mirror of
https://github.com/jlengrand/github-api.git
synced 2026-03-21 00:11:23 +00:00
Compare commits
990 Commits
github-api
...
github-api
| Author | SHA1 | Date | |
|---|---|---|---|
|
|
9022455d85 | ||
|
|
7c8a7ff26e | ||
|
|
064d6944f3 | ||
|
|
b8b3cf9c80 | ||
|
|
18e7138812 | ||
|
|
bfb3b94478 | ||
|
|
6167d196d9 | ||
|
|
43ed7c7ac7 | ||
|
|
fc98e72569 | ||
|
|
258acf79f6 | ||
|
|
b509076d6f | ||
|
|
f57ea4c4e9 | ||
|
|
578fe085ce | ||
|
|
2553a79b02 | ||
|
|
4770316898 | ||
|
|
99f192d33c | ||
|
|
fc3bac0e77 | ||
|
|
ad2990b1b6 | ||
|
|
fab848a0d3 | ||
|
|
4a2244e661 | ||
|
|
bab5399327 | ||
|
|
52705ac695 | ||
|
|
73d2e1db5c | ||
|
|
83aa9d04ef | ||
|
|
97652c6803 | ||
|
|
f40daf8488 | ||
|
|
3e6a5bc718 | ||
|
|
78ffe5a759 | ||
|
|
9abfdc805b | ||
|
|
9e47a2b8c6 | ||
|
|
feba6ed8b6 | ||
|
|
acab40b704 | ||
|
|
435272065f | ||
|
|
c5c04672fc | ||
|
|
5eef764cba | ||
|
|
2682e0a1e2 | ||
|
|
a68d16d5de | ||
|
|
304ab10cf9 | ||
|
|
dc46341432 | ||
|
|
99aea9296e | ||
|
|
b0693037f3 | ||
|
|
c19cfd98d1 | ||
|
|
cdc0e2ad6b | ||
|
|
6606b5c7d1 | ||
|
|
551dbf2a06 | ||
|
|
d734237788 | ||
|
|
47e2a5aea1 | ||
|
|
57cdc308e8 | ||
|
|
8919c5f8c7 | ||
|
|
b8f00bc699 | ||
|
|
042038f480 | ||
|
|
fb03e749bd | ||
|
|
e522239832 | ||
|
|
ae69324196 | ||
|
|
5194c2d9bc | ||
|
|
daf5c5eb98 | ||
|
|
a7b4c97020 | ||
|
|
420d5d06f3 | ||
|
|
a7cd052b7c | ||
|
|
6e1b943823 | ||
|
|
8a3559ada5 | ||
|
|
ea3cbd4c71 | ||
|
|
34a1f9d6e4 | ||
|
|
629bd510c1 | ||
|
|
40937a5cc6 | ||
|
|
8509957102 | ||
|
|
b0aea0c575 | ||
|
|
1f7f646bec | ||
|
|
a59ee6a82d | ||
|
|
1fefc77582 | ||
|
|
199eee4e25 | ||
|
|
854df5321b | ||
|
|
bd509070ac | ||
|
|
a8c7c97d06 | ||
|
|
6d86cfb4f6 | ||
|
|
fb3e956502 | ||
|
|
9b0dbe6f34 | ||
|
|
c10c7237a7 | ||
|
|
36612fe97f | ||
|
|
18e2056a10 | ||
|
|
8c8f1451d4 | ||
|
|
be67f1d9e2 | ||
|
|
90bc250269 | ||
|
|
1bd178654f | ||
|
|
f22bf160f9 | ||
|
|
4261c42949 | ||
|
|
40cfb85a8e | ||
|
|
f08299b134 | ||
|
|
a04ab45abc | ||
|
|
0647df2d2b | ||
|
|
d4cc3af1e9 | ||
|
|
936ab499ce | ||
|
|
453f475b4e | ||
|
|
bda3855b86 | ||
|
|
772a6c112b | ||
|
|
9b4134cada | ||
|
|
ed9f54006d | ||
|
|
3b1f176544 | ||
|
|
d2732bcf54 | ||
|
|
a1461f401a | ||
|
|
f9fd30275c | ||
|
|
eeea14dab4 | ||
|
|
1df807a198 | ||
|
|
0848287069 | ||
|
|
334b37a256 | ||
|
|
8776a3b672 | ||
|
|
657550f767 | ||
|
|
45a0114f75 | ||
|
|
a8ddd3e12a | ||
|
|
b668396151 | ||
|
|
9e7c33369c | ||
|
|
8943ca6d1a | ||
|
|
b3460c1f9d | ||
|
|
5166c9265f | ||
|
|
35c8cfa01d | ||
|
|
8e6dbf3772 | ||
|
|
cb381dfa06 | ||
|
|
80124e3b85 | ||
|
|
7aae27e36f | ||
|
|
b212956fbb | ||
|
|
d033355e84 | ||
|
|
59d7a117d0 | ||
|
|
dfbb38c5f1 | ||
|
|
3f9954144a | ||
|
|
1b84efdbfa | ||
|
|
c33e78a7dc | ||
|
|
747c759bbb | ||
|
|
e0a709676e | ||
|
|
a96275c286 | ||
|
|
ca7c809feb | ||
|
|
a8a0bcb7db | ||
|
|
0e2bf23830 | ||
|
|
44a8b797fb | ||
|
|
cdede298a9 | ||
|
|
f6ac4d3559 | ||
|
|
7e1531dbca | ||
|
|
9aeb422157 | ||
|
|
fba0f8cf8e | ||
|
|
0f4a5227e1 | ||
|
|
d16a752b43 | ||
|
|
4d9aed90d6 | ||
|
|
4bec27fd49 | ||
|
|
be3bd74bb7 | ||
|
|
f1720b7bbc | ||
|
|
7a79a18d8f | ||
|
|
472034c950 | ||
|
|
0b14cee817 | ||
|
|
b50ab56f9e | ||
|
|
26d30663c4 | ||
|
|
ffecc390eb | ||
|
|
252ca04084 | ||
|
|
aae5c56a31 | ||
|
|
6670446037 | ||
|
|
bd39b07bb5 | ||
|
|
a9438b6121 | ||
|
|
f546cf4521 | ||
|
|
43efa78750 | ||
|
|
9e3de43802 | ||
|
|
dc615e432e | ||
|
|
cf9caa6af5 | ||
|
|
15f748358d | ||
|
|
b30d648623 | ||
|
|
33d70560b8 | ||
|
|
865a49d2e8 | ||
|
|
4fca68c25c | ||
|
|
f131a0c1c2 | ||
|
|
cd4368fa79 | ||
|
|
4ec4b160b0 | ||
|
|
a585b4957f | ||
|
|
e6b02b3bed | ||
|
|
1ef0ec0432 | ||
|
|
2e87bd86a1 | ||
|
|
0228a0d023 | ||
|
|
6365f3749d | ||
|
|
25c18130f9 | ||
|
|
436c19634d | ||
|
|
1a6facc685 | ||
|
|
bd0093c8ea | ||
|
|
e150280010 | ||
|
|
827fd5e472 | ||
|
|
f89fbc67b9 | ||
|
|
c567a88892 | ||
|
|
6a39d7fca5 | ||
|
|
a15e67f065 | ||
|
|
7a1bce9578 | ||
|
|
f2b4de7943 | ||
|
|
b3ff4ac6d9 | ||
|
|
1c56e7fab5 | ||
|
|
70ba4df385 | ||
|
|
8062c705e8 | ||
|
|
fafb23c1a6 | ||
|
|
4e7ac7030c | ||
|
|
4803daca5a | ||
|
|
facfc61316 | ||
|
|
e3e495bfb1 | ||
|
|
e007284d2f | ||
|
|
1da8416ebd | ||
|
|
79b49a469c | ||
|
|
5888efcaef | ||
|
|
459d1b4f56 | ||
|
|
9151102bda | ||
|
|
3819984add | ||
|
|
3b58fbc186 | ||
|
|
55e589b3d9 | ||
|
|
e64d64d8d8 | ||
|
|
37c2d9135b | ||
|
|
30c96221bd | ||
|
|
bf7305e3f8 | ||
|
|
3b12a229c3 | ||
|
|
5726ceb8dc | ||
|
|
c06c06624d | ||
|
|
ad40d7071e | ||
|
|
f55a39eb90 | ||
|
|
c3869bee31 | ||
|
|
6eac15df0f | ||
|
|
6f5d3c32c3 | ||
|
|
68ef40e4d0 | ||
|
|
4046bc4f72 | ||
|
|
1b8d131915 | ||
|
|
f5ad332d28 | ||
|
|
938603ff60 | ||
|
|
17af78f2bb | ||
|
|
7588267743 | ||
|
|
ed4f9c8176 | ||
|
|
bbb46e88b0 | ||
|
|
3db7aac0d8 | ||
|
|
fdbbd2e563 | ||
|
|
e92f1321d4 | ||
|
|
da2aaff9e5 | ||
|
|
208904b634 | ||
|
|
a433bcda2e | ||
|
|
4bba692170 | ||
|
|
59b61cd8be | ||
|
|
247b013e16 | ||
|
|
77baafa643 | ||
|
|
3c56f1f076 | ||
|
|
224d8c7cb4 | ||
|
|
0feb520549 | ||
|
|
ca365b12f6 | ||
|
|
bde6ad9a06 | ||
|
|
4953f4500d | ||
|
|
7fee1fcc74 | ||
|
|
4415ac8fd2 | ||
|
|
8c81e48a31 | ||
|
|
9ad0329c56 | ||
|
|
78f533bbfc | ||
|
|
79c7dd9ecf | ||
|
|
5d796d1f79 | ||
|
|
68a82be6c4 | ||
|
|
2676ef2b73 | ||
|
|
04b283c539 | ||
|
|
98b067937a | ||
|
|
8ababb60bf | ||
|
|
b51d655f77 | ||
|
|
74496d32da | ||
|
|
316e278be1 | ||
|
|
d881bf6504 | ||
|
|
c74fbbe1fd | ||
|
|
929d9fb7bd | ||
|
|
5d069d0531 | ||
|
|
dd9e6dc5d3 | ||
|
|
d22c77c41d | ||
|
|
3a11b7ccbf | ||
|
|
d7931777bc | ||
|
|
9d161b28bb | ||
|
|
9b16a1caa0 | ||
|
|
9a918e3bac | ||
|
|
d4c5c6a1e0 | ||
|
|
63fda3555c | ||
|
|
6a2381c06b | ||
|
|
e9c0a16c26 | ||
|
|
2101a67ac1 | ||
|
|
ddac568aaa | ||
|
|
262ae9f635 | ||
|
|
381502fb80 | ||
|
|
92fb441eb2 | ||
|
|
29e08037a8 | ||
|
|
84cc6d9315 | ||
|
|
b8d5a1c732 | ||
|
|
0197ab9661 | ||
|
|
b7915e61a6 | ||
|
|
586db99450 | ||
|
|
5377d0dd18 | ||
|
|
bb48d55bd4 | ||
|
|
c5d3a7d573 | ||
|
|
8267050f06 | ||
|
|
610b02968e | ||
|
|
a7112c42df | ||
|
|
8a474a3b00 | ||
|
|
59e18d155e | ||
|
|
12ca5d8063 | ||
|
|
c959e0a928 | ||
|
|
89a08b021d | ||
|
|
04b553cdec | ||
|
|
15e9ee30ee | ||
|
|
a0d650a86c | ||
|
|
1a6ad48e08 | ||
|
|
7c82eeb018 | ||
|
|
b188e74ee0 | ||
|
|
c21bd5765a | ||
|
|
b78c37a695 | ||
|
|
2f151d45c3 | ||
|
|
3ebe3afdbd | ||
|
|
f4845df6c0 | ||
|
|
272b87f04d | ||
|
|
ff790eeefb | ||
|
|
97e918da03 | ||
|
|
4f30998873 | ||
|
|
a0fc478a28 | ||
|
|
bb03fd1968 | ||
|
|
0c65f74662 | ||
|
|
29ac2bd4f5 | ||
|
|
0d8b4f32e8 | ||
|
|
83db7f24eb | ||
|
|
5f9976a193 | ||
|
|
9480ef485b | ||
|
|
a9b7432584 | ||
|
|
6d7081910f | ||
|
|
aa96089ab4 | ||
|
|
58ae681417 | ||
|
|
c038e0af5e | ||
|
|
4f9976c0cb | ||
|
|
e308e5ed57 | ||
|
|
7b1b1ca994 | ||
|
|
551be49a1a | ||
|
|
a3888e6902 | ||
|
|
43bb6a0dd8 | ||
|
|
6e3f754366 | ||
|
|
6360112432 | ||
|
|
f1ca0b5417 | ||
|
|
0894c8007c | ||
|
|
05863acbcd | ||
|
|
0e4cd06137 | ||
|
|
85d2d974e7 | ||
|
|
3f021f9552 | ||
|
|
0456f10709 | ||
|
|
b7d03f7463 | ||
|
|
07a392c2a7 | ||
|
|
5b69de770f | ||
|
|
4688870984 | ||
|
|
bf67069768 | ||
|
|
91764c1c74 | ||
|
|
8b2a3e1221 | ||
|
|
def2f0b37d | ||
|
|
5d7479a3dd | ||
|
|
ceb2d35f9f | ||
|
|
fc38dba59a | ||
|
|
75b383d398 | ||
|
|
ee2d9491fb | ||
|
|
bf86a7c75a | ||
|
|
70f6d129e2 | ||
|
|
a4ac2aa99a | ||
|
|
ae3b6fbe6b | ||
|
|
e357fca963 | ||
|
|
c84cc89805 | ||
|
|
181238cd50 | ||
|
|
214c24c736 | ||
|
|
cf51ce8f26 | ||
|
|
2b7ed40d01 | ||
|
|
349ef7a54c | ||
|
|
94df5fc389 | ||
|
|
906238a297 | ||
|
|
7963fa82b5 | ||
|
|
1aba6012fb | ||
|
|
ff4324ac67 | ||
|
|
11bc669e1d | ||
|
|
dcf26d58e4 | ||
|
|
4d46872c35 | ||
|
|
4f0d62f421 | ||
|
|
f7ad1f517b | ||
|
|
345d6197f3 | ||
|
|
bb4d44138a | ||
|
|
a8ef0cde53 | ||
|
|
77dc009c95 | ||
|
|
aa298c93cc | ||
|
|
dfb0a5240e | ||
|
|
9cfc3c22b5 | ||
|
|
b177d98e29 | ||
|
|
5405fb0370 | ||
|
|
72a1c24b3b | ||
|
|
f146ae94ec | ||
|
|
a0bbba748a | ||
|
|
81bf818573 | ||
|
|
d5913dc292 | ||
|
|
e1e901b794 | ||
|
|
2f2f26767e | ||
|
|
bffa78c1b8 | ||
|
|
c55719c67a | ||
|
|
cb3b4a6642 | ||
|
|
92c141cee6 | ||
|
|
fd1a1a1c23 | ||
|
|
b835884b2e | ||
|
|
660763908d | ||
|
|
fe8bdb755a | ||
|
|
67dc6d2d23 | ||
|
|
9c8d73cbe2 | ||
|
|
5db97d92dd | ||
|
|
ac470dddb5 | ||
|
|
43063fe8ce | ||
|
|
59e0046c1e | ||
|
|
36ab05c265 | ||
|
|
2b2be05dae | ||
|
|
fb1adbd1ef | ||
|
|
ab68a59b25 | ||
|
|
9c7de767e9 | ||
|
|
8ba5cf7c2e | ||
|
|
b194a19b98 | ||
|
|
1d344b016f | ||
|
|
474f3ef4ca | ||
|
|
9830927020 | ||
|
|
727932a442 | ||
|
|
cd92b51845 | ||
|
|
fe26d16411 | ||
|
|
d68c66ce2b | ||
|
|
e7bfbfb48f | ||
|
|
f2a88ae61c | ||
|
|
e2113f6ee5 | ||
|
|
3867224024 | ||
|
|
9ee0bf43bc | ||
|
|
2844542efa | ||
|
|
e3fcae9392 | ||
|
|
c6ccfa91f3 | ||
|
|
b6fcee1cb9 | ||
|
|
9071befb04 | ||
|
|
bdd5fe98f3 | ||
|
|
a3d3e83a49 | ||
|
|
08bde72028 | ||
|
|
108a136368 | ||
|
|
57d87ad6b1 | ||
|
|
0c22815ff7 | ||
|
|
0ca792ecfd | ||
|
|
987c34c69e | ||
|
|
c1c02bc8ab | ||
|
|
4ee369f27c | ||
|
|
c9012efdcb | ||
|
|
41524fc67d | ||
|
|
04ff61e981 | ||
|
|
532468dc67 | ||
|
|
9c9a2dae47 | ||
|
|
c8a868b57f | ||
|
|
4b3f81ee34 | ||
|
|
afa170ba7c | ||
|
|
46e3b2272e | ||
|
|
52472e90ec | ||
|
|
4ef0d00846 | ||
|
|
580f2537f2 | ||
|
|
3d9fd96026 | ||
|
|
f449b92721 | ||
|
|
3b0216b023 | ||
|
|
98cf839737 | ||
|
|
0bb0846505 | ||
|
|
70969400a3 | ||
|
|
147e8d5d12 | ||
|
|
cacc3e6edd | ||
|
|
a284eca147 | ||
|
|
0d3ba9d7f0 | ||
|
|
be8064d642 | ||
|
|
e30dba742d | ||
|
|
44b72ed647 | ||
|
|
666bd77dac | ||
|
|
0a6613e60d | ||
|
|
62e186c123 | ||
|
|
50dd8f5bcc | ||
|
|
d5fcac9c45 | ||
|
|
c2bed85190 | ||
|
|
183b463ef2 | ||
|
|
92fdac44a0 | ||
|
|
12829ecc73 | ||
|
|
51319c3b26 | ||
|
|
8fd827040b | ||
|
|
5ec46eae0d | ||
|
|
32c03301be | ||
|
|
df7f29b2ab | ||
|
|
e863113c36 | ||
|
|
8e2c1d7382 | ||
|
|
ab7b9cccba | ||
|
|
81bf61a161 | ||
|
|
b40f008647 | ||
|
|
734e41702b | ||
|
|
038dd20a91 | ||
|
|
1dd62b8550 | ||
|
|
715deebe05 | ||
|
|
b3fe3d8590 | ||
|
|
f74c3ed3ea | ||
|
|
2c9aebeeed | ||
|
|
7474f1e11f | ||
|
|
dba9c55b64 | ||
|
|
b432364397 | ||
|
|
696967bdd1 | ||
|
|
b76889efc3 | ||
|
|
e6a7b64ebe | ||
|
|
9daa0df311 | ||
|
|
612800bda5 | ||
|
|
a6bbb1dec9 | ||
|
|
873c93ab64 | ||
|
|
d15242e2d2 | ||
|
|
992d2b937c | ||
|
|
1e05ddad4b | ||
|
|
4f8a64610b | ||
|
|
b82366218c | ||
|
|
acbe1f4cb3 | ||
|
|
4c5e018583 | ||
|
|
6c0380e85c | ||
|
|
fde48e604f | ||
|
|
e83a4de5fb | ||
|
|
927d2799dc | ||
|
|
1ad701fe5d | ||
|
|
086425d2da | ||
|
|
beca54416a | ||
|
|
c92f5c5713 | ||
|
|
dee4e6caff | ||
|
|
dd5a39e72e | ||
|
|
e5ed52165c | ||
|
|
9484f8e0f5 | ||
|
|
947caffe0a | ||
|
|
870090e8df | ||
|
|
73f07f13c5 | ||
|
|
d1952bf591 | ||
|
|
5a612e1332 | ||
|
|
b00a9faea6 | ||
|
|
74db42a703 | ||
|
|
ddf625ca04 | ||
|
|
eca2f017d8 | ||
|
|
3190bde343 | ||
|
|
c6ebf42a47 | ||
|
|
c116b60d12 | ||
|
|
5d09e6d9ab | ||
|
|
2613ce0ac9 | ||
|
|
a88e9b28ea | ||
|
|
f0a3c26ee6 | ||
|
|
84c87ecb32 | ||
|
|
6573f44d41 | ||
|
|
3cacbc552c | ||
|
|
343d623e02 | ||
|
|
6b80bb2b11 | ||
|
|
56fe7452eb | ||
|
|
d3a66f6605 | ||
|
|
dd7b4712f1 | ||
|
|
9df5871f6b | ||
|
|
29aab9e9f4 | ||
|
|
af67eb7f0b | ||
|
|
10482c0141 | ||
|
|
a7a792251a | ||
|
|
aec2308144 | ||
|
|
0741b8aa6a | ||
|
|
3082622394 | ||
|
|
965c9cb0af | ||
|
|
495a46e2d8 | ||
|
|
05bda1192e | ||
|
|
6058af0ca1 | ||
|
|
1eb8bf9719 | ||
|
|
afc02faeda | ||
|
|
66f22de90f | ||
|
|
2949a2e0ff | ||
|
|
ba12efea9d | ||
|
|
e1180a12fb | ||
|
|
1393706f13 | ||
|
|
6f994f31f7 | ||
|
|
38aa99a063 | ||
|
|
85c44b3529 | ||
|
|
e1a2768de5 | ||
|
|
e1c9b27203 | ||
|
|
969f6ef826 | ||
|
|
7abc4d4e76 | ||
|
|
ac97147c1f | ||
|
|
dbd20fe396 | ||
|
|
44e57c9c4b | ||
|
|
488e5e531f | ||
|
|
42a6a8d770 | ||
|
|
f8e877ea05 | ||
|
|
65d6fc7272 | ||
|
|
63ce8e461b | ||
|
|
fbf4c48461 | ||
|
|
81a55db644 | ||
|
|
4d4edfa181 | ||
|
|
6f9182f1f6 | ||
|
|
fa600c03e2 | ||
|
|
4a53301e9f | ||
|
|
676984b3d5 | ||
|
|
e6d7f7248b | ||
|
|
50903b5c4a | ||
|
|
01e399fb91 | ||
|
|
911aeb7af0 | ||
|
|
7e5cd9abbc | ||
|
|
115527a21a | ||
|
|
eff4f4f601 | ||
|
|
16e0099a0d | ||
|
|
2c8c678275 | ||
|
|
3b51e87fbf | ||
|
|
6c6eef5e2b | ||
|
|
6e5910f44c | ||
|
|
a967189bc6 | ||
|
|
7069176cf6 | ||
|
|
44dcbe773d | ||
|
|
ca76975461 | ||
|
|
83122ac99e | ||
|
|
c3e9458555 | ||
|
|
057ba38873 | ||
|
|
81d7d6236b | ||
|
|
191dd49653 | ||
|
|
21e9dd6f51 | ||
|
|
cc2d14acc6 | ||
|
|
87f37e9f1c | ||
|
|
d536a9f874 | ||
|
|
b45f353fa9 | ||
|
|
a3073ec14e | ||
|
|
f77eb33029 | ||
|
|
c1c919097a | ||
|
|
e05348463c | ||
|
|
fdcf74eaf2 | ||
|
|
6d57a3e3b9 | ||
|
|
1f449c866e | ||
|
|
e12deccd24 | ||
|
|
3184ebb5ee | ||
|
|
4a35ed2b35 | ||
|
|
5c9474d1c8 | ||
|
|
2321dc50c5 | ||
|
|
4efd2e8184 | ||
|
|
e30e153bfa | ||
|
|
2724211535 | ||
|
|
81068de0f1 | ||
|
|
7d842175f7 | ||
|
|
e0aee9f361 | ||
|
|
df576e2738 | ||
|
|
bb1356b25d | ||
|
|
1b67960da4 | ||
|
|
d76718e8b2 | ||
|
|
76c51922f1 | ||
|
|
f95e89a136 | ||
|
|
2dff60a23c | ||
|
|
95f83d1a29 | ||
|
|
b875ccecc1 | ||
|
|
e4c3802f16 | ||
|
|
081e485f4f | ||
|
|
4adf88da19 | ||
|
|
31e2b1b8d3 | ||
|
|
bd28abd343 | ||
|
|
955690b124 | ||
|
|
fa6f06ae15 | ||
|
|
263de140c5 | ||
|
|
ed85d06d69 | ||
|
|
4ff0870df8 | ||
|
|
410bac2040 | ||
|
|
38b1e367b1 | ||
|
|
3cddffa37f | ||
|
|
ea7a1a7175 | ||
|
|
36b5601588 | ||
|
|
7fc68f2969 | ||
|
|
c5ee07add4 | ||
|
|
32ff315b6b | ||
|
|
f919346f8f | ||
|
|
279df00404 | ||
|
|
bfd4b17fa0 | ||
|
|
5fe2817164 | ||
|
|
b337bb39bc | ||
|
|
65ae41c5f1 | ||
|
|
796c644c4a | ||
|
|
bfd9023a27 | ||
|
|
c9cdf5d03e | ||
|
|
f60bb41ad9 | ||
|
|
c333903b4a | ||
|
|
dd55e8a22c | ||
|
|
3ab9381d0a | ||
|
|
58f1fe0671 | ||
|
|
82b9c05d0f | ||
|
|
7c9397f7f6 | ||
|
|
6214b6a3ff | ||
|
|
883c8cc4c8 | ||
|
|
8d47c72913 | ||
|
|
89a6664e45 | ||
|
|
30d792d6e1 | ||
|
|
3745bf3157 | ||
|
|
a7fda3e50d | ||
|
|
7f07204fef | ||
|
|
8b51a44b7c | ||
|
|
c499c73dcc | ||
|
|
c01f3f5e8a | ||
|
|
2aef35655f | ||
|
|
7ddf1f5830 | ||
|
|
b2c513ea42 | ||
|
|
4c30f94355 | ||
|
|
e911e86c4c | ||
|
|
ca640b3f64 | ||
|
|
b4c4a05f3b | ||
|
|
fd3c36a259 | ||
|
|
d8274ac2d4 | ||
|
|
9c7479f953 | ||
|
|
b5dc3c4366 | ||
|
|
26b8082155 | ||
|
|
418df15f7b | ||
|
|
31ed0125b8 | ||
|
|
494318b879 | ||
|
|
f554ddc372 | ||
|
|
03de12c221 | ||
|
|
6c41f22b57 | ||
|
|
7ae96388e3 | ||
|
|
e8b4de00d2 | ||
|
|
cd7963b30d | ||
|
|
0dc44cffcf | ||
|
|
7a650132c5 | ||
|
|
c7fb390c38 | ||
|
|
572ff9df19 | ||
|
|
b715e0cef7 | ||
|
|
36ab2a889f | ||
|
|
a78d2f28d7 | ||
|
|
7d5a39ed89 | ||
|
|
772272ff36 | ||
|
|
2ab4eafee9 | ||
|
|
b15e0d4c45 | ||
|
|
b8180314d8 | ||
|
|
fcb8d03a0f | ||
|
|
09ec89bc2e | ||
|
|
863ad0f486 | ||
|
|
79a1bb3571 | ||
|
|
9f1d7323c7 | ||
|
|
64a82f4785 | ||
|
|
f37e4bd76e | ||
|
|
98ef2cc640 | ||
|
|
134222fd69 | ||
|
|
0cb2371517 | ||
|
|
b7de4359fd | ||
|
|
2607d6a107 | ||
|
|
db46b1ce13 | ||
|
|
d7b08d5207 | ||
|
|
29fbba832c | ||
|
|
fd621a442a | ||
|
|
a1a73568ae | ||
|
|
3daccbd6ec | ||
|
|
293deadb48 | ||
|
|
452b56c47b | ||
|
|
5cb6bfa633 | ||
|
|
0515cee6f3 | ||
|
|
4247112539 | ||
|
|
8d3374f574 | ||
|
|
26833e5f7c | ||
|
|
6752b46f67 | ||
|
|
b9429ffcaa | ||
|
|
10827c7e21 | ||
|
|
23cb4a34a4 | ||
|
|
adfd09565f | ||
|
|
78b9ff49d4 | ||
|
|
fca425d25e | ||
|
|
1a4238156c | ||
|
|
f6210cc014 | ||
|
|
6c8b466e59 | ||
|
|
2aebe97f9f | ||
|
|
157724bff8 | ||
|
|
6cbb1a0bee | ||
|
|
960a13dd38 | ||
|
|
9213f80435 | ||
|
|
bccae94c7a | ||
|
|
d71f77ce06 | ||
|
|
2787f3dc71 | ||
|
|
fb00baab5b | ||
|
|
9e22155d31 | ||
|
|
963373435d | ||
|
|
377987fa92 | ||
|
|
0b6980639e | ||
|
|
4f1cc9f94f | ||
|
|
6e5434a0ec | ||
|
|
3244f7c38f | ||
|
|
f27b676e89 | ||
|
|
4f2a80a4a3 | ||
|
|
a51bc27829 | ||
|
|
4fd321c93d | ||
|
|
bbd62bdef5 | ||
|
|
4bb1d78939 | ||
|
|
53c37ef413 | ||
|
|
a6511b6c5a | ||
|
|
829e96a2d0 | ||
|
|
2e25f37433 | ||
|
|
fbf6c73226 | ||
|
|
aab54e3f23 | ||
|
|
a6eff7fbfb | ||
|
|
d5667d2473 | ||
|
|
a42305dd59 | ||
|
|
c22a718d14 | ||
|
|
d0b23c79e2 | ||
|
|
76da04afd8 | ||
|
|
768f60709f | ||
|
|
8cd3acd318 | ||
|
|
ce7cfc0648 | ||
|
|
8b6cf55473 | ||
|
|
75d95d844c | ||
|
|
f54bfd3fb5 | ||
|
|
f8a8ee9b9d | ||
|
|
16faaae199 | ||
|
|
375417527b | ||
|
|
10b01ca6b3 | ||
|
|
f9006af04c | ||
|
|
57f947576e | ||
|
|
5a8f8c345b | ||
|
|
e96067e3c8 | ||
|
|
2242174515 | ||
|
|
73179c118b | ||
|
|
5b575134fc | ||
|
|
c11c06b896 | ||
|
|
ba8d2a251f | ||
|
|
c9589b73f4 | ||
|
|
32f4425100 | ||
|
|
05e81484f1 | ||
|
|
10cc79f737 | ||
|
|
957d9b180d | ||
|
|
883204fc43 | ||
|
|
6d3904fbbd | ||
|
|
56a51f18e7 | ||
|
|
307508b7a0 | ||
|
|
66fce79427 | ||
|
|
5e5708d8d4 | ||
|
|
944d92bbb4 | ||
|
|
0155d5aa39 | ||
|
|
fe4f45c2b0 | ||
|
|
1b63a58e63 | ||
|
|
46a141db9c | ||
|
|
66de06956c | ||
|
|
713dd62bd1 | ||
|
|
5ac65aafad | ||
|
|
4aef92e6fe | ||
|
|
a1b0e771e5 | ||
|
|
5baeac4706 | ||
|
|
87aa9bd673 | ||
|
|
2ec5ca56d5 | ||
|
|
b5c7f83ec8 | ||
|
|
eb3ebdbf52 | ||
|
|
c60698ff7e | ||
|
|
f8c2cda257 | ||
|
|
48f6c195e0 | ||
|
|
804fa60317 | ||
|
|
d77b99d3d4 | ||
|
|
006f1271d6 | ||
|
|
0d14514712 | ||
|
|
f25e5f9488 | ||
|
|
9e8bbfd175 | ||
|
|
3d11c96e23 | ||
|
|
a670737ca5 | ||
|
|
9fdd982e73 | ||
|
|
8024918e08 | ||
|
|
cda7607e1c | ||
|
|
816c83c80a | ||
|
|
0c3c490d58 | ||
|
|
99da6fb66f | ||
|
|
fa2601386c | ||
|
|
122833b0e3 | ||
|
|
8618dbf0d5 | ||
|
|
a0baf33459 | ||
|
|
0ee66ea928 | ||
|
|
f68d4aaf5b | ||
|
|
888abc9e2a | ||
|
|
c8115b1c10 | ||
|
|
137d4f591f | ||
|
|
337d49770d | ||
|
|
614c5578b0 | ||
|
|
d456e60800 | ||
|
|
064206fb9a | ||
|
|
a68fe3b39d | ||
|
|
1904c82941 | ||
|
|
6fc9dd4b30 | ||
|
|
158a31e924 | ||
|
|
b70b924db4 | ||
|
|
9018d72e97 | ||
|
|
5c395138ed | ||
|
|
af157adc1b | ||
|
|
1db4fca9db | ||
|
|
013f475859 | ||
|
|
b5bc38fa52 | ||
|
|
bd0e0cdfa4 | ||
|
|
dade4c4cc4 | ||
|
|
acc5a89dff | ||
|
|
d34881aa25 | ||
|
|
b8ad48997b | ||
|
|
77754b7246 | ||
|
|
6d5bf49a51 | ||
|
|
b7af635a9a | ||
|
|
f53b4e959c | ||
|
|
6716d156bb | ||
|
|
dc33e28452 | ||
|
|
9da4781759 | ||
|
|
0c6959cb4a | ||
|
|
ff3136df70 | ||
|
|
326c627221 | ||
|
|
075f382a8f | ||
|
|
dabb8fe49e | ||
|
|
90489e4392 | ||
|
|
ad45a74f87 | ||
|
|
60c045a713 | ||
|
|
f6c75e1f99 | ||
|
|
dd9245f6f2 | ||
|
|
7310a70743 | ||
|
|
82276837ac | ||
|
|
bd68252b44 | ||
|
|
6b1258e33a | ||
|
|
0400032923 | ||
|
|
d9563322f1 | ||
|
|
ab965969dd | ||
|
|
2f32e034d8 | ||
|
|
d7bb171c1e | ||
|
|
1cf7931f43 | ||
|
|
edc697dd73 | ||
|
|
54a059ff68 | ||
|
|
289282e235 | ||
|
|
825c36c15e | ||
|
|
1234c2e99e | ||
|
|
b8fae1308d | ||
|
|
dddcf624e6 | ||
|
|
b33fe9f7fe | ||
|
|
5a799400a9 | ||
|
|
76919a819f | ||
|
|
9c30f846b2 | ||
|
|
9230f51988 | ||
|
|
712035dc9a | ||
|
|
32e5c5b4ad | ||
|
|
134a6fab7e | ||
|
|
82e27cb962 | ||
|
|
8bcad7b3f9 | ||
|
|
d767575f76 | ||
|
|
7214c7d393 | ||
|
|
205e5ab03d | ||
|
|
6576beae76 | ||
|
|
001f8f1f50 | ||
|
|
3b694a87ef | ||
|
|
84dd06d769 | ||
|
|
c5cb16abfb | ||
|
|
79fb34324d | ||
|
|
303aef3548 | ||
|
|
fd278f8c32 | ||
|
|
53041a4117 | ||
|
|
9b3fe3b13a | ||
|
|
5c6c5081e9 | ||
|
|
e087ea0ac7 | ||
|
|
71c44dc805 | ||
|
|
c5c8596664 | ||
|
|
92a86f4d1c | ||
|
|
8098b68b8e | ||
|
|
7356001723 | ||
|
|
aba60587ab | ||
|
|
936a6a04fb | ||
|
|
9675126298 | ||
|
|
6a5886ea1c | ||
|
|
648c6a5a8f | ||
|
|
14b7bf4753 | ||
|
|
0e310fa96a | ||
|
|
0f6c282c80 | ||
|
|
ed3cd0c9c8 | ||
|
|
398f029f6d | ||
|
|
ad9c2b917b | ||
|
|
d0d65182c0 | ||
|
|
4c3a0d329b | ||
|
|
7c495c2177 | ||
|
|
2f86a9e534 | ||
|
|
12c3a0b1fa | ||
|
|
14f3660f55 | ||
|
|
5a8b032d74 | ||
|
|
57c4613b1f | ||
|
|
e008021a42 | ||
|
|
7e600c43ed | ||
|
|
963478e206 | ||
|
|
0f32783488 | ||
|
|
756d470715 | ||
|
|
2c47b7535b | ||
|
|
4cc90b4929 | ||
|
|
32754ffcf5 | ||
|
|
64aae75680 | ||
|
|
69d2160a0d | ||
|
|
99e326539e | ||
|
|
1dde975cfe | ||
|
|
58c069ec5c | ||
|
|
7916600a7b | ||
|
|
3e4f160c5d | ||
|
|
aeb5e5f681 | ||
|
|
1c2e491845 | ||
|
|
eb4000f26b | ||
|
|
74dd887c79 | ||
|
|
764599a7d9 | ||
|
|
ad683fee89 | ||
|
|
85a53fc68f | ||
|
|
3bf8baee85 | ||
|
|
8792213594 | ||
|
|
d9ebc9455c | ||
|
|
9ab8bdfe4a | ||
|
|
418ea9a19e | ||
|
|
20f04febf2 | ||
|
|
a65783201e | ||
|
|
a5f04d44a4 | ||
|
|
cbe1022f20 | ||
|
|
90301ae9ee | ||
|
|
4f38ab3640 | ||
|
|
fca179abab | ||
|
|
e426237c35 | ||
|
|
473f3954c7 | ||
|
|
5aad5406a2 |
1
.gitattributes
vendored
Normal file
1
.gitattributes
vendored
Normal file
@@ -0,0 +1 @@
|
|||||||
|
*.java text eol=lf
|
||||||
7
.github/PULL_REQUEST_TEMPLATE.md
vendored
7
.github/PULL_REQUEST_TEMPLATE.md
vendored
@@ -7,4 +7,9 @@ We love getting PRs, but we hate asking people for the same basic changes every
|
|||||||
- [ ] Push your changes to a branch other than `master`. Create your PR from that branch.
|
- [ ] Push your changes to a branch other than `master`. Create your PR from that branch.
|
||||||
- [ ] Add JavaDocs and other comments
|
- [ ] Add JavaDocs and other comments
|
||||||
- [ ] Write tests that run and pass in CI. See [CONTRIBUTING.md](CONTRIBUTING.md) for details on how to capture snapshot data.
|
- [ ] Write tests that run and pass in CI. See [CONTRIBUTING.md](CONTRIBUTING.md) for details on how to capture snapshot data.
|
||||||
- [ ] Run `mvn -P ci install site` locally. This may reformat your code, commit those changes. If this command doesn't succeed, your change will not pass CI.
|
- [ ] Run `mvn -D enable-ci clean install site` locally. If this command doesn't succeed, your change will not pass CI.
|
||||||
|
|
||||||
|
# When creating a PR:
|
||||||
|
|
||||||
|
- [ ] Fill in the "Description" above.
|
||||||
|
- [ ] Enable "Allow edits from maintainers".
|
||||||
|
|||||||
12
.github/dependabot.yml
vendored
Normal file
12
.github/dependabot.yml
vendored
Normal file
@@ -0,0 +1,12 @@
|
|||||||
|
version: 2
|
||||||
|
updates:
|
||||||
|
- package-ecosystem: "maven"
|
||||||
|
directory: "/"
|
||||||
|
schedule:
|
||||||
|
interval: "monthly"
|
||||||
|
time: "02:00"
|
||||||
|
- package-ecosystem: "github-actions"
|
||||||
|
directory: "/"
|
||||||
|
schedule:
|
||||||
|
interval: "monthly"
|
||||||
|
time: "02:00"
|
||||||
5
.github/release-drafter.yml
vendored
5
.github/release-drafter.yml
vendored
@@ -1,5 +1,6 @@
|
|||||||
name-template: 'v$NEXT_PATCH_VERSION 🌈'
|
name-template: 'v$NEXT_MINOR_VERSION 🌈'
|
||||||
tag-template: 'v$NEXT_PATCH_VERSION'
|
tag-template: 'github-api-$NEXT_MINOR_VERSION'
|
||||||
|
version-template: '$MAJOR.$MINOR'
|
||||||
categories:
|
categories:
|
||||||
- title: '🚀 Features'
|
- title: '🚀 Features'
|
||||||
labels:
|
labels:
|
||||||
|
|||||||
84
.github/workflows/maven-build.yml
vendored
84
.github/workflows/maven-build.yml
vendored
@@ -1,22 +1,92 @@
|
|||||||
name: Java CI Build and Test
|
name: CI
|
||||||
|
|
||||||
on: [push, pull_request]
|
on: [push, pull_request]
|
||||||
|
|
||||||
|
# this is required by spotless for JDK 16+
|
||||||
|
env:
|
||||||
|
JAVA_11_PLUS_MAVEN_OPTS: "--add-opens jdk.compiler/com.sun.tools.javac.util=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.file=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.parser=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.tree=ALL-UNNAMED --add-opens jdk.compiler/com.sun.tools.javac.api=ALL-UNNAMED"
|
||||||
|
|
||||||
jobs:
|
jobs:
|
||||||
build:
|
build:
|
||||||
|
name: build-only (Java ${{ matrix.java }})
|
||||||
runs-on: ubuntu-latest
|
runs-on: ubuntu-latest
|
||||||
strategy:
|
strategy:
|
||||||
|
fail-fast: false
|
||||||
matrix:
|
matrix:
|
||||||
java: [ '1.8.0', '11.0.x', '13.0.x' ]
|
java: [ 16 ]
|
||||||
steps:
|
steps:
|
||||||
- uses: actions/checkout@v2
|
- uses: actions/checkout@v2
|
||||||
- name: Set up JDK
|
- name: Set up JDK
|
||||||
uses: actions/setup-java@v1
|
uses: actions/setup-java@v1
|
||||||
with:
|
with:
|
||||||
java-version: ${{ matrix.java }}
|
java-version: ${{ matrix.java }}
|
||||||
- name: Maven Download all dependencies
|
- name: Cached .m2
|
||||||
run: mvn -B org.apache.maven.plugins:maven-dependency-plugin:3.1.1:go-offline -P ci
|
uses: actions/cache@v2.1.4
|
||||||
- name: Maven Build
|
with:
|
||||||
run: mvn -B install site -P ci --file pom.xml
|
path: ~/.m2/repository
|
||||||
|
key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
|
||||||
|
restore-keys: |
|
||||||
|
${{ runner.os }}-maven-
|
||||||
|
- name: Maven Install (skipTests)
|
||||||
|
env:
|
||||||
|
MAVEN_OPTS: ${{ env.JAVA_11_PLUS_MAVEN_OPTS }}
|
||||||
|
run: mvn -B install -DskipTests --file pom.xml
|
||||||
|
site:
|
||||||
|
name: site (Java ${{ matrix.java }})
|
||||||
|
runs-on: ubuntu-latest
|
||||||
|
strategy:
|
||||||
|
fail-fast: false
|
||||||
|
matrix:
|
||||||
|
java: [ 8, 11 ]
|
||||||
|
steps:
|
||||||
|
- uses: actions/checkout@v2
|
||||||
|
- name: Set up JDK
|
||||||
|
uses: actions/setup-java@v1
|
||||||
|
with:
|
||||||
|
java-version: ${{ matrix.java }}
|
||||||
|
- uses: actions/cache@v2.1.4
|
||||||
|
with:
|
||||||
|
path: ~/.m2/repository
|
||||||
|
key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
|
||||||
|
restore-keys: |
|
||||||
|
${{ runner.os }}-maven-
|
||||||
|
- name: Maven Site
|
||||||
|
run: mvn -B site -D enable-ci --file pom.xml
|
||||||
|
test:
|
||||||
|
name: test (${{ matrix.os }}, Java ${{ matrix.java }})
|
||||||
|
runs-on: ${{ matrix.os }}-latest
|
||||||
|
strategy:
|
||||||
|
fail-fast: false
|
||||||
|
matrix:
|
||||||
|
os: [ ubuntu, windows ]
|
||||||
|
java: [ 8, 11, 16 ]
|
||||||
|
steps:
|
||||||
|
- uses: actions/checkout@v2
|
||||||
|
- name: Set up JDK
|
||||||
|
uses: actions/setup-java@v1
|
||||||
|
with:
|
||||||
|
java-version: ${{ matrix.java }}
|
||||||
|
- uses: actions/cache@v2.1.4
|
||||||
|
with:
|
||||||
|
path: ~/.m2/repository
|
||||||
|
key: ${{ runner.os }}-maven-${{ hashFiles('**/pom.xml') }}
|
||||||
|
restore-keys: |
|
||||||
|
${{ runner.os }}-maven-
|
||||||
|
# JDK 8
|
||||||
|
- name: Maven Install without Code Coverage
|
||||||
|
if: matrix.os == 'windows' && matrix.java == '8'
|
||||||
|
run: mvn -B install --file pom.xml
|
||||||
|
- name: Maven Install with Code Coverage
|
||||||
|
if: matrix.os != 'windows' && matrix.java == '8'
|
||||||
|
run: mvn -B install -D enable-ci --file pom.xml
|
||||||
|
# JDK 11+
|
||||||
|
- name: Maven Install without Code Coverage
|
||||||
|
if: matrix.os == 'windows' && matrix.java != '8'
|
||||||
|
env:
|
||||||
|
MAVEN_OPTS: ${{ env.JAVA_11_PLUS_MAVEN_OPTS }}
|
||||||
|
run: mvn -B install --file pom.xml
|
||||||
|
- name: Maven Install with Code Coverage
|
||||||
|
if: matrix.os != 'windows' && matrix.java != '8'
|
||||||
|
env:
|
||||||
|
MAVEN_OPTS: ${{ env.JAVA_11_PLUS_MAVEN_OPTS }}
|
||||||
|
run: mvn -B install -D enable-ci --file pom.xml
|
||||||
|
|||||||
2
.gitignore
vendored
2
.gitignore
vendored
@@ -9,3 +9,5 @@ target
|
|||||||
.DS_Store
|
.DS_Store
|
||||||
|
|
||||||
dependency-reduced-pom.xml
|
dependency-reduced-pom.xml
|
||||||
|
.factorypath
|
||||||
|
.vscode/settings.json
|
||||||
|
|||||||
1326
CHANGELOG.md
1326
CHANGELOG.md
File diff suppressed because it is too large
Load Diff
@@ -14,10 +14,14 @@ Example:
|
|||||||
|
|
||||||
This the default behavior.
|
This the default behavior.
|
||||||
|
|
||||||
|
Example for a single test case:
|
||||||
|
|
||||||
|
`mvn install -Dtest=WireMockStatusReporterTest#user_whenProxying_AuthCorrectlyConfigured`
|
||||||
|
|
||||||
|
|
||||||
### Setting up credential
|
### Setting up credential
|
||||||
|
|
||||||
1. Create an OAuth token on github.com
|
1. Create a "Personal access token" on https://github.com/ (`Settings` > `Developer settings` > `Personal access tokens`)
|
||||||
2. Set the GITHUB_OAUTH environment variable to the value of that token
|
2. Set the GITHUB_OAUTH environment variable to the value of that token
|
||||||
3. Set the system property `test.github.useProxy` (usually like "-Dtest.github.useProxy" as a Java VM option)
|
3. Set the system property `test.github.useProxy` (usually like "-Dtest.github.useProxy" as a Java VM option)
|
||||||
|
|
||||||
@@ -27,21 +31,37 @@ This the default behavior.
|
|||||||
|
|
||||||
`WireMockStatusReporterTest: GitHub proxying and user auth correctly configured for user login: <your login>`
|
`WireMockStatusReporterTest: GitHub proxying and user auth correctly configured for user login: <your login>`
|
||||||
|
|
||||||
Whenever you run tests with `-Dtest.github.useProxy`, they will try to get data from local files but will fallback to proxying to github if not found.
|
Whenever you run tests with `-Dtest.github.useProxy`, they will try to get data from local files but will fallback to proxying to GitHub if not found.
|
||||||
|
|
||||||
|
|
||||||
### Writing a new test
|
### Writing a new test
|
||||||
|
|
||||||
Once you have credentials setup, you add new test classes and test methods as you would normally.
|
Once you have credentials setup, you add new test classes and test methods as you would normally.
|
||||||
Keep `useProxy` enabled and iterate on your tests as needed. Remember, while proxying your tests are interacting with GitHub - you will need to clean up your state between runs.
|
|
||||||
|
|
||||||
When you are ready to create a snapshot of your test data,
|
#### Running tests using GitHub test proxy
|
||||||
run your test with `test.github.takeSnapshot` ("-Dtest.github.takeSnapshot" as a Java VM option). For example:
|
|
||||||
|
|
||||||
`mvn install -Dtest.github.takeSnapshot -Dtest=YourTestClassName`
|
Keep `useProxy` enabled and iterate on your tests as needed. With `useProxy` enabled your tests will interact with
|
||||||
|
GitHub - you will need to clean up your server-state between runs. This can be done manually to start with.
|
||||||
|
Once your test code is somewhat stable, use `getGitHubBeforeAfter()` to get a `GitHub` instance for test setup and cleanup.
|
||||||
|
Interactions with that `GitHub` instance will not be recorded as part of the test, keeping the test data files to a minimum.
|
||||||
|
|
||||||
The above command would create snapshot WireMock data files under the path `src/test/resources/org/kohsuhke/github/YourTestClassName/wiremock`.
|
#### Running tests against your personal GitHub user account
|
||||||
Each method would get a separate director that would hold the data files for that test method.
|
|
||||||
|
By default, test helper methods such as `getTempRepository()` target the `hub4j-test-org` GitHub organization.
|
||||||
|
Please request access to this org to record your tests before submitting a PR. This helps keep the project stable and nimble.
|
||||||
|
Until you have access (or if you don't want access), you can set the following additional system property to target
|
||||||
|
your personal github account.
|
||||||
|
|
||||||
|
`mvn install -Dtest.github.org=false -Dtest=YourTestClassName`
|
||||||
|
|
||||||
|
#### Taking a snapshot
|
||||||
|
|
||||||
|
When you are ready to create a snapshot of your test data, run your test with `test.github.takeSnapshot` ("-Dtest.github.takeSnapshot" as
|
||||||
|
a Java VM option). For example:
|
||||||
|
|
||||||
|
`mvn install -Dtest.github.takeSnapshot -Dtest.github.org=false -Dtest=YourTestClassName`
|
||||||
|
|
||||||
|
The above command will create snapshot WireMock data files under the path `src/test/resources/org/kohsuhke/github/YourTestClassName/wiremock`.
|
||||||
|
Each method will get a separate directory that will hold the data files for that test method.
|
||||||
|
|
||||||
Add all files including the generated data to your commit and submit a PR.
|
Add all files including the generated data to your commit and submit a PR.
