release) {
|
||||||
|
|||||||
@@ -33,7 +33,6 @@ public class GHAuthorization extends GHObject {
|
|||||||
public static final String WRITE_KEY = "write:public_key";
|
public static final String WRITE_KEY = "write:public_key";
|
||||||
public static final String ADMIN_KEY = "admin:public_key";
|
public static final String ADMIN_KEY = "admin:public_key";
|
||||||
|
|
||||||
private GitHub root;
|
|
||||||
private List<String> scopes;
|
private List<String> scopes;
|
||||||
private String token;
|
private String token;
|
||||||
private String token_last_eight;
|
private String token_last_eight;
|
||||||
@@ -96,7 +95,7 @@ public class GHAuthorization extends GHObject {
|
|||||||
* @return the app url
|
* @return the app url
|
||||||
*/
|
*/
|
||||||
public URL getAppUrl() {
|
public URL getAppUrl() {
|
||||||
return GitHub.parseURL(app.url);
|
return GitHubClient.parseURL(app.url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -112,10 +111,12 @@ public class GHAuthorization extends GHObject {
|
|||||||
* Gets api url.
|
* Gets api url.
|
||||||
*
|
*
|
||||||
* @return the api url
|
* @return the api url
|
||||||
|
* @deprecated use {@link #getUrl()}
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
@SuppressFBWarnings(value = "NM_CONFUSING", justification = "It's a part of the library API, cannot be changed")
|
@SuppressFBWarnings(value = "NM_CONFUSING", justification = "It's a part of the library API, cannot be changed")
|
||||||
public URL getApiURL() {
|
public URL getApiURL() {
|
||||||
return GitHub.parseURL(url);
|
return getUrl();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -141,7 +142,7 @@ public class GHAuthorization extends GHObject {
|
|||||||
* @return the note url
|
* @return the note url
|
||||||
*/
|
*/
|
||||||
public URL getNoteUrl() {
|
public URL getNoteUrl() {
|
||||||
return GitHub.parseURL(note_url);
|
return GitHubClient.parseURL(note_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|||||||
@@ -24,7 +24,7 @@ public class GHBlob {
|
|||||||
* @return API URL of this blob.
|
* @return API URL of this blob.
|
||||||
*/
|
*/
|
||||||
public URL getUrl() {
|
public URL getUrl() {
|
||||||
return GitHub.parseURL(url);
|
return GitHubClient.parseURL(url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|||||||
@@ -3,12 +3,15 @@ package org.kohsuke.github;
|
|||||||
import com.fasterxml.jackson.annotation.JsonCreator;
|
import com.fasterxml.jackson.annotation.JsonCreator;
|
||||||
import com.fasterxml.jackson.annotation.JsonProperty;
|
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
import java.util.Collection;
|
import java.util.Collection;
|
||||||
import java.util.Objects;
|
import java.util.Objects;
|
||||||
|
|
||||||
|
import javax.annotation.CheckForNull;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* A branch in a repository.
|
* A branch in a repository.
|
||||||
*
|
*
|
||||||
@@ -18,8 +21,7 @@ import java.util.Objects;
|
|||||||
value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD",
|
value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD",
|
||||||
"URF_UNREAD_FIELD" },
|
"URF_UNREAD_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public class GHBranch {
|
public class GHBranch extends GitHubInteractiveObject {
|
||||||
private GitHub root;
|
|
||||||
private GHRepository owner;
|
private GHRepository owner;
|
||||||
|
|
||||||
private String name;
|
private String name;
|
||||||
@@ -76,7 +78,7 @@ public class GHBranch {
|
|||||||
*
|
*
|
||||||
* @return true if the push to this branch is restricted via branch protection.
|
* @return true if the push to this branch is restricted via branch protection.
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(Previews.LUKE_CAGE)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public boolean isProtected() {
|
public boolean isProtected() {
|
||||||
return protection;
|
return protection;
|
||||||
@@ -87,10 +89,10 @@ public class GHBranch {
|
|||||||
*
|
*
|
||||||
* @return API URL that deals with the protection of this branch.
|
* @return API URL that deals with the protection of this branch.
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(Previews.LUKE_CAGE)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public URL getProtectionUrl() {
|
public URL getProtectionUrl() {
|
||||||
return GitHub.parseURL(protection_url);
|
return GitHubClient.parseURL(protection_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -100,8 +102,14 @@ public class GHBranch {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
|
@Preview(Previews.LUKE_CAGE)
|
||||||
|
@Deprecated
|
||||||
public GHBranchProtection getProtection() throws IOException {
|
public GHBranchProtection getProtection() throws IOException {
|
||||||
return root.createRequest().withUrlPath(protection_url).fetch(GHBranchProtection.class).wrap(this);
|
return root.createRequest()
|
||||||
|
.withPreview(Previews.LUKE_CAGE)
|
||||||
|
.setRawUrlPath(protection_url)
|
||||||
|
.fetch(GHBranchProtection.class)
|
||||||
|
.wrap(this);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -120,7 +128,7 @@ public class GHBranch {
|
|||||||
* if disabling protection fails
|
* if disabling protection fails
|
||||||
*/
|
*/
|
||||||
public void disableProtection() throws IOException {
|
public void disableProtection() throws IOException {
|
||||||
root.createRequest().method("DELETE").withUrlPath(protection_url).send();
|
root.createRequest().method("DELETE").setRawUrlPath(protection_url).send();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -129,7 +137,7 @@ public class GHBranch {
|
|||||||
* @return GHBranchProtectionBuilder for enabling protection
|
* @return GHBranchProtectionBuilder for enabling protection
|
||||||
* @see GHCommitStatus#getContext() GHCommitStatus#getContext()
|
* @see GHCommitStatus#getContext() GHCommitStatus#getContext()
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(Previews.LUKE_CAGE)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHBranchProtectionBuilder enableProtection() {
|
public GHBranchProtectionBuilder enableProtection() {
|
||||||
return new GHBranchProtectionBuilder(this);
|
return new GHBranchProtectionBuilder(this);
|
||||||
@@ -161,6 +169,59 @@ public class GHBranch {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Merge a branch into this branch.
|
||||||
|
*
|
||||||
|
* @param headBranch
|
||||||
|
* the branch whose head will be merged
|
||||||
|
*
|
||||||
|
* @param commitMessage
|
||||||
|
* the commit message
|
||||||
|
*
|
||||||
|
* @return the merge {@link GHCommit} created, or {@code null} if the base already contains the head (nothing to
|
||||||
|
* merge).
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* if merging fails
|
||||||
|
*/
|
||||||
|
@CheckForNull
|
||||||
|
public GHCommit merge(GHBranch headBranch, String commitMessage) throws IOException {
|
||||||
|
return merge(headBranch.getName(), commitMessage);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Merge a ref into this branch.
|
||||||
|
*
|
||||||
|
* @param head
|
||||||
|
* the ref name that will be merged into this branch. Follows the usual ref naming rules, could be a
|
||||||
|
* branch name, tag, or commit sha.
|
||||||
|
*
|
||||||
|
* @param commitMessage
|
||||||
|
* the commit message
|
||||||
|
*
|
||||||
|
* @return the merge {@link GHCommit} created, or {@code null} if the base already contains the head (nothing to
|
||||||
|
* merge).
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* if merging fails
|
||||||
|
*/
|
||||||
|
@CheckForNull
|
||||||
|
public GHCommit merge(String head, String commitMessage) throws IOException {
|
||||||
|
GHCommit result = root.createRequest()
|
||||||
|
.withUrlPath(owner.getApiTailUrl("merges"))
|
||||||
|
.method("POST")
|
||||||
|
.with("commit_message", commitMessage)
|
||||||
|
.with("base", this.name)
|
||||||
|
.with("head", head)
|
||||||
|
.fetch(GHCommit.class);
|
||||||
|
|
||||||
|
if (result != null) {
|
||||||
|
result.wrapUp(owner);
|
||||||
|
}
|
||||||
|
|
||||||
|
return result;
|
||||||
|
}
|
||||||
|
|
||||||
String getApiRoute() {
|
String getApiRoute() {
|
||||||
return owner.getApiTailUrl("/branches/" + name);
|
return owner.getApiTailUrl("/branches/" + name);
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -6,23 +6,23 @@ import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
|||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.util.Collection;
|
import java.util.Collection;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.ZZZAX;
|
import static org.kohsuke.github.internal.Previews.ZZZAX;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The type GHBranchProtection.
|
* The type GHBranchProtection.
|
||||||
|
*
|
||||||
|
* @see <a href="https://docs.github.com/en/rest/reference/repos#get-branch-protection">GitHub Branch Protection</a>
|
||||||
*/
|
*/
|
||||||
@SuppressFBWarnings(
|
@SuppressFBWarnings(
|
||||||
value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD",
|
value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD",
|
||||||
"URF_UNREAD_FIELD" },
|
"URF_UNREAD_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public class GHBranchProtection {
|
public class GHBranchProtection extends GitHubInteractiveObject {
|
||||||
private static final String REQUIRE_SIGNATURES_URI = "/required_signatures";
|
private static final String REQUIRE_SIGNATURES_URI = "/required_signatures";
|
||||||
|
|
||||||
@JsonProperty
|
@JsonProperty
|
||||||
private EnforceAdmins enforceAdmins;
|
private EnforceAdmins enforceAdmins;
|
||||||
|
|
||||||
private GitHub root;
|
|
||||||
|
|
||||||
@JsonProperty("required_pull_request_reviews")
|
@JsonProperty("required_pull_request_reviews")
|
||||||
private RequiredReviews requiredReviews;
|
private RequiredReviews requiredReviews;
|
||||||
|
|
||||||
@@ -41,7 +41,7 @@ public class GHBranchProtection {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(ZZZAX)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public void enabledSignedCommits() throws IOException {
|
public void enabledSignedCommits() throws IOException {
|
||||||
requester().method("POST").withUrlPath(url + REQUIRE_SIGNATURES_URI).fetch(RequiredSignatures.class);
|
requester().method("POST").withUrlPath(url + REQUIRE_SIGNATURES_URI).fetch(RequiredSignatures.class);
|
||||||
@@ -53,7 +53,7 @@ public class GHBranchProtection {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(ZZZAX)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public void disableSignedCommits() throws IOException {
|
public void disableSignedCommits() throws IOException {
|
||||||
requester().method("DELETE").withUrlPath(url + REQUIRE_SIGNATURES_URI).send();
|
requester().method("DELETE").withUrlPath(url + REQUIRE_SIGNATURES_URI).send();
|
||||||
@@ -84,7 +84,7 @@ public class GHBranchProtection {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(ZZZAX)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public boolean getRequiredSignatures() throws IOException {
|
public boolean getRequiredSignatures() throws IOException {
|
||||||
return requester().withUrlPath(url + REQUIRE_SIGNATURES_URI).fetch(RequiredSignatures.class).enabled;
|
return requester().withUrlPath(url + REQUIRE_SIGNATURES_URI).fetch(RequiredSignatures.class).enabled;
|
||||||
|
|||||||
@@ -12,7 +12,7 @@ import java.util.List;
|
|||||||
import java.util.Map;
|
import java.util.Map;
|
||||||
import java.util.Set;
|
import java.util.Set;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.*;
|
import static org.kohsuke.github.internal.Previews.LUKE_CAGE;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Builder to configure the branch protection settings.
|
* Builder to configure the branch protection settings.
|
||||||
|
|||||||
@@ -1,30 +1,52 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||||
|
import com.infradna.tool.bridge_method_injector.WithBridgeMethods;
|
||||||
|
import edu.umd.cs.findbugs.annotations.NonNull;
|
||||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
|
import org.kohsuke.github.GHWorkflowRun.Conclusion;
|
||||||
|
import org.kohsuke.github.GHWorkflowRun.Status;
|
||||||
|
import org.kohsuke.github.internal.EnumUtils;
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
|
import java.util.Arrays;
|
||||||
|
import java.util.Collections;
|
||||||
|
import java.util.Date;
|
||||||
|
import java.util.List;
|
||||||
|
import java.util.Locale;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Represents a deployment
|
* Represents a check run.
|
||||||
*
|
*
|
||||||
* @see <a href="https://developer.github.com/v3/checks/runs/">documentation</a>
|
* @see <a href="https://developer.github.com/v3/checks/runs/">documentation</a>
|
||||||
*/
|
*/
|
||||||
|
|
||||||
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD", "URF_UNREAD_FIELD" },
|
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD", "URF_UNREAD_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public class GHCheckRun extends GHObject {
|
public class GHCheckRun extends GHObject {
|
||||||
|
|
||||||
|
@JsonProperty("repository")
|
||||||
GHRepository owner;
|
GHRepository owner;
|
||||||
GitHub root;
|
|
||||||
|
|
||||||
private String status;
|
private String status;
|
||||||
private String conclusion;
|
private String conclusion;
|
||||||
private String name;
|
private String name;
|
||||||
|
private String headSha;
|
||||||
|
private String nodeId;
|
||||||
|
private String externalId;
|
||||||
|
private String startedAt;
|
||||||
|
private String completedAt;
|
||||||
|
private URL htmlUrl;
|
||||||
|
private URL detailsUrl;
|
||||||
|
private Output output;
|
||||||
|
private GHApp app;
|
||||||
private GHPullRequest[] pullRequests;
|
private GHPullRequest[] pullRequests;
|
||||||
|
private GHCheckSuite checkSuite;
|
||||||
|
|
||||||
GHCheckRun wrap(GHRepository owner) {
|
GHCheckRun wrap(GHRepository owner) {
|
||||||
this.owner = owner;
|
this.owner = owner;
|
||||||
this.root = owner.root;
|
wrap(owner.root);
|
||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -32,7 +54,24 @@ public class GHCheckRun extends GHObject {
|
|||||||
this.root = root;
|
this.root = root;
|
||||||
if (owner != null) {
|
if (owner != null) {
|
||||||
owner.wrap(root);
|
owner.wrap(root);
|
||||||
|
if (pullRequests != null && pullRequests.length != 0) {
|
||||||
|
for (GHPullRequest singlePull : pullRequests) {
|
||||||
|
singlePull.wrap(owner);
|
||||||
}
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
}
|
||||||
|
if (checkSuite != null) {
|
||||||
|
if (owner != null) {
|
||||||
|
checkSuite.wrap(owner);
|
||||||
|
} else {
|
||||||
|
checkSuite.wrap(root);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
if (app != null) {
|
||||||
|
app.wrapUp(root);
|
||||||
|
}
|
||||||
|
|
||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -40,33 +79,264 @@ public class GHCheckRun extends GHObject {
|
|||||||
return pullRequests;
|
return pullRequests;
|
||||||
}
|
}
|
||||||
|
|
||||||
public String getStatus() {
|
/**
|
||||||
|
* Gets status of the check run.
|
||||||
|
*
|
||||||
|
* @return Status of the check run
|
||||||
|
* @see Status
|
||||||
|
*/
|
||||||
|
@WithBridgeMethods(value = String.class, adapterMethod = "statusAsStr")
|
||||||
|
public Status getStatus() {
|
||||||
|
return Status.from(status);
|
||||||
|
}
|
||||||
|
|
||||||
|
@SuppressFBWarnings(value = "UPM_UNCALLED_PRIVATE_METHOD", justification = "Bridge method of getStatus")
|
||||||
|
private Object statusAsStr(Status status, Class type) {
|
||||||
return status;
|
return status;
|
||||||
}
|
}
|
||||||
|
|
||||||
public String getConclusion() {
|
public static enum Status {
|
||||||
|
QUEUED, IN_PROGRESS, COMPLETED, UNKNOWN;
|
||||||
|
|
||||||
|
public static Status from(String value) {
|
||||||
|
return EnumUtils.getNullableEnumOrDefault(Status.class, value, Status.UNKNOWN);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String toString() {
|
||||||
|
return name().toLowerCase(Locale.ROOT);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets conclusion of a completed check run.
|
||||||
|
*
|
||||||
|
* @return Status of the check run
|
||||||
|
* @see Conclusion
|
||||||
|
*/
|
||||||
|
@WithBridgeMethods(value = String.class, adapterMethod = "conclusionAsStr")
|
||||||
|
public Conclusion getConclusion() {
|
||||||
|
return Conclusion.from(conclusion);
|
||||||
|
}
|
||||||
|
|
||||||
|
@SuppressFBWarnings(value = "UPM_UNCALLED_PRIVATE_METHOD", justification = "Bridge method of getConclusion")
|
||||||
|
private Object conclusionAsStr(Conclusion conclusion, Class type) {
|
||||||
return conclusion;
|
return conclusion;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Final conclusion of the check.
|
||||||
|
*
|
||||||
|
* From <a href="https://docs.github.com/en/rest/reference/checks#create-a-check-run--parameters">Check Run
|
||||||
|
* Parameters - <code>conclusion</code></a>.
|
||||||
|
*/
|
||||||
|
public static enum Conclusion {
|
||||||
|
ACTION_REQUIRED, CANCELLED, FAILURE, NEUTRAL, SUCCESS, SKIPPED, STALE, TIMED_OUT, UNKNOWN;
|
||||||
|
|
||||||
|
public static Conclusion from(String value) {
|
||||||
|
return EnumUtils.getNullableEnumOrDefault(Conclusion.class, value, Conclusion.UNKNOWN);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String toString() {
|
||||||
|
return name().toLowerCase(Locale.ROOT);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the custom name of this check run.
|
||||||
|
*
|
||||||
|
* @return Name of the check run
|
||||||
|
*/
|
||||||
public String getName() {
|
public String getName() {
|
||||||
return name;
|
return name;
|
||||||
}
|
}
|
||||||
|
|
||||||
GHPullRequest[] getPullRequests() throws IOException {
|
/**
|
||||||
if (pullRequests != null && pullRequests.length != 0) {
|
* Gets the HEAD SHA.
|
||||||
for (GHPullRequest singlePull : pullRequests) {
|
*
|
||||||
singlePull.refresh();
|
* @return sha for the HEAD commit
|
||||||
}
|
*/
|
||||||
}
|
public String getHeadSha() {
|
||||||
return pullRequests;
|
return headSha;
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* @deprecated This object has no HTML URL.
|
* Gets the pull requests participated in this check run.
|
||||||
|
*
|
||||||
|
* Note this field is only populated for events. When getting a {@link GHCheckRun} outside of an event, this is
|
||||||
|
* always empty.
|
||||||
|
*
|
||||||
|
* @return the list of {@link GHPullRequest}s for this check run. Only populated for events.
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public List<GHPullRequest> getPullRequests() throws IOException {
|
||||||
|
if (pullRequests != null && pullRequests.length != 0) {
|
||||||
|
for (GHPullRequest singlePull : pullRequests) {
|
||||||
|
// Only refresh if we haven't do so before
|
||||||
|
singlePull.refresh(singlePull.getTitle());
|
||||||
|
}
|
||||||
|
return Collections.unmodifiableList(Arrays.asList(pullRequests));
|
||||||
|
}
|
||||||
|
return Collections.emptyList();
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the HTML URL: https://github.com/[owner]/[repo-name]/runs/[check-run-id], usually an GitHub Action page of
|
||||||
|
* the check run.
|
||||||
|
*
|
||||||
|
* @return HTML URL
|
||||||
*/
|
*/
|
||||||
@Override
|
@Override
|
||||||
public URL getHtmlUrl() {
|
public URL getHtmlUrl() {
|
||||||
return null;
|
return htmlUrl;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the global node id to access most objects in GitHub.
|
||||||
|
*
|
||||||
|
* @see <a href="https://developer.github.com/v4/guides/using-global-node-ids/">documentation</a>
|
||||||
|
* @return Global node id
|
||||||
|
*/
|
||||||
|
public String getNodeId() {
|
||||||
|
return nodeId;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets a reference for the check run on the integrator's system.
|
||||||
|
*
|
||||||
|
* @return Reference id
|
||||||
|
*/
|
||||||
|
public String getExternalId() {
|
||||||
|
return externalId;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the details URL from which to find full details of the check run on the integrator's site.
|
||||||
|
*
|
||||||
|
* @return Details URL
|
||||||
|
*/
|
||||||
|
public URL getDetailsUrl() {
|
||||||
|
return detailsUrl;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the start time of the check run in ISO 8601 format: YYYY-MM-DDTHH:MM:SSZ.
|
||||||
|
*
|
||||||
|
* @return Timestamp of the start time
|
||||||
|
*/
|
||||||
|
public Date getStartedAt() {
|
||||||
|
return GitHubClient.parseDate(startedAt);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the completed time of the check run in ISO 8601 format: YYYY-MM-DDTHH:MM:SSZ.
|
||||||
|
*
|
||||||
|
* @return Timestamp of the completed time
|
||||||
|
*/
|
||||||
|
public Date getCompletedAt() {
|
||||||
|
return GitHubClient.parseDate(completedAt);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the GitHub app this check run belongs to, included in response.
|
||||||
|
*
|
||||||
|
* @return GitHub App
|
||||||
|
*/
|
||||||
|
public GHApp getApp() {
|
||||||
|
return app;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the check suite this check run belongs to
|
||||||
|
*
|
||||||
|
* @return Check suite
|
||||||
|
*/
|
||||||
|
public GHCheckSuite getCheckSuite() {
|
||||||
|
return checkSuite;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets an output for a check run.
|
||||||
|
*
|
||||||
|
* @return Output of a check run
|
||||||
|
*/
|
||||||
|
public Output getOutput() {
|
||||||
|
return output;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Represents an output in a check run to include summary and other results.
|
||||||
|
*
|
||||||
|
* @see <a href="https://developer.github.com/v3/checks/runs/#output-object">documentation</a>
|
||||||
|
*/
|
||||||
|
public static class Output {
|
||||||
|
private String title;
|
||||||
|
private String summary;
|
||||||
|
private String text;
|
||||||
|
private int annotationsCount;
|
||||||
|
private URL annotationsUrl;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the title of check run.
|
||||||
|
*
|
||||||
|
* @return title of check run
|
||||||
|
*/
|
||||||
|
public String getTitle() {
|
||||||
|
return title;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the summary of the check run, note that it supports Markdown.
|
||||||
|
*
|
||||||
|
* @return summary of check run
|
||||||
|
*/
|
||||||
|
public String getSummary() {
|
||||||
|
return summary;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the details of the check run, note that it supports Markdown.
|
||||||
|
*
|
||||||
|
* @return Details of the check run
|
||||||
|
*/
|
||||||
|
public String getText() {
|
||||||
|
return text;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the annotation count of a check run.
|
||||||
|
*
|
||||||
|
* @return annotation count of a check run
|
||||||
|
*/
|
||||||
|
public int getAnnotationsCount() {
|
||||||
|
return annotationsCount;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the URL of annotations.
|
||||||
|
*
|
||||||
|
* @return URL of annotations
|
||||||
|
*/
|
||||||
|
public URL getAnnotationsUrl() {
|
||||||
|
return annotationsUrl;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
public static enum AnnotationLevel {
|
||||||
|
NOTICE, WARNING, FAILURE
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Updates this check run.
|
||||||
|
*
|
||||||
|
* @return a builder which you should customize, then call {@link GHCheckRunBuilder#create}
|
||||||
|
*/
|
||||||
|
@Preview(Previews.ANTIOPE)
|
||||||
|
@Deprecated
|
||||||
|
public @NonNull GHCheckRunBuilder update() {
|
||||||
|
return new GHCheckRunBuilder(owner, getId());
|
||||||
}
|
}
|
||||||
|
|
||||||
}
|
}
|
||||||
|
|||||||
307
src/main/java/org/kohsuke/github/GHCheckRunBuilder.java
Normal file
307
src/main/java/org/kohsuke/github/GHCheckRunBuilder.java
Normal file
@@ -0,0 +1,307 @@
|
|||||||
|
/*
|
||||||
|
* The MIT License
|
||||||
|
*
|
||||||
|
* Copyright 2020 CloudBees, Inc.
|
||||||
|
*
|
||||||
|
* Permission is hereby granted, free of charge, to any person obtaining a copy
|
||||||
|
* of this software and associated documentation files (the "Software"), to deal
|
||||||
|
* in the Software without restriction, including without limitation the rights
|
||||||
|
* to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
|
||||||
|
* copies of the Software, and to permit persons to whom the Software is
|
||||||
|
* furnished to do so, subject to the following conditions:
|
||||||
|
*
|
||||||
|
* The above copyright notice and this permission notice shall be included in
|
||||||
|
* all copies or substantial portions of the Software.
|
||||||
|
*
|
||||||
|
* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
|
||||||
|
* IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
|
||||||
|
* FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
|
||||||
|
* AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
|
||||||
|
* LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
|
||||||
|
* OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
|
||||||
|
* THE SOFTWARE.
|
||||||
|
*/
|
||||||
|
|
||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import com.fasterxml.jackson.annotation.JsonInclude;
|
||||||
|
import edu.umd.cs.findbugs.annotations.CheckForNull;
|
||||||
|
import edu.umd.cs.findbugs.annotations.NonNull;
|
||||||
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
|
import java.io.IOException;
|
||||||
|
import java.util.Collections;
|
||||||
|
import java.util.Date;
|
||||||
|
import java.util.LinkedList;
|
||||||
|
import java.util.List;
|
||||||
|
import java.util.Locale;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Drafts or updates a check run.
|
||||||
|
*
|
||||||
|
* @see GHCheckRun
|
||||||
|
* @see GHRepository#createCheckRun
|
||||||
|
* @see <a href="https://developer.github.com/v3/checks/runs/#create-a-check-run">documentation</a>
|
||||||
|
* @see GHCheckRun#update()
|
||||||
|
* @see <a href="https://developer.github.com/v3/checks/runs/#update-a-check-run">documentation</a>
|
||||||
|
*/
|
||||||
|
@SuppressFBWarnings(value = "URF_UNREAD_FIELD", justification = "Jackson serializes these even without a getter")
|
||||||
|
@Preview(Previews.ANTIOPE)
|
||||||
|
@Deprecated
|
||||||
|
public final class GHCheckRunBuilder {
|
||||||
|
|
||||||
|
protected final GHRepository repo;
|
||||||
|
protected final Requester requester;
|
||||||
|
private Output output;
|
||||||
|
private List<Action> actions;
|
||||||
|
|
||||||
|
private GHCheckRunBuilder(GHRepository repo, Requester requester) {
|
||||||
|
this.repo = repo;
|
||||||
|
this.requester = requester;
|
||||||
|
}
|
||||||
|
|
||||||
|
GHCheckRunBuilder(GHRepository repo, String name, String headSHA) {
|
||||||
|
this(repo,
|
||||||
|
repo.root.createRequest()
|
||||||
|
.withPreview(Previews.ANTIOPE)
|
||||||
|
.method("POST")
|
||||||
|
.with("name", name)
|
||||||
|
.with("head_sha", headSHA)
|
||||||
|
.withUrlPath(repo.getApiTailUrl("check-runs")));
|
||||||
|
}
|
||||||
|
|
||||||
|
GHCheckRunBuilder(GHRepository repo, long checkId) {
|
||||||
|
this(repo,
|
||||||
|
repo.root.createRequest()
|
||||||
|
.withPreview(Previews.ANTIOPE)
|
||||||
|
.method("PATCH")
|
||||||
|
.withUrlPath(repo.getApiTailUrl("check-runs/" + checkId)));
|
||||||
|
}
|
||||||
|
|
||||||
|
public @NonNull GHCheckRunBuilder withDetailsURL(@CheckForNull String detailsURL) {
|
||||||
|
requester.with("details_url", detailsURL);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
public @NonNull GHCheckRunBuilder withExternalID(@CheckForNull String externalID) {
|
||||||
|
requester.with("external_id", externalID);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
public @NonNull GHCheckRunBuilder withStatus(@CheckForNull GHCheckRun.Status status) {
|
||||||
|
if (status != null) {
|
||||||
|
// Do *not* use the overload taking Enum, as that s/_/-/g which would be wrong here.
|
||||||
|
requester.with("status", status.toString().toLowerCase(Locale.ROOT));
|
||||||
|
}
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
public @NonNull GHCheckRunBuilder withConclusion(@CheckForNull GHCheckRun.Conclusion conclusion) {
|
||||||
|
if (conclusion != null) {
|
||||||
|
requester.with("conclusion", conclusion.toString().toLowerCase(Locale.ROOT));
|
||||||
|
}
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
public @NonNull GHCheckRunBuilder withStartedAt(@CheckForNull Date startedAt) {
|
||||||
|
if (startedAt != null) {
|
||||||
|
requester.with("started_at", GitHubClient.printDate(startedAt));
|
||||||
|
}
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
public @NonNull GHCheckRunBuilder withCompletedAt(@CheckForNull Date completedAt) {
|
||||||
|
if (completedAt != null) {
|
||||||
|
requester.with("completed_at", GitHubClient.printDate(completedAt));
|
||||||
|
}
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
public @NonNull GHCheckRunBuilder add(@NonNull Output output) {
|
||||||
|
if (this.output != null) {
|
||||||
|
throw new IllegalStateException("cannot add Output twice");
|
||||||
|
}
|
||||||
|
this.output = output;
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
public @NonNull GHCheckRunBuilder add(@NonNull Action action) {
|
||||||
|
if (actions == null) {
|
||||||
|
actions = new LinkedList<>();
|
||||||
|
}
|
||||||
|
actions.add(action);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
private static final int MAX_ANNOTATIONS = 50;
|
||||||
|
/**
|
||||||
|
* Actually creates the check run. (If more than fifty annotations were requested, this is done in batches.)
|
||||||
|
*
|
||||||
|
* @return the resulting run
|
||||||
|
* @throws IOException
|
||||||
|
* for the usual reasons
|
||||||
|
*/
|
||||||
|
public @NonNull GHCheckRun create() throws IOException {
|
||||||
|
List<Annotation> extraAnnotations;
|
||||||
|
if (output != null && output.annotations != null && output.annotations.size() > MAX_ANNOTATIONS) {
|
||||||
|
extraAnnotations = output.annotations.subList(MAX_ANNOTATIONS, output.annotations.size());
|
||||||
|
output.annotations = output.annotations.subList(0, MAX_ANNOTATIONS);
|
||||||
|
} else {
|
||||||
|
extraAnnotations = Collections.emptyList();
|
||||||
|
}
|
||||||
|
GHCheckRun run = requester.with("output", output).with("actions", actions).fetch(GHCheckRun.class).wrap(repo);
|
||||||
|
while (!extraAnnotations.isEmpty()) {
|
||||||
|
Output output2 = new Output(output.title, output.summary).withText(output.text);
|
||||||
|
int i = Math.min(extraAnnotations.size(), MAX_ANNOTATIONS);
|
||||||
|
output2.annotations = extraAnnotations.subList(0, i);
|
||||||
|
extraAnnotations = extraAnnotations.subList(i, extraAnnotations.size());
|
||||||
|
run = repo.root.createRequest()
|
||||||
|
.withPreview(Previews.ANTIOPE)
|
||||||
|
.method("PATCH")
|
||||||
|
.with("output", output2)
|
||||||
|
.withUrlPath(repo.getApiTailUrl("check-runs/" + run.getId()))
|
||||||
|
.fetch(GHCheckRun.class)
|
||||||
|
.wrap(repo);
|
||||||
|
}
|
||||||
|
return run;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* @see <a href="https://developer.github.com/v3/checks/runs/#output-object">documentation</a>
|
||||||
|
*/
|
||||||
|
@JsonInclude(JsonInclude.Include.NON_NULL)
|
||||||
|
public static final class Output {
|
||||||
|
|
||||||
|
private final String title;
|
||||||
|
private final String summary;
|
||||||
|
private String text;
|
||||||
|
private List<Annotation> annotations;
|
||||||
|
private List<Image> images;
|
||||||
|
|
||||||
|
public Output(@NonNull String title, @NonNull String summary) {
|
||||||
|
this.title = title;
|
||||||
|
this.summary = summary;
|
||||||
|
}
|
||||||
|
|
||||||
|
public @NonNull Output withText(@CheckForNull String text) {
|
||||||
|
this.text = text;
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
public @NonNull Output add(@NonNull Annotation annotation) {
|
||||||
|
if (annotations == null) {
|
||||||
|
annotations = new LinkedList<>();
|
||||||
|
}
|
||||||
|
annotations.add(annotation);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
public @NonNull Output add(@NonNull Image image) {
|
||||||
|
if (images == null) {
|
||||||
|
images = new LinkedList<>();
|
||||||
|
}
|
||||||
|
images.add(image);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* @see <a href="https://developer.github.com/v3/checks/runs/#annotations-object">documentation</a>
|
||||||
|
*/
|
||||||
|
@JsonInclude(JsonInclude.Include.NON_NULL)
|
||||||
|
public static final class Annotation {
|
||||||
|
|
||||||
|
private final String path;
|
||||||
|
private final int start_line;
|
||||||
|
private final int end_line;
|
||||||
|
private final String annotation_level;
|
||||||
|
private final String message;
|
||||||
|
private Integer start_column;
|
||||||
|
private Integer end_column;
|
||||||
|
private String title;
|
||||||
|
private String raw_details;
|
||||||
|
|
||||||
|
public Annotation(@NonNull String path,
|
||||||
|
int line,
|
||||||
|
@NonNull GHCheckRun.AnnotationLevel annotationLevel,
|
||||||
|
@NonNull String message) {
|
||||||
|
this(path, line, line, annotationLevel, message);
|
||||||
|
}
|
||||||
|
|
||||||
|
public Annotation(@NonNull String path,
|
||||||
|
int startLine,
|
||||||
|
int endLine,
|
||||||
|
@NonNull GHCheckRun.AnnotationLevel annotationLevel,
|
||||||
|
@NonNull String message) {
|
||||||
|
this.path = path;
|
||||||
|
start_line = startLine;
|
||||||
|
end_line = endLine;
|
||||||
|
annotation_level = annotationLevel.toString().toLowerCase(Locale.ROOT);
|
||||||
|
this.message = message;
|
||||||
|
}
|
||||||
|
|
||||||
|
public @NonNull Annotation withStartColumn(@CheckForNull Integer startColumn) {
|
||||||
|
start_column = startColumn;
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
public @NonNull Annotation withEndColumn(@CheckForNull Integer endColumn) {
|
||||||
|
end_column = endColumn;
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
public @NonNull Annotation withTitle(@CheckForNull String title) {
|
||||||
|
this.title = title;
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
public @NonNull Annotation withRawDetails(@CheckForNull String rawDetails) {
|
||||||
|
raw_details = rawDetails;
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* @see <a href="https://developer.github.com/v3/checks/runs/#images-object">documentation</a>
|
||||||
|
*/
|
||||||
|
@JsonInclude(JsonInclude.Include.NON_NULL)
|
||||||
|
public static final class Image {
|
||||||
|
|
||||||
|
private final String alt;
|
||||||
|
private final String image_url;
|
||||||
|
private String caption;
|
||||||
|
|
||||||
|
public Image(@NonNull String alt, @NonNull String imageURL) {
|
||||||
|
this.alt = alt;
|
||||||
|
image_url = imageURL;
|
||||||
|
}
|
||||||
|
|
||||||
|
public @NonNull Image withCaption(@CheckForNull String caption) {
|
||||||
|
this.caption = caption;
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* @see <a href="https://developer.github.com/v3/checks/runs/#actions-object">documentation</a>
|
||||||
|
*/
|
||||||
|
@JsonInclude(JsonInclude.Include.NON_NULL)
|
||||||
|
public static final class Action {
|
||||||
|
|
||||||
|
private final String label;
|
||||||
|
private final String description;
|
||||||
|
private final String identifier;
|
||||||
|
|
||||||
|
public Action(@NonNull String label, @NonNull String description, @NonNull String identifier) {
|
||||||
|
this.label = label;
|
||||||
|
this.description = description;
|
||||||
|
this.identifier = identifier;
|
||||||
|
}
|
||||||
|
|
||||||
|
}
|
||||||
|
|
||||||
|
}
|
||||||
44
src/main/java/org/kohsuke/github/GHCheckRunsIterable.java
Normal file
44
src/main/java/org/kohsuke/github/GHCheckRunsIterable.java
Normal file
@@ -0,0 +1,44 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import java.util.Iterator;
|
||||||
|
|
||||||
|
import javax.annotation.Nonnull;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Iterable for check-runs listing.
|
||||||
|
*/
|
||||||
|
class GHCheckRunsIterable extends PagedIterable<GHCheckRun> {
|
||||||
|
private final transient GitHub root;
|
||||||
|
private final GitHubRequest request;
|
||||||
|
|
||||||
|
private GHCheckRunsPage result;
|
||||||
|
|
||||||
|
public GHCheckRunsIterable(GitHub root, GitHubRequest request) {
|
||||||
|
this.root = root;
|
||||||
|
this.request = request;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Nonnull
|
||||||
|
@Override
|
||||||
|
public PagedIterator<GHCheckRun> _iterator(int pageSize) {
|
||||||
|
return new PagedIterator<>(
|
||||||
|
adapt(GitHubPageIterator.create(root.getClient(), GHCheckRunsPage.class, request, pageSize)),
|
||||||
|
null);
|
||||||
|
}
|
||||||
|
|
||||||
|
protected Iterator<GHCheckRun[]> adapt(final Iterator<GHCheckRunsPage> base) {
|
||||||
|
return new Iterator<GHCheckRun[]>() {
|
||||||
|
public boolean hasNext() {
|
||||||
|
return base.hasNext();
|
||||||
|
}
|
||||||
|
|
||||||
|
public GHCheckRun[] next() {
|
||||||
|
GHCheckRunsPage v = base.next();
|
||||||
|
if (result == null) {
|
||||||
|
result = v;
|
||||||
|
}
|
||||||
|
return v.getCheckRuns(root);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
}
|
||||||
|
}
|
||||||
20
src/main/java/org/kohsuke/github/GHCheckRunsPage.java
Normal file
20
src/main/java/org/kohsuke/github/GHCheckRunsPage.java
Normal file
@@ -0,0 +1,20 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Represents the one page of check-runs result when listing check-runs.
|
||||||
|
*/
|
||||||
|
class GHCheckRunsPage {
|
||||||
|
private int total_count;
|
||||||
|
private GHCheckRun[] check_runs;
|
||||||
|
|
||||||
|
public int getTotalCount() {
|
||||||
|
return total_count;
|
||||||
|
}
|
||||||
|
|
||||||
|
GHCheckRun[] getCheckRuns(GitHub root) {
|
||||||
|
for (GHCheckRun check_run : check_runs) {
|
||||||
|
check_run.wrap(root);
|
||||||
|
}
|
||||||
|
return check_runs;
|
||||||
|
}
|
||||||
|
}
|
||||||
259
src/main/java/org/kohsuke/github/GHCheckSuite.java
Normal file
259
src/main/java/org/kohsuke/github/GHCheckSuite.java
Normal file
@@ -0,0 +1,259 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||||
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
|
|
||||||
|
import java.io.IOException;
|
||||||
|
import java.net.URL;
|
||||||
|
import java.util.Arrays;
|
||||||
|
import java.util.Collections;
|
||||||
|
import java.util.Date;
|
||||||
|
import java.util.List;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Represents a check suite.
|
||||||
|
*
|
||||||
|
* @see <a href="https://developer.github.com/v3/checks/suites/">documentation</a>
|
||||||
|
*/
|
||||||
|
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD", "URF_UNREAD_FIELD" },
|
||||||
|
justification = "JSON API")
|
||||||
|
public class GHCheckSuite extends GHObject {
|
||||||
|
|
||||||
|
@JsonProperty("repository")
|
||||||
|
GHRepository owner;
|
||||||
|
|
||||||
|
private String nodeId;
|
||||||
|
private String headBranch;
|
||||||
|
private String headSha;
|
||||||
|
private String status;
|
||||||
|
private String conclusion;
|
||||||
|
private String before;
|
||||||
|
private String after;
|
||||||
|
private int latestCheckRunsCount;
|
||||||
|
private URL checkRunsUrl;
|
||||||
|
private HeadCommit headCommit;
|
||||||
|
private GHApp app;
|
||||||
|
private GHPullRequest[] pullRequests;
|
||||||
|
|
||||||
|
GHCheckSuite wrap(GHRepository owner) {
|
||||||
|
this.owner = owner;
|
||||||
|
this.wrap(owner.root);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
GHCheckSuite wrap(GitHub root) {
|
||||||
|
this.root = root;
|
||||||
|
if (owner != null) {
|
||||||
|
owner.wrap(root);
|
||||||
|
if (pullRequests != null && pullRequests.length != 0) {
|
||||||
|
for (GHPullRequest singlePull : pullRequests) {
|
||||||
|
singlePull.wrap(owner);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
if (app != null) {
|
||||||
|
app.wrapUp(root);
|
||||||
|
}
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
GHPullRequest[] wrap() {
|
||||||
|
return pullRequests;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the global node id to access most objects in GitHub.
|
||||||
|
*
|
||||||
|
* @see <a href="https://developer.github.com/v4/guides/using-global-node-ids/">documentation</a>
|
||||||
|
* @return global node id
|
||||||
|
*/
|
||||||
|
public String getNodeId() {
|
||||||
|
return nodeId;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The head branch name the changes are on.
|
||||||
|
*
|
||||||
|
* @return head branch name
|
||||||
|
*/
|
||||||
|
public String getHeadBranch() {
|
||||||
|
return headBranch;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the HEAD SHA.
|
||||||
|
*
|
||||||
|
* @return sha for the HEAD commit
|
||||||
|
*/
|
||||||
|
public String getHeadSha() {
|
||||||
|
return headSha;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets status of the check suite. It can be one of request, in_progress, or completed.
|
||||||
|
*
|
||||||
|
* @return status of the check suite
|
||||||
|
*/
|
||||||
|
public String getStatus() {
|
||||||
|
return status;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets conclusion of a completed check suite. It can be one of success, failure, neutral, cancelled, time_out,
|
||||||
|
* action_required, or stale. The check suite will report the highest priority check run conclusion in the check
|
||||||
|
* suite's conclusion.
|
||||||
|
*
|
||||||
|
* @return conclusion of the check suite
|
||||||
|
*/
|
||||||
|
public String getConclusion() {
|
||||||
|
return conclusion;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The SHA of the most recent commit on ref before the push.
|
||||||
|
*
|
||||||
|
* @return sha of a commit
|
||||||
|
*/
|
||||||
|
public String getBefore() {
|
||||||
|
return before;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The SHA of the most recent commit on ref after the push.
|
||||||
|
*
|
||||||
|
* @return sha of a commit
|
||||||
|
*/
|
||||||
|
public String getAfter() {
|
||||||
|
return after;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The quantity of check runs that had run as part of the latest push.
|
||||||
|
*
|
||||||
|
* @return sha of the most recent commit
|
||||||
|
*/
|
||||||
|
public int getLatestCheckRunsCount() {
|
||||||
|
return latestCheckRunsCount;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The url used to list all the check runs belonged to this suite.
|
||||||
|
*
|
||||||
|
* @return url containing all check runs
|
||||||
|
*/
|
||||||
|
public URL getCheckRunsUrl() {
|
||||||
|
return checkRunsUrl;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The commit of current head.
|
||||||
|
*
|
||||||
|
* @return head commit
|
||||||
|
*/
|
||||||
|
public HeadCommit getHeadCommit() {
|
||||||
|
return headCommit;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the GitHub app this check suite belongs to, included in response.
|
||||||
|
*
|
||||||
|
* @return GitHub App
|
||||||
|
*/
|
||||||
|
public GHApp getApp() {
|
||||||
|
return app;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the pull requests participated in this check suite.
|
||||||
|
*
|
||||||
|
* Note this field is only populated for events. When getting a {@link GHCheckSuite} outside of an event, this is
|
||||||
|
* always empty.
|
||||||
|
*
|
||||||
|
* @return the list of {@link GHPullRequest}s for this check suite. Only populated for events.
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public List<GHPullRequest> getPullRequests() throws IOException {
|
||||||
|
if (pullRequests != null && pullRequests.length != 0) {
|
||||||
|
for (GHPullRequest singlePull : pullRequests) {
|
||||||
|
// Only refresh if we haven't do so before
|
||||||
|
singlePull.refresh(singlePull.getTitle());
|
||||||
|
}
|
||||||
|
return Collections.unmodifiableList(Arrays.asList(pullRequests));
|
||||||
|
}
|
||||||
|
return Collections.emptyList();
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Check suite doesn't have a HTML URL.
|
||||||
|
*
|
||||||
|
* @return null
|
||||||
|
*/
|
||||||
|
@Override
|
||||||
|
public URL getHtmlUrl() {
|
||||||
|
return null;
|
||||||
|
}
|
||||||
|
|
||||||
|
public static class HeadCommit {
|
||||||
|
private String id;
|
||||||
|
private String treeId;
|
||||||
|
private String message;
|
||||||
|
private String timestamp;
|
||||||
|
private GitUser author;
|
||||||
|
private GitUser committer;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets id of the commit, used by {@link GHCheckSuite} when a {@link GHEvent#CHECK_SUITE} comes
|
||||||
|
*
|
||||||
|
* @return id of the commit
|
||||||
|
*/
|
||||||
|
public String getId() {
|
||||||
|
return id;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets id of the tree.
|
||||||
|
*
|
||||||
|
* @return id of the tree
|
||||||
|
*/
|
||||||
|
public String getTreeId() {
|
||||||
|
return treeId;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets message.
|
||||||
|
*
|
||||||
|
* @return commit message.
|
||||||
|
*/
|
||||||
|
public String getMessage() {
|
||||||
|
return message;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets timestamp of the commit.
|
||||||
|
*
|
||||||
|
* @return timestamp of the commit
|
||||||
|
*/
|
||||||
|
public Date getTimestamp() {
|
||||||
|
return GitHubClient.parseDate(timestamp);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets author.
|
||||||
|
*
|
||||||
|
* @return the author
|
||||||
|
*/
|
||||||
|
public GitUser getAuthor() {
|
||||||
|
return author;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets committer.
|
||||||
|
*
|
||||||
|
* @return the committer
|
||||||
|
*/
|
||||||
|
public GitUser getCommitter() {
|
||||||
|
return committer;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -11,6 +11,9 @@ import java.util.Collections;
|
|||||||
import java.util.Date;
|
import java.util.Date;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
|
|
||||||
|
import static org.kohsuke.github.internal.Previews.ANTIOPE;
|
||||||
|
import static org.kohsuke.github.internal.Previews.GROOT;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* A commit in a repository.
|
* A commit in a repository.
|
||||||
*
|
*
|
||||||
@@ -39,6 +42,8 @@ public class GHCommit {
|
|||||||
|
|
||||||
private int comment_count;
|
private int comment_count;
|
||||||
|
|
||||||
|
private GHVerification verification;
|
||||||
|
|
||||||
static class Tree {
|
static class Tree {
|
||||||
String sha;
|
String sha;
|
||||||
}
|
}
|
||||||
@@ -61,7 +66,7 @@ public class GHCommit {
|
|||||||
* @return the authored date
|
* @return the authored date
|
||||||
*/
|
*/
|
||||||
public Date getAuthoredDate() {
|
public Date getAuthoredDate() {
|
||||||
return GitHub.parseDate(author.date);
|
return author.getDate();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -80,7 +85,7 @@ public class GHCommit {
|
|||||||
* @return the commit date
|
* @return the commit date
|
||||||
*/
|
*/
|
||||||
public Date getCommitDate() {
|
public Date getCommitDate() {
|
||||||
return GitHub.parseDate(committer.date);
|
return committer.getDate();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -100,6 +105,15 @@ public class GHCommit {
|
|||||||
public int getCommentCount() {
|
public int getCommentCount() {
|
||||||
return comment_count;
|
return comment_count;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets Verification Status.
|
||||||
|
*
|
||||||
|
* @return the Verification status
|
||||||
|
*/
|
||||||
|
public GHVerification getVerification() {
|
||||||
|
return verification;
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -108,7 +122,6 @@ public class GHCommit {
|
|||||||
* @deprecated Use {@link GitUser} instead.
|
* @deprecated Use {@link GitUser} instead.
|
||||||
*/
|
*/
|
||||||
public static class GHAuthor extends GitUser {
|
public static class GHAuthor extends GitUser {
|
||||||
private String date;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -201,7 +214,7 @@ public class GHCommit {
|
|||||||
* resolves to the actual content of the file.
|
* resolves to the actual content of the file.
|
||||||
*/
|
*/
|
||||||
public URL getRawUrl() {
|
public URL getRawUrl() {
|
||||||
return GitHub.parseURL(raw_url);
|
return GitHubClient.parseURL(raw_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -212,7 +225,7 @@ public class GHCommit {
|
|||||||
* that resolves to the HTML page that describes this file.
|
* that resolves to the HTML page that describes this file.
|
||||||
*/
|
*/
|
||||||
public URL getBlobUrl() {
|
public URL getBlobUrl() {
|
||||||
return GitHub.parseURL(blob_url);
|
return GitHubClient.parseURL(blob_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -326,7 +339,7 @@ public class GHCommit {
|
|||||||
* "https://github.com/kohsuke/sandbox-ant/commit/8ae38db0ea5837313ab5f39d43a6f73de3bd9000"
|
* "https://github.com/kohsuke/sandbox-ant/commit/8ae38db0ea5837313ab5f39d43a6f73de3bd9000"
|
||||||
*/
|
*/
|
||||||
public URL getHtmlUrl() {
|
public URL getHtmlUrl() {
|
||||||
return GitHub.parseURL(html_url);
|
return GitHubClient.parseURL(html_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -435,6 +448,39 @@ public class GHCommit {
|
|||||||
return owner.root.getUser(author.login);
|
return owner.root.getUser(author.login);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Retrieves a list of pull requests which contain this commit.
|
||||||
|
*
|
||||||
|
* @return {@link PagedIterable} with the pull requests which contain this commit
|
||||||
|
*/
|
||||||
|
@Preview(GROOT)
|
||||||
|
@Deprecated
|
||||||
|
public PagedIterable<GHPullRequest> listPullRequests() {
|
||||||
|
return owner.root.createRequest()
|
||||||
|
.withPreview(GROOT)
|
||||||
|
.withUrlPath(String.format("/repos/%s/%s/commits/%s/pulls", owner.getOwnerName(), owner.getName(), sha))
|
||||||
|
.toIterable(GHPullRequest[].class, item -> item.wrapUp(owner));
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Retrieves a list of branches where this commit is the head commit.
|
||||||
|
*
|
||||||
|
* @return {@link PagedIterable} with the branches where the commit is the head commit
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
@Preview(GROOT)
|
||||||
|
@Deprecated
|
||||||
|
public PagedIterable<GHBranch> listBranchesWhereHead() throws IOException {
|
||||||
|
return owner.root.createRequest()
|
||||||
|
.withPreview(GROOT)
|
||||||
|
.withUrlPath(String.format("/repos/%s/%s/commits/%s/branches-where-head",
|
||||||
|
owner.getOwnerName(),
|
||||||
|
owner.getName(),
|
||||||
|
sha))
|
||||||
|
.toIterable(GHBranch[].class, item -> item.wrap(owner));
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* List comments paged iterable.
|
* List comments paged iterable.
|
||||||
*
|
*
|
||||||
@@ -512,6 +558,19 @@ public class GHCommit {
|
|||||||
return owner.getLastCommitStatus(sha);
|
return owner.getLastCommitStatus(sha);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets check-runs for given sha.
|
||||||
|
*
|
||||||
|
* @return check runs for given sha.
|
||||||
|
* @throws IOException
|
||||||
|
* on error
|
||||||
|
*/
|
||||||
|
@Preview(ANTIOPE)
|
||||||
|
@Deprecated
|
||||||
|
public PagedIterable<GHCheckRun> getCheckRuns() throws IOException {
|
||||||
|
return owner.getCheckRuns(sha);
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Some of the fields are not always filled in when this object is retrieved as a part of another API call.
|
* Some of the fields are not always filled in when this object is retrieved as a part of another API call.
|
||||||
*
|
*
|
||||||
|
|||||||
@@ -89,6 +89,19 @@ public class GHCommitBuilder {
|
|||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Configures the PGP signature of this commit.
|
||||||
|
*
|
||||||
|
* @param signature
|
||||||
|
* the signature calculated from the commit
|
||||||
|
*
|
||||||
|
* @return the gh commit builder
|
||||||
|
*/
|
||||||
|
public GHCommitBuilder withSignature(String signature) {
|
||||||
|
req.with("signature", signature);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Configures the committer of this commit.
|
* Configures the committer of this commit.
|
||||||
*
|
*
|
||||||
|
|||||||
@@ -5,7 +5,7 @@ import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
|||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.*;
|
import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* A comment attached to a commit (or a specific line in a specific file of a commit.)
|
* A comment attached to a commit (or a specific line in a specific file of a commit.)
|
||||||
@@ -41,7 +41,7 @@ public class GHCommitComment extends GHObject implements Reactable {
|
|||||||
* show this commit comment in a browser.
|
* show this commit comment in a browser.
|
||||||
*/
|
*/
|
||||||
public URL getHtmlUrl() {
|
public URL getHtmlUrl() {
|
||||||
return GitHub.parseURL(html_url);
|
return GitHubClient.parseURL(html_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -121,7 +121,7 @@ public class GHCommitComment extends GHObject implements Reactable {
|
|||||||
this.body = body;
|
this.body = body;
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHReaction createReaction(ReactionContent content) throws IOException {
|
public GHReaction createReaction(ReactionContent content) throws IOException {
|
||||||
return owner.root.createRequest()
|
return owner.root.createRequest()
|
||||||
@@ -133,7 +133,7 @@ public class GHCommitComment extends GHObject implements Reactable {
|
|||||||
.wrap(owner.root);
|
.wrap(owner.root);
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public PagedIterable<GHReaction> listReactions() {
|
public PagedIterable<GHReaction> listReactions() {
|
||||||
return owner.root.createRequest()
|
return owner.root.createRequest()
|
||||||
@@ -153,7 +153,7 @@ public class GHCommitComment extends GHObject implements Reactable {
|
|||||||
}
|
}
|
||||||
|
|
||||||
private String getApiTail() {
|
private String getApiTail() {
|
||||||
return String.format("/repos/%s/%s/comments/%s", owner.getOwnerName(), owner.getName(), id);
|
return String.format("/repos/%s/%s/comments/%s", owner.getOwnerName(), owner.getName(), getId());
|
||||||
}
|
}
|
||||||
|
|
||||||
GHCommitComment wrap(GHRepository owner) {
|
GHCommitComment wrap(GHRepository owner) {
|
||||||
|
|||||||
@@ -83,7 +83,7 @@ public class GHCommitQueryBuilder {
|
|||||||
* @return the gh commit query builder
|
* @return the gh commit query builder
|
||||||
*/
|
*/
|
||||||
public GHCommitQueryBuilder since(Date dt) {
|
public GHCommitQueryBuilder since(Date dt) {
|
||||||
req.with("since", GitHub.printDate(dt));
|
req.with("since", GitHubClient.printDate(dt));
|
||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -106,7 +106,7 @@ public class GHCommitQueryBuilder {
|
|||||||
* @return the gh commit query builder
|
* @return the gh commit query builder
|
||||||
*/
|
*/
|
||||||
public GHCommitQueryBuilder until(Date dt) {
|
public GHCommitQueryBuilder until(Date dt) {
|
||||||
req.with("until", GitHub.printDate(dt));
|
req.with("until", GitHubClient.printDate(dt));
|
||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
@@ -1,6 +1,7 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
import org.apache.commons.lang3.StringUtils;
|
import org.apache.commons.lang3.StringUtils;
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
|
|
||||||
@@ -10,7 +11,7 @@ import java.io.IOException;
|
|||||||
* @author Marc de Verdelhan
|
* @author Marc de Verdelhan
|
||||||
* @see GitHub#searchCommits() GitHub#searchCommits()
|
* @see GitHub#searchCommits() GitHub#searchCommits()
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(Previews.CLOAK)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public class GHCommitSearchBuilder extends GHSearchBuilder<GHCommit> {
|
public class GHCommitSearchBuilder extends GHSearchBuilder<GHCommit> {
|
||||||
GHCommitSearchBuilder(GitHub root) {
|
GHCommitSearchBuilder(GitHub root) {
|
||||||
@@ -259,7 +260,7 @@ public class GHCommitSearchBuilder extends GHSearchBuilder<GHCommit> {
|
|||||||
if (StringUtils.isBlank(commitUrl)) {
|
if (StringUtils.isBlank(commitUrl)) {
|
||||||
return null;
|
return null;
|
||||||
}
|
}
|
||||||
int indexOfUsername = (GitHub.GITHUB_URL + "/repos/").length();
|
int indexOfUsername = (GitHubClient.GITHUB_URL + "/repos/").length();
|
||||||
String[] tokens = commitUrl.substring(indexOfUsername).split("/", 3);
|
String[] tokens = commitUrl.substring(indexOfUsername).split("/", 3);
|
||||||
return tokens[0] + '/' + tokens[1];
|
return tokens[0] + '/' + tokens[1];
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -18,8 +18,6 @@ public class GHCommitStatus extends GHObject {
|
|||||||
String context;
|
String context;
|
||||||
GHUser creator;
|
GHUser creator;
|
||||||
|
|
||||||
private GitHub root;
|
|
||||||
|
|
||||||
GHCommitStatus wrapUp(GitHub root) {
|
GHCommitStatus wrapUp(GitHub root) {
|
||||||
if (creator != null)
|
if (creator != null)
|
||||||
creator.wrapUp(root);
|
creator.wrapUp(root);
|
||||||
|
|||||||
@@ -27,7 +27,7 @@ public class GHCompare {
|
|||||||
* @return the url
|
* @return the url
|
||||||
*/
|
*/
|
||||||
public URL getUrl() {
|
public URL getUrl() {
|
||||||
return GitHub.parseURL(url);
|
return GitHubClient.parseURL(url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -36,7 +36,7 @@ public class GHCompare {
|
|||||||
* @return the html url
|
* @return the html url
|
||||||
*/
|
*/
|
||||||
public URL getHtmlUrl() {
|
public URL getHtmlUrl() {
|
||||||
return GitHub.parseURL(html_url);
|
return GitHubClient.parseURL(html_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -45,7 +45,7 @@ public class GHCompare {
|
|||||||
* @return the permalink url
|
* @return the permalink url
|
||||||
*/
|
*/
|
||||||
public URL getPermalinkUrl() {
|
public URL getPermalinkUrl() {
|
||||||
return GitHub.parseURL(permalink_url);
|
return GitHubClient.parseURL(permalink_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -54,7 +54,7 @@ public class GHCompare {
|
|||||||
* @return the diff url
|
* @return the diff url
|
||||||
*/
|
*/
|
||||||
public URL getDiffUrl() {
|
public URL getDiffUrl() {
|
||||||
return GitHub.parseURL(diff_url);
|
return GitHubClient.parseURL(diff_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -63,7 +63,7 @@ public class GHCompare {
|
|||||||
* @return the patch url
|
* @return the patch url
|
||||||
*/
|
*/
|
||||||
public URL getPatchUrl() {
|
public URL getPatchUrl() {
|
||||||
return GitHub.parseURL(patch_url);
|
return GitHubClient.parseURL(patch_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|||||||
@@ -15,21 +15,20 @@ import java.util.Base64;
|
|||||||
* @see GHRepository#getFileContent(String) GHRepository#getFileContent(String)
|
* @see GHRepository#getFileContent(String) GHRepository#getFileContent(String)
|
||||||
*/
|
*/
|
||||||
@SuppressWarnings({ "UnusedDeclaration" })
|
@SuppressWarnings({ "UnusedDeclaration" })
|
||||||
public class GHContent implements Refreshable {
|
public class GHContent extends GitHubInteractiveObject implements Refreshable {
|
||||||
/*
|
/*
|
||||||
* In normal use of this class, repository field is set via wrap(), but in the code search API, there's a nested
|
* In normal use of this class, repository field is set via wrap(), but in the code search API, there's a nested
|
||||||
* 'repository' field that gets populated from JSON.
|
* 'repository' field that gets populated from JSON.
|
||||||
*/
|
*/
|
||||||
private GHRepository repository;
|
private GHRepository repository;
|
||||||
|
|
||||||
private GitHub root;
|
|
||||||
|
|
||||||
private String type;
|
private String type;
|
||||||
private String encoding;
|
private String encoding;
|
||||||
private long size;
|
private long size;
|
||||||
private String sha;
|
private String sha;
|
||||||
private String name;
|
private String name;
|
||||||
private String path;
|
private String path;
|
||||||
|
private String target;
|
||||||
private String content;
|
private String content;
|
||||||
private String url; // this is the API url
|
private String url; // this is the API url
|
||||||
private String git_url; // this is the Blob url
|
private String git_url; // this is the Blob url
|
||||||
@@ -99,6 +98,15 @@ public class GHContent implements Refreshable {
|
|||||||
return path;
|
return path;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets target of a symlink. This will only be set if {@code "symlink".equals(getType())}
|
||||||
|
*
|
||||||
|
* @return the target
|
||||||
|
*/
|
||||||
|
public String getTarget() {
|
||||||
|
return target;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Retrieve the decoded content that is stored at this location.
|
* Retrieve the decoded content that is stored at this location.
|
||||||
*
|
*
|
||||||
@@ -388,22 +396,6 @@ public class GHContent implements Refreshable {
|
|||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
|
||||||
* Wrap gh content [ ].
|
|
||||||
*
|
|
||||||
* @param contents
|
|
||||||
* the contents
|
|
||||||
* @param repository
|
|
||||||
* the repository
|
|
||||||
* @return the gh content [ ]
|
|
||||||
*/
|
|
||||||
public static GHContent[] wrap(GHContent[] contents, GHRepository repository) {
|
|
||||||
for (GHContent unwrappedContent : contents) {
|
|
||||||
unwrappedContent.wrap(repository);
|
|
||||||
}
|
|
||||||
return contents;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Fully populate the data by retrieving missing data.
|
* Fully populate the data by retrieving missing data.
|
||||||
*
|
*
|
||||||
|
|||||||
@@ -1,154 +1,25 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
|
||||||
|
import static org.kohsuke.github.internal.Previews.BAPTISTE;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a repository
|
* Creates a repository
|
||||||
*
|
*
|
||||||
* @author Kohsuke Kawaguchi
|
* @author Kohsuke Kawaguchi
|
||||||
*/
|
*/
|
||||||
public class GHCreateRepositoryBuilder {
|
public class GHCreateRepositoryBuilder extends GHRepositoryBuilder<GHCreateRepositoryBuilder> {
|
||||||
private final GitHub root;
|
|
||||||
protected final Requester builder;
|
|
||||||
private final String apiUrlTail;
|
|
||||||
|
|
||||||
GHCreateRepositoryBuilder(GitHub root, String apiUrlTail, String name) {
|
public GHCreateRepositoryBuilder(String name, GitHub root, String apiTail) {
|
||||||
this.root = root;
|
super(GHCreateRepositoryBuilder.class, root, null);
|
||||||
this.apiUrlTail = apiUrlTail;
|
requester.method("POST").withUrlPath(apiTail);
|
||||||
this.builder = root.createRequest();
|
|
||||||
this.builder.with("name", name);
|
try {
|
||||||
|
name(name);
|
||||||
|
} catch (IOException e) {
|
||||||
|
// not going to happen here
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
|
||||||
* Description for repository
|
|
||||||
*
|
|
||||||
* @param description
|
|
||||||
* description of repository
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder description(String description) {
|
|
||||||
this.builder.with("description", description);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Homepage for repository
|
|
||||||
*
|
|
||||||
* @param homepage
|
|
||||||
* homepage of repository
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder homepage(URL homepage) {
|
|
||||||
return homepage(homepage.toExternalForm());
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Homepage for repository
|
|
||||||
*
|
|
||||||
* @param homepage
|
|
||||||
* homepage of repository
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder homepage(String homepage) {
|
|
||||||
this.builder.with("homepage", homepage);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Creates a private repository
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* private if true
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder private_(boolean enabled) {
|
|
||||||
this.builder.with("private", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Enables issue tracker
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* true if enabled
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder issues(boolean enabled) {
|
|
||||||
this.builder.with("has_issues", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Enables wiki
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* true if enabled
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder wiki(boolean enabled) {
|
|
||||||
this.builder.with("has_wiki", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Enables downloads
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* true if enabled
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder downloads(boolean enabled) {
|
|
||||||
this.builder.with("has_downloads", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* If true, create an initial commit with empty README.
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* true if enabled
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder autoInit(boolean enabled) {
|
|
||||||
this.builder.with("auto_init", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Allow or disallow squash-merging pull requests.
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* true if enabled
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder allowSquashMerge(boolean enabled) {
|
|
||||||
this.builder.with("allow_squash_merge", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Allow or disallow merging pull requests with a merge commit.
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* true if enabled
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder allowMergeCommit(boolean enabled) {
|
|
||||||
this.builder.with("allow_merge_commit", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Allow or disallow rebase-merging pull requests.
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* true if enabled
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder allowRebaseMerge(boolean enabled) {
|
|
||||||
this.builder.with("allow_rebase_merge", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -157,10 +28,11 @@ public class GHCreateRepositoryBuilder {
|
|||||||
* @param language
|
* @param language
|
||||||
* template to base the ignore file on
|
* template to base the ignore file on
|
||||||
* @return a builder to continue with building See https://developer.github.com/v3/repos/#create
|
* @return a builder to continue with building See https://developer.github.com/v3/repos/#create
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
*/
|
*/
|
||||||
public GHCreateRepositoryBuilder gitignoreTemplate(String language) {
|
public GHCreateRepositoryBuilder gitignoreTemplate(String language) throws IOException {
|
||||||
this.builder.with("gitignore_template", language);
|
return with("gitignore_template", language);
|
||||||
return this;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -169,10 +41,24 @@ public class GHCreateRepositoryBuilder {
|
|||||||
* @param license
|
* @param license
|
||||||
* template to base the license file on
|
* template to base the license file on
|
||||||
* @return a builder to continue with building See https://developer.github.com/v3/repos/#create
|
* @return a builder to continue with building See https://developer.github.com/v3/repos/#create
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
*/
|
*/
|
||||||
public GHCreateRepositoryBuilder licenseTemplate(String license) {
|
public GHCreateRepositoryBuilder licenseTemplate(String license) throws IOException {
|
||||||
this.builder.with("license_template", license);
|
return with("license_template", license);
|
||||||
return this;
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* If true, create an initial commit with empty README.
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
* @return a builder to continue with building
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public GHCreateRepositoryBuilder autoInit(boolean enabled) throws IOException {
|
||||||
|
return with("auto_init", enabled);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -181,10 +67,57 @@ public class GHCreateRepositoryBuilder {
|
|||||||
* @param team
|
* @param team
|
||||||
* team to grant access to
|
* team to grant access to
|
||||||
* @return a builder to continue with building
|
* @return a builder to continue with building
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
*/
|
*/
|
||||||
public GHCreateRepositoryBuilder team(GHTeam team) {
|
public GHCreateRepositoryBuilder team(GHTeam team) throws IOException {
|
||||||
if (team != null)
|
if (team != null)
|
||||||
this.builder.with("team_id", team.getId());
|
return with("team_id", team.getId());
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Specifies whether the repository is a template.