|
||||||
|
|
||||||
|
|||||||
@@ -1,7 +1,9 @@
|
|||||||
# Java API for GitHub
|
# Java API for GitHub
|
||||||
|
|
||||||
[](https://mvnrepository.com/artifact/org.kohsuke/github-api)
|
[](https://mvnrepository.com/artifact/org.kohsuke/github-api)
|
||||||
[](https://gitter.im/github-api/github-api?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
|
[](https://gitter.im/hub4j/github-api?utm_source=badge&utm_medium=badge&utm_campaign=pr-badge&utm_content=badge)
|
||||||
|

|
||||||
|
|
||||||
|
|
||||||
|
|
||||||
See https://github-api.kohsuke.org/ for more details
|
See https://github-api.kohsuke.org/ for more details
|
||||||
|
|||||||
362
pom.xml
362
pom.xml
@@ -2,16 +2,16 @@
|
|||||||
<modelVersion>4.0.0</modelVersion>
|
<modelVersion>4.0.0</modelVersion>
|
||||||
<groupId>org.kohsuke</groupId>
|
<groupId>org.kohsuke</groupId>
|
||||||
<artifactId>github-api</artifactId>
|
<artifactId>github-api</artifactId>
|
||||||
<version>1.103</version>
|
<version>1.127</version>
|
||||||
<name>GitHub API for Java</name>
|
<name>GitHub API for Java</name>
|
||||||
<url>https://github-api.kohsuke.org/</url>
|
<url>https://github-api.kohsuke.org/</url>
|
||||||
<description>GitHub API for Java</description>
|
<description>GitHub API for Java</description>
|
||||||
|
|
||||||
<scm>
|
<scm>
|
||||||
<connection>scm:git:git@github.com/github-api/${project.artifactId}.git</connection>
|
<connection>scm:git:git@github.com/hub4j/${project.artifactId}.git</connection>
|
||||||
<developerConnection>scm:git:ssh://git@github.com/github-api/${project.artifactId}.git</developerConnection>
|
<developerConnection>scm:git:ssh://git@github.com/hub4j/${project.artifactId}.git</developerConnection>
|
||||||
<url>https://${project.artifactId}.kohsuke.org/</url>
|
<url>https://github.com/hub4j/github-api/</url>
|
||||||
<tag>github-api-1.103</tag>
|
<tag>github-api-1.127</tag>
|
||||||
</scm>
|
</scm>
|
||||||
|
|
||||||
<distributionManagement>
|
<distributionManagement>
|
||||||
@@ -27,25 +27,27 @@
|
|||||||
</repository>
|
</repository>
|
||||||
<site>
|
<site>
|
||||||
<id>github-pages</id>
|
<id>github-pages</id>
|
||||||
<url>gitsite:git@github.com/github-api/${project.artifactId}.git</url>
|
<url>gitsite:git@github.com/hub4j/${project.artifactId}.git</url>
|
||||||
</site>
|
</site>
|
||||||
</distributionManagement>
|
</distributionManagement>
|
||||||
|
|
||||||
<properties>
|
<properties>
|
||||||
<project.build.sourceEncoding>UTF-8</project.build.sourceEncoding>
|
<project.build.sourceEncoding>UTF-8</project.build.sourceEncoding>
|
||||||
<spotbugs-maven-plugin.version>3.1.12.2</spotbugs-maven-plugin.version>
|
<spotbugs-maven-plugin.version>4.2.0</spotbugs-maven-plugin.version>
|
||||||
<spotbugs.version>3.1.12</spotbugs.version>
|
<spotbugs.version>4.2.2</spotbugs.version>
|
||||||
<spotbugs-maven-plugin.failOnError>true</spotbugs-maven-plugin.failOnError>
|
<spotbugs-maven-plugin.failOnError>true</spotbugs-maven-plugin.failOnError>
|
||||||
<hamcrest.version>2.2</hamcrest.version>
|
<hamcrest.version>2.2</hamcrest.version>
|
||||||
<okhttp3.version>4.3.1</okhttp3.version>
|
<okhttp3.version>4.4.1</okhttp3.version>
|
||||||
<okio.version>2.4.3</okio.version>
|
<okio.version>2.5.0</okio.version>
|
||||||
<formatter-maven-plugin.goal>format</formatter-maven-plugin.goal>
|
|
||||||
<impsort-maven-plugin.goal>sort</impsort-maven-plugin.goal>
|
|
||||||
<!-- Using this as the minimum bar for code coverage. Adding methods without covering them will fail this. -->
|
<!-- Using this as the minimum bar for code coverage. Adding methods without covering them will fail this. -->
|
||||||
<jacoco.coverage.target.bundle.method>0.556</jacoco.coverage.target.bundle.method>
|
<jacoco.coverage.target.bundle.method>0.70</jacoco.coverage.target.bundle.method>
|
||||||
<jacoco.coverage.target.class.method>0.25</jacoco.coverage.target.class.method>
|
<jacoco.coverage.target.class.method>0.50</jacoco.coverage.target.class.method>
|
||||||
<!-- For non-ci builds we'd like the build to still complete if jacoco metrics aren't met. -->
|
<!-- For non-ci builds we'd like the build to still complete if jacoco metrics aren't met. -->
|
||||||
<jacoco.haltOnFailure>false</jacoco.haltOnFailure>
|
<jacoco.haltOnFailure>false</jacoco.haltOnFailure>
|
||||||
|
<jjwt.suite.version>0.11.2</jjwt.suite.version>
|
||||||
|
|
||||||
|
<jacoco.surefire.argLine />
|
||||||
|
<surefire.argLine />
|
||||||
</properties>
|
</properties>
|
||||||
|
|
||||||
<build>
|
<build>
|
||||||
@@ -80,52 +82,12 @@
|
|||||||
<pluginManagement>
|
<pluginManagement>
|
||||||
<plugins>
|
<plugins>
|
||||||
<plugin>
|
<plugin>
|
||||||
<groupId>org.apache.maven.plugins</groupId>
|
<artifactId>maven-surefire-plugin</artifactId>
|
||||||
<artifactId>maven-shade-plugin</artifactId>
|
<version>2.22.2</version>
|
||||||
<version>3.2.1</version>
|
|
||||||
<executions>
|
|
||||||
<execution>
|
|
||||||
<id>shaded-jar</id>
|
|
||||||
<phase>package</phase>
|
|
||||||
<goals>
|
|
||||||
<goal>shade</goal>
|
|
||||||
</goals>
|
|
||||||
<configuration>
|
<configuration>
|
||||||
<relocations>
|
<!-- SUREFIRE-1226 workaround -->
|
||||||
<relocation>
|
<trimStackTrace>false</trimStackTrace>
|
||||||
<pattern>com.fasterxml.jackson</pattern>
|
|
||||||
<shadedPattern>hidden.com.fasterxml.jackson</shadedPattern>
|
|
||||||
</relocation>
|
|
||||||
<relocation>
|
|
||||||
<pattern>org.apache</pattern>
|
|
||||||
<shadedPattern>hidden.org.apache</shadedPattern>
|
|
||||||
</relocation>
|
|
||||||
</relocations>
|
|
||||||
<artifactSet>
|
|
||||||
<excludes>
|
|
||||||
<exclude>com.infradna.tool:bridge-method-annotation</exclude>
|
|
||||||
<exclude>org.jenkins-ci:annotation-indexer</exclude>
|
|
||||||
<exclude>com.squareup.*:*</exclude>
|
|
||||||
<exclude>org.jetbrains*:*</exclude>
|
|
||||||
<exclude>com.github.spotbugs:*</exclude>
|
|
||||||
<exclude>com.google.code.findbugs:*</exclude>
|
|
||||||
</excludes>
|
|
||||||
</artifactSet>
|
|
||||||
<shadedArtifactAttached>true</shadedArtifactAttached>
|
|
||||||
<filters>
|
|
||||||
<filter>
|
|
||||||
<artifact>*:*</artifact>
|
|
||||||
<excludes>
|
|
||||||
<exclude>module-info.class</exclude>
|
|
||||||
<exclude>META-INF/*.SF</exclude>
|
|
||||||
<exclude>META-INF/*.DSA</exclude>
|
|
||||||
<exclude>META-INF/*.RSA</exclude>
|
|
||||||
</excludes>
|
|
||||||
</filter>
|
|
||||||
</filters>
|
|
||||||
</configuration>
|
</configuration>
|
||||||
</execution>
|
|
||||||
</executions>
|
|
||||||
</plugin>
|
</plugin>
|
||||||
<plugin>
|
<plugin>
|
||||||
<groupId>org.apache.maven.plugins</groupId>
|
<groupId>org.apache.maven.plugins</groupId>
|
||||||
@@ -140,12 +102,15 @@
|
|||||||
<plugin>
|
<plugin>
|
||||||
<groupId>org.jacoco</groupId>
|
<groupId>org.jacoco</groupId>
|
||||||
<artifactId>jacoco-maven-plugin</artifactId>
|
<artifactId>jacoco-maven-plugin</artifactId>
|
||||||
<version>0.8.5</version>
|
<version>0.8.6</version>
|
||||||
<executions>
|
<executions>
|
||||||
<execution>
|
<execution>
|
||||||
<goals>
|
<goals>
|
||||||
<goal>prepare-agent</goal>
|
<goal>prepare-agent</goal>
|
||||||
</goals>
|
</goals>
|
||||||
|
<configuration>
|
||||||
|
<propertyName>jacoco.surefire.argLine</propertyName>
|
||||||
|
</configuration>
|
||||||
</execution>
|
</execution>
|
||||||
<!-- attached to Maven test phase -->
|
<!-- attached to Maven test phase -->
|
||||||
<execution>
|
<execution>
|
||||||
@@ -193,64 +158,40 @@
|
|||||||
<!-- Sample only -->
|
<!-- Sample only -->
|
||||||
<exclude>org.kohsuke.github.example.*</exclude>
|
<exclude>org.kohsuke.github.example.*</exclude>
|
||||||
|
|
||||||
<!-- No methods -->
|
|
||||||
<exclude>org.kohsuke.github.DeleteToken</exclude>
|
|
||||||
<exclude>org.kohsuke.github.Previews</exclude>
|
|
||||||
|
|
||||||
<!-- Deprecated -->
|
<!-- Deprecated -->
|
||||||
<exclude>org.kohsuke.github.extras.OkHttp3Connector</exclude>
|
<exclude>org.kohsuke.github.extras.OkHttp3Connector</exclude>
|
||||||
<exclude>org.kohsuke.github.EnforcementLevel</exclude>
|
<exclude>org.kohsuke.github.EnforcementLevel</exclude>
|
||||||
<exclude>org.kohsuke.github.GHPerson.1</exclude>
|
<exclude>org.kohsuke.github.GHPerson.1</exclude>
|
||||||
<exclude>org.kohsuke.github.GHPerson.1.1</exclude>
|
<!-- TODO: Some coverage, but more needed -->
|
||||||
|
<exclude>org.kohsuke.github.GHPullRequestReviewBuilder.DraftReviewComment</exclude>
|
||||||
|
<exclude>org.kohsuke.github.GHIssue.PullRequest</exclude>
|
||||||
|
<exclude>org.kohsuke.github.GHCommitSearchBuilder</exclude>
|
||||||
|
<exclude>org.kohsuke.github.GHRepositorySearchBuilder</exclude>
|
||||||
|
<exclude>org.kohsuke.github.GHUserSearchBuilder</exclude>
|
||||||
|
|
||||||
<!-- TODO: These still need test coverage -->
|
<!-- TODO: These still need test coverage -->
|
||||||
<exclude>org.kohsuke.github.GHBranchProtection.RequiredSignatures</exclude>
|
<exclude>org.kohsuke.github.GHBranchProtection.RequiredSignatures</exclude>
|
||||||
<exclude>org.kohsuke.github.GHBranchProtectionBuilder.Restrictions</exclude>
|
<exclude>org.kohsuke.github.GHBranchProtectionBuilder.Restrictions</exclude>
|
||||||
<exclude>org.kohsuke.github.GHBranchProtection.Restrictions</exclude>
|
<exclude>org.kohsuke.github.GHBranchProtection.Restrictions</exclude>
|
||||||
<exclude>org.kohsuke.github.GHCommentAuthorAssociation</exclude>
|
<exclude>org.kohsuke.github.GHCommentAuthorAssociation</exclude>
|
||||||
<exclude>org.kohsuke.github.GHCommitBuilder.UserInfo</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHCommitSearchBuilder.CommitSearchResult</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHCommitSearchBuilder.Sort</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHCommitSearchBuilder</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHCommitState</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHCompare.Commit</exclude>
|
<exclude>org.kohsuke.github.GHCompare.Commit</exclude>
|
||||||
<exclude>org.kohsuke.github.GHCompare.InnerCommit</exclude>
|
<exclude>org.kohsuke.github.GHCompare.InnerCommit</exclude>
|
||||||
<exclude>org.kohsuke.github.GHCompare.Status</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHCompare.Tree</exclude>
|
<exclude>org.kohsuke.github.GHCompare.Tree</exclude>
|
||||||
<exclude>org.kohsuke.github.GHCompare.User</exclude>
|
<exclude>org.kohsuke.github.GHCompare.User</exclude>
|
||||||
<exclude>org.kohsuke.github.GHCompare</exclude>
|
<exclude>org.kohsuke.github.GHCompare</exclude>
|
||||||
<exclude>org.kohsuke.github.GHDeployKey</exclude>
|
<exclude>org.kohsuke.github.GHDeployKey</exclude>
|
||||||
<exclude>org.kohsuke.github.GHDeploymentStatusBuilder</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHDirection</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHEmail</exclude>
|
<exclude>org.kohsuke.github.GHEmail</exclude>
|
||||||
<exclude>org.kohsuke.github.GHEventPayload.Ping</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHEventPayload.Release</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHException</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHHook</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHHooks.OrgContext</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHInvitation</exclude>
|
<exclude>org.kohsuke.github.GHInvitation</exclude>
|
||||||
<exclude>org.kohsuke.github.GHIssueSearchBuilder.IssueSearchResult</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHIssueSearchBuilder.Sort</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHIssueSearchBuilder</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHMilestoneState</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHOrgHook</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHProject.ProjectStateFilter</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.Authorship</exclude>
|
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.Authorship</exclude>
|
||||||
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.Commit</exclude>
|
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.Commit</exclude>
|
||||||
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.CommitPointer</exclude>
|
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.CommitPointer</exclude>
|
||||||
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.Tree</exclude>
|
<exclude>org.kohsuke.github.GHPullRequestCommitDetail.Tree</exclude>
|
||||||
<exclude>org.kohsuke.github.GHPullRequestCommitDetail</exclude>
|
<exclude>org.kohsuke.github.GHPullRequestCommitDetail</exclude>
|
||||||
<exclude>org.kohsuke.github.GHPullRequestFileDetail</exclude>
|
<exclude>org.kohsuke.github.GHPullRequestFileDetail</exclude>
|
||||||
<exclude>org.kohsuke.github.GHPullRequestQueryBuilder.Sort</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHReleaseUpdater</exclude>
|
<exclude>org.kohsuke.github.GHReleaseUpdater</exclude>
|
||||||
<exclude>org.kohsuke.github.GHRepository.ForkSort</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHRequestedAction</exclude>
|
<exclude>org.kohsuke.github.GHRequestedAction</exclude>
|
||||||
<exclude>org.kohsuke.github.GHStargazer</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHTagObject</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHTeam.Role</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHUserSearchBuilder.Sort</exclude>
|
|
||||||
<exclude>org.kohsuke.github.GHVerifiedKey</exclude>
|
<exclude>org.kohsuke.github.GHVerifiedKey</exclude>
|
||||||
<exclude>org.kohsuke.github.GitHubBuilder.1</exclude>
|
|
||||||
</excludes>
|
</excludes>
|
||||||
</rule>
|
</rule>
|
||||||
</rules>
|
</rules>
|
||||||
@@ -261,7 +202,7 @@
|
|||||||
<plugin>
|
<plugin>
|
||||||
<groupId>org.apache.maven.plugins</groupId>
|
<groupId>org.apache.maven.plugins</groupId>
|
||||||
<artifactId>maven-javadoc-plugin</artifactId>
|
<artifactId>maven-javadoc-plugin</artifactId>
|
||||||
<version>3.1.1</version>
|
<version>3.2.0</version>
|
||||||
<configuration>
|
<configuration>
|
||||||
<source>8</source>
|
<source>8</source>
|
||||||
<failOnWarnings>true</failOnWarnings>
|
<failOnWarnings>true</failOnWarnings>
|
||||||
@@ -285,7 +226,7 @@
|
|||||||
<plugin>
|
<plugin>
|
||||||
<groupId>org.apache.maven.plugins</groupId>
|
<groupId>org.apache.maven.plugins</groupId>
|
||||||
<artifactId>maven-site-plugin</artifactId>
|
<artifactId>maven-site-plugin</artifactId>
|
||||||
<version>3.8.2</version>
|
<version>3.9.1</version>
|
||||||
</plugin>
|
</plugin>
|
||||||
<plugin>
|
<plugin>
|
||||||
<groupId>org.apache.maven.plugins</groupId>
|
<groupId>org.apache.maven.plugins</groupId>
|
||||||
@@ -305,12 +246,12 @@
|
|||||||
<plugin>
|
<plugin>
|
||||||
<groupId>org.apache.maven.plugins</groupId>
|
<groupId>org.apache.maven.plugins</groupId>
|
||||||
<artifactId>maven-project-info-reports-plugin</artifactId>
|
<artifactId>maven-project-info-reports-plugin</artifactId>
|
||||||
<version>3.0.0</version>
|
<version>3.1.1</version>
|
||||||
<dependencies>
|
<dependencies>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>org.apache.bcel</groupId>
|
<groupId>org.apache.bcel</groupId>
|
||||||
<artifactId>bcel</artifactId>
|
<artifactId>bcel</artifactId>
|
||||||
<version>6.4.1</version>
|
<version>6.5.0</version>
|
||||||
</dependency>
|
</dependency>
|
||||||
</dependencies>
|
</dependencies>
|
||||||
</plugin>
|
</plugin>
|
||||||
@@ -332,12 +273,20 @@
|
|||||||
|
|
||||||
<plugin>
|
<plugin>
|
||||||
<artifactId>maven-surefire-plugin</artifactId>
|
<artifactId>maven-surefire-plugin</artifactId>
|
||||||
<version>2.22.2</version>
|
<executions>
|
||||||
|
<execution>
|
||||||
|
<id>default-test</id>
|
||||||
|
<configuration>
|
||||||
|
<excludesFile>src/test/resources/slow-or-flaky-tests.txt</excludesFile>
|
||||||
|
<argLine>@{jacoco.surefire.argLine} ${surefire.argLine}</argLine>
|
||||||
|
</configuration>
|
||||||
|
</execution>
|
||||||
|
</executions>
|
||||||
</plugin>
|
</plugin>
|
||||||
<plugin>
|
<plugin>
|
||||||
<groupId>org.codehaus.mojo</groupId>
|
<groupId>org.codehaus.mojo</groupId>
|
||||||
<artifactId>animal-sniffer-maven-plugin</artifactId>
|
<artifactId>animal-sniffer-maven-plugin</artifactId>
|
||||||
<version>1.18</version>
|
<version>1.20</version>
|
||||||
<configuration>
|
<configuration>
|
||||||
<signature>
|
<signature>
|
||||||
<groupId>org.codehaus.mojo.signature</groupId>
|
<groupId>org.codehaus.mojo.signature</groupId>
|
||||||
@@ -368,36 +317,35 @@
|
|||||||
</executions>
|
</executions>
|
||||||
</plugin>
|
</plugin>
|
||||||
<plugin>
|
<plugin>
|
||||||
<groupId>net.revelc.code.formatter</groupId>
|
<groupId>com.diffplug.spotless</groupId>
|
||||||
<artifactId>formatter-maven-plugin</artifactId>
|
<artifactId>spotless-maven-plugin</artifactId>
|
||||||
<version>2.11.0</version>
|
<version>2.9.0</version>
|
||||||
<executions>
|
<executions>
|
||||||
<execution>
|
<execution>
|
||||||
|
<id>spotless-check</id>
|
||||||
|
<!-- runs in verify phase by default -->
|
||||||
<goals>
|
<goals>
|
||||||
<goal>${formatter-maven-plugin.goal}</goal>
|
<!-- can be disabled using -Dspotless.check.skip=true -->
|
||||||
</goals>
|
<goal>check</goal>
|
||||||
<configuration>
|
|
||||||
<configFile>src/main/resources/eclipse/formatter.xml</configFile>
|
|
||||||
</configuration>
|
|
||||||
</execution>
|
|
||||||
</executions>
|
|
||||||
</plugin>
|
|
||||||
<plugin>
|
|
||||||
<groupId>net.revelc.code</groupId>
|
|
||||||
<artifactId>impsort-maven-plugin</artifactId>
|
|
||||||
<version>1.3.2</version>
|
|
||||||
<configuration>
|
|
||||||
<groups>*,java.,javax.</groups>
|
|
||||||
<removeUnused>true</removeUnused>
|
|
||||||
<staticAfter>true</staticAfter>
|
|
||||||
</configuration>
|
|
||||||
<executions>
|
|
||||||
<execution>
|
|
||||||
<goals>
|
|
||||||
<goal>${impsort-maven-plugin.goal}</goal>
|
|
||||||
</goals>
|
</goals>
|
||||||
</execution>
|
</execution>
|
||||||
</executions>
|
</executions>
|
||||||
|
<configuration>
|
||||||
|
<java>
|
||||||
|
<eclipse>
|
||||||
|
<file>${basedir}/src/build/eclipse/formatter.xml</file>
|
||||||
|
</eclipse>
|
||||||
|
|
||||||
|
<importOrder>
|
||||||
|
<file>${basedir}/src/build/eclipse/eclipse.importorder</file>
|
||||||
|
</importOrder>
|
||||||
|
<removeUnusedImports />
|
||||||
|
|
||||||
|
<trimTrailingWhitespace />
|
||||||
|
<endWithNewline />
|
||||||
|
|
||||||
|
</java>
|
||||||
|
</configuration>
|
||||||
</plugin>
|
</plugin>
|
||||||
<plugin>
|
<plugin>
|
||||||
<groupId>com.github.spotbugs</groupId>
|
<groupId>com.github.spotbugs</groupId>
|
||||||
@@ -434,6 +382,12 @@
|
|||||||
<artifactId>commons-lang3</artifactId>
|
<artifactId>commons-lang3</artifactId>
|
||||||
<version>3.9</version>
|
<version>3.9</version>
|
||||||
</dependency>
|
</dependency>
|
||||||
|
<dependency>
|
||||||
|
<groupId>com.tngtech.archunit</groupId>
|
||||||
|
<artifactId>archunit</artifactId>
|
||||||
|
<version>0.17.0</version>
|
||||||
|
<scope>test</scope>
|
||||||
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>org.hamcrest</groupId>
|
<groupId>org.hamcrest</groupId>
|
||||||
<artifactId>hamcrest</artifactId>
|
<artifactId>hamcrest</artifactId>
|
||||||
@@ -456,18 +410,24 @@
|
|||||||
<dependency>
|
<dependency>
|
||||||
<groupId>junit</groupId>
|
<groupId>junit</groupId>
|
||||||
<artifactId>junit</artifactId>
|
<artifactId>junit</artifactId>
|
||||||
<version>4.13</version>
|
<version>4.13.2</version>
|
||||||
|
<scope>test</scope>
|
||||||
|
</dependency>
|
||||||
|
<dependency>
|
||||||
|
<groupId>org.awaitility</groupId>
|
||||||
|
<artifactId>awaitility</artifactId>
|
||||||
|
<version>4.0.3</version>
|
||||||
<scope>test</scope>
|
<scope>test</scope>
|
||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>com.fasterxml.jackson.core</groupId>
|
<groupId>com.fasterxml.jackson.core</groupId>
|
||||||
<artifactId>jackson-databind</artifactId>
|
<artifactId>jackson-databind</artifactId>
|
||||||
<version>2.10.2</version>
|
<version>2.12.1</version>
|
||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>commons-io</groupId>
|
<groupId>commons-io</groupId>
|
||||||
<artifactId>commons-io</artifactId>
|
<artifactId>commons-io</artifactId>
|
||||||
<version>2.6</version>
|
<version>2.4</version>
|
||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>com.infradna.tool</groupId>
|
<groupId>com.infradna.tool</groupId>
|
||||||
@@ -493,7 +453,7 @@
|
|||||||
<dependency>
|
<dependency>
|
||||||
<groupId>org.kohsuke.stapler</groupId>
|
<groupId>org.kohsuke.stapler</groupId>
|
||||||
<artifactId>stapler</artifactId>
|
<artifactId>stapler</artifactId>
|
||||||
<version>1.258</version>
|
<version>1.262</version>
|
||||||
<scope>test</scope>
|
<scope>test</scope>
|
||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
@@ -505,9 +465,27 @@
|
|||||||
<dependency>
|
<dependency>
|
||||||
<groupId>org.eclipse.jgit</groupId>
|
<groupId>org.eclipse.jgit</groupId>
|
||||||
<artifactId>org.eclipse.jgit</artifactId>
|
<artifactId>org.eclipse.jgit</artifactId>
|
||||||
<version>5.6.0.201912101111-r</version>
|
<version>5.11.0.202103091610-r</version>
|
||||||
<scope>test</scope>
|
<scope>test</scope>
|
||||||
</dependency>
|
</dependency>
|
||||||
|
<dependency>
|
||||||
|
<groupId>io.jsonwebtoken</groupId>
|
||||||
|
<artifactId>jjwt-api</artifactId>
|
||||||
|
<version>${jjwt.suite.version}</version>
|
||||||
|
<optional>true</optional>
|
||||||
|
</dependency>
|
||||||
|
<dependency>
|
||||||
|
<groupId>io.jsonwebtoken</groupId>
|
||||||
|
<artifactId>jjwt-impl</artifactId>
|
||||||
|
<version>${jjwt.suite.version}</version>
|
||||||
|
<optional>true</optional>
|
||||||
|
</dependency>
|
||||||
|
<dependency>
|
||||||
|
<groupId>io.jsonwebtoken</groupId>
|
||||||
|
<artifactId>jjwt-jackson</artifactId>
|
||||||
|
<version>${jjwt.suite.version}</version>
|
||||||
|
<optional>true</optional>
|
||||||
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
<groupId>com.squareup.okio</groupId>
|
<groupId>com.squareup.okio</groupId>
|
||||||
<artifactId>okio</artifactId>
|
<artifactId>okio</artifactId>
|
||||||
@@ -543,7 +521,7 @@
|
|||||||
<dependency>
|
<dependency>
|
||||||
<groupId>org.mockito</groupId>
|
<groupId>org.mockito</groupId>
|
||||||
<artifactId>mockito-core</artifactId>
|
<artifactId>mockito-core</artifactId>
|
||||||
<version>3.2.4</version>
|
<version>3.8.0</version>
|
||||||
<scope>test</scope>
|
<scope>test</scope>
|
||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
@@ -555,7 +533,7 @@
|
|||||||
<dependency>
|
<dependency>
|
||||||
<groupId>com.github.tomakehurst</groupId>
|
<groupId>com.github.tomakehurst</groupId>
|
||||||
<artifactId>wiremock-jre8-standalone</artifactId>
|
<artifactId>wiremock-jre8-standalone</artifactId>
|
||||||
<version>2.25.1</version>
|
<version>2.27.2</version>
|
||||||
<scope>test</scope>
|
<scope>test</scope>
|
||||||
</dependency>
|
</dependency>
|
||||||
<dependency>
|
<dependency>
|
||||||
@@ -564,6 +542,12 @@
|
|||||||
<version>2.8.6</version>
|
<version>2.8.6</version>
|
||||||
<scope>test</scope>
|
<scope>test</scope>
|
||||||
</dependency>
|
</dependency>
|
||||||
|
<dependency>
|
||||||
|
<groupId>org.slf4j</groupId>
|
||||||
|
<artifactId>slf4j-simple</artifactId>
|
||||||
|
<version>1.7.30</version>
|
||||||
|
<scope>test</scope>
|
||||||
|
</dependency>
|
||||||
</dependencies>
|
</dependencies>
|
||||||
<repositories>
|
<repositories>
|
||||||
<repository>
|
<repository>
|
||||||
@@ -578,42 +562,124 @@
|
|||||||
</pluginRepository>
|
</pluginRepository>
|
||||||
</pluginRepositories>
|
</pluginRepositories>
|
||||||
<profiles>
|
<profiles>
|
||||||
|
<!-- only enable slow-or-flaky-test if -Dtest= is not present -->
|
||||||
<profile>
|
<profile>
|
||||||
<id>ci</id>
|
<id>slow-or-flaky-test</id>
|
||||||
|
<activation>
|
||||||
|
<property>
|
||||||
|
<name>!test</name>
|
||||||
|
</property>
|
||||||
|
</activation>
|
||||||
|
<build>
|
||||||
|
<plugins>
|
||||||
|
<plugin>
|
||||||
|
<artifactId>maven-surefire-plugin</artifactId>
|
||||||
|
<executions>
|
||||||
|
<execution>
|
||||||
|
<id>slow-or-flaky-test</id>
|
||||||
|
<phase>test</phase>
|
||||||
|
<goals>
|
||||||
|
<goal>test</goal>
|
||||||
|
</goals>
|
||||||
|
<configuration>
|
||||||
|
<rerunFailingTestsCount>2</rerunFailingTestsCount>
|
||||||
|
<!-- There are some tests that take longer or are a little
|
||||||
|
flaky. Run them here. -->
|
||||||
|
<includesFile>src/test/resources/slow-or-flaky-tests.txt</includesFile>
|
||||||
|
<argLine>@{jacoco.surefire.argLine} ${surefire.argLine}</argLine>
|
||||||
|
</configuration>
|
||||||
|
</execution>
|
||||||
|
</executions>
|
||||||
|
</plugin>
|
||||||
|
</plugins>
|
||||||
|
</build>
|
||||||
|
</profile>
|
||||||
|
<profile>
|
||||||
|
<id>jdk11+</id>
|
||||||
|
<activation>
|
||||||
|
<jdk>[11,)</jdk>
|
||||||
|
</activation>
|
||||||
|
<properties>
|
||||||
|
<!-- this is required for GithubHttpUrlConnectionClient#setRequestMethod() to work with JDK 16+ -->
|
||||||
|
<surefire.argLine>--add-opens java.base/java.net=ALL-UNNAMED</surefire.argLine>
|
||||||
|
</properties>
|
||||||
|
</profile>
|
||||||
|
<profile>
|
||||||
|
<id>ci-non-windows</id>
|
||||||
|
<activation>
|
||||||
|
<property>
|
||||||
|
<name>enable-ci</name>
|
||||||
|
</property>
|
||||||
|
<os>
|
||||||
|
<family>!windows</family>
|
||||||
|
</os>
|
||||||
|
</activation>
|
||||||
|
<properties>
|
||||||
|
<!-- Only fail code coverage on non-windows machines -->
|
||||||
|
<jacoco.haltOnFailure>true</jacoco.haltOnFailure>
|
||||||
|
</properties>
|
||||||
|
</profile>
|
||||||
|
<profile>
|
||||||
|
<id>ci-all</id>
|
||||||
<activation>
|
<activation>
|
||||||
<property>
|
<property>
|
||||||
<name>enable-ci</name>
|
<name>enable-ci</name>
|
||||||
</property>
|
</property>
|
||||||
</activation>
|
</activation>
|
||||||
<properties>
|
|
||||||
<formatter-maven-plugin.goal>validate</formatter-maven-plugin.goal>
|
|
||||||
<impsort-maven-plugin.goal>check</impsort-maven-plugin.goal>
|
|
||||||
<jacoco.haltOnFailure>true</jacoco.haltOnFailure>
|
|
||||||
</properties>
|
|
||||||
<build>
|
<build>
|
||||||
<plugins>
|
<plugins>
|
||||||
<plugin>
|
|
||||||
<groupId>org.apache.maven.plugins</groupId>
|
|
||||||
<artifactId>maven-shade-plugin</artifactId>
|
|
||||||
</plugin>
|
|
||||||
<plugin>
|
<plugin>
|
||||||
<groupId>org.jacoco</groupId>
|
<groupId>org.jacoco</groupId>
|
||||||
<artifactId>jacoco-maven-plugin</artifactId>
|
<artifactId>jacoco-maven-plugin</artifactId>
|
||||||
</plugin>
|
</plugin>
|
||||||
|
<plugin>
|
||||||
|
<groupId>com.diffplug.spotless</groupId>
|
||||||
|
<artifactId>spotless-maven-plugin</artifactId>
|
||||||
|
<executions>
|
||||||
|
<execution>
|
||||||
|
<id>spotless-check</id>
|
||||||
|
<!-- In CI, run check early in the build -->
|
||||||
|
<phase>process-sources</phase>
|
||||||
|
<goals>
|
||||||
|
<goal>check</goal>
|
||||||
|
</goals>
|
||||||
|
</execution>
|
||||||
|
</executions>
|
||||||
|
</plugin>
|
||||||
|
<plugin>
|
||||||
|
<groupId>org.apache.maven.plugins</groupId>
|
||||||
|
<artifactId>maven-enforcer-plugin</artifactId>
|
||||||
|
<version>3.0.0-M3</version>
|
||||||
|
<executions>
|
||||||
|
<execution>
|
||||||
|
<id>enforce-jacoco-exist</id>
|
||||||
|
<phase>verify</phase>
|
||||||
|
<goals>
|
||||||
|
<goal>enforce</goal>
|
||||||
|
</goals>
|
||||||
|
<configuration>
|
||||||
|
<rules>
|
||||||
|
<requireFilesExist>
|
||||||
|
<files>
|
||||||
|
<file>${project.build.directory}/jacoco.exec</file>
|
||||||
|
</files>
|
||||||
|
</requireFilesExist>
|
||||||
|
</rules>
|
||||||
|
<fail>true</fail>
|
||||||
|
</configuration>
|
||||||
|
</execution>
|
||||||
|
</executions>
|
||||||
|
</plugin>
|
||||||
</plugins>
|
</plugins>
|
||||||
</build>
|
</build>
|
||||||
</profile>
|
</profile>
|
||||||
<profile>
|
<profile>
|
||||||
<id>release</id>
|
<id>release</id>
|
||||||
<properties>
|
|
||||||
<formatter-maven-plugin.goal>validate</formatter-maven-plugin.goal>
|
|
||||||
<impsort-maven-plugin.goal>check</impsort-maven-plugin.goal>
|
|
||||||
</properties>
|
|
||||||
<build>
|
<build>
|
||||||
<plugins>
|
<plugins>
|
||||||
<plugin>
|
<plugin>
|
||||||
<groupId>org.apache.maven.plugins</groupId>
|
<groupId>org.jacoco</groupId>
|
||||||
<artifactId>maven-shade-plugin</artifactId>
|
<artifactId>jacoco-maven-plugin</artifactId>
|
||||||
</plugin>
|
</plugin>
|
||||||
<plugin>
|
<plugin>
|
||||||
<groupId>org.apache.maven.plugins</groupId>
|
<groupId>org.apache.maven.plugins</groupId>
|
||||||
@@ -664,6 +730,18 @@
|
|||||||
</profiles>
|
</profiles>
|
||||||
<reporting>
|
<reporting>
|
||||||
<plugins>
|
<plugins>
|
||||||
|
<plugin>
|
||||||
|
<groupId>org.jacoco</groupId>
|
||||||
|
<artifactId>jacoco-maven-plugin</artifactId>
|
||||||
|
<reportSets>
|
||||||
|
<reportSet>
|
||||||
|
<reports>
|
||||||
|
<!-- select non-aggregate reports -->
|
||||||
|
<report>report</report>
|
||||||
|
</reports>
|
||||||
|
</reportSet>
|
||||||
|
</reportSets>
|
||||||
|
</plugin>
|
||||||
<plugin>
|
<plugin>
|
||||||
<groupId>org.apache.maven.plugins</groupId>
|
<groupId>org.apache.maven.plugins</groupId>
|
||||||
<artifactId>maven-javadoc-plugin</artifactId>
|
<artifactId>maven-javadoc-plugin</artifactId>
|
||||||
|
|||||||
6
src/build/eclipse/eclipse.importorder
Normal file
6
src/build/eclipse/eclipse.importorder
Normal file
@@ -0,0 +1,6 @@
|
|||||||
|
#Organize Import Order
|
||||||
|
# Import this file in Window -> Preferences -> Java -> Code Style -> Organize Imports -> Import...
|
||||||
|
0=
|
||||||
|
1=java
|
||||||
|
2=javax
|
||||||
|
3=\#
|
||||||
166
src/main/java/org/kohsuke/github/AbstractBuilder.java
Normal file
166
src/main/java/org/kohsuke/github/AbstractBuilder.java
Normal file
@@ -0,0 +1,166 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import java.io.IOException;
|
||||||
|
|
||||||
|
import javax.annotation.CheckForNull;
|
||||||
|
import javax.annotation.Nonnull;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* An abstract data object builder/updater.
|
||||||
|
*
|
||||||
|
* This class can be use to make a Builder that supports both batch and single property changes.
|
||||||
|
* <p>
|
||||||
|
* Batching looks like this:
|
||||||
|
* </p>
|
||||||
|
*
|
||||||
|
* <pre>
|
||||||
|
* update().someName(value).otherName(value).done()
|
||||||
|
* </pre>
|
||||||
|
* <p>
|
||||||
|
* Single changes look like this:
|
||||||
|
* </p>
|
||||||
|
*
|
||||||
|
* <pre>
|
||||||
|
* set().someName(value);
|
||||||
|
* set().otherName(value);
|
||||||
|
* </pre>
|
||||||
|
* <p>
|
||||||
|
* If {@link S} is the same as {@link R}, {@link #with(String, Object)} will commit changes after the first value change
|
||||||
|
* and return a {@link R} from {@link #done()}.
|
||||||
|
* </p>
|
||||||
|
* <p>
|
||||||
|
* If {@link S} is not the same as {@link R}, {@link #with(String, Object)} will batch together multiple changes and let
|
||||||
|
* the user call {@link #done()} when they are ready.
|
||||||
|
*
|
||||||
|
* @param <R>
|
||||||
|
* Final return type built by this builder returned when {@link #done()}} is called.
|
||||||
|
* @param <S>
|
||||||
|
* Intermediate return type for this builder returned by calls to {@link #with(String, Object)}. If {@link S}
|
||||||
|
* the same as {@link R}, this builder will commit changes after each call to {@link #with(String, Object)}.
|
||||||
|
*/
|
||||||
|
abstract class AbstractBuilder<R, S> extends GitHubInteractiveObject {
|
||||||
|
|
||||||
|
@Nonnull
|
||||||
|
private final Class<R> returnType;
|
||||||
|
|
||||||
|
private final boolean commitChangesImmediately;
|
||||||
|
|
||||||
|
@CheckForNull
|
||||||
|
private final R baseInstance;
|
||||||
|
|
||||||
|
@Nonnull
|
||||||
|
protected final Requester requester;
|
||||||
|
|
||||||
|
// TODO: Not sure how update-in-place behavior should be controlled
|
||||||
|
// However, it certainly can be controlled dynamically down to the instance level or inherited for all children of
|
||||||
|
// some
|
||||||
|
// connection.
|
||||||
|
protected boolean updateInPlace;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Creates a builder.
|
||||||
|
*
|
||||||
|
* @param root
|
||||||
|
* the GitHub instance to connect to.
|
||||||
|
* @param intermediateReturnType
|
||||||
|
* the intermediate return type of type {@link S} returned by calls to {@link #with(String, Object)}.
|
||||||
|
* Must either be equal to {@code builtReturnType} or this instance must be castable to this class. If
|
||||||
|
* not, the constructor will throw {@link IllegalArgumentException}.
|
||||||
|
* @param finalReturnType
|
||||||
|
* the final return type for built by this builder returned when {@link #done()}} is called.
|
||||||
|
* @param baseInstance
|
||||||
|
* optional instance on which to base this builder.
|
||||||
|
*/
|
||||||
|
protected AbstractBuilder(@Nonnull Class<R> finalReturnType,
|
||||||
|
@Nonnull Class<S> intermediateReturnType,
|
||||||
|
@Nonnull GitHub root,
|
||||||
|
@CheckForNull R baseInstance) {
|
||||||
|
super(root);
|
||||||
|
this.requester = root.createRequest();
|
||||||
|
this.returnType = finalReturnType;
|
||||||
|
this.commitChangesImmediately = returnType.equals(intermediateReturnType);
|
||||||
|
if (!commitChangesImmediately && !intermediateReturnType.isInstance(this)) {
|
||||||
|
throw new IllegalArgumentException(
|
||||||
|
"Argument \"intermediateReturnType\": This instance must be castable to intermediateReturnType or finalReturnType must be equal to intermediateReturnType.");
|
||||||
|
}
|
||||||
|
|
||||||
|
this.baseInstance = baseInstance;
|
||||||
|
this.updateInPlace = false;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Finishes an update, committing changes.
|
||||||
|
*
|
||||||
|
* This method may update-in-place or not. Either way it returns the resulting instance.
|
||||||
|
*
|
||||||
|
* @return an instance with updated current data
|
||||||
|
* @throws IOException
|
||||||
|
* if there is an I/O Exception
|
||||||
|
*/
|
||||||
|
@Nonnull
|
||||||
|
@BetaApi
|
||||||
|
@Deprecated
|
||||||
|
public R done() throws IOException {
|
||||||
|
R result;
|
||||||
|
if (updateInPlace && baseInstance != null) {
|
||||||
|
result = requester.fetchInto(baseInstance);
|
||||||
|
} else {
|
||||||
|
result = requester.fetch(returnType);
|
||||||
|
}
|
||||||
|
return result;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Applies a value to a name for this builder.
|
||||||
|
*
|
||||||
|
* If {@link S} is the same as {@link R}, this method will commit changes after the first value change and return a
|
||||||
|
* {@link R} from {@link #done()}.
|
||||||
|
*
|
||||||
|
* If {@link S} is not the same as {@link R}, this method will return an {@link S} and letting the caller batch
|
||||||
|
* together multiple changes and call {@link #done()} when they are ready.
|
||||||
|
*
|
||||||
|
* @param name
|
||||||
|
* the name of the field
|
||||||
|
* @param value
|
||||||
|
* the value of the field
|
||||||
|
* @return either a continuing builder or an updated data record
|
||||||
|
* @throws IOException
|
||||||
|
* if an I/O error occurs
|
||||||
|
*/
|
||||||
|
@Nonnull
|
||||||
|
@BetaApi
|
||||||
|
@Deprecated
|
||||||
|
protected S with(@Nonnull String name, Object value) throws IOException {
|
||||||
|
requester.with(name, value);
|
||||||
|
return continueOrDone();
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Chooses whether to return a continuing builder or an updated data record
|
||||||
|
*
|
||||||
|
* If {@link S} is the same as {@link R}, this method will commit changes after the first value change and return a
|
||||||
|
* {@link R} from {@link #done()}.
|
||||||
|
*
|
||||||
|
* If {@link S} is not the same as {@link R}, this method will return an {@link S} and letting the caller batch
|
||||||
|
* together multiple changes and call {@link #done()} when they are ready.
|
||||||
|
*
|
||||||
|
* @return either a continuing builder or an updated data record
|
||||||
|
* @throws IOException
|
||||||
|
* if an I/O error occurs
|
||||||
|
*/
|
||||||
|
@Nonnull
|
||||||
|
@BetaApi
|
||||||
|
@Deprecated
|
||||||
|
protected S continueOrDone() throws IOException {
|
||||||
|
// This little bit of roughness in this base class means all inheriting builders get to create Updater and
|
||||||
|
// Setter classes from almost identical code. Creator can often be implemented with significant code reuse as
|
||||||
|
// well.
|
||||||
|
if (commitChangesImmediately) {
|
||||||
|
// These casts look strange and risky, but they they're actually guaranteed safe due to the return path
|
||||||
|
// being based on the previous comparison of class instances passed to the constructor.
|
||||||
|
return (S) done();
|
||||||
|
} else {
|
||||||
|
return (S) this;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -29,6 +29,10 @@ public abstract class AbuseLimitHandler {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* on failure
|
* on failure
|
||||||
* @see <a href="https://developer.github.com/v3/#abuse-rate-limits">API documentation from GitHub</a>
|
* @see <a href="https://developer.github.com/v3/#abuse-rate-limits">API documentation from GitHub</a>
|
||||||
|
* @see <a href=
|
||||||
|
* "https://developer.github.com/v3/guides/best-practices-for-integrators/#dealing-with-abuse-rate-limits">Dealing
|
||||||
|
* with abuse rate limits</a>
|
||||||
|
*
|
||||||
*/
|
*/
|
||||||
public abstract void onError(IOException e, HttpURLConnection uc) throws IOException;
|
public abstract void onError(IOException e, HttpURLConnection uc) throws IOException;
|
||||||
|
|
||||||
|
|||||||
18
src/main/java/org/kohsuke/github/BetaApi.java
Normal file
18
src/main/java/org/kohsuke/github/BetaApi.java
Normal file
@@ -0,0 +1,18 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import java.lang.annotation.Documented;
|
||||||
|
import java.lang.annotation.Retention;
|
||||||
|
import java.lang.annotation.RetentionPolicy;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Indicates that the method/class/etc marked is a beta implementation of an sdk feature.
|
||||||
|
* <p>
|
||||||
|
* These APIs are subject to change and not a part of the backward compatibility commitment. Always used in conjunction
|
||||||
|
* with 'deprecated' to raise awareness to clients.
|
||||||
|
* </p>
|
||||||
|
*
|
||||||
|
*/
|
||||||
|
@Retention(RetentionPolicy.RUNTIME)
|
||||||
|
@Documented
|
||||||
|
public @interface BetaApi {
|
||||||
|
}
|
||||||
@@ -1,35 +0,0 @@
|
|||||||
/*
|
|
||||||
* The MIT License
|
|
||||||
*
|
|
||||||
* Copyright (c) 2010, Kohsuke Kawaguchi
|
|
||||||
*
|
|
||||||
* Permission is hereby granted, free of charge, to any person obtaining a copy
|
|
||||||
* of this software and associated documentation files (the "Software"), to deal
|
|
||||||
* in the Software without restriction, including without limitation the rights
|
|
||||||
* to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
|
|
||||||
* copies of the Software, and to permit persons to whom the Software is
|
|
||||||
* furnished to do so, subject to the following conditions:
|
|
||||||
*
|
|
||||||
* The above copyright notice and this permission notice shall be included in
|
|
||||||
* all copies or substantial portions of the Software.
|
|
||||||
*
|
|
||||||
* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
|
|
||||||
* IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
|
|
||||||
* FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
|
|
||||||
* AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
|
|
||||||
* LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
|
|
||||||
* OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
|
|
||||||
* THE SOFTWARE.
|
|
||||||
*/
|
|
||||||
package org.kohsuke.github;
|
|
||||||
|
|
||||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
|
||||||
|
|
||||||
/**
|
|
||||||
* @author Kohsuke Kawaguchi
|
|
||||||
*/
|
|
||||||
@SuppressFBWarnings(value = "UUF_UNUSED_PUBLIC_OR_PROTECTED_FIELD",
|
|
||||||
justification = "Being constructed by JSON deserialization")
|
|
||||||
class DeleteToken {
|
|
||||||
public String delete_token;
|
|
||||||
}
|
|
||||||
@@ -5,7 +5,7 @@ import java.net.URL;
|
|||||||
import java.util.List;
|
import java.util.List;
|
||||||
import java.util.Map;
|
import java.util.Map;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.MACHINE_MAN;
|
import static org.kohsuke.github.internal.Previews.MACHINE_MAN;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* A Github App.
|
* A Github App.