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
* @return a builder to continue with building
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
* @deprecated Use {@link #isTemplate(boolean)} method instead
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
public GHCreateRepositoryBuilder templateRepository(boolean enabled) throws IOException {
|
||||||
|
return isTemplate(enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Specifies the ownership of the repository.
|
||||||
|
*
|
||||||
|
* @param owner
|
||||||
|
* organization or personage
|
||||||
|
* @return a builder to continue with building
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public GHCreateRepositoryBuilder owner(String owner) throws IOException {
|
||||||
|
return with("owner", owner);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Create repository from template repository
|
||||||
|
*
|
||||||
|
* @param templateOwner
|
||||||
|
* template repository owner
|
||||||
|
* @param templateRepo
|
||||||
|
* template repository
|
||||||
|
* @return a builder to continue with building
|
||||||
|
* @see <a href="https://developer.github.com/v3/previews/">GitHub API Previews</a>
|
||||||
|
*/
|
||||||
|
@Preview(BAPTISTE)
|
||||||
|
@Deprecated
|
||||||
|
public GHCreateRepositoryBuilder fromTemplateRepository(String templateOwner, String templateRepo) {
|
||||||
|
requester.withPreview(BAPTISTE).withUrlPath("/repos/" + templateOwner + "/" + templateRepo + "/generate");
|
||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -193,10 +126,9 @@ public class GHCreateRepositoryBuilder {
|
|||||||
*
|
*
|
||||||
* @return the gh repository
|
* @return the gh repository
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* if repsitory cannot be created
|
* if repository cannot be created
|
||||||
*/
|
*/
|
||||||
public GHRepository create() throws IOException {
|
public GHRepository create() throws IOException {
|
||||||
return builder.method("POST").withUrlPath(apiUrlTail).fetch(GHRepository.class).wrap(root);
|
return done();
|
||||||
}
|
}
|
||||||
|
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -1,7 +1,10 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
|
import java.util.Map;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Represents a deployment
|
* Represents a deployment
|
||||||
@@ -13,7 +16,6 @@ import java.net.URL;
|
|||||||
*/
|
*/
|
||||||
public class GHDeployment extends GHObject {
|
public class GHDeployment extends GHObject {
|
||||||
private GHRepository owner;
|
private GHRepository owner;
|
||||||
private GitHub root;
|
|
||||||
protected String sha;
|
protected String sha;
|
||||||
protected String ref;
|
protected String ref;
|
||||||
protected String task;
|
protected String task;
|
||||||
@@ -23,6 +25,9 @@ public class GHDeployment extends GHObject {
|
|||||||
protected String statuses_url;
|
protected String statuses_url;
|
||||||
protected String repository_url;
|
protected String repository_url;
|
||||||
protected GHUser creator;
|
protected GHUser creator;
|
||||||
|
protected String original_environment;
|
||||||
|
protected boolean transient_environment;
|
||||||
|
protected boolean production_environment;
|
||||||
|
|
||||||
GHDeployment wrap(GHRepository owner) {
|
GHDeployment wrap(GHRepository owner) {
|
||||||
this.owner = owner;
|
this.owner = owner;
|
||||||
@@ -38,7 +43,7 @@ public class GHDeployment extends GHObject {
|
|||||||
* @return the statuses url
|
* @return the statuses url
|
||||||
*/
|
*/
|
||||||
public URL getStatusesUrl() {
|
public URL getStatusesUrl() {
|
||||||
return GitHub.parseURL(statuses_url);
|
return GitHubClient.parseURL(statuses_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -47,7 +52,7 @@ public class GHDeployment extends GHObject {
|
|||||||
* @return the repository url
|
* @return the repository url
|
||||||
*/
|
*/
|
||||||
public URL getRepositoryUrl() {
|
public URL getRepositoryUrl() {
|
||||||
return GitHub.parseURL(repository_url);
|
return GitHubClient.parseURL(repository_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -60,7 +65,8 @@ public class GHDeployment extends GHObject {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets payload.
|
* Gets payload. <b>NOTE:</b> only use this method if you can guarantee the payload will be a simple string,
|
||||||
|
* otherwise use {@link #getPayloadObject()}.
|
||||||
*
|
*
|
||||||
* @return the payload
|
* @return the payload
|
||||||
*/
|
*/
|
||||||
@@ -68,6 +74,38 @@ public class GHDeployment extends GHObject {
|
|||||||
return (String) payload;
|
return (String) payload;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets payload. <b>NOTE:</b> only use this method if you can guarantee the payload will be a JSON object (Map),
|
||||||
|
* otherwise use {@link #getPayloadObject()}.
|
||||||
|
*
|
||||||
|
* @return the payload
|
||||||
|
*/
|
||||||
|
public Map<String, Object> getPayloadMap() {
|
||||||
|
return (Map<String, Object>) payload;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets payload without assuming its type. It could be a String or a Map.
|
||||||
|
*
|
||||||
|
* @return the payload
|
||||||
|
*/
|
||||||
|
public Object getPayloadObject() {
|
||||||
|
return payload;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The environment defined when the deployment was first created.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @return the original deployment environment
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.FLASH)
|
||||||
|
public String getOriginalEnvironment() {
|
||||||
|
return original_environment;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets environment.
|
* Gets environment.
|
||||||
*
|
*
|
||||||
@@ -77,6 +115,33 @@ public class GHDeployment extends GHObject {
|
|||||||
return environment;
|
return environment;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Specifies if the given environment is specific to the deployment and will no longer exist at some point in the
|
||||||
|
* future.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @return the environment is transient
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
public boolean isTransientEnvironment() {
|
||||||
|
return transient_environment;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Specifies if the given environment is one that end-users directly interact with.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @return the environment is used by end-users directly
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
public boolean isProductionEnvironment() {
|
||||||
|
return production_environment;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets creator.
|
* Gets creator.
|
||||||
*
|
*
|
||||||
@@ -122,7 +187,7 @@ public class GHDeployment extends GHObject {
|
|||||||
* @return the gh deployment status builder
|
* @return the gh deployment status builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentStatusBuilder createStatus(GHDeploymentState state) {
|
public GHDeploymentStatusBuilder createStatus(GHDeploymentState state) {
|
||||||
return new GHDeploymentStatusBuilder(owner, id, state);
|
return new GHDeploymentStatusBuilder(owner, getId(), state);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -133,6 +198,8 @@ public class GHDeployment extends GHObject {
|
|||||||
public PagedIterable<GHDeploymentStatus> listStatuses() {
|
public PagedIterable<GHDeploymentStatus> listStatuses() {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
.withUrlPath(statuses_url)
|
.withUrlPath(statuses_url)
|
||||||
|
.withPreview(Previews.ANT_MAN)
|
||||||
|
.withPreview(Previews.FLASH)
|
||||||
.toIterable(GHDeploymentStatus[].class, item -> item.wrap(owner));
|
.toIterable(GHDeploymentStatus[].class, item -> item.wrap(owner));
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
@@ -1,5 +1,7 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
|
|
||||||
@@ -19,7 +21,10 @@ public class GHDeploymentBuilder {
|
|||||||
*/
|
*/
|
||||||
public GHDeploymentBuilder(GHRepository repo) {
|
public GHDeploymentBuilder(GHRepository repo) {
|
||||||
this.repo = repo;
|
this.repo = repo;
|
||||||
this.builder = repo.root.createRequest().method("POST");
|
this.builder = repo.root.createRequest()
|
||||||
|
.withPreview(Previews.ANT_MAN)
|
||||||
|
.withPreview(Previews.FLASH)
|
||||||
|
.method("POST");
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -40,6 +45,7 @@ public class GHDeploymentBuilder {
|
|||||||
*
|
*
|
||||||
* @param branch
|
* @param branch
|
||||||
* the branch
|
* the branch
|
||||||
|
*
|
||||||
* @return the gh deployment builder
|
* @return the gh deployment builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentBuilder ref(String branch) {
|
public GHDeploymentBuilder ref(String branch) {
|
||||||
@@ -52,6 +58,7 @@ public class GHDeploymentBuilder {
|
|||||||
*
|
*
|
||||||
* @param task
|
* @param task
|
||||||
* the task
|
* the task
|
||||||
|
*
|
||||||
* @return the gh deployment builder
|
* @return the gh deployment builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentBuilder task(String task) {
|
public GHDeploymentBuilder task(String task) {
|
||||||
@@ -64,6 +71,7 @@ public class GHDeploymentBuilder {
|
|||||||
*
|
*
|
||||||
* @param autoMerge
|
* @param autoMerge
|
||||||
* the auto merge
|
* the auto merge
|
||||||
|
*
|
||||||
* @return the gh deployment builder
|
* @return the gh deployment builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentBuilder autoMerge(boolean autoMerge) {
|
public GHDeploymentBuilder autoMerge(boolean autoMerge) {
|
||||||
@@ -76,6 +84,7 @@ public class GHDeploymentBuilder {
|
|||||||
*
|
*
|
||||||
* @param requiredContexts
|
* @param requiredContexts
|
||||||
* the required contexts
|
* the required contexts
|
||||||
|
*
|
||||||
* @return the gh deployment builder
|
* @return the gh deployment builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentBuilder requiredContexts(List<String> requiredContexts) {
|
public GHDeploymentBuilder requiredContexts(List<String> requiredContexts) {
|
||||||
@@ -88,6 +97,7 @@ public class GHDeploymentBuilder {
|
|||||||
*
|
*
|
||||||
* @param payload
|
* @param payload
|
||||||
* the payload
|
* the payload
|
||||||
|
*
|
||||||
* @return the gh deployment builder
|
* @return the gh deployment builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentBuilder payload(String payload) {
|
public GHDeploymentBuilder payload(String payload) {
|
||||||
@@ -100,6 +110,7 @@ public class GHDeploymentBuilder {
|
|||||||
*
|
*
|
||||||
* @param environment
|
* @param environment
|
||||||
* the environment
|
* the environment
|
||||||
|
*
|
||||||
* @return the gh deployment builder
|
* @return the gh deployment builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentBuilder environment(String environment) {
|
public GHDeploymentBuilder environment(String environment) {
|
||||||
@@ -107,11 +118,47 @@ public class GHDeploymentBuilder {
|
|||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Specifies if the given environment is specific to the deployment and will no longer exist at some point in the
|
||||||
|
* future.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @param transientEnvironment
|
||||||
|
* the environment is transient
|
||||||
|
*
|
||||||
|
* @return the gh deployment builder
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
public GHDeploymentBuilder transientEnvironment(boolean transientEnvironment) {
|
||||||
|
builder.with("transient_environment", transientEnvironment);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Specifies if the given environment is one that end-users directly interact with.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @param productionEnvironment
|
||||||
|
* the environment is used by end-users directly
|
||||||
|
*
|
||||||
|
* @return the gh deployment builder
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
public GHDeploymentBuilder productionEnvironment(boolean productionEnvironment) {
|
||||||
|
builder.with("production_environment", productionEnvironment);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Description gh deployment builder.
|
* Description gh deployment builder.
|
||||||
*
|
*
|
||||||
* @param description
|
* @param description
|
||||||
* the description
|
* the description
|
||||||
|
*
|
||||||
* @return the gh deployment builder
|
* @return the gh deployment builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentBuilder description(String description) {
|
public GHDeploymentBuilder description(String description) {
|
||||||
@@ -123,6 +170,7 @@ public class GHDeploymentBuilder {
|
|||||||
* Create gh deployment.
|
* Create gh deployment.
|
||||||
*
|
*
|
||||||
* @return the gh deployment
|
* @return the gh deployment
|
||||||
|
*
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
|
|||||||
@@ -1,8 +1,40 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Represents the state of deployment
|
* Represents the state of deployment
|
||||||
*/
|
*/
|
||||||
public enum GHDeploymentState {
|
public enum GHDeploymentState {
|
||||||
PENDING, SUCCESS, ERROR, FAILURE
|
PENDING,
|
||||||
|
SUCCESS,
|
||||||
|
ERROR,
|
||||||
|
FAILURE,
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The state of the deployment currently reflects it's in progress.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.FLASH)
|
||||||
|
IN_PROGRESS,
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The state of the deployment currently reflects it's queued up for processing.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.FLASH)
|
||||||
|
QUEUED,
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The state of the deployment currently reflects it's no longer active.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
INACTIVE
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -1,5 +1,7 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
import java.util.Locale;
|
import java.util.Locale;
|
||||||
|
|
||||||
@@ -8,19 +10,21 @@ import java.util.Locale;
|
|||||||
*/
|
*/
|
||||||
public class GHDeploymentStatus extends GHObject {
|
public class GHDeploymentStatus extends GHObject {
|
||||||
private GHRepository owner;
|
private GHRepository owner;
|
||||||
private GitHub root;
|
|
||||||
protected GHUser creator;
|
protected GHUser creator;
|
||||||
protected String state;
|
protected String state;
|
||||||
protected String description;
|
protected String description;
|
||||||
protected String target_url;
|
protected String target_url;
|
||||||
|
protected String log_url;
|
||||||
protected String deployment_url;
|
protected String deployment_url;
|
||||||
protected String repository_url;
|
protected String repository_url;
|
||||||
|
protected String environment_url;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Wrap gh deployment status.
|
* Wrap gh deployment status.
|
||||||
*
|
*
|
||||||
* @param owner
|
* @param owner
|
||||||
* the owner
|
* the owner
|
||||||
|
*
|
||||||
* @return the gh deployment status
|
* @return the gh deployment status
|
||||||
*/
|
*/
|
||||||
public GHDeploymentStatus wrap(GHRepository owner) {
|
public GHDeploymentStatus wrap(GHRepository owner) {
|
||||||
@@ -34,10 +38,28 @@ public class GHDeploymentStatus extends GHObject {
|
|||||||
/**
|
/**
|
||||||
* Gets target url.
|
* Gets target url.
|
||||||
*
|
*
|
||||||
|
* @deprecated Target url is deprecated in favor of {@link #getLogUrl() getLogUrl}
|
||||||
|
*
|
||||||
* @return the target url
|
* @return the target url
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public URL getTargetUrl() {
|
public URL getTargetUrl() {
|
||||||
return GitHub.parseURL(target_url);
|
return GitHubClient.parseURL(target_url);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets target url.
|
||||||
|
* <p>
|
||||||
|
* This method replaces {@link #getTargetUrl() getTargetUrl}}.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @return the target url
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
public URL getLogUrl() {
|
||||||
|
return GitHubClient.parseURL(log_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -46,7 +68,20 @@ public class GHDeploymentStatus extends GHObject {
|
|||||||
* @return the deployment url
|
* @return the deployment url
|
||||||
*/
|
*/
|
||||||
public URL getDeploymentUrl() {
|
public URL getDeploymentUrl() {
|
||||||
return GitHub.parseURL(deployment_url);
|
return GitHubClient.parseURL(deployment_url);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets deployment environment url.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @return the deployment environment url
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
public URL getEnvironmentUrl() {
|
||||||
|
return GitHubClient.parseURL(environment_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -55,7 +90,7 @@ public class GHDeploymentStatus extends GHObject {
|
|||||||
* @return the repository url
|
* @return the repository url
|
||||||
*/
|
*/
|
||||||
public URL getRepositoryUrl() {
|
public URL getRepositoryUrl() {
|
||||||
return GitHub.parseURL(repository_url);
|
return GitHubClient.parseURL(repository_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|||||||
@@ -1,5 +1,7 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -21,8 +23,10 @@ public class GHDeploymentStatusBuilder {
|
|||||||
* the deployment id
|
* the deployment id
|
||||||
* @param state
|
* @param state
|
||||||
* the state
|
* the state
|
||||||
|
*
|
||||||
* @deprecated Use {@link GHDeployment#createStatus(GHDeploymentState)}
|
* @deprecated Use {@link GHDeployment#createStatus(GHDeploymentState)}
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public GHDeploymentStatusBuilder(GHRepository repo, int deploymentId, GHDeploymentState state) {
|
public GHDeploymentStatusBuilder(GHRepository repo, int deploymentId, GHDeploymentState state) {
|
||||||
this(repo, (long) deploymentId, state);
|
this(repo, (long) deploymentId, state);
|
||||||
}
|
}
|
||||||
@@ -30,15 +34,38 @@ public class GHDeploymentStatusBuilder {
|
|||||||
GHDeploymentStatusBuilder(GHRepository repo, long deploymentId, GHDeploymentState state) {
|
GHDeploymentStatusBuilder(GHRepository repo, long deploymentId, GHDeploymentState state) {
|
||||||
this.repo = repo;
|
this.repo = repo;
|
||||||
this.deploymentId = deploymentId;
|
this.deploymentId = deploymentId;
|
||||||
this.builder = repo.root.createRequest().method("POST");
|
this.builder = repo.root.createRequest()
|
||||||
|
.withPreview(Previews.ANT_MAN)
|
||||||
|
.withPreview(Previews.FLASH)
|
||||||
|
.method("POST");
|
||||||
|
|
||||||
this.builder.with("state", state);
|
this.builder.with("state", state);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Add an inactive status to all prior non-transient, non-production environment deployments with the same
|
||||||
|
* repository and environment name as the created status's deployment.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @param autoInactive
|
||||||
|
* Add inactive status flag
|
||||||
|
*
|
||||||
|
* @return the gh deployment status builder
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview({ Previews.ANT_MAN, Previews.FLASH })
|
||||||
|
public GHDeploymentStatusBuilder autoInactive(boolean autoInactive) {
|
||||||
|
this.builder.with("auto_inactive", autoInactive);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Description gh deployment status builder.
|
* Description gh deployment status builder.
|
||||||
*
|
*
|
||||||
* @param description
|
* @param description
|
||||||
* the description
|
* the description
|
||||||
|
*
|
||||||
* @return the gh deployment status builder
|
* @return the gh deployment status builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentStatusBuilder description(String description) {
|
public GHDeploymentStatusBuilder description(String description) {
|
||||||
@@ -46,13 +73,70 @@ public class GHDeploymentStatusBuilder {
|
|||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Name for the target deployment environment, which can be changed when setting a deploy status.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @param environment
|
||||||
|
* the environment name
|
||||||
|
*
|
||||||
|
* @return the gh deployment status builder
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.FLASH)
|
||||||
|
public GHDeploymentStatusBuilder environment(String environment) {
|
||||||
|
this.builder.with("environment", environment);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The URL for accessing the environment
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @param environmentUrl
|
||||||
|
* the environment url
|
||||||
|
*
|
||||||
|
* @return the gh deployment status builder
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
public GHDeploymentStatusBuilder environmentUrl(String environmentUrl) {
|
||||||
|
this.builder.with("environment_url", environmentUrl);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The full URL of the deployment's output.
|
||||||
|
* <p>
|
||||||
|
* This method replaces {@link #targetUrl(String) targetUrl}.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @param logUrl
|
||||||
|
* the deployment output url
|
||||||
|
*
|
||||||
|
* @return the gh deployment status builder
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
public GHDeploymentStatusBuilder logUrl(String logUrl) {
|
||||||
|
this.builder.with("log_url", logUrl);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Target url gh deployment status builder.
|
* Target url gh deployment status builder.
|
||||||
*
|
*
|
||||||
|
* @deprecated Target url is deprecated in favor of {@link #logUrl(String) logUrl}
|
||||||
|
*
|
||||||
* @param targetUrl
|
* @param targetUrl
|
||||||
* the target url
|
* the target url
|
||||||
|
*
|
||||||
* @return the gh deployment status builder
|
* @return the gh deployment status builder
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public GHDeploymentStatusBuilder targetUrl(String targetUrl) {
|
public GHDeploymentStatusBuilder targetUrl(String targetUrl) {
|
||||||
this.builder.with("target_url", targetUrl);
|
this.builder.with("target_url", targetUrl);
|
||||||
return this;
|
return this;
|
||||||
@@ -62,6 +146,7 @@ public class GHDeploymentStatusBuilder {
|
|||||||
* Create gh deployment status.
|
* Create gh deployment status.
|
||||||
*
|
*
|
||||||
* @return the gh deployment status
|
* @return the gh deployment status
|
||||||
|
*
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
|
|||||||
230
src/main/java/org/kohsuke/github/GHDiscussion.java
Normal file
230
src/main/java/org/kohsuke/github/GHDiscussion.java
Normal file
@@ -0,0 +1,230 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
|
import java.io.IOException;
|
||||||
|
import java.net.URL;
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
|
import javax.annotation.CheckForNull;
|
||||||
|
import javax.annotation.Nonnull;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A discussion in GitHub Team.
|
||||||
|
*
|
||||||
|
* @author Charles Moulliard
|
||||||
|
* @see <a href="https://developer.github.com/v3/teams/discussions">GitHub Team Discussions</a>
|
||||||
|
*/
|
||||||
|
public class GHDiscussion extends GHObject {
|
||||||
|
|
||||||
|
private GHTeam team;
|
||||||
|
private long number;
|
||||||
|
private String body, title, htmlUrl;
|
||||||
|
|
||||||
|
@JsonProperty(value = "private")
|
||||||
|
private boolean isPrivate;
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public URL getHtmlUrl() throws IOException {
|
||||||
|
return GitHubClient.parseURL(htmlUrl);
|
||||||
|
}
|
||||||
|
|
||||||
|
GHDiscussion wrapUp(GHTeam team) {
|
||||||
|
this.team = team;
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get the team to which this discussion belongs.
|
||||||
|
*
|
||||||
|
* @return the team for this discussion
|
||||||
|
*/
|
||||||
|
@Nonnull
|
||||||
|
public GHTeam getTeam() {
|
||||||
|
return team;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get the title of the discussion.
|
||||||
|
*
|
||||||
|
* @return the title
|
||||||
|
*/
|
||||||
|
public String getTitle() {
|
||||||
|
return title;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The description of this discussion.
|
||||||
|
*
|
||||||
|
* @return the body
|
||||||
|
*/
|
||||||
|
public String getBody() {
|
||||||
|
return body;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The number of this discussion.
|
||||||
|
*
|
||||||
|
* @return the number
|
||||||
|
*/
|
||||||
|
public long getNumber() {
|
||||||
|
return number;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The id number of this discussion. GitHub discussions have "number" instead of "id". This is provided for
|
||||||
|
* convenience.
|
||||||
|
*
|
||||||
|
* @return the id number for this discussion
|
||||||
|
* @see #getNumber()
|
||||||
|
*/
|
||||||
|
@Override
|
||||||
|
public long getId() {
|
||||||
|
return getNumber();
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Whether the discussion is private to the team.
|
||||||
|
*
|
||||||
|
* @return {@code true} if discussion is private.
|
||||||
|
*/
|
||||||
|
public boolean isPrivate() {
|
||||||
|
return isPrivate;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Begins the creation of a new instance.
|
||||||
|
*
|
||||||
|
* Consumer must call {@link GHDiscussion.Creator#done()} to commit changes.
|
||||||
|
*
|
||||||
|
* @param team
|
||||||
|
* the team in which the discussion will be created.
|
||||||
|
* @return a {@link GHLabel.Creator}
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
static GHDiscussion.Creator create(GHTeam team) throws IOException {
|
||||||
|
return new GHDiscussion.Creator(team);
|
||||||
|
}
|
||||||
|
|
||||||
|
static GHDiscussion read(GHTeam team, long discussionNumber) throws IOException {
|
||||||
|
return team.root.createRequest()
|
||||||
|
.setRawUrlPath(getRawUrlPath(team, discussionNumber))
|
||||||
|
.fetch(GHDiscussion.class)
|
||||||
|
.wrapUp(team);
|
||||||
|
}
|
||||||
|
|
||||||
|
static PagedIterable<GHDiscussion> readAll(GHTeam team) throws IOException {
|
||||||
|
return team.root.createRequest()
|
||||||
|
.setRawUrlPath(getRawUrlPath(team, null))
|
||||||
|
.toIterable(GHDiscussion[].class, item -> item.wrapUp(team));
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Begins a batch update
|
||||||
|
*
|
||||||
|
* Consumer must call {@link GHDiscussion.Updater#done()} to commit changes.
|
||||||
|
*
|
||||||
|
* @return a {@link GHDiscussion.Updater}
|
||||||
|
*/
|
||||||
|
@Preview(Previews.SQUIRREL_GIRL)
|
||||||
|
@Deprecated
|
||||||
|
public GHDiscussion.Updater update() {
|
||||||
|
return new GHDiscussion.Updater(this);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Begins a single property update.
|
||||||
|
*
|
||||||
|
* @return a {@link GHDiscussion.Setter}
|
||||||
|
*/
|
||||||
|
@Preview(Previews.SQUIRREL_GIRL)
|
||||||
|
@Deprecated
|
||||||
|
public GHDiscussion.Setter set() {
|
||||||
|
return new GHDiscussion.Setter(this);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Delete the discussion
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public void delete() throws IOException {
|
||||||
|
team.root.createRequest().method("DELETE").setRawUrlPath(getRawUrlPath(team, number)).send();
|
||||||
|
}
|
||||||
|
|
||||||
|
private static String getRawUrlPath(@Nonnull GHTeam team, @CheckForNull Long discussionNumber) {
|
||||||
|
return team.getUrl().toString() + "/discussions" + (discussionNumber == null ? "" : "/" + discussionNumber);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A {@link GHLabelBuilder} that updates a single property per request
|
||||||
|
*
|
||||||
|
* {@link #done()} is called automatically after the property is set.
|
||||||
|
*/
|
||||||
|
public static class Setter extends GHDiscussionBuilder<GHDiscussion> {
|
||||||
|
private Setter(@Nonnull GHDiscussion base) {
|
||||||
|
super(GHDiscussion.class, base.team, base);
|
||||||
|
requester.method("PATCH").setRawUrlPath(base.getUrl().toString());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A {@link GHLabelBuilder} that allows multiple properties to be updated per request.
|
||||||
|
*
|
||||||
|
* Consumer must call {@link #done()} to commit changes.
|
||||||
|
*/
|
||||||
|
public static class Updater extends GHDiscussionBuilder<Updater> {
|
||||||
|
private Updater(@Nonnull GHDiscussion base) {
|
||||||
|
super(GHDiscussion.Updater.class, base.team, base);
|
||||||
|
requester.method("PATCH").setRawUrlPath(base.getUrl().toString());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A {@link GHLabelBuilder} that creates a new {@link GHLabel}
|
||||||
|
*
|
||||||
|
* Consumer must call {@link #done()} to create the new instance.
|
||||||
|
*/
|
||||||
|
public static class Creator extends GHDiscussionBuilder<Creator> {
|
||||||
|
|
||||||
|
private Creator(@Nonnull GHTeam team) {
|
||||||
|
super(GHDiscussion.Creator.class, team, null);
|
||||||
|
requester.method("POST").setRawUrlPath(getRawUrlPath(team, null));
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Sets whether this discussion is private to this team.
|
||||||
|
*
|
||||||
|
* @param value
|
||||||
|
* privacy of this discussion
|
||||||
|
* @return either a continuing builder or an updated {@link GHDiscussion}
|
||||||
|
* @throws IOException
|
||||||
|
* if there is an I/O Exception
|
||||||
|
*/
|
||||||
|
@Nonnull
|
||||||
|
public Creator private_(boolean value) throws IOException {
|
||||||
|
return with("private", value);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean equals(Object o) {
|
||||||
|
if (this == o) {
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
if (o == null || getClass() != o.getClass()) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
GHDiscussion that = (GHDiscussion) o;
|
||||||
|
return number == that.number && Objects.equals(getUrl(), that.getUrl()) && Objects.equals(team, that.team)
|
||||||
|
&& Objects.equals(body, that.body) && Objects.equals(title, that.title);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int hashCode() {
|
||||||
|
return Objects.hash(team, number, body, title);
|
||||||
|
}
|
||||||
|
}
|
||||||
80
src/main/java/org/kohsuke/github/GHDiscussionBuilder.java
Normal file
80
src/main/java/org/kohsuke/github/GHDiscussionBuilder.java
Normal file
@@ -0,0 +1,80 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import java.io.IOException;
|
||||||
|
|
||||||
|
import javax.annotation.CheckForNull;
|
||||||
|
import javax.annotation.Nonnull;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Base class for creating or updating a discussion.
|
||||||
|
*
|
||||||
|
* @param <S>
|
||||||
|
* Intermediate return type for this builder returned by calls to {@link #with(String, Object)}. If {@link S}
|
||||||
|
* the same as {@link GHLabel}, this builder will commit changes after each call to
|
||||||
|
* {@link #with(String, Object)}.
|
||||||
|
*/
|
||||||
|
class GHDiscussionBuilder<S> extends AbstractBuilder<GHDiscussion, S> {
|
||||||
|
|
||||||
|
private final GHTeam team;
|
||||||
|
|
||||||
|
/**
|
||||||
|
*
|
||||||
|
* @param intermediateReturnType
|
||||||
|
* Intermediate return type for this builder returned by calls to {@link #with(String, Object)}. If
|
||||||
|
* {@link S} the same as {@link GHDiscussion}, this builder will commit changes after each call to
|
||||||
|
* {@link #with(String, Object)}.
|
||||||
|
* @param team
|
||||||
|
* the GitHub team. Updates will be sent to the root of this team.
|
||||||
|
* @param baseInstance
|
||||||
|
* instance on which to base this builder. If {@code null} a new instance will be created.
|
||||||
|
*/
|
||||||
|
protected GHDiscussionBuilder(@Nonnull Class<S> intermediateReturnType,
|
||||||
|
@Nonnull GHTeam team,
|
||||||
|
@CheckForNull GHDiscussion baseInstance) {
|
||||||
|
super(GHDiscussion.class, intermediateReturnType, team.root, baseInstance);
|
||||||
|
|
||||||
|
this.team = team;
|
||||||
|
|
||||||
|
if (baseInstance != null) {
|
||||||
|
requester.with("title", baseInstance.getTitle());
|
||||||
|
requester.with("body", baseInstance.getBody());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Title for this discussion.
|
||||||
|
*
|
||||||
|
* @param value
|
||||||
|
* title of discussion
|
||||||
|
* @return either a continuing builder or an updated {@link GHDiscussion}
|
||||||
|
* @throws IOException
|
||||||
|
* if there is an I/O Exception
|
||||||
|
*/
|
||||||
|
@Nonnull
|
||||||
|
public S title(String value) throws IOException {
|
||||||
|
return with("title", value);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Body content for this discussion.
|
||||||
|
*
|
||||||
|
* @param value
|
||||||
|
* body of discussion*
|
||||||
|
* @return either a continuing builder or an updated {@link GHDiscussion}
|
||||||
|
* @throws IOException
|
||||||
|
* if there is an I/O Exception
|
||||||
|
*/
|
||||||
|
@Nonnull
|
||||||
|
public S body(String value) throws IOException {
|
||||||
|
return with("body", value);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* {@inheritDoc}
|
||||||
|
*/
|
||||||
|
@Nonnull
|
||||||
|
@Override
|
||||||
|
public GHDiscussion done() throws IOException {
|
||||||
|
return super.done().wrapUp(team);
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -12,6 +12,7 @@ import java.util.Locale;
|
|||||||
public enum GHEvent {
|
public enum GHEvent {
|
||||||
CHECK_RUN,
|
CHECK_RUN,
|
||||||
CHECK_SUITE,
|
CHECK_SUITE,
|
||||||
|
CODE_SCANNING_ALERT,
|
||||||
COMMIT_COMMENT,
|
COMMIT_COMMENT,
|
||||||
CONTENT_REFERENCE,
|
CONTENT_REFERENCE,
|
||||||
CREATE,
|
CREATE,
|
||||||
@@ -50,6 +51,7 @@ public enum GHEvent {
|
|||||||
PULL_REQUEST_REVIEW,
|
PULL_REQUEST_REVIEW,
|
||||||
PULL_REQUEST_REVIEW_COMMENT,
|
PULL_REQUEST_REVIEW_COMMENT,
|
||||||
PUSH,
|
PUSH,
|
||||||
|
REGISTRY_PACKAGE,
|
||||||
RELEASE,
|
RELEASE,
|
||||||
REPOSITORY_DISPATCH, // only valid for org hooks
|
REPOSITORY_DISPATCH, // only valid for org hooks
|
||||||
REPOSITORY,
|
REPOSITORY,
|
||||||
@@ -61,6 +63,8 @@ public enum GHEvent {
|
|||||||
TEAM,
|
TEAM,
|
||||||
TEAM_ADD,
|
TEAM_ADD,
|
||||||
WATCH,
|
WATCH,
|
||||||
|
WORKFLOW_DISPATCH,
|
||||||
|
WORKFLOW_RUN,
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Special event type that means "every possible event"
|
* Special event type that means "every possible event"
|
||||||
|
|||||||
@@ -12,9 +12,7 @@ import java.util.Date;
|
|||||||
* @author Kohsuke Kawaguchi
|
* @author Kohsuke Kawaguchi
|
||||||
*/
|
*/
|
||||||
@SuppressFBWarnings(value = "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", justification = "JSON API")
|
@SuppressFBWarnings(value = "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", justification = "JSON API")
|
||||||
public class GHEventInfo {
|
public class GHEventInfo extends GitHubInteractiveObject {
|
||||||
private GitHub root;
|
|
||||||
|
|
||||||
// we don't want to expose Jackson dependency to the user. This needs databinding
|
// we don't want to expose Jackson dependency to the user. This needs databinding
|
||||||
private ObjectNode payload;
|
private ObjectNode payload;
|
||||||
|
|
||||||
@@ -78,7 +76,7 @@ public class GHEventInfo {
|
|||||||
* @return the created at
|
* @return the created at
|
||||||
*/
|
*/
|
||||||
public Date getCreatedAt() {
|
public Date getCreatedAt() {
|
||||||
return GitHub.parseDate(created_at);
|
return GitHubClient.parseDate(created_at);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -144,7 +142,7 @@ public class GHEventInfo {
|
|||||||
* if payload cannot be parsed
|
* if payload cannot be parsed
|
||||||
*/
|
*/
|
||||||
public <T extends GHEventPayload> T getPayload(Class<T> type) throws IOException {
|
public <T extends GHEventPayload> T getPayload(Class<T> type) throws IOException {
|
||||||
T v = GitHub.MAPPER.readValue(payload.traverse(), type);
|
T v = GitHubClient.getMappingObjectReader(root).readValue(payload.traverse(), type);
|
||||||
v.wrapUp(root);
|
v.wrapUp(root);
|
||||||
return v;
|
return v;
|
||||||
}
|
}
|
||||||
|
|||||||
File diff suppressed because it is too large
Load Diff
@@ -1,11 +1,11 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
import java.io.FileNotFoundException;
|
import java.io.FileNotFoundException;
|
||||||
import java.net.HttpURLConnection;
|
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
import java.util.Map;
|
import java.util.Map;
|
||||||
|
|
||||||
import javax.annotation.CheckForNull;
|
import javax.annotation.CheckForNull;
|
||||||
|
import javax.annotation.Nonnull;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Request/responce contains useful metadata. Custom exception allows store info for next diagnostics.
|
* Request/responce contains useful metadata. Custom exception allows store info for next diagnostics.
|
||||||
@@ -24,11 +24,24 @@ public class GHFileNotFoundException extends FileNotFoundException {
|
|||||||
/**
|
/**
|
||||||
* Instantiates a new Gh file not found exception.
|
* Instantiates a new Gh file not found exception.
|
||||||
*
|
*
|
||||||
* @param s
|
* @param message
|
||||||
* the s
|
* the message
|
||||||
*/
|
*/
|
||||||
public GHFileNotFoundException(String s) {
|
public GHFileNotFoundException(String message) {
|
||||||
super(s);
|
super(message);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Instantiates a new Gh file not found exception.
|
||||||
|
*
|
||||||
|
* @param message
|
||||||
|
* the message
|
||||||
|
* @param cause
|
||||||
|
* the cause
|
||||||
|
*/
|
||||||
|
public GHFileNotFoundException(String message, Throwable cause) {
|
||||||
|
super(message);
|
||||||
|
this.initCause(cause);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -41,8 +54,8 @@ public class GHFileNotFoundException extends FileNotFoundException {
|
|||||||
return responseHeaderFields;
|
return responseHeaderFields;
|
||||||
}
|
}
|
||||||
|
|
||||||
GHFileNotFoundException withResponseHeaderFields(HttpURLConnection urlConnection) {
|
GHFileNotFoundException withResponseHeaderFields(@Nonnull Map<String, List<String>> headerFields) {
|
||||||
this.responseHeaderFields = urlConnection.getHeaderFields();
|
this.responseHeaderFields = headerFields;
|
||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -1,12 +1,13 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import com.fasterxml.jackson.annotation.JacksonInject;
|
||||||
|
import com.fasterxml.jackson.annotation.JsonCreator;
|
||||||
import com.fasterxml.jackson.annotation.JsonProperty;
|
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||||
import org.apache.commons.lang3.StringUtils;
|
import org.apache.commons.lang3.StringUtils;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
import java.util.Collections;
|
import java.util.Collections;
|
||||||
import java.util.HashMap;
|
|
||||||
import java.util.Map;
|
import java.util.Map;
|
||||||
import java.util.Map.Entry;
|
import java.util.Map.Entry;
|
||||||
|
|
||||||
@@ -20,8 +21,8 @@ import java.util.Map.Entry;
|
|||||||
* @see <a href="https://developer.github.com/v3/gists/">documentation</a>
|
* @see <a href="https://developer.github.com/v3/gists/">documentation</a>
|
||||||
*/
|
*/
|
||||||
public class GHGist extends GHObject {
|
public class GHGist extends GHObject {
|
||||||
/* package almost final */ GHUser owner;
|
|
||||||
/* package almost final */ GitHub root;
|
final GHUser owner;
|
||||||
|
|
||||||
private String forks_url, commits_url, id, git_pull_url, git_push_url, html_url;
|
private String forks_url, commits_url, id, git_pull_url, git_push_url, html_url;
|
||||||
|
|
||||||
@@ -34,7 +35,43 @@ public class GHGist extends GHObject {
|
|||||||
|
|
||||||
private String comments_url;
|
private String comments_url;
|
||||||
|
|
||||||
private Map<String, GHGistFile> files = new HashMap<String, GHGistFile>();
|
private final Map<String, GHGistFile> files;
|
||||||
|
|
||||||
|
@JsonCreator
|
||||||
|
private GHGist(@JacksonInject GitHub root,
|
||||||
|
@JsonProperty("owner") GHUser owner,
|
||||||
|
@JsonProperty("files") Map<String, GHGistFile> files) {
|
||||||
|
this.root = root;
|
||||||
|
for (Entry<String, GHGistFile> e : files.entrySet()) {
|
||||||
|
e.getValue().fileName = e.getKey();
|
||||||
|
}
|
||||||
|
this.files = Collections.unmodifiableMap(files);
|
||||||
|
this.owner = root.getUser(owner);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Unlike most other GitHub objects, the id for Gists can be non-numeric, such as "aa5a315d61ae9438b18d". If the id
|
||||||
|
* is numeric, this method will get it. If id is not numeric, this will throw a runtime
|
||||||
|
* {@link NumberFormatException}.
|
||||||
|
*
|
||||||
|
* @return id of the Gist.
|
||||||
|
* @deprecated Use {@link #getGistId()} instead.
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Override
|
||||||
|
public long getId() {
|
||||||
|
return Long.parseLong(getGistId());
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the id for this Gist. Unlike most other GitHub objects, the id for Gists can be non-numeric, such as
|
||||||
|
* "aa5a315d61ae9438b18d". This should be used instead of {@link #getId()}.
|
||||||
|
*
|
||||||
|
* @return id of this Gist
|
||||||
|
*/
|
||||||
|
public String getGistId() {
|
||||||
|
return this.id;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets owner.
|
* Gets owner.
|
||||||
@@ -44,7 +81,7 @@ public class GHGist extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public GHUser getOwner() throws IOException {
|
public GHUser getOwner() throws IOException {
|
||||||
return root.intern(owner);
|
return owner;
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -83,8 +120,13 @@ public class GHGist extends GHObject {
|
|||||||
return git_push_url;
|
return git_push_url;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get the html url.
|
||||||
|
*
|
||||||
|
* @return the github html url
|
||||||
|
*/
|
||||||
public URL getHtmlUrl() {
|
public URL getHtmlUrl() {
|
||||||
return GitHub.parseURL(html_url);
|
return GitHubClient.parseURL(html_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -140,31 +182,7 @@ public class GHGist extends GHObject {
|
|||||||
* @return the files
|
* @return the files
|
||||||
*/
|
*/
|
||||||
public Map<String, GHGistFile> getFiles() {
|
public Map<String, GHGistFile> getFiles() {
|
||||||
return Collections.unmodifiableMap(files);
|
return files;
|
||||||
}
|
|
||||||
|
|
||||||
GHGist wrapUp(GHUser owner) {
|
|
||||||
this.owner = owner;
|
|
||||||
this.root = owner.root;
|
|
||||||
wrapUp();
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Used when caller obtains {@link GHGist} without knowing its owner. A partially constructed owner object is
|
|
||||||
* interned.
|
|
||||||
*/
|
|
||||||
GHGist wrapUp(GitHub root) {
|
|
||||||
this.owner = root.getUser(owner);
|
|
||||||
this.root = root;
|
|
||||||
wrapUp();
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
private void wrapUp() {
|
|
||||||
for (Entry<String, GHGistFile> e : files.entrySet()) {
|
|
||||||
e.getValue().fileName = e.getKey();
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
|
|
||||||
String getApiTailUrl(String tail) {
|
String getApiTailUrl(String tail) {
|
||||||
@@ -214,7 +232,7 @@ public class GHGist extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public GHGist fork() throws IOException {
|
public GHGist fork() throws IOException {
|
||||||
return root.createRequest().method("POST").withUrlPath(getApiTailUrl("forks")).fetch(GHGist.class).wrapUp(root);
|
return root.createRequest().method("POST").withUrlPath(getApiTailUrl("forks")).fetch(GHGist.class);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -223,9 +241,7 @@ public class GHGist extends GHObject {
|
|||||||
* @return the paged iterable
|
* @return the paged iterable
|
||||||
*/
|
*/
|
||||||
public PagedIterable<GHGist> listForks() {
|
public PagedIterable<GHGist> listForks() {
|
||||||
return root.createRequest()
|
return root.createRequest().withUrlPath(getApiTailUrl("forks")).toIterable(GHGist[].class, null);
|
||||||
.withUrlPath(getApiTailUrl("forks"))
|
|
||||||
.toIterable(GHGist[].class, item -> item.wrapUp(root));
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -264,10 +280,4 @@ public class GHGist extends GHObject {
|
|||||||
public int hashCode() {
|
public int hashCode() {
|
||||||
return id.hashCode();
|
return id.hashCode();
|
||||||
}
|
}
|
||||||
|
|
||||||
GHGist wrap(GHUser owner) {
|
|
||||||
this.owner = owner;
|
|
||||||
this.root = owner.root;
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -4,6 +4,8 @@ import java.io.IOException;
|
|||||||
import java.util.Collections;
|
import java.util.Collections;
|
||||||
import java.util.LinkedHashMap;
|
import java.util.LinkedHashMap;
|
||||||
|
|
||||||
|
import javax.annotation.Nonnull;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Builder pattern for creating a new Gist.
|
* Builder pattern for creating a new Gist.
|
||||||
*
|
*
|
||||||
@@ -11,7 +13,6 @@ import java.util.LinkedHashMap;
|
|||||||
* @see GitHub#createGist() GitHub#createGist()
|
* @see GitHub#createGist() GitHub#createGist()
|
||||||
*/
|
*/
|
||||||
public class GHGistBuilder {
|
public class GHGistBuilder {
|
||||||
private final GitHub root;
|
|
||||||
private final Requester req;
|
private final Requester req;
|
||||||
private final LinkedHashMap<String, Object> files = new LinkedHashMap<String, Object>();
|
private final LinkedHashMap<String, Object> files = new LinkedHashMap<String, Object>();
|
||||||
|
|
||||||
@@ -22,7 +23,6 @@ public class GHGistBuilder {
|
|||||||
* the root
|
* the root
|
||||||
*/
|
*/
|
||||||
public GHGistBuilder(GitHub root) {
|
public GHGistBuilder(GitHub root) {
|
||||||
this.root = root;
|
|
||||||
req = root.createRequest().method("POST");
|
req = root.createRequest().method("POST");
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -59,7 +59,7 @@ public class GHGistBuilder {
|
|||||||
* the content
|
* the content
|
||||||
* @return Adds a new file.
|
* @return Adds a new file.
|
||||||
*/
|
*/
|
||||||
public GHGistBuilder file(String fileName, String content) {
|
public GHGistBuilder file(@Nonnull String fileName, @Nonnull String content) {
|
||||||
files.put(fileName, Collections.singletonMap("content", content));
|
files.put(fileName, Collections.singletonMap("content", content));
|
||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
@@ -73,6 +73,6 @@ public class GHGistBuilder {
|
|||||||
*/
|
*/
|
||||||
public GHGist create() throws IOException {
|
public GHGist create() throws IOException {
|
||||||
req.with("files", files);
|
req.with("files", files);
|
||||||
return req.withUrlPath("/gists").fetch(GHGist.class).wrapUp(root);
|
return req.withUrlPath("/gists").fetch(GHGist.class);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -1,8 +1,11 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.util.Collections;
|
import java.util.HashMap;
|
||||||
import java.util.LinkedHashMap;
|
import java.util.LinkedHashMap;
|
||||||
|
import java.util.Map;
|
||||||
|
|
||||||
|
import javax.annotation.Nonnull;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Builder pattern for updating a Gist.
|
* Builder pattern for updating a Gist.
|
||||||
@@ -12,7 +15,7 @@ import java.util.LinkedHashMap;
|
|||||||
public class GHGistUpdater {
|
public class GHGistUpdater {
|
||||||
private final GHGist base;
|
private final GHGist base;
|
||||||
private final Requester builder;
|
private final Requester builder;
|
||||||
LinkedHashMap<String, Object> files;
|
LinkedHashMap<String, Map<String, String>> files;
|
||||||
|
|
||||||
GHGistUpdater(GHGist base) {
|
GHGistUpdater(GHGist base) {
|
||||||
this.base = base;
|
this.base = base;
|
||||||
@@ -32,16 +35,15 @@ public class GHGistUpdater {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public GHGistUpdater addFile(String fileName, String content) throws IOException {
|
public GHGistUpdater addFile(@Nonnull String fileName, @Nonnull String content) throws IOException {
|
||||||
updateFile(fileName, content);
|
updateFile(fileName, content);
|
||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
// // This method does not work.
|
public GHGistUpdater deleteFile(@Nonnull String fileName) throws IOException {
|
||||||
// public GHGistUpdater deleteFile(String fileName) throws IOException {
|
files.put(fileName, null);
|
||||||
// files.put(fileName, Collections.singletonMap("filename", null));
|
return this;
|
||||||
// return this;
|
}
|
||||||
// }
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Rename file gh gist updater.
|
* Rename file gh gist updater.
|
||||||
@@ -54,8 +56,9 @@ public class GHGistUpdater {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public GHGistUpdater renameFile(String fileName, String newFileName) throws IOException {
|
public GHGistUpdater renameFile(@Nonnull String fileName, @Nonnull String newFileName) throws IOException {
|
||||||
files.put(fileName, Collections.singletonMap("filename", newFileName));
|
Map<String, String> file = files.computeIfAbsent(fileName, d -> new HashMap<>());
|
||||||
|
file.put("filename", newFileName);
|
||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -70,8 +73,31 @@ public class GHGistUpdater {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public GHGistUpdater updateFile(String fileName, String content) throws IOException {
|
public GHGistUpdater updateFile(@Nonnull String fileName, @Nonnull String content) throws IOException {
|
||||||
files.put(fileName, Collections.singletonMap("content", content));
|
Map<String, String> file = files.computeIfAbsent(fileName, d -> new HashMap<>());
|
||||||
|
file.put("content", content);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Update file name and content
|
||||||
|
*
|
||||||
|
* @param fileName
|
||||||
|
* the file name
|
||||||
|
* @param newFileName
|
||||||
|
* the new file name
|
||||||
|
* @param content
|
||||||
|
* the content
|
||||||
|
* @return the gh gist updater
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public GHGistUpdater updateFile(@Nonnull String fileName, @Nonnull String newFileName, @Nonnull String content)
|
||||||
|
throws IOException {
|
||||||
|
Map<String, String> file = files.computeIfAbsent(fileName, d -> new HashMap<>());
|
||||||
|
file.put("content", content);
|
||||||
|
file.put("filename", newFileName);
|
||||||
|
files.put(fileName, file);
|
||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -96,6 +122,6 @@ public class GHGistUpdater {
|
|||||||
*/
|
*/
|
||||||
public GHGist update() throws IOException {
|
public GHGist update() throws IOException {
|
||||||
builder.with("files", files);
|
builder.with("files", files);
|
||||||
return builder.method("PATCH").withUrlPath(base.getApiTailUrl("")).fetch(GHGist.class).wrap(base.owner);
|
return builder.method("PATCH").withUrlPath(base.getApiTailUrl("")).fetch(GHGist.class);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -12,8 +12,7 @@ import java.util.Map;
|
|||||||
* functionality
|
* functionality
|
||||||
*/
|
*/
|
||||||
class GHHooks {
|
class GHHooks {
|
||||||
static abstract class Context {
|
static abstract class Context extends GitHubInteractiveObject {
|
||||||
private final GitHub root;
|
|
||||||
|
|
||||||
private Context(GitHub root) {
|
private Context(GitHub root) {
|
||||||
this.root = root;
|
this.root = root;
|
||||||
|
|||||||
@@ -1,11 +1,11 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.HttpURLConnection;
|
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
import java.util.Map;
|
import java.util.Map;
|
||||||
|
|
||||||
import javax.annotation.CheckForNull;
|
import javax.annotation.CheckForNull;
|
||||||
|
import javax.annotation.Nonnull;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Request/responce contains useful metadata. Custom exception allows store info for next diagnostics.
|
* Request/responce contains useful metadata. Custom exception allows store info for next diagnostics.
|
||||||
@@ -31,6 +31,20 @@ public class GHIOException extends IOException {
|
|||||||
super(message);
|
super(message);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Constructs a {@code GHIOException} with the specified detail message and cause.
|
||||||
|
*
|
||||||
|
* @param message
|
||||||
|
* The detail message (which is saved for later retrieval by the {@link #getMessage()} method)
|
||||||
|
*
|
||||||
|
* @param cause
|
||||||
|
* The cause (which is saved for later retrieval by the {@link #getCause()} method). (A null value is
|
||||||
|
* permitted, and indicates that the cause is nonexistent or unknown.)
|
||||||
|
*/
|
||||||
|
public GHIOException(String message, Throwable cause) {
|
||||||
|
super(message, cause);
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets response header fields.
|
* Gets response header fields.
|
||||||
*
|
*
|
||||||
@@ -41,8 +55,8 @@ public class GHIOException extends IOException {
|
|||||||
return responseHeaderFields;
|
return responseHeaderFields;
|
||||||
}
|
}
|
||||||
|
|
||||||
GHIOException withResponseHeaderFields(HttpURLConnection urlConnection) {
|
GHIOException withResponseHeaderFields(@Nonnull Map<String, List<String>> headerFields) {
|
||||||
this.responseHeaderFields = urlConnection.getHeaderFields();
|
this.responseHeaderFields = headerFields;
|
||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -16,7 +16,6 @@ import java.net.URL;
|
|||||||
"UUF_UNUSED_FIELD" },
|
"UUF_UNUSED_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public class GHInvitation extends GHObject {
|
public class GHInvitation extends GHObject {
|
||||||
/* package almost final */ GitHub root;
|
|
||||||
|
|
||||||
private int id;
|
private int id;
|
||||||
private GHRepository repository;
|
private GHRepository repository;
|
||||||
@@ -51,6 +50,6 @@ public class GHInvitation extends GHObject {
|
|||||||
|
|
||||||
@Override
|
@Override
|
||||||
public URL getHtmlUrl() {
|
public URL getHtmlUrl() {
|
||||||
return GitHub.parseURL(html_url);
|
return GitHubClient.parseURL(html_url);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -26,6 +26,7 @@ package org.kohsuke.github;
|
|||||||
|
|
||||||
import com.infradna.tool.bridge_method_injector.WithBridgeMethods;
|
import com.infradna.tool.bridge_method_injector.WithBridgeMethods;
|
||||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
|
import org.apache.commons.lang3.StringUtils;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
@@ -36,8 +37,9 @@ import java.util.Collections;
|
|||||||
import java.util.Date;
|
import java.util.Date;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
import java.util.Locale;
|
import java.util.Locale;
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.SQUIRREL_GIRL;
|
import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Represents an issue on GitHub.
|
* Represents an issue on GitHub.
|
||||||
@@ -51,7 +53,6 @@ import static org.kohsuke.github.Previews.SQUIRREL_GIRL;
|
|||||||
public class GHIssue extends GHObject implements Reactable {
|
public class GHIssue extends GHObject implements Reactable {
|
||||||
private static final String ASSIGNEES = "assignees";
|
private static final String ASSIGNEES = "assignees";
|
||||||
|
|
||||||
GitHub root;
|
|
||||||
GHRepository owner;
|
GHRepository owner;
|
||||||
|
|
||||||
// API v3
|
// API v3
|
||||||
@@ -63,8 +64,7 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
protected int comments;
|
protected int comments;
|
||||||
@SkipFromToString
|
@SkipFromToString
|
||||||
protected String body;
|
protected String body;
|
||||||
// for backward compatibility with < 1.63, this collection needs to hold instances of Label, not GHLabel
|
protected List<GHLabel> labels;
|
||||||
protected List<Label> labels;
|
|
||||||
protected GHUser user;
|
protected GHUser user;
|
||||||
protected String title, html_url;
|
protected String title, html_url;
|
||||||
protected GHIssue.PullRequest pull_request;
|
protected GHIssue.PullRequest pull_request;
|
||||||
@@ -72,14 +72,6 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
protected GHUser closed_by;
|
protected GHUser closed_by;
|
||||||
protected boolean locked;
|
protected boolean locked;
|
||||||
|
|
||||||
/**
|
|
||||||
* The type Label.
|
|
||||||
*
|
|
||||||
* @deprecated use {@link GHLabel}
|
|
||||||
*/
|
|
||||||
public static class Label extends GHLabel {
|
|
||||||
}
|
|
||||||
|
|
||||||
GHIssue wrap(GHRepository owner) {
|
GHIssue wrap(GHRepository owner) {
|
||||||
this.owner = owner;
|
this.owner = owner;
|
||||||
if (milestone != null)
|
if (milestone != null)
|
||||||
@@ -100,12 +92,6 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
static GHIssue[] wrap(GHIssue[] issues, GHRepository owner) {
|
|
||||||
for (GHIssue i : issues)
|
|
||||||
i.wrap(owner);
|
|
||||||
return issues;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Repository to which the issue belongs.
|
* Repository to which the issue belongs.
|
||||||
*
|
*
|
||||||
@@ -137,7 +123,7 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
* The HTML page of this issue, like https://github.com/jenkinsci/jenkins/issues/100
|
* The HTML page of this issue, like https://github.com/jenkinsci/jenkins/issues/100
|
||||||
*/
|
*/
|
||||||
public URL getHtmlUrl() {
|
public URL getHtmlUrl() {
|
||||||
return GitHub.parseURL(html_url);
|
return GitHubClient.parseURL(html_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -171,14 +157,12 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
* Gets labels.
|
* Gets labels.
|
||||||
*
|
*
|
||||||
* @return the labels
|
* @return the labels
|
||||||
* @throws IOException
|
|
||||||
* the io exception
|
|
||||||
*/
|
*/
|
||||||
public Collection<GHLabel> getLabels() throws IOException {
|
public Collection<GHLabel> getLabels() {
|
||||||
if (labels == null) {
|
if (labels == null) {
|
||||||
return Collections.emptyList();
|
return Collections.emptyList();
|
||||||
}
|
}
|
||||||
return Collections.<GHLabel>unmodifiableList(labels);
|
return Collections.unmodifiableList(labels);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -187,16 +171,18 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
* @return the closed at
|
* @return the closed at
|
||||||
*/
|
*/
|
||||||
public Date getClosedAt() {
|
public Date getClosedAt() {
|
||||||
return GitHub.parseDate(closed_at);
|
return GitHubClient.parseDate(closed_at);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets api url.
|
* Gets api url.
|
||||||
*
|
*
|
||||||
* @return the api url
|
* @return API URL of this object.
|
||||||
|
* @deprecated use {@link #getUrl()}
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public URL getApiURL() {
|
public URL getApiURL() {
|
||||||
return GitHub.parseURL(url);
|
return getUrl();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -242,8 +228,15 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
root.createRequest().with(key, value).method("PATCH").withUrlPath(getApiRoute()).send();
|
root.createRequest().with(key, value).method("PATCH").withUrlPath(getApiRoute()).send();
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Identical to edit(), but allows null for the value.
|
||||||
|
*/
|
||||||
|
private void editNullable(String key, Object value) throws IOException {
|
||||||
|
root.createRequest().withNullable(key, value).method("PATCH").withUrlPath(getApiRoute()).send();
|
||||||
|
}
|
||||||
|
|
||||||
private void editIssue(String key, Object value) throws IOException {
|
private void editIssue(String key, Object value) throws IOException {
|
||||||
root.createRequest().with(key, value).method("PATCH").withUrlPath(getIssuesApiRoute()).send();
|
root.createRequest().withNullable(key, value).method("PATCH").withUrlPath(getIssuesApiRoute()).send();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -291,15 +284,19 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Sets milestone.
|
* Sets the milestone for this issue.
|
||||||
*
|
*
|
||||||
* @param milestone
|
* @param milestone
|
||||||
* the milestone
|
* The milestone to assign this issue to. Use null to remove the milestone for this issue.
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* The io exception
|
||||||
*/
|
*/
|
||||||
public void setMilestone(GHMilestone milestone) throws IOException {
|
public void setMilestone(GHMilestone milestone) throws IOException {
|
||||||
edit("milestone", milestone.getNumber());
|
if (milestone == null) {
|
||||||
|
editIssue("milestone", null);
|
||||||
|
} else {
|
||||||
|
editIssue("milestone", milestone.getNumber());
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -315,7 +312,7 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Sets labels.
|
* Sets labels on the target to a specific list.
|
||||||
*
|
*
|
||||||
* @param labels
|
* @param labels
|
||||||
* the labels
|
* the labels
|
||||||
@@ -329,6 +326,8 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
/**
|
/**
|
||||||
* Adds labels to the issue.
|
* Adds labels to the issue.
|
||||||
*
|
*
|
||||||
|
* Labels that are already present on the target are ignored.
|
||||||
|
*
|
||||||
* @param names
|
* @param names
|
||||||
* Names of the label
|
* Names of the label
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
@@ -341,6 +340,8 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
/**
|
/**
|
||||||
* Add labels.
|
* Add labels.
|
||||||
*
|
*
|
||||||
|
* Labels that are already present on the target are ignored.
|
||||||
|
*
|
||||||
* @param labels
|
* @param labels
|
||||||
* the labels
|
* the labels
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
@@ -353,6 +354,8 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
/**
|
/**
|
||||||
* Add labels.
|
* Add labels.
|
||||||
*
|
*
|
||||||
|
* Labels that are already present on the target are ignored.
|
||||||
|
*
|
||||||
* @param labels
|
* @param labels
|
||||||
* the labels
|
* the labels
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
@@ -363,21 +366,27 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
}
|
}
|
||||||
|
|
||||||
private void _addLabels(Collection<String> names) throws IOException {
|
private void _addLabels(Collection<String> names) throws IOException {
|
||||||
List<String> newLabels = new ArrayList<String>();
|
root.createRequest().with("labels", names).method("POST").withUrlPath(getIssuesApiRoute() + "/labels").send();
|
||||||
|
|
||||||
for (GHLabel label : getLabels()) {
|
|
||||||
newLabels.add(label.getName());
|
|
||||||
}
|
|
||||||
for (String name : names) {
|
|
||||||
if (!newLabels.contains(name)) {
|
|
||||||
newLabels.add(name);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
setLabels(newLabels.toArray(new String[0]));
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Remove a given label by name from this issue.
|
* Remove a single label.
|
||||||
|
*
|
||||||
|
* Attempting to remove a label that is not present throws {@link GHFileNotFoundException}.
|
||||||
|
*
|
||||||
|
* @param name
|
||||||
|
* the name
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception, throws {@link GHFileNotFoundException} if label was not present.
|
||||||
|
*/
|
||||||
|
public void removeLabel(String name) throws IOException {
|
||||||
|
root.createRequest().method("DELETE").withUrlPath(getIssuesApiRoute() + "/labels", name).send();
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Remove a collection of labels.
|
||||||
|
*
|
||||||
|
* Attempting to remove labels that are not present on the target are ignored.
|
||||||
*
|
*
|
||||||
* @param names
|
* @param names
|
||||||
* the names
|
* the names
|
||||||
@@ -389,7 +398,9 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Remove labels.
|
* Remove a collection of labels.
|
||||||
|
*
|
||||||
|
* Attempting to remove labels that are not present on the target are ignored.
|
||||||
*
|
*
|
||||||
* @param labels
|
* @param labels
|
||||||
* the labels
|
* the labels
|
||||||
@@ -402,7 +413,9 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Remove labels.
|
* Remove a collection of labels.
|
||||||
|
*
|
||||||
|
* Attempting to remove labels that are not present on the target are ignored.
|
||||||
*
|
*
|
||||||
* @param labels
|
* @param labels
|
||||||
* the labels
|
* the labels
|
||||||
@@ -414,15 +427,13 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
}
|
}
|
||||||
|
|
||||||
private void _removeLabels(Collection<String> names) throws IOException {
|
private void _removeLabels(Collection<String> names) throws IOException {
|
||||||
List<String> newLabels = new ArrayList<String>();
|
for (String name : names) {
|
||||||
|
try {
|
||||||
for (GHLabel l : getLabels()) {
|
removeLabel(name);
|
||||||
if (!names.contains(l.getName())) {
|
} catch (GHFileNotFoundException e) {
|
||||||
newLabels.add(l.getName());
|
// when trying to remove multiple labels, we ignore already removed
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
setLabels(newLabels.toArray(new String[0]));
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -434,7 +445,7 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
* @see #listComments() #listComments()
|
* @see #listComments() #listComments()
|
||||||
*/
|
*/
|
||||||
public List<GHIssueComment> getComments() throws IOException {
|
public List<GHIssueComment> getComments() throws IOException {
|
||||||
return listComments().asList();
|
return listComments().toList();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -450,10 +461,10 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
.toIterable(GHIssueComment[].class, item -> item.wrapUp(this));
|
.toIterable(GHIssueComment[].class, item -> item.wrapUp(this));
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHReaction createReaction(ReactionContent content) throws IOException {
|
public GHReaction createReaction(ReactionContent content) throws IOException {
|
||||||
return owner.root.createRequest()
|
return root.createRequest()
|
||||||
.method("POST")
|
.method("POST")
|
||||||
.withPreview(SQUIRREL_GIRL)
|
.withPreview(SQUIRREL_GIRL)
|
||||||
.with("content", content.getContent())
|
.with("content", content.getContent())
|
||||||
@@ -462,13 +473,13 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
.wrap(root);
|
.wrap(root);
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public PagedIterable<GHReaction> listReactions() {
|
public PagedIterable<GHReaction> listReactions() {
|
||||||
return owner.root.createRequest()
|
return root.createRequest()
|
||||||
.withPreview(SQUIRREL_GIRL)
|
.withPreview(SQUIRREL_GIRL)
|
||||||
.withUrlPath(getApiRoute() + "/reactions")
|
.withUrlPath(getApiRoute() + "/reactions")
|
||||||
.toIterable(GHReaction[].class, item -> item.wrap(owner.root));
|
.toIterable(GHReaction[].class, item -> item.wrap(root));
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -571,6 +582,11 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
* @return the issues api route
|
* @return the issues api route
|
||||||
*/
|
*/
|
||||||
protected String getIssuesApiRoute() {
|
protected String getIssuesApiRoute() {
|
||||||
|
if (owner == null) {
|
||||||
|
// Issues returned from search to do not have an owner. Attempt to use url.
|
||||||
|
final URL url = Objects.requireNonNull(getUrl(), "Missing instance URL!");
|
||||||
|
return StringUtils.prependIfMissing(url.toString().replace(root.getApiUrl(), ""), "/");
|
||||||
|
}
|
||||||
return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/issues/" + number;
|
return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/issues/" + number;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -677,7 +693,7 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
* @return the diff url
|
* @return the diff url
|
||||||
*/
|
*/
|
||||||
public URL getDiffUrl() {
|
public URL getDiffUrl() {
|
||||||
return GitHub.parseURL(diff_url);
|
return GitHubClient.parseURL(diff_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -686,7 +702,7 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
* @return the patch url
|
* @return the patch url
|
||||||
*/
|
*/
|
||||||
public URL getPatchUrl() {
|
public URL getPatchUrl() {
|
||||||
return GitHub.parseURL(patch_url);
|
return GitHubClient.parseURL(patch_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -695,7 +711,7 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
* @return the url
|
* @return the url
|
||||||
*/
|
*/
|
||||||
public URL getUrl() {
|
public URL getUrl() {
|
||||||
return GitHub.parseURL(html_url);
|
return GitHubClient.parseURL(html_url);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
49
src/main/java/org/kohsuke/github/GHIssueChanges.java
Normal file
49
src/main/java/org/kohsuke/github/GHIssueChanges.java
Normal file
@@ -0,0 +1,49 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Wrapper to define changed fields on issues action="edited"
|
||||||
|
*
|
||||||
|
* @see GHEventPayload.Issue
|
||||||
|
*/
|
||||||
|
@SuppressFBWarnings("UWF_UNWRITTEN_FIELD")
|
||||||
|
public class GHIssueChanges {
|
||||||
|
|
||||||
|
private GHFrom title;
|
||||||
|
private GHFrom body;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Old issue title.
|
||||||
|
*
|
||||||
|
* @return old issue title (or null if not changed)
|
||||||
|
*/
|
||||||
|
public GHFrom getTitle() {
|
||||||
|
return title;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Old issue body.
|
||||||
|
*
|
||||||
|
* @return old issue body (or null if not changed)
|
||||||
|
*/
|
||||||
|
public GHFrom getBody() {
|
||||||
|
return body;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Wrapper for changed values.
|
||||||
|
*/
|
||||||
|
public static class GHFrom {
|
||||||
|
private String from;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Previous value that was changed.
|
||||||
|
*
|
||||||
|
* @return previous value
|
||||||
|
*/
|
||||||
|
public String getFrom() {
|
||||||
|
return from;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -26,7 +26,7 @@ package org.kohsuke.github;
|
|||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.*;
|
import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Comment to the issue
|
* Comment to the issue
|
||||||
@@ -87,7 +87,7 @@ public class GHIssueComment extends GHObject implements Reactable {
|
|||||||
|
|
||||||
@Override
|
@Override
|
||||||
public URL getHtmlUrl() {
|
public URL getHtmlUrl() {
|
||||||
return GitHub.parseURL(html_url);
|
return GitHubClient.parseURL(html_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -126,7 +126,7 @@ public class GHIssueComment extends GHObject implements Reactable {
|
|||||||
owner.root.createRequest().method("DELETE").withUrlPath(getApiRoute()).send();
|
owner.root.createRequest().method("DELETE").withUrlPath(getApiRoute()).send();
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHReaction createReaction(ReactionContent content) throws IOException {
|
public GHReaction createReaction(ReactionContent content) throws IOException {
|
||||||
return owner.root.createRequest()
|
return owner.root.createRequest()
|
||||||
@@ -138,7 +138,7 @@ public class GHIssueComment extends GHObject implements Reactable {
|
|||||||
.wrap(owner.root);
|
.wrap(owner.root);
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public PagedIterable<GHReaction> listReactions() {
|
public PagedIterable<GHReaction> listReactions() {
|
||||||
return owner.root.createRequest()
|
return owner.root.createRequest()
|
||||||
@@ -149,6 +149,6 @@ public class GHIssueComment extends GHObject implements Reactable {
|
|||||||
|
|
||||||
private String getApiRoute() {
|
private String getApiRoute() {
|
||||||
return "/repos/" + owner.getRepository().getOwnerName() + "/" + owner.getRepository().getName()
|
return "/repos/" + owner.getRepository().getOwnerName() + "/" + owner.getRepository().getName()
|
||||||
+ "/issues/comments/" + id;
|
+ "/issues/comments/" + getId();
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -5,11 +5,11 @@ import java.util.Date;
|
|||||||
/**
|
/**
|
||||||
* The type GHIssueEvent.
|
* The type GHIssueEvent.
|
||||||
*
|
*
|
||||||
|
* @see <a href="https://developer.github.com/v3/issues/events/">Github documentation for issue events</a>
|
||||||
|
*
|
||||||
* @author Martin van Zijl
|
* @author Martin van Zijl
|
||||||
*/
|
*/
|
||||||
public class GHIssueEvent {
|
public class GHIssueEvent extends GitHubInteractiveObject {
|
||||||
private GitHub root;
|
|
||||||
|
|
||||||
private long id;
|
private long id;
|
||||||
private String node_id;
|
private String node_id;
|
||||||
private String url;
|
private String url;
|
||||||
@@ -18,6 +18,9 @@ public class GHIssueEvent {
|
|||||||
private String commit_id;
|
private String commit_id;
|
||||||
private String commit_url;
|
private String commit_url;
|
||||||
private String created_at;
|
private String created_at;
|
||||||
|
private GHMilestone milestone;
|
||||||
|
private GHLabel label;
|
||||||
|
private GHUser assignee;
|
||||||
|
|
||||||
private GHIssue issue;
|
private GHIssue issue;
|
||||||
|
|
||||||
@@ -90,7 +93,7 @@ public class GHIssueEvent {
|
|||||||
* @return the created at
|
* @return the created at
|
||||||
*/
|
*/
|
||||||
public Date getCreatedAt() {
|
public Date getCreatedAt() {
|
||||||
return GitHub.parseDate(created_at);
|
return GitHubClient.parseDate(created_at);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -111,6 +114,36 @@ public class GHIssueEvent {
|
|||||||
return issue;
|
return issue;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get the {@link GHMilestone} that this issue was added to or removed from. Only present for events "milestoned"
|
||||||
|
* and "demilestoned", <code>null</code> otherwise.
|
||||||
|
*
|
||||||
|
* @return the milestone
|
||||||
|
*/
|
||||||
|
public GHMilestone getMilestone() {
|
||||||
|
return milestone;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get the {@link GHLabel} that was added to or removed from the issue. Only present for events "labeled" and
|
||||||
|
* "unlabeled", <code>null</code> otherwise.
|
||||||
|
*
|
||||||
|
* @return the label
|
||||||
|
*/
|
||||||
|
public GHLabel getLabel() {
|
||||||
|
return label;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get the {@link GHUser} that was assigned or unassigned from the issue. Only present for events "assigned" and
|
||||||
|
* "unassigned", <code>null</code> otherwise.