|
||||||
@@ -15,7 +15,6 @@ import static org.kohsuke.github.Previews.MACHINE_MAN;
|
|||||||
*/
|
*/
|
||||||
public class GHApp extends GHObject {
|
public class GHApp extends GHObject {
|
||||||
|
|
||||||
private GitHub root;
|
|
||||||
private GHUser owner;
|
private GHUser owner;
|
||||||
private String name;
|
private String name;
|
||||||
private String description;
|
private String description;
|
||||||
@@ -39,7 +38,9 @@ public class GHApp extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param owner
|
* @param owner
|
||||||
* the owner
|
* the owner
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setOwner(GHUser owner) {
|
public void setOwner(GHUser owner) {
|
||||||
this.owner = owner;
|
this.owner = owner;
|
||||||
}
|
}
|
||||||
@@ -58,7 +59,9 @@ public class GHApp extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param name
|
* @param name
|
||||||
* the name
|
* the name
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setName(String name) {
|
public void setName(String name) {
|
||||||
this.name = name;
|
this.name = name;
|
||||||
}
|
}
|
||||||
@@ -77,7 +80,9 @@ public class GHApp extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param description
|
* @param description
|
||||||
* the description
|
* the description
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setDescription(String description) {
|
public void setDescription(String description) {
|
||||||
this.description = description;
|
this.description = description;
|
||||||
}
|
}
|
||||||
@@ -96,7 +101,9 @@ public class GHApp extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param externalUrl
|
* @param externalUrl
|
||||||
* the external url
|
* the external url
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setExternalUrl(String externalUrl) {
|
public void setExternalUrl(String externalUrl) {
|
||||||
this.externalUrl = externalUrl;
|
this.externalUrl = externalUrl;
|
||||||
}
|
}
|
||||||
@@ -115,7 +122,9 @@ public class GHApp extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param events
|
* @param events
|
||||||
* the events
|
* the events
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setEvents(List<GHEvent> events) {
|
public void setEvents(List<GHEvent> events) {
|
||||||
this.events = events;
|
this.events = events;
|
||||||
}
|
}
|
||||||
@@ -134,13 +143,15 @@ public class GHApp extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param installationsCount
|
* @param installationsCount
|
||||||
* the installations count
|
* the installations count
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setInstallationsCount(long installationsCount) {
|
public void setInstallationsCount(long installationsCount) {
|
||||||
this.installationsCount = installationsCount;
|
this.installationsCount = installationsCount;
|
||||||
}
|
}
|
||||||
|
|
||||||
public URL getHtmlUrl() {
|
public URL getHtmlUrl() {
|
||||||
return GitHub.parseURL(htmlUrl);
|
return GitHubClient.parseURL(htmlUrl);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -157,7 +168,9 @@ public class GHApp extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param permissions
|
* @param permissions
|
||||||
* the permissions
|
* the permissions
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setPermissions(Map<String, String> permissions) {
|
public void setPermissions(Map<String, String> permissions) {
|
||||||
this.permissions = permissions;
|
this.permissions = permissions;
|
||||||
}
|
}
|
||||||
@@ -175,7 +188,7 @@ public class GHApp extends GHObject {
|
|||||||
* @return a list of App installations
|
* @return a list of App installations
|
||||||
* @see <a href="https://developer.github.com/v3/apps/#list-installations">List installations</a>
|
* @see <a href="https://developer.github.com/v3/apps/#list-installations">List installations</a>
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(MACHINE_MAN)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public PagedIterable<GHAppInstallation> listInstallations() {
|
public PagedIterable<GHAppInstallation> listInstallations() {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
@@ -196,7 +209,7 @@ public class GHApp extends GHObject {
|
|||||||
* on error
|
* on error
|
||||||
* @see <a href="https://developer.github.com/v3/apps/#get-an-installation">Get an installation</a>
|
* @see <a href="https://developer.github.com/v3/apps/#get-an-installation">Get an installation</a>
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(MACHINE_MAN)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppInstallation getInstallationById(long id) throws IOException {
|
public GHAppInstallation getInstallationById(long id) throws IOException {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
@@ -219,7 +232,7 @@ public class GHApp extends GHObject {
|
|||||||
* @see <a href="https://developer.github.com/v3/apps/#get-an-organization-installation">Get an organization
|
* @see <a href="https://developer.github.com/v3/apps/#get-an-organization-installation">Get an organization
|
||||||
* installation</a>
|
* installation</a>
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(MACHINE_MAN)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppInstallation getInstallationByOrganization(String name) throws IOException {
|
public GHAppInstallation getInstallationByOrganization(String name) throws IOException {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
@@ -244,7 +257,7 @@ public class GHApp extends GHObject {
|
|||||||
* @see <a href="https://developer.github.com/v3/apps/#get-a-repository-installation">Get a repository
|
* @see <a href="https://developer.github.com/v3/apps/#get-a-repository-installation">Get a repository
|
||||||
* installation</a>
|
* installation</a>
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(MACHINE_MAN)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppInstallation getInstallationByRepository(String ownerName, String repositoryName) throws IOException {
|
public GHAppInstallation getInstallationByRepository(String ownerName, String repositoryName) throws IOException {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
@@ -266,7 +279,7 @@ public class GHApp extends GHObject {
|
|||||||
* on error
|
* on error
|
||||||
* @see <a href="https://developer.github.com/v3/apps/#get-a-user-installation">Get a user installation</a>
|
* @see <a href="https://developer.github.com/v3/apps/#get-a-user-installation">Get a user installation</a>
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(MACHINE_MAN)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppInstallation getInstallationByUser(String name) throws IOException {
|
public GHAppInstallation getInstallationByUser(String name) throws IOException {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
|
|||||||
@@ -5,7 +5,7 @@ import java.util.HashMap;
|
|||||||
import java.util.List;
|
import java.util.List;
|
||||||
import java.util.Map;
|
import java.util.Map;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.MACHINE_MAN;
|
import static org.kohsuke.github.internal.Previews.MACHINE_MAN;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a access token for a GitHub App Installation
|
* Creates a access token for a GitHub App Installation
|
||||||
@@ -14,12 +14,11 @@ import static org.kohsuke.github.Previews.MACHINE_MAN;
|
|||||||
* @see GHAppInstallation#createToken(Map) GHAppInstallation#createToken(Map)
|
* @see GHAppInstallation#createToken(Map) GHAppInstallation#createToken(Map)
|
||||||
* @see GHAppInstallation#createToken() GHAppInstallation#createToken()
|
* @see GHAppInstallation#createToken() GHAppInstallation#createToken()
|
||||||
*/
|
*/
|
||||||
public class GHAppCreateTokenBuilder {
|
public class GHAppCreateTokenBuilder extends GitHubInteractiveObject {
|
||||||
private final GitHub root;
|
|
||||||
protected final Requester builder;
|
protected final Requester builder;
|
||||||
private final String apiUrlTail;
|
private final String apiUrlTail;
|
||||||
|
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
GHAppCreateTokenBuilder(GitHub root, String apiUrlTail) {
|
GHAppCreateTokenBuilder(GitHub root, String apiUrlTail) {
|
||||||
this.root = root;
|
this.root = root;
|
||||||
@@ -27,7 +26,7 @@ public class GHAppCreateTokenBuilder {
|
|||||||
this.builder = root.createRequest();
|
this.builder = root.createRequest();
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
GHAppCreateTokenBuilder(GitHub root, String apiUrlTail, Map<String, GHPermissionType> permissions) {
|
GHAppCreateTokenBuilder(GitHub root, String apiUrlTail, Map<String, GHPermissionType> permissions) {
|
||||||
this(root, apiUrlTail);
|
this(root, apiUrlTail);
|
||||||
@@ -43,7 +42,7 @@ public class GHAppCreateTokenBuilder {
|
|||||||
* Array containing the repositories Ids
|
* Array containing the repositories Ids
|
||||||
* @return a GHAppCreateTokenBuilder
|
* @return a GHAppCreateTokenBuilder
|
||||||
*/
|
*/
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppCreateTokenBuilder repositoryIds(List<Long> repositoryIds) {
|
public GHAppCreateTokenBuilder repositoryIds(List<Long> repositoryIds) {
|
||||||
this.builder.with("repository_ids", repositoryIds);
|
this.builder.with("repository_ids", repositoryIds);
|
||||||
@@ -58,12 +57,12 @@ public class GHAppCreateTokenBuilder {
|
|||||||
* Map containing the permission names and types.
|
* Map containing the permission names and types.
|
||||||
* @return a GHAppCreateTokenBuilder
|
* @return a GHAppCreateTokenBuilder
|
||||||
*/
|
*/
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppCreateTokenBuilder permissions(Map<String, GHPermissionType> permissions) {
|
public GHAppCreateTokenBuilder permissions(Map<String, GHPermissionType> permissions) {
|
||||||
Map<String, String> retMap = new HashMap<>();
|
Map<String, String> retMap = new HashMap<>();
|
||||||
for (Map.Entry<String, GHPermissionType> entry : permissions.entrySet()) {
|
for (Map.Entry<String, GHPermissionType> entry : permissions.entrySet()) {
|
||||||
retMap.put(entry.getKey(), Requester.transformEnum(entry.getValue()));
|
retMap.put(entry.getKey(), GitHubRequest.transformEnum(entry.getValue()));
|
||||||
}
|
}
|
||||||
builder.with("permissions", retMap);
|
builder.with("permissions", retMap);
|
||||||
return this;
|
return this;
|
||||||
@@ -78,7 +77,7 @@ public class GHAppCreateTokenBuilder {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* on error
|
* on error
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(MACHINE_MAN)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppInstallationToken create() throws IOException {
|
public GHAppInstallationToken create() throws IOException {
|
||||||
return builder.method("POST")
|
return builder.method("POST")
|
||||||
|
|||||||
@@ -3,11 +3,13 @@ package org.kohsuke.github;
|
|||||||
import com.fasterxml.jackson.annotation.JsonProperty;
|
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
|
import java.net.MalformedURLException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
import java.util.Map;
|
import java.util.Map;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.GAMBIT;
|
import static org.kohsuke.github.internal.Previews.GAMBIT;
|
||||||
|
import static org.kohsuke.github.internal.Previews.MACHINE_MAN;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* A Github App Installation.
|
* A Github App Installation.
|
||||||
@@ -20,7 +22,6 @@ import static org.kohsuke.github.Previews.GAMBIT;
|
|||||||
* @see GHApp#getInstallationByUser(String) GHApp#getInstallationByUser(String)
|
* @see GHApp#getInstallationByUser(String) GHApp#getInstallationByUser(String)
|
||||||
*/
|
*/
|
||||||
public class GHAppInstallation extends GHObject {
|
public class GHAppInstallation extends GHObject {
|
||||||
private GitHub root;
|
|
||||||
private GHUser account;
|
private GHUser account;
|
||||||
|
|
||||||
@JsonProperty("access_tokens_url")
|
@JsonProperty("access_tokens_url")
|
||||||
@@ -42,7 +43,7 @@ public class GHAppInstallation extends GHObject {
|
|||||||
private String htmlUrl;
|
private String htmlUrl;
|
||||||
|
|
||||||
public URL getHtmlUrl() {
|
public URL getHtmlUrl() {
|
||||||
return GitHub.parseURL(htmlUrl);
|
return GitHubClient.parseURL(htmlUrl);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -59,7 +60,9 @@ public class GHAppInstallation extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param root
|
* @param root
|
||||||
* the root
|
* the root
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setRoot(GitHub root) {
|
public void setRoot(GitHub root) {
|
||||||
this.root = root;
|
this.root = root;
|
||||||
}
|
}
|
||||||
@@ -78,7 +81,9 @@ public class GHAppInstallation extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param account
|
* @param account
|
||||||
* the account
|
* the account
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setAccount(GHUser account) {
|
public void setAccount(GHUser account) {
|
||||||
this.account = account;
|
this.account = account;
|
||||||
}
|
}
|
||||||
@@ -97,7 +102,9 @@ public class GHAppInstallation extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param accessTokenUrl
|
* @param accessTokenUrl
|
||||||
* the access token url
|
* the access token url
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setAccessTokenUrl(String accessTokenUrl) {
|
public void setAccessTokenUrl(String accessTokenUrl) {
|
||||||
this.accessTokenUrl = accessTokenUrl;
|
this.accessTokenUrl = accessTokenUrl;
|
||||||
}
|
}
|
||||||
@@ -111,12 +118,44 @@ public class GHAppInstallation extends GHObject {
|
|||||||
return repositoriesUrl;
|
return repositoriesUrl;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* List repositories that this app installation can access.
|
||||||
|
*
|
||||||
|
* @return the paged iterable
|
||||||
|
*/
|
||||||
|
@Preview(MACHINE_MAN)
|
||||||
|
@Deprecated
|
||||||
|
public PagedSearchIterable<GHRepository> listRepositories() {
|
||||||
|
GitHubRequest request;
|
||||||
|
|
||||||
|
try {
|
||||||
|
request = root.createRequest().withPreview(MACHINE_MAN).withUrlPath("/installation/repositories").build();
|
||||||
|
} catch (MalformedURLException e) {
|
||||||
|
throw new GHException("", e);
|
||||||
|
}
|
||||||
|
|
||||||
|
return new PagedSearchIterable<>(root, request, GHAppInstallationRepositoryResult.class);
|
||||||
|
}
|
||||||
|
|
||||||
|
private static class GHAppInstallationRepositoryResult extends SearchResult<GHRepository> {
|
||||||
|
private GHRepository[] repositories;
|
||||||
|
|
||||||
|
@Override
|
||||||
|
GHRepository[] getItems(GitHub root) {
|
||||||
|
for (GHRepository item : repositories)
|
||||||
|
item.wrap(root);
|
||||||
|
return repositories;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Sets repositories url.
|
* Sets repositories url.
|
||||||
*
|
*
|
||||||
* @param repositoriesUrl
|
* @param repositoriesUrl
|
||||||
* the repositories url
|
* the repositories url
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setRepositoriesUrl(String repositoriesUrl) {
|
public void setRepositoriesUrl(String repositoriesUrl) {
|
||||||
this.repositoriesUrl = repositoriesUrl;
|
this.repositoriesUrl = repositoriesUrl;
|
||||||
}
|
}
|
||||||
@@ -135,7 +174,9 @@ public class GHAppInstallation extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param appId
|
* @param appId
|
||||||
* the app id
|
* the app id
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setAppId(long appId) {
|
public void setAppId(long appId) {
|
||||||
this.appId = appId;
|
this.appId = appId;
|
||||||
}
|
}
|
||||||
@@ -154,7 +195,9 @@ public class GHAppInstallation extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param targetId
|
* @param targetId
|
||||||
* the target id
|
* the target id
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setTargetId(long targetId) {
|
public void setTargetId(long targetId) {
|
||||||
this.targetId = targetId;
|
this.targetId = targetId;
|
||||||
}
|
}
|
||||||
@@ -173,7 +216,9 @@ public class GHAppInstallation extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param targetType
|
* @param targetType
|
||||||
* the target type
|
* the target type
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setTargetType(GHTargetType targetType) {
|
public void setTargetType(GHTargetType targetType) {
|
||||||
this.targetType = targetType;
|
this.targetType = targetType;
|
||||||
}
|
}
|
||||||
@@ -192,7 +237,9 @@ public class GHAppInstallation extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param permissions
|
* @param permissions
|
||||||
* the permissions
|
* the permissions
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setPermissions(Map<String, GHPermissionType> permissions) {
|
public void setPermissions(Map<String, GHPermissionType> permissions) {
|
||||||
this.permissions = permissions;
|
this.permissions = permissions;
|
||||||
}
|
}
|
||||||
@@ -211,7 +258,9 @@ public class GHAppInstallation extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param events
|
* @param events
|
||||||
* the events
|
* the events
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setEvents(List<GHEvent> events) {
|
public void setEvents(List<GHEvent> events) {
|
||||||
this.events = events;
|
this.events = events;
|
||||||
}
|
}
|
||||||
@@ -230,7 +279,9 @@ public class GHAppInstallation extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param singleFileName
|
* @param singleFileName
|
||||||
* the single file name
|
* the single file name
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setSingleFileName(String singleFileName) {
|
public void setSingleFileName(String singleFileName) {
|
||||||
this.singleFileName = singleFileName;
|
this.singleFileName = singleFileName;
|
||||||
}
|
}
|
||||||
@@ -249,7 +300,9 @@ public class GHAppInstallation extends GHObject {
|
|||||||
*
|
*
|
||||||
* @param repositorySelection
|
* @param repositorySelection
|
||||||
* the repository selection
|
* the repository selection
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setRepositorySelection(GHRepositorySelection repositorySelection) {
|
public void setRepositorySelection(GHRepositorySelection repositorySelection) {
|
||||||
this.repositorySelection = repositorySelection;
|
this.repositorySelection = repositorySelection;
|
||||||
}
|
}
|
||||||
@@ -268,13 +321,13 @@ public class GHAppInstallation extends GHObject {
|
|||||||
* on error
|
* on error
|
||||||
* @see <a href="https://developer.github.com/v3/apps/#delete-an-installation">Delete an installation</a>
|
* @see <a href="https://developer.github.com/v3/apps/#delete-an-installation">Delete an installation</a>
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(GAMBIT)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public void deleteInstallation() throws IOException {
|
public void deleteInstallation() throws IOException {
|
||||||
root.createRequest()
|
root.createRequest()
|
||||||
.method("DELETE")
|
.method("DELETE")
|
||||||
.withPreview(GAMBIT)
|
.withPreview(GAMBIT)
|
||||||
.withUrlPath(String.format("/app/installations/%d", id))
|
.withUrlPath(String.format("/app/installations/%d", getId()))
|
||||||
.send();
|
.send();
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -290,10 +343,12 @@ public class GHAppInstallation extends GHObject {
|
|||||||
* @return a GHAppCreateTokenBuilder instance
|
* @return a GHAppCreateTokenBuilder instance
|
||||||
* @deprecated Use {@link GHAppInstallation#createToken()} instead.
|
* @deprecated Use {@link GHAppInstallation#createToken()} instead.
|
||||||
*/
|
*/
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppCreateTokenBuilder createToken(Map<String, GHPermissionType> permissions) {
|
public GHAppCreateTokenBuilder createToken(Map<String, GHPermissionType> permissions) {
|
||||||
return new GHAppCreateTokenBuilder(root, String.format("/app/installations/%d/access_tokens", id), permissions);
|
return new GHAppCreateTokenBuilder(root,
|
||||||
|
String.format("/app/installations/%d/access_tokens", getId()),
|
||||||
|
permissions);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -305,9 +360,9 @@ public class GHAppInstallation extends GHObject {
|
|||||||
*
|
*
|
||||||
* @return a GHAppCreateTokenBuilder instance
|
* @return a GHAppCreateTokenBuilder instance
|
||||||
*/
|
*/
|
||||||
@Preview
|
@BetaApi
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHAppCreateTokenBuilder createToken() {
|
public GHAppCreateTokenBuilder createToken() {
|
||||||
return new GHAppCreateTokenBuilder(root, String.format("/app/installations/%d/access_tokens", id));
|
return new GHAppCreateTokenBuilder(root, String.format("/app/installations/%d/access_tokens", getId()));
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -14,9 +14,7 @@ import java.util.Map;
|
|||||||
* @author Paulo Miguel Almeida
|
* @author Paulo Miguel Almeida
|
||||||
* @see GHAppInstallation#createToken(Map) GHAppInstallation#createToken(Map)
|
* @see GHAppInstallation#createToken(Map) GHAppInstallation#createToken(Map)
|
||||||
*/
|
*/
|
||||||
public class GHAppInstallationToken {
|
public class GHAppInstallationToken extends GitHubInteractiveObject {
|
||||||
private GitHub root;
|
|
||||||
|
|
||||||
private String token;
|
private String token;
|
||||||
protected String expires_at;
|
protected String expires_at;
|
||||||
private Map<String, String> permissions;
|
private Map<String, String> permissions;
|
||||||
@@ -37,7 +35,9 @@ public class GHAppInstallationToken {
|
|||||||
*
|
*
|
||||||
* @param root
|
* @param root
|
||||||
* the root
|
* the root
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setRoot(GitHub root) {
|
public void setRoot(GitHub root) {
|
||||||
this.root = root;
|
this.root = root;
|
||||||
}
|
}
|
||||||
@@ -56,7 +56,9 @@ public class GHAppInstallationToken {
|
|||||||
*
|
*
|
||||||
* @param permissions
|
* @param permissions
|
||||||
* the permissions
|
* the permissions
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setPermissions(Map<String, String> permissions) {
|
public void setPermissions(Map<String, String> permissions) {
|
||||||
this.permissions = permissions;
|
this.permissions = permissions;
|
||||||
}
|
}
|
||||||
@@ -75,7 +77,9 @@ public class GHAppInstallationToken {
|
|||||||
*
|
*
|
||||||
* @param token
|
* @param token
|
||||||
* the token
|
* the token
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setToken(String token) {
|
public void setToken(String token) {
|
||||||
this.token = token;
|
this.token = token;
|
||||||
}
|
}
|
||||||
@@ -94,7 +98,9 @@ public class GHAppInstallationToken {
|
|||||||
*
|
*
|
||||||
* @param repositories
|
* @param repositories
|
||||||
* the repositories
|
* the repositories
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setRepositories(List<GHRepository> repositories) {
|
public void setRepositories(List<GHRepository> repositories) {
|
||||||
this.repositories = repositories;
|
this.repositories = repositories;
|
||||||
}
|
}
|
||||||
@@ -113,7 +119,9 @@ public class GHAppInstallationToken {
|
|||||||
*
|
*
|
||||||
* @param repositorySelection
|
* @param repositorySelection
|
||||||
* the repository selection
|
* the repository selection
|
||||||
|
* @deprecated Do not use this method. It was added due to incomplete understanding of Jackson binding.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setRepositorySelection(GHRepositorySelection repositorySelection) {
|
public void setRepositorySelection(GHRepositorySelection repositorySelection) {
|
||||||
this.repositorySelection = repositorySelection;
|
this.repositorySelection = repositorySelection;
|
||||||
}
|
}
|
||||||
@@ -127,7 +135,7 @@ public class GHAppInstallationToken {
|
|||||||
*/
|
*/
|
||||||
@WithBridgeMethods(value = String.class, adapterMethod = "expiresAtStr")
|
@WithBridgeMethods(value = String.class, adapterMethod = "expiresAtStr")
|
||||||
public Date getExpiresAt() throws IOException {
|
public Date getExpiresAt() throws IOException {
|
||||||
return GitHub.parseDate(expires_at);
|
return GitHubClient.parseDate(expires_at);
|
||||||
}
|
}
|
||||||
|
|
||||||
@SuppressFBWarnings(value = "UPM_UNCALLED_PRIVATE_METHOD", justification = "Bridge method of getExpiresAt")
|
@SuppressFBWarnings(value = "UPM_UNCALLED_PRIVATE_METHOD", justification = "Bridge method of getExpiresAt")
|
||||||
|
|||||||
140
src/main/java/org/kohsuke/github/GHArtifact.java
Normal file
140
src/main/java/org/kohsuke/github/GHArtifact.java
Normal file
@@ -0,0 +1,140 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import com.fasterxml.jackson.annotation.JsonIgnore;
|
||||||
|
import org.apache.commons.lang3.StringUtils;
|
||||||
|
import org.kohsuke.github.function.InputStreamFunction;
|
||||||
|
|
||||||
|
import java.io.IOException;
|
||||||
|
import java.net.URL;
|
||||||
|
import java.util.Date;
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
|
import static java.util.Objects.requireNonNull;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* An artifact from a workflow run.
|
||||||
|
*
|
||||||
|
* @author Guillaume Smet
|
||||||
|
*/
|
||||||
|
public class GHArtifact extends GHObject {
|
||||||
|
|
||||||
|
// Not provided by the API.
|
||||||
|
@JsonIgnore
|
||||||
|
private GHRepository owner;
|
||||||
|
|
||||||
|
private String name;
|
||||||
|
private long sizeInBytes;
|
||||||
|
private String archiveDownloadUrl;
|
||||||
|
private boolean expired;
|
||||||
|
private String expiresAt;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the name.
|
||||||
|
*
|
||||||
|
* @return the name
|
||||||
|
*/
|
||||||
|
public String getName() {
|
||||||
|
return name;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the size of the artifact in bytes.
|
||||||
|
*
|
||||||
|
* @return the size
|
||||||
|
*/
|
||||||
|
public long getSizeInBytes() {
|
||||||
|
return sizeInBytes;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the archive download URL.
|
||||||
|
*
|
||||||
|
* @return the archive download URL
|
||||||
|
*/
|
||||||
|
public URL getArchiveDownloadUrl() {
|
||||||
|
return GitHubClient.parseURL(archiveDownloadUrl);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* If this artifact has expired.
|
||||||
|
*
|
||||||
|
* @return if the artifact has expired
|
||||||
|
*/
|
||||||
|
public boolean isExpired() {
|
||||||
|
return expired;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the date at which this artifact will expire.
|
||||||
|
*
|
||||||
|
* @return the date of expiration
|
||||||
|
*/
|
||||||
|
public Date getExpiresAt() {
|
||||||
|
return GitHubClient.parseDate(expiresAt);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Repository to which the artifact belongs.
|
||||||
|
*
|
||||||
|
* @return the repository
|
||||||
|
*/
|
||||||
|
public GHRepository getRepository() {
|
||||||
|
return owner;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* @deprecated This object has no HTML URL.
|
||||||
|
*/
|
||||||
|
@Override
|
||||||
|
public URL getHtmlUrl() throws IOException {
|
||||||
|
return null;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Deletes the artifact.
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public void delete() throws IOException {
|
||||||
|
root.createRequest().method("DELETE").withUrlPath(getApiRoute()).fetchHttpStatusCode();
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Downloads the artifact.
|
||||||
|
*
|
||||||
|
* @param <T>
|
||||||
|
* the type of result
|
||||||
|
* @param streamFunction
|
||||||
|
* The {@link InputStreamFunction} that will process the stream
|
||||||
|
* @throws IOException
|
||||||
|
* The IO exception.
|
||||||
|
* @return the result of reading the stream.
|
||||||
|
*/
|
||||||
|
public <T> T download(InputStreamFunction<T> streamFunction) throws IOException {
|
||||||
|
requireNonNull(streamFunction, "Stream function must not be null");
|
||||||
|
|
||||||
|
return root.createRequest().method("GET").withUrlPath(getApiRoute(), "zip").fetchStream(streamFunction);
|
||||||
|
}
|
||||||
|
|
||||||
|
private String getApiRoute() {
|
||||||
|
if (owner == null) {
|
||||||
|
// Workflow runs returned from search to do not have an owner. Attempt to use url.
|
||||||
|
final URL url = Objects.requireNonNull(getUrl(), "Missing instance URL!");
|
||||||
|
return StringUtils.prependIfMissing(url.toString().replace(root.getApiUrl(), ""), "/");
|
||||||
|
}
|
||||||
|
return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/actions/artifacts/" + getId();
|
||||||
|
}
|
||||||
|
|
||||||
|
GHArtifact wrapUp(GHRepository owner) {
|
||||||
|
this.owner = owner;
|
||||||
|
return wrapUp(owner.root);
|
||||||
|
}
|
||||||
|
|
||||||
|
GHArtifact wrapUp(GitHub root) {
|
||||||
|
this.root = root;
|
||||||
|
if (owner != null)
|
||||||
|
owner.wrap(root);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
}
|
||||||
49
src/main/java/org/kohsuke/github/GHArtifactsIterable.java
Normal file
49
src/main/java/org/kohsuke/github/GHArtifactsIterable.java
Normal file
@@ -0,0 +1,49 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import java.net.MalformedURLException;
|
||||||
|
import java.util.Iterator;
|
||||||
|
|
||||||
|
import javax.annotation.Nonnull;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Iterable for artifacts listing.
|
||||||
|
*/
|
||||||
|
class GHArtifactsIterable extends PagedIterable<GHArtifact> {
|
||||||
|
private final transient GHRepository owner;
|
||||||
|
private final GitHubRequest request;
|
||||||
|
|
||||||
|
private GHArtifactsPage result;
|
||||||
|
|
||||||
|
public GHArtifactsIterable(GHRepository owner, GitHubRequest.Builder<?> requestBuilder) {
|
||||||
|
this.owner = owner;
|
||||||
|
try {
|
||||||
|
this.request = requestBuilder.build();
|
||||||
|
} catch (MalformedURLException e) {
|
||||||
|
throw new GHException("Malformed URL", e);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
@Nonnull
|
||||||
|
@Override
|
||||||
|
public PagedIterator<GHArtifact> _iterator(int pageSize) {
|
||||||
|
return new PagedIterator<>(
|
||||||
|
adapt(GitHubPageIterator.create(owner.getRoot().getClient(), GHArtifactsPage.class, request, pageSize)),
|
||||||
|
null);
|
||||||
|
}
|
||||||
|
|
||||||
|
protected Iterator<GHArtifact[]> adapt(final Iterator<GHArtifactsPage> base) {
|
||||||
|
return new Iterator<GHArtifact[]>() {
|
||||||
|
public boolean hasNext() {
|
||||||
|
return base.hasNext();
|
||||||
|
}
|
||||||
|
|
||||||
|
public GHArtifact[] next() {
|
||||||
|
GHArtifactsPage v = base.next();
|
||||||
|
if (result == null) {
|
||||||
|
result = v;
|
||||||
|
}
|
||||||
|
return v.getArtifacts(owner);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
}
|
||||||
|
}
|
||||||
20
src/main/java/org/kohsuke/github/GHArtifactsPage.java
Normal file
20
src/main/java/org/kohsuke/github/GHArtifactsPage.java
Normal file
@@ -0,0 +1,20 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Represents the one page of artifacts result when listing artifacts.
|
||||||
|
*/
|
||||||
|
class GHArtifactsPage {
|
||||||
|
private int total_count;
|
||||||
|
private GHArtifact[] artifacts;
|
||||||
|
|
||||||
|
public int getTotalCount() {
|
||||||
|
return total_count;
|
||||||
|
}
|
||||||
|
|
||||||
|
GHArtifact[] getArtifacts(GHRepository owner) {
|
||||||
|
for (GHArtifact artifact : artifacts) {
|
||||||
|
artifact.wrapUp(owner);
|
||||||
|
}
|
||||||
|
return artifacts;
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -9,7 +9,6 @@ import java.net.URL;
|
|||||||
* @see GHRelease#getAssets() GHRelease#getAssets()
|
* @see GHRelease#getAssets() GHRelease#getAssets()
|
||||||
*/
|
*/
|
||||||
public class GHAsset extends GHObject {
|
public class GHAsset extends GHObject {
|
||||||
GitHub root;
|
|
||||||
GHRepository owner;
|
GHRepository owner;
|
||||||
private String name;
|
private String name;
|
||||||
private String label;
|
private String label;
|
||||||
@@ -149,7 +148,7 @@ public class GHAsset extends GHObject {
|
|||||||
}
|
}
|
||||||
|
|
||||||
private String getApiRoute() {
|
private String getApiRoute() {
|
||||||
return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/releases/assets/" + id;
|
return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/releases/assets/" + getId();
|
||||||
}
|
}
|
||||||
|
|
||||||
GHAsset wrap(GHRelease release) {
|
GHAsset wrap(GHRelease release) {
|
||||||
|
|||||||
@@ -33,7 +33,6 @@ public class GHAuthorization extends GHObject {
|
|||||||
public static final String WRITE_KEY = "write:public_key";
|
public static final String WRITE_KEY = "write:public_key";
|
||||||
public static final String ADMIN_KEY = "admin:public_key";
|
public static final String ADMIN_KEY = "admin:public_key";
|
||||||
|
|
||||||
private GitHub root;
|
|
||||||
private List<String> scopes;
|
private List<String> scopes;
|
||||||
private String token;
|
private String token;
|
||||||
private String token_last_eight;
|
private String token_last_eight;
|
||||||
@@ -96,7 +95,7 @@ public class GHAuthorization extends GHObject {
|
|||||||
* @return the app url
|
* @return the app url
|
||||||
*/
|
*/
|
||||||
public URL getAppUrl() {
|
public URL getAppUrl() {
|
||||||
return GitHub.parseURL(app.url);
|
return GitHubClient.parseURL(app.url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -112,10 +111,12 @@ public class GHAuthorization extends GHObject {
|
|||||||
* Gets api url.
|
* Gets api url.
|
||||||
*
|
*
|
||||||
* @return the api url
|
* @return the api url
|
||||||
|
* @deprecated use {@link #getUrl()}
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
@SuppressFBWarnings(value = "NM_CONFUSING", justification = "It's a part of the library API, cannot be changed")
|
@SuppressFBWarnings(value = "NM_CONFUSING", justification = "It's a part of the library API, cannot be changed")
|
||||||
public URL getApiURL() {
|
public URL getApiURL() {
|
||||||
return GitHub.parseURL(url);
|
return getUrl();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -141,7 +142,7 @@ public class GHAuthorization extends GHObject {
|
|||||||
* @return the note url
|
* @return the note url
|
||||||
*/
|
*/
|
||||||
public URL getNoteUrl() {
|
public URL getNoteUrl() {
|
||||||
return GitHub.parseURL(note_url);
|
return GitHubClient.parseURL(note_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|||||||
@@ -24,7 +24,7 @@ public class GHBlob {
|
|||||||
* @return API URL of this blob.
|
* @return API URL of this blob.
|
||||||
*/
|
*/
|
||||||
public URL getUrl() {
|
public URL getUrl() {
|
||||||
return GitHub.parseURL(url);
|
return GitHubClient.parseURL(url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|||||||
@@ -3,12 +3,15 @@ package org.kohsuke.github;
|
|||||||
import com.fasterxml.jackson.annotation.JsonCreator;
|
import com.fasterxml.jackson.annotation.JsonCreator;
|
||||||
import com.fasterxml.jackson.annotation.JsonProperty;
|
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
import java.util.Collection;
|
import java.util.Collection;
|
||||||
import java.util.Objects;
|
import java.util.Objects;
|
||||||
|
|
||||||
|
import javax.annotation.CheckForNull;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* A branch in a repository.
|
* A branch in a repository.
|
||||||
*
|
*
|
||||||
@@ -18,8 +21,7 @@ import java.util.Objects;
|
|||||||
value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD",
|
value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD",
|
||||||
"URF_UNREAD_FIELD" },
|
"URF_UNREAD_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public class GHBranch {
|
public class GHBranch extends GitHubInteractiveObject {
|
||||||
private GitHub root;
|
|
||||||
private GHRepository owner;
|
private GHRepository owner;
|
||||||
|
|
||||||
private String name;
|
private String name;
|
||||||
@@ -76,7 +78,7 @@ public class GHBranch {
|
|||||||
*
|
*
|
||||||
* @return true if the push to this branch is restricted via branch protection.
|
* @return true if the push to this branch is restricted via branch protection.
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(Previews.LUKE_CAGE)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public boolean isProtected() {
|
public boolean isProtected() {
|
||||||
return protection;
|
return protection;
|
||||||
@@ -87,10 +89,10 @@ public class GHBranch {
|
|||||||
*
|
*
|
||||||
* @return API URL that deals with the protection of this branch.
|
* @return API URL that deals with the protection of this branch.
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(Previews.LUKE_CAGE)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public URL getProtectionUrl() {
|
public URL getProtectionUrl() {
|
||||||
return GitHub.parseURL(protection_url);
|
return GitHubClient.parseURL(protection_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -100,8 +102,14 @@ public class GHBranch {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
|
@Preview(Previews.LUKE_CAGE)
|
||||||
|
@Deprecated
|
||||||
public GHBranchProtection getProtection() throws IOException {
|
public GHBranchProtection getProtection() throws IOException {
|
||||||
return root.createRequest().withUrlPath(protection_url).fetch(GHBranchProtection.class).wrap(this);
|
return root.createRequest()
|
||||||
|
.withPreview(Previews.LUKE_CAGE)
|
||||||
|
.setRawUrlPath(protection_url)
|
||||||
|
.fetch(GHBranchProtection.class)
|
||||||
|
.wrap(this);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -120,7 +128,7 @@ public class GHBranch {
|
|||||||
* if disabling protection fails
|
* if disabling protection fails
|
||||||
*/
|
*/
|
||||||
public void disableProtection() throws IOException {
|
public void disableProtection() throws IOException {
|
||||||
root.createRequest().method("DELETE").withUrlPath(protection_url).send();
|
root.createRequest().method("DELETE").setRawUrlPath(protection_url).send();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -129,7 +137,7 @@ public class GHBranch {
|
|||||||
* @return GHBranchProtectionBuilder for enabling protection
|
* @return GHBranchProtectionBuilder for enabling protection
|
||||||
* @see GHCommitStatus#getContext() GHCommitStatus#getContext()
|
* @see GHCommitStatus#getContext() GHCommitStatus#getContext()
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(Previews.LUKE_CAGE)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHBranchProtectionBuilder enableProtection() {
|
public GHBranchProtectionBuilder enableProtection() {
|
||||||
return new GHBranchProtectionBuilder(this);
|
return new GHBranchProtectionBuilder(this);
|
||||||
@@ -161,6 +169,59 @@ public class GHBranch {
|
|||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Merge a branch into this branch.
|
||||||
|
*
|
||||||
|
* @param headBranch
|
||||||
|
* the branch whose head will be merged
|
||||||
|
*
|
||||||
|
* @param commitMessage
|
||||||
|
* the commit message
|
||||||
|
*
|
||||||
|
* @return the merge {@link GHCommit} created, or {@code null} if the base already contains the head (nothing to
|
||||||
|
* merge).
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* if merging fails
|
||||||
|
*/
|
||||||
|
@CheckForNull
|
||||||
|
public GHCommit merge(GHBranch headBranch, String commitMessage) throws IOException {
|
||||||
|
return merge(headBranch.getName(), commitMessage);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Merge a ref into this branch.
|
||||||
|
*
|
||||||
|
* @param head
|
||||||
|
* the ref name that will be merged into this branch. Follows the usual ref naming rules, could be a
|
||||||
|
* branch name, tag, or commit sha.
|
||||||
|
*
|
||||||
|
* @param commitMessage
|
||||||
|
* the commit message
|
||||||
|
*
|
||||||
|
* @return the merge {@link GHCommit} created, or {@code null} if the base already contains the head (nothing to
|
||||||
|
* merge).
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* if merging fails
|
||||||
|
*/
|
||||||
|
@CheckForNull
|
||||||
|
public GHCommit merge(String head, String commitMessage) throws IOException {
|
||||||
|
GHCommit result = root.createRequest()
|
||||||
|
.withUrlPath(owner.getApiTailUrl("merges"))
|
||||||
|
.method("POST")
|
||||||
|
.with("commit_message", commitMessage)
|
||||||
|
.with("base", this.name)
|
||||||
|
.with("head", head)
|
||||||
|
.fetch(GHCommit.class);
|
||||||
|
|
||||||
|
if (result != null) {
|
||||||
|
result.wrapUp(owner);
|
||||||
|
}
|
||||||
|
|
||||||
|
return result;
|
||||||
|
}
|
||||||
|
|
||||||
String getApiRoute() {
|
String getApiRoute() {
|
||||||
return owner.getApiTailUrl("/branches/" + name);
|
return owner.getApiTailUrl("/branches/" + name);
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -6,23 +6,23 @@ import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
|||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.util.Collection;
|
import java.util.Collection;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.ZZZAX;
|
import static org.kohsuke.github.internal.Previews.ZZZAX;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The type GHBranchProtection.
|
* The type GHBranchProtection.
|
||||||
|
*
|
||||||
|
* @see <a href="https://docs.github.com/en/rest/reference/repos#get-branch-protection">GitHub Branch Protection</a>
|
||||||
*/
|
*/
|
||||||
@SuppressFBWarnings(
|
@SuppressFBWarnings(
|
||||||
value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD",
|
value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD",
|
||||||
"URF_UNREAD_FIELD" },
|
"URF_UNREAD_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public class GHBranchProtection {
|
public class GHBranchProtection extends GitHubInteractiveObject {
|
||||||
private static final String REQUIRE_SIGNATURES_URI = "/required_signatures";
|
private static final String REQUIRE_SIGNATURES_URI = "/required_signatures";
|
||||||
|
|
||||||
@JsonProperty
|
@JsonProperty
|
||||||
private EnforceAdmins enforceAdmins;
|
private EnforceAdmins enforceAdmins;
|
||||||
|
|
||||||
private GitHub root;
|
|
||||||
|
|
||||||
@JsonProperty("required_pull_request_reviews")
|
@JsonProperty("required_pull_request_reviews")
|
||||||
private RequiredReviews requiredReviews;
|
private RequiredReviews requiredReviews;
|
||||||
|
|
||||||
@@ -41,7 +41,7 @@ public class GHBranchProtection {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(ZZZAX)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public void enabledSignedCommits() throws IOException {
|
public void enabledSignedCommits() throws IOException {
|
||||||
requester().method("POST").withUrlPath(url + REQUIRE_SIGNATURES_URI).fetch(RequiredSignatures.class);
|
requester().method("POST").withUrlPath(url + REQUIRE_SIGNATURES_URI).fetch(RequiredSignatures.class);
|
||||||
@@ -53,7 +53,7 @@ public class GHBranchProtection {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(ZZZAX)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public void disableSignedCommits() throws IOException {
|
public void disableSignedCommits() throws IOException {
|
||||||
requester().method("DELETE").withUrlPath(url + REQUIRE_SIGNATURES_URI).send();
|
requester().method("DELETE").withUrlPath(url + REQUIRE_SIGNATURES_URI).send();
|
||||||
@@ -84,7 +84,7 @@ public class GHBranchProtection {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(ZZZAX)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public boolean getRequiredSignatures() throws IOException {
|
public boolean getRequiredSignatures() throws IOException {
|
||||||
return requester().withUrlPath(url + REQUIRE_SIGNATURES_URI).fetch(RequiredSignatures.class).enabled;
|
return requester().withUrlPath(url + REQUIRE_SIGNATURES_URI).fetch(RequiredSignatures.class).enabled;
|
||||||
|
|||||||
@@ -12,7 +12,7 @@ import java.util.List;
|
|||||||
import java.util.Map;
|
import java.util.Map;
|
||||||
import java.util.Set;
|
import java.util.Set;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.*;
|
import static org.kohsuke.github.internal.Previews.LUKE_CAGE;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Builder to configure the branch protection settings.
|
* Builder to configure the branch protection settings.
|
||||||
|
|||||||
@@ -1,30 +1,52 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||||
|
import com.infradna.tool.bridge_method_injector.WithBridgeMethods;
|
||||||
|
import edu.umd.cs.findbugs.annotations.NonNull;
|
||||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
|
import org.kohsuke.github.GHWorkflowRun.Conclusion;
|
||||||
|
import org.kohsuke.github.GHWorkflowRun.Status;
|
||||||
|
import org.kohsuke.github.internal.EnumUtils;
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
|
import java.util.Arrays;
|
||||||
|
import java.util.Collections;
|
||||||
|
import java.util.Date;
|
||||||
|
import java.util.List;
|
||||||
|
import java.util.Locale;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Represents a deployment
|
* Represents a check run.
|
||||||
*
|
*
|
||||||
* @see <a href="https://developer.github.com/v3/checks/runs/">documentation</a>
|
* @see <a href="https://developer.github.com/v3/checks/runs/">documentation</a>
|
||||||
*/
|
*/
|
||||||
|
|
||||||
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD", "URF_UNREAD_FIELD" },
|
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD", "URF_UNREAD_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public class GHCheckRun extends GHObject {
|
public class GHCheckRun extends GHObject {
|
||||||
|
|
||||||
|
@JsonProperty("repository")
|
||||||
GHRepository owner;
|
GHRepository owner;
|
||||||
GitHub root;
|
|
||||||
|
|
||||||
private String status;
|
private String status;
|
||||||
private String conclusion;
|
private String conclusion;
|
||||||
private String name;
|
private String name;
|
||||||
|
private String headSha;
|
||||||
|
private String nodeId;
|
||||||
|
private String externalId;
|
||||||
|
private String startedAt;
|
||||||
|
private String completedAt;
|
||||||
|
private URL htmlUrl;
|
||||||
|
private URL detailsUrl;
|
||||||
|
private Output output;
|
||||||
|
private GHApp app;
|
||||||
private GHPullRequest[] pullRequests;
|
private GHPullRequest[] pullRequests;
|
||||||
|
private GHCheckSuite checkSuite;
|
||||||
|
|
||||||
GHCheckRun wrap(GHRepository owner) {
|
GHCheckRun wrap(GHRepository owner) {
|
||||||
this.owner = owner;
|
this.owner = owner;
|
||||||
this.root = owner.root;
|
wrap(owner.root);
|
||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -32,7 +54,24 @@ public class GHCheckRun extends GHObject {
|
|||||||
this.root = root;
|
this.root = root;
|
||||||
if (owner != null) {
|
if (owner != null) {
|
||||||
owner.wrap(root);
|
owner.wrap(root);
|
||||||
|
if (pullRequests != null && pullRequests.length != 0) {
|
||||||
|
for (GHPullRequest singlePull : pullRequests) {
|
||||||
|
singlePull.wrap(owner);
|
||||||
}
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
}
|
||||||
|
if (checkSuite != null) {
|
||||||
|
if (owner != null) {
|
||||||
|
checkSuite.wrap(owner);
|
||||||
|
} else {
|
||||||
|
checkSuite.wrap(root);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
if (app != null) {
|
||||||
|
app.wrapUp(root);
|
||||||
|
}
|
||||||
|
|
||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -40,33 +79,264 @@ public class GHCheckRun extends GHObject {
|
|||||||
return pullRequests;
|
return pullRequests;
|
||||||
}
|
}
|
||||||
|
|
||||||
public String getStatus() {
|
/**
|
||||||
|
* Gets status of the check run.
|
||||||
|
*
|
||||||
|
* @return Status of the check run
|
||||||
|
* @see Status
|
||||||
|
*/
|
||||||
|
@WithBridgeMethods(value = String.class, adapterMethod = "statusAsStr")
|
||||||
|
public Status getStatus() {
|
||||||
|
return Status.from(status);
|
||||||
|
}
|
||||||
|
|
||||||
|
@SuppressFBWarnings(value = "UPM_UNCALLED_PRIVATE_METHOD", justification = "Bridge method of getStatus")
|
||||||
|
private Object statusAsStr(Status status, Class type) {
|
||||||
return status;
|
return status;
|
||||||
}
|
}
|
||||||
|
|
||||||
public String getConclusion() {
|
public static enum Status {
|
||||||
|
QUEUED, IN_PROGRESS, COMPLETED, UNKNOWN;
|
||||||
|
|
||||||
|
public static Status from(String value) {
|
||||||
|
return EnumUtils.getNullableEnumOrDefault(Status.class, value, Status.UNKNOWN);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String toString() {
|
||||||
|
return name().toLowerCase(Locale.ROOT);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets conclusion of a completed check run.
|
||||||
|
*
|
||||||
|
* @return Status of the check run
|
||||||
|
* @see Conclusion
|
||||||
|
*/
|
||||||
|
@WithBridgeMethods(value = String.class, adapterMethod = "conclusionAsStr")
|
||||||
|
public Conclusion getConclusion() {
|
||||||
|
return Conclusion.from(conclusion);
|
||||||
|
}
|
||||||
|
|
||||||
|
@SuppressFBWarnings(value = "UPM_UNCALLED_PRIVATE_METHOD", justification = "Bridge method of getConclusion")
|
||||||
|
private Object conclusionAsStr(Conclusion conclusion, Class type) {
|
||||||
return conclusion;
|
return conclusion;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Final conclusion of the check.
|
||||||
|
*
|
||||||
|
* From <a href="https://docs.github.com/en/rest/reference/checks#create-a-check-run--parameters">Check Run
|
||||||
|
* Parameters - <code>conclusion</code></a>.
|
||||||
|
*/
|
||||||
|
public static enum Conclusion {
|
||||||
|
ACTION_REQUIRED, CANCELLED, FAILURE, NEUTRAL, SUCCESS, SKIPPED, STALE, TIMED_OUT, UNKNOWN;
|
||||||
|
|
||||||
|
public static Conclusion from(String value) {
|
||||||
|
return EnumUtils.getNullableEnumOrDefault(Conclusion.class, value, Conclusion.UNKNOWN);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public String toString() {
|
||||||
|
return name().toLowerCase(Locale.ROOT);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the custom name of this check run.
|
||||||
|
*
|
||||||
|
* @return Name of the check run
|
||||||
|
*/
|
||||||
public String getName() {
|
public String getName() {
|
||||||
return name;
|
return name;
|
||||||
}
|
}
|
||||||
|
|
||||||
GHPullRequest[] getPullRequests() throws IOException {
|
/**
|
||||||
if (pullRequests != null && pullRequests.length != 0) {
|
* Gets the HEAD SHA.
|
||||||
for (GHPullRequest singlePull : pullRequests) {
|
*
|
||||||
singlePull.refresh();
|
* @return sha for the HEAD commit
|
||||||
}
|
*/
|
||||||
}
|
public String getHeadSha() {
|
||||||
return pullRequests;
|
return headSha;
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* @deprecated This object has no HTML URL.
|
* Gets the pull requests participated in this check run.
|
||||||
|
*
|
||||||
|
* Note this field is only populated for events. When getting a {@link GHCheckRun} outside of an event, this is
|
||||||
|
* always empty.
|
||||||
|
*
|
||||||
|
* @return the list of {@link GHPullRequest}s for this check run. Only populated for events.