|
||||||
|
*
|
||||||
|
* @return the user
|
||||||
|
*/
|
||||||
|
public GHUser getAssignee() {
|
||||||
|
return assignee;
|
||||||
|
}
|
||||||
|
|
||||||
GHIssueEvent wrapUp(GitHub root) {
|
GHIssueEvent wrapUp(GitHub root) {
|
||||||
this.root = root;
|
this.root = root;
|
||||||
return this;
|
return this;
|
||||||
|
|||||||
@@ -9,9 +9,7 @@ import org.apache.commons.lang3.builder.ToStringBuilder;
|
|||||||
* @author Kohsuke Kawaguchi
|
* @author Kohsuke Kawaguchi
|
||||||
*/
|
*/
|
||||||
@SuppressFBWarnings(value = "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", justification = "JSON API")
|
@SuppressFBWarnings(value = "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", justification = "JSON API")
|
||||||
public class GHKey {
|
public class GHKey extends GitHubInteractiveObject {
|
||||||
/* package almost final */ GitHub root;
|
|
||||||
|
|
||||||
protected String url, key, title;
|
protected String url, key, title;
|
||||||
protected boolean verified;
|
protected boolean verified;
|
||||||
protected int id;
|
protected int id;
|
||||||
|
|||||||
@@ -1,27 +1,77 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import com.fasterxml.jackson.annotation.JacksonInject;
|
||||||
|
import com.fasterxml.jackson.annotation.JsonCreator;
|
||||||
|
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.util.ArrayList;
|
import java.util.ArrayList;
|
||||||
import java.util.Collection;
|
import java.util.Collection;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
import java.util.Objects;
|
import java.util.Objects;
|
||||||
|
|
||||||
|
import javax.annotation.CheckForNull;
|
||||||
|
import javax.annotation.Nonnull;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The type GHLabel.
|
* The type GHLabel.
|
||||||
*
|
*
|
||||||
* @author Kohsuke Kawaguchi
|
* @author Kohsuke Kawaguchi
|
||||||
|
* @see <a href="https://developer.github.com/v3/issues/labels/">Labels</a>
|
||||||
* @see GHIssue#getLabels() GHIssue#getLabels()
|
* @see GHIssue#getLabels() GHIssue#getLabels()
|
||||||
* @see GHRepository#listLabels() GHRepository#listLabels()
|
* @see GHRepository#listLabels() GHRepository#listLabels()
|
||||||
*/
|
*/
|
||||||
public class GHLabel {
|
public class GHLabel extends GitHubInteractiveObject {
|
||||||
private String url, name, color, description;
|
|
||||||
private GHRepository repo;
|
private long id;
|
||||||
|
private String nodeId;
|
||||||
|
@JsonProperty("default")
|
||||||
|
private boolean default_;
|
||||||
|
|
||||||
|
@Nonnull
|
||||||
|
private String url, name, color;
|
||||||
|
|
||||||
|
@CheckForNull
|
||||||
|
private String description;
|
||||||
|
|
||||||
|
@JsonCreator
|
||||||
|
private GHLabel(@JacksonInject @Nonnull GitHub root) {
|
||||||
|
this.root = root;
|
||||||
|
url = "";
|
||||||
|
name = "";
|
||||||
|
color = "";
|
||||||
|
description = null;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Nonnull
|
||||||
|
GitHub getApiRoot() {
|
||||||
|
return Objects.requireNonNull(root);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets id.
|
||||||
|
*
|
||||||
|
* @return the id
|
||||||
|
*/
|
||||||
|
public long getId() {
|
||||||
|
return id;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets node id.
|
||||||
|
*
|
||||||
|
* @return the node id.
|
||||||
|
*/
|
||||||
|
public String getNodeId() {
|
||||||
|
return nodeId;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets url.
|
* Gets url.
|
||||||
*
|
*
|
||||||
* @return the url
|
* @return the url
|
||||||
*/
|
*/
|
||||||
|
@Nonnull
|
||||||
public String getUrl() {
|
public String getUrl() {
|
||||||
return url;
|
return url;
|
||||||
}
|
}
|
||||||
@@ -31,6 +81,7 @@ public class GHLabel {
|
|||||||
*
|
*
|
||||||
* @return the name
|
* @return the name
|
||||||
*/
|
*/
|
||||||
|
@Nonnull
|
||||||
public String getName() {
|
public String getName() {
|
||||||
return name;
|
return name;
|
||||||
}
|
}
|
||||||
@@ -40,6 +91,7 @@ public class GHLabel {
|
|||||||
*
|
*
|
||||||
* @return the color
|
* @return the color
|
||||||
*/
|
*/
|
||||||
|
@Nonnull
|
||||||
public String getColor() {
|
public String getColor() {
|
||||||
return color;
|
return color;
|
||||||
}
|
}
|
||||||
@@ -49,23 +101,18 @@ public class GHLabel {
|
|||||||
*
|
*
|
||||||
* @return the description
|
* @return the description
|
||||||
*/
|
*/
|
||||||
|
@CheckForNull
|
||||||
public String getDescription() {
|
public String getDescription() {
|
||||||
return description;
|
return description;
|
||||||
}
|
}
|
||||||
|
|
||||||
GHLabel wrapUp(GHRepository repo) {
|
|
||||||
this.repo = repo;
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Delete.
|
* If the label is one of the default labels created by GitHub automatically.
|
||||||
*
|
*
|
||||||
* @throws IOException
|
* @return true if the label is a default one
|
||||||
* the io exception
|
|
||||||
*/
|
*/
|
||||||
public void delete() throws IOException {
|
public boolean isDefault() {
|
||||||
repo.root.createRequest().method("DELETE").setRawUrlPath(url).send();
|
return default_;
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -75,15 +122,11 @@ public class GHLabel {
|
|||||||
* 6-letter hex color code, like "f29513"
|
* 6-letter hex color code, like "f29513"
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
|
* @deprecated use {@link #set()} or {@link #update()} instead
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setColor(String newColor) throws IOException {
|
public void setColor(String newColor) throws IOException {
|
||||||
repo.root.createRequest()
|
set().color(newColor);
|
||||||
.method("PATCH")
|
|
||||||
.with("name", name)
|
|
||||||
.with("color", newColor)
|
|
||||||
.with("description", description)
|
|
||||||
.setRawUrlPath(url)
|
|
||||||
.send();
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -93,25 +136,106 @@ public class GHLabel {
|
|||||||
* Description of label
|
* Description of label
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
|
* @deprecated use {@link #set()} or {@link #update()} instead
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setDescription(String newDescription) throws IOException {
|
public void setDescription(String newDescription) throws IOException {
|
||||||
repo.root.createRequest()
|
set().description(newDescription);
|
||||||
.method("PATCH")
|
|
||||||
.with("name", name)
|
|
||||||
.with("color", color)
|
|
||||||
.with("description", newDescription)
|
|
||||||
.setRawUrlPath(url)
|
|
||||||
.send();
|
|
||||||
}
|
}
|
||||||
|
|
||||||
static Collection<String> toNames(Collection<GHLabel> labels) {
|
static Collection<String> toNames(Collection<GHLabel> labels) {
|
||||||
List<String> r = new ArrayList<String>();
|
List<String> r = new ArrayList<>();
|
||||||
for (GHLabel l : labels) {
|
for (GHLabel l : labels) {
|
||||||
r.add(l.getName());
|
r.add(l.getName());
|
||||||
}
|
}
|
||||||
return r;
|
return r;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Begins the creation of a new instance.
|
||||||
|
*
|
||||||
|
* Consumer must call {@link Creator#done()} to commit changes.
|
||||||
|
*
|
||||||
|
* @param repository
|
||||||
|
* the repository in which the label will be created.
|
||||||
|
* @return a {@link Creator}
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
@BetaApi
|
||||||
|
@Deprecated
|
||||||
|
static Creator create(GHRepository repository) throws IOException {
|
||||||
|
return new Creator(repository);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Reads a label from a repository.
|
||||||
|
*
|
||||||
|
* @param repository
|
||||||
|
* the repository to read from
|
||||||
|
* @param name
|
||||||
|
* the name of the label
|
||||||
|
* @return a label
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
static GHLabel read(@Nonnull GHRepository repository, @Nonnull String name) throws IOException {
|
||||||
|
return repository.root.createRequest()
|
||||||
|
.withUrlPath(repository.getApiTailUrl("labels"), name)
|
||||||
|
.fetch(GHLabel.class);
|
||||||
|
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Reads all labels from a repository.
|
||||||
|
*
|
||||||
|
* @param repository
|
||||||
|
* the repository to read from
|
||||||
|
* @return iterable of all labels
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
static PagedIterable<GHLabel> readAll(@Nonnull final GHRepository repository) throws IOException {
|
||||||
|
return repository.root.createRequest()
|
||||||
|
.withUrlPath(repository.getApiTailUrl("labels"))
|
||||||
|
.toIterable(GHLabel[].class, null);
|
||||||
|
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Begins a batch update
|
||||||
|
*
|
||||||
|
* Consumer must call {@link Updater#done()} to commit changes.
|
||||||
|
*
|
||||||
|
* @return a {@link Updater}
|
||||||
|
*/
|
||||||
|
@BetaApi
|
||||||
|
@Deprecated
|
||||||
|
public Updater update() {
|
||||||
|
return new Updater(this);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Begins a single property update.
|
||||||
|
*
|
||||||
|
* @return a {@link Setter}
|
||||||
|
*/
|
||||||
|
@BetaApi
|
||||||
|
@Deprecated
|
||||||
|
public Setter set() {
|
||||||
|
return new Setter(this);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Delete this label from the repository.
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public void delete() throws IOException {
|
||||||
|
root.createRequest().method("DELETE").setRawUrlPath(getUrl()).send();
|
||||||
|
}
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
public boolean equals(final Object o) {
|
public boolean equals(final Object o) {
|
||||||
if (this == o)
|
if (this == o)
|
||||||
@@ -120,11 +244,54 @@ public class GHLabel {
|
|||||||
return false;
|
return false;
|
||||||
final GHLabel ghLabel = (GHLabel) o;
|
final GHLabel ghLabel = (GHLabel) o;
|
||||||
return Objects.equals(url, ghLabel.url) && Objects.equals(name, ghLabel.name)
|
return Objects.equals(url, ghLabel.url) && Objects.equals(name, ghLabel.name)
|
||||||
&& Objects.equals(color, ghLabel.color) && Objects.equals(repo, ghLabel.repo);
|
&& Objects.equals(color, ghLabel.color) && Objects.equals(description, ghLabel.description);
|
||||||
}
|
}
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
public int hashCode() {
|
public int hashCode() {
|
||||||
return Objects.hash(url, name, color, repo);
|
return Objects.hash(url, name, color, description);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A {@link GHLabelBuilder} that updates a single property per request
|
||||||
|
*
|
||||||
|
* {@link #done()} is called automatically after the property is set.
|
||||||
|
*/
|
||||||
|
@BetaApi
|
||||||
|
@Deprecated
|
||||||
|
public static class Setter extends GHLabelBuilder<GHLabel> {
|
||||||
|
private Setter(@Nonnull GHLabel base) {
|
||||||
|
super(GHLabel.class, base.getApiRoot(), base);
|
||||||
|
requester.method("PATCH").setRawUrlPath(base.getUrl());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A {@link GHLabelBuilder} that allows multiple properties to be updated per request.
|
||||||
|
*
|
||||||
|
* Consumer must call {@link #done()} to commit changes.
|
||||||
|
*/
|
||||||
|
@BetaApi
|
||||||
|
@Deprecated
|
||||||
|
public static class Updater extends GHLabelBuilder<Updater> {
|
||||||
|
private Updater(@Nonnull GHLabel base) {
|
||||||
|
super(Updater.class, base.getApiRoot(), base);
|
||||||
|
requester.method("PATCH").setRawUrlPath(base.getUrl());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A {@link GHLabelBuilder} that creates a new {@link GHLabel}
|
||||||
|
*
|
||||||
|
* Consumer must call {@link #done()} to create the new instance.
|
||||||
|
*/
|
||||||
|
@BetaApi
|
||||||
|
@Deprecated
|
||||||
|
public static class Creator extends GHLabelBuilder<Creator> {
|
||||||
|
private Creator(@Nonnull GHRepository repository) {
|
||||||
|
super(Creator.class, repository.root, null);
|
||||||
|
requester.method("POST").withUrlPath(repository.getApiTailUrl("labels"));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
}
|
}
|
||||||
|
|||||||
60
src/main/java/org/kohsuke/github/GHLabelBuilder.java
Normal file
60
src/main/java/org/kohsuke/github/GHLabelBuilder.java
Normal file
@@ -0,0 +1,60 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import java.io.IOException;
|
||||||
|
|
||||||
|
import javax.annotation.CheckForNull;
|
||||||
|
import javax.annotation.Nonnull;
|
||||||
|
|
||||||
|
/**
|
||||||
|
*
|
||||||
|
* @param <S>
|
||||||
|
* Intermediate return type for this builder returned by calls to {@link #with(String, Object)}. If {@link S}
|
||||||
|
* the same as {@link GHLabel}, this builder will commit changes after each call to
|
||||||
|
* {@link #with(String, Object)}.
|
||||||
|
*/
|
||||||
|
class GHLabelBuilder<S> extends AbstractBuilder<GHLabel, S> {
|
||||||
|
|
||||||
|
/**
|
||||||
|
*
|
||||||
|
* @param intermediateReturnType
|
||||||
|
* Intermediate return type for this builder returned by calls to {@link #with(String, Object)}. If
|
||||||
|
* {@link S} the same as {@link GHLabel}, this builder will commit changes after each call to
|
||||||
|
* {@link #with(String, Object)}.
|
||||||
|
* @param root
|
||||||
|
* the GitHub instance to which updates will be sent
|
||||||
|
* @param baseInstance
|
||||||
|
* instance on which to base this builder. If {@code null} a new instance will be created.
|
||||||
|
*/
|
||||||
|
protected GHLabelBuilder(@Nonnull Class<S> intermediateReturnType,
|
||||||
|
@Nonnull GitHub root,
|
||||||
|
@CheckForNull GHLabel baseInstance) {
|
||||||
|
super(GHLabel.class, intermediateReturnType, root, baseInstance);
|
||||||
|
|
||||||
|
if (baseInstance != null) {
|
||||||
|
requester.with("name", baseInstance.getName());
|
||||||
|
requester.with("color", baseInstance.getColor());
|
||||||
|
requester.with("description", baseInstance.getDescription());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
@Nonnull
|
||||||
|
@BetaApi
|
||||||
|
@Deprecated
|
||||||
|
public S name(String value) throws IOException {
|
||||||
|
return with("name", value);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Nonnull
|
||||||
|
@BetaApi
|
||||||
|
@Deprecated
|
||||||
|
public S color(String value) throws IOException {
|
||||||
|
return with("color", value);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Nonnull
|
||||||
|
@BetaApi
|
||||||
|
@Deprecated
|
||||||
|
public S description(String value) throws IOException {
|
||||||
|
return with("description", value);
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -24,13 +24,13 @@
|
|||||||
|
|
||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
import com.infradna.tool.bridge_method_injector.WithBridgeMethods;
|
|
||||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
import java.util.ArrayList;
|
import java.util.ArrayList;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The GitHub Preview API's license information
|
* The GitHub Preview API's license information
|
||||||
@@ -44,9 +44,6 @@ import java.util.List;
|
|||||||
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public class GHLicense extends GHObject {
|
public class GHLicense extends GHObject {
|
||||||
@SuppressFBWarnings("IS2_INCONSISTENT_SYNC")
|
|
||||||
// root is set before the object is returned to the app
|
|
||||||
/* package almost final */ GitHub root;
|
|
||||||
|
|
||||||
// these fields are always present, even in the short form
|
// these fields are always present, even in the short form
|
||||||
protected String key, name;
|
protected String key, name;
|
||||||
@@ -78,14 +75,6 @@ public class GHLicense extends GHObject {
|
|||||||
return name;
|
return name;
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
|
||||||
* @return API URL of this object.
|
|
||||||
*/
|
|
||||||
@WithBridgeMethods(value = String.class, adapterMethod = "urlToString")
|
|
||||||
public URL getUrl() {
|
|
||||||
return GitHub.parseURL(url);
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Featured licenses are bold in the new repository drop-down
|
* Featured licenses are bold in the new repository drop-down
|
||||||
*
|
*
|
||||||
@@ -100,7 +89,7 @@ public class GHLicense extends GHObject {
|
|||||||
|
|
||||||
public URL getHtmlUrl() throws IOException {
|
public URL getHtmlUrl() throws IOException {
|
||||||
populate();
|
populate();
|
||||||
return GitHub.parseURL(html_url);
|
return GitHubClient.parseURL(html_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -199,7 +188,14 @@ public class GHLicense extends GHObject {
|
|||||||
if (description != null)
|
if (description != null)
|
||||||
return; // already populated
|
return; // already populated
|
||||||
|
|
||||||
root.createRequest().withUrlPath(url).fetchInto(this);
|
if (root == null || root.isOffline()) {
|
||||||
|
return; // cannot populate, will have to live with what we have
|
||||||
|
}
|
||||||
|
|
||||||
|
URL url = getUrl();
|
||||||
|
if (url != null) {
|
||||||
|
root.createRequest().setRawUrlPath(url.toString()).fetchInto(this);
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
@@ -210,12 +206,12 @@ public class GHLicense extends GHObject {
|
|||||||
return false;
|
return false;
|
||||||
|
|
||||||
GHLicense that = (GHLicense) o;
|
GHLicense that = (GHLicense) o;
|
||||||
return this.url.equals(that.url);
|
return Objects.equals(getUrl(), that.getUrl());
|
||||||
}
|
}
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
public int hashCode() {
|
public int hashCode() {
|
||||||
return url.hashCode();
|
return Objects.hashCode(getUrl());
|
||||||
}
|
}
|
||||||
|
|
||||||
GHLicense wrap(GitHub root) {
|
GHLicense wrap(GitHub root) {
|
||||||
|
|||||||
@@ -9,9 +9,7 @@ import java.net.URL;
|
|||||||
* @see GitHub#getMyMarketplacePurchases()
|
* @see GitHub#getMyMarketplacePurchases()
|
||||||
* @see GHMarketplaceListAccountBuilder#createRequest()
|
* @see GHMarketplaceListAccountBuilder#createRequest()
|
||||||
*/
|
*/
|
||||||
public class GHMarketplaceAccount {
|
public class GHMarketplaceAccount extends GitHubInteractiveObject {
|
||||||
|
|
||||||
protected GitHub root;
|
|
||||||
private String url;
|
private String url;
|
||||||
private long id;
|
private long id;
|
||||||
private String login;
|
private String login;
|
||||||
@@ -37,7 +35,7 @@ public class GHMarketplaceAccount {
|
|||||||
* @return the url
|
* @return the url
|
||||||
*/
|
*/
|
||||||
public URL getUrl() {
|
public URL getUrl() {
|
||||||
return GitHub.parseURL(url);
|
return GitHubClient.parseURL(url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|||||||
@@ -8,8 +8,7 @@ import java.io.IOException;
|
|||||||
* @author Paulo Miguel Almeida
|
* @author Paulo Miguel Almeida
|
||||||
* @see GHMarketplacePlan#listAccounts()
|
* @see GHMarketplacePlan#listAccounts()
|
||||||
*/
|
*/
|
||||||
public class GHMarketplaceListAccountBuilder {
|
public class GHMarketplaceListAccountBuilder extends GitHubInteractiveObject {
|
||||||
private final GitHub root;
|
|
||||||
private final Requester builder;
|
private final Requester builder;
|
||||||
private final long planId;
|
private final long planId;
|
||||||
|
|
||||||
|
|||||||
@@ -10,8 +10,7 @@ import java.util.Date;
|
|||||||
* @author Paulo Miguel Almeida
|
* @author Paulo Miguel Almeida
|
||||||
* @see GHMarketplaceListAccountBuilder#createRequest()
|
* @see GHMarketplaceListAccountBuilder#createRequest()
|
||||||
*/
|
*/
|
||||||
public class GHMarketplacePendingChange {
|
public class GHMarketplacePendingChange extends GitHubInteractiveObject {
|
||||||
private GitHub root;
|
|
||||||
private long id;
|
private long id;
|
||||||
@SuppressFBWarnings(value = "UWF_UNWRITTEN_FIELD", justification = "Field comes from JSON deserialization")
|
@SuppressFBWarnings(value = "UWF_UNWRITTEN_FIELD", justification = "Field comes from JSON deserialization")
|
||||||
private Long unitCount;
|
private Long unitCount;
|
||||||
@@ -68,7 +67,7 @@ public class GHMarketplacePendingChange {
|
|||||||
* @return the effective date
|
* @return the effective date
|
||||||
*/
|
*/
|
||||||
public Date getEffectiveDate() {
|
public Date getEffectiveDate() {
|
||||||
return GitHub.parseDate(effectiveDate);
|
return GitHubClient.parseDate(effectiveDate);
|
||||||
}
|
}
|
||||||
|
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -11,9 +11,7 @@ import java.util.List;
|
|||||||
* @author Paulo Miguel Almeida
|
* @author Paulo Miguel Almeida
|
||||||
* @see GitHub#listMarketplacePlans()
|
* @see GitHub#listMarketplacePlans()
|
||||||
*/
|
*/
|
||||||
public class GHMarketplacePlan {
|
public class GHMarketplacePlan extends GitHubInteractiveObject {
|
||||||
|
|
||||||
private GitHub root;
|
|
||||||
private String url;
|
private String url;
|
||||||
private String accountsUrl;
|
private String accountsUrl;
|
||||||
private long id;
|
private long id;
|
||||||
@@ -47,7 +45,7 @@ public class GHMarketplacePlan {
|
|||||||
* @return the url
|
* @return the url
|
||||||
*/
|
*/
|
||||||
public URL getUrl() {
|
public URL getUrl() {
|
||||||
return GitHub.parseURL(url);
|
return GitHubClient.parseURL(url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|||||||
@@ -10,9 +10,8 @@ import java.util.Date;
|
|||||||
* @author Paulo Miguel Almeida
|
* @author Paulo Miguel Almeida
|
||||||
* @see GHMarketplaceListAccountBuilder#createRequest() GHMarketplaceListAccountBuilder#createRequest()
|
* @see GHMarketplaceListAccountBuilder#createRequest() GHMarketplaceListAccountBuilder#createRequest()
|
||||||
*/
|
*/
|
||||||
public class GHMarketplacePurchase {
|
public class GHMarketplacePurchase extends GitHubInteractiveObject {
|
||||||
|
|
||||||
private GitHub root;
|
|
||||||
private String billingCycle;
|
private String billingCycle;
|
||||||
private String nextBillingDate;
|
private String nextBillingDate;
|
||||||
private boolean onFreeTrial;
|
private boolean onFreeTrial;
|
||||||
@@ -52,7 +51,7 @@ public class GHMarketplacePurchase {
|
|||||||
* @return the next billing date
|
* @return the next billing date
|
||||||
*/
|
*/
|
||||||
public Date getNextBillingDate() {
|
public Date getNextBillingDate() {
|
||||||
return GitHub.parseDate(nextBillingDate);
|
return GitHubClient.parseDate(nextBillingDate);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -70,7 +69,7 @@ public class GHMarketplacePurchase {
|
|||||||
* @return the free trial ends on
|
* @return the free trial ends on
|
||||||
*/
|
*/
|
||||||
public Date getFreeTrialEndsOn() {
|
public Date getFreeTrialEndsOn() {
|
||||||
return GitHub.parseDate(freeTrialEndsOn);
|
return GitHubClient.parseDate(freeTrialEndsOn);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -88,7 +87,7 @@ public class GHMarketplacePurchase {
|
|||||||
* @return the updated at
|
* @return the updated at
|
||||||
*/
|
*/
|
||||||
public Date getUpdatedAt() {
|
public Date getUpdatedAt() {
|
||||||
return GitHub.parseDate(updatedAt);
|
return GitHubClient.parseDate(updatedAt);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|||||||
@@ -10,8 +10,7 @@ import java.util.Date;
|
|||||||
* @author Paulo Miguel Almeida
|
* @author Paulo Miguel Almeida
|
||||||
* @see GitHub#getMyMarketplacePurchases()
|
* @see GitHub#getMyMarketplacePurchases()
|
||||||
*/
|
*/
|
||||||
public class GHMarketplaceUserPurchase {
|
public class GHMarketplaceUserPurchase extends GitHubInteractiveObject {
|
||||||
protected GitHub root;
|
|
||||||
private String billingCycle;
|
private String billingCycle;
|
||||||
private String nextBillingDate;
|
private String nextBillingDate;
|
||||||
private boolean onFreeTrial;
|
private boolean onFreeTrial;
|
||||||
@@ -54,7 +53,7 @@ public class GHMarketplaceUserPurchase {
|
|||||||
* @return the next billing date
|
* @return the next billing date
|
||||||
*/
|
*/
|
||||||
public Date getNextBillingDate() {
|
public Date getNextBillingDate() {
|
||||||
return GitHub.parseDate(nextBillingDate);
|
return GitHubClient.parseDate(nextBillingDate);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -72,7 +71,7 @@ public class GHMarketplaceUserPurchase {
|
|||||||
* @return the free trial ends on
|
* @return the free trial ends on
|
||||||
*/
|
*/
|
||||||
public Date getFreeTrialEndsOn() {
|
public Date getFreeTrialEndsOn() {
|
||||||
return GitHub.parseDate(freeTrialEndsOn);
|
return GitHubClient.parseDate(freeTrialEndsOn);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -90,7 +89,7 @@ public class GHMarketplaceUserPurchase {
|
|||||||
* @return the updated at
|
* @return the updated at
|
||||||
*/
|
*/
|
||||||
public Date getUpdatedAt() {
|
public Date getUpdatedAt() {
|
||||||
return GitHub.parseDate(updatedAt);
|
return GitHubClient.parseDate(updatedAt);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|||||||
@@ -10,9 +10,7 @@ import java.util.Locale;
|
|||||||
* @author Kohsuke Kawaguchi
|
* @author Kohsuke Kawaguchi
|
||||||
* @see GHMyself#listOrgMemberships() GHMyself#listOrgMemberships()
|
* @see GHMyself#listOrgMemberships() GHMyself#listOrgMemberships()
|
||||||
*/
|
*/
|
||||||
public class GHMembership /* extends GHObject --- but it doesn't have id, created_at, etc. */ {
|
public class GHMembership extends GitHubInteractiveObject {
|
||||||
GitHub root;
|
|
||||||
|
|
||||||
String url;
|
String url;
|
||||||
String state;
|
String state;
|
||||||
String role;
|
String role;
|
||||||
@@ -25,7 +23,7 @@ public class GHMembership /* extends GHObject --- but it doesn't have id, create
|
|||||||
* @return the url
|
* @return the url
|
||||||
*/
|
*/
|
||||||
public URL getUrl() {
|
public URL getUrl() {
|
||||||
return GitHub.parseURL(url);
|
return GitHubClient.parseURL(url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -84,11 +82,6 @@ public class GHMembership /* extends GHObject --- but it doesn't have id, create
|
|||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
static void wrap(GHMembership[] page, GitHub root) {
|
|
||||||
for (GHMembership m : page)
|
|
||||||
m.wrap(root);
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Role of a user in an organization.
|
* Role of a user in an organization.
|
||||||
*/
|
*/
|
||||||
|
|||||||
@@ -11,7 +11,6 @@ import java.util.Locale;
|
|||||||
* @author Yusuke Kokubo
|
* @author Yusuke Kokubo
|
||||||
*/
|
*/
|
||||||
public class GHMilestone extends GHObject {
|
public class GHMilestone extends GHObject {
|
||||||
GitHub root;
|
|
||||||
GHRepository owner;
|
GHRepository owner;
|
||||||
|
|
||||||
GHUser creator;
|
GHUser creator;
|
||||||
@@ -56,7 +55,7 @@ public class GHMilestone extends GHObject {
|
|||||||
public Date getDueOn() {
|
public Date getDueOn() {
|
||||||
if (due_on == null)
|
if (due_on == null)
|
||||||
return null;
|
return null;
|
||||||
return GitHub.parseDate(due_on);
|
return GitHubClient.parseDate(due_on);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -67,7 +66,7 @@ public class GHMilestone extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public Date getClosedAt() throws IOException {
|
public Date getClosedAt() throws IOException {
|
||||||
return GitHub.parseDate(closed_at);
|
return GitHubClient.parseDate(closed_at);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -116,7 +115,7 @@ public class GHMilestone extends GHObject {
|
|||||||
}
|
}
|
||||||
|
|
||||||
public URL getHtmlUrl() {
|
public URL getHtmlUrl() {
|
||||||
return GitHub.parseURL(html_url);
|
return GitHubClient.parseURL(html_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -195,7 +194,7 @@ public class GHMilestone extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void setDueOn(Date dueOn) throws IOException {
|
public void setDueOn(Date dueOn) throws IOException {
|
||||||
edit("due_on", GitHub.printDate(dueOn));
|
edit("due_on", GitHubClient.printDate(dueOn));
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|||||||
@@ -2,7 +2,6 @@ package org.kohsuke.github;
|
|||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.util.ArrayList;
|
import java.util.ArrayList;
|
||||||
import java.util.Arrays;
|
|
||||||
import java.util.Collections;
|
import java.util.Collections;
|
||||||
import java.util.HashSet;
|
import java.util.HashSet;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
@@ -71,8 +70,7 @@ public class GHMyself extends GHUser {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public List<GHEmail> getEmails2() throws IOException {
|
public List<GHEmail> getEmails2() throws IOException {
|
||||||
GHEmail[] addresses = root.createRequest().withUrlPath("/user/emails").fetchArray(GHEmail[].class);
|
return root.createRequest().withUrlPath("/user/emails").toIterable(GHEmail[].class, null).toList();
|
||||||
return Collections.unmodifiableList(Arrays.asList(addresses));
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -86,8 +84,7 @@ public class GHMyself extends GHUser {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public List<GHKey> getPublicKeys() throws IOException {
|
public List<GHKey> getPublicKeys() throws IOException {
|
||||||
return Collections.unmodifiableList(
|
return root.createRequest().withUrlPath("/user/keys").toIterable(GHKey[].class, null).toList();
|
||||||
Arrays.asList(root.createRequest().withUrlPath("/user/keys").fetchArray(GHKey[].class)));
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -101,8 +98,10 @@ public class GHMyself extends GHUser {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public List<GHVerifiedKey> getPublicVerifiedKeys() throws IOException {
|
public List<GHVerifiedKey> getPublicVerifiedKeys() throws IOException {
|
||||||
return Collections.unmodifiableList(Arrays.asList(
|
return root.createRequest()
|
||||||
root.createRequest().withUrlPath("/users/" + getLogin() + "/keys").fetchArray(GHVerifiedKey[].class)));
|
.withUrlPath("/users/" + getLogin() + "/keys")
|
||||||
|
.toIterable(GHVerifiedKey[].class, null)
|
||||||
|
.toList();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -115,7 +114,10 @@ public class GHMyself extends GHUser {
|
|||||||
public GHPersonSet<GHOrganization> getAllOrganizations() throws IOException {
|
public GHPersonSet<GHOrganization> getAllOrganizations() throws IOException {
|
||||||
GHPersonSet<GHOrganization> orgs = new GHPersonSet<GHOrganization>();
|
GHPersonSet<GHOrganization> orgs = new GHPersonSet<GHOrganization>();
|
||||||
Set<String> names = new HashSet<String>();
|
Set<String> names = new HashSet<String>();
|
||||||
for (GHOrganization o : root.createRequest().withUrlPath("/user/orgs").fetchArray(GHOrganization[].class)) {
|
for (GHOrganization o : root.createRequest()
|
||||||
|
.withUrlPath("/user/orgs")
|
||||||
|
.toIterable(GHOrganization[].class, null)
|
||||||
|
.toArray()) {
|
||||||
if (names.add(o.getLogin())) // in case of rumoured duplicates in the data
|
if (names.add(o.getLogin())) // in case of rumoured duplicates in the data
|
||||||
orgs.add(root.getOrganization(o.getLogin()));
|
orgs.add(root.getOrganization(o.getLogin()));
|
||||||
}
|
}
|
||||||
@@ -189,6 +191,7 @@ public class GHMyself extends GHUser {
|
|||||||
* @return the paged iterable
|
* @return the paged iterable
|
||||||
* @deprecated Use {@link #listRepositories()}
|
* @deprecated Use {@link #listRepositories()}
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public PagedIterable<GHRepository> listAllRepositories() {
|
public PagedIterable<GHRepository> listAllRepositories() {
|
||||||
return listRepositories();
|
return listRepositories();
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -23,9 +23,7 @@ import java.util.NoSuchElementException;
|
|||||||
* @see GitHub#listNotifications() GitHub#listNotifications()
|
* @see GitHub#listNotifications() GitHub#listNotifications()
|
||||||
* @see GHRepository#listNotifications() GHRepository#listNotifications()
|
* @see GHRepository#listNotifications() GHRepository#listNotifications()
|
||||||
*/
|
*/
|
||||||
public class GHNotificationStream implements Iterable<GHThread> {
|
public class GHNotificationStream extends GitHubInteractiveObject implements Iterable<GHThread> {
|
||||||
private final GitHub root;
|
|
||||||
|
|
||||||
private Boolean all, participating;
|
private Boolean all, participating;
|
||||||
private String since;
|
private String since;
|
||||||
private String apiUrl;
|
private String apiUrl;
|
||||||
@@ -79,7 +77,7 @@ public class GHNotificationStream implements Iterable<GHThread> {
|
|||||||
* @return the gh notification stream
|
* @return the gh notification stream
|
||||||
*/
|
*/
|
||||||
public GHNotificationStream since(Date dt) {
|
public GHNotificationStream since(Date dt) {
|
||||||
since = GitHub.printDate(dt);
|
since = GitHubClient.printDate(dt);
|
||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -180,7 +178,11 @@ public class GHNotificationStream implements Iterable<GHThread> {
|
|||||||
|
|
||||||
req.setHeader("If-Modified-Since", lastModified);
|
req.setHeader("If-Modified-Since", lastModified);
|
||||||
|
|
||||||
threads = req.withUrlPath(apiUrl).fetchArray(GHThread[].class);
|
Requester requester = req.withUrlPath(apiUrl);
|
||||||
|
GitHubResponse<GHThread[]> response = ((GitHubPageContentsIterable<GHThread>) requester
|
||||||
|
.toIterable(GHThread[].class, null)).toResponse();
|
||||||
|
threads = response.body();
|
||||||
|
|
||||||
if (threads == null) {
|
if (threads == null) {
|
||||||
threads = EMPTY_ARRAY; // if unmodified, we get empty array
|
threads = EMPTY_ARRAY; // if unmodified, we get empty array
|
||||||
} else {
|
} else {
|
||||||
@@ -189,27 +191,21 @@ public class GHNotificationStream implements Iterable<GHThread> {
|
|||||||
}
|
}
|
||||||
idx = threads.length - 1;
|
idx = threads.length - 1;
|
||||||
|
|
||||||
nextCheckTime = calcNextCheckTime();
|
nextCheckTime = calcNextCheckTime(response);
|
||||||
lastModified = req.getResponseHeader("Last-Modified");
|
lastModified = response.headerField("Last-Modified");
|
||||||
}
|
}
|
||||||
} catch (IOException e) {
|
} catch (IOException | InterruptedException e) {
|
||||||
throw new RuntimeException(e);
|
|
||||||
} catch (InterruptedException e) {
|
|
||||||
throw new RuntimeException(e);
|
throw new RuntimeException(e);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
private long calcNextCheckTime() {
|
private long calcNextCheckTime(GitHubResponse<GHThread[]> response) {
|
||||||
String v = req.getResponseHeader("X-Poll-Interval");
|
String v = response.headerField("X-Poll-Interval");
|
||||||
if (v == null)
|
if (v == null)
|
||||||
v = "60";
|
v = "60";
|
||||||
long seconds = Integer.parseInt(v);
|
long seconds = Integer.parseInt(v);
|
||||||
return System.currentTimeMillis() + seconds * 1000;
|
return System.currentTimeMillis() + seconds * 1000;
|
||||||
}
|
}
|
||||||
|
|
||||||
public void remove() {
|
|
||||||
throw new UnsupportedOperationException();
|
|
||||||
}
|
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -234,7 +230,7 @@ public class GHNotificationStream implements Iterable<GHThread> {
|
|||||||
public void markAsRead(long timestamp) throws IOException {
|
public void markAsRead(long timestamp) throws IOException {
|
||||||
final Requester req = root.createRequest();
|
final Requester req = root.createRequest();
|
||||||
if (timestamp >= 0)
|
if (timestamp >= 0)
|
||||||
req.with("last_read_at", GitHub.printDate(new Date(timestamp)));
|
req.with("last_read_at", GitHubClient.printDate(new Date(timestamp)));
|
||||||
req.withUrlPath(apiUrl).fetchHttpStatusCode();
|
req.withUrlPath(apiUrl).fetchHttpStatusCode();
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
@@ -1,5 +1,6 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import com.fasterxml.jackson.annotation.JacksonInject;
|
||||||
import com.infradna.tool.bridge_method_injector.WithBridgeMethods;
|
import com.infradna.tool.bridge_method_injector.WithBridgeMethods;
|
||||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
import org.apache.commons.lang3.builder.ReflectionToStringBuilder;
|
import org.apache.commons.lang3.builder.ReflectionToStringBuilder;
|
||||||
@@ -19,20 +20,35 @@ import javax.annotation.CheckForNull;
|
|||||||
*/
|
*/
|
||||||
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public abstract class GHObject {
|
public abstract class GHObject extends GitHubInteractiveObject {
|
||||||
/**
|
/**
|
||||||
* Capture response HTTP headers on the state object.
|
* Capture response HTTP headers on the state object.
|
||||||
*/
|
*/
|
||||||
protected Map<String, List<String>> responseHeaderFields;
|
protected transient Map<String, List<String>> responseHeaderFields;
|
||||||
|
|
||||||
protected String url;
|
private String url;
|
||||||
protected long id;
|
|
||||||
protected String created_at;
|
private long id;
|
||||||
protected String updated_at;
|
private String nodeId;
|
||||||
|
private String createdAt;
|
||||||
|
private String updatedAt;
|
||||||
|
|
||||||
GHObject() {
|
GHObject() {
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Called by Jackson
|
||||||
|
*
|
||||||
|
* @param responseInfo
|
||||||
|
* the {@link GitHubResponse.ResponseInfo} to get headers from.
|
||||||
|
*/
|
||||||
|
@JacksonInject
|
||||||
|
protected void setResponseHeaderFields(@CheckForNull GitHubResponse.ResponseInfo responseInfo) {
|
||||||
|
if (responseInfo != null) {
|
||||||
|
responseHeaderFields = responseInfo.headers();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Returns the HTTP response headers given along with the state of this object.
|
* Returns the HTTP response headers given along with the state of this object.
|
||||||
*
|
*
|
||||||
@@ -60,12 +76,12 @@ public abstract class GHObject {
|
|||||||
*/
|
*/
|
||||||
@WithBridgeMethods(value = String.class, adapterMethod = "createdAtStr")
|
@WithBridgeMethods(value = String.class, adapterMethod = "createdAtStr")
|
||||||
public Date getCreatedAt() throws IOException {
|
public Date getCreatedAt() throws IOException {
|
||||||
return GitHub.parseDate(created_at);
|
return GitHubClient.parseDate(createdAt);
|
||||||
}
|
}
|
||||||
|
|
||||||
@SuppressFBWarnings(value = "UPM_UNCALLED_PRIVATE_METHOD", justification = "Bridge method of getCreatedAt")
|
@SuppressFBWarnings(value = "UPM_UNCALLED_PRIVATE_METHOD", justification = "Bridge method of getCreatedAt")
|
||||||
private Object createdAtStr(Date id, Class type) {
|
private Object createdAtStr(Date id, Class type) {
|
||||||
return created_at;
|
return createdAt;
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -75,7 +91,7 @@ public abstract class GHObject {
|
|||||||
*/
|
*/
|
||||||
@WithBridgeMethods(value = String.class, adapterMethod = "urlToString")
|
@WithBridgeMethods(value = String.class, adapterMethod = "urlToString")
|
||||||
public URL getUrl() {
|
public URL getUrl() {
|
||||||
return GitHub.parseURL(url);
|
return GitHubClient.parseURL(url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -96,7 +112,18 @@ public abstract class GHObject {
|
|||||||
* on error
|
* on error
|
||||||
*/
|
*/
|
||||||
public Date getUpdatedAt() throws IOException {
|
public Date getUpdatedAt() throws IOException {
|
||||||
return GitHub.parseDate(updated_at);
|
return GitHubClient.parseDate(updatedAt);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get Global node_id from Github object.
|
||||||
|
*
|
||||||
|
* @see <a href="https://developer.github.com/v4/guides/using-global-node-ids/">Using Global Node IDs</a>
|
||||||
|
*
|
||||||
|
* @return Global Node ID.
|
||||||
|
*/
|
||||||
|
public String getNodeId() {
|
||||||
|
return nodeId;
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|||||||
@@ -22,6 +22,6 @@ class GHOrgHook extends GHHook {
|
|||||||
|
|
||||||
@Override
|
@Override
|
||||||
String getApiRoute() {
|
String getApiRoute() {
|
||||||
return String.format("/orgs/%s/hooks/%d", organization.getLogin(), id);
|
return String.format("/orgs/%s/hooks/%d", organization.getLogin(), getId());
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -10,7 +10,7 @@ import java.util.List;
|
|||||||
import java.util.Map;
|
import java.util.Map;
|
||||||
import java.util.TreeMap;
|
import java.util.TreeMap;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.INERTIA;
|
import static org.kohsuke.github.internal.Previews.INERTIA;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The type GHOrganization.
|
* The type GHOrganization.
|
||||||
@@ -40,6 +40,7 @@ public class GHOrganization extends GHPerson {
|
|||||||
* the io exception
|
* the io exception
|
||||||
* @deprecated Use {@link #createRepository(String)} that uses a builder pattern to let you control every aspect.
|
* @deprecated Use {@link #createRepository(String)} that uses a builder pattern to let you control every aspect.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public GHRepository createRepository(String name,
|
public GHRepository createRepository(String name,
|
||||||
String description,
|
String description,
|
||||||
String homepage,
|
String homepage,
|
||||||
@@ -69,6 +70,7 @@ public class GHOrganization extends GHPerson {
|
|||||||
* the io exception
|
* the io exception
|
||||||
* @deprecated Use {@link #createRepository(String)} that uses a builder pattern to let you control every aspect.
|
* @deprecated Use {@link #createRepository(String)} that uses a builder pattern to let you control every aspect.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public GHRepository createRepository(String name,
|
public GHRepository createRepository(String name,
|
||||||
String description,
|
String description,
|
||||||
String homepage,
|
String homepage,
|
||||||
@@ -95,7 +97,7 @@ public class GHOrganization extends GHPerson {
|
|||||||
* @return the gh create repository builder
|
* @return the gh create repository builder
|
||||||
*/
|
*/
|
||||||
public GHCreateRepositoryBuilder createRepository(String name) {
|
public GHCreateRepositoryBuilder createRepository(String name) {
|
||||||
return new GHCreateRepositoryBuilder(root, "/orgs/" + login + "/repos", name);
|
return new GHCreateRepositoryBuilder(name, root, "/orgs/" + login + "/repos");
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -126,6 +128,40 @@ public class GHOrganization extends GHPerson {
|
|||||||
.toIterable(GHTeam[].class, item -> item.wrapUp(this));
|
.toIterable(GHTeam[].class, item -> item.wrapUp(this));
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets a single team by ID.
|
||||||
|
*
|
||||||
|
* @param teamId
|
||||||
|
* id of the team that we want to query for
|
||||||
|
* @return the team
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*
|
||||||
|
* @deprecated Use {@link GHOrganization#getTeam(long)}
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
public GHTeam getTeam(int teamId) throws IOException {
|
||||||
|
return getTeam((long) teamId);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets a single team by ID.
|
||||||
|
*
|
||||||
|
* @param teamId
|
||||||
|
* id of the team that we want to query for
|
||||||
|
* @return the team
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*
|
||||||
|
* @see <a href= "https://developer.github.com/v3/teams/#get-team-by-name">documentation</a>
|
||||||
|
*/
|
||||||
|
public GHTeam getTeam(long teamId) throws IOException {
|
||||||
|
return root.createRequest()
|
||||||
|
.withUrlPath(String.format("/organizations/%d/team/%d", getId(), teamId))
|
||||||
|
.fetch(GHTeam.class)
|
||||||
|
.wrapUp(this);
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Finds a team that has the given name in its {@link GHTeam#getName()}
|
* Finds a team that has the given name in its {@link GHTeam#getName()}
|
||||||
*
|
*
|
||||||
@@ -151,13 +187,13 @@ public class GHOrganization extends GHPerson {
|
|||||||
* @return the team by slug
|
* @return the team by slug
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
|
* @see <a href= "https://developer.github.com/v3/teams/#get-team-by-name">documentation</a>
|
||||||
*/
|
*/
|
||||||
public GHTeam getTeamBySlug(String slug) throws IOException {
|
public GHTeam getTeamBySlug(String slug) throws IOException {
|
||||||
for (GHTeam t : listTeams()) {
|
return root.createRequest()
|
||||||
if (t.getSlug().equals(slug))
|
.withUrlPath(String.format("/orgs/%s/teams/%s", login, slug))
|
||||||
return t;
|
.fetch(GHTeam.class)
|
||||||
}
|
.wrapUp(this);
|
||||||
return null;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -255,7 +291,7 @@ public class GHOrganization extends GHPerson {
|
|||||||
* @deprecated use {@link #listMembers()}
|
* @deprecated use {@link #listMembers()}
|
||||||
*/
|
*/
|
||||||
public List<GHUser> getMembers() throws IOException {
|
public List<GHUser> getMembers() throws IOException {
|
||||||
return listMembers().asList();
|
return listMembers().toList();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -281,7 +317,7 @@ public class GHOrganization extends GHPerson {
|
|||||||
}
|
}
|
||||||
|
|
||||||
private PagedIterable<GHUser> listMembers(String suffix) throws IOException {
|
private PagedIterable<GHUser> listMembers(String suffix) throws IOException {
|
||||||
return listMembers(suffix, null);
|
return listMembers(suffix, null, null);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -294,13 +330,28 @@ public class GHOrganization extends GHPerson {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public PagedIterable<GHUser> listMembersWithFilter(String filter) throws IOException {
|
public PagedIterable<GHUser> listMembersWithFilter(String filter) throws IOException {
|
||||||
return listMembers("members", filter);
|
return listMembers("members", filter, null);
|
||||||
}
|
}
|
||||||
|
|
||||||
private PagedIterable<GHUser> listMembers(final String suffix, final String filter) throws IOException {
|
/**
|
||||||
String filterParams = (filter == null) ? "" : ("?filter=" + filter);
|
* List members with specified role paged iterable.
|
||||||
|
*
|
||||||
|
* @param role
|
||||||
|
* the role
|
||||||
|
* @return the paged iterable
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public PagedIterable<GHUser> listMembersWithRole(String role) throws IOException {
|
||||||
|
return listMembers("members", null, role);
|
||||||
|
}
|
||||||
|
|
||||||
|
private PagedIterable<GHUser> listMembers(final String suffix, final String filter, String role)
|
||||||
|
throws IOException {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
.withUrlPath(String.format("/orgs/%s/%s%s", login, suffix, filterParams))
|
.withUrlPath(String.format("/orgs/%s/%s", login, suffix))
|
||||||
|
.with("filter", filter)
|
||||||
|
.with("role", role)
|
||||||
.toIterable(GHUser[].class, item -> item.wrapUp(root));
|
.toIterable(GHUser[].class, item -> item.wrapUp(root));
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -370,7 +421,7 @@ public class GHOrganization extends GHPerson {
|
|||||||
* The enum Permission.
|
* The enum Permission.
|
||||||
*/
|
*/
|
||||||
public enum Permission {
|
public enum Permission {
|
||||||
ADMIN, PUSH, PULL
|
ADMIN, MAINTAIN, PUSH, TRIAGE, PULL
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|||||||
@@ -2,13 +2,14 @@ package org.kohsuke.github;
|
|||||||
|
|
||||||
import java.io.FileNotFoundException;
|
import java.io.FileNotFoundException;
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
|
import java.net.MalformedURLException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
import java.util.Arrays;
|
|
||||||
import java.util.Collections;
|
import java.util.Collections;
|
||||||
import java.util.Date;
|
import java.util.Date;
|
||||||
import java.util.Iterator;
|
import java.util.Iterator;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
import java.util.Map;
|
import java.util.Map;
|
||||||
|
import java.util.Optional;
|
||||||
import java.util.TreeMap;
|
import java.util.TreeMap;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -17,16 +18,18 @@ import java.util.TreeMap;
|
|||||||
* @author Kohsuke Kawaguchi
|
* @author Kohsuke Kawaguchi
|
||||||
*/
|
*/
|
||||||
public abstract class GHPerson extends GHObject {
|
public abstract class GHPerson extends GHObject {
|
||||||
/* package almost final */ GitHub root;
|
|
||||||
|
|
||||||
// core data fields that exist even for "small" user data (such as the user info in pull request)
|
// core data fields that exist even for "small" user data (such as the user info in pull request)
|
||||||
protected String login, avatar_url, gravatar_id;
|
protected String login, avatar_url;
|
||||||
|
|
||||||
// other fields (that only show up in full data)
|
// other fields (that only show up in full data)
|
||||||
protected String location, blog, email, name, company, type;
|
protected String location, blog, email, bio, name, company, type, twitter_username;
|
||||||
protected String html_url;
|
protected String html_url;
|
||||||
protected int followers, following, public_repos, public_gists;
|
protected int followers, following, public_repos, public_gists;
|
||||||
protected boolean site_admin;
|
protected boolean site_admin, hireable;
|
||||||
|
|
||||||
|
// other fields (that only show up in full data) that require privileged scope
|
||||||
|
protected Integer total_private_repos;
|
||||||
|
|
||||||
GHPerson wrapUp(GitHub root) {
|
GHPerson wrapUp(GitHub root) {
|
||||||
this.root = root;
|
this.root = root;
|
||||||
@@ -42,13 +45,16 @@ public abstract class GHPerson extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
protected synchronized void populate() throws IOException {
|
protected synchronized void populate() throws IOException {
|
||||||
if (created_at != null) {
|
if (super.getCreatedAt() != null) {
|
||||||
return; // already populated
|
return; // already populated
|
||||||
}
|
}
|
||||||
if (root == null || root.isOffline()) {
|
if (root == null || root.isOffline()) {
|
||||||
return; // cannot populate, will have to live with what we have
|
return; // cannot populate, will have to live with what we have
|
||||||
}
|
}
|
||||||
root.createRequest().withUrlPath(url).fetchInto(this);
|
URL url = getUrl();
|
||||||
|
if (url != null) {
|
||||||
|
root.createRequest().setRawUrlPath(url.toString()).fetchInto(this);
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -112,11 +118,17 @@ public abstract class GHPerson extends GHObject {
|
|||||||
*/
|
*/
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public synchronized Iterable<List<GHRepository>> iterateRepositories(final int pageSize) {
|
public synchronized Iterable<List<GHRepository>> iterateRepositories(final int pageSize) {
|
||||||
return new Iterable<List<GHRepository>>() {
|
return () -> {
|
||||||
public Iterator<List<GHRepository>> iterator() {
|
final PagedIterator<GHRepository> pager;
|
||||||
final Iterator<GHRepository[]> pager = root.createRequest()
|
try {
|
||||||
.withUrlPath("users", login, "repos")
|
GitHubPageIterator<GHRepository[]> iterator = GitHubPageIterator.create(root.getClient(),
|
||||||
.asIterator(GHRepository[].class, pageSize);
|
GHRepository[].class,
|
||||||
|
root.createRequest().withUrlPath("users", login, "repos").build(),
|
||||||
|
pageSize);
|
||||||
|
pager = new PagedIterator<>(iterator, item -> item.wrap(root));
|
||||||
|
} catch (MalformedURLException e) {
|
||||||
|
throw new GHException("Unable to build GitHub API URL", e);
|
||||||
|
}
|
||||||
|
|
||||||
return new Iterator<List<GHRepository>>() {
|
return new Iterator<List<GHRepository>>() {
|
||||||
public boolean hasNext() {
|
public boolean hasNext() {
|
||||||
@@ -124,17 +136,9 @@ public abstract class GHPerson extends GHObject {
|
|||||||
}
|
}
|
||||||
|
|
||||||
public List<GHRepository> next() {
|
public List<GHRepository> next() {
|
||||||
GHRepository[] batch = pager.next();
|
return pager.nextPage();
|
||||||
for (GHRepository r : batch)
|
|
||||||
r.root = root;
|
|
||||||
return Arrays.asList(batch);
|
|
||||||
}
|
|
||||||
|
|
||||||
public void remove() {
|
|
||||||
throw new UnsupportedOperationException();
|
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
}
|
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -149,10 +153,7 @@ public abstract class GHPerson extends GHObject {
|
|||||||
*/
|
*/
|
||||||
public GHRepository getRepository(String name) throws IOException {
|
public GHRepository getRepository(String name) throws IOException {
|
||||||
try {
|
try {
|
||||||
return root.createRequest()
|
return GHRepository.read(root, login, name);
|
||||||
.withUrlPath("/repos/" + login + '/' + name)
|
|
||||||
.fetch(GHRepository.class)
|
|
||||||
.wrap(root);
|
|
||||||
} catch (FileNotFoundException e) {
|
} catch (FileNotFoundException e) {
|
||||||
return null;
|
return null;
|
||||||
}
|
}
|
||||||
@@ -173,22 +174,18 @@ public abstract class GHPerson extends GHObject {
|
|||||||
* @return the gravatar id
|
* @return the gravatar id
|
||||||
* @deprecated No longer available in the v3 API.
|
* @deprecated No longer available in the v3 API.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public String getGravatarId() {
|
public String getGravatarId() {
|
||||||
return gravatar_id;
|
return "";
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Returns a string like 'https://secure.gravatar.com/avatar/0cb9832a01c22c083390f3c5dcb64105' that indicates the
|
* Returns a string of the avatar image URL.
|
||||||
* avatar image URL.
|
|
||||||
*
|
*
|
||||||
* @return the avatar url
|
* @return the avatar url
|
||||||
*/
|
*/
|
||||||
public String getAvatarUrl() {
|
public String getAvatarUrl() {
|
||||||
if (avatar_url != null)
|
|
||||||
return avatar_url;
|
return avatar_url;
|
||||||
if (gravatar_id != null)
|
|
||||||
return "https://secure.gravatar.com/avatar/" + gravatar_id;
|
|
||||||
return null;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -236,6 +233,18 @@ public abstract class GHPerson extends GHObject {
|
|||||||
return location;
|
return location;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the Twitter Username of this user, like "GitHub"
|
||||||
|
*
|
||||||
|
* @return the Twitter username
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public String getTwitterUsername() throws IOException {
|
||||||
|
populate();
|
||||||
|
return twitter_username;
|
||||||
|
}
|
||||||
|
|
||||||
public Date getCreatedAt() throws IOException {
|
public Date getCreatedAt() throws IOException {
|
||||||
populate();
|
populate();
|
||||||
return super.getCreatedAt();
|
return super.getCreatedAt();
|
||||||
@@ -260,7 +269,7 @@ public abstract class GHPerson extends GHObject {
|
|||||||
|
|
||||||
@Override
|
@Override
|
||||||
public URL getHtmlUrl() {
|
public URL getHtmlUrl() {
|
||||||
return GitHub.parseURL(html_url);
|
return GitHubClient.parseURL(html_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -346,4 +355,16 @@ public abstract class GHPerson extends GHObject {
|
|||||||
populate();
|
populate();
|
||||||
return site_admin;
|
return site_admin;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets total private repo count.
|
||||||
|
*
|
||||||
|
* @return the total private repo count
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public Optional<Integer> getTotalPrivateRepoCount() throws IOException {
|
||||||
|
populate();
|
||||||
|
return Optional.ofNullable(total_private_repos);
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -28,7 +28,7 @@ import java.io.IOException;
|
|||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
import java.util.Locale;
|
import java.util.Locale;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.INERTIA;
|
import static org.kohsuke.github.internal.Previews.INERTIA;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* A GitHub project.
|
* A GitHub project.
|
||||||
@@ -37,12 +37,10 @@ import static org.kohsuke.github.Previews.INERTIA;
|
|||||||
* @see <a href="https://developer.github.com/v3/projects/">Projects</a>
|
* @see <a href="https://developer.github.com/v3/projects/">Projects</a>
|
||||||
*/
|
*/
|
||||||
public class GHProject extends GHObject {
|
public class GHProject extends GHObject {
|
||||||
protected GitHub root;
|
|
||||||
protected GHObject owner;
|
protected GHObject owner;
|
||||||
|
|
||||||
private String owner_url;
|
private String owner_url;
|
||||||
private String html_url;
|
private String html_url;
|
||||||
private String node_id;
|
|
||||||
private String name;
|
private String name;
|
||||||
private String body;
|
private String body;
|
||||||
private int number;
|
private int number;
|
||||||
@@ -51,7 +49,7 @@ public class GHProject extends GHObject {
|
|||||||
|
|
||||||
@Override
|
@Override
|
||||||
public URL getHtmlUrl() throws IOException {
|
public URL getHtmlUrl() throws IOException {
|
||||||
return GitHub.parseURL(html_url);
|
return GitHubClient.parseURL(html_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -81,10 +79,8 @@ public class GHProject extends GHObject {
|
|||||||
} else if (owner_url.contains("/users/")) {
|
} else if (owner_url.contains("/users/")) {
|
||||||
owner = root.createRequest().withUrlPath(getOwnerUrl().getPath()).fetch(GHUser.class).wrapUp(root);
|
owner = root.createRequest().withUrlPath(getOwnerUrl().getPath()).fetch(GHUser.class).wrapUp(root);
|
||||||
} else if (owner_url.contains("/repos/")) {
|
} else if (owner_url.contains("/repos/")) {
|
||||||
owner = root.createRequest()
|
String[] pathElements = getOwnerUrl().getPath().split("/");
|
||||||
.withUrlPath(getOwnerUrl().getPath())
|
owner = GHRepository.read(root, pathElements[1], pathElements[2]);
|
||||||
.fetch(GHRepository.class)
|
|
||||||
.wrap(root);
|
|
||||||
}
|
}
|
||||||
} catch (FileNotFoundException e) {
|
} catch (FileNotFoundException e) {
|
||||||
return null;
|
return null;
|
||||||
@@ -99,16 +95,18 @@ public class GHProject extends GHObject {
|
|||||||
* @return the owner url
|
* @return the owner url
|
||||||
*/
|
*/
|
||||||
public URL getOwnerUrl() {
|
public URL getOwnerUrl() {
|
||||||
return GitHub.parseURL(owner_url);
|
return GitHubClient.parseURL(owner_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets node id.
|
* Gets node id.
|
||||||
*
|
*
|
||||||
|
* @deprecated Use {@link GHObject#getNodeId()}
|
||||||
* @return the node id
|
* @return the node id
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public String getNode_id() {
|
public String getNode_id() {
|
||||||
return node_id;
|
return getNodeId();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -191,7 +189,7 @@ public class GHProject extends GHObject {
|
|||||||
* @return the api route
|
* @return the api route
|
||||||
*/
|
*/
|
||||||
protected String getApiRoute() {
|
protected String getApiRoute() {
|
||||||
return "/projects/" + id;
|
return "/projects/" + getId();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -290,7 +288,7 @@ public class GHProject extends GHObject {
|
|||||||
final GHProject project = this;
|
final GHProject project = this;
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
.withPreview(INERTIA)
|
.withPreview(INERTIA)
|
||||||
.withUrlPath(String.format("/projects/%d/columns", id))
|
.withUrlPath(String.format("/projects/%d/columns", getId()))
|
||||||
.toIterable(GHProjectColumn[].class, item -> item.wrap(project));
|
.toIterable(GHProjectColumn[].class, item -> item.wrap(project));
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -308,7 +306,7 @@ public class GHProject extends GHObject {
|
|||||||
.method("POST")
|
.method("POST")
|
||||||
.withPreview(INERTIA)
|
.withPreview(INERTIA)
|
||||||
.with("name", name)
|
.with("name", name)
|
||||||
.withUrlPath(String.format("/projects/%d/columns", id))
|
.withUrlPath(String.format("/projects/%d/columns", getId()))
|
||||||
.fetch(GHProjectColumn.class)
|
.fetch(GHProjectColumn.class)
|
||||||
.wrap(this);
|
.wrap(this);
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -6,7 +6,7 @@ import java.io.FileNotFoundException;
|
|||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.INERTIA;
|
import static org.kohsuke.github.internal.Previews.INERTIA;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The type GHProjectCard.
|
* The type GHProjectCard.
|
||||||
@@ -14,7 +14,6 @@ import static org.kohsuke.github.Previews.INERTIA;
|
|||||||
* @author Gunnar Skjold
|
* @author Gunnar Skjold
|
||||||
*/
|
*/
|
||||||
public class GHProjectCard extends GHObject {
|
public class GHProjectCard extends GHObject {
|
||||||
private GitHub root;
|
|
||||||
private GHProject project;
|
private GHProject project;
|
||||||
private GHProjectColumn column;
|
private GHProjectColumn column;
|
||||||
|
|
||||||
@@ -149,7 +148,7 @@ public class GHProjectCard extends GHObject {
|
|||||||
* @return the content url
|
* @return the content url
|
||||||
*/
|
*/
|
||||||
public URL getContentUrl() {
|
public URL getContentUrl() {
|
||||||
return GitHub.parseURL(content_url);
|
return GitHubClient.parseURL(content_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -158,7 +157,7 @@ public class GHProjectCard extends GHObject {
|
|||||||
* @return the project url
|
* @return the project url
|
||||||
*/
|
*/
|
||||||
public URL getProjectUrl() {
|
public URL getProjectUrl() {
|
||||||
return GitHub.parseURL(project_url);
|
return GitHubClient.parseURL(project_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -167,7 +166,7 @@ public class GHProjectCard extends GHObject {
|
|||||||
* @return the column url
|
* @return the column url
|
||||||
*/
|
*/
|
||||||
public URL getColumnUrl() {
|
public URL getColumnUrl() {
|
||||||
return GitHub.parseURL(column_url);
|
return GitHubClient.parseURL(column_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -213,7 +212,7 @@ public class GHProjectCard extends GHObject {
|
|||||||
* @return the api route
|
* @return the api route
|
||||||
*/
|
*/
|
||||||
protected String getApiRoute() {
|
protected String getApiRoute() {
|
||||||
return String.format("/projects/columns/cards/%d", id);
|
return String.format("/projects/columns/cards/%d", getId());
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|||||||
@@ -4,7 +4,7 @@ import java.io.FileNotFoundException;
|
|||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.INERTIA;
|
import static org.kohsuke.github.internal.Previews.INERTIA;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The type GHProjectColumn.
|
* The type GHProjectColumn.
|
||||||
@@ -12,7 +12,6 @@ import static org.kohsuke.github.Previews.INERTIA;
|
|||||||
* @author Gunnar Skjold
|
* @author Gunnar Skjold
|
||||||
*/
|
*/
|
||||||
public class GHProjectColumn extends GHObject {
|
public class GHProjectColumn extends GHObject {
|
||||||
protected GitHub root;
|
|
||||||
protected GHProject project;
|
protected GHProject project;
|
||||||
|
|
||||||
private String name;
|
private String name;
|
||||||
@@ -90,7 +89,7 @@ public class GHProjectColumn extends GHObject {
|
|||||||
* @return the project url
|
* @return the project url
|
||||||
*/
|
*/
|
||||||
public URL getProjectUrl() {
|
public URL getProjectUrl() {
|
||||||
return GitHub.parseURL(project_url);
|
return GitHubClient.parseURL(project_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -115,7 +114,7 @@ public class GHProjectColumn extends GHObject {
|
|||||||
* @return the api route
|
* @return the api route
|
||||||
*/
|
*/
|
||||||
protected String getApiRoute() {
|
protected String getApiRoute() {
|
||||||
return String.format("/projects/columns/%d", id);
|
return String.format("/projects/columns/%d", getId());
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -139,7 +138,7 @@ public class GHProjectColumn extends GHObject {
|
|||||||
final GHProjectColumn column = this;
|
final GHProjectColumn column = this;
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
.withPreview(INERTIA)
|
.withPreview(INERTIA)
|
||||||
.withUrlPath(String.format("/projects/columns/%d/cards", id))
|
.withUrlPath(String.format("/projects/columns/%d/cards", getId()))
|
||||||
.toIterable(GHProjectCard[].class, item -> item.wrap(column));
|
.toIterable(GHProjectCard[].class, item -> item.wrap(column));
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -157,7 +156,7 @@ public class GHProjectColumn extends GHObject {
|
|||||||
.method("POST")
|
.method("POST")
|
||||||
.withPreview(INERTIA)
|
.withPreview(INERTIA)
|
||||||
.with("note", note)
|
.with("note", note)
|
||||||
.withUrlPath(String.format("/projects/columns/%d/cards", id))
|
.withUrlPath(String.format("/projects/columns/%d/cards", getId()))
|
||||||
.fetch(GHProjectCard.class)
|
.fetch(GHProjectCard.class)
|
||||||
.wrap(this);
|
.wrap(this);
|
||||||
}
|
}
|
||||||
@@ -177,7 +176,7 @@ public class GHProjectColumn extends GHObject {
|
|||||||
.withPreview(INERTIA)
|
.withPreview(INERTIA)
|
||||||
.with("content_type", issue instanceof GHPullRequest ? "PullRequest" : "Issue")
|
.with("content_type", issue instanceof GHPullRequest ? "PullRequest" : "Issue")
|
||||||
.with("content_id", issue.getId())
|
.with("content_id", issue.getId())
|
||||||
.withUrlPath(String.format("/projects/columns/%d/cards", id))
|
.withUrlPath(String.format("/projects/columns/%d/cards", getId()))
|
||||||
.fetch(GHProjectCard.class)
|
.fetch(GHProjectCard.class)
|
||||||
.wrap(this);
|
.wrap(this);
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -23,18 +23,21 @@
|
|||||||
*/
|
*/
|
||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import org.apache.commons.lang3.StringUtils;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
import java.util.ArrayList;
|
import java.util.ArrayList;
|
||||||
import java.util.Arrays;
|
import java.util.Arrays;
|
||||||
import java.util.Collection;
|
|
||||||
import java.util.Collections;
|
import java.util.Collections;
|
||||||
import java.util.Date;
|
import java.util.Date;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
import javax.annotation.CheckForNull;
|
import javax.annotation.CheckForNull;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.SHADOW_CAT;
|
import static org.kohsuke.github.internal.Previews.LYDIAN;
|
||||||
|
import static org.kohsuke.github.internal.Previews.SHADOW_CAT;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* A pull request.
|
* A pull request.
|
||||||
@@ -69,13 +72,6 @@ public class GHPullRequest extends GHIssue implements Refreshable {
|
|||||||
private GHUser[] requested_reviewers;
|
private GHUser[] requested_reviewers;
|
||||||
private GHTeam[] requested_teams;
|
private GHTeam[] requested_teams;
|
||||||
|
|
||||||
/**
|
|
||||||
* GitHub doesn't return some properties of {@link GHIssue} when requesting the GET on the 'pulls' API route as
|
|
||||||
* opposed to 'issues' API route. This flag remembers whether we made the GET call on the 'issues' route on this
|
|
||||||
* object to fill in those missing details
|
|
||||||
*/
|
|
||||||
private transient boolean fetchedIssueDetails;
|
|
||||||
|
|
||||||
GHPullRequest wrapUp(GHRepository owner) {
|
GHPullRequest wrapUp(GHRepository owner) {
|
||||||
this.wrap(owner);
|
this.wrap(owner);
|
||||||
return wrapUp(owner.root);
|
return wrapUp(owner.root);
|
||||||
@@ -99,6 +95,12 @@ public class GHPullRequest extends GHIssue implements Refreshable {
|
|||||||
|
|
||||||
@Override
|
@Override
|
||||||
protected String getApiRoute() {
|
protected String getApiRoute() {
|
||||||
|
if (owner == null) {
|
||||||
|
// Issues returned from search to do not have an owner. Attempt to use url.
|
||||||
|
final URL url = Objects.requireNonNull(getUrl(), "Missing instance URL!");
|
||||||
|
return StringUtils.prependIfMissing(url.toString().replace(root.getApiUrl(), ""), "/");
|
||||||
|
|
||||||
|
}
|
||||||
return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/pulls/" + number;
|
return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/pulls/" + number;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -108,7 +110,7 @@ public class GHPullRequest extends GHIssue implements Refreshable {
|
|||||||
* @return the patch url
|
* @return the patch url
|
||||||
*/
|
*/
|
||||||
public URL getPatchUrl() {
|
public URL getPatchUrl() {
|
||||||
return GitHub.parseURL(patch_url);
|
return GitHubClient.parseURL(patch_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -117,7 +119,7 @@ public class GHPullRequest extends GHIssue implements Refreshable {
|
|||||||
* @return the issue url
|
* @return the issue url
|
||||||
*/
|
*/
|
||||||
public URL getIssueUrl() {
|
public URL getIssueUrl() {
|
||||||
return GitHub.parseURL(issue_url);
|
return GitHubClient.parseURL(issue_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -156,7 +158,7 @@ public class GHPullRequest extends GHIssue implements Refreshable {
|
|||||||
* @return the diff url
|
* @return the diff url
|
||||||
*/
|
*/
|
||||||
public URL getDiffUrl() {
|
public URL getDiffUrl() {
|
||||||
return GitHub.parseURL(diff_url);
|
return GitHubClient.parseURL(diff_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -165,13 +167,7 @@ public class GHPullRequest extends GHIssue implements Refreshable {
|
|||||||
* @return the merged at
|
* @return the merged at
|
||||||
*/
|
*/
|
||||||
public Date getMergedAt() {
|
public Date getMergedAt() {
|
||||||
return GitHub.parseDate(merged_at);
|
return GitHubClient.parseDate(merged_at);
|
||||||
}
|
|
||||||
|
|
||||||
@Override
|
|
||||||
public Collection<GHLabel> getLabels() throws IOException {
|
|
||||||
fetchIssue();
|
|
||||||
return super.getLabels();
|
|
||||||
}
|
}
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
@@ -381,10 +377,14 @@ public class GHPullRequest extends GHIssue implements Refreshable {
|
|||||||
* Repopulates this object.
|
* Repopulates this object.
|
||||||
*/
|
*/
|
||||||
public void refresh() throws IOException {
|
public void refresh() throws IOException {
|
||||||
if (root.isOffline()) {
|
if (root == null || root.isOffline()) {
|
||||||
return; // cannot populate, will have to live with what we have
|
return; // cannot populate, will have to live with what we have
|
||||||
}
|
}
|
||||||
root.createRequest().withPreview(SHADOW_CAT).withUrlPath(url).fetchInto(this).wrapUp(owner);
|
|
||||||
|
URL url = getUrl();
|
||||||
|
if (url != null) {
|
||||||
|
root.createRequest().withPreview(SHADOW_CAT).setRawUrlPath(url.toString()).fetchInto(this).wrapUp(owner);
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -447,6 +447,7 @@ public class GHPullRequest extends GHIssue implements Refreshable {
|
|||||||
* the io exception
|
* the io exception
|
||||||
* @deprecated Use {@link #createReview()}
|
* @deprecated Use {@link #createReview()}
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public GHPullRequestReview createReview(String body,
|
public GHPullRequestReview createReview(String body,
|
||||||
@CheckForNull GHPullRequestReviewState event,
|
@CheckForNull GHPullRequestReviewState event,
|
||||||
GHPullRequestReviewComment... comments) throws IOException {
|
GHPullRequestReviewComment... comments) throws IOException {
|
||||||
@@ -467,6 +468,7 @@ public class GHPullRequest extends GHIssue implements Refreshable {
|
|||||||
* the io exception
|
* the io exception
|
||||||
* @deprecated Use {@link #createReview()}
|
* @deprecated Use {@link #createReview()}
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public GHPullRequestReview createReview(String body,
|
public GHPullRequestReview createReview(String body,
|
||||||
@CheckForNull GHPullRequestReviewState event,
|
@CheckForNull GHPullRequestReviewState event,
|
||||||
List<GHPullRequestReviewComment> comments) throws IOException {
|
List<GHPullRequestReviewComment> comments) throws IOException {
|
||||||
@@ -550,6 +552,41 @@ public class GHPullRequest extends GHIssue implements Refreshable {
|
|||||||
.send();
|
.send();
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Set the base branch on the pull request
|
||||||
|
*
|
||||||
|
* @param newBaseBranch
|
||||||
|
* the name of the new base branch
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
* @return the updated pull request
|
||||||
|
*/
|
||||||
|
public GHPullRequest setBaseBranch(String newBaseBranch) throws IOException {
|
||||||
|
return root.createRequest()
|
||||||
|
.method("PATCH")
|
||||||
|
.with("base", newBaseBranch)
|
||||||
|
.withUrlPath(getApiRoute())
|
||||||
|
.fetch(GHPullRequest.class)
|
||||||
|
.wrapUp(root);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Updates the branch. The same as pressing the button in the web GUI.