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public List<GHPullRequest> getPullRequests() throws IOException {
|
||||||
|
if (pullRequests != null && pullRequests.length != 0) {
|
||||||
|
for (GHPullRequest singlePull : pullRequests) {
|
||||||
|
// Only refresh if we haven't do so before
|
||||||
|
singlePull.refresh(singlePull.getTitle());
|
||||||
|
}
|
||||||
|
return Collections.unmodifiableList(Arrays.asList(pullRequests));
|
||||||
|
}
|
||||||
|
return Collections.emptyList();
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the HTML URL: https://github.com/[owner]/[repo-name]/runs/[check-run-id], usually an GitHub Action page of
|
||||||
|
* the check run.
|
||||||
|
*
|
||||||
|
* @return HTML URL
|
||||||
*/
|
*/
|
||||||
@Override
|
@Override
|
||||||
public URL getHtmlUrl() {
|
public URL getHtmlUrl() {
|
||||||
return null;
|
return htmlUrl;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the global node id to access most objects in GitHub.
|
||||||
|
*
|
||||||
|
* @see <a href="https://developer.github.com/v4/guides/using-global-node-ids/">documentation</a>
|
||||||
|
* @return Global node id
|
||||||
|
*/
|
||||||
|
public String getNodeId() {
|
||||||
|
return nodeId;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets a reference for the check run on the integrator's system.
|
||||||
|
*
|
||||||
|
* @return Reference id
|
||||||
|
*/
|
||||||
|
public String getExternalId() {
|
||||||
|
return externalId;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the details URL from which to find full details of the check run on the integrator's site.
|
||||||
|
*
|
||||||
|
* @return Details URL
|
||||||
|
*/
|
||||||
|
public URL getDetailsUrl() {
|
||||||
|
return detailsUrl;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the start time of the check run in ISO 8601 format: YYYY-MM-DDTHH:MM:SSZ.
|
||||||
|
*
|
||||||
|
* @return Timestamp of the start time
|
||||||
|
*/
|
||||||
|
public Date getStartedAt() {
|
||||||
|
return GitHubClient.parseDate(startedAt);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the completed time of the check run in ISO 8601 format: YYYY-MM-DDTHH:MM:SSZ.
|
||||||
|
*
|
||||||
|
* @return Timestamp of the completed time
|
||||||
|
*/
|
||||||
|
public Date getCompletedAt() {
|
||||||
|
return GitHubClient.parseDate(completedAt);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the GitHub app this check run belongs to, included in response.
|
||||||
|
*
|
||||||
|
* @return GitHub App
|
||||||
|
*/
|
||||||
|
public GHApp getApp() {
|
||||||
|
return app;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the check suite this check run belongs to
|
||||||
|
*
|
||||||
|
* @return Check suite
|
||||||
|
*/
|
||||||
|
public GHCheckSuite getCheckSuite() {
|
||||||
|
return checkSuite;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets an output for a check run.
|
||||||
|
*
|
||||||
|
* @return Output of a check run
|
||||||
|
*/
|
||||||
|
public Output getOutput() {
|
||||||
|
return output;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Represents an output in a check run to include summary and other results.
|
||||||
|
*
|
||||||
|
* @see <a href="https://developer.github.com/v3/checks/runs/#output-object">documentation</a>
|
||||||
|
*/
|
||||||
|
public static class Output {
|
||||||
|
private String title;
|
||||||
|
private String summary;
|
||||||
|
private String text;
|
||||||
|
private int annotationsCount;
|
||||||
|
private URL annotationsUrl;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the title of check run.
|
||||||
|
*
|
||||||
|
* @return title of check run
|
||||||
|
*/
|
||||||
|
public String getTitle() {
|
||||||
|
return title;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the summary of the check run, note that it supports Markdown.
|
||||||
|
*
|
||||||
|
* @return summary of check run
|
||||||
|
*/
|
||||||
|
public String getSummary() {
|
||||||
|
return summary;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the details of the check run, note that it supports Markdown.
|
||||||
|
*
|
||||||
|
* @return Details of the check run
|
||||||
|
*/
|
||||||
|
public String getText() {
|
||||||
|
return text;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the annotation count of a check run.
|
||||||
|
*
|
||||||
|
* @return annotation count of a check run
|
||||||
|
*/
|
||||||
|
public int getAnnotationsCount() {
|
||||||
|
return annotationsCount;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the URL of annotations.
|
||||||
|
*
|
||||||
|
* @return URL of annotations
|
||||||
|
*/
|
||||||
|
public URL getAnnotationsUrl() {
|
||||||
|
return annotationsUrl;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
public static enum AnnotationLevel {
|
||||||
|
NOTICE, WARNING, FAILURE
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Updates this check run.
|
||||||
|
*
|
||||||
|
* @return a builder which you should customize, then call {@link GHCheckRunBuilder#create}
|
||||||
|
*/
|
||||||
|
@Preview(Previews.ANTIOPE)
|
||||||
|
@Deprecated
|
||||||
|
public @NonNull GHCheckRunBuilder update() {
|
||||||
|
return new GHCheckRunBuilder(owner, getId());
|
||||||
}
|
}
|
||||||
|
|
||||||
}
|
}
|
||||||
|
|||||||
307
src/main/java/org/kohsuke/github/GHCheckRunBuilder.java
Normal file
307
src/main/java/org/kohsuke/github/GHCheckRunBuilder.java
Normal file
@@ -0,0 +1,307 @@
|
|||||||
|
/*
|
||||||
|
* The MIT License
|
||||||
|
*
|
||||||
|
* Copyright 2020 CloudBees, Inc.
|
||||||
|
*
|
||||||
|
* Permission is hereby granted, free of charge, to any person obtaining a copy
|
||||||
|
* of this software and associated documentation files (the "Software"), to deal
|
||||||
|
* in the Software without restriction, including without limitation the rights
|
||||||
|
* to use, copy, modify, merge, publish, distribute, sublicense, and/or sell
|
||||||
|
* copies of the Software, and to permit persons to whom the Software is
|
||||||
|
* furnished to do so, subject to the following conditions:
|
||||||
|
*
|
||||||
|
* The above copyright notice and this permission notice shall be included in
|
||||||
|
* all copies or substantial portions of the Software.
|
||||||
|
*
|
||||||
|
* THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR
|
||||||
|
* IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY,
|
||||||
|
* FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE
|
||||||
|
* AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER
|
||||||
|
* LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM,
|
||||||
|
* OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN
|
||||||
|
* THE SOFTWARE.
|
||||||
|
*/
|
||||||
|
|
||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import com.fasterxml.jackson.annotation.JsonInclude;
|
||||||
|
import edu.umd.cs.findbugs.annotations.CheckForNull;
|
||||||
|
import edu.umd.cs.findbugs.annotations.NonNull;
|
||||||
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
|
import java.io.IOException;
|
||||||
|
import java.util.Collections;
|
||||||
|
import java.util.Date;
|
||||||
|
import java.util.LinkedList;
|
||||||
|
import java.util.List;
|
||||||
|
import java.util.Locale;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Drafts or updates a check run.
|
||||||
|
*
|
||||||
|
* @see GHCheckRun
|
||||||
|
* @see GHRepository#createCheckRun
|
||||||
|
* @see <a href="https://developer.github.com/v3/checks/runs/#create-a-check-run">documentation</a>
|
||||||
|
* @see GHCheckRun#update()
|
||||||
|
* @see <a href="https://developer.github.com/v3/checks/runs/#update-a-check-run">documentation</a>
|
||||||
|
*/
|
||||||
|
@SuppressFBWarnings(value = "URF_UNREAD_FIELD", justification = "Jackson serializes these even without a getter")
|
||||||
|
@Preview(Previews.ANTIOPE)
|
||||||
|
@Deprecated
|
||||||
|
public final class GHCheckRunBuilder {
|
||||||
|
|
||||||
|
protected final GHRepository repo;
|
||||||
|
protected final Requester requester;
|
||||||
|
private Output output;
|
||||||
|
private List<Action> actions;
|
||||||
|
|
||||||
|
private GHCheckRunBuilder(GHRepository repo, Requester requester) {
|
||||||
|
this.repo = repo;
|
||||||
|
this.requester = requester;
|
||||||
|
}
|
||||||
|
|
||||||
|
GHCheckRunBuilder(GHRepository repo, String name, String headSHA) {
|
||||||
|
this(repo,
|
||||||
|
repo.root.createRequest()
|
||||||
|
.withPreview(Previews.ANTIOPE)
|
||||||
|
.method("POST")
|
||||||
|
.with("name", name)
|
||||||
|
.with("head_sha", headSHA)
|
||||||
|
.withUrlPath(repo.getApiTailUrl("check-runs")));
|
||||||
|
}
|
||||||
|
|
||||||
|
GHCheckRunBuilder(GHRepository repo, long checkId) {
|
||||||
|
this(repo,
|
||||||
|
repo.root.createRequest()
|
||||||
|
.withPreview(Previews.ANTIOPE)
|
||||||
|
.method("PATCH")
|
||||||
|
.withUrlPath(repo.getApiTailUrl("check-runs/" + checkId)));
|
||||||
|
}
|
||||||
|
|
||||||
|
public @NonNull GHCheckRunBuilder withDetailsURL(@CheckForNull String detailsURL) {
|
||||||
|
requester.with("details_url", detailsURL);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
public @NonNull GHCheckRunBuilder withExternalID(@CheckForNull String externalID) {
|
||||||
|
requester.with("external_id", externalID);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
public @NonNull GHCheckRunBuilder withStatus(@CheckForNull GHCheckRun.Status status) {
|
||||||
|
if (status != null) {
|
||||||
|
// Do *not* use the overload taking Enum, as that s/_/-/g which would be wrong here.
|
||||||
|
requester.with("status", status.toString().toLowerCase(Locale.ROOT));
|
||||||
|
}
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
public @NonNull GHCheckRunBuilder withConclusion(@CheckForNull GHCheckRun.Conclusion conclusion) {
|
||||||
|
if (conclusion != null) {
|
||||||
|
requester.with("conclusion", conclusion.toString().toLowerCase(Locale.ROOT));
|
||||||
|
}
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
public @NonNull GHCheckRunBuilder withStartedAt(@CheckForNull Date startedAt) {
|
||||||
|
if (startedAt != null) {
|
||||||
|
requester.with("started_at", GitHubClient.printDate(startedAt));
|
||||||
|
}
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
public @NonNull GHCheckRunBuilder withCompletedAt(@CheckForNull Date completedAt) {
|
||||||
|
if (completedAt != null) {
|
||||||
|
requester.with("completed_at", GitHubClient.printDate(completedAt));
|
||||||
|
}
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
public @NonNull GHCheckRunBuilder add(@NonNull Output output) {
|
||||||
|
if (this.output != null) {
|
||||||
|
throw new IllegalStateException("cannot add Output twice");
|
||||||
|
}
|
||||||
|
this.output = output;
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
public @NonNull GHCheckRunBuilder add(@NonNull Action action) {
|
||||||
|
if (actions == null) {
|
||||||
|
actions = new LinkedList<>();
|
||||||
|
}
|
||||||
|
actions.add(action);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
private static final int MAX_ANNOTATIONS = 50;
|
||||||
|
/**
|
||||||
|
* Actually creates the check run. (If more than fifty annotations were requested, this is done in batches.)
|
||||||
|
*
|
||||||
|
* @return the resulting run
|
||||||
|
* @throws IOException
|
||||||
|
* for the usual reasons
|
||||||
|
*/
|
||||||
|
public @NonNull GHCheckRun create() throws IOException {
|
||||||
|
List<Annotation> extraAnnotations;
|
||||||
|
if (output != null && output.annotations != null && output.annotations.size() > MAX_ANNOTATIONS) {
|
||||||
|
extraAnnotations = output.annotations.subList(MAX_ANNOTATIONS, output.annotations.size());
|
||||||
|
output.annotations = output.annotations.subList(0, MAX_ANNOTATIONS);
|
||||||
|
} else {
|
||||||
|
extraAnnotations = Collections.emptyList();
|
||||||
|
}
|
||||||
|
GHCheckRun run = requester.with("output", output).with("actions", actions).fetch(GHCheckRun.class).wrap(repo);
|
||||||
|
while (!extraAnnotations.isEmpty()) {
|
||||||
|
Output output2 = new Output(output.title, output.summary).withText(output.text);
|
||||||
|
int i = Math.min(extraAnnotations.size(), MAX_ANNOTATIONS);
|
||||||
|
output2.annotations = extraAnnotations.subList(0, i);
|
||||||
|
extraAnnotations = extraAnnotations.subList(i, extraAnnotations.size());
|
||||||
|
run = repo.root.createRequest()
|
||||||
|
.withPreview(Previews.ANTIOPE)
|
||||||
|
.method("PATCH")
|
||||||
|
.with("output", output2)
|
||||||
|
.withUrlPath(repo.getApiTailUrl("check-runs/" + run.getId()))
|
||||||
|
.fetch(GHCheckRun.class)
|
||||||
|
.wrap(repo);
|
||||||
|
}
|
||||||
|
return run;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* @see <a href="https://developer.github.com/v3/checks/runs/#output-object">documentation</a>
|
||||||
|
*/
|
||||||
|
@JsonInclude(JsonInclude.Include.NON_NULL)
|
||||||
|
public static final class Output {
|
||||||
|
|
||||||
|
private final String title;
|
||||||
|
private final String summary;
|
||||||
|
private String text;
|
||||||
|
private List<Annotation> annotations;
|
||||||
|
private List<Image> images;
|
||||||
|
|
||||||
|
public Output(@NonNull String title, @NonNull String summary) {
|
||||||
|
this.title = title;
|
||||||
|
this.summary = summary;
|
||||||
|
}
|
||||||
|
|
||||||
|
public @NonNull Output withText(@CheckForNull String text) {
|
||||||
|
this.text = text;
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
public @NonNull Output add(@NonNull Annotation annotation) {
|
||||||
|
if (annotations == null) {
|
||||||
|
annotations = new LinkedList<>();
|
||||||
|
}
|
||||||
|
annotations.add(annotation);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
public @NonNull Output add(@NonNull Image image) {
|
||||||
|
if (images == null) {
|
||||||
|
images = new LinkedList<>();
|
||||||
|
}
|
||||||
|
images.add(image);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* @see <a href="https://developer.github.com/v3/checks/runs/#annotations-object">documentation</a>
|
||||||
|
*/
|
||||||
|
@JsonInclude(JsonInclude.Include.NON_NULL)
|
||||||
|
public static final class Annotation {
|
||||||
|
|
||||||
|
private final String path;
|
||||||
|
private final int start_line;
|
||||||
|
private final int end_line;
|
||||||
|
private final String annotation_level;
|
||||||
|
private final String message;
|
||||||
|
private Integer start_column;
|
||||||
|
private Integer end_column;
|
||||||
|
private String title;
|
||||||
|
private String raw_details;
|
||||||
|
|
||||||
|
public Annotation(@NonNull String path,
|
||||||
|
int line,
|
||||||
|
@NonNull GHCheckRun.AnnotationLevel annotationLevel,
|
||||||
|
@NonNull String message) {
|
||||||
|
this(path, line, line, annotationLevel, message);
|
||||||
|
}
|
||||||
|
|
||||||
|
public Annotation(@NonNull String path,
|
||||||
|
int startLine,
|
||||||
|
int endLine,
|
||||||
|
@NonNull GHCheckRun.AnnotationLevel annotationLevel,
|
||||||
|
@NonNull String message) {
|
||||||
|
this.path = path;
|
||||||
|
start_line = startLine;
|
||||||
|
end_line = endLine;
|
||||||
|
annotation_level = annotationLevel.toString().toLowerCase(Locale.ROOT);
|
||||||
|
this.message = message;
|
||||||
|
}
|
||||||
|
|
||||||
|
public @NonNull Annotation withStartColumn(@CheckForNull Integer startColumn) {
|
||||||
|
start_column = startColumn;
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
public @NonNull Annotation withEndColumn(@CheckForNull Integer endColumn) {
|
||||||
|
end_column = endColumn;
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
public @NonNull Annotation withTitle(@CheckForNull String title) {
|
||||||
|
this.title = title;
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
public @NonNull Annotation withRawDetails(@CheckForNull String rawDetails) {
|
||||||
|
raw_details = rawDetails;
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* @see <a href="https://developer.github.com/v3/checks/runs/#images-object">documentation</a>
|
||||||
|
*/
|
||||||
|
@JsonInclude(JsonInclude.Include.NON_NULL)
|
||||||
|
public static final class Image {
|
||||||
|
|
||||||
|
private final String alt;
|
||||||
|
private final String image_url;
|
||||||
|
private String caption;
|
||||||
|
|
||||||
|
public Image(@NonNull String alt, @NonNull String imageURL) {
|
||||||
|
this.alt = alt;
|
||||||
|
image_url = imageURL;
|
||||||
|
}
|
||||||
|
|
||||||
|
public @NonNull Image withCaption(@CheckForNull String caption) {
|
||||||
|
this.caption = caption;
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* @see <a href="https://developer.github.com/v3/checks/runs/#actions-object">documentation</a>
|
||||||
|
*/
|
||||||
|
@JsonInclude(JsonInclude.Include.NON_NULL)
|
||||||
|
public static final class Action {
|
||||||
|
|
||||||
|
private final String label;
|
||||||
|
private final String description;
|
||||||
|
private final String identifier;
|
||||||
|
|
||||||
|
public Action(@NonNull String label, @NonNull String description, @NonNull String identifier) {
|
||||||
|
this.label = label;
|
||||||
|
this.description = description;
|
||||||
|
this.identifier = identifier;
|
||||||
|
}
|
||||||
|
|
||||||
|
}
|
||||||
|
|
||||||
|
}
|
||||||
44
src/main/java/org/kohsuke/github/GHCheckRunsIterable.java
Normal file
44
src/main/java/org/kohsuke/github/GHCheckRunsIterable.java
Normal file
@@ -0,0 +1,44 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import java.util.Iterator;
|
||||||
|
|
||||||
|
import javax.annotation.Nonnull;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Iterable for check-runs listing.
|
||||||
|
*/
|
||||||
|
class GHCheckRunsIterable extends PagedIterable<GHCheckRun> {
|
||||||
|
private final transient GitHub root;
|
||||||
|
private final GitHubRequest request;
|
||||||
|
|
||||||
|
private GHCheckRunsPage result;
|
||||||
|
|
||||||
|
public GHCheckRunsIterable(GitHub root, GitHubRequest request) {
|
||||||
|
this.root = root;
|
||||||
|
this.request = request;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Nonnull
|
||||||
|
@Override
|
||||||
|
public PagedIterator<GHCheckRun> _iterator(int pageSize) {
|
||||||
|
return new PagedIterator<>(
|
||||||
|
adapt(GitHubPageIterator.create(root.getClient(), GHCheckRunsPage.class, request, pageSize)),
|
||||||
|
null);
|
||||||
|
}
|
||||||
|
|
||||||
|
protected Iterator<GHCheckRun[]> adapt(final Iterator<GHCheckRunsPage> base) {
|
||||||
|
return new Iterator<GHCheckRun[]>() {
|
||||||
|
public boolean hasNext() {
|
||||||
|
return base.hasNext();
|
||||||
|
}
|
||||||
|
|
||||||
|
public GHCheckRun[] next() {
|
||||||
|
GHCheckRunsPage v = base.next();
|
||||||
|
if (result == null) {
|
||||||
|
result = v;
|
||||||
|
}
|
||||||
|
return v.getCheckRuns(root);
|
||||||
|
}
|
||||||
|
};
|
||||||
|
}
|
||||||
|
}
|
||||||
20
src/main/java/org/kohsuke/github/GHCheckRunsPage.java
Normal file
20
src/main/java/org/kohsuke/github/GHCheckRunsPage.java
Normal file
@@ -0,0 +1,20 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Represents the one page of check-runs result when listing check-runs.
|
||||||
|
*/
|
||||||
|
class GHCheckRunsPage {
|
||||||
|
private int total_count;
|
||||||
|
private GHCheckRun[] check_runs;
|
||||||
|
|
||||||
|
public int getTotalCount() {
|
||||||
|
return total_count;
|
||||||
|
}
|
||||||
|
|
||||||
|
GHCheckRun[] getCheckRuns(GitHub root) {
|
||||||
|
for (GHCheckRun check_run : check_runs) {
|
||||||
|
check_run.wrap(root);
|
||||||
|
}
|
||||||
|
return check_runs;
|
||||||
|
}
|
||||||
|
}
|
||||||
259
src/main/java/org/kohsuke/github/GHCheckSuite.java
Normal file
259
src/main/java/org/kohsuke/github/GHCheckSuite.java
Normal file
@@ -0,0 +1,259 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||||
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
|
|
||||||
|
import java.io.IOException;
|
||||||
|
import java.net.URL;
|
||||||
|
import java.util.Arrays;
|
||||||
|
import java.util.Collections;
|
||||||
|
import java.util.Date;
|
||||||
|
import java.util.List;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Represents a check suite.
|
||||||
|
*
|
||||||
|
* @see <a href="https://developer.github.com/v3/checks/suites/">documentation</a>
|
||||||
|
*/
|
||||||
|
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD", "URF_UNREAD_FIELD" },
|
||||||
|
justification = "JSON API")
|
||||||
|
public class GHCheckSuite extends GHObject {
|
||||||
|
|
||||||
|
@JsonProperty("repository")
|
||||||
|
GHRepository owner;
|
||||||
|
|
||||||
|
private String nodeId;
|
||||||
|
private String headBranch;
|
||||||
|
private String headSha;
|
||||||
|
private String status;
|
||||||
|
private String conclusion;
|
||||||
|
private String before;
|
||||||
|
private String after;
|
||||||
|
private int latestCheckRunsCount;
|
||||||
|
private URL checkRunsUrl;
|
||||||
|
private HeadCommit headCommit;
|
||||||
|
private GHApp app;
|
||||||
|
private GHPullRequest[] pullRequests;
|
||||||
|
|
||||||
|
GHCheckSuite wrap(GHRepository owner) {
|
||||||
|
this.owner = owner;
|
||||||
|
this.wrap(owner.root);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
GHCheckSuite wrap(GitHub root) {
|
||||||
|
this.root = root;
|
||||||
|
if (owner != null) {
|
||||||
|
owner.wrap(root);
|
||||||
|
if (pullRequests != null && pullRequests.length != 0) {
|
||||||
|
for (GHPullRequest singlePull : pullRequests) {
|
||||||
|
singlePull.wrap(owner);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
|
if (app != null) {
|
||||||
|
app.wrapUp(root);
|
||||||
|
}
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
GHPullRequest[] wrap() {
|
||||||
|
return pullRequests;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the global node id to access most objects in GitHub.
|
||||||
|
*
|
||||||
|
* @see <a href="https://developer.github.com/v4/guides/using-global-node-ids/">documentation</a>
|
||||||
|
* @return global node id
|
||||||
|
*/
|
||||||
|
public String getNodeId() {
|
||||||
|
return nodeId;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The head branch name the changes are on.
|
||||||
|
*
|
||||||
|
* @return head branch name
|
||||||
|
*/
|
||||||
|
public String getHeadBranch() {
|
||||||
|
return headBranch;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the HEAD SHA.
|
||||||
|
*
|
||||||
|
* @return sha for the HEAD commit
|
||||||
|
*/
|
||||||
|
public String getHeadSha() {
|
||||||
|
return headSha;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets status of the check suite. It can be one of request, in_progress, or completed.
|
||||||
|
*
|
||||||
|
* @return status of the check suite
|
||||||
|
*/
|
||||||
|
public String getStatus() {
|
||||||
|
return status;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets conclusion of a completed check suite. It can be one of success, failure, neutral, cancelled, time_out,
|
||||||
|
* action_required, or stale. The check suite will report the highest priority check run conclusion in the check
|
||||||
|
* suite's conclusion.
|
||||||
|
*
|
||||||
|
* @return conclusion of the check suite
|
||||||
|
*/
|
||||||
|
public String getConclusion() {
|
||||||
|
return conclusion;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The SHA of the most recent commit on ref before the push.
|
||||||
|
*
|
||||||
|
* @return sha of a commit
|
||||||
|
*/
|
||||||
|
public String getBefore() {
|
||||||
|
return before;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The SHA of the most recent commit on ref after the push.
|
||||||
|
*
|
||||||
|
* @return sha of a commit
|
||||||
|
*/
|
||||||
|
public String getAfter() {
|
||||||
|
return after;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The quantity of check runs that had run as part of the latest push.
|
||||||
|
*
|
||||||
|
* @return sha of the most recent commit
|
||||||
|
*/
|
||||||
|
public int getLatestCheckRunsCount() {
|
||||||
|
return latestCheckRunsCount;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The url used to list all the check runs belonged to this suite.
|
||||||
|
*
|
||||||
|
* @return url containing all check runs
|
||||||
|
*/
|
||||||
|
public URL getCheckRunsUrl() {
|
||||||
|
return checkRunsUrl;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The commit of current head.
|
||||||
|
*
|
||||||
|
* @return head commit
|
||||||
|
*/
|
||||||
|
public HeadCommit getHeadCommit() {
|
||||||
|
return headCommit;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the GitHub app this check suite belongs to, included in response.
|
||||||
|
*
|
||||||
|
* @return GitHub App
|
||||||
|
*/
|
||||||
|
public GHApp getApp() {
|
||||||
|
return app;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the pull requests participated in this check suite.
|
||||||
|
*
|
||||||
|
* Note this field is only populated for events. When getting a {@link GHCheckSuite} outside of an event, this is
|
||||||
|
* always empty.
|
||||||
|
*
|
||||||
|
* @return the list of {@link GHPullRequest}s for this check suite. Only populated for events.
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public List<GHPullRequest> getPullRequests() throws IOException {
|
||||||
|
if (pullRequests != null && pullRequests.length != 0) {
|
||||||
|
for (GHPullRequest singlePull : pullRequests) {
|
||||||
|
// Only refresh if we haven't do so before
|
||||||
|
singlePull.refresh(singlePull.getTitle());
|
||||||
|
}
|
||||||
|
return Collections.unmodifiableList(Arrays.asList(pullRequests));
|
||||||
|
}
|
||||||
|
return Collections.emptyList();
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Check suite doesn't have a HTML URL.
|
||||||
|
*
|
||||||
|
* @return null
|
||||||
|
*/
|
||||||
|
@Override
|
||||||
|
public URL getHtmlUrl() {
|
||||||
|
return null;
|
||||||
|
}
|
||||||
|
|
||||||
|
public static class HeadCommit {
|
||||||
|
private String id;
|
||||||
|
private String treeId;
|
||||||
|
private String message;
|
||||||
|
private String timestamp;
|
||||||
|
private GitUser author;
|
||||||
|
private GitUser committer;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets id of the commit, used by {@link GHCheckSuite} when a {@link GHEvent#CHECK_SUITE} comes
|
||||||
|
*
|
||||||
|
* @return id of the commit
|
||||||
|
*/
|
||||||
|
public String getId() {
|
||||||
|
return id;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets id of the tree.
|
||||||
|
*
|
||||||
|
* @return id of the tree
|
||||||
|
*/
|
||||||
|
public String getTreeId() {
|
||||||
|
return treeId;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets message.
|
||||||
|
*
|
||||||
|
* @return commit message.
|
||||||
|
*/
|
||||||
|
public String getMessage() {
|
||||||
|
return message;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets timestamp of the commit.
|
||||||
|
*
|
||||||
|
* @return timestamp of the commit
|
||||||
|
*/
|
||||||
|
public Date getTimestamp() {
|
||||||
|
return GitHubClient.parseDate(timestamp);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets author.
|
||||||
|
*
|
||||||
|
* @return the author
|
||||||
|
*/
|
||||||
|
public GitUser getAuthor() {
|
||||||
|
return author;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets committer.
|
||||||
|
*
|
||||||
|
* @return the committer
|
||||||
|
*/
|
||||||
|
public GitUser getCommitter() {
|
||||||
|
return committer;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -11,6 +11,9 @@ import java.util.Collections;
|
|||||||
import java.util.Date;
|
import java.util.Date;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
|
|
||||||
|
import static org.kohsuke.github.internal.Previews.ANTIOPE;
|
||||||
|
import static org.kohsuke.github.internal.Previews.GROOT;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* A commit in a repository.
|
* A commit in a repository.
|
||||||
*
|
*
|
||||||
@@ -39,6 +42,8 @@ public class GHCommit {
|
|||||||
|
|
||||||
private int comment_count;
|
private int comment_count;
|
||||||
|
|
||||||
|
private GHVerification verification;
|
||||||
|
|
||||||
static class Tree {
|
static class Tree {
|
||||||
String sha;
|
String sha;
|
||||||
}
|
}
|
||||||
@@ -61,7 +66,7 @@ public class GHCommit {
|
|||||||
* @return the authored date
|
* @return the authored date
|
||||||
*/
|
*/
|
||||||
public Date getAuthoredDate() {
|
public Date getAuthoredDate() {
|
||||||
return GitHub.parseDate(author.date);
|
return author.getDate();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -80,7 +85,7 @@ public class GHCommit {
|
|||||||
* @return the commit date
|
* @return the commit date
|
||||||
*/
|
*/
|
||||||
public Date getCommitDate() {
|
public Date getCommitDate() {
|
||||||
return GitHub.parseDate(committer.date);
|
return committer.getDate();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -100,6 +105,15 @@ public class GHCommit {
|
|||||||
public int getCommentCount() {
|
public int getCommentCount() {
|
||||||
return comment_count;
|
return comment_count;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets Verification Status.
|
||||||
|
*
|
||||||
|
* @return the Verification status
|
||||||
|
*/
|
||||||
|
public GHVerification getVerification() {
|
||||||
|
return verification;
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -108,7 +122,6 @@ public class GHCommit {
|
|||||||
* @deprecated Use {@link GitUser} instead.
|
* @deprecated Use {@link GitUser} instead.
|
||||||
*/
|
*/
|
||||||
public static class GHAuthor extends GitUser {
|
public static class GHAuthor extends GitUser {
|
||||||
private String date;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -201,7 +214,7 @@ public class GHCommit {
|
|||||||
* resolves to the actual content of the file.
|
* resolves to the actual content of the file.
|
||||||
*/
|
*/
|
||||||
public URL getRawUrl() {
|
public URL getRawUrl() {
|
||||||
return GitHub.parseURL(raw_url);
|
return GitHubClient.parseURL(raw_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -212,7 +225,7 @@ public class GHCommit {
|
|||||||
* that resolves to the HTML page that describes this file.
|
* that resolves to the HTML page that describes this file.
|
||||||
*/
|
*/
|
||||||
public URL getBlobUrl() {
|
public URL getBlobUrl() {
|
||||||
return GitHub.parseURL(blob_url);
|
return GitHubClient.parseURL(blob_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -326,7 +339,7 @@ public class GHCommit {
|
|||||||
* "https://github.com/kohsuke/sandbox-ant/commit/8ae38db0ea5837313ab5f39d43a6f73de3bd9000"
|
* "https://github.com/kohsuke/sandbox-ant/commit/8ae38db0ea5837313ab5f39d43a6f73de3bd9000"
|
||||||
*/
|
*/
|
||||||
public URL getHtmlUrl() {
|
public URL getHtmlUrl() {
|
||||||
return GitHub.parseURL(html_url);
|
return GitHubClient.parseURL(html_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -435,6 +448,39 @@ public class GHCommit {
|
|||||||
return owner.root.getUser(author.login);
|
return owner.root.getUser(author.login);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Retrieves a list of pull requests which contain this commit.
|
||||||
|
*
|
||||||
|
* @return {@link PagedIterable} with the pull requests which contain this commit
|
||||||
|
*/
|
||||||
|
@Preview(GROOT)
|
||||||
|
@Deprecated
|
||||||
|
public PagedIterable<GHPullRequest> listPullRequests() {
|
||||||
|
return owner.root.createRequest()
|
||||||
|
.withPreview(GROOT)
|
||||||
|
.withUrlPath(String.format("/repos/%s/%s/commits/%s/pulls", owner.getOwnerName(), owner.getName(), sha))
|
||||||
|
.toIterable(GHPullRequest[].class, item -> item.wrapUp(owner));
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Retrieves a list of branches where this commit is the head commit.
|
||||||
|
*
|
||||||
|
* @return {@link PagedIterable} with the branches where the commit is the head commit
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
@Preview(GROOT)
|
||||||
|
@Deprecated
|
||||||
|
public PagedIterable<GHBranch> listBranchesWhereHead() throws IOException {
|
||||||
|
return owner.root.createRequest()
|
||||||
|
.withPreview(GROOT)
|
||||||
|
.withUrlPath(String.format("/repos/%s/%s/commits/%s/branches-where-head",
|
||||||
|
owner.getOwnerName(),
|
||||||
|
owner.getName(),
|
||||||
|
sha))
|
||||||
|
.toIterable(GHBranch[].class, item -> item.wrap(owner));
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* List comments paged iterable.
|
* List comments paged iterable.
|
||||||
*
|
*
|
||||||
@@ -512,6 +558,19 @@ public class GHCommit {
|
|||||||
return owner.getLastCommitStatus(sha);
|
return owner.getLastCommitStatus(sha);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets check-runs for given sha.
|
||||||
|
*
|
||||||
|
* @return check runs for given sha.
|
||||||
|
* @throws IOException
|
||||||
|
* on error
|
||||||
|
*/
|
||||||
|
@Preview(ANTIOPE)
|
||||||
|
@Deprecated
|
||||||
|
public PagedIterable<GHCheckRun> getCheckRuns() throws IOException {
|
||||||
|
return owner.getCheckRuns(sha);
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Some of the fields are not always filled in when this object is retrieved as a part of another API call.
|
* Some of the fields are not always filled in when this object is retrieved as a part of another API call.
|
||||||
*
|
*
|
||||||
|
|||||||
@@ -89,6 +89,19 @@ public class GHCommitBuilder {
|
|||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Configures the PGP signature of this commit.
|
||||||
|
*
|
||||||
|
* @param signature
|
||||||
|
* the signature calculated from the commit
|
||||||
|
*
|
||||||
|
* @return the gh commit builder
|
||||||
|
*/
|
||||||
|
public GHCommitBuilder withSignature(String signature) {
|
||||||
|
req.with("signature", signature);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Configures the committer of this commit.
|
* Configures the committer of this commit.
|
||||||
*
|
*
|
||||||
|
|||||||
@@ -5,7 +5,7 @@ import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
|||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.*;
|
import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* A comment attached to a commit (or a specific line in a specific file of a commit.)
|
* A comment attached to a commit (or a specific line in a specific file of a commit.)
|
||||||
@@ -41,7 +41,7 @@ public class GHCommitComment extends GHObject implements Reactable {
|
|||||||
* show this commit comment in a browser.
|
* show this commit comment in a browser.
|
||||||
*/
|
*/
|
||||||
public URL getHtmlUrl() {
|
public URL getHtmlUrl() {
|
||||||
return GitHub.parseURL(html_url);
|
return GitHubClient.parseURL(html_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -121,7 +121,7 @@ public class GHCommitComment extends GHObject implements Reactable {
|
|||||||
this.body = body;
|
this.body = body;
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHReaction createReaction(ReactionContent content) throws IOException {
|
public GHReaction createReaction(ReactionContent content) throws IOException {
|
||||||
return owner.root.createRequest()
|
return owner.root.createRequest()
|
||||||
@@ -133,7 +133,7 @@ public class GHCommitComment extends GHObject implements Reactable {
|
|||||||
.wrap(owner.root);
|
.wrap(owner.root);
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public PagedIterable<GHReaction> listReactions() {
|
public PagedIterable<GHReaction> listReactions() {
|
||||||
return owner.root.createRequest()
|
return owner.root.createRequest()
|
||||||
@@ -153,7 +153,7 @@ public class GHCommitComment extends GHObject implements Reactable {
|
|||||||
}
|
}
|
||||||
|
|
||||||
private String getApiTail() {
|
private String getApiTail() {
|
||||||
return String.format("/repos/%s/%s/comments/%s", owner.getOwnerName(), owner.getName(), id);
|
return String.format("/repos/%s/%s/comments/%s", owner.getOwnerName(), owner.getName(), getId());
|
||||||
}
|
}
|
||||||
|
|
||||||
GHCommitComment wrap(GHRepository owner) {
|
GHCommitComment wrap(GHRepository owner) {
|
||||||
|
|||||||
@@ -83,7 +83,7 @@ public class GHCommitQueryBuilder {
|
|||||||
* @return the gh commit query builder
|
* @return the gh commit query builder
|
||||||
*/
|
*/
|
||||||
public GHCommitQueryBuilder since(Date dt) {
|
public GHCommitQueryBuilder since(Date dt) {
|
||||||
req.with("since", GitHub.printDate(dt));
|
req.with("since", GitHubClient.printDate(dt));
|
||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -106,7 +106,7 @@ public class GHCommitQueryBuilder {
|
|||||||
* @return the gh commit query builder
|
* @return the gh commit query builder
|
||||||
*/
|
*/
|
||||||
public GHCommitQueryBuilder until(Date dt) {
|
public GHCommitQueryBuilder until(Date dt) {
|
||||||
req.with("until", GitHub.printDate(dt));
|
req.with("until", GitHubClient.printDate(dt));
|
||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
@@ -1,6 +1,7 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
import org.apache.commons.lang3.StringUtils;
|
import org.apache.commons.lang3.StringUtils;
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
|
|
||||||
@@ -10,7 +11,7 @@ import java.io.IOException;
|
|||||||
* @author Marc de Verdelhan
|
* @author Marc de Verdelhan
|
||||||
* @see GitHub#searchCommits() GitHub#searchCommits()
|
* @see GitHub#searchCommits() GitHub#searchCommits()
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(Previews.CLOAK)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public class GHCommitSearchBuilder extends GHSearchBuilder<GHCommit> {
|
public class GHCommitSearchBuilder extends GHSearchBuilder<GHCommit> {
|
||||||
GHCommitSearchBuilder(GitHub root) {
|
GHCommitSearchBuilder(GitHub root) {
|
||||||
@@ -259,7 +260,7 @@ public class GHCommitSearchBuilder extends GHSearchBuilder<GHCommit> {
|
|||||||
if (StringUtils.isBlank(commitUrl)) {
|
if (StringUtils.isBlank(commitUrl)) {
|
||||||
return null;
|
return null;
|
||||||
}
|
}
|
||||||
int indexOfUsername = (GitHub.GITHUB_URL + "/repos/").length();
|
int indexOfUsername = (GitHubClient.GITHUB_URL + "/repos/").length();
|
||||||
String[] tokens = commitUrl.substring(indexOfUsername).split("/", 3);
|
String[] tokens = commitUrl.substring(indexOfUsername).split("/", 3);
|
||||||
return tokens[0] + '/' + tokens[1];
|
return tokens[0] + '/' + tokens[1];
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -18,8 +18,6 @@ public class GHCommitStatus extends GHObject {
|
|||||||
String context;
|
String context;
|
||||||
GHUser creator;
|
GHUser creator;
|
||||||
|
|
||||||
private GitHub root;
|
|
||||||
|
|
||||||
GHCommitStatus wrapUp(GitHub root) {
|
GHCommitStatus wrapUp(GitHub root) {
|
||||||
if (creator != null)
|
if (creator != null)
|
||||||
creator.wrapUp(root);
|
creator.wrapUp(root);
|
||||||
|
|||||||
@@ -27,7 +27,7 @@ public class GHCompare {
|
|||||||
* @return the url
|
* @return the url
|
||||||
*/
|
*/
|
||||||
public URL getUrl() {
|
public URL getUrl() {
|
||||||
return GitHub.parseURL(url);
|
return GitHubClient.parseURL(url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -36,7 +36,7 @@ public class GHCompare {
|
|||||||
* @return the html url
|
* @return the html url
|
||||||
*/
|
*/
|
||||||
public URL getHtmlUrl() {
|
public URL getHtmlUrl() {
|
||||||
return GitHub.parseURL(html_url);
|
return GitHubClient.parseURL(html_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -45,7 +45,7 @@ public class GHCompare {
|
|||||||
* @return the permalink url
|
* @return the permalink url
|
||||||
*/
|
*/
|
||||||
public URL getPermalinkUrl() {
|
public URL getPermalinkUrl() {
|
||||||
return GitHub.parseURL(permalink_url);
|
return GitHubClient.parseURL(permalink_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -54,7 +54,7 @@ public class GHCompare {
|
|||||||
* @return the diff url
|
* @return the diff url
|
||||||
*/
|
*/
|
||||||
public URL getDiffUrl() {
|
public URL getDiffUrl() {
|
||||||
return GitHub.parseURL(diff_url);
|
return GitHubClient.parseURL(diff_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -63,7 +63,7 @@ public class GHCompare {
|
|||||||
* @return the patch url
|
* @return the patch url
|
||||||
*/
|
*/
|
||||||
public URL getPatchUrl() {
|
public URL getPatchUrl() {
|
||||||
return GitHub.parseURL(patch_url);
|
return GitHubClient.parseURL(patch_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|||||||
@@ -15,21 +15,20 @@ import java.util.Base64;
|
|||||||
* @see GHRepository#getFileContent(String) GHRepository#getFileContent(String)
|
* @see GHRepository#getFileContent(String) GHRepository#getFileContent(String)
|
||||||
*/
|
*/
|
||||||
@SuppressWarnings({ "UnusedDeclaration" })
|
@SuppressWarnings({ "UnusedDeclaration" })
|
||||||
public class GHContent implements Refreshable {
|
public class GHContent extends GitHubInteractiveObject implements Refreshable {
|
||||||
/*
|
/*
|
||||||
* In normal use of this class, repository field is set via wrap(), but in the code search API, there's a nested
|
* In normal use of this class, repository field is set via wrap(), but in the code search API, there's a nested
|
||||||
* 'repository' field that gets populated from JSON.
|
* 'repository' field that gets populated from JSON.
|
||||||
*/
|
*/
|
||||||
private GHRepository repository;
|
private GHRepository repository;
|
||||||
|
|
||||||
private GitHub root;
|
|
||||||
|
|
||||||
private String type;
|
private String type;
|
||||||
private String encoding;
|
private String encoding;
|
||||||
private long size;
|
private long size;
|
||||||
private String sha;
|
private String sha;
|
||||||
private String name;
|
private String name;
|
||||||
private String path;
|
private String path;
|
||||||
|
private String target;
|
||||||
private String content;
|
private String content;
|
||||||
private String url; // this is the API url
|
private String url; // this is the API url
|
||||||
private String git_url; // this is the Blob url
|
private String git_url; // this is the Blob url
|
||||||
@@ -99,6 +98,15 @@ public class GHContent implements Refreshable {
|
|||||||
return path;
|
return path;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets target of a symlink. This will only be set if {@code "symlink".equals(getType())}
|
||||||
|
*
|
||||||
|
* @return the target
|
||||||
|
*/
|
||||||
|
public String getTarget() {
|
||||||
|
return target;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Retrieve the decoded content that is stored at this location.
|
* Retrieve the decoded content that is stored at this location.
|
||||||
*
|
*
|
||||||
@@ -388,22 +396,6 @@ public class GHContent implements Refreshable {
|
|||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
|
||||||
* Wrap gh content [ ].
|
|
||||||
*
|
|
||||||
* @param contents
|
|
||||||
* the contents
|
|
||||||
* @param repository
|
|
||||||
* the repository
|
|
||||||
* @return the gh content [ ]
|
|
||||||
*/
|
|
||||||
public static GHContent[] wrap(GHContent[] contents, GHRepository repository) {
|
|
||||||
for (GHContent unwrappedContent : contents) {
|
|
||||||
unwrappedContent.wrap(repository);
|
|
||||||
}
|
|
||||||
return contents;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Fully populate the data by retrieving missing data.
|
* Fully populate the data by retrieving missing data.
|
||||||
*
|
*
|
||||||
|
|||||||
@@ -1,154 +1,25 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
|
||||||
|
import static org.kohsuke.github.internal.Previews.BAPTISTE;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Creates a repository
|
* Creates a repository
|
||||||
*
|
*
|
||||||
* @author Kohsuke Kawaguchi
|
* @author Kohsuke Kawaguchi
|
||||||
*/
|
*/
|
||||||
public class GHCreateRepositoryBuilder {
|
public class GHCreateRepositoryBuilder extends GHRepositoryBuilder<GHCreateRepositoryBuilder> {
|
||||||
private final GitHub root;
|
|
||||||
protected final Requester builder;
|
|
||||||
private final String apiUrlTail;
|
|
||||||
|
|
||||||
GHCreateRepositoryBuilder(GitHub root, String apiUrlTail, String name) {
|
public GHCreateRepositoryBuilder(String name, GitHub root, String apiTail) {
|
||||||
this.root = root;
|
super(GHCreateRepositoryBuilder.class, root, null);
|
||||||
this.apiUrlTail = apiUrlTail;
|
requester.method("POST").withUrlPath(apiTail);
|
||||||
this.builder = root.createRequest();
|
|
||||||
this.builder.with("name", name);
|
try {
|
||||||
|
name(name);
|
||||||
|
} catch (IOException e) {
|
||||||
|
// not going to happen here
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
|
||||||
* Description for repository
|
|
||||||
*
|
|
||||||
* @param description
|
|
||||||
* description of repository
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder description(String description) {
|
|
||||||
this.builder.with("description", description);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Homepage for repository
|
|
||||||
*
|
|
||||||
* @param homepage
|
|
||||||
* homepage of repository
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder homepage(URL homepage) {
|
|
||||||
return homepage(homepage.toExternalForm());
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Homepage for repository
|
|
||||||
*
|
|
||||||
* @param homepage
|
|
||||||
* homepage of repository
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder homepage(String homepage) {
|
|
||||||
this.builder.with("homepage", homepage);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Creates a private repository
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* private if true
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder private_(boolean enabled) {
|
|
||||||
this.builder.with("private", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Enables issue tracker
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* true if enabled
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder issues(boolean enabled) {
|
|
||||||
this.builder.with("has_issues", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Enables wiki
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* true if enabled
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder wiki(boolean enabled) {
|
|
||||||
this.builder.with("has_wiki", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Enables downloads
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* true if enabled
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder downloads(boolean enabled) {
|
|
||||||
this.builder.with("has_downloads", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* If true, create an initial commit with empty README.
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* true if enabled
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder autoInit(boolean enabled) {
|
|
||||||
this.builder.with("auto_init", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Allow or disallow squash-merging pull requests.
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* true if enabled
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder allowSquashMerge(boolean enabled) {
|
|
||||||
this.builder.with("allow_squash_merge", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Allow or disallow merging pull requests with a merge commit.
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* true if enabled
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder allowMergeCommit(boolean enabled) {
|
|
||||||
this.builder.with("allow_merge_commit", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Allow or disallow rebase-merging pull requests.
|
|
||||||
*
|
|
||||||
* @param enabled
|
|
||||||
* true if enabled
|
|
||||||
* @return a builder to continue with building
|
|
||||||
*/
|
|
||||||
public GHCreateRepositoryBuilder allowRebaseMerge(boolean enabled) {
|
|
||||||
this.builder.with("allow_rebase_merge", enabled);
|
|
||||||
return this;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -157,10 +28,11 @@ public class GHCreateRepositoryBuilder {
|
|||||||
* @param language
|
* @param language
|
||||||
* template to base the ignore file on
|
* template to base the ignore file on
|
||||||
* @return a builder to continue with building See https://developer.github.com/v3/repos/#create
|
* @return a builder to continue with building See https://developer.github.com/v3/repos/#create
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
*/
|
*/
|
||||||
public GHCreateRepositoryBuilder gitignoreTemplate(String language) {
|
public GHCreateRepositoryBuilder gitignoreTemplate(String language) throws IOException {
|
||||||
this.builder.with("gitignore_template", language);
|
return with("gitignore_template", language);
|
||||||
return this;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -169,10 +41,24 @@ public class GHCreateRepositoryBuilder {
|
|||||||
* @param license
|
* @param license
|
||||||
* template to base the license file on
|
* template to base the license file on
|
||||||
* @return a builder to continue with building See https://developer.github.com/v3/repos/#create
|
* @return a builder to continue with building See https://developer.github.com/v3/repos/#create
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
*/
|
*/
|
||||||
public GHCreateRepositoryBuilder licenseTemplate(String license) {
|
public GHCreateRepositoryBuilder licenseTemplate(String license) throws IOException {
|
||||||
this.builder.with("license_template", license);
|
return with("license_template", license);
|
||||||
return this;
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* If true, create an initial commit with empty README.