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
@Preview(LYDIAN)
|
||||||
|
@Deprecated
|
||||||
|
public void updateBranch() throws IOException {
|
||||||
|
root.createRequest()
|
||||||
|
.withPreview(LYDIAN)
|
||||||
|
.method("PUT")
|
||||||
|
.with("expected_head_sha", head.getSha())
|
||||||
|
.withUrlPath(getApiRoute() + "/update-branch")
|
||||||
|
.send();
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Merge this pull request.
|
* Merge this pull request.
|
||||||
* <p>
|
* <p>
|
||||||
@@ -611,10 +648,4 @@ public class GHPullRequest extends GHIssue implements Refreshable {
|
|||||||
MERGE, SQUASH, REBASE
|
MERGE, SQUASH, REBASE
|
||||||
}
|
}
|
||||||
|
|
||||||
private void fetchIssue() throws IOException {
|
|
||||||
if (!fetchedIssueDetails) {
|
|
||||||
root.createRequest().withUrlPath(getIssuesApiRoute()).fetchInto(this);
|
|
||||||
fetchedIssueDetails = true;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
|
|||||||
86
src/main/java/org/kohsuke/github/GHPullRequestChanges.java
Normal file
86
src/main/java/org/kohsuke/github/GHPullRequestChanges.java
Normal file
@@ -0,0 +1,86 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Wrapper to define changed fields on pull_request action="edited"
|
||||||
|
*
|
||||||
|
* @see GHEventPayload.PullRequest
|
||||||
|
*/
|
||||||
|
@SuppressFBWarnings("UWF_UNWRITTEN_FIELD")
|
||||||
|
public class GHPullRequestChanges {
|
||||||
|
|
||||||
|
private GHCommitPointer base;
|
||||||
|
private GHFrom title;
|
||||||
|
private GHFrom body;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Old target branch for pull request.
|
||||||
|
*
|
||||||
|
* @return old target branch info (or null if not changed)
|
||||||
|
*/
|
||||||
|
public GHCommitPointer getBase() {
|
||||||
|
return base;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Old pull request title.
|
||||||
|
*
|
||||||
|
* @return old pull request title (or null if not changed)
|
||||||
|
*/
|
||||||
|
public GHFrom getTitle() {
|
||||||
|
return title;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Old pull request body.
|
||||||
|
*
|
||||||
|
* @return old pull request body (or null if not changed)
|
||||||
|
*/
|
||||||
|
public GHFrom getBody() {
|
||||||
|
return body;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* @see org.kohsuke.github.GHCommitPointer
|
||||||
|
*/
|
||||||
|
public static class GHCommitPointer {
|
||||||
|
private GHFrom ref;
|
||||||
|
private GHFrom sha;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Named ref to the commit. This (from value) appears to be a "short ref" that doesn't include "refs/heads/"
|
||||||
|
* portion.
|
||||||
|
*
|
||||||
|
* @return the ref
|
||||||
|
*/
|
||||||
|
public GHFrom getRef() {
|
||||||
|
return ref;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* SHA1 of the commit.
|
||||||
|
*
|
||||||
|
* @return sha
|
||||||
|
*/
|
||||||
|
public GHFrom getSha() {
|
||||||
|
return sha;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Wrapper for changed values.
|
||||||
|
*/
|
||||||
|
public static class GHFrom {
|
||||||
|
private String from;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Previous value that was changed.
|
||||||
|
*
|
||||||
|
* @return previous value
|
||||||
|
*/
|
||||||
|
public String getFrom() {
|
||||||
|
return from;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -75,7 +75,7 @@ public class GHPullRequestCommitDetail {
|
|||||||
* @return the url
|
* @return the url
|
||||||
*/
|
*/
|
||||||
public URL getUrl() {
|
public URL getUrl() {
|
||||||
return GitHub.parseURL(url);
|
return GitHubClient.parseURL(url);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -125,7 +125,7 @@ public class GHPullRequestCommitDetail {
|
|||||||
* @return the url
|
* @return the url
|
||||||
*/
|
*/
|
||||||
public URL getUrl() {
|
public URL getUrl() {
|
||||||
return GitHub.parseURL(url);
|
return GitHubClient.parseURL(url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -161,7 +161,7 @@ public class GHPullRequestCommitDetail {
|
|||||||
* @return the url
|
* @return the url
|
||||||
*/
|
*/
|
||||||
public URL getUrl() {
|
public URL getUrl() {
|
||||||
return GitHub.parseURL(url);
|
return GitHubClient.parseURL(url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -170,7 +170,7 @@ public class GHPullRequestCommitDetail {
|
|||||||
* @return the html url
|
* @return the html url
|
||||||
*/
|
*/
|
||||||
public URL getHtml_url() {
|
public URL getHtml_url() {
|
||||||
return GitHub.parseURL(html_url);
|
return GitHubClient.parseURL(html_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -214,7 +214,7 @@ public class GHPullRequestCommitDetail {
|
|||||||
* @return the api url
|
* @return the api url
|
||||||
*/
|
*/
|
||||||
public URL getApiUrl() {
|
public URL getApiUrl() {
|
||||||
return GitHub.parseURL(url);
|
return GitHubClient.parseURL(url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -223,7 +223,7 @@ public class GHPullRequestCommitDetail {
|
|||||||
* @return the url
|
* @return the url
|
||||||
*/
|
*/
|
||||||
public URL getUrl() {
|
public URL getUrl() {
|
||||||
return GitHub.parseURL(html_url);
|
return GitHubClient.parseURL(html_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -232,7 +232,7 @@ public class GHPullRequestCommitDetail {
|
|||||||
* @return the comments url
|
* @return the comments url
|
||||||
*/
|
*/
|
||||||
public URL getCommentsUrl() {
|
public URL getCommentsUrl() {
|
||||||
return GitHub.parseURL(comments_url);
|
return GitHubClient.parseURL(comments_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|||||||
@@ -105,7 +105,7 @@ public class GHPullRequestFileDetail {
|
|||||||
* @return the blob url
|
* @return the blob url
|
||||||
*/
|
*/
|
||||||
public URL getBlobUrl() {
|
public URL getBlobUrl() {
|
||||||
return GitHub.parseURL(blob_url);
|
return GitHubClient.parseURL(blob_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -114,7 +114,7 @@ public class GHPullRequestFileDetail {
|
|||||||
* @return the raw url
|
* @return the raw url
|
||||||
*/
|
*/
|
||||||
public URL getRawUrl() {
|
public URL getRawUrl() {
|
||||||
return GitHub.parseURL(raw_url);
|
return GitHubClient.parseURL(raw_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -123,7 +123,7 @@ public class GHPullRequestFileDetail {
|
|||||||
* @return the contents url
|
* @return the contents url
|
||||||
*/
|
*/
|
||||||
public URL getContentsUrl() {
|
public URL getContentsUrl() {
|
||||||
return GitHub.parseURL(contents_url);
|
return GitHubClient.parseURL(contents_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|||||||
@@ -1,6 +1,6 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.SHADOW_CAT;
|
import static org.kohsuke.github.internal.Previews.SHADOW_CAT;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Lists up pull requests with some filtering and sorting.
|
* Lists up pull requests with some filtering and sorting.
|
||||||
|
|||||||
@@ -46,6 +46,7 @@ public class GHPullRequestReview extends GHObject {
|
|||||||
private String commit_id;
|
private String commit_id;
|
||||||
private GHPullRequestReviewState state;
|
private GHPullRequestReviewState state;
|
||||||
private String submitted_at;
|
private String submitted_at;
|
||||||
|
private String html_url;
|
||||||
|
|
||||||
GHPullRequestReview wrapUp(GHPullRequest owner) {
|
GHPullRequestReview wrapUp(GHPullRequest owner) {
|
||||||
this.owner = owner;
|
this.owner = owner;
|
||||||
@@ -102,7 +103,7 @@ public class GHPullRequestReview extends GHObject {
|
|||||||
|
|
||||||
@Override
|
@Override
|
||||||
public URL getHtmlUrl() {
|
public URL getHtmlUrl() {
|
||||||
return null;
|
return GitHubClient.parseURL(html_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -111,7 +112,7 @@ public class GHPullRequestReview extends GHObject {
|
|||||||
* @return the api route
|
* @return the api route
|
||||||
*/
|
*/
|
||||||
protected String getApiRoute() {
|
protected String getApiRoute() {
|
||||||
return owner.getApiRoute() + "/reviews/" + id;
|
return owner.getApiRoute() + "/reviews/" + getId();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -122,7 +123,7 @@ public class GHPullRequestReview extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public Date getSubmittedAt() throws IOException {
|
public Date getSubmittedAt() throws IOException {
|
||||||
return GitHub.parseDate(submitted_at);
|
return GitHubClient.parseDate(submitted_at);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -145,6 +146,7 @@ public class GHPullRequestReview extends GHObject {
|
|||||||
* @deprecated Former preview method that changed when it got public. Left here for backward compatibility. Use
|
* @deprecated Former preview method that changed when it got public. Left here for backward compatibility. Use
|
||||||
* {@link #submit(String, GHPullRequestReviewEvent)}
|
* {@link #submit(String, GHPullRequestReviewEvent)}
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void submit(String body, GHPullRequestReviewState state) throws IOException {
|
public void submit(String body, GHPullRequestReviewState state) throws IOException {
|
||||||
submit(body, state.toEvent());
|
submit(body, state.toEvent());
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -28,7 +28,7 @@ import java.net.URL;
|
|||||||
|
|
||||||
import javax.annotation.CheckForNull;
|
import javax.annotation.CheckForNull;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.*;
|
import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Review comment to the pull request
|
* Review comment to the pull request
|
||||||
@@ -44,6 +44,7 @@ public class GHPullRequestReviewComment extends GHObject implements Reactable {
|
|||||||
private String body;
|
private String body;
|
||||||
private GHUser user;
|
private GHUser user;
|
||||||
private String path;
|
private String path;
|
||||||
|
private String html_url;
|
||||||
private int position = -1;
|
private int position = -1;
|
||||||
private int original_position = -1;
|
private int original_position = -1;
|
||||||
private long in_reply_to_id = -1L;
|
private long in_reply_to_id = -1L;
|
||||||
@@ -60,6 +61,7 @@ public class GHPullRequestReviewComment extends GHObject implements Reactable {
|
|||||||
* @return the gh pull request review comment
|
* @return the gh pull request review comment
|
||||||
* @deprecated You should be using {@link GHPullRequestReviewBuilder#comment(String, String, int)}
|
* @deprecated You should be using {@link GHPullRequestReviewBuilder#comment(String, String, int)}
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public static GHPullRequestReviewComment draft(String body, String path, int position) {
|
public static GHPullRequestReviewComment draft(String body, String path, int position) {
|
||||||
GHPullRequestReviewComment result = new GHPullRequestReviewComment();
|
GHPullRequestReviewComment result = new GHPullRequestReviewComment();
|
||||||
result.body = body;
|
result.body = body;
|
||||||
@@ -142,7 +144,7 @@ public class GHPullRequestReviewComment extends GHObject implements Reactable {
|
|||||||
|
|
||||||
@Override
|
@Override
|
||||||
public URL getHtmlUrl() {
|
public URL getHtmlUrl() {
|
||||||
return null;
|
return GitHubClient.parseURL(html_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -151,7 +153,20 @@ public class GHPullRequestReviewComment extends GHObject implements Reactable {
|
|||||||
* @return the api route
|
* @return the api route
|
||||||
*/
|
*/
|
||||||
protected String getApiRoute() {
|
protected String getApiRoute() {
|
||||||
return "/repos/" + owner.getRepository().getFullName() + "/pulls/comments/" + id;
|
return getApiRoute(false);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets api route.
|
||||||
|
*
|
||||||
|
* @param includePullNumber
|
||||||
|
* if true, includes the owning pull request's number in the route.
|
||||||
|
*
|
||||||
|
* @return the api route
|
||||||
|
*/
|
||||||
|
protected String getApiRoute(boolean includePullNumber) {
|
||||||
|
return "/repos/" + owner.getRepository().getFullName() + "/pulls"
|
||||||
|
+ (includePullNumber ? "/" + owner.getNumber() : "") + "/comments/" + getId();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -190,13 +205,12 @@ public class GHPullRequestReviewComment extends GHObject implements Reactable {
|
|||||||
return owner.root.createRequest()
|
return owner.root.createRequest()
|
||||||
.method("POST")
|
.method("POST")
|
||||||
.with("body", body)
|
.with("body", body)
|
||||||
.with("in_reply_to", getId())
|
.withUrlPath(getApiRoute(true) + "/replies")
|
||||||
.withUrlPath(getApiRoute() + "/comments")
|
|
||||||
.fetch(GHPullRequestReviewComment.class)
|
.fetch(GHPullRequestReviewComment.class)
|
||||||
.wrapUp(owner);
|
.wrapUp(owner);
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHReaction createReaction(ReactionContent content) throws IOException {
|
public GHReaction createReaction(ReactionContent content) throws IOException {
|
||||||
return owner.root.createRequest()
|
return owner.root.createRequest()
|
||||||
@@ -208,7 +222,7 @@ public class GHPullRequestReviewComment extends GHObject implements Reactable {
|
|||||||
.wrap(owner.root);
|
.wrap(owner.root);
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public PagedIterable<GHReaction> listReactions() {
|
public PagedIterable<GHReaction> listReactions() {
|
||||||
return owner.root.createRequest()
|
return owner.root.createRequest()
|
||||||
|
|||||||
@@ -7,8 +7,7 @@ package org.kohsuke.github;
|
|||||||
* the type parameter
|
* the type parameter
|
||||||
* @author Kohsuke Kawaguchi
|
* @author Kohsuke Kawaguchi
|
||||||
*/
|
*/
|
||||||
public abstract class GHQueryBuilder<T> {
|
public abstract class GHQueryBuilder<T> extends GitHubInteractiveObject {
|
||||||
protected final GitHub root;
|
|
||||||
protected final Requester req;
|
protected final Requester req;
|
||||||
|
|
||||||
GHQueryBuilder(GitHub root) {
|
GHQueryBuilder(GitHub root) {
|
||||||
|
|||||||
@@ -1,10 +1,12 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import com.fasterxml.jackson.annotation.JacksonInject;
|
||||||
import com.fasterxml.jackson.annotation.JsonCreator;
|
import com.fasterxml.jackson.annotation.JsonCreator;
|
||||||
import com.fasterxml.jackson.annotation.JsonProperty;
|
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
import org.apache.commons.lang3.StringUtils;
|
import org.apache.commons.lang3.StringUtils;
|
||||||
|
|
||||||
|
import java.time.Duration;
|
||||||
import java.time.ZonedDateTime;
|
import java.time.ZonedDateTime;
|
||||||
import java.time.format.DateTimeFormatter;
|
import java.time.format.DateTimeFormatter;
|
||||||
import java.time.format.DateTimeParseException;
|
import java.time.format.DateTimeParseException;
|
||||||
@@ -28,7 +30,7 @@ public class GHRateLimit {
|
|||||||
/**
|
/**
|
||||||
* Remaining calls that can be made.
|
* Remaining calls that can be made.
|
||||||
*
|
*
|
||||||
* @deprecated This value should never have been made public. Use {@link #getRemaining()}
|
* @deprecated This field should never have been made public. Use {@link #getRemaining()}
|
||||||
*/
|
*/
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public int remaining;
|
public int remaining;
|
||||||
@@ -36,7 +38,7 @@ public class GHRateLimit {
|
|||||||
/**
|
/**
|
||||||
* Allotted API call per hour.
|
* Allotted API call per hour.
|
||||||
*
|
*
|
||||||
* @deprecated This value should never have been made public. Use {@link #getLimit()}
|
* @deprecated This field should never have been made public. Use {@link #getLimit()}
|
||||||
*/
|
*/
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public int limit;
|
public int limit;
|
||||||
@@ -47,7 +49,7 @@ public class GHRateLimit {
|
|||||||
* date. To use this field in any meaningful way, it must be converted to a long using {@link Date#getTime()}
|
* date. To use this field in any meaningful way, it must be converted to a long using {@link Date#getTime()}
|
||||||
* multiplied by 1000.
|
* multiplied by 1000.
|
||||||
*
|
*
|
||||||
* @deprecated This value should never have been made public. Use {@link #getResetDate()}
|
* @deprecated This field should never have been made public. Use {@link #getResetDate()}
|
||||||
*/
|
*/
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public Date reset;
|
public Date reset;
|
||||||
@@ -64,17 +66,58 @@ public class GHRateLimit {
|
|||||||
@Nonnull
|
@Nonnull
|
||||||
private final Record integrationManifest;
|
private final Record integrationManifest;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The default GHRateLimit provided to new {@link GitHubClient}s.
|
||||||
|
*
|
||||||
|
* Contains all expired records that will cause {@link GitHubClient#rateLimit(RateLimitTarget)} to refresh with new
|
||||||
|
* data when called.
|
||||||
|
*
|
||||||
|
* Private, but made internal for testing.
|
||||||
|
*/
|
||||||
@Nonnull
|
@Nonnull
|
||||||
static GHRateLimit Unknown() {
|
static final GHRateLimit DEFAULT = new GHRateLimit(UnknownLimitRecord.DEFAULT,
|
||||||
return new GHRateLimit(new UnknownLimitRecord(),
|
UnknownLimitRecord.DEFAULT,
|
||||||
new UnknownLimitRecord(),
|
UnknownLimitRecord.DEFAULT,
|
||||||
new UnknownLimitRecord(),
|
UnknownLimitRecord.DEFAULT);
|
||||||
new UnknownLimitRecord());
|
|
||||||
}
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Creates a new {@link GHRateLimit} from a single record for the specified endpoint with place holders for other
|
||||||
|
* records.
|
||||||
|
*
|
||||||
|
* This is used to create {@link GHRateLimit} instances that can merged with other instances.
|
||||||
|
*
|
||||||
|
* @param record
|
||||||
|
* the rate limit record. Can be a regular {@link Record} constructed from header information or an
|
||||||
|
* {@link UnknownLimitRecord} placeholder.
|
||||||
|
* @param rateLimitTarget
|
||||||
|
* which rate limit record to fill
|
||||||
|
* @return a new {@link GHRateLimit} instance containing the supplied record
|
||||||
|
*/
|
||||||
@Nonnull
|
@Nonnull
|
||||||
static GHRateLimit fromHeaderRecord(Record header) {
|
static GHRateLimit fromRecord(@Nonnull Record record, @Nonnull RateLimitTarget rateLimitTarget) {
|
||||||
return new GHRateLimit(header, new UnknownLimitRecord(), new UnknownLimitRecord(), new UnknownLimitRecord());
|
if (rateLimitTarget == RateLimitTarget.CORE || rateLimitTarget == RateLimitTarget.NONE) {
|
||||||
|
return new GHRateLimit(record,
|
||||||
|
UnknownLimitRecord.DEFAULT,
|
||||||
|
UnknownLimitRecord.DEFAULT,
|
||||||
|
UnknownLimitRecord.DEFAULT);
|
||||||
|
} else if (rateLimitTarget == RateLimitTarget.SEARCH) {
|
||||||
|
return new GHRateLimit(UnknownLimitRecord.DEFAULT,
|
||||||
|
record,
|
||||||
|
UnknownLimitRecord.DEFAULT,
|
||||||
|
UnknownLimitRecord.DEFAULT);
|
||||||
|
} else if (rateLimitTarget == RateLimitTarget.GRAPHQL) {
|
||||||
|
return new GHRateLimit(UnknownLimitRecord.DEFAULT,
|
||||||
|
UnknownLimitRecord.DEFAULT,
|
||||||
|
record,
|
||||||
|
UnknownLimitRecord.DEFAULT);
|
||||||
|
} else if (rateLimitTarget == RateLimitTarget.INTEGRATION_MANIFEST) {
|
||||||
|
return new GHRateLimit(UnknownLimitRecord.DEFAULT,
|
||||||
|
UnknownLimitRecord.DEFAULT,
|
||||||
|
UnknownLimitRecord.DEFAULT,
|
||||||
|
record);
|
||||||
|
} else {
|
||||||
|
throw new IllegalArgumentException("Unknown rate limit target: " + rateLimitTarget.toString());
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@JsonCreator
|
@JsonCreator
|
||||||
@@ -141,7 +184,7 @@ public class GHRateLimit {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Whether the rate limit reset date for this instance has passed.
|
* Whether the reset date for the Core API rate limit has passed.
|
||||||
*
|
*
|
||||||
* @return true if the rate limit reset date has passed. Otherwise false.
|
* @return true if the rate limit reset date has passed. Otherwise false.
|
||||||
* @since 1.100
|
* @since 1.100
|
||||||
@@ -151,7 +194,7 @@ public class GHRateLimit {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The core object provides your rate limit status for all non-search-related resources in the REST API.
|
* The core object provides the rate limit status for all non-search-related resources in the REST API.
|
||||||
*
|
*
|
||||||
* @return a rate limit record
|
* @return a rate limit record
|
||||||
* @since 1.100
|
* @since 1.100
|
||||||
@@ -162,42 +205,43 @@ public class GHRateLimit {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The search object provides your rate limit status for the Search API. TODO: integrate with header limit updating.
|
* The search record provides the rate limit status for the Search API.
|
||||||
* Issue #605.
|
|
||||||
*
|
*
|
||||||
* @return a rate limit record
|
* @return a rate limit record
|
||||||
|
* @since 1.115
|
||||||
*/
|
*/
|
||||||
@Nonnull
|
@Nonnull
|
||||||
Record getSearch() {
|
public Record getSearch() {
|
||||||
return search;
|
return search;
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The graphql object provides your rate limit status for the GraphQL API. TODO: integrate with header limit
|
* The graphql record provides the rate limit status for the GraphQL API.
|
||||||
* updating. Issue #605.
|
|
||||||
*
|
*
|
||||||
* @return a rate limit record
|
* @return a rate limit record
|
||||||
|
* @since 1.115
|
||||||
*/
|
*/
|
||||||
@Nonnull
|
@Nonnull
|
||||||
Record getGraphQL() {
|
public Record getGraphQL() {
|
||||||
return graphql;
|
return graphql;
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The integration_manifest object provides your rate limit status for the GitHub App Manifest code conversion
|
* The integration manifest record provides the rate limit status for the GitHub App Manifest code conversion
|
||||||
* endpoint. TODO: integrate with header limit updating. Issue #605.
|
* endpoint.
|
||||||
*
|
*
|
||||||
* @return a rate limit record
|
* @return a rate limit record
|
||||||
|
* @since 1.115
|
||||||
*/
|
*/
|
||||||
@Nonnull
|
@Nonnull
|
||||||
Record getIntegrationManifest() {
|
public Record getIntegrationManifest() {
|
||||||
return integrationManifest;
|
return integrationManifest;
|
||||||
}
|
}
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
public String toString() {
|
public String toString() {
|
||||||
return "GHRateLimit {" + "core " + getCore().toString() + "search " + getSearch().toString() + "graphql "
|
return "GHRateLimit {" + "core " + getCore().toString() + ", search " + getSearch().toString() + ", graphql "
|
||||||
+ getGraphQL().toString() + "integrationManifest " + getIntegrationManifest().toString() + '}';
|
+ getGraphQL().toString() + ", integrationManifest " + getIntegrationManifest().toString() + "}";
|
||||||
}
|
}
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
@@ -219,23 +263,112 @@ public class GHRateLimit {
|
|||||||
return Objects.hash(getCore(), getSearch(), getGraphQL(), getIntegrationManifest());
|
return Objects.hash(getCore(), getSearch(), getGraphQL(), getIntegrationManifest());
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Merge a {@link GHRateLimit} with another one to create a new {@link GHRateLimit} keeping the latest
|
||||||
|
* {@link Record}s from each.
|
||||||
|
*
|
||||||
|
* @param newLimit
|
||||||
|
* {@link GHRateLimit} with potentially updated {@link Record}s.
|
||||||
|
* @return a merged {@link GHRateLimit} with the latest {@link Record}s from these two instances. If the merged
|
||||||
|
* instance is equal to the current instance, the current instance is returned.
|
||||||
|
*/
|
||||||
|
@Nonnull
|
||||||
|
GHRateLimit getMergedRateLimit(@Nonnull GHRateLimit newLimit) {
|
||||||
|
|
||||||
|
GHRateLimit merged = new GHRateLimit(getCore().currentOrUpdated(newLimit.getCore()),
|
||||||
|
getSearch().currentOrUpdated(newLimit.getSearch()),
|
||||||
|
getGraphQL().currentOrUpdated(newLimit.getGraphQL()),
|
||||||
|
getIntegrationManifest().currentOrUpdated(newLimit.getIntegrationManifest()));
|
||||||
|
|
||||||
|
if (merged.equals(this)) {
|
||||||
|
merged = this;
|
||||||
|
}
|
||||||
|
|
||||||
|
return merged;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the specified {@link Record}.
|
||||||
|
*
|
||||||
|
* {@link RateLimitTarget#NONE} will return {@link UnknownLimitRecord#DEFAULT} to prevent any clients from
|
||||||
|
* accidentally waiting on that record to reset before continuing.
|
||||||
|
*
|
||||||
|
* @param rateLimitTarget
|
||||||
|
* the target rate limit record
|
||||||
|
* @return the target {@link Record} from this instance.
|
||||||
|
*/
|
||||||
|
@Nonnull
|
||||||
|
Record getRecord(@Nonnull RateLimitTarget rateLimitTarget) {
|
||||||
|
if (rateLimitTarget == RateLimitTarget.CORE) {
|
||||||
|
return getCore();
|
||||||
|
} else if (rateLimitTarget == RateLimitTarget.SEARCH) {
|
||||||
|
return getSearch();
|
||||||
|
} else if (rateLimitTarget == RateLimitTarget.GRAPHQL) {
|
||||||
|
return getGraphQL();
|
||||||
|
} else if (rateLimitTarget == RateLimitTarget.INTEGRATION_MANIFEST) {
|
||||||
|
return getIntegrationManifest();
|
||||||
|
} else if (rateLimitTarget == RateLimitTarget.NONE) {
|
||||||
|
return UnknownLimitRecord.DEFAULT;
|
||||||
|
} else {
|
||||||
|
throw new IllegalArgumentException("Unknown rate limit target: " + rateLimitTarget.toString());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* A limit record used as a placeholder when the the actual limit is not known.
|
* A limit record used as a placeholder when the the actual limit is not known.
|
||||||
* <p>
|
|
||||||
* Has a large limit and long duration so that it will doesn't expire too often.
|
|
||||||
*
|
*
|
||||||
* @since 1.100
|
* @since 1.100
|
||||||
*/
|
*/
|
||||||
public static class UnknownLimitRecord extends Record {
|
public static class UnknownLimitRecord extends Record {
|
||||||
|
|
||||||
// One hour
|
private static final long defaultUnknownLimitResetSeconds = Duration.ofSeconds(30).getSeconds();
|
||||||
private static final long unknownLimitResetSeconds = 60L * 60L;
|
|
||||||
|
/**
|
||||||
|
* The number of seconds until a {@link UnknownLimitRecord} will expire.
|
||||||
|
*
|
||||||
|
* This is set to a somewhat short duration, rather than a long one. This avoids
|
||||||
|
* {@link {@link GitHubClient#rateLimit(RateLimitTarget)}} requesting rate limit updates continuously, but also
|
||||||
|
* avoids holding on to stale unknown records indefinitely.
|
||||||
|
*
|
||||||
|
* When merging {@link GHRateLimit} instances, {@link UnknownLimitRecord}s will be superseded by incoming
|
||||||
|
* regular {@link Record}s.
|
||||||
|
*
|
||||||
|
* @see GHRateLimit#getMergedRateLimit(GHRateLimit)
|
||||||
|
*/
|
||||||
|
static long unknownLimitResetSeconds = defaultUnknownLimitResetSeconds;
|
||||||
|
|
||||||
static final int unknownLimit = 1000000;
|
static final int unknownLimit = 1000000;
|
||||||
static final int unknownRemaining = 999999;
|
static final int unknownRemaining = 999999;
|
||||||
|
|
||||||
private UnknownLimitRecord() {
|
// The default UnknownLimitRecord is an expired record.
|
||||||
super(unknownLimit, unknownRemaining, System.currentTimeMillis() / 1000L + unknownLimitResetSeconds);
|
private static final UnknownLimitRecord DEFAULT = new UnknownLimitRecord(Long.MIN_VALUE);
|
||||||
|
|
||||||
|
// The starting current UnknownLimitRecord is an expired record.
|
||||||
|
private static UnknownLimitRecord current = DEFAULT;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Create a new unknown record that resets at the specified time.
|
||||||
|
*
|
||||||
|
* @param resetEpochSeconds
|
||||||
|
* the epoch second time when this record will expire.
|
||||||
|
*/
|
||||||
|
private UnknownLimitRecord(long resetEpochSeconds) {
|
||||||
|
super(unknownLimit, unknownRemaining, resetEpochSeconds);
|
||||||
|
}
|
||||||
|
|
||||||
|
static synchronized Record current() {
|
||||||
|
if (current.isExpired()) {
|
||||||
|
current = new UnknownLimitRecord(System.currentTimeMillis() / 1000L + unknownLimitResetSeconds);
|
||||||
|
}
|
||||||
|
return current;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Reset the current UnknownLimitRecord. For use during testing only.
|
||||||
|
*/
|
||||||
|
static synchronized void reset() {
|
||||||
|
current = DEFAULT;
|
||||||
|
unknownLimitResetSeconds = defaultUnknownLimitResetSeconds;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -251,7 +384,7 @@ public class GHRateLimit {
|
|||||||
private final int remaining;
|
private final int remaining;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Allotted API call per hour.
|
* Allotted API call per time period.
|
||||||
*/
|
*/
|
||||||
private final int limit;
|
private final int limit;
|
||||||
|
|
||||||
@@ -266,11 +399,14 @@ public class GHRateLimit {
|
|||||||
private final long createdAtEpochSeconds = System.currentTimeMillis() / 1000;
|
private final long createdAtEpochSeconds = System.currentTimeMillis() / 1000;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The calculated time at which the rate limit will reset. Recalculated if {@link #recalculateResetDate} is
|
* The date at which the rate limit will reset, adjusted to local machine time if the local machine's clock not
|
||||||
* called.
|
* synchronized with to the same clock as the GitHub server.
|
||||||
|
*
|
||||||
|
* @see #calculateResetDate(String)
|
||||||
|
* @see #getResetDate()
|
||||||
*/
|
*/
|
||||||
@Nonnull
|
@Nonnull
|
||||||
private Date resetDate;
|
private final Date resetDate;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Instantiates a new Record.
|
* Instantiates a new Record.
|
||||||
@@ -282,7 +418,6 @@ public class GHRateLimit {
|
|||||||
* @param resetEpochSeconds
|
* @param resetEpochSeconds
|
||||||
* the reset epoch seconds
|
* the reset epoch seconds
|
||||||
*/
|
*/
|
||||||
@JsonCreator
|
|
||||||
public Record(@JsonProperty(value = "limit", required = true) int limit,
|
public Record(@JsonProperty(value = "limit", required = true) int limit,
|
||||||
@JsonProperty(value = "remaining", required = true) int remaining,
|
@JsonProperty(value = "remaining", required = true) int remaining,
|
||||||
@JsonProperty(value = "reset", required = true) long resetEpochSeconds) {
|
@JsonProperty(value = "reset", required = true) long resetEpochSeconds) {
|
||||||
@@ -290,7 +425,7 @@ public class GHRateLimit {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Instantiates a new Record.
|
* Instantiates a new Record. Called by Jackson data binding or during header parsing.
|
||||||
*
|
*
|
||||||
* @param limit
|
* @param limit
|
||||||
* the limit
|
* the limit
|
||||||
@@ -298,26 +433,99 @@ public class GHRateLimit {
|
|||||||
* the remaining
|
* the remaining
|
||||||
* @param resetEpochSeconds
|
* @param resetEpochSeconds
|
||||||
* the reset epoch seconds
|
* the reset epoch seconds
|
||||||
* @param updatedAt
|
* @param responseInfo
|
||||||
* the updated at
|
* the response info
|
||||||
*/
|
*/
|
||||||
@SuppressFBWarnings(value = "URF_UNREAD_PUBLIC_OR_PROTECTED_FIELD", justification = "Deprecated")
|
@JsonCreator
|
||||||
public Record(int limit, int remaining, long resetEpochSeconds, @CheckForNull String updatedAt) {
|
Record(@JsonProperty(value = "limit", required = true) int limit,
|
||||||
|
@JsonProperty(value = "remaining", required = true) int remaining,
|
||||||
|
@JsonProperty(value = "reset", required = true) long resetEpochSeconds,
|
||||||
|
@JacksonInject @CheckForNull GitHubResponse.ResponseInfo responseInfo) {
|
||||||
this.limit = limit;
|
this.limit = limit;
|
||||||
this.remaining = remaining;
|
this.remaining = remaining;
|
||||||
this.resetEpochSeconds = resetEpochSeconds;
|
this.resetEpochSeconds = resetEpochSeconds;
|
||||||
this.resetDate = recalculateResetDate(updatedAt);
|
String updatedAt = null;
|
||||||
|
if (responseInfo != null) {
|
||||||
|
updatedAt = responseInfo.headerField("Date");
|
||||||
|
}
|
||||||
|
this.resetDate = calculateResetDate(updatedAt);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Recalculates the reset date using the server response date to calculate a time duration and then add that to
|
* Determine if the current {@link Record} is outdated compared to another. Rate Limit dates are only accurate
|
||||||
* the local created time for this record.
|
* to the second, so we look at other information in the record as well.
|
||||||
|
*
|
||||||
|
* {@link Record}s with earlier {@link #getResetEpochSeconds()} are replaced by those with later.
|
||||||
|
* {@link Record}s with the same {@link #getResetEpochSeconds()} are replaced by those with less remaining
|
||||||
|
* count.
|
||||||
|
*
|
||||||
|
* {@link UnknownLimitRecord}s compare with each other like regular {@link Record}s.
|
||||||
|
*
|
||||||
|
* {@link Record}s are replaced by {@link UnknownLimitRecord}s only when the current {@link Record} is expired
|
||||||
|
* and the {@link UnknownLimitRecord} is not. Otherwise Regular {@link Record}s are not replaced by
|
||||||
|
* {@link UnknownLimitRecord}s.
|
||||||
|
*
|
||||||
|
* Expiration is only considered after other checks, meaning expired records may sometimes be replaced by other
|
||||||
|
* expired records.
|
||||||
|
*
|
||||||
|
* @param other
|
||||||
|
* the other {@link Record}
|
||||||
|
* @return the {@link Record} that is most current
|
||||||
|
*/
|
||||||
|
Record currentOrUpdated(@Nonnull Record other) {
|
||||||
|
// This set of checks avoids most calls to isExpired()
|
||||||
|
// Depends on UnknownLimitRecord.current() to prevent continuous updating of GHRateLimit rateLimit()
|
||||||
|
if (getResetEpochSeconds() > other.getResetEpochSeconds()
|
||||||
|
|| (getResetEpochSeconds() == other.getResetEpochSeconds()
|
||||||
|
&& getRemaining() <= other.getRemaining())) {
|
||||||
|
// If the current record has a later reset
|
||||||
|
// or the current record has the same reset and fewer or same requests remaining
|
||||||
|
// Then it is most recent
|
||||||
|
return this;
|
||||||
|
} else if (!(other instanceof UnknownLimitRecord)) {
|
||||||
|
// If the above is not the case that means other has a later reset
|
||||||
|
// or the same resent and fewer requests remaining.
|
||||||
|
// If the other record is not an unknown record, the the other is more recent
|
||||||
|
return other;
|
||||||
|
} else if (this.isExpired() && !other.isExpired()) {
|
||||||
|
// The other is an unknown record.
|
||||||
|
// If the current record has expired and the other hasn't, return the other.
|
||||||
|
return other;
|
||||||
|
}
|
||||||
|
|
||||||
|
// If none of the above, the current record is most valid.