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
* @return a builder to continue with building
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public GHCreateRepositoryBuilder autoInit(boolean enabled) throws IOException {
|
||||||
|
return with("auto_init", enabled);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -181,10 +67,57 @@ public class GHCreateRepositoryBuilder {
|
|||||||
* @param team
|
* @param team
|
||||||
* team to grant access to
|
* team to grant access to
|
||||||
* @return a builder to continue with building
|
* @return a builder to continue with building
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
*/
|
*/
|
||||||
public GHCreateRepositoryBuilder team(GHTeam team) {
|
public GHCreateRepositoryBuilder team(GHTeam team) throws IOException {
|
||||||
if (team != null)
|
if (team != null)
|
||||||
this.builder.with("team_id", team.getId());
|
return with("team_id", team.getId());
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Specifies whether the repository is a template.
|
||||||
|
*
|
||||||
|
* @param enabled
|
||||||
|
* true if enabled
|
||||||
|
* @return a builder to continue with building
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
* @deprecated Use {@link #isTemplate(boolean)} method instead
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
public GHCreateRepositoryBuilder templateRepository(boolean enabled) throws IOException {
|
||||||
|
return isTemplate(enabled);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Specifies the ownership of the repository.
|
||||||
|
*
|
||||||
|
* @param owner
|
||||||
|
* organization or personage
|
||||||
|
* @return a builder to continue with building
|
||||||
|
* @throws IOException
|
||||||
|
* In case of any networking error or error from the server.
|
||||||
|
*/
|
||||||
|
public GHCreateRepositoryBuilder owner(String owner) throws IOException {
|
||||||
|
return with("owner", owner);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Create repository from template repository
|
||||||
|
*
|
||||||
|
* @param templateOwner
|
||||||
|
* template repository owner
|
||||||
|
* @param templateRepo
|
||||||
|
* template repository
|
||||||
|
* @return a builder to continue with building
|
||||||
|
* @see <a href="https://developer.github.com/v3/previews/">GitHub API Previews</a>
|
||||||
|
*/
|
||||||
|
@Preview(BAPTISTE)
|
||||||
|
@Deprecated
|
||||||
|
public GHCreateRepositoryBuilder fromTemplateRepository(String templateOwner, String templateRepo) {
|
||||||
|
requester.withPreview(BAPTISTE).withUrlPath("/repos/" + templateOwner + "/" + templateRepo + "/generate");
|
||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -193,10 +126,9 @@ public class GHCreateRepositoryBuilder {
|
|||||||
*
|
*
|
||||||
* @return the gh repository
|
* @return the gh repository
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* if repsitory cannot be created
|
* if repository cannot be created
|
||||||
*/
|
*/
|
||||||
public GHRepository create() throws IOException {
|
public GHRepository create() throws IOException {
|
||||||
return builder.method("POST").withUrlPath(apiUrlTail).fetch(GHRepository.class).wrap(root);
|
return done();
|
||||||
}
|
}
|
||||||
|
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -1,7 +1,10 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
|
import java.util.Map;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Represents a deployment
|
* Represents a deployment
|
||||||
@@ -13,7 +16,6 @@ import java.net.URL;
|
|||||||
*/
|
*/
|
||||||
public class GHDeployment extends GHObject {
|
public class GHDeployment extends GHObject {
|
||||||
private GHRepository owner;
|
private GHRepository owner;
|
||||||
private GitHub root;
|
|
||||||
protected String sha;
|
protected String sha;
|
||||||
protected String ref;
|
protected String ref;
|
||||||
protected String task;
|
protected String task;
|
||||||
@@ -23,6 +25,9 @@ public class GHDeployment extends GHObject {
|
|||||||
protected String statuses_url;
|
protected String statuses_url;
|
||||||
protected String repository_url;
|
protected String repository_url;
|
||||||
protected GHUser creator;
|
protected GHUser creator;
|
||||||
|
protected String original_environment;
|
||||||
|
protected boolean transient_environment;
|
||||||
|
protected boolean production_environment;
|
||||||
|
|
||||||
GHDeployment wrap(GHRepository owner) {
|
GHDeployment wrap(GHRepository owner) {
|
||||||
this.owner = owner;
|
this.owner = owner;
|
||||||
@@ -38,7 +43,7 @@ public class GHDeployment extends GHObject {
|
|||||||
* @return the statuses url
|
* @return the statuses url
|
||||||
*/
|
*/
|
||||||
public URL getStatusesUrl() {
|
public URL getStatusesUrl() {
|
||||||
return GitHub.parseURL(statuses_url);
|
return GitHubClient.parseURL(statuses_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -47,7 +52,7 @@ public class GHDeployment extends GHObject {
|
|||||||
* @return the repository url
|
* @return the repository url
|
||||||
*/
|
*/
|
||||||
public URL getRepositoryUrl() {
|
public URL getRepositoryUrl() {
|
||||||
return GitHub.parseURL(repository_url);
|
return GitHubClient.parseURL(repository_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -60,7 +65,8 @@ public class GHDeployment extends GHObject {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets payload.
|
* Gets payload. <b>NOTE:</b> only use this method if you can guarantee the payload will be a simple string,
|
||||||
|
* otherwise use {@link #getPayloadObject()}.
|
||||||
*
|
*
|
||||||
* @return the payload
|
* @return the payload
|
||||||
*/
|
*/
|
||||||
@@ -68,6 +74,38 @@ public class GHDeployment extends GHObject {
|
|||||||
return (String) payload;
|
return (String) payload;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets payload. <b>NOTE:</b> only use this method if you can guarantee the payload will be a JSON object (Map),
|
||||||
|
* otherwise use {@link #getPayloadObject()}.
|
||||||
|
*
|
||||||
|
* @return the payload
|
||||||
|
*/
|
||||||
|
public Map<String, Object> getPayloadMap() {
|
||||||
|
return (Map<String, Object>) payload;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets payload without assuming its type. It could be a String or a Map.
|
||||||
|
*
|
||||||
|
* @return the payload
|
||||||
|
*/
|
||||||
|
public Object getPayloadObject() {
|
||||||
|
return payload;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The environment defined when the deployment was first created.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @return the original deployment environment
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.FLASH)
|
||||||
|
public String getOriginalEnvironment() {
|
||||||
|
return original_environment;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets environment.
|
* Gets environment.
|
||||||
*
|
*
|
||||||
@@ -77,6 +115,33 @@ public class GHDeployment extends GHObject {
|
|||||||
return environment;
|
return environment;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Specifies if the given environment is specific to the deployment and will no longer exist at some point in the
|
||||||
|
* future.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @return the environment is transient
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
public boolean isTransientEnvironment() {
|
||||||
|
return transient_environment;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Specifies if the given environment is one that end-users directly interact with.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @return the environment is used by end-users directly
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
public boolean isProductionEnvironment() {
|
||||||
|
return production_environment;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets creator.
|
* Gets creator.
|
||||||
*
|
*
|
||||||
@@ -122,7 +187,7 @@ public class GHDeployment extends GHObject {
|
|||||||
* @return the gh deployment status builder
|
* @return the gh deployment status builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentStatusBuilder createStatus(GHDeploymentState state) {
|
public GHDeploymentStatusBuilder createStatus(GHDeploymentState state) {
|
||||||
return new GHDeploymentStatusBuilder(owner, id, state);
|
return new GHDeploymentStatusBuilder(owner, getId(), state);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -133,6 +198,8 @@ public class GHDeployment extends GHObject {
|
|||||||
public PagedIterable<GHDeploymentStatus> listStatuses() {
|
public PagedIterable<GHDeploymentStatus> listStatuses() {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
.withUrlPath(statuses_url)
|
.withUrlPath(statuses_url)
|
||||||
|
.withPreview(Previews.ANT_MAN)
|
||||||
|
.withPreview(Previews.FLASH)
|
||||||
.toIterable(GHDeploymentStatus[].class, item -> item.wrap(owner));
|
.toIterable(GHDeploymentStatus[].class, item -> item.wrap(owner));
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
@@ -1,5 +1,7 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
|
|
||||||
@@ -19,7 +21,10 @@ public class GHDeploymentBuilder {
|
|||||||
*/
|
*/
|
||||||
public GHDeploymentBuilder(GHRepository repo) {
|
public GHDeploymentBuilder(GHRepository repo) {
|
||||||
this.repo = repo;
|
this.repo = repo;
|
||||||
this.builder = repo.root.createRequest().method("POST");
|
this.builder = repo.root.createRequest()
|
||||||
|
.withPreview(Previews.ANT_MAN)
|
||||||
|
.withPreview(Previews.FLASH)
|
||||||
|
.method("POST");
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -40,6 +45,7 @@ public class GHDeploymentBuilder {
|
|||||||
*
|
*
|
||||||
* @param branch
|
* @param branch
|
||||||
* the branch
|
* the branch
|
||||||
|
*
|
||||||
* @return the gh deployment builder
|
* @return the gh deployment builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentBuilder ref(String branch) {
|
public GHDeploymentBuilder ref(String branch) {
|
||||||
@@ -52,6 +58,7 @@ public class GHDeploymentBuilder {
|
|||||||
*
|
*
|
||||||
* @param task
|
* @param task
|
||||||
* the task
|
* the task
|
||||||
|
*
|
||||||
* @return the gh deployment builder
|
* @return the gh deployment builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentBuilder task(String task) {
|
public GHDeploymentBuilder task(String task) {
|
||||||
@@ -64,6 +71,7 @@ public class GHDeploymentBuilder {
|
|||||||
*
|
*
|
||||||
* @param autoMerge
|
* @param autoMerge
|
||||||
* the auto merge
|
* the auto merge
|
||||||
|
*
|
||||||
* @return the gh deployment builder
|
* @return the gh deployment builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentBuilder autoMerge(boolean autoMerge) {
|
public GHDeploymentBuilder autoMerge(boolean autoMerge) {
|
||||||
@@ -76,6 +84,7 @@ public class GHDeploymentBuilder {
|
|||||||
*
|
*
|
||||||
* @param requiredContexts
|
* @param requiredContexts
|
||||||
* the required contexts
|
* the required contexts
|
||||||
|
*
|
||||||
* @return the gh deployment builder
|
* @return the gh deployment builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentBuilder requiredContexts(List<String> requiredContexts) {
|
public GHDeploymentBuilder requiredContexts(List<String> requiredContexts) {
|
||||||
@@ -88,6 +97,7 @@ public class GHDeploymentBuilder {
|
|||||||
*
|
*
|
||||||
* @param payload
|
* @param payload
|
||||||
* the payload
|
* the payload
|
||||||
|
*
|
||||||
* @return the gh deployment builder
|
* @return the gh deployment builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentBuilder payload(String payload) {
|
public GHDeploymentBuilder payload(String payload) {
|
||||||
@@ -100,6 +110,7 @@ public class GHDeploymentBuilder {
|
|||||||
*
|
*
|
||||||
* @param environment
|
* @param environment
|
||||||
* the environment
|
* the environment
|
||||||
|
*
|
||||||
* @return the gh deployment builder
|
* @return the gh deployment builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentBuilder environment(String environment) {
|
public GHDeploymentBuilder environment(String environment) {
|
||||||
@@ -107,11 +118,47 @@ public class GHDeploymentBuilder {
|
|||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Specifies if the given environment is specific to the deployment and will no longer exist at some point in the
|
||||||
|
* future.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @param transientEnvironment
|
||||||
|
* the environment is transient
|
||||||
|
*
|
||||||
|
* @return the gh deployment builder
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
public GHDeploymentBuilder transientEnvironment(boolean transientEnvironment) {
|
||||||
|
builder.with("transient_environment", transientEnvironment);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Specifies if the given environment is one that end-users directly interact with.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @param productionEnvironment
|
||||||
|
* the environment is used by end-users directly
|
||||||
|
*
|
||||||
|
* @return the gh deployment builder
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
public GHDeploymentBuilder productionEnvironment(boolean productionEnvironment) {
|
||||||
|
builder.with("production_environment", productionEnvironment);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Description gh deployment builder.
|
* Description gh deployment builder.
|
||||||
*
|
*
|
||||||
* @param description
|
* @param description
|
||||||
* the description
|
* the description
|
||||||
|
*
|
||||||
* @return the gh deployment builder
|
* @return the gh deployment builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentBuilder description(String description) {
|
public GHDeploymentBuilder description(String description) {
|
||||||
@@ -123,6 +170,7 @@ public class GHDeploymentBuilder {
|
|||||||
* Create gh deployment.
|
* Create gh deployment.
|
||||||
*
|
*
|
||||||
* @return the gh deployment
|
* @return the gh deployment
|
||||||
|
*
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
|
|||||||
@@ -1,8 +1,40 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Represents the state of deployment
|
* Represents the state of deployment
|
||||||
*/
|
*/
|
||||||
public enum GHDeploymentState {
|
public enum GHDeploymentState {
|
||||||
PENDING, SUCCESS, ERROR, FAILURE
|
PENDING,
|
||||||
|
SUCCESS,
|
||||||
|
ERROR,
|
||||||
|
FAILURE,
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The state of the deployment currently reflects it's in progress.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.FLASH)
|
||||||
|
IN_PROGRESS,
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The state of the deployment currently reflects it's queued up for processing.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.FLASH)
|
||||||
|
QUEUED,
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The state of the deployment currently reflects it's no longer active.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
INACTIVE
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -1,5 +1,7 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
import java.util.Locale;
|
import java.util.Locale;
|
||||||
|
|
||||||
@@ -8,19 +10,21 @@ import java.util.Locale;
|
|||||||
*/
|
*/
|
||||||
public class GHDeploymentStatus extends GHObject {
|
public class GHDeploymentStatus extends GHObject {
|
||||||
private GHRepository owner;
|
private GHRepository owner;
|
||||||
private GitHub root;
|
|
||||||
protected GHUser creator;
|
protected GHUser creator;
|
||||||
protected String state;
|
protected String state;
|
||||||
protected String description;
|
protected String description;
|
||||||
protected String target_url;
|
protected String target_url;
|
||||||
|
protected String log_url;
|
||||||
protected String deployment_url;
|
protected String deployment_url;
|
||||||
protected String repository_url;
|
protected String repository_url;
|
||||||
|
protected String environment_url;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Wrap gh deployment status.
|
* Wrap gh deployment status.
|
||||||
*
|
*
|
||||||
* @param owner
|
* @param owner
|
||||||
* the owner
|
* the owner
|
||||||
|
*
|
||||||
* @return the gh deployment status
|
* @return the gh deployment status
|
||||||
*/
|
*/
|
||||||
public GHDeploymentStatus wrap(GHRepository owner) {
|
public GHDeploymentStatus wrap(GHRepository owner) {
|
||||||
@@ -34,10 +38,28 @@ public class GHDeploymentStatus extends GHObject {
|
|||||||
/**
|
/**
|
||||||
* Gets target url.
|
* Gets target url.
|
||||||
*
|
*
|
||||||
|
* @deprecated Target url is deprecated in favor of {@link #getLogUrl() getLogUrl}
|
||||||
|
*
|
||||||
* @return the target url
|
* @return the target url
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public URL getTargetUrl() {
|
public URL getTargetUrl() {
|
||||||
return GitHub.parseURL(target_url);
|
return GitHubClient.parseURL(target_url);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets target url.
|
||||||
|
* <p>
|
||||||
|
* This method replaces {@link #getTargetUrl() getTargetUrl}}.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @return the target url
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
public URL getLogUrl() {
|
||||||
|
return GitHubClient.parseURL(log_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -46,7 +68,20 @@ public class GHDeploymentStatus extends GHObject {
|
|||||||
* @return the deployment url
|
* @return the deployment url
|
||||||
*/
|
*/
|
||||||
public URL getDeploymentUrl() {
|
public URL getDeploymentUrl() {
|
||||||
return GitHub.parseURL(deployment_url);
|
return GitHubClient.parseURL(deployment_url);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets deployment environment url.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @return the deployment environment url
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
public URL getEnvironmentUrl() {
|
||||||
|
return GitHubClient.parseURL(environment_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -55,7 +90,7 @@ public class GHDeploymentStatus extends GHObject {
|
|||||||
* @return the repository url
|
* @return the repository url
|
||||||
*/
|
*/
|
||||||
public URL getRepositoryUrl() {
|
public URL getRepositoryUrl() {
|
||||||
return GitHub.parseURL(repository_url);
|
return GitHubClient.parseURL(repository_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|||||||
@@ -1,5 +1,7 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -21,8 +23,10 @@ public class GHDeploymentStatusBuilder {
|
|||||||
* the deployment id
|
* the deployment id
|
||||||
* @param state
|
* @param state
|
||||||
* the state
|
* the state
|
||||||
|
*
|
||||||
* @deprecated Use {@link GHDeployment#createStatus(GHDeploymentState)}
|
* @deprecated Use {@link GHDeployment#createStatus(GHDeploymentState)}
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public GHDeploymentStatusBuilder(GHRepository repo, int deploymentId, GHDeploymentState state) {
|
public GHDeploymentStatusBuilder(GHRepository repo, int deploymentId, GHDeploymentState state) {
|
||||||
this(repo, (long) deploymentId, state);
|
this(repo, (long) deploymentId, state);
|
||||||
}
|
}
|
||||||
@@ -30,15 +34,38 @@ public class GHDeploymentStatusBuilder {
|
|||||||
GHDeploymentStatusBuilder(GHRepository repo, long deploymentId, GHDeploymentState state) {
|
GHDeploymentStatusBuilder(GHRepository repo, long deploymentId, GHDeploymentState state) {
|
||||||
this.repo = repo;
|
this.repo = repo;
|
||||||
this.deploymentId = deploymentId;
|
this.deploymentId = deploymentId;
|
||||||
this.builder = repo.root.createRequest().method("POST");
|
this.builder = repo.root.createRequest()
|
||||||
|
.withPreview(Previews.ANT_MAN)
|
||||||
|
.withPreview(Previews.FLASH)
|
||||||
|
.method("POST");
|
||||||
|
|
||||||
this.builder.with("state", state);
|
this.builder.with("state", state);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Add an inactive status to all prior non-transient, non-production environment deployments with the same
|
||||||
|
* repository and environment name as the created status's deployment.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @param autoInactive
|
||||||
|
* Add inactive status flag
|
||||||
|
*
|
||||||
|
* @return the gh deployment status builder
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview({ Previews.ANT_MAN, Previews.FLASH })
|
||||||
|
public GHDeploymentStatusBuilder autoInactive(boolean autoInactive) {
|
||||||
|
this.builder.with("auto_inactive", autoInactive);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Description gh deployment status builder.
|
* Description gh deployment status builder.
|
||||||
*
|
*
|
||||||
* @param description
|
* @param description
|
||||||
* the description
|
* the description
|
||||||
|
*
|
||||||
* @return the gh deployment status builder
|
* @return the gh deployment status builder
|
||||||
*/
|
*/
|
||||||
public GHDeploymentStatusBuilder description(String description) {
|
public GHDeploymentStatusBuilder description(String description) {
|
||||||
@@ -46,13 +73,70 @@ public class GHDeploymentStatusBuilder {
|
|||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Name for the target deployment environment, which can be changed when setting a deploy status.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @param environment
|
||||||
|
* the environment name
|
||||||
|
*
|
||||||
|
* @return the gh deployment status builder
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.FLASH)
|
||||||
|
public GHDeploymentStatusBuilder environment(String environment) {
|
||||||
|
this.builder.with("environment", environment);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The URL for accessing the environment
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @param environmentUrl
|
||||||
|
* the environment url
|
||||||
|
*
|
||||||
|
* @return the gh deployment status builder
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
public GHDeploymentStatusBuilder environmentUrl(String environmentUrl) {
|
||||||
|
this.builder.with("environment_url", environmentUrl);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The full URL of the deployment's output.
|
||||||
|
* <p>
|
||||||
|
* This method replaces {@link #targetUrl(String) targetUrl}.
|
||||||
|
*
|
||||||
|
* @deprecated until preview feature has graduated to stable
|
||||||
|
*
|
||||||
|
* @param logUrl
|
||||||
|
* the deployment output url
|
||||||
|
*
|
||||||
|
* @return the gh deployment status builder
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Preview(Previews.ANT_MAN)
|
||||||
|
public GHDeploymentStatusBuilder logUrl(String logUrl) {
|
||||||
|
this.builder.with("log_url", logUrl);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Target url gh deployment status builder.
|
* Target url gh deployment status builder.
|
||||||
*
|
*
|
||||||
|
* @deprecated Target url is deprecated in favor of {@link #logUrl(String) logUrl}
|
||||||
|
*
|
||||||
* @param targetUrl
|
* @param targetUrl
|
||||||
* the target url
|
* the target url
|
||||||
|
*
|
||||||
* @return the gh deployment status builder
|
* @return the gh deployment status builder
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public GHDeploymentStatusBuilder targetUrl(String targetUrl) {
|
public GHDeploymentStatusBuilder targetUrl(String targetUrl) {
|
||||||
this.builder.with("target_url", targetUrl);
|
this.builder.with("target_url", targetUrl);
|
||||||
return this;
|
return this;
|
||||||
@@ -62,6 +146,7 @@ public class GHDeploymentStatusBuilder {
|
|||||||
* Create gh deployment status.
|
* Create gh deployment status.
|
||||||
*
|
*
|
||||||
* @return the gh deployment status
|
* @return the gh deployment status
|
||||||
|
*
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
|
|||||||
230
src/main/java/org/kohsuke/github/GHDiscussion.java
Normal file
230
src/main/java/org/kohsuke/github/GHDiscussion.java
Normal file
@@ -0,0 +1,230 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||||
|
import org.kohsuke.github.internal.Previews;
|
||||||
|
|
||||||
|
import java.io.IOException;
|
||||||
|
import java.net.URL;
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
|
import javax.annotation.CheckForNull;
|
||||||
|
import javax.annotation.Nonnull;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A discussion in GitHub Team.
|
||||||
|
*
|
||||||
|
* @author Charles Moulliard
|
||||||
|
* @see <a href="https://developer.github.com/v3/teams/discussions">GitHub Team Discussions</a>
|
||||||
|
*/
|
||||||
|
public class GHDiscussion extends GHObject {
|
||||||
|
|
||||||
|
private GHTeam team;
|
||||||
|
private long number;
|
||||||
|
private String body, title, htmlUrl;
|
||||||
|
|
||||||
|
@JsonProperty(value = "private")
|
||||||
|
private boolean isPrivate;
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public URL getHtmlUrl() throws IOException {
|
||||||
|
return GitHubClient.parseURL(htmlUrl);
|
||||||
|
}
|
||||||
|
|
||||||
|
GHDiscussion wrapUp(GHTeam team) {
|
||||||
|
this.team = team;
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get the team to which this discussion belongs.
|
||||||
|
*
|
||||||
|
* @return the team for this discussion
|
||||||
|
*/
|
||||||
|
@Nonnull
|
||||||
|
public GHTeam getTeam() {
|
||||||
|
return team;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get the title of the discussion.
|
||||||
|
*
|
||||||
|
* @return the title
|
||||||
|
*/
|
||||||
|
public String getTitle() {
|
||||||
|
return title;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The description of this discussion.
|
||||||
|
*
|
||||||
|
* @return the body
|
||||||
|
*/
|
||||||
|
public String getBody() {
|
||||||
|
return body;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The number of this discussion.
|
||||||
|
*
|
||||||
|
* @return the number
|
||||||
|
*/
|
||||||
|
public long getNumber() {
|
||||||
|
return number;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The id number of this discussion. GitHub discussions have "number" instead of "id". This is provided for
|
||||||
|
* convenience.
|
||||||
|
*
|
||||||
|
* @return the id number for this discussion
|
||||||
|
* @see #getNumber()
|
||||||
|
*/
|
||||||
|
@Override
|
||||||
|
public long getId() {
|
||||||
|
return getNumber();
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Whether the discussion is private to the team.
|
||||||
|
*
|
||||||
|
* @return {@code true} if discussion is private.
|
||||||
|
*/
|
||||||
|
public boolean isPrivate() {
|
||||||
|
return isPrivate;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Begins the creation of a new instance.
|
||||||
|
*
|
||||||
|
* Consumer must call {@link GHDiscussion.Creator#done()} to commit changes.
|
||||||
|
*
|
||||||
|
* @param team
|
||||||
|
* the team in which the discussion will be created.
|
||||||
|
* @return a {@link GHLabel.Creator}
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
static GHDiscussion.Creator create(GHTeam team) throws IOException {
|
||||||
|
return new GHDiscussion.Creator(team);
|
||||||
|
}
|
||||||
|
|
||||||
|
static GHDiscussion read(GHTeam team, long discussionNumber) throws IOException {
|
||||||
|
return team.root.createRequest()
|
||||||
|
.setRawUrlPath(getRawUrlPath(team, discussionNumber))
|
||||||
|
.fetch(GHDiscussion.class)
|
||||||
|
.wrapUp(team);
|
||||||
|
}
|
||||||
|
|
||||||
|
static PagedIterable<GHDiscussion> readAll(GHTeam team) throws IOException {
|
||||||
|
return team.root.createRequest()
|
||||||
|
.setRawUrlPath(getRawUrlPath(team, null))
|
||||||
|
.toIterable(GHDiscussion[].class, item -> item.wrapUp(team));
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Begins a batch update
|
||||||
|
*
|
||||||
|
* Consumer must call {@link GHDiscussion.Updater#done()} to commit changes.
|
||||||
|
*
|
||||||
|
* @return a {@link GHDiscussion.Updater}
|
||||||
|
*/
|
||||||
|
@Preview(Previews.SQUIRREL_GIRL)
|
||||||
|
@Deprecated
|
||||||
|
public GHDiscussion.Updater update() {
|
||||||
|
return new GHDiscussion.Updater(this);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Begins a single property update.
|
||||||
|
*
|
||||||
|
* @return a {@link GHDiscussion.Setter}
|
||||||
|
*/
|
||||||
|
@Preview(Previews.SQUIRREL_GIRL)
|
||||||
|
@Deprecated
|
||||||
|
public GHDiscussion.Setter set() {
|
||||||
|
return new GHDiscussion.Setter(this);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Delete the discussion
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public void delete() throws IOException {
|
||||||
|
team.root.createRequest().method("DELETE").setRawUrlPath(getRawUrlPath(team, number)).send();
|
||||||
|
}
|
||||||
|
|
||||||
|
private static String getRawUrlPath(@Nonnull GHTeam team, @CheckForNull Long discussionNumber) {
|
||||||
|
return team.getUrl().toString() + "/discussions" + (discussionNumber == null ? "" : "/" + discussionNumber);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A {@link GHLabelBuilder} that updates a single property per request
|
||||||
|
*
|
||||||
|
* {@link #done()} is called automatically after the property is set.
|
||||||
|
*/
|
||||||
|
public static class Setter extends GHDiscussionBuilder<GHDiscussion> {
|
||||||
|
private Setter(@Nonnull GHDiscussion base) {
|
||||||
|
super(GHDiscussion.class, base.team, base);
|
||||||
|
requester.method("PATCH").setRawUrlPath(base.getUrl().toString());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A {@link GHLabelBuilder} that allows multiple properties to be updated per request.
|
||||||
|
*
|
||||||
|
* Consumer must call {@link #done()} to commit changes.
|
||||||
|
*/
|
||||||
|
public static class Updater extends GHDiscussionBuilder<Updater> {
|
||||||
|
private Updater(@Nonnull GHDiscussion base) {
|
||||||
|
super(GHDiscussion.Updater.class, base.team, base);
|
||||||
|
requester.method("PATCH").setRawUrlPath(base.getUrl().toString());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A {@link GHLabelBuilder} that creates a new {@link GHLabel}
|
||||||
|
*
|
||||||
|
* Consumer must call {@link #done()} to create the new instance.
|
||||||
|
*/
|
||||||
|
public static class Creator extends GHDiscussionBuilder<Creator> {
|
||||||
|
|
||||||
|
private Creator(@Nonnull GHTeam team) {
|
||||||
|
super(GHDiscussion.Creator.class, team, null);
|
||||||
|
requester.method("POST").setRawUrlPath(getRawUrlPath(team, null));
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Sets whether this discussion is private to this team.
|
||||||
|
*
|
||||||
|
* @param value
|
||||||
|
* privacy of this discussion
|
||||||
|
* @return either a continuing builder or an updated {@link GHDiscussion}
|
||||||
|
* @throws IOException
|
||||||
|
* if there is an I/O Exception
|
||||||
|
*/
|
||||||
|
@Nonnull
|
||||||
|
public Creator private_(boolean value) throws IOException {
|
||||||
|
return with("private", value);
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public boolean equals(Object o) {
|
||||||
|
if (this == o) {
|
||||||
|
return true;
|
||||||
|
}
|
||||||
|
if (o == null || getClass() != o.getClass()) {
|
||||||
|
return false;
|
||||||
|
}
|
||||||
|
GHDiscussion that = (GHDiscussion) o;
|
||||||
|
return number == that.number && Objects.equals(getUrl(), that.getUrl()) && Objects.equals(team, that.team)
|
||||||
|
&& Objects.equals(body, that.body) && Objects.equals(title, that.title);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Override
|
||||||
|
public int hashCode() {
|
||||||
|
return Objects.hash(team, number, body, title);
|
||||||
|
}
|
||||||
|
}
|
||||||
80
src/main/java/org/kohsuke/github/GHDiscussionBuilder.java
Normal file
80
src/main/java/org/kohsuke/github/GHDiscussionBuilder.java
Normal file
@@ -0,0 +1,80 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import java.io.IOException;
|
||||||
|
|
||||||
|
import javax.annotation.CheckForNull;
|
||||||
|
import javax.annotation.Nonnull;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Base class for creating or updating a discussion.
|
||||||
|
*
|
||||||
|
* @param <S>
|
||||||
|
* Intermediate return type for this builder returned by calls to {@link #with(String, Object)}. If {@link S}
|
||||||
|
* the same as {@link GHLabel}, this builder will commit changes after each call to
|
||||||
|
* {@link #with(String, Object)}.
|
||||||
|
*/
|
||||||
|
class GHDiscussionBuilder<S> extends AbstractBuilder<GHDiscussion, S> {
|
||||||
|
|
||||||
|
private final GHTeam team;
|
||||||
|
|
||||||
|
/**
|
||||||
|
*
|
||||||
|
* @param intermediateReturnType
|
||||||
|
* Intermediate return type for this builder returned by calls to {@link #with(String, Object)}. If
|
||||||
|
* {@link S} the same as {@link GHDiscussion}, this builder will commit changes after each call to
|
||||||
|
* {@link #with(String, Object)}.
|
||||||
|
* @param team
|
||||||
|
* the GitHub team. Updates will be sent to the root of this team.
|
||||||
|
* @param baseInstance
|
||||||
|
* instance on which to base this builder. If {@code null} a new instance will be created.
|
||||||
|
*/
|
||||||
|
protected GHDiscussionBuilder(@Nonnull Class<S> intermediateReturnType,
|
||||||
|
@Nonnull GHTeam team,
|
||||||
|
@CheckForNull GHDiscussion baseInstance) {
|
||||||
|
super(GHDiscussion.class, intermediateReturnType, team.root, baseInstance);
|
||||||
|
|
||||||
|
this.team = team;
|
||||||
|
|
||||||
|
if (baseInstance != null) {
|
||||||
|
requester.with("title", baseInstance.getTitle());
|
||||||
|
requester.with("body", baseInstance.getBody());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Title for this discussion.
|
||||||
|
*
|
||||||
|
* @param value
|
||||||
|
* title of discussion
|
||||||
|
* @return either a continuing builder or an updated {@link GHDiscussion}
|
||||||
|
* @throws IOException
|
||||||
|
* if there is an I/O Exception
|
||||||
|
*/
|
||||||
|
@Nonnull
|
||||||
|
public S title(String value) throws IOException {
|
||||||
|
return with("title", value);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Body content for this discussion.
|
||||||
|
*
|
||||||
|
* @param value
|
||||||
|
* body of discussion*
|
||||||
|
* @return either a continuing builder or an updated {@link GHDiscussion}
|
||||||
|
* @throws IOException
|
||||||
|
* if there is an I/O Exception
|
||||||
|
*/
|
||||||
|
@Nonnull
|
||||||
|
public S body(String value) throws IOException {
|
||||||
|
return with("body", value);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* {@inheritDoc}
|
||||||
|
*/
|
||||||
|
@Nonnull
|
||||||
|
@Override
|
||||||
|
public GHDiscussion done() throws IOException {
|
||||||
|
return super.done().wrapUp(team);
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -12,6 +12,7 @@ import java.util.Locale;
|
|||||||
public enum GHEvent {
|
public enum GHEvent {
|
||||||
CHECK_RUN,
|
CHECK_RUN,
|
||||||
CHECK_SUITE,
|
CHECK_SUITE,
|
||||||
|
CODE_SCANNING_ALERT,
|
||||||
COMMIT_COMMENT,
|
COMMIT_COMMENT,
|
||||||
CONTENT_REFERENCE,
|
CONTENT_REFERENCE,
|
||||||
CREATE,
|
CREATE,
|
||||||
@@ -50,6 +51,7 @@ public enum GHEvent {
|
|||||||
PULL_REQUEST_REVIEW,
|
PULL_REQUEST_REVIEW,
|
||||||
PULL_REQUEST_REVIEW_COMMENT,
|
PULL_REQUEST_REVIEW_COMMENT,
|
||||||
PUSH,
|
PUSH,
|
||||||
|
REGISTRY_PACKAGE,
|
||||||
RELEASE,
|
RELEASE,
|
||||||
REPOSITORY_DISPATCH, // only valid for org hooks
|
REPOSITORY_DISPATCH, // only valid for org hooks
|
||||||
REPOSITORY,
|
REPOSITORY,
|
||||||
@@ -61,6 +63,8 @@ public enum GHEvent {
|
|||||||
TEAM,
|
TEAM,
|
||||||
TEAM_ADD,
|
TEAM_ADD,
|
||||||
WATCH,
|
WATCH,
|
||||||
|
WORKFLOW_DISPATCH,
|
||||||
|
WORKFLOW_RUN,
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Special event type that means "every possible event"
|
* Special event type that means "every possible event"
|
||||||
|
|||||||
@@ -12,9 +12,7 @@ import java.util.Date;
|
|||||||
* @author Kohsuke Kawaguchi
|
* @author Kohsuke Kawaguchi
|
||||||
*/
|
*/
|
||||||
@SuppressFBWarnings(value = "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", justification = "JSON API")
|
@SuppressFBWarnings(value = "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", justification = "JSON API")
|
||||||
public class GHEventInfo {
|
public class GHEventInfo extends GitHubInteractiveObject {
|
||||||
private GitHub root;
|
|
||||||
|
|
||||||
// we don't want to expose Jackson dependency to the user. This needs databinding
|
// we don't want to expose Jackson dependency to the user. This needs databinding
|
||||||
private ObjectNode payload;
|
private ObjectNode payload;
|
||||||
|
|
||||||
@@ -78,7 +76,7 @@ public class GHEventInfo {
|
|||||||
* @return the created at
|
* @return the created at
|
||||||
*/
|
*/
|
||||||
public Date getCreatedAt() {
|
public Date getCreatedAt() {
|
||||||
return GitHub.parseDate(created_at);
|
return GitHubClient.parseDate(created_at);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -144,7 +142,7 @@ public class GHEventInfo {
|
|||||||
* if payload cannot be parsed
|
* if payload cannot be parsed
|
||||||
*/
|
*/
|
||||||
public <T extends GHEventPayload> T getPayload(Class<T> type) throws IOException {
|
public <T extends GHEventPayload> T getPayload(Class<T> type) throws IOException {
|
||||||
T v = GitHub.MAPPER.readValue(payload.traverse(), type);
|
T v = GitHubClient.getMappingObjectReader(root).readValue(payload.traverse(), type);
|
||||||
v.wrapUp(root);
|
v.wrapUp(root);
|
||||||
return v;
|
return v;
|
||||||
}
|
}
|
||||||
|
|||||||
File diff suppressed because it is too large
Load Diff
@@ -1,11 +1,11 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
import java.io.FileNotFoundException;
|
import java.io.FileNotFoundException;
|
||||||
import java.net.HttpURLConnection;
|
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
import java.util.Map;
|
import java.util.Map;
|
||||||
|
|
||||||
import javax.annotation.CheckForNull;
|
import javax.annotation.CheckForNull;
|
||||||
|
import javax.annotation.Nonnull;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Request/responce contains useful metadata. Custom exception allows store info for next diagnostics.
|
* Request/responce contains useful metadata. Custom exception allows store info for next diagnostics.
|
||||||
@@ -24,11 +24,24 @@ public class GHFileNotFoundException extends FileNotFoundException {
|
|||||||
/**
|
/**
|
||||||
* Instantiates a new Gh file not found exception.
|
* Instantiates a new Gh file not found exception.
|
||||||
*
|
*
|
||||||
* @param s
|
* @param message
|
||||||
* the s
|
* the message
|
||||||
*/
|
*/
|
||||||
public GHFileNotFoundException(String s) {
|
public GHFileNotFoundException(String message) {
|
||||||
super(s);
|
super(message);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Instantiates a new Gh file not found exception.
|
||||||
|
*
|
||||||
|
* @param message
|
||||||
|
* the message
|
||||||
|
* @param cause
|
||||||
|
* the cause
|
||||||
|
*/
|
||||||
|
public GHFileNotFoundException(String message, Throwable cause) {
|
||||||
|
super(message);
|
||||||
|
this.initCause(cause);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -41,8 +54,8 @@ public class GHFileNotFoundException extends FileNotFoundException {
|
|||||||
return responseHeaderFields;
|
return responseHeaderFields;
|
||||||
}
|
}
|
||||||
|
|
||||||
GHFileNotFoundException withResponseHeaderFields(HttpURLConnection urlConnection) {
|
GHFileNotFoundException withResponseHeaderFields(@Nonnull Map<String, List<String>> headerFields) {
|
||||||
this.responseHeaderFields = urlConnection.getHeaderFields();
|
this.responseHeaderFields = headerFields;
|
||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -1,12 +1,13 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import com.fasterxml.jackson.annotation.JacksonInject;
|
||||||
|
import com.fasterxml.jackson.annotation.JsonCreator;
|
||||||
import com.fasterxml.jackson.annotation.JsonProperty;
|
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||||
import org.apache.commons.lang3.StringUtils;
|
import org.apache.commons.lang3.StringUtils;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
import java.util.Collections;
|
import java.util.Collections;
|
||||||
import java.util.HashMap;
|
|
||||||
import java.util.Map;
|
import java.util.Map;
|
||||||
import java.util.Map.Entry;
|
import java.util.Map.Entry;
|
||||||
|
|
||||||
@@ -20,8 +21,8 @@ import java.util.Map.Entry;
|
|||||||
* @see <a href="https://developer.github.com/v3/gists/">documentation</a>
|
* @see <a href="https://developer.github.com/v3/gists/">documentation</a>
|
||||||
*/
|
*/
|
||||||
public class GHGist extends GHObject {
|
public class GHGist extends GHObject {
|
||||||
/* package almost final */ GHUser owner;
|
|
||||||
/* package almost final */ GitHub root;
|
final GHUser owner;
|
||||||
|
|
||||||
private String forks_url, commits_url, id, git_pull_url, git_push_url, html_url;
|
private String forks_url, commits_url, id, git_pull_url, git_push_url, html_url;
|
||||||
|
|
||||||
@@ -34,7 +35,43 @@ public class GHGist extends GHObject {
|
|||||||
|
|
||||||
private String comments_url;
|
private String comments_url;
|
||||||
|
|
||||||
private Map<String, GHGistFile> files = new HashMap<String, GHGistFile>();
|
private final Map<String, GHGistFile> files;
|
||||||
|
|
||||||
|
@JsonCreator
|
||||||
|
private GHGist(@JacksonInject GitHub root,
|
||||||
|
@JsonProperty("owner") GHUser owner,
|
||||||
|
@JsonProperty("files") Map<String, GHGistFile> files) {
|
||||||
|
this.root = root;
|
||||||
|
for (Entry<String, GHGistFile> e : files.entrySet()) {
|
||||||
|
e.getValue().fileName = e.getKey();
|
||||||
|
}
|
||||||
|
this.files = Collections.unmodifiableMap(files);
|
||||||
|
this.owner = root.getUser(owner);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Unlike most other GitHub objects, the id for Gists can be non-numeric, such as "aa5a315d61ae9438b18d". If the id
|
||||||
|
* is numeric, this method will get it. If id is not numeric, this will throw a runtime
|
||||||
|
* {@link NumberFormatException}.
|
||||||
|
*
|
||||||
|
* @return id of the Gist.
|
||||||
|
* @deprecated Use {@link #getGistId()} instead.
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
@Override
|
||||||
|
public long getId() {
|
||||||
|
return Long.parseLong(getGistId());
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the id for this Gist. Unlike most other GitHub objects, the id for Gists can be non-numeric, such as
|
||||||
|
* "aa5a315d61ae9438b18d". This should be used instead of {@link #getId()}.
|
||||||
|
*
|
||||||
|
* @return id of this Gist
|
||||||
|
*/
|
||||||
|
public String getGistId() {
|
||||||
|
return this.id;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets owner.
|
* Gets owner.
|
||||||
@@ -44,7 +81,7 @@ public class GHGist extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public GHUser getOwner() throws IOException {
|
public GHUser getOwner() throws IOException {
|
||||||
return root.intern(owner);
|
return owner;
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -83,8 +120,13 @@ public class GHGist extends GHObject {
|
|||||||
return git_push_url;
|
return git_push_url;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get the html url.
|
||||||
|
*
|
||||||
|
* @return the github html url
|
||||||
|
*/
|
||||||
public URL getHtmlUrl() {
|
public URL getHtmlUrl() {
|
||||||
return GitHub.parseURL(html_url);
|
return GitHubClient.parseURL(html_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -140,31 +182,7 @@ public class GHGist extends GHObject {
|
|||||||
* @return the files
|
* @return the files
|
||||||
*/
|
*/
|
||||||
public Map<String, GHGistFile> getFiles() {
|
public Map<String, GHGistFile> getFiles() {
|
||||||
return Collections.unmodifiableMap(files);
|
return files;
|
||||||
}
|
|
||||||
|
|
||||||
GHGist wrapUp(GHUser owner) {
|
|
||||||
this.owner = owner;
|
|
||||||
this.root = owner.root;
|
|
||||||
wrapUp();
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
|
||||||
* Used when caller obtains {@link GHGist} without knowing its owner. A partially constructed owner object is
|
|
||||||
* interned.
|
|
||||||
*/
|
|
||||||
GHGist wrapUp(GitHub root) {
|
|
||||||
this.owner = root.getUser(owner);
|
|
||||||
this.root = root;
|
|
||||||
wrapUp();
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
private void wrapUp() {
|
|
||||||
for (Entry<String, GHGistFile> e : files.entrySet()) {
|
|
||||||
e.getValue().fileName = e.getKey();
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
|
|
||||||
String getApiTailUrl(String tail) {
|
String getApiTailUrl(String tail) {
|
||||||
@@ -214,7 +232,7 @@ public class GHGist extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public GHGist fork() throws IOException {
|
public GHGist fork() throws IOException {
|
||||||
return root.createRequest().method("POST").withUrlPath(getApiTailUrl("forks")).fetch(GHGist.class).wrapUp(root);
|
return root.createRequest().method("POST").withUrlPath(getApiTailUrl("forks")).fetch(GHGist.class);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -223,9 +241,7 @@ public class GHGist extends GHObject {
|
|||||||
* @return the paged iterable
|
* @return the paged iterable
|
||||||
*/
|
*/
|
||||||
public PagedIterable<GHGist> listForks() {
|
public PagedIterable<GHGist> listForks() {
|
||||||
return root.createRequest()
|
return root.createRequest().withUrlPath(getApiTailUrl("forks")).toIterable(GHGist[].class, null);
|
||||||
.withUrlPath(getApiTailUrl("forks"))
|
|
||||||
.toIterable(GHGist[].class, item -> item.wrapUp(root));
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -264,10 +280,4 @@ public class GHGist extends GHObject {
|
|||||||
public int hashCode() {
|
public int hashCode() {
|
||||||
return id.hashCode();
|
return id.hashCode();
|
||||||
}
|
}
|
||||||
|
|
||||||
GHGist wrap(GHUser owner) {
|
|
||||||
this.owner = owner;
|
|
||||||
this.root = owner.root;
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -4,6 +4,8 @@ import java.io.IOException;
|
|||||||
import java.util.Collections;
|
import java.util.Collections;
|
||||||
import java.util.LinkedHashMap;
|
import java.util.LinkedHashMap;
|
||||||
|
|
||||||
|
import javax.annotation.Nonnull;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Builder pattern for creating a new Gist.
|
* Builder pattern for creating a new Gist.
|
||||||
*
|
*
|
||||||
@@ -11,7 +13,6 @@ import java.util.LinkedHashMap;
|
|||||||
* @see GitHub#createGist() GitHub#createGist()
|
* @see GitHub#createGist() GitHub#createGist()
|
||||||
*/
|
*/
|
||||||
public class GHGistBuilder {
|
public class GHGistBuilder {
|
||||||
private final GitHub root;
|
|
||||||
private final Requester req;
|
private final Requester req;
|
||||||
private final LinkedHashMap<String, Object> files = new LinkedHashMap<String, Object>();
|
private final LinkedHashMap<String, Object> files = new LinkedHashMap<String, Object>();
|
||||||
|
|
||||||
@@ -22,7 +23,6 @@ public class GHGistBuilder {
|
|||||||
* the root
|
* the root
|
||||||
*/
|
*/
|
||||||
public GHGistBuilder(GitHub root) {
|
public GHGistBuilder(GitHub root) {
|
||||||
this.root = root;
|
|
||||||
req = root.createRequest().method("POST");
|
req = root.createRequest().method("POST");
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -59,7 +59,7 @@ public class GHGistBuilder {
|
|||||||
* the content
|
* the content
|
||||||
* @return Adds a new file.
|
* @return Adds a new file.
|
||||||
*/
|
*/
|
||||||
public GHGistBuilder file(String fileName, String content) {
|
public GHGistBuilder file(@Nonnull String fileName, @Nonnull String content) {
|
||||||
files.put(fileName, Collections.singletonMap("content", content));
|
files.put(fileName, Collections.singletonMap("content", content));
|
||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
@@ -73,6 +73,6 @@ public class GHGistBuilder {
|
|||||||
*/
|
*/
|
||||||
public GHGist create() throws IOException {
|
public GHGist create() throws IOException {
|
||||||
req.with("files", files);
|
req.with("files", files);
|
||||||
return req.withUrlPath("/gists").fetch(GHGist.class).wrapUp(root);
|
return req.withUrlPath("/gists").fetch(GHGist.class);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -1,8 +1,11 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.util.Collections;
|
import java.util.HashMap;
|
||||||
import java.util.LinkedHashMap;
|
import java.util.LinkedHashMap;
|
||||||
|
import java.util.Map;
|
||||||
|
|
||||||
|
import javax.annotation.Nonnull;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Builder pattern for updating a Gist.
|
* Builder pattern for updating a Gist.
|
||||||
@@ -12,7 +15,7 @@ import java.util.LinkedHashMap;
|
|||||||
public class GHGistUpdater {
|
public class GHGistUpdater {
|
||||||
private final GHGist base;
|
private final GHGist base;
|
||||||
private final Requester builder;
|
private final Requester builder;
|
||||||
LinkedHashMap<String, Object> files;
|
LinkedHashMap<String, Map<String, String>> files;
|
||||||
|
|
||||||
GHGistUpdater(GHGist base) {
|
GHGistUpdater(GHGist base) {
|
||||||
this.base = base;
|
this.base = base;
|
||||||
@@ -32,16 +35,15 @@ public class GHGistUpdater {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public GHGistUpdater addFile(String fileName, String content) throws IOException {
|
public GHGistUpdater addFile(@Nonnull String fileName, @Nonnull String content) throws IOException {
|
||||||
updateFile(fileName, content);
|
updateFile(fileName, content);
|
||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
// // This method does not work.
|
public GHGistUpdater deleteFile(@Nonnull String fileName) throws IOException {
|
||||||
// public GHGistUpdater deleteFile(String fileName) throws IOException {
|
files.put(fileName, null);
|
||||||
// files.put(fileName, Collections.singletonMap("filename", null));
|
return this;
|
||||||
// return this;
|
}
|
||||||
// }
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Rename file gh gist updater.
|
* Rename file gh gist updater.
|
||||||
@@ -54,8 +56,9 @@ public class GHGistUpdater {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public GHGistUpdater renameFile(String fileName, String newFileName) throws IOException {
|
public GHGistUpdater renameFile(@Nonnull String fileName, @Nonnull String newFileName) throws IOException {
|
||||||
files.put(fileName, Collections.singletonMap("filename", newFileName));
|
Map<String, String> file = files.computeIfAbsent(fileName, d -> new HashMap<>());
|
||||||
|
file.put("filename", newFileName);
|
||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -70,8 +73,31 @@ public class GHGistUpdater {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public GHGistUpdater updateFile(String fileName, String content) throws IOException {
|
public GHGistUpdater updateFile(@Nonnull String fileName, @Nonnull String content) throws IOException {
|
||||||
files.put(fileName, Collections.singletonMap("content", content));
|
Map<String, String> file = files.computeIfAbsent(fileName, d -> new HashMap<>());
|
||||||
|
file.put("content", content);
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Update file name and content
|
||||||
|
*
|
||||||
|
* @param fileName
|
||||||
|
* the file name
|
||||||
|
* @param newFileName
|
||||||
|
* the new file name
|
||||||
|
* @param content
|
||||||
|
* the content
|
||||||
|
* @return the gh gist updater
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public GHGistUpdater updateFile(@Nonnull String fileName, @Nonnull String newFileName, @Nonnull String content)
|
||||||
|
throws IOException {
|
||||||
|
Map<String, String> file = files.computeIfAbsent(fileName, d -> new HashMap<>());
|
||||||
|
file.put("content", content);
|
||||||
|
file.put("filename", newFileName);
|
||||||
|
files.put(fileName, file);
|
||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -96,6 +122,6 @@ public class GHGistUpdater {
|
|||||||
*/
|
*/
|
||||||
public GHGist update() throws IOException {
|
public GHGist update() throws IOException {
|
||||||
builder.with("files", files);
|
builder.with("files", files);
|
||||||
return builder.method("PATCH").withUrlPath(base.getApiTailUrl("")).fetch(GHGist.class).wrap(base.owner);
|
return builder.method("PATCH").withUrlPath(base.getApiTailUrl("")).fetch(GHGist.class);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -12,8 +12,7 @@ import java.util.Map;
|
|||||||
* functionality
|
* functionality
|
||||||
*/
|
*/
|
||||||
class GHHooks {
|
class GHHooks {
|
||||||
static abstract class Context {
|
static abstract class Context extends GitHubInteractiveObject {
|
||||||
private final GitHub root;
|
|
||||||
|
|
||||||
private Context(GitHub root) {
|
private Context(GitHub root) {
|
||||||
this.root = root;
|
this.root = root;
|
||||||
|
|||||||
@@ -1,11 +1,11 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.HttpURLConnection;
|
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
import java.util.Map;
|
import java.util.Map;
|
||||||
|
|
||||||
import javax.annotation.CheckForNull;
|
import javax.annotation.CheckForNull;
|
||||||
|
import javax.annotation.Nonnull;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Request/responce contains useful metadata. Custom exception allows store info for next diagnostics.
|
* Request/responce contains useful metadata. Custom exception allows store info for next diagnostics.
|
||||||
@@ -31,6 +31,20 @@ public class GHIOException extends IOException {
|
|||||||
super(message);
|
super(message);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Constructs a {@code GHIOException} with the specified detail message and cause.
|
||||||
|
*
|
||||||
|
* @param message
|
||||||
|
* The detail message (which is saved for later retrieval by the {@link #getMessage()} method)
|
||||||
|
*
|
||||||
|
* @param cause
|
||||||
|
* The cause (which is saved for later retrieval by the {@link #getCause()} method). (A null value is
|
||||||
|
* permitted, and indicates that the cause is nonexistent or unknown.)
|
||||||
|
*/
|
||||||
|
public GHIOException(String message, Throwable cause) {
|
||||||
|
super(message, cause);
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets response header fields.
|
* Gets response header fields.
|
||||||
*
|
*
|
||||||
@@ -41,8 +55,8 @@ public class GHIOException extends IOException {
|
|||||||
return responseHeaderFields;
|
return responseHeaderFields;
|
||||||
}
|
}
|
||||||
|
|
||||||
GHIOException withResponseHeaderFields(HttpURLConnection urlConnection) {
|
GHIOException withResponseHeaderFields(@Nonnull Map<String, List<String>> headerFields) {
|
||||||
this.responseHeaderFields = urlConnection.getHeaderFields();
|
this.responseHeaderFields = headerFields;
|
||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -16,7 +16,6 @@ import java.net.URL;
|
|||||||
"UUF_UNUSED_FIELD" },
|
"UUF_UNUSED_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public class GHInvitation extends GHObject {
|
public class GHInvitation extends GHObject {
|
||||||
/* package almost final */ GitHub root;
|
|
||||||
|
|
||||||
private int id;
|
private int id;
|
||||||
private GHRepository repository;
|
private GHRepository repository;
|
||||||
@@ -51,6 +50,6 @@ public class GHInvitation extends GHObject {
|
|||||||
|
|
||||||
@Override
|
@Override
|
||||||
public URL getHtmlUrl() {
|
public URL getHtmlUrl() {
|
||||||
return GitHub.parseURL(html_url);
|
return GitHubClient.parseURL(html_url);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -26,6 +26,7 @@ package org.kohsuke.github;
|
|||||||
|
|
||||||
import com.infradna.tool.bridge_method_injector.WithBridgeMethods;
|
import com.infradna.tool.bridge_method_injector.WithBridgeMethods;
|
||||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
|
import org.apache.commons.lang3.StringUtils;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
@@ -36,8 +37,9 @@ import java.util.Collections;
|
|||||||
import java.util.Date;
|
import java.util.Date;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
import java.util.Locale;
|
import java.util.Locale;
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.SQUIRREL_GIRL;
|
import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Represents an issue on GitHub.
|
* Represents an issue on GitHub.
|
||||||
@@ -51,7 +53,6 @@ import static org.kohsuke.github.Previews.SQUIRREL_GIRL;
|
|||||||
public class GHIssue extends GHObject implements Reactable {
|
public class GHIssue extends GHObject implements Reactable {
|
||||||
private static final String ASSIGNEES = "assignees";
|
private static final String ASSIGNEES = "assignees";
|
||||||
|
|
||||||
GitHub root;
|
|
||||||
GHRepository owner;
|
GHRepository owner;
|
||||||
|
|
||||||
// API v3
|
// API v3
|
||||||
@@ -63,8 +64,7 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
protected int comments;
|
protected int comments;
|
||||||
@SkipFromToString
|
@SkipFromToString
|
||||||
protected String body;
|
protected String body;
|
||||||
// for backward compatibility with < 1.63, this collection needs to hold instances of Label, not GHLabel
|
protected List<GHLabel> labels;
|
||||||
protected List<Label> labels;
|
|
||||||
protected GHUser user;
|
protected GHUser user;
|
||||||
protected String title, html_url;
|
protected String title, html_url;
|
||||||
protected GHIssue.PullRequest pull_request;
|
protected GHIssue.PullRequest pull_request;
|
||||||
@@ -72,14 +72,6 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
protected GHUser closed_by;
|
protected GHUser closed_by;
|
||||||
protected boolean locked;
|
protected boolean locked;
|
||||||
|
|
||||||
/**
|
|
||||||
* The type Label.
|
|
||||||
*
|
|
||||||
* @deprecated use {@link GHLabel}
|
|
||||||
*/
|
|
||||||
public static class Label extends GHLabel {
|
|
||||||
}
|
|
||||||
|
|
||||||
GHIssue wrap(GHRepository owner) {
|
GHIssue wrap(GHRepository owner) {
|
||||||
this.owner = owner;
|
this.owner = owner;
|
||||||
if (milestone != null)
|
if (milestone != null)
|
||||||
@@ -100,12 +92,6 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
static GHIssue[] wrap(GHIssue[] issues, GHRepository owner) {
|
|
||||||
for (GHIssue i : issues)
|
|
||||||
i.wrap(owner);
|
|
||||||
return issues;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Repository to which the issue belongs.
|
* Repository to which the issue belongs.
|
||||||
*
|
*
|
||||||
@@ -137,7 +123,7 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
* The HTML page of this issue, like https://github.com/jenkinsci/jenkins/issues/100
|
* The HTML page of this issue, like https://github.com/jenkinsci/jenkins/issues/100
|
||||||
*/
|
*/
|
||||||
public URL getHtmlUrl() {
|
public URL getHtmlUrl() {
|
||||||
return GitHub.parseURL(html_url);
|
return GitHubClient.parseURL(html_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -171,14 +157,12 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
* Gets labels.
|
* Gets labels.
|
||||||
*
|
*
|
||||||
* @return the labels
|
* @return the labels
|
||||||
* @throws IOException
|
|
||||||
* the io exception
|
|
||||||
*/
|
*/
|
||||||
public Collection<GHLabel> getLabels() throws IOException {
|
public Collection<GHLabel> getLabels() {
|
||||||
if (labels == null) {
|
if (labels == null) {
|
||||||
return Collections.emptyList();
|
return Collections.emptyList();
|
||||||
}
|
}
|
||||||
return Collections.<GHLabel>unmodifiableList(labels);
|
return Collections.unmodifiableList(labels);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -187,16 +171,18 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
* @return the closed at
|
* @return the closed at
|
||||||
*/
|
*/
|
||||||
public Date getClosedAt() {
|
public Date getClosedAt() {
|
||||||
return GitHub.parseDate(closed_at);
|
return GitHubClient.parseDate(closed_at);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets api url.
|
* Gets api url.
|
||||||
*
|
*
|
||||||
* @return the api url
|
* @return API URL of this object.
|
||||||
|
* @deprecated use {@link #getUrl()}
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public URL getApiURL() {
|
public URL getApiURL() {
|
||||||
return GitHub.parseURL(url);
|
return getUrl();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -242,8 +228,15 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
root.createRequest().with(key, value).method("PATCH").withUrlPath(getApiRoute()).send();
|
root.createRequest().with(key, value).method("PATCH").withUrlPath(getApiRoute()).send();
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Identical to edit(), but allows null for the value.
|
||||||
|
*/
|
||||||
|
private void editNullable(String key, Object value) throws IOException {
|
||||||
|
root.createRequest().withNullable(key, value).method("PATCH").withUrlPath(getApiRoute()).send();
|
||||||
|
}
|
||||||
|
|
||||||
private void editIssue(String key, Object value) throws IOException {
|
private void editIssue(String key, Object value) throws IOException {
|
||||||
root.createRequest().with(key, value).method("PATCH").withUrlPath(getIssuesApiRoute()).send();
|
root.createRequest().withNullable(key, value).method("PATCH").withUrlPath(getIssuesApiRoute()).send();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -291,15 +284,19 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Sets milestone.
|
* Sets the milestone for this issue.
|
||||||
*
|
*
|
||||||
* @param milestone
|
* @param milestone
|
||||||
* the milestone
|
* The milestone to assign this issue to. Use null to remove the milestone for this issue.
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* The io exception
|
||||||
*/
|
*/
|
||||||
public void setMilestone(GHMilestone milestone) throws IOException {
|
public void setMilestone(GHMilestone milestone) throws IOException {
|
||||||
edit("milestone", milestone.getNumber());
|
if (milestone == null) {
|
||||||
|
editIssue("milestone", null);
|
||||||
|
} else {
|
||||||
|
editIssue("milestone", milestone.getNumber());
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -315,7 +312,7 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Sets labels.
|
* Sets labels on the target to a specific list.
|
||||||
*
|
*
|
||||||
* @param labels
|
* @param labels
|
||||||
* the labels
|
* the labels
|
||||||
@@ -329,6 +326,8 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
/**
|
/**
|
||||||
* Adds labels to the issue.
|
* Adds labels to the issue.
|
||||||
*
|
*
|
||||||
|
* Labels that are already present on the target are ignored.
|
||||||
|
*
|
||||||
* @param names
|
* @param names
|
||||||
* Names of the label
|
* Names of the label
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
@@ -341,6 +340,8 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
/**
|
/**
|
||||||
* Add labels.
|
* Add labels.
|
||||||
*
|
*
|
||||||
|
* Labels that are already present on the target are ignored.
|
||||||
|
*
|
||||||
* @param labels
|
* @param labels
|
||||||
* the labels
|
* the labels
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
@@ -353,6 +354,8 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
/**
|
/**
|
||||||
* Add labels.
|
* Add labels.
|
||||||
*
|
*
|
||||||
|
* Labels that are already present on the target are ignored.
|
||||||
|
*
|
||||||
* @param labels
|
* @param labels
|
||||||
* the labels
|
* the labels
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
@@ -363,21 +366,27 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
}
|
}
|
||||||
|
|
||||||
private void _addLabels(Collection<String> names) throws IOException {
|
private void _addLabels(Collection<String> names) throws IOException {
|
||||||
List<String> newLabels = new ArrayList<String>();
|
root.createRequest().with("labels", names).method("POST").withUrlPath(getIssuesApiRoute() + "/labels").send();
|
||||||
|
|
||||||
for (GHLabel label : getLabels()) {
|
|
||||||
newLabels.add(label.getName());
|
|
||||||
}
|
|
||||||
for (String name : names) {
|
|
||||||
if (!newLabels.contains(name)) {
|
|
||||||
newLabels.add(name);
|
|
||||||
}
|
|
||||||
}
|
|
||||||
setLabels(newLabels.toArray(new String[0]));
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Remove a given label by name from this issue.
|
* Remove a single label.
|
||||||
|
*
|
||||||
|
* Attempting to remove a label that is not present throws {@link GHFileNotFoundException}.
|
||||||
|
*
|
||||||
|
* @param name
|
||||||
|
* the name
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception, throws {@link GHFileNotFoundException} if label was not present.
|
||||||
|
*/
|
||||||
|
public void removeLabel(String name) throws IOException {
|
||||||
|
root.createRequest().method("DELETE").withUrlPath(getIssuesApiRoute() + "/labels", name).send();
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Remove a collection of labels.
|
||||||
|
*
|
||||||
|
* Attempting to remove labels that are not present on the target are ignored.
|
||||||
*
|
*
|
||||||
* @param names
|
* @param names
|
||||||
* the names
|
* the names
|
||||||
@@ -389,7 +398,9 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Remove labels.
|
* Remove a collection of labels.
|
||||||
|
*
|
||||||
|
* Attempting to remove labels that are not present on the target are ignored.
|
||||||
*
|
*
|
||||||
* @param labels
|
* @param labels
|
||||||
* the labels
|
* the labels
|
||||||
@@ -402,7 +413,9 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Remove labels.
|
* Remove a collection of labels.
|
||||||
|
*
|
||||||
|
* Attempting to remove labels that are not present on the target are ignored.
|
||||||
*
|
*
|
||||||
* @param labels
|
* @param labels
|
||||||
* the labels
|
* the labels
|
||||||
@@ -414,15 +427,13 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
}
|
}
|
||||||
|
|
||||||
private void _removeLabels(Collection<String> names) throws IOException {
|
private void _removeLabels(Collection<String> names) throws IOException {
|
||||||
List<String> newLabels = new ArrayList<String>();
|
for (String name : names) {
|
||||||
|
try {
|
||||||
for (GHLabel l : getLabels()) {
|
removeLabel(name);
|
||||||
if (!names.contains(l.getName())) {
|
} catch (GHFileNotFoundException e) {
|
||||||
newLabels.add(l.getName());
|
// when trying to remove multiple labels, we ignore already removed
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
setLabels(newLabels.toArray(new String[0]));
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -434,7 +445,7 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
* @see #listComments() #listComments()
|
* @see #listComments() #listComments()
|
||||||
*/
|
*/
|
||||||
public List<GHIssueComment> getComments() throws IOException {
|
public List<GHIssueComment> getComments() throws IOException {
|
||||||
return listComments().asList();
|
return listComments().toList();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -450,10 +461,10 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
.toIterable(GHIssueComment[].class, item -> item.wrapUp(this));
|
.toIterable(GHIssueComment[].class, item -> item.wrapUp(this));
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHReaction createReaction(ReactionContent content) throws IOException {
|
public GHReaction createReaction(ReactionContent content) throws IOException {
|
||||||
return owner.root.createRequest()
|
return root.createRequest()
|
||||||
.method("POST")
|
.method("POST")
|
||||||
.withPreview(SQUIRREL_GIRL)
|
.withPreview(SQUIRREL_GIRL)
|
||||||
.with("content", content.getContent())
|
.with("content", content.getContent())
|
||||||
@@ -462,13 +473,13 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
.wrap(root);
|
.wrap(root);
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public PagedIterable<GHReaction> listReactions() {
|
public PagedIterable<GHReaction> listReactions() {
|
||||||
return owner.root.createRequest()
|
return root.createRequest()
|
||||||
.withPreview(SQUIRREL_GIRL)
|
.withPreview(SQUIRREL_GIRL)
|
||||||
.withUrlPath(getApiRoute() + "/reactions")
|
.withUrlPath(getApiRoute() + "/reactions")
|
||||||
.toIterable(GHReaction[].class, item -> item.wrap(owner.root));
|
.toIterable(GHReaction[].class, item -> item.wrap(root));
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -571,6 +582,11 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
* @return the issues api route
|
* @return the issues api route
|
||||||
*/
|
*/
|
||||||
protected String getIssuesApiRoute() {
|
protected String getIssuesApiRoute() {
|
||||||
|
if (owner == null) {
|
||||||
|
// Issues returned from search to do not have an owner. Attempt to use url.
|
||||||
|
final URL url = Objects.requireNonNull(getUrl(), "Missing instance URL!");
|
||||||
|
return StringUtils.prependIfMissing(url.toString().replace(root.getApiUrl(), ""), "/");
|
||||||
|
}
|
||||||
return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/issues/" + number;
|
return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/issues/" + number;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -677,7 +693,7 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
* @return the diff url
|
* @return the diff url
|
||||||
*/
|
*/
|
||||||
public URL getDiffUrl() {
|
public URL getDiffUrl() {
|
||||||
return GitHub.parseURL(diff_url);
|
return GitHubClient.parseURL(diff_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -686,7 +702,7 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
* @return the patch url
|
* @return the patch url
|
||||||
*/
|
*/
|
||||||
public URL getPatchUrl() {
|
public URL getPatchUrl() {
|
||||||
return GitHub.parseURL(patch_url);
|
return GitHubClient.parseURL(patch_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -695,7 +711,7 @@ public class GHIssue extends GHObject implements Reactable {
|
|||||||
* @return the url
|
* @return the url
|
||||||
*/
|
*/
|
||||||
public URL getUrl() {
|
public URL getUrl() {
|
||||||
return GitHub.parseURL(html_url);
|
return GitHubClient.parseURL(html_url);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
49
src/main/java/org/kohsuke/github/GHIssueChanges.java
Normal file
49
src/main/java/org/kohsuke/github/GHIssueChanges.java
Normal file
@@ -0,0 +1,49 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Wrapper to define changed fields on issues action="edited"
|
||||||
|
*
|
||||||
|
* @see GHEventPayload.Issue
|
||||||
|
*/
|
||||||
|
@SuppressFBWarnings("UWF_UNWRITTEN_FIELD")
|
||||||
|
public class GHIssueChanges {
|
||||||
|
|
||||||
|
private GHFrom title;
|
||||||
|
private GHFrom body;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Old issue title.
|
||||||
|
*
|
||||||
|
* @return old issue title (or null if not changed)
|
||||||
|
*/
|
||||||
|
public GHFrom getTitle() {
|
||||||
|
return title;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Old issue body.
|
||||||
|
*
|
||||||
|
* @return old issue body (or null if not changed)
|
||||||
|
*/
|
||||||
|
public GHFrom getBody() {
|
||||||
|
return body;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Wrapper for changed values.
|
||||||
|
*/
|
||||||
|
public static class GHFrom {
|
||||||
|
private String from;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Previous value that was changed.
|
||||||
|
*
|
||||||
|
* @return previous value
|
||||||
|
*/
|
||||||
|
public String getFrom() {
|
||||||
|
return from;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -26,7 +26,7 @@ package org.kohsuke.github;
|
|||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.*;
|
import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Comment to the issue
|
* Comment to the issue
|
||||||
@@ -87,7 +87,7 @@ public class GHIssueComment extends GHObject implements Reactable {
|
|||||||
|
|
||||||
@Override
|
@Override
|
||||||
public URL getHtmlUrl() {
|
public URL getHtmlUrl() {
|
||||||
return GitHub.parseURL(html_url);
|
return GitHubClient.parseURL(html_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -126,7 +126,7 @@ public class GHIssueComment extends GHObject implements Reactable {
|
|||||||
owner.root.createRequest().method("DELETE").withUrlPath(getApiRoute()).send();
|
owner.root.createRequest().method("DELETE").withUrlPath(getApiRoute()).send();
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHReaction createReaction(ReactionContent content) throws IOException {
|
public GHReaction createReaction(ReactionContent content) throws IOException {
|
||||||
return owner.root.createRequest()
|
return owner.root.createRequest()
|
||||||
@@ -138,7 +138,7 @@ public class GHIssueComment extends GHObject implements Reactable {
|
|||||||
.wrap(owner.root);
|
.wrap(owner.root);
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public PagedIterable<GHReaction> listReactions() {
|
public PagedIterable<GHReaction> listReactions() {
|
||||||
return owner.root.createRequest()
|
return owner.root.createRequest()
|
||||||
@@ -149,6 +149,6 @@ public class GHIssueComment extends GHObject implements Reactable {
|
|||||||
|
|
||||||
private String getApiRoute() {
|
private String getApiRoute() {
|
||||||
return "/repos/" + owner.getRepository().getOwnerName() + "/" + owner.getRepository().getName()
|
return "/repos/" + owner.getRepository().getOwnerName() + "/" + owner.getRepository().getName()
|
||||||
+ "/issues/comments/" + id;
|
+ "/issues/comments/" + getId();
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -5,11 +5,11 @@ import java.util.Date;
|
|||||||
/**
|
/**
|
||||||
* The type GHIssueEvent.
|
* The type GHIssueEvent.
|
||||||
*
|
*
|
||||||
|
* @see <a href="https://developer.github.com/v3/issues/events/">Github documentation for issue events</a>
|
||||||
|
*
|
||||||
* @author Martin van Zijl
|
* @author Martin van Zijl
|
||||||
*/
|
*/
|
||||||
public class GHIssueEvent {
|
public class GHIssueEvent extends GitHubInteractiveObject {
|
||||||
private GitHub root;
|
|
||||||
|
|
||||||
private long id;
|
private long id;
|
||||||
private String node_id;
|
private String node_id;
|
||||||
private String url;
|
private String url;
|
||||||
@@ -18,6 +18,9 @@ public class GHIssueEvent {
|
|||||||
private String commit_id;
|
private String commit_id;
|
||||||
private String commit_url;
|
private String commit_url;
|
||||||
private String created_at;
|
private String created_at;
|
||||||
|
private GHMilestone milestone;
|
||||||
|
private GHLabel label;
|
||||||
|
private GHUser assignee;
|
||||||
|
|
||||||
private GHIssue issue;
|
private GHIssue issue;
|
||||||
|
|
||||||
@@ -90,7 +93,7 @@ public class GHIssueEvent {
|
|||||||
* @return the created at
|
* @return the created at
|
||||||
*/
|
*/
|
||||||
public Date getCreatedAt() {
|
public Date getCreatedAt() {
|
||||||
return GitHub.parseDate(created_at);
|
return GitHubClient.parseDate(created_at);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -111,6 +114,36 @@ public class GHIssueEvent {
|
|||||||
return issue;
|
return issue;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get the {@link GHMilestone} that this issue was added to or removed from. Only present for events "milestoned"
|
||||||
|
* and "demilestoned", <code>null</code> otherwise.
|
||||||
|
*
|
||||||
|
* @return the milestone
|
||||||
|
*/
|
||||||
|
public GHMilestone getMilestone() {
|
||||||
|
return milestone;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get the {@link GHLabel} that was added to or removed from the issue. Only present for events "labeled" and
|
||||||
|
* "unlabeled", <code>null</code> otherwise.
|
||||||
|
*
|
||||||
|
* @return the label
|
||||||
|
*/
|
||||||
|
public GHLabel getLabel() {
|
||||||
|
return label;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get the {@link GHUser} that was assigned or unassigned from the issue. Only present for events "assigned" and
|
||||||
|
* "unassigned", <code>null</code> otherwise.
|
||||||
|
*
|
||||||
|
* @return the user
|
||||||
|
*/
|
||||||
|
public GHUser getAssignee() {
|
||||||
|
return assignee;
|
||||||
|
}
|
||||||
|
|
||||||
GHIssueEvent wrapUp(GitHub root) {
|
GHIssueEvent wrapUp(GitHub root) {
|
||||||
this.root = root;
|
this.root = root;
|
||||||
return this;
|
return this;
|
||||||
|
|||||||
@@ -9,9 +9,7 @@ import org.apache.commons.lang3.builder.ToStringBuilder;
|
|||||||
* @author Kohsuke Kawaguchi
|
* @author Kohsuke Kawaguchi
|
||||||
*/
|
*/
|
||||||
@SuppressFBWarnings(value = "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", justification = "JSON API")
|
@SuppressFBWarnings(value = "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", justification = "JSON API")
|
||||||
public class GHKey {
|
public class GHKey extends GitHubInteractiveObject {
|
||||||
/* package almost final */ GitHub root;
|
|
||||||
|
|
||||||
protected String url, key, title;
|
protected String url, key, title;
|
||||||
protected boolean verified;
|
protected boolean verified;
|
||||||
protected int id;
|
protected int id;
|
||||||
|
|||||||
@@ -1,27 +1,77 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import com.fasterxml.jackson.annotation.JacksonInject;
|
||||||
|
import com.fasterxml.jackson.annotation.JsonCreator;
|
||||||
|
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.util.ArrayList;
|
import java.util.ArrayList;
|
||||||
import java.util.Collection;
|
import java.util.Collection;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
import java.util.Objects;
|
import java.util.Objects;
|
||||||
|
|
||||||
|
import javax.annotation.CheckForNull;
|
||||||
|
import javax.annotation.Nonnull;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The type GHLabel.
|
* The type GHLabel.
|
||||||
*
|
*
|
||||||
* @author Kohsuke Kawaguchi
|
* @author Kohsuke Kawaguchi
|
||||||
|
* @see <a href="https://developer.github.com/v3/issues/labels/">Labels</a>
|
||||||
* @see GHIssue#getLabels() GHIssue#getLabels()
|
* @see GHIssue#getLabels() GHIssue#getLabels()
|
||||||
* @see GHRepository#listLabels() GHRepository#listLabels()
|
* @see GHRepository#listLabels() GHRepository#listLabels()
|
||||||
*/
|
*/
|
||||||
public class GHLabel {
|
public class GHLabel extends GitHubInteractiveObject {
|
||||||
private String url, name, color, description;
|
|
||||||
private GHRepository repo;
|
private long id;
|
||||||
|
private String nodeId;
|
||||||
|
@JsonProperty("default")
|
||||||
|
private boolean default_;
|
||||||
|
|
||||||
|
@Nonnull
|
||||||
|
private String url, name, color;
|
||||||
|
|
||||||
|
@CheckForNull
|
||||||
|
private String description;
|
||||||
|
|
||||||
|
@JsonCreator
|
||||||
|
private GHLabel(@JacksonInject @Nonnull GitHub root) {
|
||||||
|
this.root = root;
|
||||||
|
url = "";
|
||||||
|
name = "";
|
||||||
|
color = "";
|
||||||
|
description = null;
|
||||||
|
}
|
||||||
|
|
||||||
|
@Nonnull
|
||||||
|
GitHub getApiRoot() {
|
||||||
|
return Objects.requireNonNull(root);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets id.
|
||||||
|
*
|
||||||
|
* @return the id
|
||||||
|
*/
|
||||||
|
public long getId() {
|
||||||
|
return id;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets node id.
|
||||||
|
*
|
||||||
|
* @return the node id.
|
||||||
|
*/
|
||||||
|
public String getNodeId() {
|
||||||
|
return nodeId;
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets url.
|
* Gets url.
|
||||||
*
|
*
|
||||||
* @return the url
|
* @return the url
|
||||||
*/
|
*/
|
||||||
|
@Nonnull
|
||||||
public String getUrl() {
|
public String getUrl() {
|
||||||
return url;
|
return url;
|
||||||
}
|
}
|
||||||
@@ -31,6 +81,7 @@ public class GHLabel {
|
|||||||
*
|
*
|
||||||
* @return the name
|
* @return the name
|
||||||
*/
|
*/
|
||||||
|
@Nonnull
|
||||||
public String getName() {
|
public String getName() {
|
||||||
return name;
|
return name;
|
||||||
}
|
}
|
||||||
@@ -40,6 +91,7 @@ public class GHLabel {
|
|||||||
*
|
*
|
||||||
* @return the color
|
* @return the color
|
||||||
*/
|
*/
|
||||||
|
@Nonnull
|
||||||
public String getColor() {
|
public String getColor() {
|
||||||
return color;
|
return color;
|
||||||
}
|
}
|
||||||
@@ -49,23 +101,18 @@ public class GHLabel {
|
|||||||
*
|
*
|
||||||
* @return the description
|
* @return the description
|
||||||
*/
|
*/
|
||||||
|
@CheckForNull
|
||||||
public String getDescription() {
|
public String getDescription() {
|
||||||
return description;
|
return description;
|
||||||
}
|
}
|
||||||
|
|
||||||
GHLabel wrapUp(GHRepository repo) {
|
|
||||||
this.repo = repo;
|
|
||||||
return this;
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Delete.
|
* If the label is one of the default labels created by GitHub automatically.
|
||||||
*
|
*
|
||||||
* @throws IOException
|
* @return true if the label is a default one
|
||||||
* the io exception
|
|
||||||
*/
|
*/
|
||||||
public void delete() throws IOException {
|
public boolean isDefault() {
|
||||||
repo.root.createRequest().method("DELETE").setRawUrlPath(url).send();
|
return default_;
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -75,15 +122,11 @@ public class GHLabel {
|
|||||||
* 6-letter hex color code, like "f29513"
|
* 6-letter hex color code, like "f29513"
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
|
* @deprecated use {@link #set()} or {@link #update()} instead
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setColor(String newColor) throws IOException {
|
public void setColor(String newColor) throws IOException {
|
||||||
repo.root.createRequest()
|
set().color(newColor);
|
||||||
.method("PATCH")
|
|
||||||
.with("name", name)
|
|
||||||
.with("color", newColor)
|
|
||||||
.with("description", description)
|
|
||||||
.setRawUrlPath(url)
|
|
||||||
.send();
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -93,25 +136,106 @@ public class GHLabel {
|
|||||||
* Description of label
|
* Description of label
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
|
* @deprecated use {@link #set()} or {@link #update()} instead
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void setDescription(String newDescription) throws IOException {
|
public void setDescription(String newDescription) throws IOException {
|
||||||
repo.root.createRequest()
|
set().description(newDescription);
|
||||||
.method("PATCH")
|
|
||||||
.with("name", name)
|
|
||||||
.with("color", color)
|
|
||||||
.with("description", newDescription)
|
|
||||||
.setRawUrlPath(url)
|
|
||||||
.send();
|
|
||||||
}
|
}
|
||||||
|
|
||||||
static Collection<String> toNames(Collection<GHLabel> labels) {
|
static Collection<String> toNames(Collection<GHLabel> labels) {
|
||||||
List<String> r = new ArrayList<String>();
|
List<String> r = new ArrayList<>();
|
||||||
for (GHLabel l : labels) {
|
for (GHLabel l : labels) {
|
||||||
r.add(l.getName());
|
r.add(l.getName());
|
||||||
}
|
}
|
||||||
return r;
|
return r;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Begins the creation of a new instance.
|
||||||
|
*
|
||||||
|
* Consumer must call {@link Creator#done()} to commit changes.
|
||||||
|
*
|
||||||
|
* @param repository
|
||||||
|
* the repository in which the label will be created.
|
||||||
|
* @return a {@link Creator}
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
@BetaApi
|
||||||
|
@Deprecated
|
||||||
|
static Creator create(GHRepository repository) throws IOException {
|
||||||
|
return new Creator(repository);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Reads a label from a repository.
|
||||||
|
*
|
||||||
|
* @param repository
|
||||||
|
* the repository to read from
|
||||||
|
* @param name
|
||||||
|
* the name of the label
|
||||||
|
* @return a label
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
static GHLabel read(@Nonnull GHRepository repository, @Nonnull String name) throws IOException {
|
||||||
|
return repository.root.createRequest()
|
||||||
|
.withUrlPath(repository.getApiTailUrl("labels"), name)
|
||||||
|
.fetch(GHLabel.class);
|
||||||
|
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Reads all labels from a repository.
|
||||||
|
*
|
||||||
|
* @param repository
|
||||||
|
* the repository to read from
|
||||||
|
* @return iterable of all labels
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
static PagedIterable<GHLabel> readAll(@Nonnull final GHRepository repository) throws IOException {
|
||||||
|
return repository.root.createRequest()
|
||||||
|
.withUrlPath(repository.getApiTailUrl("labels"))
|
||||||
|
.toIterable(GHLabel[].class, null);
|
||||||
|
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Begins a batch update
|
||||||
|
*
|
||||||
|
* Consumer must call {@link Updater#done()} to commit changes.
|
||||||
|
*
|
||||||
|
* @return a {@link Updater}
|
||||||
|
*/
|
||||||
|
@BetaApi
|
||||||
|
@Deprecated
|
||||||
|
public Updater update() {
|
||||||
|
return new Updater(this);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Begins a single property update.
|
||||||
|
*
|
||||||
|
* @return a {@link Setter}
|
||||||
|
*/
|
||||||
|
@BetaApi
|
||||||
|
@Deprecated
|
||||||
|
public Setter set() {
|
||||||
|
return new Setter(this);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Delete this label from the repository.
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public void delete() throws IOException {
|
||||||
|
root.createRequest().method("DELETE").setRawUrlPath(getUrl()).send();
|
||||||
|
}
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
public boolean equals(final Object o) {
|
public boolean equals(final Object o) {
|
||||||
if (this == o)
|
if (this == o)
|
||||||
@@ -120,11 +244,54 @@ public class GHLabel {
|
|||||||
return false;
|
return false;
|
||||||
final GHLabel ghLabel = (GHLabel) o;
|
final GHLabel ghLabel = (GHLabel) o;
|
||||||
return Objects.equals(url, ghLabel.url) && Objects.equals(name, ghLabel.name)
|
return Objects.equals(url, ghLabel.url) && Objects.equals(name, ghLabel.name)
|
||||||
&& Objects.equals(color, ghLabel.color) && Objects.equals(repo, ghLabel.repo);
|
&& Objects.equals(color, ghLabel.color) && Objects.equals(description, ghLabel.description);
|
||||||
}
|
}
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
public int hashCode() {
|
public int hashCode() {
|
||||||
return Objects.hash(url, name, color, repo);
|
return Objects.hash(url, name, color, description);
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A {@link GHLabelBuilder} that updates a single property per request
|
||||||
|
*
|
||||||
|
* {@link #done()} is called automatically after the property is set.
|
||||||
|
*/
|
||||||
|
@BetaApi
|
||||||
|
@Deprecated
|
||||||
|
public static class Setter extends GHLabelBuilder<GHLabel> {
|
||||||
|
private Setter(@Nonnull GHLabel base) {
|
||||||
|
super(GHLabel.class, base.getApiRoot(), base);
|
||||||
|
requester.method("PATCH").setRawUrlPath(base.getUrl());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A {@link GHLabelBuilder} that allows multiple properties to be updated per request.
|
||||||
|
*
|
||||||
|
* Consumer must call {@link #done()} to commit changes.
|
||||||
|
*/
|
||||||
|
@BetaApi
|
||||||
|
@Deprecated
|
||||||
|
public static class Updater extends GHLabelBuilder<Updater> {
|
||||||
|
private Updater(@Nonnull GHLabel base) {
|
||||||
|
super(Updater.class, base.getApiRoot(), base);
|
||||||
|
requester.method("PATCH").setRawUrlPath(base.getUrl());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* A {@link GHLabelBuilder} that creates a new {@link GHLabel}
|
||||||
|
*
|
||||||
|
* Consumer must call {@link #done()} to create the new instance.
|
||||||
|
*/
|
||||||
|
@BetaApi
|
||||||
|
@Deprecated
|
||||||
|
public static class Creator extends GHLabelBuilder<Creator> {
|
||||||
|
private Creator(@Nonnull GHRepository repository) {
|
||||||
|
super(Creator.class, repository.root, null);
|
||||||
|
requester.method("POST").withUrlPath(repository.getApiTailUrl("labels"));
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
}
|
}
|
||||||
|
|||||||
60
src/main/java/org/kohsuke/github/GHLabelBuilder.java
Normal file
60
src/main/java/org/kohsuke/github/GHLabelBuilder.java
Normal file
@@ -0,0 +1,60 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import java.io.IOException;
|
||||||
|
|
||||||
|
import javax.annotation.CheckForNull;
|
||||||
|
import javax.annotation.Nonnull;
|
||||||
|
|
||||||
|
/**
|
||||||
|
*
|
||||||
|
* @param <S>
|
||||||
|
* Intermediate return type for this builder returned by calls to {@link #with(String, Object)}. If {@link S}
|
||||||
|
* the same as {@link GHLabel}, this builder will commit changes after each call to
|
||||||
|
* {@link #with(String, Object)}.
|
||||||
|
*/
|
||||||
|
class GHLabelBuilder<S> extends AbstractBuilder<GHLabel, S> {
|
||||||
|
|
||||||
|
/**
|
||||||
|
*
|
||||||
|
* @param intermediateReturnType
|
||||||
|
* Intermediate return type for this builder returned by calls to {@link #with(String, Object)}. If
|
||||||
|
* {@link S} the same as {@link GHLabel}, this builder will commit changes after each call to
|
||||||
|
* {@link #with(String, Object)}.
|
||||||
|
* @param root
|
||||||
|
* the GitHub instance to which updates will be sent
|
||||||
|
* @param baseInstance
|
||||||
|
* instance on which to base this builder. If {@code null} a new instance will be created.
|
||||||
|
*/
|
||||||
|
protected GHLabelBuilder(@Nonnull Class<S> intermediateReturnType,
|
||||||
|
@Nonnull GitHub root,
|
||||||
|
@CheckForNull GHLabel baseInstance) {
|
||||||
|
super(GHLabel.class, intermediateReturnType, root, baseInstance);
|
||||||
|
|
||||||
|
if (baseInstance != null) {
|
||||||
|
requester.with("name", baseInstance.getName());
|
||||||
|
requester.with("color", baseInstance.getColor());
|
||||||
|
requester.with("description", baseInstance.getDescription());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
@Nonnull
|
||||||
|
@BetaApi
|
||||||
|
@Deprecated
|
||||||
|
public S name(String value) throws IOException {
|
||||||
|
return with("name", value);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Nonnull
|
||||||
|
@BetaApi
|
||||||
|
@Deprecated
|
||||||
|
public S color(String value) throws IOException {
|
||||||
|
return with("color", value);
|
||||||
|
}
|
||||||
|
|
||||||
|
@Nonnull
|
||||||
|
@BetaApi
|
||||||
|
@Deprecated
|
||||||
|
public S description(String value) throws IOException {
|
||||||
|
return with("description", value);
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -24,13 +24,13 @@
|
|||||||
|
|
||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
import com.infradna.tool.bridge_method_injector.WithBridgeMethods;
|
|
||||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
import java.util.ArrayList;
|
import java.util.ArrayList;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The GitHub Preview API's license information
|
* The GitHub Preview API's license information
|
||||||
@@ -44,9 +44,6 @@ import java.util.List;
|
|||||||
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public class GHLicense extends GHObject {
|
public class GHLicense extends GHObject {
|
||||||
@SuppressFBWarnings("IS2_INCONSISTENT_SYNC")
|
|
||||||
// root is set before the object is returned to the app
|
|
||||||
/* package almost final */ GitHub root;
|
|
||||||
|
|
||||||
// these fields are always present, even in the short form
|
// these fields are always present, even in the short form
|
||||||
protected String key, name;
|
protected String key, name;
|
||||||
@@ -78,14 +75,6 @@ public class GHLicense extends GHObject {
|
|||||||
return name;
|
return name;
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
|
||||||
* @return API URL of this object.
|
|
||||||
*/
|
|
||||||
@WithBridgeMethods(value = String.class, adapterMethod = "urlToString")
|
|
||||||
public URL getUrl() {
|
|
||||||
return GitHub.parseURL(url);
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Featured licenses are bold in the new repository drop-down
|
* Featured licenses are bold in the new repository drop-down
|
||||||
*
|
*
|
||||||
@@ -100,7 +89,7 @@ public class GHLicense extends GHObject {
|
|||||||
|
|
||||||
public URL getHtmlUrl() throws IOException {
|
public URL getHtmlUrl() throws IOException {
|
||||||
populate();
|
populate();
|
||||||
return GitHub.parseURL(html_url);
|
return GitHubClient.parseURL(html_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -199,7 +188,14 @@ public class GHLicense extends GHObject {
|
|||||||
if (description != null)
|
if (description != null)
|
||||||
return; // already populated
|
return; // already populated
|
||||||
|
|
||||||
root.createRequest().withUrlPath(url).fetchInto(this);
|
if (root == null || root.isOffline()) {
|
||||||
|
return; // cannot populate, will have to live with what we have
|
||||||
|
}
|
||||||
|
|
||||||
|
URL url = getUrl();
|
||||||
|
if (url != null) {
|
||||||
|
root.createRequest().setRawUrlPath(url.toString()).fetchInto(this);
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
@@ -210,12 +206,12 @@ public class GHLicense extends GHObject {
|
|||||||
return false;
|
return false;
|
||||||
|
|
||||||
GHLicense that = (GHLicense) o;
|
GHLicense that = (GHLicense) o;
|
||||||
return this.url.equals(that.url);
|
return Objects.equals(getUrl(), that.getUrl());
|
||||||
}
|
}
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
public int hashCode() {
|
public int hashCode() {
|
||||||
return url.hashCode();
|
return Objects.hashCode(getUrl());
|
||||||
}
|
}
|
||||||
|
|
||||||
GHLicense wrap(GitHub root) {
|
GHLicense wrap(GitHub root) {
|
||||||
|
|||||||
@@ -9,9 +9,7 @@ import java.net.URL;
|
|||||||
* @see GitHub#getMyMarketplacePurchases()
|
* @see GitHub#getMyMarketplacePurchases()
|
||||||
* @see GHMarketplaceListAccountBuilder#createRequest()
|
* @see GHMarketplaceListAccountBuilder#createRequest()
|
||||||
*/
|
*/
|
||||||
public class GHMarketplaceAccount {
|
public class GHMarketplaceAccount extends GitHubInteractiveObject {
|
||||||
|
|
||||||
protected GitHub root;
|
|
||||||
private String url;
|
private String url;
|
||||||
private long id;
|
private long id;
|
||||||
private String login;
|
private String login;
|
||||||
@@ -37,7 +35,7 @@ public class GHMarketplaceAccount {
|
|||||||
* @return the url
|
* @return the url
|
||||||
*/
|
*/
|
||||||
public URL getUrl() {
|
public URL getUrl() {
|
||||||
return GitHub.parseURL(url);
|
return GitHubClient.parseURL(url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|||||||
@@ -8,8 +8,7 @@ import java.io.IOException;
|
|||||||
* @author Paulo Miguel Almeida
|
* @author Paulo Miguel Almeida
|
||||||
* @see GHMarketplacePlan#listAccounts()
|
* @see GHMarketplacePlan#listAccounts()
|
||||||
*/
|
*/
|
||||||
public class GHMarketplaceListAccountBuilder {
|
public class GHMarketplaceListAccountBuilder extends GitHubInteractiveObject {
|
||||||
private final GitHub root;
|
|
||||||
private final Requester builder;
|
private final Requester builder;
|
||||||
private final long planId;
|
private final long planId;
|
||||||
|
|
||||||
|
|||||||
@@ -10,8 +10,7 @@ import java.util.Date;
|
|||||||
* @author Paulo Miguel Almeida
|
* @author Paulo Miguel Almeida
|
||||||
* @see GHMarketplaceListAccountBuilder#createRequest()
|
* @see GHMarketplaceListAccountBuilder#createRequest()
|
||||||
*/
|
*/
|
||||||
public class GHMarketplacePendingChange {
|
public class GHMarketplacePendingChange extends GitHubInteractiveObject {
|
||||||
private GitHub root;
|
|
||||||
private long id;
|
private long id;
|
||||||
@SuppressFBWarnings(value = "UWF_UNWRITTEN_FIELD", justification = "Field comes from JSON deserialization")
|
@SuppressFBWarnings(value = "UWF_UNWRITTEN_FIELD", justification = "Field comes from JSON deserialization")
|
||||||
private Long unitCount;
|
private Long unitCount;
|
||||||
@@ -68,7 +67,7 @@ public class GHMarketplacePendingChange {
|
|||||||
* @return the effective date
|
* @return the effective date
|
||||||
*/
|
*/
|
||||||
public Date getEffectiveDate() {
|
public Date getEffectiveDate() {
|
||||||
return GitHub.parseDate(effectiveDate);
|
return GitHubClient.parseDate(effectiveDate);
|
||||||
}
|
}
|
||||||
|
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -11,9 +11,7 @@ import java.util.List;
|
|||||||
* @author Paulo Miguel Almeida
|
* @author Paulo Miguel Almeida
|
||||||
* @see GitHub#listMarketplacePlans()
|
* @see GitHub#listMarketplacePlans()
|
||||||
*/
|
*/
|
||||||
public class GHMarketplacePlan {
|
public class GHMarketplacePlan extends GitHubInteractiveObject {
|
||||||
|
|
||||||
private GitHub root;
|
|
||||||
private String url;
|
private String url;
|
||||||
private String accountsUrl;
|
private String accountsUrl;
|
||||||
private long id;
|
private long id;
|
||||||
@@ -47,7 +45,7 @@ public class GHMarketplacePlan {
|
|||||||
* @return the url
|
* @return the url
|
||||||
*/
|
*/
|
||||||
public URL getUrl() {
|
public URL getUrl() {
|
||||||
return GitHub.parseURL(url);
|
return GitHubClient.parseURL(url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|||||||
@@ -10,9 +10,8 @@ import java.util.Date;
|
|||||||
* @author Paulo Miguel Almeida
|
* @author Paulo Miguel Almeida
|
||||||
* @see GHMarketplaceListAccountBuilder#createRequest() GHMarketplaceListAccountBuilder#createRequest()
|
* @see GHMarketplaceListAccountBuilder#createRequest() GHMarketplaceListAccountBuilder#createRequest()
|
||||||
*/
|
*/
|
||||||
public class GHMarketplacePurchase {
|
public class GHMarketplacePurchase extends GitHubInteractiveObject {
|
||||||
|
|
||||||
private GitHub root;
|
|
||||||
private String billingCycle;
|
private String billingCycle;
|
||||||
private String nextBillingDate;
|
private String nextBillingDate;
|
||||||
private boolean onFreeTrial;
|
private boolean onFreeTrial;
|
||||||
@@ -52,7 +51,7 @@ public class GHMarketplacePurchase {
|
|||||||
* @return the next billing date
|
* @return the next billing date
|
||||||
*/
|
*/
|
||||||
public Date getNextBillingDate() {
|
public Date getNextBillingDate() {
|
||||||
return GitHub.parseDate(nextBillingDate);
|
return GitHubClient.parseDate(nextBillingDate);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -70,7 +69,7 @@ public class GHMarketplacePurchase {
|
|||||||
* @return the free trial ends on
|
* @return the free trial ends on
|
||||||
*/
|
*/
|
||||||
public Date getFreeTrialEndsOn() {
|
public Date getFreeTrialEndsOn() {
|
||||||
return GitHub.parseDate(freeTrialEndsOn);
|
return GitHubClient.parseDate(freeTrialEndsOn);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -88,7 +87,7 @@ public class GHMarketplacePurchase {
|
|||||||
* @return the updated at
|
* @return the updated at
|
||||||
*/
|
*/
|
||||||
public Date getUpdatedAt() {
|
public Date getUpdatedAt() {
|
||||||
return GitHub.parseDate(updatedAt);
|
return GitHubClient.parseDate(updatedAt);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|||||||
@@ -10,8 +10,7 @@ import java.util.Date;
|
|||||||
* @author Paulo Miguel Almeida
|
* @author Paulo Miguel Almeida
|
||||||
* @see GitHub#getMyMarketplacePurchases()
|
* @see GitHub#getMyMarketplacePurchases()
|
||||||
*/
|
*/
|
||||||
public class GHMarketplaceUserPurchase {
|
public class GHMarketplaceUserPurchase extends GitHubInteractiveObject {
|
||||||
protected GitHub root;
|
|
||||||
private String billingCycle;
|
private String billingCycle;
|
||||||
private String nextBillingDate;
|
private String nextBillingDate;
|
||||||
private boolean onFreeTrial;
|
private boolean onFreeTrial;
|
||||||
@@ -54,7 +53,7 @@ public class GHMarketplaceUserPurchase {
|
|||||||
* @return the next billing date
|
* @return the next billing date
|
||||||
*/
|
*/
|
||||||
public Date getNextBillingDate() {
|
public Date getNextBillingDate() {
|
||||||
return GitHub.parseDate(nextBillingDate);
|
return GitHubClient.parseDate(nextBillingDate);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -72,7 +71,7 @@ public class GHMarketplaceUserPurchase {
|
|||||||
* @return the free trial ends on
|
* @return the free trial ends on
|
||||||
*/
|
*/
|
||||||
public Date getFreeTrialEndsOn() {
|
public Date getFreeTrialEndsOn() {
|
||||||
return GitHub.parseDate(freeTrialEndsOn);
|
return GitHubClient.parseDate(freeTrialEndsOn);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -90,7 +89,7 @@ public class GHMarketplaceUserPurchase {
|
|||||||
* @return the updated at
|
* @return the updated at
|
||||||
*/
|
*/
|
||||||
public Date getUpdatedAt() {
|
public Date getUpdatedAt() {
|
||||||
return GitHub.parseDate(updatedAt);
|
return GitHubClient.parseDate(updatedAt);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|||||||
@@ -10,9 +10,7 @@ import java.util.Locale;
|
|||||||
* @author Kohsuke Kawaguchi
|
* @author Kohsuke Kawaguchi
|
||||||
* @see GHMyself#listOrgMemberships() GHMyself#listOrgMemberships()
|
* @see GHMyself#listOrgMemberships() GHMyself#listOrgMemberships()
|
||||||
*/
|
*/
|
||||||
public class GHMembership /* extends GHObject --- but it doesn't have id, created_at, etc. */ {
|
public class GHMembership extends GitHubInteractiveObject {
|
||||||
GitHub root;
|
|
||||||
|
|
||||||
String url;
|
String url;
|
||||||
String state;
|
String state;
|
||||||
String role;
|
String role;
|
||||||
@@ -25,7 +23,7 @@ public class GHMembership /* extends GHObject --- but it doesn't have id, create
|
|||||||
* @return the url
|
* @return the url
|
||||||
*/
|
*/
|
||||||
public URL getUrl() {
|
public URL getUrl() {
|
||||||
return GitHub.parseURL(url);
|
return GitHubClient.parseURL(url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -84,11 +82,6 @@ public class GHMembership /* extends GHObject --- but it doesn't have id, create
|
|||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
static void wrap(GHMembership[] page, GitHub root) {
|
|
||||||
for (GHMembership m : page)
|
|
||||||
m.wrap(root);
|
|
||||||
}
|
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Role of a user in an organization.
|
* Role of a user in an organization.