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Recalculates the {@link #resetDate} relative to the local machine clock.
|
||||||
|
* <p>
|
||||||
|
* {@link RateLimitChecker}s and {@link RateLimitHandler}s use {@link #getResetDate()} to make decisions about
|
||||||
|
* how long to wait for until for the rate limit to reset. That means that {@link #getResetDate()} needs to be
|
||||||
|
* calculated based on the local machine clock.
|
||||||
|
* </p>
|
||||||
|
* <p>
|
||||||
|
* When we say that the clock on two machines is "synchronized", we mean that the UTC time returned from
|
||||||
|
* {@link System#currentTimeMillis()} on each machine is basically the same. For the purposes of rate limits an
|
||||||
|
* differences of up to a second can be ignored.
|
||||||
|
* </p>
|
||||||
|
* <p>
|
||||||
|
* When the clock on the local machine is synchronized to the same time as the clock on the GitHub server (via a
|
||||||
|
* time service for example), the {@link #resetDate} generated directly from {@link #resetEpochSeconds} will be
|
||||||
|
* accurate for the local machine as well.
|
||||||
|
* </p>
|
||||||
|
* <p>
|
||||||
|
* When the clock on the local machine is not synchronized with the server, the {@link #resetDate} must be
|
||||||
|
* recalculated relative to the local machine clock. This is done by taking the number of seconds between the
|
||||||
|
* response "Date" header and {@link #resetEpochSeconds} and then adding that to this record's
|
||||||
|
* {@link #createdAtEpochSeconds}.
|
||||||
*
|
*
|
||||||
* @param updatedAt
|
* @param updatedAt
|
||||||
* a string date in RFC 1123
|
* a string date in RFC 1123
|
||||||
* @return reset date based on the passed date
|
* @return reset date based on the passed date
|
||||||
*/
|
*/
|
||||||
Date recalculateResetDate(@CheckForNull String updatedAt) {
|
@Nonnull
|
||||||
|
private Date calculateResetDate(@CheckForNull String updatedAt) {
|
||||||
long updatedAtEpochSeconds = createdAtEpochSeconds;
|
long updatedAtEpochSeconds = createdAtEpochSeconds;
|
||||||
if (!StringUtils.isBlank(updatedAt)) {
|
if (!StringUtils.isBlank(updatedAt)) {
|
||||||
try {
|
try {
|
||||||
@@ -334,7 +542,7 @@ public class GHRateLimit {
|
|||||||
// This may seem odd but it results in an accurate or slightly pessimistic reset date
|
// This may seem odd but it results in an accurate or slightly pessimistic reset date
|
||||||
// based on system time rather than assuming the system time synchronized with the server
|
// based on system time rather than assuming the system time synchronized with the server
|
||||||
long calculatedSecondsUntilReset = resetEpochSeconds - updatedAtEpochSeconds;
|
long calculatedSecondsUntilReset = resetEpochSeconds - updatedAtEpochSeconds;
|
||||||
return resetDate = new Date((createdAtEpochSeconds + calculatedSecondsUntilReset) * 1000);
|
return new Date((createdAtEpochSeconds + calculatedSecondsUntilReset) * 1000);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -358,7 +566,12 @@ public class GHRateLimit {
|
|||||||
/**
|
/**
|
||||||
* Gets the time in epoch seconds when the rate limit will reset.
|
* Gets the time in epoch seconds when the rate limit will reset.
|
||||||
*
|
*
|
||||||
* @return a long
|
* This is the raw value returned by the server. This value is not adjusted if local machine time is not
|
||||||
|
* synchronized with server time. If attempting to check when the rate limit will reset, use
|
||||||
|
* {@link #getResetDate()} or implement a {@link RateLimitChecker} instead.
|
||||||
|
*
|
||||||
|
* @return a long representing the time in epoch seconds when the rate limit will reset
|
||||||
|
* @see #getResetDate()
|
||||||
*/
|
*/
|
||||||
public long getResetEpochSeconds() {
|
public long getResetEpochSeconds() {
|
||||||
return resetEpochSeconds;
|
return resetEpochSeconds;
|
||||||
@@ -367,6 +580,8 @@ public class GHRateLimit {
|
|||||||
/**
|
/**
|
||||||
* Whether the rate limit reset date indicated by this instance is expired
|
* Whether the rate limit reset date indicated by this instance is expired
|
||||||
*
|
*
|
||||||
|
* If attempting to wait for the rate limit to reset, consider implementing a {@link RateLimitChecker} instead.
|
||||||
|
*
|
||||||
* @return true if the rate limit reset date has passed. Otherwise false.
|
* @return true if the rate limit reset date has passed. Otherwise false.
|
||||||
*/
|
*/
|
||||||
public boolean isExpired() {
|
public boolean isExpired() {
|
||||||
@@ -374,7 +589,10 @@ public class GHRateLimit {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Returns the date at which the rate limit will reset.
|
* The date at which the rate limit will reset, adjusted to local machine time if the local machine's clock not
|
||||||
|
* synchronized with to the same clock as the GitHub server.
|
||||||
|
*
|
||||||
|
* If attempting to wait for the rate limit to reset, consider implementing a {@link RateLimitChecker} instead.
|
||||||
*
|
*
|
||||||
* @return the calculated date at which the rate limit has or will reset.
|
* @return the calculated date at which the rate limit has or will reset.
|
||||||
*/
|
*/
|
||||||
|
|||||||
@@ -3,7 +3,7 @@ package org.kohsuke.github;
|
|||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.*;
|
import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Reaction to issue, comment, PR, and so on.
|
* Reaction to issue, comment, PR, and so on.
|
||||||
@@ -11,10 +11,9 @@ import static org.kohsuke.github.Previews.*;
|
|||||||
* @author Kohsuke Kawaguchi
|
* @author Kohsuke Kawaguchi
|
||||||
* @see Reactable
|
* @see Reactable
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public class GHReaction extends GHObject {
|
public class GHReaction extends GHObject {
|
||||||
private GitHub root;
|
|
||||||
|
|
||||||
private GHUser user;
|
private GHUser user;
|
||||||
private ReactionContent content;
|
private ReactionContent content;
|
||||||
@@ -58,6 +57,6 @@ public class GHReaction extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void delete() throws IOException {
|
public void delete() throws IOException {
|
||||||
root.createRequest().method("DELETE").withPreview(SQUIRREL_GIRL).withUrlPath("/reactions/" + id).send();
|
root.createRequest().method("DELETE").withPreview(SQUIRREL_GIRL).withUrlPath("/reactions/" + getId()).send();
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -1,5 +1,6 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import com.fasterxml.jackson.databind.JsonMappingException;
|
||||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
@@ -10,9 +11,7 @@ import java.net.URL;
|
|||||||
*
|
*
|
||||||
* @author Michael Clarke
|
* @author Michael Clarke
|
||||||
*/
|
*/
|
||||||
public class GHRef {
|
public class GHRef extends GitHubInteractiveObject {
|
||||||
/* package almost final */ GitHub root;
|
|
||||||
|
|
||||||
private String ref, url;
|
private String ref, url;
|
||||||
private GHObject object;
|
private GHObject object;
|
||||||
|
|
||||||
@@ -31,7 +30,7 @@ public class GHRef {
|
|||||||
* @return the url
|
* @return the url
|
||||||
*/
|
*/
|
||||||
public URL getUrl() {
|
public URL getUrl() {
|
||||||
return GitHub.parseURL(url);
|
return GitHubClient.parseURL(url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -90,11 +89,76 @@ public class GHRef {
|
|||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
static GHRef[] wrap(GHRef[] in, GitHub root) {
|
/**
|
||||||
for (GHRef r : in) {
|
* Retrive a ref of the given type for the current GitHub repository.
|
||||||
r.wrap(root);
|
*
|
||||||
|
* @param repository
|
||||||
|
* the repository to read from
|
||||||
|
* @param refName
|
||||||
|
* eg: heads/branch
|
||||||
|
* @return refs matching the request type
|
||||||
|
* @throws IOException
|
||||||
|
* on failure communicating with GitHub, potentially due to an invalid ref type being requested
|
||||||
|
*/
|
||||||
|
static GHRef read(GHRepository repository, String refName) throws IOException {
|
||||||
|
// Also accept e.g. "refs/heads/branch" for consistency with createRef().
|
||||||
|
if (refName.startsWith("refs/")) {
|
||||||
|
refName = refName.replaceFirst("refs/", "");
|
||||||
}
|
}
|
||||||
return in;
|
|
||||||
|
// We would expect this to use `git/ref/%s` but some versions of GHE seem to not support it
|
||||||
|
// Instead use `git/refs/%s` and check the result actually matches the ref
|
||||||
|
GHRef result = null;
|
||||||
|
try {
|
||||||
|
result = repository.root.createRequest()
|
||||||
|
.withUrlPath(repository.getApiTailUrl(String.format("git/refs/%s", refName)))
|
||||||
|
.fetch(GHRef.class)
|
||||||
|
.wrap(repository.root);
|
||||||
|
} catch (IOException e) {
|
||||||
|
// If the parse exception is due to the above returning an array instead of a single ref
|
||||||
|
// that means the individual ref did not exist. Handled by result check below.
|
||||||
|
// Otherwise, rethrow.
|
||||||
|
if (!(e.getCause() instanceof JsonMappingException)) {
|
||||||
|
throw e;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Verify that the ref returned is the one requested
|
||||||
|
// Used .endsWith(refName) instead of .equals("refs/" + refName) to workaround a GitBucket
|
||||||
|
// issue where the "ref" field omits the "refs/" prefix. "endsWith()" is functionally
|
||||||
|
// the same for this scenario - the server refs matching is prefix-based, so
|
||||||
|
// a ref that ends with the correct string will always be the correct one.
|
||||||
|
if (result == null || !result.getRef().endsWith(refName)) {
|
||||||
|
throw new GHFileNotFoundException(String.format("git/refs/%s", refName)
|
||||||
|
+ " {\"message\":\"Not Found\",\"documentation_url\":\"https://developer.github.com/v3/git/refs/#get-a-reference\"}");
|
||||||
|
}
|
||||||
|
return result;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Retrieves all refs of the given type for the current GitHub repository.
|
||||||
|
*
|
||||||
|
* @param repository
|
||||||
|
* the repository to read from
|
||||||
|
* @param refType
|
||||||
|
* the type of reg to search for e.g. <code>tags</code> or <code>commits</code>
|
||||||
|
* @return paged iterable of all refs of the specified type
|
||||||
|
* @throws IOException
|
||||||
|
* on failure communicating with GitHub, potentially due to an invalid ref type being requested
|
||||||
|
*/
|
||||||
|
static PagedIterable<GHRef> readMatching(GHRepository repository, String refType) throws IOException {
|
||||||
|
if (refType.startsWith("refs/")) {
|
||||||
|
refType = refType.replaceFirst("refs/", "");
|
||||||
|
}
|
||||||
|
|
||||||
|
String url = repository.getApiTailUrl(String.format("git/refs/%s", refType));
|
||||||
|
// if no types, do not end with slash just to be safe.
|
||||||
|
if (refType.equals("")) {
|
||||||
|
url = url.substring(0, url.length() - 1);
|
||||||
|
}
|
||||||
|
return repository.root.createRequest()
|
||||||
|
.withUrlPath(url)
|
||||||
|
.toIterable(GHRef[].class, item -> item.wrap(repository.root));
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -131,7 +195,7 @@ public class GHRef {
|
|||||||
* @return the url
|
* @return the url
|
||||||
*/
|
*/
|
||||||
public URL getUrl() {
|
public URL getUrl() {
|
||||||
return GitHub.parseURL(url);
|
return GitHubClient.parseURL(url);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -6,7 +6,6 @@ import java.io.IOException;
|
|||||||
import java.io.InputStream;
|
import java.io.InputStream;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
import java.net.URLEncoder;
|
import java.net.URLEncoder;
|
||||||
import java.util.Arrays;
|
|
||||||
import java.util.Date;
|
import java.util.Date;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
|
|
||||||
@@ -16,14 +15,15 @@ import static java.lang.String.*;
|
|||||||
* Release in a github repository.
|
* Release in a github repository.
|
||||||
*
|
*
|
||||||
* @see GHRepository#getReleases() GHRepository#getReleases()
|
* @see GHRepository#getReleases() GHRepository#getReleases()
|
||||||
|
* @see GHRepository#listReleases() () GHRepository#listReleases()
|
||||||
* @see GHRepository#createRelease(String) GHRepository#createRelease(String)
|
* @see GHRepository#createRelease(String) GHRepository#createRelease(String)
|
||||||
*/
|
*/
|
||||||
public class GHRelease extends GHObject {
|
public class GHRelease extends GHObject {
|
||||||
GitHub root;
|
|
||||||
GHRepository owner;
|
GHRepository owner;
|
||||||
|
|
||||||
private String html_url;
|
private String html_url;
|
||||||
private String assets_url;
|
private String assets_url;
|
||||||
|
private List<GHAsset> assets;
|
||||||
private String upload_url;
|
private String upload_url;
|
||||||
private String tag_name;
|
private String tag_name;
|
||||||
private String target_commitish;
|
private String target_commitish;
|
||||||
@@ -72,12 +72,13 @@ public class GHRelease extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
* @deprecated Use {@link #update()}
|
* @deprecated Use {@link #update()}
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public GHRelease setDraft(boolean draft) throws IOException {
|
public GHRelease setDraft(boolean draft) throws IOException {
|
||||||
return update().draft(draft).update();
|
return update().draft(draft).update();
|
||||||
}
|
}
|
||||||
|
|
||||||
public URL getHtmlUrl() {
|
public URL getHtmlUrl() {
|
||||||
return GitHub.parseURL(html_url);
|
return GitHubClient.parseURL(html_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -249,17 +250,44 @@ public class GHRelease extends GHObject {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets assets.
|
* Get the cached assets.
|
||||||
|
*
|
||||||
|
* @return the assets
|
||||||
|
*
|
||||||
|
* @deprecated This should be the default behavior of {@link #getAssets()} in a future release. This method is
|
||||||
|
* introduced in addition to enable a transition to using cached asset information while keeping the
|
||||||
|
* existing logic in place for backwards compatibility.
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
public List<GHAsset> assets() {
|
||||||
|
return assets;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Re-fetch the assets of this release.
|
||||||
|
*
|
||||||
|
* @return the assets
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
* @deprecated The behavior of this method will change in a future release. It will then provide cached assets as
|
||||||
|
* provided by {@link #assets()}. Use {@link #listAssets()} instead to fetch up-to-date information of
|
||||||
|
* assets.
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
public List<GHAsset> getAssets() throws IOException {
|
||||||
|
return listAssets().toList();
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Re-fetch the assets of this release.
|
||||||
*
|
*
|
||||||
* @return the assets
|
* @return the assets
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public List<GHAsset> getAssets() throws IOException {
|
public PagedIterable<GHAsset> listAssets() throws IOException {
|
||||||
Requester builder = owner.root.createRequest();
|
Requester builder = owner.root.createRequest();
|
||||||
|
return builder.withUrlPath(getApiTailUrl("assets")).toIterable(GHAsset[].class, item -> item.wrap(this));
|
||||||
GHAsset[] assets = builder.withUrlPath(getApiTailUrl("assets")).fetchArray(GHAsset[].class);
|
|
||||||
return Arrays.asList(GHAsset.wrap(assets, this));
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -269,7 +297,7 @@ public class GHRelease extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void delete() throws IOException {
|
public void delete() throws IOException {
|
||||||
root.createRequest().method("DELETE").withUrlPath(owner.getApiTailUrl("releases/" + id)).send();
|
root.createRequest().method("DELETE").withUrlPath(owner.getApiTailUrl("releases/" + getId())).send();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -282,6 +310,6 @@ public class GHRelease extends GHObject {
|
|||||||
}
|
}
|
||||||
|
|
||||||
private String getApiTailUrl(String end) {
|
private String getApiTailUrl(String end) {
|
||||||
return owner.getApiTailUrl(format("releases/%s/%s", id, end));
|
return owner.getApiTailUrl(format("releases/%s/%s", getId(), end));
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -100,7 +100,7 @@ public class GHReleaseUpdater {
|
|||||||
*/
|
*/
|
||||||
public GHRelease update() throws IOException {
|
public GHRelease update() throws IOException {
|
||||||
return builder.method("PATCH")
|
return builder.method("PATCH")
|
||||||
.withUrlPath(base.owner.getApiTailUrl("releases/" + base.id))
|
.withUrlPath(base.owner.getApiTailUrl("releases/" + base.getId()))
|
||||||
.fetch(GHRelease.class)
|
.fetch(GHRelease.class)
|
||||||
.wrap(base.owner);
|
.wrap(base.owner);
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -18,6 +18,6 @@ class GHRepoHook extends GHHook {
|
|||||||
|
|
||||||
@Override
|
@Override
|
||||||
String getApiRoute() {
|
String getApiRoute() {
|
||||||
return String.format("/repos/%s/%s/hooks/%d", repository.getOwnerName(), repository.getName(), id);
|
return String.format("/repos/%s/%s/hooks/%d", repository.getOwnerName(), repository.getName(), getId());
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
File diff suppressed because it is too large
Load Diff
235
src/main/java/org/kohsuke/github/GHRepositoryBuilder.java
Normal file
235
src/main/java/org/kohsuke/github/GHRepositoryBuilder.java
Normal file
@@ -0,0 +1,235 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import java.io.IOException;
|
||||||
|
import java.net.URL;
|
||||||
|
|
||||||
|
import static org.kohsuke.github.internal.Previews.BAPTISTE;
|
||||||
|
|
||||||
|
abstract class GHRepositoryBuilder<S> extends AbstractBuilder<GHRepository, S> {
|
||||||
|
|
||||||
|
protected GHRepositoryBuilder(Class<S> intermediateReturnType, GitHub root, GHRepository baseInstance) {
|
||||||
|
super(GHRepository.class, intermediateReturnType, root, baseInstance);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Allow or disallow squash-merging pull requests.
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S allowSquashMerge(boolean enabled) throws IOException {
|
||||||
|
return with("allow_squash_merge", enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Allow or disallow merging pull requests with a merge commit.
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S allowMergeCommit(boolean enabled) throws IOException {
|
||||||
|
return with("allow_merge_commit", enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Allow or disallow rebase-merging pull requests.
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S allowRebaseMerge(boolean enabled) throws IOException {
|
||||||
|
return with("allow_rebase_merge", enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* After pull requests are merged, you can have head branches deleted automatically.
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S deleteBranchOnMerge(boolean enabled) throws IOException {
|
||||||
|
return with("delete_branch_on_merge", enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Default repository branch
|
||||||
|
*
|
||||||
|
* @param branch
|
||||||
|
* branch name
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S defaultBranch(String branch) throws IOException {
|
||||||
|
return with("default_branch", branch);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Description for repository
|
||||||
|
*
|
||||||
|
* @param description
|
||||||
|
* description of repository
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S description(String description) throws IOException {
|
||||||
|
return with("description", description);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Homepage for repository
|
||||||
|
*
|
||||||
|
* @param homepage
|
||||||
|
* homepage of repository
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S homepage(URL homepage) throws IOException {
|
||||||
|
return homepage(homepage.toExternalForm());
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Homepage for repository
|
||||||
|
*
|
||||||
|
* @param homepage
|
||||||
|
* homepage of repository
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S homepage(String homepage) throws IOException {
|
||||||
|
return with("homepage", homepage);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Sets the repository to private
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* private if true
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S private_(boolean enabled) throws IOException {
|
||||||
|
return with("private", enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Enables issue tracker
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S issues(boolean enabled) throws IOException {
|
||||||
|
return with("has_issues", enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Enables projects
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S projects(boolean enabled) throws IOException {
|
||||||
|
return with("has_projects", enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Enables wiki
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
* @return a builder to continue with building
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S wiki(boolean enabled) throws IOException {
|
||||||
|
return with("has_wiki", enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Enables downloads
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
*
|
||||||
|
* @return a builder to continue with building
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public S downloads(boolean enabled) throws IOException {
|
||||||
|
return with("has_downloads", enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Specifies whether the repository is a template.
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
* @return a builder to continue with building
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
@Preview(BAPTISTE)
|
||||||
|
@Deprecated
|
||||||
|
public S isTemplate(boolean enabled) throws IOException {
|
||||||
|
requester.withPreview(BAPTISTE);
|
||||||
|
return with("is_template", enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public GHRepository done() throws IOException {
|
||||||
|
return super.done().wrap(this.root);
|
||||||
|
}
|
||||||
|
|
||||||
|
S archive() throws IOException {
|
||||||
|
return with("archived", true);
|
||||||
|
}
|
||||||
|
|
||||||
|
S name(String name) throws IOException {
|
||||||
|
return with("name", name);
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -1,12 +1,13 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import com.fasterxml.jackson.annotation.JsonCreator;
|
||||||
import com.fasterxml.jackson.databind.exc.MismatchedInputException;
|
import com.fasterxml.jackson.databind.exc.MismatchedInputException;
|
||||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
import java.util.ArrayList;
|
|
||||||
import java.util.Arrays;
|
import java.util.Arrays;
|
||||||
|
import java.util.Collections;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
import java.util.NoSuchElementException;
|
import java.util.NoSuchElementException;
|
||||||
|
|
||||||
@@ -15,10 +16,9 @@ import java.util.NoSuchElementException;
|
|||||||
*
|
*
|
||||||
* @author Martin van Zijl
|
* @author Martin van Zijl
|
||||||
*/
|
*/
|
||||||
public class GHRepositoryStatistics {
|
public class GHRepositoryStatistics extends GitHubInteractiveObject {
|
||||||
|
|
||||||
private final GHRepository repo;
|
private final GHRepository repo;
|
||||||
private final GitHub root;
|
|
||||||
|
|
||||||
private static final int MAX_WAIT_ITERATIONS = 3;
|
private static final int MAX_WAIT_ITERATIONS = 3;
|
||||||
private static final int WAIT_SLEEP_INTERVAL = 5000;
|
private static final int WAIT_SLEEP_INTERVAL = 5000;
|
||||||
@@ -59,7 +59,7 @@ public class GHRepositoryStatistics {
|
|||||||
* @throws InterruptedException
|
* @throws InterruptedException
|
||||||
* the interrupted exception
|
* the interrupted exception
|
||||||
*/
|
*/
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
@SuppressWarnings("SleepWhileInLoop")
|
@SuppressWarnings("SleepWhileInLoop")
|
||||||
@SuppressFBWarnings(value = { "RCN_REDUNDANT_NULLCHECK_OF_NONNULL_VALUE" }, justification = "JSON API")
|
@SuppressFBWarnings(value = { "RCN_REDUNDANT_NULLCHECK_OF_NONNULL_VALUE" }, justification = "JSON API")
|
||||||
@@ -98,7 +98,6 @@ public class GHRepositoryStatistics {
|
|||||||
"URF_UNREAD_FIELD" },
|
"URF_UNREAD_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public static class ContributorStats extends GHObject {
|
public static class ContributorStats extends GHObject {
|
||||||
/* package almost final */ private GitHub root;
|
|
||||||
private GHUser author;
|
private GHUser author;
|
||||||
private int total;
|
private int total;
|
||||||
private List<Week> weeks;
|
private List<Week> weeks;
|
||||||
@@ -254,7 +253,6 @@ public class GHRepositoryStatistics {
|
|||||||
value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public static class CommitActivity extends GHObject {
|
public static class CommitActivity extends GHObject {
|
||||||
/* package almost final */ private GitHub root;
|
|
||||||
private List<Integer> days;
|
private List<Integer> days;
|
||||||
private int total;
|
private int total;
|
||||||
private long week;
|
private long week;
|
||||||
@@ -315,21 +313,12 @@ public class GHRepositoryStatistics {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public List<CodeFrequency> getCodeFrequency() throws IOException {
|
public List<CodeFrequency> getCodeFrequency() throws IOException {
|
||||||
// Map to arrays first, since there are no field names in the
|
|
||||||
// returned JSON.
|
|
||||||
try {
|
try {
|
||||||
Integer[][] list = root.createRequest()
|
CodeFrequency[] list = root.createRequest()
|
||||||
.withUrlPath(getApiTailUrl("code_frequency"))
|
.withUrlPath(getApiTailUrl("code_frequency"))
|
||||||
.fetch(Integer[][].class);
|
.fetch(CodeFrequency[].class);
|
||||||
|
|
||||||
// Convert to proper objects.
|
return Arrays.asList(list);
|
||||||
List<CodeFrequency> returnList = new ArrayList<>();
|
|
||||||
for (Integer[] item : list) {
|
|
||||||
CodeFrequency cf = new CodeFrequency(Arrays.asList(item));
|
|
||||||
returnList.add(cf);
|
|
||||||
}
|
|
||||||
|
|
||||||
return returnList;
|
|
||||||
} catch (MismatchedInputException e) {
|
} catch (MismatchedInputException e) {
|
||||||
// This sometimes happens when retrieving code frequency statistics
|
// This sometimes happens when retrieving code frequency statistics
|
||||||
// for a repository for the first time. It is probably still being
|
// for a repository for the first time. It is probably still being
|
||||||
@@ -342,10 +331,12 @@ public class GHRepositoryStatistics {
|
|||||||
* The type CodeFrequency.
|
* The type CodeFrequency.
|
||||||
*/
|
*/
|
||||||
public static class CodeFrequency {
|
public static class CodeFrequency {
|
||||||
private int week;
|
|
||||||
private int additions;
|
|
||||||
private int deletions;
|
|
||||||
|
|
||||||
|
private final int week;
|
||||||
|
private final int additions;
|
||||||
|
private final int deletions;
|
||||||
|
|
||||||
|
@JsonCreator(mode = JsonCreator.Mode.DELEGATING)
|
||||||
private CodeFrequency(List<Integer> item) {
|
private CodeFrequency(List<Integer> item) {
|
||||||
week = item.get(0);
|
week = item.get(0);
|
||||||
additions = item.get(1);
|
additions = item.get(1);
|
||||||
@@ -404,7 +395,6 @@ public class GHRepositoryStatistics {
|
|||||||
* The type Participation.
|
* The type Participation.
|
||||||
*/
|
*/
|
||||||
public static class Participation extends GHObject {
|
public static class Participation extends GHObject {
|
||||||
/* package almost final */ private GitHub root;
|
|
||||||
private List<Integer> all;
|
private List<Integer> all;
|
||||||
private List<Integer> owner;
|
private List<Integer> owner;
|
||||||
|
|
||||||
@@ -428,7 +418,7 @@ public class GHRepositoryStatistics {
|
|||||||
* @return The list of commit counts for everyone combined, for the last 52 weeks.
|
* @return The list of commit counts for everyone combined, for the last 52 weeks.
|
||||||
*/
|
*/
|
||||||
public List<Integer> getAllCommits() {
|
public List<Integer> getAllCommits() {
|
||||||
return all;
|
return Collections.unmodifiableList(all);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -437,7 +427,7 @@ public class GHRepositoryStatistics {
|
|||||||
* @return The list of commit counts for the owner, for the last 52 weeks.
|
* @return The list of commit counts for the owner, for the last 52 weeks.
|
||||||
*/
|
*/
|
||||||
public List<Integer> getOwnerCommits() {
|
public List<Integer> getOwnerCommits() {
|
||||||
return owner;
|
return Collections.unmodifiableList(owner);
|
||||||
}
|
}
|
||||||
|
|
||||||
Participation wrapUp(GitHub root) {
|
Participation wrapUp(GitHub root) {
|
||||||
@@ -455,28 +445,22 @@ public class GHRepositoryStatistics {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public List<PunchCardItem> getPunchCard() throws IOException {
|
public List<PunchCardItem> getPunchCard() throws IOException {
|
||||||
// Map to ArrayLists first, since there are no field names in the
|
PunchCardItem[] list = root.createRequest()
|
||||||
// returned JSON.
|
.withUrlPath(getApiTailUrl("punch_card"))
|
||||||
Integer[][] list = root.createRequest().withUrlPath(getApiTailUrl("punch_card")).fetch(Integer[][].class);
|
.fetch(PunchCardItem[].class);
|
||||||
|
return Arrays.asList(list);
|
||||||
// Convert to proper objects.
|
|
||||||
ArrayList<PunchCardItem> returnList = new ArrayList<>();
|
|
||||||
for (Integer[] item : list) {
|
|
||||||
PunchCardItem pci = new PunchCardItem(Arrays.asList(item));
|
|
||||||
returnList.add(pci);
|
|
||||||
}
|
|
||||||
|
|
||||||
return returnList;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The type PunchCardItem.
|
* The type PunchCardItem.
|
||||||
*/
|
*/
|
||||||
public static class PunchCardItem {
|
public static class PunchCardItem {
|
||||||
private int dayOfWeek;
|
|
||||||
private int hourOfDay;
|
|
||||||
private int numberOfCommits;
|
|
||||||
|
|
||||||
|
private final int dayOfWeek;
|
||||||
|
private final int hourOfDay;
|
||||||
|
private final int numberOfCommits;
|
||||||
|
|
||||||
|
@JsonCreator(mode = JsonCreator.Mode.DELEGATING)
|
||||||
private PunchCardItem(List<Integer> item) {
|
private PunchCardItem(List<Integer> item) {
|
||||||
dayOfWeek = item.get(0);
|
dayOfWeek = item.get(0);
|
||||||
hourOfDay = item.get(1);
|
hourOfDay = item.get(1);
|
||||||
|
|||||||
@@ -47,7 +47,7 @@ public abstract class GHRepositoryTraffic implements TrafficInfo {
|
|||||||
* @return the timestamp
|
* @return the timestamp
|
||||||
*/
|
*/
|
||||||
public Date getTimestamp() {
|
public Date getTimestamp() {
|
||||||
return GitHub.parseDate(timestamp);
|
return GitHubClient.parseDate(timestamp);
|
||||||
}
|
}
|
||||||
|
|
||||||
public int getCount() {
|
public int getCount() {
|
||||||
|
|||||||
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user