|
||||||
*/
|
*/
|
||||||
|
|||||||
@@ -11,7 +11,6 @@ import java.util.Locale;
|
|||||||
* @author Yusuke Kokubo
|
* @author Yusuke Kokubo
|
||||||
*/
|
*/
|
||||||
public class GHMilestone extends GHObject {
|
public class GHMilestone extends GHObject {
|
||||||
GitHub root;
|
|
||||||
GHRepository owner;
|
GHRepository owner;
|
||||||
|
|
||||||
GHUser creator;
|
GHUser creator;
|
||||||
@@ -56,7 +55,7 @@ public class GHMilestone extends GHObject {
|
|||||||
public Date getDueOn() {
|
public Date getDueOn() {
|
||||||
if (due_on == null)
|
if (due_on == null)
|
||||||
return null;
|
return null;
|
||||||
return GitHub.parseDate(due_on);
|
return GitHubClient.parseDate(due_on);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -67,7 +66,7 @@ public class GHMilestone extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public Date getClosedAt() throws IOException {
|
public Date getClosedAt() throws IOException {
|
||||||
return GitHub.parseDate(closed_at);
|
return GitHubClient.parseDate(closed_at);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -116,7 +115,7 @@ public class GHMilestone extends GHObject {
|
|||||||
}
|
}
|
||||||
|
|
||||||
public URL getHtmlUrl() {
|
public URL getHtmlUrl() {
|
||||||
return GitHub.parseURL(html_url);
|
return GitHubClient.parseURL(html_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -195,7 +194,7 @@ public class GHMilestone extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void setDueOn(Date dueOn) throws IOException {
|
public void setDueOn(Date dueOn) throws IOException {
|
||||||
edit("due_on", GitHub.printDate(dueOn));
|
edit("due_on", GitHubClient.printDate(dueOn));
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|||||||
@@ -2,7 +2,6 @@ package org.kohsuke.github;
|
|||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.util.ArrayList;
|
import java.util.ArrayList;
|
||||||
import java.util.Arrays;
|
|
||||||
import java.util.Collections;
|
import java.util.Collections;
|
||||||
import java.util.HashSet;
|
import java.util.HashSet;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
@@ -71,8 +70,7 @@ public class GHMyself extends GHUser {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public List<GHEmail> getEmails2() throws IOException {
|
public List<GHEmail> getEmails2() throws IOException {
|
||||||
GHEmail[] addresses = root.createRequest().withUrlPath("/user/emails").fetchArray(GHEmail[].class);
|
return root.createRequest().withUrlPath("/user/emails").toIterable(GHEmail[].class, null).toList();
|
||||||
return Collections.unmodifiableList(Arrays.asList(addresses));
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -86,8 +84,7 @@ public class GHMyself extends GHUser {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public List<GHKey> getPublicKeys() throws IOException {
|
public List<GHKey> getPublicKeys() throws IOException {
|
||||||
return Collections.unmodifiableList(
|
return root.createRequest().withUrlPath("/user/keys").toIterable(GHKey[].class, null).toList();
|
||||||
Arrays.asList(root.createRequest().withUrlPath("/user/keys").fetchArray(GHKey[].class)));
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -101,8 +98,10 @@ public class GHMyself extends GHUser {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public List<GHVerifiedKey> getPublicVerifiedKeys() throws IOException {
|
public List<GHVerifiedKey> getPublicVerifiedKeys() throws IOException {
|
||||||
return Collections.unmodifiableList(Arrays.asList(
|
return root.createRequest()
|
||||||
root.createRequest().withUrlPath("/users/" + getLogin() + "/keys").fetchArray(GHVerifiedKey[].class)));
|
.withUrlPath("/users/" + getLogin() + "/keys")
|
||||||
|
.toIterable(GHVerifiedKey[].class, null)
|
||||||
|
.toList();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -115,7 +114,10 @@ public class GHMyself extends GHUser {
|
|||||||
public GHPersonSet<GHOrganization> getAllOrganizations() throws IOException {
|
public GHPersonSet<GHOrganization> getAllOrganizations() throws IOException {
|
||||||
GHPersonSet<GHOrganization> orgs = new GHPersonSet<GHOrganization>();
|
GHPersonSet<GHOrganization> orgs = new GHPersonSet<GHOrganization>();
|
||||||
Set<String> names = new HashSet<String>();
|
Set<String> names = new HashSet<String>();
|
||||||
for (GHOrganization o : root.createRequest().withUrlPath("/user/orgs").fetchArray(GHOrganization[].class)) {
|
for (GHOrganization o : root.createRequest()
|
||||||
|
.withUrlPath("/user/orgs")
|
||||||
|
.toIterable(GHOrganization[].class, null)
|
||||||
|
.toArray()) {
|
||||||
if (names.add(o.getLogin())) // in case of rumoured duplicates in the data
|
if (names.add(o.getLogin())) // in case of rumoured duplicates in the data
|
||||||
orgs.add(root.getOrganization(o.getLogin()));
|
orgs.add(root.getOrganization(o.getLogin()));
|
||||||
}
|
}
|
||||||
@@ -189,6 +191,7 @@ public class GHMyself extends GHUser {
|
|||||||
* @return the paged iterable
|
* @return the paged iterable
|
||||||
* @deprecated Use {@link #listRepositories()}
|
* @deprecated Use {@link #listRepositories()}
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public PagedIterable<GHRepository> listAllRepositories() {
|
public PagedIterable<GHRepository> listAllRepositories() {
|
||||||
return listRepositories();
|
return listRepositories();
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -23,9 +23,7 @@ import java.util.NoSuchElementException;
|
|||||||
* @see GitHub#listNotifications() GitHub#listNotifications()
|
* @see GitHub#listNotifications() GitHub#listNotifications()
|
||||||
* @see GHRepository#listNotifications() GHRepository#listNotifications()
|
* @see GHRepository#listNotifications() GHRepository#listNotifications()
|
||||||
*/
|
*/
|
||||||
public class GHNotificationStream implements Iterable<GHThread> {
|
public class GHNotificationStream extends GitHubInteractiveObject implements Iterable<GHThread> {
|
||||||
private final GitHub root;
|
|
||||||
|
|
||||||
private Boolean all, participating;
|
private Boolean all, participating;
|
||||||
private String since;
|
private String since;
|
||||||
private String apiUrl;
|
private String apiUrl;
|
||||||
@@ -79,7 +77,7 @@ public class GHNotificationStream implements Iterable<GHThread> {
|
|||||||
* @return the gh notification stream
|
* @return the gh notification stream
|
||||||
*/
|
*/
|
||||||
public GHNotificationStream since(Date dt) {
|
public GHNotificationStream since(Date dt) {
|
||||||
since = GitHub.printDate(dt);
|
since = GitHubClient.printDate(dt);
|
||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -180,7 +178,11 @@ public class GHNotificationStream implements Iterable<GHThread> {
|
|||||||
|
|
||||||
req.setHeader("If-Modified-Since", lastModified);
|
req.setHeader("If-Modified-Since", lastModified);
|
||||||
|
|
||||||
threads = req.withUrlPath(apiUrl).fetchArray(GHThread[].class);
|
Requester requester = req.withUrlPath(apiUrl);
|
||||||
|
GitHubResponse<GHThread[]> response = ((GitHubPageContentsIterable<GHThread>) requester
|
||||||
|
.toIterable(GHThread[].class, null)).toResponse();
|
||||||
|
threads = response.body();
|
||||||
|
|
||||||
if (threads == null) {
|
if (threads == null) {
|
||||||
threads = EMPTY_ARRAY; // if unmodified, we get empty array
|
threads = EMPTY_ARRAY; // if unmodified, we get empty array
|
||||||
} else {
|
} else {
|
||||||
@@ -189,27 +191,21 @@ public class GHNotificationStream implements Iterable<GHThread> {
|
|||||||
}
|
}
|
||||||
idx = threads.length - 1;
|
idx = threads.length - 1;
|
||||||
|
|
||||||
nextCheckTime = calcNextCheckTime();
|
nextCheckTime = calcNextCheckTime(response);
|
||||||
lastModified = req.getResponseHeader("Last-Modified");
|
lastModified = response.headerField("Last-Modified");
|
||||||
}
|
}
|
||||||
} catch (IOException e) {
|
} catch (IOException | InterruptedException e) {
|
||||||
throw new RuntimeException(e);
|
|
||||||
} catch (InterruptedException e) {
|
|
||||||
throw new RuntimeException(e);
|
throw new RuntimeException(e);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
private long calcNextCheckTime() {
|
private long calcNextCheckTime(GitHubResponse<GHThread[]> response) {
|
||||||
String v = req.getResponseHeader("X-Poll-Interval");
|
String v = response.headerField("X-Poll-Interval");
|
||||||
if (v == null)
|
if (v == null)
|
||||||
v = "60";
|
v = "60";
|
||||||
long seconds = Integer.parseInt(v);
|
long seconds = Integer.parseInt(v);
|
||||||
return System.currentTimeMillis() + seconds * 1000;
|
return System.currentTimeMillis() + seconds * 1000;
|
||||||
}
|
}
|
||||||
|
|
||||||
public void remove() {
|
|
||||||
throw new UnsupportedOperationException();
|
|
||||||
}
|
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -234,7 +230,7 @@ public class GHNotificationStream implements Iterable<GHThread> {
|
|||||||
public void markAsRead(long timestamp) throws IOException {
|
public void markAsRead(long timestamp) throws IOException {
|
||||||
final Requester req = root.createRequest();
|
final Requester req = root.createRequest();
|
||||||
if (timestamp >= 0)
|
if (timestamp >= 0)
|
||||||
req.with("last_read_at", GitHub.printDate(new Date(timestamp)));
|
req.with("last_read_at", GitHubClient.printDate(new Date(timestamp)));
|
||||||
req.withUrlPath(apiUrl).fetchHttpStatusCode();
|
req.withUrlPath(apiUrl).fetchHttpStatusCode();
|
||||||
}
|
}
|
||||||
|
|
||||||
|
|||||||
@@ -1,5 +1,6 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import com.fasterxml.jackson.annotation.JacksonInject;
|
||||||
import com.infradna.tool.bridge_method_injector.WithBridgeMethods;
|
import com.infradna.tool.bridge_method_injector.WithBridgeMethods;
|
||||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
import org.apache.commons.lang3.builder.ReflectionToStringBuilder;
|
import org.apache.commons.lang3.builder.ReflectionToStringBuilder;
|
||||||
@@ -19,20 +20,35 @@ import javax.annotation.CheckForNull;
|
|||||||
*/
|
*/
|
||||||
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
@SuppressFBWarnings(value = { "UWF_UNWRITTEN_PUBLIC_OR_PROTECTED_FIELD", "UWF_UNWRITTEN_FIELD", "NP_UNWRITTEN_FIELD" },
|
||||||
justification = "JSON API")
|
justification = "JSON API")
|
||||||
public abstract class GHObject {
|
public abstract class GHObject extends GitHubInteractiveObject {
|
||||||
/**
|
/**
|
||||||
* Capture response HTTP headers on the state object.
|
* Capture response HTTP headers on the state object.
|
||||||
*/
|
*/
|
||||||
protected Map<String, List<String>> responseHeaderFields;
|
protected transient Map<String, List<String>> responseHeaderFields;
|
||||||
|
|
||||||
protected String url;
|
private String url;
|
||||||
protected long id;
|
|
||||||
protected String created_at;
|
private long id;
|
||||||
protected String updated_at;
|
private String nodeId;
|
||||||
|
private String createdAt;
|
||||||
|
private String updatedAt;
|
||||||
|
|
||||||
GHObject() {
|
GHObject() {
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Called by Jackson
|
||||||
|
*
|
||||||
|
* @param responseInfo
|
||||||
|
* the {@link GitHubResponse.ResponseInfo} to get headers from.
|
||||||
|
*/
|
||||||
|
@JacksonInject
|
||||||
|
protected void setResponseHeaderFields(@CheckForNull GitHubResponse.ResponseInfo responseInfo) {
|
||||||
|
if (responseInfo != null) {
|
||||||
|
responseHeaderFields = responseInfo.headers();
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Returns the HTTP response headers given along with the state of this object.
|
* Returns the HTTP response headers given along with the state of this object.
|
||||||
*
|
*
|
||||||
@@ -60,12 +76,12 @@ public abstract class GHObject {
|
|||||||
*/
|
*/
|
||||||
@WithBridgeMethods(value = String.class, adapterMethod = "createdAtStr")
|
@WithBridgeMethods(value = String.class, adapterMethod = "createdAtStr")
|
||||||
public Date getCreatedAt() throws IOException {
|
public Date getCreatedAt() throws IOException {
|
||||||
return GitHub.parseDate(created_at);
|
return GitHubClient.parseDate(createdAt);
|
||||||
}
|
}
|
||||||
|
|
||||||
@SuppressFBWarnings(value = "UPM_UNCALLED_PRIVATE_METHOD", justification = "Bridge method of getCreatedAt")
|
@SuppressFBWarnings(value = "UPM_UNCALLED_PRIVATE_METHOD", justification = "Bridge method of getCreatedAt")
|
||||||
private Object createdAtStr(Date id, Class type) {
|
private Object createdAtStr(Date id, Class type) {
|
||||||
return created_at;
|
return createdAt;
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -75,7 +91,7 @@ public abstract class GHObject {
|
|||||||
*/
|
*/
|
||||||
@WithBridgeMethods(value = String.class, adapterMethod = "urlToString")
|
@WithBridgeMethods(value = String.class, adapterMethod = "urlToString")
|
||||||
public URL getUrl() {
|
public URL getUrl() {
|
||||||
return GitHub.parseURL(url);
|
return GitHubClient.parseURL(url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -96,7 +112,18 @@ public abstract class GHObject {
|
|||||||
* on error
|
* on error
|
||||||
*/
|
*/
|
||||||
public Date getUpdatedAt() throws IOException {
|
public Date getUpdatedAt() throws IOException {
|
||||||
return GitHub.parseDate(updated_at);
|
return GitHubClient.parseDate(updatedAt);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Get Global node_id from Github object.
|
||||||
|
*
|
||||||
|
* @see <a href="https://developer.github.com/v4/guides/using-global-node-ids/">Using Global Node IDs</a>
|
||||||
|
*
|
||||||
|
* @return Global Node ID.
|
||||||
|
*/
|
||||||
|
public String getNodeId() {
|
||||||
|
return nodeId;
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|||||||
@@ -22,6 +22,6 @@ class GHOrgHook extends GHHook {
|
|||||||
|
|
||||||
@Override
|
@Override
|
||||||
String getApiRoute() {
|
String getApiRoute() {
|
||||||
return String.format("/orgs/%s/hooks/%d", organization.getLogin(), id);
|
return String.format("/orgs/%s/hooks/%d", organization.getLogin(), getId());
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -10,7 +10,7 @@ import java.util.List;
|
|||||||
import java.util.Map;
|
import java.util.Map;
|
||||||
import java.util.TreeMap;
|
import java.util.TreeMap;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.INERTIA;
|
import static org.kohsuke.github.internal.Previews.INERTIA;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The type GHOrganization.
|
* The type GHOrganization.
|
||||||
@@ -40,6 +40,7 @@ public class GHOrganization extends GHPerson {
|
|||||||
* the io exception
|
* the io exception
|
||||||
* @deprecated Use {@link #createRepository(String)} that uses a builder pattern to let you control every aspect.
|
* @deprecated Use {@link #createRepository(String)} that uses a builder pattern to let you control every aspect.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public GHRepository createRepository(String name,
|
public GHRepository createRepository(String name,
|
||||||
String description,
|
String description,
|
||||||
String homepage,
|
String homepage,
|
||||||
@@ -69,6 +70,7 @@ public class GHOrganization extends GHPerson {
|
|||||||
* the io exception
|
* the io exception
|
||||||
* @deprecated Use {@link #createRepository(String)} that uses a builder pattern to let you control every aspect.
|
* @deprecated Use {@link #createRepository(String)} that uses a builder pattern to let you control every aspect.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public GHRepository createRepository(String name,
|
public GHRepository createRepository(String name,
|
||||||
String description,
|
String description,
|
||||||
String homepage,
|
String homepage,
|
||||||
@@ -88,14 +90,14 @@ public class GHOrganization extends GHPerson {
|
|||||||
*
|
*
|
||||||
* <p>
|
* <p>
|
||||||
* You use the returned builder to set various properties, then call {@link GHCreateRepositoryBuilder#create()} to
|
* You use the returned builder to set various properties, then call {@link GHCreateRepositoryBuilder#create()} to
|
||||||
* finally createa repository.
|
* finally create a repository.
|
||||||
*
|
*
|
||||||
* @param name
|
* @param name
|
||||||
* the name
|
* the name
|
||||||
* @return the gh create repository builder
|
* @return the gh create repository builder
|
||||||
*/
|
*/
|
||||||
public GHCreateRepositoryBuilder createRepository(String name) {
|
public GHCreateRepositoryBuilder createRepository(String name) {
|
||||||
return new GHCreateRepositoryBuilder(root, "/orgs/" + login + "/repos", name);
|
return new GHCreateRepositoryBuilder(name, root, "/orgs/" + login + "/repos");
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -126,6 +128,40 @@ public class GHOrganization extends GHPerson {
|
|||||||
.toIterable(GHTeam[].class, item -> item.wrapUp(this));
|
.toIterable(GHTeam[].class, item -> item.wrapUp(this));
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets a single team by ID.
|
||||||
|
*
|
||||||
|
* @param teamId
|
||||||
|
* id of the team that we want to query for
|
||||||
|
* @return the team
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*
|
||||||
|
* @deprecated Use {@link GHOrganization#getTeam(long)}
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
public GHTeam getTeam(int teamId) throws IOException {
|
||||||
|
return getTeam((long) teamId);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets a single team by ID.
|
||||||
|
*
|
||||||
|
* @param teamId
|
||||||
|
* id of the team that we want to query for
|
||||||
|
* @return the team
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*
|
||||||
|
* @see <a href= "https://developer.github.com/v3/teams/#get-team-by-name">documentation</a>
|
||||||
|
*/
|
||||||
|
public GHTeam getTeam(long teamId) throws IOException {
|
||||||
|
return root.createRequest()
|
||||||
|
.withUrlPath(String.format("/organizations/%d/team/%d", getId(), teamId))
|
||||||
|
.fetch(GHTeam.class)
|
||||||
|
.wrapUp(this);
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Finds a team that has the given name in its {@link GHTeam#getName()}
|
* Finds a team that has the given name in its {@link GHTeam#getName()}
|
||||||
*
|
*
|
||||||
@@ -151,13 +187,13 @@ public class GHOrganization extends GHPerson {
|
|||||||
* @return the team by slug
|
* @return the team by slug
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
|
* @see <a href= "https://developer.github.com/v3/teams/#get-team-by-name">documentation</a>
|
||||||
*/
|
*/
|
||||||
public GHTeam getTeamBySlug(String slug) throws IOException {
|
public GHTeam getTeamBySlug(String slug) throws IOException {
|
||||||
for (GHTeam t : listTeams()) {
|
return root.createRequest()
|
||||||
if (t.getSlug().equals(slug))
|
.withUrlPath(String.format("/orgs/%s/teams/%s", login, slug))
|
||||||
return t;
|
.fetch(GHTeam.class)
|
||||||
}
|
.wrapUp(this);
|
||||||
return null;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -255,7 +291,7 @@ public class GHOrganization extends GHPerson {
|
|||||||
* @deprecated use {@link #listMembers()}
|
* @deprecated use {@link #listMembers()}
|
||||||
*/
|
*/
|
||||||
public List<GHUser> getMembers() throws IOException {
|
public List<GHUser> getMembers() throws IOException {
|
||||||
return listMembers().asList();
|
return listMembers().toList();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -281,7 +317,7 @@ public class GHOrganization extends GHPerson {
|
|||||||
}
|
}
|
||||||
|
|
||||||
private PagedIterable<GHUser> listMembers(String suffix) throws IOException {
|
private PagedIterable<GHUser> listMembers(String suffix) throws IOException {
|
||||||
return listMembers(suffix, null);
|
return listMembers(suffix, null, null);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -294,13 +330,28 @@ public class GHOrganization extends GHPerson {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public PagedIterable<GHUser> listMembersWithFilter(String filter) throws IOException {
|
public PagedIterable<GHUser> listMembersWithFilter(String filter) throws IOException {
|
||||||
return listMembers("members", filter);
|
return listMembers("members", filter, null);
|
||||||
}
|
}
|
||||||
|
|
||||||
private PagedIterable<GHUser> listMembers(final String suffix, final String filter) throws IOException {
|
/**
|
||||||
String filterParams = (filter == null) ? "" : ("?filter=" + filter);
|
* List members with specified role paged iterable.
|
||||||
|
*
|
||||||
|
* @param role
|
||||||
|
* the role
|
||||||
|
* @return the paged iterable
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public PagedIterable<GHUser> listMembersWithRole(String role) throws IOException {
|
||||||
|
return listMembers("members", null, role);
|
||||||
|
}
|
||||||
|
|
||||||
|
private PagedIterable<GHUser> listMembers(final String suffix, final String filter, String role)
|
||||||
|
throws IOException {
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
.withUrlPath(String.format("/orgs/%s/%s%s", login, suffix, filterParams))
|
.withUrlPath(String.format("/orgs/%s/%s", login, suffix))
|
||||||
|
.with("filter", filter)
|
||||||
|
.with("role", role)
|
||||||
.toIterable(GHUser[].class, item -> item.wrapUp(root));
|
.toIterable(GHUser[].class, item -> item.wrapUp(root));
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -370,7 +421,7 @@ public class GHOrganization extends GHPerson {
|
|||||||
* The enum Permission.
|
* The enum Permission.
|
||||||
*/
|
*/
|
||||||
public enum Permission {
|
public enum Permission {
|
||||||
ADMIN, PUSH, PULL
|
ADMIN, MAINTAIN, PUSH, TRIAGE, PULL
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -386,7 +437,7 @@ public class GHOrganization extends GHPerson {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
* @deprecated https://developer.github.com/v3/teams/#create-team deprecates permission field use
|
* @deprecated https://developer.github.com/v3/teams/#create-team deprecates permission field use
|
||||||
* {@link #createTeam(String, Collection)}
|
* {@link #createTeam(String)}
|
||||||
*/
|
*/
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHTeam createTeam(String name, Permission p, Collection<GHRepository> repositories) throws IOException {
|
public GHTeam createTeam(String name, Permission p, Collection<GHRepository> repositories) throws IOException {
|
||||||
@@ -412,7 +463,7 @@ public class GHOrganization extends GHPerson {
|
|||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
* @deprecated https://developer.github.com/v3/teams/#create-team deprecates permission field use
|
* @deprecated https://developer.github.com/v3/teams/#create-team deprecates permission field use
|
||||||
* {@link #createTeam(String, GHRepository...)}
|
* {@link #createTeam(String)}
|
||||||
*/
|
*/
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHTeam createTeam(String name, Permission p, GHRepository... repositories) throws IOException {
|
public GHTeam createTeam(String name, Permission p, GHRepository... repositories) throws IOException {
|
||||||
@@ -429,7 +480,9 @@ public class GHOrganization extends GHPerson {
|
|||||||
* @return the gh team
|
* @return the gh team
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
|
* @deprecated Use {@link #createTeam(String)} that uses a builder pattern to let you control every aspect.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public GHTeam createTeam(String name, Collection<GHRepository> repositories) throws IOException {
|
public GHTeam createTeam(String name, Collection<GHRepository> repositories) throws IOException {
|
||||||
Requester post = root.createRequest().method("POST").with("name", name);
|
Requester post = root.createRequest().method("POST").with("name", name);
|
||||||
List<String> repo_names = new ArrayList<String>();
|
List<String> repo_names = new ArrayList<String>();
|
||||||
@@ -450,11 +503,28 @@ public class GHOrganization extends GHPerson {
|
|||||||
* @return the gh team
|
* @return the gh team
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
|
* @deprecated Use {@link #createTeam(String)} that uses a builder pattern to let you control every aspect.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public GHTeam createTeam(String name, GHRepository... repositories) throws IOException {
|
public GHTeam createTeam(String name, GHRepository... repositories) throws IOException {
|
||||||
return createTeam(name, Arrays.asList(repositories));
|
return createTeam(name, Arrays.asList(repositories));
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Starts a builder that creates a new team.
|
||||||
|
*
|
||||||
|
* <p>
|
||||||
|
* You use the returned builder to set various properties, then call {@link GHTeamBuilder#create()} to finally
|
||||||
|
* create a team.
|
||||||
|
*
|
||||||
|
* @param name
|
||||||
|
* the name
|
||||||
|
* @return the gh create repository builder
|
||||||
|
*/
|
||||||
|
public GHTeamBuilder createTeam(String name) {
|
||||||
|
return new GHTeamBuilder(root, login, name);
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* List up repositories that has some open pull requests.
|
* List up repositories that has some open pull requests.
|
||||||
* <p>
|
* <p>
|
||||||
|
|||||||
@@ -2,13 +2,14 @@ package org.kohsuke.github;
|
|||||||
|
|
||||||
import java.io.FileNotFoundException;
|
import java.io.FileNotFoundException;
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
|
import java.net.MalformedURLException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
import java.util.Arrays;
|
|
||||||
import java.util.Collections;
|
import java.util.Collections;
|
||||||
import java.util.Date;
|
import java.util.Date;
|
||||||
import java.util.Iterator;
|
import java.util.Iterator;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
import java.util.Map;
|
import java.util.Map;
|
||||||
|
import java.util.Optional;
|
||||||
import java.util.TreeMap;
|
import java.util.TreeMap;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -17,16 +18,18 @@ import java.util.TreeMap;
|
|||||||
* @author Kohsuke Kawaguchi
|
* @author Kohsuke Kawaguchi
|
||||||
*/
|
*/
|
||||||
public abstract class GHPerson extends GHObject {
|
public abstract class GHPerson extends GHObject {
|
||||||
/* package almost final */ GitHub root;
|
|
||||||
|
|
||||||
// core data fields that exist even for "small" user data (such as the user info in pull request)
|
// core data fields that exist even for "small" user data (such as the user info in pull request)
|
||||||
protected String login, avatar_url, gravatar_id;
|
protected String login, avatar_url;
|
||||||
|
|
||||||
// other fields (that only show up in full data)
|
// other fields (that only show up in full data)
|
||||||
protected String location, blog, email, name, company, type;
|
protected String location, blog, email, bio, name, company, type, twitter_username;
|
||||||
protected String html_url;
|
protected String html_url;
|
||||||
protected int followers, following, public_repos, public_gists;
|
protected int followers, following, public_repos, public_gists;
|
||||||
protected boolean site_admin;
|
protected boolean site_admin, hireable;
|
||||||
|
|
||||||
|
// other fields (that only show up in full data) that require privileged scope
|
||||||
|
protected Integer total_private_repos;
|
||||||
|
|
||||||
GHPerson wrapUp(GitHub root) {
|
GHPerson wrapUp(GitHub root) {
|
||||||
this.root = root;
|
this.root = root;
|
||||||
@@ -42,13 +45,16 @@ public abstract class GHPerson extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
protected synchronized void populate() throws IOException {
|
protected synchronized void populate() throws IOException {
|
||||||
if (created_at != null) {
|
if (super.getCreatedAt() != null) {
|
||||||
return; // already populated
|
return; // already populated
|
||||||
}
|
}
|
||||||
if (root == null || root.isOffline()) {
|
if (root == null || root.isOffline()) {
|
||||||
return; // cannot populate, will have to live with what we have
|
return; // cannot populate, will have to live with what we have
|
||||||
}
|
}
|
||||||
root.createRequest().withUrlPath(url).fetchInto(this);
|
URL url = getUrl();
|
||||||
|
if (url != null) {
|
||||||
|
root.createRequest().setRawUrlPath(url.toString()).fetchInto(this);
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -112,11 +118,17 @@ public abstract class GHPerson extends GHObject {
|
|||||||
*/
|
*/
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public synchronized Iterable<List<GHRepository>> iterateRepositories(final int pageSize) {
|
public synchronized Iterable<List<GHRepository>> iterateRepositories(final int pageSize) {
|
||||||
return new Iterable<List<GHRepository>>() {
|
return () -> {
|
||||||
public Iterator<List<GHRepository>> iterator() {
|
final PagedIterator<GHRepository> pager;
|
||||||
final Iterator<GHRepository[]> pager = root.createRequest()
|
try {
|
||||||
.withUrlPath("users", login, "repos")
|
GitHubPageIterator<GHRepository[]> iterator = GitHubPageIterator.create(root.getClient(),
|
||||||
.asIterator(GHRepository[].class, pageSize);
|
GHRepository[].class,
|
||||||
|
root.createRequest().withUrlPath("users", login, "repos").build(),
|
||||||
|
pageSize);
|
||||||
|
pager = new PagedIterator<>(iterator, item -> item.wrap(root));
|
||||||
|
} catch (MalformedURLException e) {
|
||||||
|
throw new GHException("Unable to build GitHub API URL", e);
|
||||||
|
}
|
||||||
|
|
||||||
return new Iterator<List<GHRepository>>() {
|
return new Iterator<List<GHRepository>>() {
|
||||||
public boolean hasNext() {
|
public boolean hasNext() {
|
||||||
@@ -124,17 +136,9 @@ public abstract class GHPerson extends GHObject {
|
|||||||
}
|
}
|
||||||
|
|
||||||
public List<GHRepository> next() {
|
public List<GHRepository> next() {
|
||||||
GHRepository[] batch = pager.next();
|
return pager.nextPage();
|
||||||
for (GHRepository r : batch)
|
|
||||||
r.root = root;
|
|
||||||
return Arrays.asList(batch);
|
|
||||||
}
|
|
||||||
|
|
||||||
public void remove() {
|
|
||||||
throw new UnsupportedOperationException();
|
|
||||||
}
|
}
|
||||||
};
|
};
|
||||||
}
|
|
||||||
};
|
};
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -149,10 +153,7 @@ public abstract class GHPerson extends GHObject {
|
|||||||
*/
|
*/
|
||||||
public GHRepository getRepository(String name) throws IOException {
|
public GHRepository getRepository(String name) throws IOException {
|
||||||
try {
|
try {
|
||||||
return root.createRequest()
|
return GHRepository.read(root, login, name);
|
||||||
.withUrlPath("/repos/" + login + '/' + name)
|
|
||||||
.fetch(GHRepository.class)
|
|
||||||
.wrap(root);
|
|
||||||
} catch (FileNotFoundException e) {
|
} catch (FileNotFoundException e) {
|
||||||
return null;
|
return null;
|
||||||
}
|
}
|
||||||
@@ -173,22 +174,18 @@ public abstract class GHPerson extends GHObject {
|
|||||||
* @return the gravatar id
|
* @return the gravatar id
|
||||||
* @deprecated No longer available in the v3 API.
|
* @deprecated No longer available in the v3 API.
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public String getGravatarId() {
|
public String getGravatarId() {
|
||||||
return gravatar_id;
|
return "";
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Returns a string like 'https://secure.gravatar.com/avatar/0cb9832a01c22c083390f3c5dcb64105' that indicates the
|
* Returns a string of the avatar image URL.
|
||||||
* avatar image URL.
|
|
||||||
*
|
*
|
||||||
* @return the avatar url
|
* @return the avatar url
|
||||||
*/
|
*/
|
||||||
public String getAvatarUrl() {
|
public String getAvatarUrl() {
|
||||||
if (avatar_url != null)
|
|
||||||
return avatar_url;
|
return avatar_url;
|
||||||
if (gravatar_id != null)
|
|
||||||
return "https://secure.gravatar.com/avatar/" + gravatar_id;
|
|
||||||
return null;
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -236,6 +233,18 @@ public abstract class GHPerson extends GHObject {
|
|||||||
return location;
|
return location;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the Twitter Username of this user, like "GitHub"
|
||||||
|
*
|
||||||
|
* @return the Twitter username
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public String getTwitterUsername() throws IOException {
|
||||||
|
populate();
|
||||||
|
return twitter_username;
|
||||||
|
}
|
||||||
|
|
||||||
public Date getCreatedAt() throws IOException {
|
public Date getCreatedAt() throws IOException {
|
||||||
populate();
|
populate();
|
||||||
return super.getCreatedAt();
|
return super.getCreatedAt();
|
||||||
@@ -260,7 +269,7 @@ public abstract class GHPerson extends GHObject {
|
|||||||
|
|
||||||
@Override
|
@Override
|
||||||
public URL getHtmlUrl() {
|
public URL getHtmlUrl() {
|
||||||
return GitHub.parseURL(html_url);
|
return GitHubClient.parseURL(html_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -346,4 +355,16 @@ public abstract class GHPerson extends GHObject {
|
|||||||
populate();
|
populate();
|
||||||
return site_admin;
|
return site_admin;
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets total private repo count.
|
||||||
|
*
|
||||||
|
* @return the total private repo count
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
public Optional<Integer> getTotalPrivateRepoCount() throws IOException {
|
||||||
|
populate();
|
||||||
|
return Optional.ofNullable(total_private_repos);
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -28,7 +28,7 @@ import java.io.IOException;
|
|||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
import java.util.Locale;
|
import java.util.Locale;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.INERTIA;
|
import static org.kohsuke.github.internal.Previews.INERTIA;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* A GitHub project.
|
* A GitHub project.
|
||||||
@@ -37,12 +37,10 @@ import static org.kohsuke.github.Previews.INERTIA;
|
|||||||
* @see <a href="https://developer.github.com/v3/projects/">Projects</a>
|
* @see <a href="https://developer.github.com/v3/projects/">Projects</a>
|
||||||
*/
|
*/
|
||||||
public class GHProject extends GHObject {
|
public class GHProject extends GHObject {
|
||||||
protected GitHub root;
|
|
||||||
protected GHObject owner;
|
protected GHObject owner;
|
||||||
|
|
||||||
private String owner_url;
|
private String owner_url;
|
||||||
private String html_url;
|
private String html_url;
|
||||||
private String node_id;
|
|
||||||
private String name;
|
private String name;
|
||||||
private String body;
|
private String body;
|
||||||
private int number;
|
private int number;
|
||||||
@@ -51,7 +49,7 @@ public class GHProject extends GHObject {
|
|||||||
|
|
||||||
@Override
|
@Override
|
||||||
public URL getHtmlUrl() throws IOException {
|
public URL getHtmlUrl() throws IOException {
|
||||||
return GitHub.parseURL(html_url);
|
return GitHubClient.parseURL(html_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -81,10 +79,8 @@ public class GHProject extends GHObject {
|
|||||||
} else if (owner_url.contains("/users/")) {
|
} else if (owner_url.contains("/users/")) {
|
||||||
owner = root.createRequest().withUrlPath(getOwnerUrl().getPath()).fetch(GHUser.class).wrapUp(root);
|
owner = root.createRequest().withUrlPath(getOwnerUrl().getPath()).fetch(GHUser.class).wrapUp(root);
|
||||||
} else if (owner_url.contains("/repos/")) {
|
} else if (owner_url.contains("/repos/")) {
|
||||||
owner = root.createRequest()
|
String[] pathElements = getOwnerUrl().getPath().split("/");
|
||||||
.withUrlPath(getOwnerUrl().getPath())
|
owner = GHRepository.read(root, pathElements[1], pathElements[2]);
|
||||||
.fetch(GHRepository.class)
|
|
||||||
.wrap(root);
|
|
||||||
}
|
}
|
||||||
} catch (FileNotFoundException e) {
|
} catch (FileNotFoundException e) {
|
||||||
return null;
|
return null;
|
||||||
@@ -99,16 +95,18 @@ public class GHProject extends GHObject {
|
|||||||
* @return the owner url
|
* @return the owner url
|
||||||
*/
|
*/
|
||||||
public URL getOwnerUrl() {
|
public URL getOwnerUrl() {
|
||||||
return GitHub.parseURL(owner_url);
|
return GitHubClient.parseURL(owner_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets node id.
|
* Gets node id.
|
||||||
*
|
*
|
||||||
|
* @deprecated Use {@link GHObject#getNodeId()}
|
||||||
* @return the node id
|
* @return the node id
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public String getNode_id() {
|
public String getNode_id() {
|
||||||
return node_id;
|
return getNodeId();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -191,7 +189,7 @@ public class GHProject extends GHObject {
|
|||||||
* @return the api route
|
* @return the api route
|
||||||
*/
|
*/
|
||||||
protected String getApiRoute() {
|
protected String getApiRoute() {
|
||||||
return "/projects/" + id;
|
return "/projects/" + getId();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -290,7 +288,7 @@ public class GHProject extends GHObject {
|
|||||||
final GHProject project = this;
|
final GHProject project = this;
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
.withPreview(INERTIA)
|
.withPreview(INERTIA)
|
||||||
.withUrlPath(String.format("/projects/%d/columns", id))
|
.withUrlPath(String.format("/projects/%d/columns", getId()))
|
||||||
.toIterable(GHProjectColumn[].class, item -> item.wrap(project));
|
.toIterable(GHProjectColumn[].class, item -> item.wrap(project));
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -308,7 +306,7 @@ public class GHProject extends GHObject {
|
|||||||
.method("POST")
|
.method("POST")
|
||||||
.withPreview(INERTIA)
|
.withPreview(INERTIA)
|
||||||
.with("name", name)
|
.with("name", name)
|
||||||
.withUrlPath(String.format("/projects/%d/columns", id))
|
.withUrlPath(String.format("/projects/%d/columns", getId()))
|
||||||
.fetch(GHProjectColumn.class)
|
.fetch(GHProjectColumn.class)
|
||||||
.wrap(this);
|
.wrap(this);
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -6,7 +6,7 @@ import java.io.FileNotFoundException;
|
|||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.INERTIA;
|
import static org.kohsuke.github.internal.Previews.INERTIA;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The type GHProjectCard.
|
* The type GHProjectCard.
|
||||||
@@ -14,7 +14,6 @@ import static org.kohsuke.github.Previews.INERTIA;
|
|||||||
* @author Gunnar Skjold
|
* @author Gunnar Skjold
|
||||||
*/
|
*/
|
||||||
public class GHProjectCard extends GHObject {
|
public class GHProjectCard extends GHObject {
|
||||||
private GitHub root;
|
|
||||||
private GHProject project;
|
private GHProject project;
|
||||||
private GHProjectColumn column;
|
private GHProjectColumn column;
|
||||||
|
|
||||||
@@ -149,7 +148,7 @@ public class GHProjectCard extends GHObject {
|
|||||||
* @return the content url
|
* @return the content url
|
||||||
*/
|
*/
|
||||||
public URL getContentUrl() {
|
public URL getContentUrl() {
|
||||||
return GitHub.parseURL(content_url);
|
return GitHubClient.parseURL(content_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -158,7 +157,7 @@ public class GHProjectCard extends GHObject {
|
|||||||
* @return the project url
|
* @return the project url
|
||||||
*/
|
*/
|
||||||
public URL getProjectUrl() {
|
public URL getProjectUrl() {
|
||||||
return GitHub.parseURL(project_url);
|
return GitHubClient.parseURL(project_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -167,7 +166,7 @@ public class GHProjectCard extends GHObject {
|
|||||||
* @return the column url
|
* @return the column url
|
||||||
*/
|
*/
|
||||||
public URL getColumnUrl() {
|
public URL getColumnUrl() {
|
||||||
return GitHub.parseURL(column_url);
|
return GitHubClient.parseURL(column_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -213,7 +212,7 @@ public class GHProjectCard extends GHObject {
|
|||||||
* @return the api route
|
* @return the api route
|
||||||
*/
|
*/
|
||||||
protected String getApiRoute() {
|
protected String getApiRoute() {
|
||||||
return String.format("/projects/columns/cards/%d", id);
|
return String.format("/projects/columns/cards/%d", getId());
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|||||||
@@ -4,7 +4,7 @@ import java.io.FileNotFoundException;
|
|||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.INERTIA;
|
import static org.kohsuke.github.internal.Previews.INERTIA;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The type GHProjectColumn.
|
* The type GHProjectColumn.
|
||||||
@@ -12,7 +12,6 @@ import static org.kohsuke.github.Previews.INERTIA;
|
|||||||
* @author Gunnar Skjold
|
* @author Gunnar Skjold
|
||||||
*/
|
*/
|
||||||
public class GHProjectColumn extends GHObject {
|
public class GHProjectColumn extends GHObject {
|
||||||
protected GitHub root;
|
|
||||||
protected GHProject project;
|
protected GHProject project;
|
||||||
|
|
||||||
private String name;
|
private String name;
|
||||||
@@ -90,7 +89,7 @@ public class GHProjectColumn extends GHObject {
|
|||||||
* @return the project url
|
* @return the project url
|
||||||
*/
|
*/
|
||||||
public URL getProjectUrl() {
|
public URL getProjectUrl() {
|
||||||
return GitHub.parseURL(project_url);
|
return GitHubClient.parseURL(project_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -115,7 +114,7 @@ public class GHProjectColumn extends GHObject {
|
|||||||
* @return the api route
|
* @return the api route
|
||||||
*/
|
*/
|
||||||
protected String getApiRoute() {
|
protected String getApiRoute() {
|
||||||
return String.format("/projects/columns/%d", id);
|
return String.format("/projects/columns/%d", getId());
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -139,7 +138,7 @@ public class GHProjectColumn extends GHObject {
|
|||||||
final GHProjectColumn column = this;
|
final GHProjectColumn column = this;
|
||||||
return root.createRequest()
|
return root.createRequest()
|
||||||
.withPreview(INERTIA)
|
.withPreview(INERTIA)
|
||||||
.withUrlPath(String.format("/projects/columns/%d/cards", id))
|
.withUrlPath(String.format("/projects/columns/%d/cards", getId()))
|
||||||
.toIterable(GHProjectCard[].class, item -> item.wrap(column));
|
.toIterable(GHProjectCard[].class, item -> item.wrap(column));
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -157,7 +156,7 @@ public class GHProjectColumn extends GHObject {
|
|||||||
.method("POST")
|
.method("POST")
|
||||||
.withPreview(INERTIA)
|
.withPreview(INERTIA)
|
||||||
.with("note", note)
|
.with("note", note)
|
||||||
.withUrlPath(String.format("/projects/columns/%d/cards", id))
|
.withUrlPath(String.format("/projects/columns/%d/cards", getId()))
|
||||||
.fetch(GHProjectCard.class)
|
.fetch(GHProjectCard.class)
|
||||||
.wrap(this);
|
.wrap(this);
|
||||||
}
|
}
|
||||||
@@ -177,7 +176,7 @@ public class GHProjectColumn extends GHObject {
|
|||||||
.withPreview(INERTIA)
|
.withPreview(INERTIA)
|
||||||
.with("content_type", issue instanceof GHPullRequest ? "PullRequest" : "Issue")
|
.with("content_type", issue instanceof GHPullRequest ? "PullRequest" : "Issue")
|
||||||
.with("content_id", issue.getId())
|
.with("content_id", issue.getId())
|
||||||
.withUrlPath(String.format("/projects/columns/%d/cards", id))
|
.withUrlPath(String.format("/projects/columns/%d/cards", getId()))
|
||||||
.fetch(GHProjectCard.class)
|
.fetch(GHProjectCard.class)
|
||||||
.wrap(this);
|
.wrap(this);
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -23,18 +23,21 @@
|
|||||||
*/
|
*/
|
||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import org.apache.commons.lang3.StringUtils;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
import java.util.ArrayList;
|
import java.util.ArrayList;
|
||||||
import java.util.Arrays;
|
import java.util.Arrays;
|
||||||
import java.util.Collection;
|
|
||||||
import java.util.Collections;
|
import java.util.Collections;
|
||||||
import java.util.Date;
|
import java.util.Date;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
|
import java.util.Objects;
|
||||||
|
|
||||||
import javax.annotation.CheckForNull;
|
import javax.annotation.CheckForNull;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.SHADOW_CAT;
|
import static org.kohsuke.github.internal.Previews.LYDIAN;
|
||||||
|
import static org.kohsuke.github.internal.Previews.SHADOW_CAT;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* A pull request.
|
* A pull request.
|
||||||
@@ -69,13 +72,6 @@ public class GHPullRequest extends GHIssue implements Refreshable {
|
|||||||
private GHUser[] requested_reviewers;
|
private GHUser[] requested_reviewers;
|
||||||
private GHTeam[] requested_teams;
|
private GHTeam[] requested_teams;
|
||||||
|
|
||||||
/**
|
|
||||||
* GitHub doesn't return some properties of {@link GHIssue} when requesting the GET on the 'pulls' API route as
|
|
||||||
* opposed to 'issues' API route. This flag remembers whether we made the GET call on the 'issues' route on this
|
|
||||||
* object to fill in those missing details
|
|
||||||
*/
|
|
||||||
private transient boolean fetchedIssueDetails;
|
|
||||||
|
|
||||||
GHPullRequest wrapUp(GHRepository owner) {
|
GHPullRequest wrapUp(GHRepository owner) {
|
||||||
this.wrap(owner);
|
this.wrap(owner);
|
||||||
return wrapUp(owner.root);
|
return wrapUp(owner.root);
|
||||||
@@ -99,6 +95,12 @@ public class GHPullRequest extends GHIssue implements Refreshable {
|
|||||||
|
|
||||||
@Override
|
@Override
|
||||||
protected String getApiRoute() {
|
protected String getApiRoute() {
|
||||||
|
if (owner == null) {
|
||||||
|
// Issues returned from search to do not have an owner. Attempt to use url.
|
||||||
|
final URL url = Objects.requireNonNull(getUrl(), "Missing instance URL!");
|
||||||
|
return StringUtils.prependIfMissing(url.toString().replace(root.getApiUrl(), ""), "/");
|
||||||
|
|
||||||
|
}
|
||||||
return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/pulls/" + number;
|
return "/repos/" + owner.getOwnerName() + "/" + owner.getName() + "/pulls/" + number;
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -108,7 +110,7 @@ public class GHPullRequest extends GHIssue implements Refreshable {
|
|||||||
* @return the patch url
|
* @return the patch url
|
||||||
*/
|
*/
|
||||||
public URL getPatchUrl() {
|
public URL getPatchUrl() {
|
||||||
return GitHub.parseURL(patch_url);
|
return GitHubClient.parseURL(patch_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -117,7 +119,7 @@ public class GHPullRequest extends GHIssue implements Refreshable {
|
|||||||
* @return the issue url
|
* @return the issue url
|
||||||
*/
|
*/
|
||||||
public URL getIssueUrl() {
|
public URL getIssueUrl() {
|
||||||
return GitHub.parseURL(issue_url);
|
return GitHubClient.parseURL(issue_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -156,7 +158,7 @@ public class GHPullRequest extends GHIssue implements Refreshable {
|
|||||||
* @return the diff url
|
* @return the diff url
|
||||||
*/
|
*/
|
||||||
public URL getDiffUrl() {
|
public URL getDiffUrl() {
|
||||||
return GitHub.parseURL(diff_url);
|
return GitHubClient.parseURL(diff_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -165,13 +167,7 @@ public class GHPullRequest extends GHIssue implements Refreshable {
|
|||||||
* @return the merged at
|
* @return the merged at
|
||||||
*/
|
*/
|
||||||
public Date getMergedAt() {
|
public Date getMergedAt() {
|
||||||
return GitHub.parseDate(merged_at);
|
return GitHubClient.parseDate(merged_at);
|
||||||
}
|
|
||||||
|
|
||||||
@Override
|
|
||||||
public Collection<GHLabel> getLabels() throws IOException {
|
|
||||||
fetchIssue();
|
|
||||||
return super.getLabels();
|
|
||||||
}
|
}
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
@@ -381,10 +377,14 @@ public class GHPullRequest extends GHIssue implements Refreshable {
|
|||||||
* Repopulates this object.
|
* Repopulates this object.
|
||||||
*/
|
*/
|
||||||
public void refresh() throws IOException {
|
public void refresh() throws IOException {
|
||||||
if (root.isOffline()) {
|
if (root == null || root.isOffline()) {
|
||||||
return; // cannot populate, will have to live with what we have
|
return; // cannot populate, will have to live with what we have
|
||||||
}
|
}
|
||||||
root.createRequest().withPreview(SHADOW_CAT).withUrlPath(url).fetchInto(this).wrapUp(owner);
|
|
||||||
|
URL url = getUrl();
|
||||||
|
if (url != null) {
|
||||||
|
root.createRequest().withPreview(SHADOW_CAT).setRawUrlPath(url.toString()).fetchInto(this).wrapUp(owner);
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -447,6 +447,7 @@ public class GHPullRequest extends GHIssue implements Refreshable {
|
|||||||
* the io exception
|
* the io exception
|
||||||
* @deprecated Use {@link #createReview()}
|
* @deprecated Use {@link #createReview()}
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public GHPullRequestReview createReview(String body,
|
public GHPullRequestReview createReview(String body,
|
||||||
@CheckForNull GHPullRequestReviewState event,
|
@CheckForNull GHPullRequestReviewState event,
|
||||||
GHPullRequestReviewComment... comments) throws IOException {
|
GHPullRequestReviewComment... comments) throws IOException {
|
||||||
@@ -467,6 +468,7 @@ public class GHPullRequest extends GHIssue implements Refreshable {
|
|||||||
* the io exception
|
* the io exception
|
||||||
* @deprecated Use {@link #createReview()}
|
* @deprecated Use {@link #createReview()}
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public GHPullRequestReview createReview(String body,
|
public GHPullRequestReview createReview(String body,
|
||||||
@CheckForNull GHPullRequestReviewState event,
|
@CheckForNull GHPullRequestReviewState event,
|
||||||
List<GHPullRequestReviewComment> comments) throws IOException {
|
List<GHPullRequestReviewComment> comments) throws IOException {
|
||||||
@@ -550,6 +552,41 @@ public class GHPullRequest extends GHIssue implements Refreshable {
|
|||||||
.send();
|
.send();
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Set the base branch on the pull request
|
||||||
|
*
|
||||||
|
* @param newBaseBranch
|
||||||
|
* the name of the new base branch
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
* @return the updated pull request
|
||||||
|
*/
|
||||||
|
public GHPullRequest setBaseBranch(String newBaseBranch) throws IOException {
|
||||||
|
return root.createRequest()
|
||||||
|
.method("PATCH")
|
||||||
|
.with("base", newBaseBranch)
|
||||||
|
.withUrlPath(getApiRoute())
|
||||||
|
.fetch(GHPullRequest.class)
|
||||||
|
.wrapUp(root);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Updates the branch. The same as pressing the button in the web GUI.
|
||||||
|
*
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
*/
|
||||||
|
@Preview(LYDIAN)
|
||||||
|
@Deprecated
|
||||||
|
public void updateBranch() throws IOException {
|
||||||
|
root.createRequest()
|
||||||
|
.withPreview(LYDIAN)
|
||||||
|
.method("PUT")
|
||||||
|
.with("expected_head_sha", head.getSha())
|
||||||
|
.withUrlPath(getApiRoute() + "/update-branch")
|
||||||
|
.send();
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Merge this pull request.
|
* Merge this pull request.
|
||||||
* <p>
|
* <p>
|
||||||
@@ -611,10 +648,4 @@ public class GHPullRequest extends GHIssue implements Refreshable {
|
|||||||
MERGE, SQUASH, REBASE
|
MERGE, SQUASH, REBASE
|
||||||
}
|
}
|
||||||
|
|
||||||
private void fetchIssue() throws IOException {
|
|
||||||
if (!fetchedIssueDetails) {
|
|
||||||
root.createRequest().withUrlPath(getIssuesApiRoute()).fetchInto(this);
|
|
||||||
fetchedIssueDetails = true;
|
|
||||||
}
|
|
||||||
}
|
|
||||||
}
|
}
|
||||||
|
|||||||
86
src/main/java/org/kohsuke/github/GHPullRequestChanges.java
Normal file
86
src/main/java/org/kohsuke/github/GHPullRequestChanges.java
Normal file
@@ -0,0 +1,86 @@
|
|||||||
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Wrapper to define changed fields on pull_request action="edited"
|
||||||
|
*
|
||||||
|
* @see GHEventPayload.PullRequest
|
||||||
|
*/
|
||||||
|
@SuppressFBWarnings("UWF_UNWRITTEN_FIELD")
|
||||||
|
public class GHPullRequestChanges {
|
||||||
|
|
||||||
|
private GHCommitPointer base;
|
||||||
|
private GHFrom title;
|
||||||
|
private GHFrom body;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Old target branch for pull request.
|
||||||
|
*
|
||||||
|
* @return old target branch info (or null if not changed)
|
||||||
|
*/
|
||||||
|
public GHCommitPointer getBase() {
|
||||||
|
return base;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Old pull request title.
|
||||||
|
*
|
||||||
|
* @return old pull request title (or null if not changed)
|
||||||
|
*/
|
||||||
|
public GHFrom getTitle() {
|
||||||
|
return title;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Old pull request body.
|
||||||
|
*
|
||||||
|
* @return old pull request body (or null if not changed)
|
||||||
|
*/
|
||||||
|
public GHFrom getBody() {
|
||||||
|
return body;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* @see org.kohsuke.github.GHCommitPointer
|
||||||
|
*/
|
||||||
|
public static class GHCommitPointer {
|
||||||
|
private GHFrom ref;
|
||||||
|
private GHFrom sha;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Named ref to the commit. This (from value) appears to be a "short ref" that doesn't include "refs/heads/"
|
||||||
|
* portion.
|
||||||
|
*
|
||||||
|
* @return the ref
|
||||||
|
*/
|
||||||
|
public GHFrom getRef() {
|
||||||
|
return ref;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* SHA1 of the commit.
|
||||||
|
*
|
||||||
|
* @return sha
|
||||||
|
*/
|
||||||
|
public GHFrom getSha() {
|
||||||
|
return sha;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Wrapper for changed values.
|
||||||
|
*/
|
||||||
|
public static class GHFrom {
|
||||||
|
private String from;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Previous value that was changed.
|
||||||
|
*
|
||||||
|
* @return previous value
|
||||||
|
*/
|
||||||
|
public String getFrom() {
|
||||||
|
return from;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
}
|
||||||
@@ -75,7 +75,7 @@ public class GHPullRequestCommitDetail {
|
|||||||
* @return the url
|
* @return the url
|
||||||
*/
|
*/
|
||||||
public URL getUrl() {
|
public URL getUrl() {
|
||||||
return GitHub.parseURL(url);
|
return GitHubClient.parseURL(url);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -125,7 +125,7 @@ public class GHPullRequestCommitDetail {
|
|||||||
* @return the url
|
* @return the url
|
||||||
*/
|
*/
|
||||||
public URL getUrl() {
|
public URL getUrl() {
|
||||||
return GitHub.parseURL(url);
|
return GitHubClient.parseURL(url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -161,7 +161,7 @@ public class GHPullRequestCommitDetail {
|
|||||||
* @return the url
|
* @return the url
|
||||||
*/
|
*/
|
||||||
public URL getUrl() {
|
public URL getUrl() {
|
||||||
return GitHub.parseURL(url);
|
return GitHubClient.parseURL(url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -170,7 +170,7 @@ public class GHPullRequestCommitDetail {
|
|||||||
* @return the html url
|
* @return the html url
|
||||||
*/
|
*/
|
||||||
public URL getHtml_url() {
|
public URL getHtml_url() {
|
||||||
return GitHub.parseURL(html_url);
|
return GitHubClient.parseURL(html_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -214,7 +214,7 @@ public class GHPullRequestCommitDetail {
|
|||||||
* @return the api url
|
* @return the api url
|
||||||
*/
|
*/
|
||||||
public URL getApiUrl() {
|
public URL getApiUrl() {
|
||||||
return GitHub.parseURL(url);
|
return GitHubClient.parseURL(url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -223,7 +223,7 @@ public class GHPullRequestCommitDetail {
|
|||||||
* @return the url
|
* @return the url
|
||||||
*/
|
*/
|
||||||
public URL getUrl() {
|
public URL getUrl() {
|
||||||
return GitHub.parseURL(html_url);
|
return GitHubClient.parseURL(html_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -232,7 +232,7 @@ public class GHPullRequestCommitDetail {
|
|||||||
* @return the comments url
|
* @return the comments url
|
||||||
*/
|
*/
|
||||||
public URL getCommentsUrl() {
|
public URL getCommentsUrl() {
|
||||||
return GitHub.parseURL(comments_url);
|
return GitHubClient.parseURL(comments_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|||||||
@@ -105,7 +105,7 @@ public class GHPullRequestFileDetail {
|
|||||||
* @return the blob url
|
* @return the blob url
|
||||||
*/
|
*/
|
||||||
public URL getBlobUrl() {
|
public URL getBlobUrl() {
|
||||||
return GitHub.parseURL(blob_url);
|
return GitHubClient.parseURL(blob_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -114,7 +114,7 @@ public class GHPullRequestFileDetail {
|
|||||||
* @return the raw url
|
* @return the raw url
|
||||||
*/
|
*/
|
||||||
public URL getRawUrl() {
|
public URL getRawUrl() {
|
||||||
return GitHub.parseURL(raw_url);
|
return GitHubClient.parseURL(raw_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -123,7 +123,7 @@ public class GHPullRequestFileDetail {
|
|||||||
* @return the contents url
|
* @return the contents url
|
||||||
*/
|
*/
|
||||||
public URL getContentsUrl() {
|
public URL getContentsUrl() {
|
||||||
return GitHub.parseURL(contents_url);
|
return GitHubClient.parseURL(contents_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
|
|||||||
@@ -1,6 +1,6 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.SHADOW_CAT;
|
import static org.kohsuke.github.internal.Previews.SHADOW_CAT;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Lists up pull requests with some filtering and sorting.
|
* Lists up pull requests with some filtering and sorting.
|
||||||
|
|||||||
@@ -46,6 +46,7 @@ public class GHPullRequestReview extends GHObject {
|
|||||||
private String commit_id;
|
private String commit_id;
|
||||||
private GHPullRequestReviewState state;
|
private GHPullRequestReviewState state;
|
||||||
private String submitted_at;
|
private String submitted_at;
|
||||||
|
private String html_url;
|
||||||
|
|
||||||
GHPullRequestReview wrapUp(GHPullRequest owner) {
|
GHPullRequestReview wrapUp(GHPullRequest owner) {
|
||||||
this.owner = owner;
|
this.owner = owner;
|
||||||
@@ -102,7 +103,7 @@ public class GHPullRequestReview extends GHObject {
|
|||||||
|
|
||||||
@Override
|
@Override
|
||||||
public URL getHtmlUrl() {
|
public URL getHtmlUrl() {
|
||||||
return null;
|
return GitHubClient.parseURL(html_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -111,7 +112,7 @@ public class GHPullRequestReview extends GHObject {
|
|||||||
* @return the api route
|
* @return the api route
|
||||||
*/
|
*/
|
||||||
protected String getApiRoute() {
|
protected String getApiRoute() {
|
||||||
return owner.getApiRoute() + "/reviews/" + id;
|
return owner.getApiRoute() + "/reviews/" + getId();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -122,7 +123,7 @@ public class GHPullRequestReview extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public Date getSubmittedAt() throws IOException {
|
public Date getSubmittedAt() throws IOException {
|
||||||
return GitHub.parseDate(submitted_at);
|
return GitHubClient.parseDate(submitted_at);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -145,6 +146,7 @@ public class GHPullRequestReview extends GHObject {
|
|||||||
* @deprecated Former preview method that changed when it got public. Left here for backward compatibility. Use
|
* @deprecated Former preview method that changed when it got public. Left here for backward compatibility. Use
|
||||||
* {@link #submit(String, GHPullRequestReviewEvent)}
|
* {@link #submit(String, GHPullRequestReviewEvent)}
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public void submit(String body, GHPullRequestReviewState state) throws IOException {
|
public void submit(String body, GHPullRequestReviewState state) throws IOException {
|
||||||
submit(body, state.toEvent());
|
submit(body, state.toEvent());
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -28,7 +28,7 @@ import java.net.URL;
|
|||||||
|
|
||||||
import javax.annotation.CheckForNull;
|
import javax.annotation.CheckForNull;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.*;
|
import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Review comment to the pull request
|
* Review comment to the pull request
|
||||||
@@ -44,6 +44,7 @@ public class GHPullRequestReviewComment extends GHObject implements Reactable {
|
|||||||
private String body;
|
private String body;
|
||||||
private GHUser user;
|
private GHUser user;
|
||||||
private String path;
|
private String path;
|
||||||
|
private String html_url;
|
||||||
private int position = -1;
|
private int position = -1;
|
||||||
private int original_position = -1;
|
private int original_position = -1;
|
||||||
private long in_reply_to_id = -1L;
|
private long in_reply_to_id = -1L;
|
||||||
@@ -60,6 +61,7 @@ public class GHPullRequestReviewComment extends GHObject implements Reactable {
|
|||||||
* @return the gh pull request review comment
|
* @return the gh pull request review comment
|
||||||
* @deprecated You should be using {@link GHPullRequestReviewBuilder#comment(String, String, int)}
|
* @deprecated You should be using {@link GHPullRequestReviewBuilder#comment(String, String, int)}
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public static GHPullRequestReviewComment draft(String body, String path, int position) {
|
public static GHPullRequestReviewComment draft(String body, String path, int position) {
|
||||||
GHPullRequestReviewComment result = new GHPullRequestReviewComment();
|
GHPullRequestReviewComment result = new GHPullRequestReviewComment();
|
||||||
result.body = body;
|
result.body = body;
|
||||||
@@ -142,7 +144,7 @@ public class GHPullRequestReviewComment extends GHObject implements Reactable {
|
|||||||
|
|
||||||
@Override
|
@Override
|
||||||
public URL getHtmlUrl() {
|
public URL getHtmlUrl() {
|
||||||
return null;
|
return GitHubClient.parseURL(html_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -151,7 +153,20 @@ public class GHPullRequestReviewComment extends GHObject implements Reactable {
|
|||||||
* @return the api route
|
* @return the api route
|
||||||
*/
|
*/
|
||||||
protected String getApiRoute() {
|
protected String getApiRoute() {
|
||||||
return "/repos/" + owner.getRepository().getFullName() + "/pulls/comments/" + id;
|
return getApiRoute(false);
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets api route.
|
||||||
|
*
|
||||||
|
* @param includePullNumber
|
||||||
|
* if true, includes the owning pull request's number in the route.
|
||||||
|
*
|
||||||
|
* @return the api route
|
||||||
|
*/
|
||||||
|
protected String getApiRoute(boolean includePullNumber) {
|
||||||
|
return "/repos/" + owner.getRepository().getFullName() + "/pulls"
|
||||||
|
+ (includePullNumber ? "/" + owner.getNumber() : "") + "/comments/" + getId();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -190,13 +205,12 @@ public class GHPullRequestReviewComment extends GHObject implements Reactable {
|
|||||||
return owner.root.createRequest()
|
return owner.root.createRequest()
|
||||||
.method("POST")
|
.method("POST")
|
||||||
.with("body", body)
|
.with("body", body)
|
||||||
.with("in_reply_to", getId())
|
.withUrlPath(getApiRoute(true) + "/replies")
|
||||||
.withUrlPath(getApiRoute() + "/comments")
|
|
||||||
.fetch(GHPullRequestReviewComment.class)
|
.fetch(GHPullRequestReviewComment.class)
|
||||||
.wrapUp(owner);
|
.wrapUp(owner);
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public GHReaction createReaction(ReactionContent content) throws IOException {
|
public GHReaction createReaction(ReactionContent content) throws IOException {
|
||||||
return owner.root.createRequest()
|
return owner.root.createRequest()
|
||||||
@@ -208,7 +222,7 @@ public class GHPullRequestReviewComment extends GHObject implements Reactable {
|
|||||||
.wrap(owner.root);
|
.wrap(owner.root);
|
||||||
}
|
}
|
||||||
|
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public PagedIterable<GHReaction> listReactions() {
|
public PagedIterable<GHReaction> listReactions() {
|
||||||
return owner.root.createRequest()
|
return owner.root.createRequest()
|
||||||
|
|||||||
@@ -7,8 +7,7 @@ package org.kohsuke.github;
|
|||||||
* the type parameter
|
* the type parameter
|
||||||
* @author Kohsuke Kawaguchi
|
* @author Kohsuke Kawaguchi
|
||||||
*/
|
*/
|
||||||
public abstract class GHQueryBuilder<T> {
|
public abstract class GHQueryBuilder<T> extends GitHubInteractiveObject {
|
||||||
protected final GitHub root;
|
|
||||||
protected final Requester req;
|
protected final Requester req;
|
||||||
|
|
||||||
GHQueryBuilder(GitHub root) {
|
GHQueryBuilder(GitHub root) {
|
||||||
|
|||||||
@@ -1,10 +1,12 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import com.fasterxml.jackson.annotation.JacksonInject;
|
||||||
import com.fasterxml.jackson.annotation.JsonCreator;
|
import com.fasterxml.jackson.annotation.JsonCreator;
|
||||||
import com.fasterxml.jackson.annotation.JsonProperty;
|
import com.fasterxml.jackson.annotation.JsonProperty;
|
||||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
import org.apache.commons.lang3.StringUtils;
|
import org.apache.commons.lang3.StringUtils;
|
||||||
|
|
||||||
|
import java.time.Duration;
|
||||||
import java.time.ZonedDateTime;
|
import java.time.ZonedDateTime;
|
||||||
import java.time.format.DateTimeFormatter;
|
import java.time.format.DateTimeFormatter;
|
||||||
import java.time.format.DateTimeParseException;
|
import java.time.format.DateTimeParseException;
|
||||||
@@ -28,7 +30,7 @@ public class GHRateLimit {
|
|||||||
/**
|
/**
|
||||||
* Remaining calls that can be made.
|
* Remaining calls that can be made.
|
||||||
*
|
*
|
||||||
* @deprecated This value should never have been made public. Use {@link #getRemaining()}
|
* @deprecated This field should never have been made public. Use {@link #getRemaining()}
|
||||||
*/
|
*/
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public int remaining;
|
public int remaining;
|
||||||
@@ -36,7 +38,7 @@ public class GHRateLimit {
|
|||||||
/**
|
/**
|
||||||
* Allotted API call per hour.
|
* Allotted API call per hour.
|
||||||
*
|
*
|
||||||
* @deprecated This value should never have been made public. Use {@link #getLimit()}
|
* @deprecated This field should never have been made public. Use {@link #getLimit()}
|
||||||
*/
|
*/
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public int limit;
|
public int limit;
|
||||||
@@ -47,7 +49,7 @@ public class GHRateLimit {
|
|||||||
* date. To use this field in any meaningful way, it must be converted to a long using {@link Date#getTime()}
|
* date. To use this field in any meaningful way, it must be converted to a long using {@link Date#getTime()}
|
||||||
* multiplied by 1000.
|
* multiplied by 1000.
|
||||||
*
|
*
|
||||||
* @deprecated This value should never have been made public. Use {@link #getResetDate()}
|
* @deprecated This field should never have been made public. Use {@link #getResetDate()}
|
||||||
*/
|
*/
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public Date reset;
|
public Date reset;
|
||||||
@@ -64,17 +66,58 @@ public class GHRateLimit {
|
|||||||
@Nonnull
|
@Nonnull
|
||||||
private final Record integrationManifest;
|
private final Record integrationManifest;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* The default GHRateLimit provided to new {@link GitHubClient}s.
|
||||||
|
*
|
||||||
|
* Contains all expired records that will cause {@link GitHubClient#rateLimit(RateLimitTarget)} to refresh with new
|
||||||
|
* data when called.
|
||||||
|
*
|
||||||
|
* Private, but made internal for testing.
|
||||||
|
*/
|
||||||
@Nonnull
|
@Nonnull
|
||||||
static GHRateLimit Unknown() {
|
static final GHRateLimit DEFAULT = new GHRateLimit(UnknownLimitRecord.DEFAULT,
|
||||||
return new GHRateLimit(new UnknownLimitRecord(),
|
UnknownLimitRecord.DEFAULT,
|
||||||
new UnknownLimitRecord(),
|
UnknownLimitRecord.DEFAULT,
|
||||||
new UnknownLimitRecord(),
|
UnknownLimitRecord.DEFAULT);
|
||||||
new UnknownLimitRecord());
|
|
||||||
}
|
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Creates a new {@link GHRateLimit} from a single record for the specified endpoint with place holders for other
|
||||||
|
* records.
|
||||||
|
*
|
||||||
|
* This is used to create {@link GHRateLimit} instances that can merged with other instances.
|
||||||
|
*
|
||||||
|
* @param record
|
||||||
|
* the rate limit record. Can be a regular {@link Record} constructed from header information or an
|
||||||
|
* {@link UnknownLimitRecord} placeholder.
|
||||||
|
* @param rateLimitTarget
|
||||||
|
* which rate limit record to fill
|
||||||
|
* @return a new {@link GHRateLimit} instance containing the supplied record
|
||||||
|
*/
|
||||||
@Nonnull
|
@Nonnull
|
||||||
static GHRateLimit fromHeaderRecord(Record header) {
|
static GHRateLimit fromRecord(@Nonnull Record record, @Nonnull RateLimitTarget rateLimitTarget) {
|
||||||
return new GHRateLimit(header, new UnknownLimitRecord(), new UnknownLimitRecord(), new UnknownLimitRecord());
|
if (rateLimitTarget == RateLimitTarget.CORE || rateLimitTarget == RateLimitTarget.NONE) {
|
||||||
|
return new GHRateLimit(record,
|
||||||
|
UnknownLimitRecord.DEFAULT,
|
||||||
|
UnknownLimitRecord.DEFAULT,
|
||||||
|
UnknownLimitRecord.DEFAULT);
|
||||||
|
} else if (rateLimitTarget == RateLimitTarget.SEARCH) {
|
||||||
|
return new GHRateLimit(UnknownLimitRecord.DEFAULT,
|
||||||
|
record,
|
||||||
|
UnknownLimitRecord.DEFAULT,
|
||||||
|
UnknownLimitRecord.DEFAULT);
|
||||||
|
} else if (rateLimitTarget == RateLimitTarget.GRAPHQL) {
|
||||||
|
return new GHRateLimit(UnknownLimitRecord.DEFAULT,
|
||||||
|
UnknownLimitRecord.DEFAULT,
|
||||||
|
record,
|
||||||
|
UnknownLimitRecord.DEFAULT);
|
||||||
|
} else if (rateLimitTarget == RateLimitTarget.INTEGRATION_MANIFEST) {
|
||||||
|
return new GHRateLimit(UnknownLimitRecord.DEFAULT,
|
||||||
|
UnknownLimitRecord.DEFAULT,
|
||||||
|
UnknownLimitRecord.DEFAULT,
|
||||||
|
record);
|
||||||
|
} else {
|
||||||
|
throw new IllegalArgumentException("Unknown rate limit target: " + rateLimitTarget.toString());
|
||||||
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@JsonCreator
|
@JsonCreator
|
||||||
@@ -141,7 +184,7 @@ public class GHRateLimit {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Whether the rate limit reset date for this instance has passed.
|
* Whether the reset date for the Core API rate limit has passed.
|
||||||
*
|
*
|
||||||
* @return true if the rate limit reset date has passed. Otherwise false.
|
* @return true if the rate limit reset date has passed. Otherwise false.
|
||||||
* @since 1.100
|
* @since 1.100
|
||||||
@@ -151,7 +194,7 @@ public class GHRateLimit {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The core object provides your rate limit status for all non-search-related resources in the REST API.
|
* The core object provides the rate limit status for all non-search-related resources in the REST API.
|
||||||
*
|
*
|
||||||
* @return a rate limit record
|
* @return a rate limit record
|
||||||
* @since 1.100
|
* @since 1.100
|
||||||
@@ -162,42 +205,43 @@ public class GHRateLimit {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The search object provides your rate limit status for the Search API. TODO: integrate with header limit updating.
|
* The search record provides the rate limit status for the Search API.
|
||||||
* Issue #605.
|
|
||||||
*
|
*
|
||||||
* @return a rate limit record
|
* @return a rate limit record
|
||||||
|
* @since 1.115
|
||||||
*/
|
*/
|
||||||
@Nonnull
|
@Nonnull
|
||||||
Record getSearch() {
|
public Record getSearch() {
|
||||||
return search;
|
return search;
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The graphql object provides your rate limit status for the GraphQL API. TODO: integrate with header limit
|
* The graphql record provides the rate limit status for the GraphQL API.
|
||||||
* updating. Issue #605.
|
|
||||||
*
|
*
|
||||||
* @return a rate limit record
|
* @return a rate limit record
|
||||||
|
* @since 1.115
|
||||||
*/
|
*/
|
||||||
@Nonnull
|
@Nonnull
|
||||||
Record getGraphQL() {
|
public Record getGraphQL() {
|
||||||
return graphql;
|
return graphql;
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The integration_manifest object provides your rate limit status for the GitHub App Manifest code conversion
|
* The integration manifest record provides the rate limit status for the GitHub App Manifest code conversion
|
||||||
* endpoint. TODO: integrate with header limit updating. Issue #605.
|
* endpoint.
|
||||||
*
|
*
|
||||||
* @return a rate limit record
|
* @return a rate limit record
|
||||||
|
* @since 1.115
|
||||||
*/
|
*/
|
||||||
@Nonnull
|
@Nonnull
|
||||||
Record getIntegrationManifest() {
|
public Record getIntegrationManifest() {
|
||||||
return integrationManifest;
|
return integrationManifest;
|
||||||
}
|
}
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
public String toString() {
|
public String toString() {
|
||||||
return "GHRateLimit {" + "core " + getCore().toString() + "search " + getSearch().toString() + "graphql "
|
return "GHRateLimit {" + "core " + getCore().toString() + ", search " + getSearch().toString() + ", graphql "
|
||||||
+ getGraphQL().toString() + "integrationManifest " + getIntegrationManifest().toString() + '}';
|
+ getGraphQL().toString() + ", integrationManifest " + getIntegrationManifest().toString() + "}";
|
||||||
}
|
}
|
||||||
|
|
||||||
@Override
|
@Override
|
||||||
@@ -219,23 +263,112 @@ public class GHRateLimit {
|
|||||||
return Objects.hash(getCore(), getSearch(), getGraphQL(), getIntegrationManifest());
|
return Objects.hash(getCore(), getSearch(), getGraphQL(), getIntegrationManifest());
|
||||||
}
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Merge a {@link GHRateLimit} with another one to create a new {@link GHRateLimit} keeping the latest
|
||||||
|
* {@link Record}s from each.
|
||||||
|
*
|
||||||
|
* @param newLimit
|
||||||
|
* {@link GHRateLimit} with potentially updated {@link Record}s.
|
||||||
|
* @return a merged {@link GHRateLimit} with the latest {@link Record}s from these two instances. If the merged
|
||||||
|
* instance is equal to the current instance, the current instance is returned.
|
||||||
|
*/
|
||||||
|
@Nonnull
|
||||||
|
GHRateLimit getMergedRateLimit(@Nonnull GHRateLimit newLimit) {
|
||||||
|
|
||||||
|
GHRateLimit merged = new GHRateLimit(getCore().currentOrUpdated(newLimit.getCore()),
|
||||||
|
getSearch().currentOrUpdated(newLimit.getSearch()),
|
||||||
|
getGraphQL().currentOrUpdated(newLimit.getGraphQL()),
|
||||||
|
getIntegrationManifest().currentOrUpdated(newLimit.getIntegrationManifest()));
|
||||||
|
|
||||||
|
if (merged.equals(this)) {
|
||||||
|
merged = this;
|
||||||
|
}
|
||||||
|
|
||||||
|
return merged;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Gets the specified {@link Record}.
|
||||||
|
*
|
||||||
|
* {@link RateLimitTarget#NONE} will return {@link UnknownLimitRecord#DEFAULT} to prevent any clients from
|
||||||
|
* accidentally waiting on that record to reset before continuing.
|
||||||
|
*
|
||||||
|
* @param rateLimitTarget
|
||||||
|
* the target rate limit record
|
||||||
|
* @return the target {@link Record} from this instance.
|
||||||
|
*/
|
||||||
|
@Nonnull
|
||||||
|
Record getRecord(@Nonnull RateLimitTarget rateLimitTarget) {
|
||||||
|
if (rateLimitTarget == RateLimitTarget.CORE) {
|
||||||
|
return getCore();
|
||||||
|
} else if (rateLimitTarget == RateLimitTarget.SEARCH) {
|
||||||
|
return getSearch();
|
||||||
|
} else if (rateLimitTarget == RateLimitTarget.GRAPHQL) {
|
||||||
|
return getGraphQL();
|
||||||
|
} else if (rateLimitTarget == RateLimitTarget.INTEGRATION_MANIFEST) {
|
||||||
|
return getIntegrationManifest();
|
||||||
|
} else if (rateLimitTarget == RateLimitTarget.NONE) {
|
||||||
|
return UnknownLimitRecord.DEFAULT;
|
||||||
|
} else {
|
||||||
|
throw new IllegalArgumentException("Unknown rate limit target: " + rateLimitTarget.toString());
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* A limit record used as a placeholder when the the actual limit is not known.
|
* A limit record used as a placeholder when the the actual limit is not known.
|
||||||
* <p>
|
|
||||||
* Has a large limit and long duration so that it will doesn't expire too often.
|
|
||||||
*
|
*
|
||||||
* @since 1.100
|
* @since 1.100
|
||||||
*/
|
*/
|
||||||
public static class UnknownLimitRecord extends Record {
|
public static class UnknownLimitRecord extends Record {
|
||||||
|
|
||||||
// One hour
|
private static final long defaultUnknownLimitResetSeconds = Duration.ofSeconds(30).getSeconds();
|
||||||
private static final long unknownLimitResetSeconds = 60L * 60L;
|
|
||||||
|
/**
|
||||||
|
* The number of seconds until a {@link UnknownLimitRecord} will expire.
|
||||||
|
*
|
||||||
|
* This is set to a somewhat short duration, rather than a long one. This avoids
|
||||||
|
* {@link {@link GitHubClient#rateLimit(RateLimitTarget)}} requesting rate limit updates continuously, but also
|
||||||
|
* avoids holding on to stale unknown records indefinitely.
|
||||||
|
*
|
||||||
|
* When merging {@link GHRateLimit} instances, {@link UnknownLimitRecord}s will be superseded by incoming
|
||||||
|
* regular {@link Record}s.
|
||||||
|
*
|
||||||
|
* @see GHRateLimit#getMergedRateLimit(GHRateLimit)
|
||||||
|
*/
|
||||||
|
static long unknownLimitResetSeconds = defaultUnknownLimitResetSeconds;
|
||||||
|
|
||||||
static final int unknownLimit = 1000000;
|
static final int unknownLimit = 1000000;
|
||||||
static final int unknownRemaining = 999999;
|
static final int unknownRemaining = 999999;
|
||||||
|
|
||||||
private UnknownLimitRecord() {
|
// The default UnknownLimitRecord is an expired record.
|
||||||
super(unknownLimit, unknownRemaining, System.currentTimeMillis() / 1000L + unknownLimitResetSeconds);
|
private static final UnknownLimitRecord DEFAULT = new UnknownLimitRecord(Long.MIN_VALUE);
|
||||||
|
|
||||||
|
// The starting current UnknownLimitRecord is an expired record.
|
||||||
|
private static UnknownLimitRecord current = DEFAULT;
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Create a new unknown record that resets at the specified time.
|
||||||
|
*
|
||||||
|
* @param resetEpochSeconds
|
||||||
|
* the epoch second time when this record will expire.
|
||||||
|
*/
|
||||||
|
private UnknownLimitRecord(long resetEpochSeconds) {
|
||||||
|
super(unknownLimit, unknownRemaining, resetEpochSeconds);
|
||||||
|
}
|
||||||
|
|
||||||
|
static synchronized Record current() {
|
||||||
|
if (current.isExpired()) {
|
||||||
|
current = new UnknownLimitRecord(System.currentTimeMillis() / 1000L + unknownLimitResetSeconds);
|
||||||
|
}
|
||||||
|
return current;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Reset the current UnknownLimitRecord. For use during testing only.
|
||||||
|
*/
|
||||||
|
static synchronized void reset() {
|
||||||
|
current = DEFAULT;
|
||||||
|
unknownLimitResetSeconds = defaultUnknownLimitResetSeconds;
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|
||||||
@@ -251,7 +384,7 @@ public class GHRateLimit {
|
|||||||
private final int remaining;
|
private final int remaining;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Allotted API call per hour.
|
* Allotted API call per time period.
|
||||||
*/
|
*/
|
||||||
private final int limit;
|
private final int limit;
|
||||||
|
|
||||||
@@ -266,11 +399,14 @@ public class GHRateLimit {
|
|||||||
private final long createdAtEpochSeconds = System.currentTimeMillis() / 1000;
|
private final long createdAtEpochSeconds = System.currentTimeMillis() / 1000;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* The calculated time at which the rate limit will reset. Recalculated if {@link #recalculateResetDate} is
|
* The date at which the rate limit will reset, adjusted to local machine time if the local machine's clock not
|
||||||
* called.
|
* synchronized with to the same clock as the GitHub server.
|
||||||
|
*
|
||||||
|
* @see #calculateResetDate(String)
|
||||||
|
* @see #getResetDate()
|
||||||
*/
|
*/
|
||||||
@Nonnull
|
@Nonnull
|
||||||
private Date resetDate;
|
private final Date resetDate;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Instantiates a new Record.
|
* Instantiates a new Record.
|
||||||
@@ -282,7 +418,6 @@ public class GHRateLimit {
|
|||||||
* @param resetEpochSeconds
|
* @param resetEpochSeconds
|
||||||
* the reset epoch seconds
|
* the reset epoch seconds
|
||||||
*/
|
*/
|
||||||
@JsonCreator
|
|
||||||
public Record(@JsonProperty(value = "limit", required = true) int limit,
|
public Record(@JsonProperty(value = "limit", required = true) int limit,
|
||||||
@JsonProperty(value = "remaining", required = true) int remaining,
|
@JsonProperty(value = "remaining", required = true) int remaining,
|
||||||
@JsonProperty(value = "reset", required = true) long resetEpochSeconds) {
|
@JsonProperty(value = "reset", required = true) long resetEpochSeconds) {
|
||||||
@@ -290,7 +425,7 @@ public class GHRateLimit {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Instantiates a new Record.
|
* Instantiates a new Record. Called by Jackson data binding or during header parsing.
|
||||||
*
|
*
|
||||||
* @param limit
|
* @param limit
|
||||||
* the limit
|
* the limit
|
||||||
@@ -298,26 +433,99 @@ public class GHRateLimit {
|
|||||||
* the remaining
|
* the remaining
|
||||||
* @param resetEpochSeconds
|
* @param resetEpochSeconds
|
||||||
* the reset epoch seconds
|
* the reset epoch seconds
|
||||||
* @param updatedAt
|
* @param responseInfo
|
||||||
* the updated at
|
* the response info
|
||||||
*/
|
*/
|
||||||
@SuppressFBWarnings(value = "URF_UNREAD_PUBLIC_OR_PROTECTED_FIELD", justification = "Deprecated")
|
@JsonCreator
|
||||||
public Record(int limit, int remaining, long resetEpochSeconds, @CheckForNull String updatedAt) {
|
Record(@JsonProperty(value = "limit", required = true) int limit,
|
||||||
|
@JsonProperty(value = "remaining", required = true) int remaining,
|
||||||
|
@JsonProperty(value = "reset", required = true) long resetEpochSeconds,
|
||||||
|
@JacksonInject @CheckForNull GitHubResponse.ResponseInfo responseInfo) {
|
||||||
this.limit = limit;
|
this.limit = limit;
|
||||||
this.remaining = remaining;
|
this.remaining = remaining;
|
||||||
this.resetEpochSeconds = resetEpochSeconds;
|
this.resetEpochSeconds = resetEpochSeconds;
|
||||||
this.resetDate = recalculateResetDate(updatedAt);
|
String updatedAt = null;
|
||||||
|
if (responseInfo != null) {
|
||||||
|
updatedAt = responseInfo.headerField("Date");
|
||||||
|
}
|
||||||
|
this.resetDate = calculateResetDate(updatedAt);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Recalculates the reset date using the server response date to calculate a time duration and then add that to
|
* Determine if the current {@link Record} is outdated compared to another. Rate Limit dates are only accurate
|
||||||
* the local created time for this record.
|
* to the second, so we look at other information in the record as well.
|
||||||
|
*
|
||||||
|
* {@link Record}s with earlier {@link #getResetEpochSeconds()} are replaced by those with later.
|
||||||
|
* {@link Record}s with the same {@link #getResetEpochSeconds()} are replaced by those with less remaining
|
||||||
|
* count.
|
||||||
|
*
|
||||||
|
* {@link UnknownLimitRecord}s compare with each other like regular {@link Record}s.
|
||||||
|
*
|
||||||
|
* {@link Record}s are replaced by {@link UnknownLimitRecord}s only when the current {@link Record} is expired
|
||||||
|
* and the {@link UnknownLimitRecord} is not. Otherwise Regular {@link Record}s are not replaced by
|
||||||
|
* {@link UnknownLimitRecord}s.
|
||||||
|
*
|
||||||
|
* Expiration is only considered after other checks, meaning expired records may sometimes be replaced by other
|
||||||
|
* expired records.
|
||||||
|
*
|
||||||
|
* @param other
|
||||||
|
* the other {@link Record}
|
||||||
|
* @return the {@link Record} that is most current
|
||||||
|
*/
|
||||||
|
Record currentOrUpdated(@Nonnull Record other) {
|
||||||
|
// This set of checks avoids most calls to isExpired()
|
||||||
|
// Depends on UnknownLimitRecord.current() to prevent continuous updating of GHRateLimit rateLimit()
|
||||||
|
if (getResetEpochSeconds() > other.getResetEpochSeconds()
|
||||||
|
|| (getResetEpochSeconds() == other.getResetEpochSeconds()
|
||||||
|
&& getRemaining() <= other.getRemaining())) {
|
||||||
|
// If the current record has a later reset
|
||||||
|
// or the current record has the same reset and fewer or same requests remaining
|
||||||
|
// Then it is most recent
|
||||||
|
return this;
|
||||||
|
} else if (!(other instanceof UnknownLimitRecord)) {
|
||||||
|
// If the above is not the case that means other has a later reset
|
||||||
|
// or the same resent and fewer requests remaining.
|
||||||
|
// If the other record is not an unknown record, the the other is more recent
|
||||||
|
return other;
|
||||||
|
} else if (this.isExpired() && !other.isExpired()) {
|
||||||
|
// The other is an unknown record.
|
||||||
|
// If the current record has expired and the other hasn't, return the other.
|
||||||
|
return other;
|
||||||
|
}
|
||||||
|
|
||||||
|
// If none of the above, the current record is most valid.
|
||||||
|
return this;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Recalculates the {@link #resetDate} relative to the local machine clock.
|
||||||
|
* <p>
|
||||||
|
* {@link RateLimitChecker}s and {@link RateLimitHandler}s use {@link #getResetDate()} to make decisions about
|
||||||
|
* how long to wait for until for the rate limit to reset. That means that {@link #getResetDate()} needs to be
|
||||||
|
* calculated based on the local machine clock.
|
||||||
|
* </p>
|
||||||
|
* <p>
|
||||||
|
* When we say that the clock on two machines is "synchronized", we mean that the UTC time returned from
|
||||||
|
* {@link System#currentTimeMillis()} on each machine is basically the same. For the purposes of rate limits an
|
||||||
|
* differences of up to a second can be ignored.
|
||||||
|
* </p>
|
||||||
|
* <p>
|
||||||
|
* When the clock on the local machine is synchronized to the same time as the clock on the GitHub server (via a
|
||||||
|
* time service for example), the {@link #resetDate} generated directly from {@link #resetEpochSeconds} will be
|
||||||
|
* accurate for the local machine as well.
|
||||||
|
* </p>
|
||||||
|
* <p>
|
||||||
|
* When the clock on the local machine is not synchronized with the server, the {@link #resetDate} must be
|
||||||
|
* recalculated relative to the local machine clock. This is done by taking the number of seconds between the
|
||||||
|
* response "Date" header and {@link #resetEpochSeconds} and then adding that to this record's
|
||||||
|
* {@link #createdAtEpochSeconds}.
|
||||||
*
|
*
|
||||||
* @param updatedAt
|
* @param updatedAt
|
||||||
* a string date in RFC 1123
|
* a string date in RFC 1123
|
||||||
* @return reset date based on the passed date
|
* @return reset date based on the passed date
|
||||||
*/
|
*/
|
||||||
Date recalculateResetDate(@CheckForNull String updatedAt) {
|
@Nonnull
|
||||||
|
private Date calculateResetDate(@CheckForNull String updatedAt) {
|
||||||
long updatedAtEpochSeconds = createdAtEpochSeconds;
|
long updatedAtEpochSeconds = createdAtEpochSeconds;
|
||||||
if (!StringUtils.isBlank(updatedAt)) {
|
if (!StringUtils.isBlank(updatedAt)) {
|
||||||
try {
|
try {
|
||||||
@@ -334,7 +542,7 @@ public class GHRateLimit {
|
|||||||
// This may seem odd but it results in an accurate or slightly pessimistic reset date
|
// This may seem odd but it results in an accurate or slightly pessimistic reset date
|
||||||
// based on system time rather than assuming the system time synchronized with the server
|
// based on system time rather than assuming the system time synchronized with the server
|
||||||
long calculatedSecondsUntilReset = resetEpochSeconds - updatedAtEpochSeconds;
|
long calculatedSecondsUntilReset = resetEpochSeconds - updatedAtEpochSeconds;
|
||||||
return resetDate = new Date((createdAtEpochSeconds + calculatedSecondsUntilReset) * 1000);
|
return new Date((createdAtEpochSeconds + calculatedSecondsUntilReset) * 1000);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -358,7 +566,12 @@ public class GHRateLimit {
|
|||||||
/**
|
/**
|
||||||
* Gets the time in epoch seconds when the rate limit will reset.
|
* Gets the time in epoch seconds when the rate limit will reset.
|
||||||
*
|
*
|
||||||
* @return a long
|
* This is the raw value returned by the server. This value is not adjusted if local machine time is not
|
||||||
|
* synchronized with server time. If attempting to check when the rate limit will reset, use
|
||||||
|
* {@link #getResetDate()} or implement a {@link RateLimitChecker} instead.
|
||||||
|
*
|
||||||
|
* @return a long representing the time in epoch seconds when the rate limit will reset
|
||||||
|
* @see #getResetDate()
|
||||||
*/
|
*/
|
||||||
public long getResetEpochSeconds() {
|
public long getResetEpochSeconds() {
|
||||||
return resetEpochSeconds;
|
return resetEpochSeconds;
|
||||||
@@ -367,6 +580,8 @@ public class GHRateLimit {
|
|||||||
/**
|
/**
|
||||||
* Whether the rate limit reset date indicated by this instance is expired
|
* Whether the rate limit reset date indicated by this instance is expired
|
||||||
*
|
*
|
||||||
|
* If attempting to wait for the rate limit to reset, consider implementing a {@link RateLimitChecker} instead.
|
||||||
|
*
|
||||||
* @return true if the rate limit reset date has passed. Otherwise false.
|
* @return true if the rate limit reset date has passed. Otherwise false.
|
||||||
*/
|
*/
|
||||||
public boolean isExpired() {
|
public boolean isExpired() {
|
||||||
@@ -374,7 +589,10 @@ public class GHRateLimit {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Returns the date at which the rate limit will reset.
|
* The date at which the rate limit will reset, adjusted to local machine time if the local machine's clock not
|
||||||
|
* synchronized with to the same clock as the GitHub server.
|
||||||
|
*
|
||||||
|
* If attempting to wait for the rate limit to reset, consider implementing a {@link RateLimitChecker} instead.
|
||||||
*
|
*
|
||||||
* @return the calculated date at which the rate limit has or will reset.
|
* @return the calculated date at which the rate limit has or will reset.
|
||||||
*/
|
*/
|
||||||
|
|||||||
@@ -3,7 +3,7 @@ package org.kohsuke.github;
|
|||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
|
|
||||||
import static org.kohsuke.github.Previews.*;
|
import static org.kohsuke.github.internal.Previews.SQUIRREL_GIRL;
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Reaction to issue, comment, PR, and so on.
|
* Reaction to issue, comment, PR, and so on.
|
||||||
@@ -11,10 +11,9 @@ import static org.kohsuke.github.Previews.*;
|
|||||||
* @author Kohsuke Kawaguchi
|
* @author Kohsuke Kawaguchi
|
||||||
* @see Reactable
|
* @see Reactable
|
||||||
*/
|
*/
|
||||||
@Preview
|
@Preview(SQUIRREL_GIRL)
|
||||||
@Deprecated
|
@Deprecated
|
||||||
public class GHReaction extends GHObject {
|
public class GHReaction extends GHObject {
|
||||||
private GitHub root;
|
|
||||||
|
|
||||||
private GHUser user;
|
private GHUser user;
|
||||||
private ReactionContent content;
|
private ReactionContent content;
|
||||||
@@ -58,6 +57,6 @@ public class GHReaction extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void delete() throws IOException {
|
public void delete() throws IOException {
|
||||||
root.createRequest().method("DELETE").withPreview(SQUIRREL_GIRL).withUrlPath("/reactions/" + id).send();
|
root.createRequest().method("DELETE").withPreview(SQUIRREL_GIRL).withUrlPath("/reactions/" + getId()).send();
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -1,5 +1,6 @@
|
|||||||
package org.kohsuke.github;
|
package org.kohsuke.github;
|
||||||
|
|
||||||
|
import com.fasterxml.jackson.databind.JsonMappingException;
|
||||||
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
import edu.umd.cs.findbugs.annotations.SuppressFBWarnings;
|
||||||
|
|
||||||
import java.io.IOException;
|
import java.io.IOException;
|
||||||
@@ -10,9 +11,7 @@ import java.net.URL;
|
|||||||
*
|
*
|
||||||
* @author Michael Clarke
|
* @author Michael Clarke
|
||||||
*/
|
*/
|
||||||
public class GHRef {
|
public class GHRef extends GitHubInteractiveObject {
|
||||||
/* package almost final */ GitHub root;
|
|
||||||
|
|
||||||
private String ref, url;
|
private String ref, url;
|
||||||
private GHObject object;
|
private GHObject object;
|
||||||
|
|
||||||
@@ -31,7 +30,7 @@ public class GHRef {
|
|||||||
* @return the url
|
* @return the url
|
||||||
*/
|
*/
|
||||||
public URL getUrl() {
|
public URL getUrl() {
|
||||||
return GitHub.parseURL(url);
|
return GitHubClient.parseURL(url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -90,11 +89,76 @@ public class GHRef {
|
|||||||
return this;
|
return this;
|
||||||
}
|
}
|
||||||
|
|
||||||
static GHRef[] wrap(GHRef[] in, GitHub root) {
|
/**
|
||||||
for (GHRef r : in) {
|
* Retrive a ref of the given type for the current GitHub repository.
|
||||||
r.wrap(root);
|
*
|
||||||
|
* @param repository
|
||||||
|
* the repository to read from
|
||||||
|
* @param refName
|
||||||
|
* eg: heads/branch
|
||||||
|
* @return refs matching the request type
|
||||||
|
* @throws IOException
|
||||||
|
* on failure communicating with GitHub, potentially due to an invalid ref type being requested
|
||||||
|
*/
|
||||||
|
static GHRef read(GHRepository repository, String refName) throws IOException {
|
||||||
|
// Also accept e.g. "refs/heads/branch" for consistency with createRef().
|
||||||
|
if (refName.startsWith("refs/")) {
|
||||||
|
refName = refName.replaceFirst("refs/", "");
|
||||||
}
|
}
|
||||||
return in;
|
|
||||||
|
// We would expect this to use `git/ref/%s` but some versions of GHE seem to not support it
|
||||||
|
// Instead use `git/refs/%s` and check the result actually matches the ref
|
||||||
|
GHRef result = null;
|
||||||
|
try {
|
||||||
|
result = repository.root.createRequest()
|
||||||
|
.withUrlPath(repository.getApiTailUrl(String.format("git/refs/%s", refName)))
|
||||||
|
.fetch(GHRef.class)
|
||||||
|
.wrap(repository.root);
|
||||||
|
} catch (IOException e) {
|
||||||
|
// If the parse exception is due to the above returning an array instead of a single ref
|
||||||
|
// that means the individual ref did not exist. Handled by result check below.
|
||||||
|
// Otherwise, rethrow.
|
||||||
|
if (!(e.getCause() instanceof JsonMappingException)) {
|
||||||
|
throw e;
|
||||||
|
}
|
||||||
|
}
|
||||||
|
|
||||||
|
// Verify that the ref returned is the one requested
|
||||||
|
// Used .endsWith(refName) instead of .equals("refs/" + refName) to workaround a GitBucket
|
||||||
|
// issue where the "ref" field omits the "refs/" prefix. "endsWith()" is functionally
|
||||||
|
// the same for this scenario - the server refs matching is prefix-based, so
|
||||||
|
// a ref that ends with the correct string will always be the correct one.
|
||||||
|
if (result == null || !result.getRef().endsWith(refName)) {
|
||||||
|
throw new GHFileNotFoundException(String.format("git/refs/%s", refName)
|
||||||
|
+ " {\"message\":\"Not Found\",\"documentation_url\":\"https://developer.github.com/v3/git/refs/#get-a-reference\"}");
|
||||||
|
}
|
||||||
|
return result;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Retrieves all refs of the given type for the current GitHub repository.
|
||||||
|
*
|
||||||
|
* @param repository
|
||||||
|
* the repository to read from
|
||||||
|
* @param refType
|
||||||
|
* the type of reg to search for e.g. <code>tags</code> or <code>commits</code>
|
||||||
|
* @return paged iterable of all refs of the specified type
|
||||||
|
* @throws IOException
|
||||||
|
* on failure communicating with GitHub, potentially due to an invalid ref type being requested
|
||||||
|
*/
|
||||||
|
static PagedIterable<GHRef> readMatching(GHRepository repository, String refType) throws IOException {
|
||||||
|
if (refType.startsWith("refs/")) {
|
||||||
|
refType = refType.replaceFirst("refs/", "");
|
||||||
|
}
|
||||||
|
|
||||||
|
String url = repository.getApiTailUrl(String.format("git/refs/%s", refType));
|
||||||
|
// if no types, do not end with slash just to be safe.
|
||||||
|
if (refType.equals("")) {
|
||||||
|
url = url.substring(0, url.length() - 1);
|
||||||
|
}
|
||||||
|
return repository.root.createRequest()
|
||||||
|
.withUrlPath(url)
|
||||||
|
.toIterable(GHRef[].class, item -> item.wrap(repository.root));
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -131,7 +195,7 @@ public class GHRef {
|
|||||||
* @return the url
|
* @return the url
|
||||||
*/
|
*/
|
||||||
public URL getUrl() {
|
public URL getUrl() {
|
||||||
return GitHub.parseURL(url);
|
return GitHubClient.parseURL(url);
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -6,7 +6,6 @@ import java.io.IOException;
|
|||||||
import java.io.InputStream;
|
import java.io.InputStream;
|
||||||
import java.net.URL;
|
import java.net.URL;
|
||||||
import java.net.URLEncoder;
|
import java.net.URLEncoder;
|
||||||
import java.util.Arrays;
|
|
||||||
import java.util.Date;
|
import java.util.Date;
|
||||||
import java.util.List;
|
import java.util.List;
|
||||||
|
|
||||||
@@ -16,14 +15,15 @@ import static java.lang.String.*;
|
|||||||
* Release in a github repository.
|
* Release in a github repository.
|
||||||
*
|
*
|
||||||
* @see GHRepository#getReleases() GHRepository#getReleases()
|
* @see GHRepository#getReleases() GHRepository#getReleases()
|
||||||
|
* @see GHRepository#listReleases() () GHRepository#listReleases()
|
||||||
* @see GHRepository#createRelease(String) GHRepository#createRelease(String)
|
* @see GHRepository#createRelease(String) GHRepository#createRelease(String)
|
||||||
*/
|
*/
|
||||||
public class GHRelease extends GHObject {
|
public class GHRelease extends GHObject {
|
||||||
GitHub root;
|
|
||||||
GHRepository owner;
|
GHRepository owner;
|
||||||
|
|
||||||
private String html_url;
|
private String html_url;
|
||||||
private String assets_url;
|
private String assets_url;
|
||||||
|
private List<GHAsset> assets;
|
||||||
private String upload_url;
|
private String upload_url;
|
||||||
private String tag_name;
|
private String tag_name;
|
||||||
private String target_commitish;
|
private String target_commitish;
|
||||||
@@ -72,12 +72,13 @@ public class GHRelease extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
* @deprecated Use {@link #update()}
|
* @deprecated Use {@link #update()}
|
||||||
*/
|
*/
|
||||||
|
@Deprecated
|
||||||
public GHRelease setDraft(boolean draft) throws IOException {
|
public GHRelease setDraft(boolean draft) throws IOException {
|
||||||
return update().draft(draft).update();
|
return update().draft(draft).update();
|
||||||
}
|
}
|
||||||
|
|
||||||
public URL getHtmlUrl() {
|
public URL getHtmlUrl() {
|
||||||
return GitHub.parseURL(html_url);
|
return GitHubClient.parseURL(html_url);
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -249,17 +250,44 @@ public class GHRelease extends GHObject {
|
|||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
* Gets assets.
|
* Get the cached assets.
|
||||||
|
*
|
||||||
|
* @return the assets
|
||||||
|
*
|
||||||
|
* @deprecated This should be the default behavior of {@link #getAssets()} in a future release. This method is
|
||||||
|
* introduced in addition to enable a transition to using cached asset information while keeping the
|
||||||
|
* existing logic in place for backwards compatibility.
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
public List<GHAsset> assets() {
|
||||||
|
return assets;
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Re-fetch the assets of this release.
|
||||||
|
*
|
||||||
|
* @return the assets
|
||||||
|
* @throws IOException
|
||||||
|
* the io exception
|
||||||
|
* @deprecated The behavior of this method will change in a future release. It will then provide cached assets as
|
||||||
|
* provided by {@link #assets()}. Use {@link #listAssets()} instead to fetch up-to-date information of
|
||||||
|
* assets.
|
||||||
|
*/
|
||||||
|
@Deprecated
|
||||||
|
public List<GHAsset> getAssets() throws IOException {
|
||||||
|
return listAssets().toList();
|
||||||
|
}
|
||||||
|
|
||||||
|
/**
|
||||||
|
* Re-fetch the assets of this release.
|
||||||
*
|
*
|
||||||
* @return the assets
|
* @return the assets
|
||||||
* @throws IOException
|
* @throws IOException
|
||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public List<GHAsset> getAssets() throws IOException {
|
public PagedIterable<GHAsset> listAssets() throws IOException {
|
||||||
Requester builder = owner.root.createRequest();
|
Requester builder = owner.root.createRequest();
|
||||||
|
return builder.withUrlPath(getApiTailUrl("assets")).toIterable(GHAsset[].class, item -> item.wrap(this));
|
||||||
GHAsset[] assets = builder.withUrlPath(getApiTailUrl("assets")).fetchArray(GHAsset[].class);
|
|
||||||
return Arrays.asList(GHAsset.wrap(assets, this));
|
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -269,7 +297,7 @@ public class GHRelease extends GHObject {
|
|||||||
* the io exception
|
* the io exception
|
||||||
*/
|
*/
|
||||||
public void delete() throws IOException {
|
public void delete() throws IOException {
|
||||||
root.createRequest().method("DELETE").withUrlPath(owner.getApiTailUrl("releases/" + id)).send();
|
root.createRequest().method("DELETE").withUrlPath(owner.getApiTailUrl("releases/" + getId())).send();
|
||||||
}
|
}
|
||||||
|
|
||||||
/**
|
/**
|
||||||
@@ -282,6 +310,6 @@ public class GHRelease extends GHObject {
|
|||||||
}
|
}
|
||||||
|
|
||||||
private String getApiTailUrl(String end) {
|
private String getApiTailUrl(String end) {
|
||||||
return owner.getApiTailUrl(format("releases/%s/%s", id, end));
|
return owner.getApiTailUrl(format("releases/%s/%s", getId(), end));
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -100,7 +100,7 @@ public class GHReleaseUpdater {
|
|||||||
*/
|
*/
|
||||||
public GHRelease update() throws IOException {
|
public GHRelease update() throws IOException {
|
||||||
return builder.method("PATCH")
|
return builder.method("PATCH")
|
||||||
.withUrlPath(base.owner.getApiTailUrl("releases/" + base.id))
|
.withUrlPath(base.owner.getApiTailUrl("releases/" + base.getId()))
|
||||||
.fetch(GHRelease.class)
|
.fetch(GHRelease.class)
|
||||||
.wrap(base.owner);
|
.wrap(base.owner);
|
||||||
}
|
}
|
||||||
|
|||||||
@@ -18,6 +18,6 @@ class GHRepoHook extends GHHook {
|
|||||||
|
|
||||||
@Override
|
@Override
|
||||||
String getApiRoute() {
|
String getApiRoute() {
|
||||||
return String.format("/repos/%s/%s/hooks/%d", repository.getOwnerName(), repository.getName(), id);
|
return String.format("/repos/%s/%s/hooks/%d", repository.getOwnerName(), repository.getName(), getId());
|
||||||
}
|
}
|
||||||
}
|
}
|
||||||
|
|||||||
File diff suppressed because it is too large
Load Diff
Some files were not shown because too many files have changed in this diff Show More
Reference in New Issue
Block a user